Merge "Update Memtrack HAL VTS Requirements"
diff --git a/audio/7.0/IDevice.hal b/audio/7.0/IDevice.hal
index e30e545..e423f29 100644
--- a/audio/7.0/IDevice.hal
+++ b/audio/7.0/IDevice.hal
@@ -103,6 +103,11 @@
* If the stream can not be opened with the proposed audio config,
* HAL must provide suggested values for the audio config.
*
+ * Note: INVALID_ARGUMENTS is returned both in the case when the
+ * HAL can not use the provided config and in the case when
+ * the value of any argument is invalid. In the latter case the
+ * HAL must provide a default initialized suggested config.
+ *
* @param ioHandle handle assigned by AudioFlinger.
* @param device device type and (if needed) address.
* @param config stream configuration.
@@ -111,7 +116,8 @@
May be used by implementations to configure hardware effects.
* @return retval operation completion status.
* @return outStream created output stream.
- * @return suggestedConfig in case of invalid parameters, suggested config.
+ * @return suggestedConfig in the case of rejection of the proposed config,
+ * a config suggested by the HAL.
*/
openOutputStream(
AudioIoHandle ioHandle,
@@ -128,6 +134,11 @@
* If the stream can not be opened with the proposed audio config,
* HAL must provide suggested values for the audio config.
*
+ * Note: INVALID_ARGUMENTS is returned both in the case when the
+ * HAL can not use the provided config and in the case when
+ * the value of any argument is invalid. In the latter case the
+ * HAL must provide a default initialized suggested config.
+ *
* @param ioHandle handle assigned by AudioFlinger.
* @param device device type and (if needed) address.
* @param config stream configuration.
@@ -136,7 +147,8 @@
* May be used by implementations to configure processing effects.
* @return retval operation completion status.
* @return inStream in case of success, created input stream.
- * @return suggestedConfig in case of invalid parameters, suggested config.
+ * @return suggestedConfig in the case of rejection of the proposed config,
+ * a config suggested by the HAL.
*/
openInputStream(
AudioIoHandle ioHandle,
@@ -162,6 +174,9 @@
* Creates an audio patch between several source and sink ports. The handle
* is allocated by the HAL and must be unique for this audio HAL module.
*
+ * Optional method. HAL must support it if 'supportsAudioPatches' returns
+ * 'true'.
+ *
* @param sources patch sources.
* @param sinks patch sinks.
* @return retval operation completion status.
@@ -177,6 +192,9 @@
* as the HAL module can figure out a way of switching the route without
* causing audio disruption.
*
+ * Optional method. HAL must support it if 'supportsAudioPatches' returns
+ * 'true'.
+ *
* @param previousPatch handle of the previous patch to update.
* @param sources new patch sources.
* @param sinks new patch sinks.
@@ -192,6 +210,9 @@
/**
* Release an audio patch.
*
+ * Optional method. HAL must support it if 'supportsAudioPatches' returns
+ * 'true'.
+ *
* @param patch patch handle.
* @return retval operation completion status.
*/
diff --git a/audio/7.0/IStreamIn.hal b/audio/7.0/IStreamIn.hal
index 0a3f24b..bf9ae52 100644
--- a/audio/7.0/IStreamIn.hal
+++ b/audio/7.0/IStreamIn.hal
@@ -41,6 +41,18 @@
setGain(float gain) generates (Result retval);
/**
+ * Called when the metadata of the stream's sink has been changed.
+ * Optional method
+ *
+ * @param sinkMetadata Description of the audio that is suggested by the clients.
+ * @return retval operation completion status.
+ * If any of the metadata fields contains an invalid value,
+ * returns INVALID_ARGUMENTS.
+ * If method isn't supported by the HAL returns NOT_SUPPORTED.
+ */
+ updateSinkMetadata(SinkMetadata sinkMetadata) generates (Result retval);
+
+ /**
* Commands that can be executed on the driver reader thread.
*/
enum ReadCommand : int32_t {
@@ -82,12 +94,6 @@
};
/**
- * Called when the metadata of the stream's sink has been changed.
- * @param sinkMetadata Description of the audio that is suggested by the clients.
- */
- updateSinkMetadata(SinkMetadata sinkMetadata);
-
- /**
* Set up required transports for receiving audio buffers from the driver.
*
* The transport consists of three message queues:
diff --git a/audio/7.0/IStreamOut.hal b/audio/7.0/IStreamOut.hal
index 38d750f..4daab26 100644
--- a/audio/7.0/IStreamOut.hal
+++ b/audio/7.0/IStreamOut.hal
@@ -45,6 +45,18 @@
setVolume(float left, float right) generates (Result retval);
/**
+ * Called when the metadata of the stream's source has been changed.
+ * Optional method
+ *
+ * @param sourceMetadata Description of the audio that is played by the clients.
+ * @return retval operation completion status.
+ * If any of the metadata fields contains an invalid value,
+ * returns INVALID_ARGUMENTS.
+ * If method isn't supported by the HAL returns NOT_SUPPORTED.
+ */
+ updateSourceMetadata(SourceMetadata sourceMetadata) generates (Result retval);
+
+ /**
* Commands that can be executed on the driver writer thread.
*/
enum WriteCommand : int32_t {
@@ -77,12 +89,6 @@
};
/**
- * Called when the metadata of the stream's source has been changed.
- * @param sourceMetadata Description of the audio that is played by the clients.
- */
- updateSourceMetadata(SourceMetadata sourceMetadata);
-
- /**
* Set up required transports for passing audio buffers to the driver.
*
* The transport consists of three message queues:
diff --git a/audio/common/7.0/enums/include/android_audio_policy_configuration_V7_0-enums.h b/audio/common/7.0/enums/include/android_audio_policy_configuration_V7_0-enums.h
index b7c1cc9..c0042db 100644
--- a/audio/common/7.0/enums/include/android_audio_policy_configuration_V7_0-enums.h
+++ b/audio/common/7.0/enums/include/android_audio_policy_configuration_V7_0-enums.h
@@ -212,12 +212,11 @@
return isOutputDevice(stringToAudioDevice(device));
}
-static inline bool isVendorExtension(const std::string& device) {
+static inline bool isVendorExtension(const std::string& s) {
// Must match the "vendorExtension" rule from the XSD file.
static const std::string vendorPrefix = "VX_";
- return device.size() > vendorPrefix.size() &&
- device.substr(0, vendorPrefix.size()) == vendorPrefix &&
- std::all_of(device.begin() + vendorPrefix.size(), device.end(),
+ return s.size() > vendorPrefix.size() && s.substr(0, vendorPrefix.size()) == vendorPrefix &&
+ std::all_of(s.begin() + vendorPrefix.size(), s.end(),
[](unsigned char c) { return c == '_' || std::isalnum(c); });
}
diff --git a/audio/common/7.0/types.hal b/audio/common/7.0/types.hal
index ed56c73..ed6d94f 100644
--- a/audio/common/7.0/types.hal
+++ b/audio/common/7.0/types.hal
@@ -270,14 +270,29 @@
*/
struct AudioConfig {
AudioConfigBase base;
- AudioOffloadInfo offloadInfo;
+ safe_union OffloadInfo {
+ Monostate unspecified;
+ AudioOffloadInfo info;
+ } offloadInfo;
uint64_t frameCount;
};
+/**
+ * AudioTag is an additional use case qualifier complementing
+ * AudioUsage and AudioContentType. Tags are set by vendor specific applications
+ * and must be prefixed by "VX_". Vendor must namespace their tag
+ * names to avoid conflicts. See 'vendorExtension' in audio_policy_configuration.xsd
+ * for a formal definition.
+ */
+typedef string AudioTag;
+
/** Metadata of a playback track for a StreamOut. */
struct PlaybackTrackMetadata {
AudioUsage usage;
AudioContentType contentType;
+ /** Tags from AudioTrack audio atttributes */
+ vec<AudioTag> tags;
+ AudioChannelMask channelMask;
/**
* Positive linear gain applied to the track samples. 0 being muted and 1 is no attenuation,
* 2 means double amplification...
@@ -294,6 +309,9 @@
/** Metadata of a record track for a StreamIn. */
struct RecordTrackMetadata {
AudioSource source;
+ /** Tags from AudioTrack audio atttributes */
+ vec<AudioTag> tags;
+ AudioChannelMask channelMask;
/**
* Positive linear gain applied to the track samples. 0 being muted and 1 is no attenuation,
* 2 means double amplification...
diff --git a/audio/common/all-versions/default/7.0/HidlUtils.cpp b/audio/common/all-versions/default/7.0/HidlUtils.cpp
index c985a70..de19faf 100644
--- a/audio/common/all-versions/default/7.0/HidlUtils.cpp
+++ b/audio/common/all-versions/default/7.0/HidlUtils.cpp
@@ -21,6 +21,7 @@
#include <log/log.h>
#include <android_audio_policy_configuration_V7_0-enums.h>
+#include <common/all-versions/HidlSupport.h>
#include <common/all-versions/VersionUtils.h>
#include "HidlUtils.h"
@@ -306,7 +307,12 @@
audio_config_base_t halConfigBase = {halConfig.sample_rate, halConfig.channel_mask,
halConfig.format};
CONVERT_CHECKED(audioConfigBaseFromHal(halConfigBase, isInput, &config->base), result);
- CONVERT_CHECKED(audioOffloadInfoFromHal(halConfig.offload_info, &config->offloadInfo), result);
+ if (halConfig.offload_info.sample_rate != 0) {
+ config->offloadInfo.info({});
+ CONVERT_CHECKED(
+ audioOffloadInfoFromHal(halConfig.offload_info, &config->offloadInfo.info()),
+ result);
+ }
config->frameCount = halConfig.frame_count;
return result;
}
@@ -319,7 +325,11 @@
halConfig->sample_rate = halConfigBase.sample_rate;
halConfig->channel_mask = halConfigBase.channel_mask;
halConfig->format = halConfigBase.format;
- CONVERT_CHECKED(audioOffloadInfoToHal(config.offloadInfo, &halConfig->offload_info), result);
+ if (config.offloadInfo.getDiscriminator() ==
+ AudioConfig::OffloadInfo::hidl_discriminator::info) {
+ CONVERT_CHECKED(audioOffloadInfoToHal(config.offloadInfo.info(), &halConfig->offload_info),
+ result);
+ }
halConfig->frame_count = config.frameCount;
return result;
}
@@ -800,6 +810,47 @@
return result;
}
+status_t HidlUtils::audioTagsFromHal(const char* halTags, hidl_vec<AudioTag>* tags) {
+ std::vector<std::string> strTags = utils::splitString(halTags, sAudioTagSeparator);
+ status_t result = NO_ERROR;
+ tags->resize(strTags.size());
+ size_t to = 0;
+ for (size_t from = 0; from < strTags.size(); ++from) {
+ if (xsd::isVendorExtension(strTags[from])) {
+ (*tags)[to++] = strTags[from];
+ } else {
+ result = BAD_VALUE;
+ }
+ }
+ if (to != strTags.size()) {
+ tags->resize(to);
+ }
+ return result;
+}
+
+status_t HidlUtils::audioTagsToHal(const hidl_vec<AudioTag>& tags, char* halTags) {
+ memset(halTags, 0, AUDIO_ATTRIBUTES_TAGS_MAX_SIZE);
+ status_t result = NO_ERROR;
+ std::ostringstream halTagsBuffer;
+ bool hasValue = false;
+ for (const auto& tag : tags) {
+ if (hasValue) {
+ halTagsBuffer << sAudioTagSeparator;
+ }
+ if (xsd::isVendorExtension(tag) && strchr(tag.c_str(), sAudioTagSeparator) == nullptr) {
+ halTagsBuffer << tag;
+ hasValue = true;
+ } else {
+ result = BAD_VALUE;
+ }
+ }
+ std::string fullHalTags{std::move(halTagsBuffer.str())};
+ strncpy(halTags, fullHalTags.c_str(), AUDIO_ATTRIBUTES_TAGS_MAX_SIZE);
+ CONVERT_CHECKED(fullHalTags.length() <= AUDIO_ATTRIBUTES_TAGS_MAX_SIZE ? NO_ERROR : BAD_VALUE,
+ result);
+ return result;
+}
+
status_t HidlUtils::deviceAddressFromHal(audio_devices_t halDeviceType,
const char* halDeviceAddress, DeviceAddress* device) {
status_t result = NO_ERROR;
diff --git a/audio/common/all-versions/default/HidlUtils.h b/audio/common/all-versions/default/HidlUtils.h
index a0bd1bc..8e9275c 100644
--- a/audio/common/all-versions/default/HidlUtils.h
+++ b/audio/common/all-versions/default/HidlUtils.h
@@ -77,6 +77,8 @@
#endif
#if MAJOR_VERSION >= 7
+ static constexpr char sAudioTagSeparator = ';';
+
static status_t audioChannelMaskFromHal(audio_channel_mask_t halChannelMask, bool isInput,
AudioChannelMask* channelMask);
static status_t audioChannelMasksFromHal(const std::vector<std::string>& halChannelMasks,
@@ -107,6 +109,8 @@
AudioStreamType* streamType);
static status_t audioStreamTypeToHal(const AudioStreamType& streamType,
audio_stream_type_t* halStreamType);
+ static status_t audioTagsFromHal(const char* halTags, hidl_vec<AudioTag>* tags);
+ static status_t audioTagsToHal(const hidl_vec<AudioTag>& tags, char* halTags);
private:
static status_t audioIndexChannelMaskFromHal(audio_channel_mask_t halChannelMask,
@@ -126,6 +130,7 @@
struct audio_port_config_device_ext* device,
struct audio_port_config_mix_ext* mix,
struct audio_port_config_session_ext* session);
+
#endif // MAJOR_VERSION >= 7
// V4 and below have DeviceAddress defined in the 'core' interface.
diff --git a/audio/common/all-versions/default/tests/hidlutils_tests.cpp b/audio/common/all-versions/default/tests/hidlutils_tests.cpp
index 22571c0..fef88b4 100644
--- a/audio/common/all-versions/default/tests/hidlutils_tests.cpp
+++ b/audio/common/all-versions/default/tests/hidlutils_tests.cpp
@@ -589,16 +589,29 @@
config.base.sampleRateHz = 44100;
config.base.channelMask = toString(xsd::AudioChannelMask::AUDIO_CHANNEL_OUT_STEREO);
config.base.format = toString(xsd::AudioFormat::AUDIO_FORMAT_PCM_16_BIT);
- config.offloadInfo.base = config.base;
- config.offloadInfo.streamType = toString(xsd::AudioStreamType::AUDIO_STREAM_MUSIC);
- config.offloadInfo.bitRatePerSecond = 320;
- config.offloadInfo.durationMicroseconds = -1;
- config.offloadInfo.bitWidth = 16;
- config.offloadInfo.bufferSize = 1024;
- config.offloadInfo.usage = toString(xsd::AudioUsage::AUDIO_USAGE_MEDIA);
- config.offloadInfo.encapsulationMode = AudioEncapsulationMode::ELEMENTARY_STREAM;
- config.offloadInfo.contentId = 42;
- config.offloadInfo.syncId = 13;
+ audio_config_t halConfig;
+ EXPECT_EQ(NO_ERROR, HidlUtils::audioConfigToHal(config, &halConfig));
+ AudioConfig configBack;
+ EXPECT_EQ(NO_ERROR, HidlUtils::audioConfigFromHal(halConfig, false /*isInput*/, &configBack));
+ EXPECT_EQ(config, configBack);
+}
+
+TEST(HidlUtils, ConvertConfigWithOffloadInfo) {
+ AudioConfig config = {};
+ config.base.sampleRateHz = 44100;
+ config.base.channelMask = toString(xsd::AudioChannelMask::AUDIO_CHANNEL_OUT_STEREO);
+ config.base.format = toString(xsd::AudioFormat::AUDIO_FORMAT_PCM_16_BIT);
+ config.offloadInfo.info(
+ AudioOffloadInfo{.base = config.base,
+ .streamType = toString(xsd::AudioStreamType::AUDIO_STREAM_MUSIC),
+ .bitRatePerSecond = 320,
+ .durationMicroseconds = -1,
+ .bitWidth = 16,
+ .bufferSize = 1024,
+ .usage = toString(xsd::AudioUsage::AUDIO_USAGE_MEDIA),
+ .encapsulationMode = AudioEncapsulationMode::ELEMENTARY_STREAM,
+ .contentId = 42,
+ .syncId = 13});
audio_config_t halConfig;
EXPECT_EQ(NO_ERROR, HidlUtils::audioConfigToHal(config, &halConfig));
AudioConfig configBack;
@@ -707,3 +720,43 @@
EXPECT_EQ(NO_ERROR, HidlUtils::audioPortToHal(portBack, &halPortBack));
EXPECT_TRUE(audio_ports_v7_are_equal(&halPort, &halPortBack));
}
+
+TEST(HidlUtils, ConvertInvalidAudioTags) {
+ char halTag[AUDIO_ATTRIBUTES_TAGS_MAX_SIZE] = {};
+
+ hidl_vec<AudioTag> emptyTag = {{""}};
+ EXPECT_EQ(BAD_VALUE, HidlUtils::audioTagsToHal(emptyTag, halTag));
+
+ hidl_vec<AudioTag> longTag = {{std::string(AUDIO_ATTRIBUTES_TAGS_MAX_SIZE + 1, 'A')}};
+ EXPECT_EQ(BAD_VALUE, HidlUtils::audioTagsToHal(longTag, halTag));
+
+ hidl_vec<AudioTag> tagSeparator = {
+ {std::string(AUDIO_ATTRIBUTES_TAGS_MAX_SIZE - 1, HidlUtils::sAudioTagSeparator)}};
+ EXPECT_EQ(BAD_VALUE, HidlUtils::audioTagsToHal(tagSeparator, halTag));
+
+ hidl_vec<AudioTag> notExtensions = {{"random string", "VX_", "VX_GOOGLE_$$"}};
+ EXPECT_EQ(BAD_VALUE, HidlUtils::audioTagsToHal(notExtensions, halTag));
+}
+
+TEST(HidlUtils, ConvertAudioTags) {
+ hidl_vec<AudioTag> emptyTags;
+ char halEmptyTags[AUDIO_ATTRIBUTES_TAGS_MAX_SIZE] = {};
+ EXPECT_EQ(NO_ERROR, HidlUtils::audioTagsToHal(emptyTags, halEmptyTags));
+ hidl_vec<AudioTag> emptyTagsBack;
+ EXPECT_EQ(NO_ERROR, HidlUtils::audioTagsFromHal(halEmptyTags, &emptyTagsBack));
+ EXPECT_EQ(emptyTags, emptyTagsBack);
+
+ hidl_vec<AudioTag> oneTag = {{"VX_GOOGLE_VR"}};
+ char halOneTag[AUDIO_ATTRIBUTES_TAGS_MAX_SIZE] = {};
+ EXPECT_EQ(NO_ERROR, HidlUtils::audioTagsToHal(oneTag, halOneTag));
+ hidl_vec<AudioTag> oneTagBack;
+ EXPECT_EQ(NO_ERROR, HidlUtils::audioTagsFromHal(halOneTag, &oneTagBack));
+ EXPECT_EQ(oneTag, oneTagBack);
+
+ hidl_vec<AudioTag> twoTags = {{"VX_GOOGLE_VR_42", "VX_GOOGLE_1E100"}};
+ char halTwoTags[AUDIO_ATTRIBUTES_TAGS_MAX_SIZE] = {};
+ EXPECT_EQ(NO_ERROR, HidlUtils::audioTagsToHal(twoTags, halTwoTags));
+ hidl_vec<AudioTag> twoTagsBack;
+ EXPECT_EQ(NO_ERROR, HidlUtils::audioTagsFromHal(halTwoTags, &twoTagsBack));
+ EXPECT_EQ(twoTags, twoTagsBack);
+}
diff --git a/audio/common/all-versions/util/include/common/all-versions/HidlSupport.h b/audio/common/all-versions/util/include/common/all-versions/HidlSupport.h
index b514a43..d7802cf 100644
--- a/audio/common/all-versions/util/include/common/all-versions/HidlSupport.h
+++ b/audio/common/all-versions/util/include/common/all-versions/HidlSupport.h
@@ -20,6 +20,9 @@
#include <hidl/HidlSupport.h>
#include <algorithm>
+#include <sstream>
+#include <string>
+#include <vector>
namespace android::hardware::audio::common::utils {
@@ -29,6 +32,16 @@
return std::find(values.begin(), values.end(), e) != values.end();
}
+static inline std::vector<std::string> splitString(const std::string& s, char separator) {
+ std::istringstream iss(s);
+ std::string t;
+ std::vector<std::string> result;
+ while (std::getline(iss, t, separator)) {
+ result.push_back(std::move(t));
+ }
+ return result;
+}
+
} // namespace android::hardware::audio::common::utils
#endif // android_hardware_audio_common_HidlSupport_H_
diff --git a/audio/core/all-versions/default/Conversions.cpp b/audio/core/all-versions/default/Conversions.cpp
index 8e0a140..f1752cc 100644
--- a/audio/core/all-versions/default/Conversions.cpp
+++ b/audio/core/all-versions/default/Conversions.cpp
@@ -32,14 +32,10 @@
using ::android::hardware::audio::common::CPP_VERSION::implementation::HidlUtils;
-#if MAJOR_VERSION <= 6
-std::string deviceAddressToHal(const DeviceAddress& address) {
- audio_devices_t halDevice;
- char halAddress[AUDIO_DEVICE_MAX_ADDRESS_LEN];
- (void)deviceAddressToHal(address, &halDevice, halAddress);
- return halAddress;
-}
-#endif
+#define CONVERT_CHECKED(expr, result) \
+ if (status_t status = (expr); status != NO_ERROR) { \
+ result = status; \
+ }
status_t deviceAddressToHal(const DeviceAddress& device, audio_devices_t* halDeviceType,
char* halDeviceAddress) {
@@ -97,6 +93,52 @@
}
return status;
}
+
+status_t sinkMetadataToHal(const SinkMetadata& sinkMetadata,
+ std::vector<record_track_metadata>* halTracks) {
+ status_t result = NO_ERROR;
+ if (halTracks != nullptr) {
+ halTracks->reserve(sinkMetadata.tracks.size());
+ }
+ for (auto& metadata : sinkMetadata.tracks) {
+ record_track_metadata halTrackMetadata{.gain = metadata.gain};
+ CONVERT_CHECKED(HidlUtils::audioSourceToHal(metadata.source, &halTrackMetadata.source),
+ result);
+#if MAJOR_VERSION >= 5
+ if (metadata.destination.getDiscriminator() ==
+ RecordTrackMetadata::Destination::hidl_discriminator::device) {
+ CONVERT_CHECKED(
+ deviceAddressToHal(metadata.destination.device(), &halTrackMetadata.dest_device,
+ halTrackMetadata.dest_device_address),
+ result);
+ }
+#endif
+ if (halTracks != nullptr) {
+ halTracks->push_back(std::move(halTrackMetadata));
+ }
+ }
+ return result;
+}
+
+status_t sourceMetadataToHal(const SourceMetadata& sourceMetadata,
+ std::vector<playback_track_metadata_t>* halTracks) {
+ status_t result = NO_ERROR;
+ if (halTracks != nullptr) {
+ halTracks->reserve(sourceMetadata.tracks.size());
+ }
+ for (auto& metadata : sourceMetadata.tracks) {
+ playback_track_metadata_t halTrackMetadata{.gain = metadata.gain};
+ CONVERT_CHECKED(HidlUtils::audioUsageToHal(metadata.usage, &halTrackMetadata.usage),
+ result);
+ CONVERT_CHECKED(HidlUtils::audioContentTypeToHal(metadata.contentType,
+ &halTrackMetadata.content_type),
+ result);
+ if (halTracks != nullptr) {
+ halTracks->push_back(std::move(halTrackMetadata));
+ }
+ }
+ return result;
+}
#endif // MAJOR_VERSION >= 4
#if MAJOR_VERSION >= 7
@@ -135,6 +177,50 @@
}
return success;
}
+
+status_t sinkMetadataToHalV7(const SinkMetadata& sinkMetadata,
+ std::vector<record_track_metadata_v7_t>* halTracks) {
+ std::vector<record_track_metadata> bases;
+ status_t result = sinkMetadataToHal(sinkMetadata, halTracks != nullptr ? &bases : nullptr);
+ if (halTracks != nullptr) {
+ halTracks->reserve(bases.size());
+ }
+ auto baseIter = std::make_move_iterator(bases.begin());
+ for (auto& metadata : sinkMetadata.tracks) {
+ record_track_metadata_v7_t halTrackMetadata;
+ CONVERT_CHECKED(HidlUtils::audioChannelMaskToHal(metadata.channelMask,
+ &halTrackMetadata.channel_mask),
+ result);
+ CONVERT_CHECKED(HidlUtils::audioTagsToHal(metadata.tags, halTrackMetadata.tags), result);
+ if (halTracks != nullptr) {
+ halTrackMetadata.base = std::move(*baseIter++);
+ halTracks->push_back(std::move(halTrackMetadata));
+ }
+ }
+ return result;
+}
+
+status_t sourceMetadataToHalV7(const SourceMetadata& sourceMetadata,
+ std::vector<playback_track_metadata_v7_t>* halTracks) {
+ std::vector<playback_track_metadata_t> bases;
+ status_t result = sourceMetadataToHal(sourceMetadata, halTracks != nullptr ? &bases : nullptr);
+ if (halTracks != nullptr) {
+ halTracks->reserve(bases.size());
+ }
+ auto baseIter = std::make_move_iterator(bases.begin());
+ for (auto& metadata : sourceMetadata.tracks) {
+ playback_track_metadata_v7_t halTrackMetadata;
+ CONVERT_CHECKED(HidlUtils::audioChannelMaskToHal(metadata.channelMask,
+ &halTrackMetadata.channel_mask),
+ result);
+ CONVERT_CHECKED(HidlUtils::audioTagsToHal(metadata.tags, halTrackMetadata.tags), result);
+ if (halTracks != nullptr) {
+ halTrackMetadata.base = std::move(*baseIter++);
+ halTracks->push_back(std::move(halTrackMetadata));
+ }
+ }
+ return result;
+}
#endif
} // namespace implementation
diff --git a/audio/core/all-versions/default/Device.cpp b/audio/core/all-versions/default/Device.cpp
index bb69f0b..7caed44 100644
--- a/audio/core/all-versions/default/Device.cpp
+++ b/audio/core/all-versions/default/Device.cpp
@@ -135,13 +135,14 @@
Return<void> Device::getInputBufferSize(const AudioConfig& config, getInputBufferSize_cb _hidl_cb) {
audio_config_t halConfig;
- HidlUtils::audioConfigToHal(config, &halConfig);
- size_t halBufferSize = mDevice->get_input_buffer_size(mDevice, &halConfig);
Result retval(Result::INVALID_ARGUMENTS);
uint64_t bufferSize = 0;
- if (halBufferSize != 0) {
- retval = Result::OK;
- bufferSize = halBufferSize;
+ if (HidlUtils::audioConfigToHal(config, &halConfig) == NO_ERROR) {
+ size_t halBufferSize = mDevice->get_input_buffer_size(mDevice, &halConfig);
+ if (halBufferSize != 0) {
+ retval = Result::OK;
+ bufferSize = halBufferSize;
+ }
}
_hidl_cb(retval, bufferSize);
return Void();
@@ -153,7 +154,9 @@
const AudioOutputFlags& flags,
AudioConfig* suggestedConfig) {
audio_config_t halConfig;
- HidlUtils::audioConfigToHal(config, &halConfig);
+ if (HidlUtils::audioConfigToHal(config, &halConfig) != NO_ERROR) {
+ return {Result::INVALID_ARGUMENTS, nullptr};
+ }
audio_stream_out_t* halStream;
audio_devices_t halDevice;
char halDeviceAddress[AUDIO_DEVICE_MAX_ADDRESS_LEN];
@@ -186,7 +189,9 @@
int32_t ioHandle, const DeviceAddress& device, const AudioConfig& config,
const AudioInputFlags& flags, AudioSource source, AudioConfig* suggestedConfig) {
audio_config_t halConfig;
- HidlUtils::audioConfigToHal(config, &halConfig);
+ if (HidlUtils::audioConfigToHal(config, &halConfig) != NO_ERROR) {
+ return {Result::INVALID_ARGUMENTS, nullptr};
+ }
audio_stream_in_t* halStream;
audio_devices_t halDevice;
char halDeviceAddress[AUDIO_DEVICE_MAX_ADDRESS_LEN];
@@ -248,6 +253,14 @@
#endif
const SourceMetadata& sourceMetadata,
openOutputStream_cb _hidl_cb) {
+#if MAJOR_VERSION <= 6
+ if (status_t status = sourceMetadataToHal(sourceMetadata, nullptr); status != NO_ERROR) {
+#else
+ if (status_t status = sourceMetadataToHalV7(sourceMetadata, nullptr); status != NO_ERROR) {
+#endif
+ _hidl_cb(analyzeStatus("sourceMetadataToHal", status), nullptr, AudioConfig{});
+ return Void();
+ }
AudioConfig suggestedConfig;
auto [result, streamOut] =
openOutputStreamImpl(ioHandle, device, config, flags, &suggestedConfig);
@@ -271,7 +284,15 @@
// This should never happen, the framework must not create as stream
// if there is no client
ALOGE("openInputStream called without tracks connected");
- _hidl_cb(Result::INVALID_ARGUMENTS, nullptr, AudioConfig());
+ _hidl_cb(Result::INVALID_ARGUMENTS, nullptr, AudioConfig{});
+ return Void();
+ }
+#if MAJOR_VERSION <= 6
+ if (status_t status = sinkMetadataToHal(sinkMetadata, nullptr); status != NO_ERROR) {
+#else
+ if (status_t status = sinkMetadataToHalV7(sinkMetadata, nullptr); status != NO_ERROR) {
+#endif
+ _hidl_cb(analyzeStatus("sinkMetadataToHal", status), nullptr, AudioConfig{});
return Void();
}
// Pick the first one as the main.
@@ -304,11 +325,17 @@
const hidl_vec<AudioPortConfig>& sinks) {
Result retval(Result::NOT_SUPPORTED);
if (version() >= AUDIO_DEVICE_API_VERSION_3_0) {
- std::unique_ptr<audio_port_config[]> halSources;
- HidlUtils::audioPortConfigsToHal(sources, &halSources);
- std::unique_ptr<audio_port_config[]> halSinks;
- HidlUtils::audioPortConfigsToHal(sinks, &halSinks);
audio_patch_handle_t halPatch = static_cast<audio_patch_handle_t>(patch);
+ std::unique_ptr<audio_port_config[]> halSources;
+ if (status_t status = HidlUtils::audioPortConfigsToHal(sources, &halSources);
+ status != NO_ERROR) {
+ return {analyzeStatus("audioPortConfigsToHal;sources", status), patch};
+ }
+ std::unique_ptr<audio_port_config[]> halSinks;
+ if (status_t status = HidlUtils::audioPortConfigsToHal(sinks, &halSinks);
+ status != NO_ERROR) {
+ return {analyzeStatus("audioPortConfigsToHal;sinks", status), patch};
+ }
retval = analyzeStatus("create_audio_patch",
mDevice->create_audio_patch(mDevice, sources.size(), &halSources[0],
sinks.size(), &halSinks[0], &halPatch));
@@ -343,7 +370,10 @@
Return<Result> Device::setAudioPortConfig(const AudioPortConfig& config) {
if (version() >= AUDIO_DEVICE_API_VERSION_3_0) {
struct audio_port_config halPortConfig;
- HidlUtils::audioPortConfigToHal(config, &halPortConfig);
+ if (status_t status = HidlUtils::audioPortConfigToHal(config, &halPortConfig);
+ status != NO_ERROR) {
+ return analyzeStatus("audioPortConfigToHal", status);
+ }
return analyzeStatus("set_audio_port_config",
mDevice->set_audio_port_config(mDevice, &halPortConfig));
}
diff --git a/audio/core/all-versions/default/Stream.cpp b/audio/core/all-versions/default/Stream.cpp
index c74079d..f964cbb 100644
--- a/audio/core/all-versions/default/Stream.cpp
+++ b/audio/core/all-versions/default/Stream.cpp
@@ -17,6 +17,7 @@
#define LOG_TAG "StreamHAL"
#include "core/default/Stream.h"
+#include "common/all-versions/HidlSupport.h"
#include "common/all-versions/default/EffectMap.h"
#include "core/default/Conversions.h"
#include "core/default/Util.h"
@@ -37,6 +38,7 @@
namespace implementation {
using ::android::hardware::audio::common::CPP_VERSION::implementation::HidlUtils;
+using ::android::hardware::audio::common::utils::splitString;
Stream::Stream(bool isInput, audio_stream_t* stream) : mIsInput(isInput), mStream(stream) {
(void)mIsInput; // prevent 'unused field' warnings in pre-V7 versions.
@@ -220,7 +222,7 @@
// Ensure that the separator is one character, despite that it's defined as a C string.
static_assert(sizeof(AUDIO_PARAMETER_VALUE_LIST_SEPARATOR) == 2);
std::vector<std::string> halFormats =
- util::splitString(halListValue.string(), AUDIO_PARAMETER_VALUE_LIST_SEPARATOR[0]);
+ splitString(halListValue.string(), AUDIO_PARAMETER_VALUE_LIST_SEPARATOR[0]);
hidl_vec<AudioFormat> formats;
(void)HidlUtils::audioFormatsFromHal(halFormats, &formats);
std::vector<AudioProfile> tempProfiles;
@@ -235,7 +237,7 @@
result = getParam(AudioParameter::keyStreamSupportedSamplingRates, &halListValue, context);
if (result != Result::OK) break;
std::vector<std::string> halSampleRates =
- util::splitString(halListValue.string(), AUDIO_PARAMETER_VALUE_LIST_SEPARATOR[0]);
+ splitString(halListValue.string(), AUDIO_PARAMETER_VALUE_LIST_SEPARATOR[0]);
hidl_vec<uint32_t> sampleRates;
sampleRates.resize(halSampleRates.size());
for (size_t i = 0; i < sampleRates.size(); ++i) {
@@ -245,7 +247,7 @@
result = getParam(AudioParameter::keyStreamSupportedChannels, &halListValue, context);
if (result != Result::OK) break;
std::vector<std::string> halChannelMasks =
- util::splitString(halListValue.string(), AUDIO_PARAMETER_VALUE_LIST_SEPARATOR[0]);
+ splitString(halListValue.string(), AUDIO_PARAMETER_VALUE_LIST_SEPARATOR[0]);
hidl_vec<AudioChannelMask> channelMasks;
(void)HidlUtils::audioChannelMasksFromHal(halChannelMasks, &channelMasks);
// Create a profile.
diff --git a/audio/core/all-versions/default/StreamIn.cpp b/audio/core/all-versions/default/StreamIn.cpp
index ead7204..2c5e9f1 100644
--- a/audio/core/all-versions/default/StreamIn.cpp
+++ b/audio/core/all-versions/default/StreamIn.cpp
@@ -478,31 +478,70 @@
}
#if MAJOR_VERSION >= 4
-Return<void> StreamIn::updateSinkMetadata(const SinkMetadata& sinkMetadata) {
- if (mStream->update_sink_metadata == nullptr) {
- return Void(); // not supported by the HAL
- }
+Result StreamIn::doUpdateSinkMetadata(const SinkMetadata& sinkMetadata) {
std::vector<record_track_metadata> halTracks;
- halTracks.reserve(sinkMetadata.tracks.size());
- for (auto& metadata : sinkMetadata.tracks) {
- record_track_metadata halTrackMetadata = {.gain = metadata.gain};
- (void)HidlUtils::audioSourceToHal(metadata.source, &halTrackMetadata.source);
-#if MAJOR_VERSION >= 5
- if (metadata.destination.getDiscriminator() ==
- RecordTrackMetadata::Destination::hidl_discriminator::device) {
- (void)deviceAddressToHal(metadata.destination.device(), &halTrackMetadata.dest_device,
- halTrackMetadata.dest_device_address);
+#if MAJOR_VERSION <= 6
+ (void)sinkMetadataToHal(sinkMetadata, &halTracks);
+#else
+ // Validate whether a conversion to V7 is possible. This is needed
+ // to have a consistent behavior of the HAL regardless of the API
+ // version of the legacy HAL (and also to be consistent with openInputStream).
+ std::vector<record_track_metadata_v7> halTracksV7;
+ if (status_t status = sinkMetadataToHalV7(sinkMetadata, &halTracksV7); status == NO_ERROR) {
+ halTracks.reserve(halTracksV7.size());
+ for (auto metadata_v7 : halTracksV7) {
+ halTracks.push_back(std::move(metadata_v7.base));
}
-#endif
- halTracks.push_back(halTrackMetadata);
+ } else {
+ return Stream::analyzeStatus("sinkMetadataToHal", status);
}
+#endif // MAJOR_VERSION <= 6
const sink_metadata_t halMetadata = {
.track_count = halTracks.size(),
.tracks = halTracks.data(),
};
mStream->update_sink_metadata(mStream, &halMetadata);
+ return Result::OK;
+}
+
+#if MAJOR_VERSION >= 7
+Result StreamIn::doUpdateSinkMetadataV7(const SinkMetadata& sinkMetadata) {
+ std::vector<record_track_metadata_v7> halTracks;
+ if (status_t status = sinkMetadataToHalV7(sinkMetadata, &halTracks); status != NO_ERROR) {
+ return Stream::analyzeStatus("sinkMetadataToHal", status);
+ }
+ const sink_metadata_v7_t halMetadata = {
+ .track_count = halTracks.size(),
+ .tracks = halTracks.data(),
+ };
+ mStream->update_sink_metadata_v7(mStream, &halMetadata);
+ return Result::OK;
+}
+#endif // MAJOR_VERSION >= 7
+
+#if MAJOR_VERSION <= 6
+Return<void> StreamIn::updateSinkMetadata(const SinkMetadata& sinkMetadata) {
+ if (mStream->update_sink_metadata == nullptr) {
+ return Void(); // not supported by the HAL
+ }
+ (void)doUpdateSinkMetadata(sinkMetadata);
return Void();
}
+#elif MAJOR_VERSION >= 7
+Return<Result> StreamIn::updateSinkMetadata(const SinkMetadata& sinkMetadata) {
+ if (mDevice->version() < AUDIO_DEVICE_API_VERSION_3_2) {
+ if (mStream->update_sink_metadata == nullptr) {
+ return Result::NOT_SUPPORTED;
+ }
+ return doUpdateSinkMetadata(sinkMetadata);
+ } else {
+ if (mStream->update_sink_metadata_v7 == nullptr) {
+ return Result::NOT_SUPPORTED;
+ }
+ return doUpdateSinkMetadataV7(sinkMetadata);
+ }
+}
+#endif
Return<void> StreamIn::getActiveMicrophones(getActiveMicrophones_cb _hidl_cb) {
Result retval = Result::NOT_SUPPORTED;
diff --git a/audio/core/all-versions/default/StreamOut.cpp b/audio/core/all-versions/default/StreamOut.cpp
index 5633cbb..ffd3b6b 100644
--- a/audio/core/all-versions/default/StreamOut.cpp
+++ b/audio/core/all-versions/default/StreamOut.cpp
@@ -17,6 +17,7 @@
#define LOG_TAG "StreamOutHAL"
#include "core/default/StreamOut.h"
+#include "core/default/Conversions.h"
#include "core/default/Util.h"
//#define LOG_NDEBUG 0
@@ -585,26 +586,71 @@
}
#if MAJOR_VERSION >= 4
-Return<void> StreamOut::updateSourceMetadata(const SourceMetadata& sourceMetadata) {
- if (mStream->update_source_metadata == nullptr) {
- return Void(); // not supported by the HAL
- }
+Result StreamOut::doUpdateSourceMetadata(const SourceMetadata& sourceMetadata) {
std::vector<playback_track_metadata_t> halTracks;
- halTracks.reserve(sourceMetadata.tracks.size());
- for (auto& metadata : sourceMetadata.tracks) {
- playback_track_metadata_t halTrackMetadata = {.gain = metadata.gain};
- (void)HidlUtils::audioUsageToHal(metadata.usage, &halTrackMetadata.usage);
- (void)HidlUtils::audioContentTypeToHal(metadata.contentType,
- &halTrackMetadata.content_type);
- halTracks.push_back(std::move(halTrackMetadata));
+#if MAJOR_VERSION <= 6
+ (void)sourceMetadataToHal(sourceMetadata, &halTracks);
+#else
+ // Validate whether a conversion to V7 is possible. This is needed
+ // to have a consistent behavior of the HAL regardless of the API
+ // version of the legacy HAL (and also to be consistent with openOutputStream).
+ std::vector<playback_track_metadata_v7> halTracksV7;
+ if (status_t status = sourceMetadataToHalV7(sourceMetadata, &halTracksV7); status == NO_ERROR) {
+ halTracks.reserve(halTracksV7.size());
+ for (auto metadata_v7 : halTracksV7) {
+ halTracks.push_back(std::move(metadata_v7.base));
+ }
+ } else {
+ return Stream::analyzeStatus("sourceMetadataToHal", status);
}
+#endif // MAJOR_VERSION <= 6
const source_metadata_t halMetadata = {
.track_count = halTracks.size(),
.tracks = halTracks.data(),
};
mStream->update_source_metadata(mStream, &halMetadata);
+ return Result::OK;
+}
+
+#if MAJOR_VERSION >= 7
+Result StreamOut::doUpdateSourceMetadataV7(const SourceMetadata& sourceMetadata) {
+ std::vector<playback_track_metadata_v7> halTracks;
+ if (status_t status = sourceMetadataToHalV7(sourceMetadata, &halTracks); status != NO_ERROR) {
+ return Stream::analyzeStatus("sourceMetadataToHal", status);
+ }
+ const source_metadata_v7_t halMetadata = {
+ .track_count = halTracks.size(),
+ .tracks = halTracks.data(),
+ };
+ mStream->update_source_metadata_v7(mStream, &halMetadata);
+ return Result::OK;
+}
+#endif // MAJOR_VERSION >= 7
+
+#if MAJOR_VERSION <= 6
+Return<void> StreamOut::updateSourceMetadata(const SourceMetadata& sourceMetadata) {
+ if (mStream->update_source_metadata == nullptr) {
+ return Void(); // not supported by the HAL
+ }
+ (void)doUpdateSourceMetadata(sourceMetadata);
return Void();
}
+#elif MAJOR_VERSION >= 7
+Return<Result> StreamOut::updateSourceMetadata(const SourceMetadata& sourceMetadata) {
+ if (mDevice->version() < AUDIO_DEVICE_API_VERSION_3_2) {
+ if (mStream->update_source_metadata == nullptr) {
+ return Result::NOT_SUPPORTED;
+ }
+ return doUpdateSourceMetadata(sourceMetadata);
+ } else {
+ if (mStream->update_source_metadata_v7 == nullptr) {
+ return Result::NOT_SUPPORTED;
+ }
+ return doUpdateSourceMetadataV7(sourceMetadata);
+ }
+}
+#endif
+
Return<Result> StreamOut::selectPresentation(int32_t /*presentationId*/, int32_t /*programId*/) {
return Result::NOT_SUPPORTED; // TODO: propagate to legacy
}
diff --git a/audio/core/all-versions/default/include/core/default/Conversions.h b/audio/core/all-versions/default/include/core/default/Conversions.h
index 2372771..61720d5 100644
--- a/audio/core/all-versions/default/include/core/default/Conversions.h
+++ b/audio/core/all-versions/default/include/core/default/Conversions.h
@@ -35,12 +35,6 @@
using namespace ::android::hardware::audio::common::CPP_VERSION;
using namespace ::android::hardware::audio::CPP_VERSION;
-#if MAJOR_VERSION <= 6
-// Temporary version for compatibility with forks of the default implementation.
-// Will be removed, do not use!
-std::string deviceAddressToHal(const DeviceAddress& address);
-#endif
-
status_t deviceAddressToHal(const DeviceAddress& device, audio_devices_t* halDeviceType,
char* halDeviceAddress);
status_t deviceAddressFromHal(audio_devices_t halDeviceType, const char* halDeviceAddress,
@@ -49,6 +43,10 @@
#if MAJOR_VERSION >= 4
bool halToMicrophoneCharacteristics(MicrophoneInfo* pDst,
const struct audio_microphone_characteristic_t& src);
+status_t sinkMetadataToHal(const SinkMetadata& sinkMetadata,
+ std::vector<record_track_metadata>* halTracks);
+status_t sourceMetadataToHal(const SourceMetadata& sourceMetadata,
+ std::vector<playback_track_metadata_t>* halTracks);
#endif
#if MAJOR_VERSION <= 6
@@ -69,6 +67,11 @@
#else
bool audioInputFlagsToHal(const hidl_vec<AudioInOutFlag>& flags, audio_input_flags_t* halFlags);
bool audioOutputFlagsToHal(const hidl_vec<AudioInOutFlag>& flags, audio_output_flags_t* halFlags);
+// Overloading isn't convenient when passing a nullptr.
+status_t sinkMetadataToHalV7(const SinkMetadata& sinkMetadata,
+ std::vector<record_track_metadata_v7_t>* halTracks);
+status_t sourceMetadataToHalV7(const SourceMetadata& sourceMetadata,
+ std::vector<playback_track_metadata_v7_t>* halTracks);
#endif
} // namespace implementation
diff --git a/audio/core/all-versions/default/include/core/default/Device.h b/audio/core/all-versions/default/include/core/default/Device.h
index 461c253..2a4d226 100644
--- a/audio/core/all-versions/default/include/core/default/Device.h
+++ b/audio/core/all-versions/default/include/core/default/Device.h
@@ -146,6 +146,8 @@
void closeOutputStream(audio_stream_out_t* stream);
audio_hw_device_t* device() const { return mDevice; }
+ uint32_t version() const { return mDevice->common.version; }
+
private:
bool mIsClosed;
audio_hw_device_t* mDevice;
@@ -161,8 +163,6 @@
// Methods from ParametersUtil.
char* halGetParameters(const char* keys) override;
int halSetParameters(const char* keysAndValues) override;
-
- uint32_t version() const { return mDevice->common.version; }
};
} // namespace implementation
diff --git a/audio/core/all-versions/default/include/core/default/StreamIn.h b/audio/core/all-versions/default/include/core/default/StreamIn.h
index b861c6c..651b3a6 100644
--- a/audio/core/all-versions/default/include/core/default/StreamIn.h
+++ b/audio/core/all-versions/default/include/core/default/StreamIn.h
@@ -114,9 +114,13 @@
Return<void> createMmapBuffer(int32_t minSizeFrames, createMmapBuffer_cb _hidl_cb) override;
Return<void> getMmapPosition(getMmapPosition_cb _hidl_cb) override;
#if MAJOR_VERSION >= 4
+#if MAJOR_VERSION <= 6
Return<void> updateSinkMetadata(const SinkMetadata& sinkMetadata) override;
- Return<void> getActiveMicrophones(getActiveMicrophones_cb _hidl_cb) override;
+#else
+ Return<Result> updateSinkMetadata(const SinkMetadata& sinkMetadata) override;
#endif
+ Return<void> getActiveMicrophones(getActiveMicrophones_cb _hidl_cb) override;
+#endif // MAJOR_VERSION >= 4
#if MAJOR_VERSION >= 5
Return<Result> setMicrophoneDirection(MicrophoneDirection direction) override;
Return<Result> setMicrophoneFieldDimension(float zoom) override;
@@ -124,7 +128,14 @@
static Result getCapturePositionImpl(audio_stream_in_t* stream, uint64_t* frames,
uint64_t* time);
- private:
+ private:
+#if MAJOR_VERSION >= 4
+ Result doUpdateSinkMetadata(const SinkMetadata& sinkMetadata);
+#if MAJOR_VERSION >= 7
+ Result doUpdateSinkMetadataV7(const SinkMetadata& sinkMetadata);
+#endif
+#endif // MAJOR_VERSION >= 4
+
const sp<Device> mDevice;
audio_stream_in_t* mStream;
const sp<Stream> mStreamCommon;
diff --git a/audio/core/all-versions/default/include/core/default/StreamOut.h b/audio/core/all-versions/default/include/core/default/StreamOut.h
index 9f64e3e..b8e8515 100644
--- a/audio/core/all-versions/default/include/core/default/StreamOut.h
+++ b/audio/core/all-versions/default/include/core/default/StreamOut.h
@@ -123,9 +123,13 @@
Return<void> createMmapBuffer(int32_t minSizeFrames, createMmapBuffer_cb _hidl_cb) override;
Return<void> getMmapPosition(getMmapPosition_cb _hidl_cb) override;
#if MAJOR_VERSION >= 4
- Return<void> updateSourceMetadata(const SourceMetadata& sourceMetadata) override;
Return<Result> selectPresentation(int32_t presentationId, int32_t programId) override;
+#if MAJOR_VERSION <= 6
+ Return<void> updateSourceMetadata(const SourceMetadata& sourceMetadata) override;
+#else
+ Return<Result> updateSourceMetadata(const SourceMetadata& sourceMetadata) override;
#endif
+#endif // MAJOR_VERSION >= 4
#if MAJOR_VERSION >= 6
Return<void> getDualMonoMode(getDualMonoMode_cb _hidl_cb) override;
Return<Result> setDualMonoMode(DualMonoMode mode) override;
@@ -143,6 +147,13 @@
#endif
private:
+#if MAJOR_VERSION >= 4
+ Result doUpdateSourceMetadata(const SourceMetadata& sourceMetadata);
+#if MAJOR_VERSION >= 7
+ Result doUpdateSourceMetadataV7(const SourceMetadata& sourceMetadata);
+#endif
+#endif // MAJOR_VERSION >= 4
+
const sp<Device> mDevice;
audio_stream_out_t* mStream;
const sp<Stream> mStreamCommon;
diff --git a/audio/core/all-versions/default/include/core/default/Util.h b/audio/core/all-versions/default/include/core/default/Util.h
index 3d629cd..78ae03e 100644
--- a/audio/core/all-versions/default/include/core/default/Util.h
+++ b/audio/core/all-versions/default/include/core/default/Util.h
@@ -20,8 +20,6 @@
#include PATH(android/hardware/audio/FILE_VERSION/types.h)
#include <algorithm>
-#include <sstream>
-#include <string>
#include <vector>
#include <system/audio.h>
@@ -72,16 +70,6 @@
return analyzeStatus(status);
}
-static inline std::vector<std::string> splitString(const std::string& s, char separator) {
- std::istringstream iss(s);
- std::string t;
- std::vector<std::string> result;
- while (std::getline(iss, t, separator)) {
- result.push_back(std::move(t));
- }
- return result;
-}
-
} // namespace util
} // namespace implementation
} // namespace CPP_VERSION
diff --git a/audio/core/all-versions/vts/functional/4.0/AudioPrimaryHidlHalTest.cpp b/audio/core/all-versions/vts/functional/4.0/AudioPrimaryHidlHalTest.cpp
index 9a4a8b2..5076dcf 100644
--- a/audio/core/all-versions/vts/functional/4.0/AudioPrimaryHidlHalTest.cpp
+++ b/audio/core/all-versions/vts/functional/4.0/AudioPrimaryHidlHalTest.cpp
@@ -72,7 +72,10 @@
config.base.format = toString(xsd::AudioFormat::AUDIO_FORMAT_PCM_16_BIT);
hidl_vec<hidl_string> flags;
const SinkMetadata initMetadata = {
- {{.source = toString(xsd::AudioSource::AUDIO_SOURCE_MIC), .gain = 1}}};
+ {{.source = toString(xsd::AudioSource::AUDIO_SOURCE_MIC),
+ .gain = 1,
+ .tags = {},
+ .channelMask = toString(xsd::AudioChannelMask::AUDIO_CHANNEL_IN_MONO)}}};
#endif
EventFlag* efGroup;
for (auto microphone : microphones) {
@@ -234,22 +237,14 @@
TEST_P(InputStreamTest, updateSinkMetadata) {
doc::test("The HAL should not crash on metadata change");
-
#if MAJOR_VERSION <= 6
hidl_enum_range<AudioSource> range;
-#elif MAJOR_VERSION >= 7
- xsdc_enum_range<android::audio::policy::configuration::V7_0::AudioSource> range;
-#endif
// Test all possible track configuration
for (auto source : range) {
for (float volume : {0.0, 0.5, 1.0}) {
-#if MAJOR_VERSION <= 6
const SinkMetadata metadata = {{{.source = source, .gain = volume}}};
-#elif MAJOR_VERSION >= 7
- const SinkMetadata metadata = {{{.source = toString(source), .gain = volume}}};
-#endif
ASSERT_OK(stream->updateSinkMetadata(metadata))
- << "source=" << toString(source) << ", volume=" << volume;
+ << "source=" << toString(source) << ", volume=" << volume;
}
}
@@ -257,9 +252,30 @@
// Set no metadata as if all stream track had stopped
ASSERT_OK(stream->updateSinkMetadata({}));
-
// Restore initial
ASSERT_OK(stream->updateSinkMetadata(initMetadata));
+
+#elif MAJOR_VERSION >= 7
+ xsdc_enum_range<android::audio::policy::configuration::V7_0::AudioSource> range;
+ // Test all possible track configuration
+ for (auto source : range) {
+ for (float volume : {0.0, 0.5, 1.0}) {
+ const SinkMetadata metadata = {
+ {{.source = toString(source),
+ .gain = volume,
+ .tags = {},
+ .channelMask = toString(xsd::AudioChannelMask::AUDIO_CHANNEL_IN_MONO)}}};
+ ASSERT_RESULT(okOrNotSupported, stream->updateSinkMetadata(metadata))
+ << "source=" << toString(source) << ", volume=" << volume;
+ }
+ }
+ // Do not test concurrent capture as this is not officially supported
+
+ // Set no metadata as if all stream track had stopped
+ ASSERT_RESULT(okOrNotSupported, stream->updateSinkMetadata({}));
+ // Restore initial
+ ASSERT_RESULT(okOrNotSupported, stream->updateSinkMetadata(initMetadata));
+#endif
}
TEST_P(OutputStreamTest, SelectPresentation) {
@@ -269,56 +285,82 @@
TEST_P(OutputStreamTest, updateSourceMetadata) {
doc::test("The HAL should not crash on metadata change");
-
#if MAJOR_VERSION <= 6
hidl_enum_range<AudioUsage> usageRange;
hidl_enum_range<AudioContentType> contentRange;
-#elif MAJOR_VERSION >= 7
- xsdc_enum_range<android::audio::policy::configuration::V7_0::AudioUsage> usageRange;
- xsdc_enum_range<android::audio::policy::configuration::V7_0::AudioContentType> contentRange;
-#endif
// Test all possible track configuration
for (auto usage : usageRange) {
for (auto content : contentRange) {
for (float volume : {0.0, 0.5, 1.0}) {
-#if MAJOR_VERSION <= 6
const SourceMetadata metadata = {{{usage, content, volume}}};
-#elif MAJOR_VERSION >= 7
- const SourceMetadata metadata = {{{toString(usage), toString(content), volume}}};
-#endif
ASSERT_OK(stream->updateSourceMetadata(metadata))
<< "usage=" << toString(usage) << ", content=" << toString(content)
<< ", volume=" << volume;
}
}
}
-
- // clang-format off
// Set many track of different configuration
+ // clang-format off
ASSERT_OK(stream->updateSourceMetadata(
-#if MAJOR_VERSION <= 6
{{{AudioUsage::MEDIA, AudioContentType::MUSIC, 0.1},
{AudioUsage::VOICE_COMMUNICATION, AudioContentType::SPEECH, 1.0},
{AudioUsage::ALARM, AudioContentType::SONIFICATION, 0.0},
{AudioUsage::ASSISTANT, AudioContentType::UNKNOWN, 0.3}}}
-#elif MAJOR_VERSION >= 7
- {{{toString(xsd::AudioUsage::AUDIO_USAGE_MEDIA),
- toString(xsd::AudioContentType::AUDIO_CONTENT_TYPE_MUSIC), 0.1},
- {toString(xsd::AudioUsage::AUDIO_USAGE_VOICE_COMMUNICATION),
- toString(xsd::AudioContentType::AUDIO_CONTENT_TYPE_SPEECH), 1.0},
- {toString(xsd::AudioUsage::AUDIO_USAGE_ALARM),
- toString(xsd::AudioContentType::AUDIO_CONTENT_TYPE_SONIFICATION), 0.0},
- {toString(xsd::AudioUsage::AUDIO_USAGE_ASSISTANT),
- toString(xsd::AudioContentType::AUDIO_CONTENT_TYPE_UNKNOWN), 0.3}}}
-#endif
));
// clang-format on
-
// Set no metadata as if all stream track had stopped
ASSERT_OK(stream->updateSourceMetadata({}));
-
// Restore initial
ASSERT_OK(stream->updateSourceMetadata(initMetadata));
+#elif MAJOR_VERSION >= 7
+ xsdc_enum_range<android::audio::policy::configuration::V7_0::AudioUsage> usageRange;
+ xsdc_enum_range<android::audio::policy::configuration::V7_0::AudioContentType> contentRange;
+ // Test all possible track configuration
+ for (auto usage : usageRange) {
+ for (auto content : contentRange) {
+ for (float volume : {0.0, 0.5, 1.0}) {
+ const SourceMetadata metadata = {
+ {{toString(usage),
+ toString(content),
+ {} /* tags */,
+ toString(xsd::AudioChannelMask::AUDIO_CHANNEL_OUT_STEREO),
+ volume}}};
+ ASSERT_RESULT(okOrNotSupported, stream->updateSourceMetadata(metadata))
+ << "usage=" << toString(usage) << ", content=" << toString(content)
+ << ", volume=" << volume;
+ }
+ }
+ }
+ // Set many track of different configuration
+ // clang-format off
+ ASSERT_RESULT(okOrNotSupported, stream->updateSourceMetadata(
+ {{{toString(xsd::AudioUsage::AUDIO_USAGE_MEDIA),
+ toString(xsd::AudioContentType::AUDIO_CONTENT_TYPE_MUSIC),
+ {},
+ toString(xsd::AudioChannelMask::AUDIO_CHANNEL_OUT_STEREO),
+ 0.1},
+ {toString(xsd::AudioUsage::AUDIO_USAGE_VOICE_COMMUNICATION),
+ toString(xsd::AudioContentType::AUDIO_CONTENT_TYPE_SPEECH),
+ {}, // tags
+ toString(xsd::AudioChannelMask::AUDIO_CHANNEL_OUT_MONO),
+ 1.0},
+ {toString(xsd::AudioUsage::AUDIO_USAGE_ALARM),
+ toString(xsd::AudioContentType::AUDIO_CONTENT_TYPE_SONIFICATION),
+ {}, // tags
+ toString(xsd::AudioChannelMask::AUDIO_CHANNEL_OUT_STEREO),
+ 0.0},
+ {toString(xsd::AudioUsage::AUDIO_USAGE_ASSISTANT),
+ toString(xsd::AudioContentType::AUDIO_CONTENT_TYPE_UNKNOWN),
+ {},
+ toString(xsd::AudioChannelMask::AUDIO_CHANNEL_OUT_MONO),
+ 0.3}}}
+ ));
+ // clang-format on
+ // Set no metadata as if all stream track had stopped
+ ASSERT_RESULT(okOrNotSupported, stream->updateSourceMetadata({}));
+ // Restore initial
+ ASSERT_RESULT(okOrNotSupported, stream->updateSourceMetadata(initMetadata));
+#endif
}
TEST_P(AudioPrimaryHidlTest, setMode) {
diff --git a/audio/core/all-versions/vts/functional/6.0/AudioPrimaryHidlHalTest.cpp b/audio/core/all-versions/vts/functional/6.0/AudioPrimaryHidlHalTest.cpp
index bd8de2d..0ebe4c2 100644
--- a/audio/core/all-versions/vts/functional/6.0/AudioPrimaryHidlHalTest.cpp
+++ b/audio/core/all-versions/vts/functional/6.0/AudioPrimaryHidlHalTest.cpp
@@ -18,137 +18,131 @@
#include "5.0/AudioPrimaryHidlHalTest.cpp"
#if MAJOR_VERSION <= 6
-const std::vector<DeviceConfigParameter>& getOutputDeviceConfigParameters() {
- static std::vector<DeviceConfigParameter> parameters = [] {
- std::vector<DeviceConfigParameter> result;
- for (const auto& device : getDeviceParameters()) {
- auto module =
- getCachedPolicyConfig().getModuleFromName(std::get<PARAM_DEVICE_NAME>(device));
- for (const auto& ioProfile : module->getOutputProfiles()) {
- for (const auto& profile : ioProfile->getAudioProfiles()) {
- const auto& channels = profile->getChannels();
- const auto& sampleRates = profile->getSampleRates();
- auto configs = ConfigHelper::combineAudioConfig(
- std::vector<audio_channel_mask_t>(channels.begin(), channels.end()),
- std::vector<uint32_t>(sampleRates.begin(), sampleRates.end()),
- profile->getFormat());
- auto flags = ioProfile->getFlags();
- for (auto& config : configs) {
- // Some combinations of flags declared in the config file require special
- // treatment.
- if (flags & AUDIO_OUTPUT_FLAG_COMPRESS_OFFLOAD) {
- config.offloadInfo.sampleRateHz = config.sampleRateHz;
- config.offloadInfo.channelMask = config.channelMask;
- config.offloadInfo.format = config.format;
- config.offloadInfo.streamType = AudioStreamType::MUSIC;
- config.offloadInfo.bitRatePerSecond = 320;
- config.offloadInfo.durationMicroseconds = -1;
- config.offloadInfo.bitWidth = 16;
- config.offloadInfo.bufferSize = 256; // arbitrary value
- config.offloadInfo.usage = AudioUsage::MEDIA;
- result.emplace_back(device, config,
- AudioOutputFlag(AudioOutputFlag::COMPRESS_OFFLOAD |
- AudioOutputFlag::DIRECT));
- } else {
- if (flags & AUDIO_OUTPUT_FLAG_PRIMARY) { // ignore the flag
- flags &= ~AUDIO_OUTPUT_FLAG_PRIMARY;
- }
- result.emplace_back(device, config, AudioOutputFlag(flags));
+static std::vector<DeviceConfigParameter> generateOutputDeviceConfigParameters(
+ bool oneProfilePerDevice) {
+ std::vector<DeviceConfigParameter> result;
+ for (const auto& device : getDeviceParameters()) {
+ auto module =
+ getCachedPolicyConfig().getModuleFromName(std::get<PARAM_DEVICE_NAME>(device));
+ for (const auto& ioProfile : module->getOutputProfiles()) {
+ for (const auto& profile : ioProfile->getAudioProfiles()) {
+ const auto& channels = profile->getChannels();
+ const auto& sampleRates = profile->getSampleRates();
+ auto configs = ConfigHelper::combineAudioConfig(
+ std::vector<audio_channel_mask_t>(channels.begin(), channels.end()),
+ std::vector<uint32_t>(sampleRates.begin(), sampleRates.end()),
+ profile->getFormat());
+ auto flags = ioProfile->getFlags();
+ for (auto& config : configs) {
+ // Some combinations of flags declared in the config file require special
+ // treatment.
+ if (flags & AUDIO_OUTPUT_FLAG_COMPRESS_OFFLOAD) {
+ config.offloadInfo.sampleRateHz = config.sampleRateHz;
+ config.offloadInfo.channelMask = config.channelMask;
+ config.offloadInfo.format = config.format;
+ config.offloadInfo.streamType = AudioStreamType::MUSIC;
+ config.offloadInfo.bitRatePerSecond = 320;
+ config.offloadInfo.durationMicroseconds = -1;
+ config.offloadInfo.bitWidth = 16;
+ config.offloadInfo.bufferSize = 256; // arbitrary value
+ config.offloadInfo.usage = AudioUsage::MEDIA;
+ result.emplace_back(device, config,
+ AudioOutputFlag(AudioOutputFlag::COMPRESS_OFFLOAD |
+ AudioOutputFlag::DIRECT));
+ } else {
+ if (flags & AUDIO_OUTPUT_FLAG_PRIMARY) { // ignore the flag
+ flags &= ~AUDIO_OUTPUT_FLAG_PRIMARY;
}
+ result.emplace_back(device, config, AudioOutputFlag(flags));
}
+ if (oneProfilePerDevice) break;
}
+ if (oneProfilePerDevice) break;
}
+ if (oneProfilePerDevice) break;
}
- return result;
- }();
+ }
+ return result;
+}
+
+const std::vector<DeviceConfigParameter>& getOutputDeviceConfigParameters() {
+ static std::vector<DeviceConfigParameter> parameters =
+ generateOutputDeviceConfigParameters(false);
return parameters;
}
-const std::vector<DeviceConfigParameter>& getInputDeviceConfigParameters() {
- static std::vector<DeviceConfigParameter> parameters = [] {
- std::vector<DeviceConfigParameter> result;
- for (const auto& device : getDeviceParameters()) {
- auto module =
- getCachedPolicyConfig().getModuleFromName(std::get<PARAM_DEVICE_NAME>(device));
- for (const auto& ioProfile : module->getInputProfiles()) {
- for (const auto& profile : ioProfile->getAudioProfiles()) {
- const auto& channels = profile->getChannels();
- const auto& sampleRates = profile->getSampleRates();
- auto configs = ConfigHelper::combineAudioConfig(
- std::vector<audio_channel_mask_t>(channels.begin(), channels.end()),
- std::vector<uint32_t>(sampleRates.begin(), sampleRates.end()),
- profile->getFormat());
- for (const auto& config : configs) {
- result.emplace_back(device, config, AudioInputFlag(ioProfile->getFlags()));
- }
+const std::vector<DeviceConfigParameter>& getOutputDeviceSingleConfigParameters() {
+ static std::vector<DeviceConfigParameter> parameters =
+ generateOutputDeviceConfigParameters(true);
+ return parameters;
+}
+
+static std::vector<DeviceConfigParameter> generateInputDeviceConfigParameters(
+ bool oneProfilePerDevice) {
+ std::vector<DeviceConfigParameter> result;
+ for (const auto& device : getDeviceParameters()) {
+ auto module =
+ getCachedPolicyConfig().getModuleFromName(std::get<PARAM_DEVICE_NAME>(device));
+ for (const auto& ioProfile : module->getInputProfiles()) {
+ for (const auto& profile : ioProfile->getAudioProfiles()) {
+ const auto& channels = profile->getChannels();
+ const auto& sampleRates = profile->getSampleRates();
+ auto configs = ConfigHelper::combineAudioConfig(
+ std::vector<audio_channel_mask_t>(channels.begin(), channels.end()),
+ std::vector<uint32_t>(sampleRates.begin(), sampleRates.end()),
+ profile->getFormat());
+ for (const auto& config : configs) {
+ result.emplace_back(device, config, AudioInputFlag(ioProfile->getFlags()));
+ if (oneProfilePerDevice) break;
}
+ if (oneProfilePerDevice) break;
}
+ if (oneProfilePerDevice) break;
}
- return result;
- }();
+ }
+ return result;
+}
+
+const std::vector<DeviceConfigParameter>& getInputDeviceConfigParameters() {
+ static std::vector<DeviceConfigParameter> parameters =
+ generateInputDeviceConfigParameters(false);
+ return parameters;
+}
+
+const std::vector<DeviceConfigParameter>& getInputDeviceSingleConfigParameters() {
+ static std::vector<DeviceConfigParameter> parameters =
+ generateInputDeviceConfigParameters(true);
return parameters;
}
#endif // MAJOR_VERSION <= 6
-TEST_P(AudioHidlDeviceTest, CloseDeviceWithOpenedOutputStreams) {
- doc::test("Verify that a device can't be closed if there are streams opened");
-#if MAJOR_VERSION <= 6
- DeviceAddress address{.device = AudioDevice::OUT_DEFAULT};
- SourceMetadata initMetadata = {{{AudioUsage::MEDIA, AudioContentType::MUSIC, 1 /* gain */}}};
- auto flags = hidl_bitfield<AudioOutputFlag>(AudioOutputFlag::NONE);
-#elif MAJOR_VERSION >= 7
- DeviceAddress address{.deviceType = toString(xsd::AudioDevice::AUDIO_DEVICE_OUT_DEFAULT)};
- SourceMetadata initMetadata = {
- {{toString(xsd::AudioUsage::AUDIO_USAGE_MEDIA),
- toString(xsd::AudioContentType::AUDIO_CONTENT_TYPE_MUSIC), 1 /* gain */}}};
- hidl_vec<AudioInOutFlag> flags;
-#endif
- AudioConfig config{};
- sp<IStreamOut> stream;
- StreamHelper<IStreamOut> helper(stream);
- AudioConfig suggestedConfig{};
- ASSERT_NO_FATAL_FAILURE(helper.open(
- [&](AudioIoHandle handle, AudioConfig config, auto cb) {
- return getDevice()->openOutputStream(handle, address, config, flags, initMetadata,
- cb);
- },
- config, &res, &suggestedConfig));
+class SingleConfigOutputStreamTest : public OutputStreamTest {};
+TEST_P(SingleConfigOutputStreamTest, CloseDeviceWithOpenedOutputStreams) {
+ doc::test("Verify that a device can't be closed if there are output streams opened");
+ // Opening of the stream is done in SetUp.
ASSERT_RESULT(Result::INVALID_STATE, getDevice()->close());
- ASSERT_NO_FATAL_FAILURE(helper.close(true /*clear*/, &res));
+ ASSERT_OK(closeStream(true /*clear*/));
ASSERT_OK(getDevice()->close());
ASSERT_TRUE(resetDevice());
}
+INSTANTIATE_TEST_CASE_P(SingleConfigOutputStream, SingleConfigOutputStreamTest,
+ ::testing::ValuesIn(getOutputDeviceSingleConfigParameters()),
+ &DeviceConfigParameterToString);
+GTEST_ALLOW_UNINSTANTIATED_PARAMETERIZED_TEST(SingleConfigOutputStreamTest);
-TEST_P(AudioHidlDeviceTest, CloseDeviceWithOpenedInputStreams) {
- doc::test("Verify that a device can't be closed if there are streams opened");
- if (!getCachedPolicyConfig().haveInputProfilesInModule(getDeviceName())) {
- GTEST_SKIP() << "Device doesn't have input profiles";
- }
-#if MAJOR_VERSION <= 6
- DeviceAddress address{.device = AudioDevice::IN_DEFAULT};
- SinkMetadata initMetadata = {{{.source = AudioSource::MIC, .gain = 1}}};
- auto flags = hidl_bitfield<AudioInputFlag>(AudioInputFlag::NONE);
-#elif MAJOR_VERSION >= 7
- DeviceAddress address{.deviceType = toString(xsd::AudioDevice::AUDIO_DEVICE_IN_DEFAULT)};
- SinkMetadata initMetadata = {
- {{.source = toString(xsd::AudioSource::AUDIO_SOURCE_MIC), .gain = 1}}};
- hidl_vec<AudioInOutFlag> flags;
-#endif
- AudioConfig config{};
- sp<IStreamIn> stream;
- StreamHelper<IStreamIn> helper(stream);
- AudioConfig suggestedConfig{};
- ASSERT_NO_FATAL_FAILURE(helper.open(
- [&](AudioIoHandle handle, AudioConfig config, auto cb) {
- return getDevice()->openInputStream(handle, address, config, flags, initMetadata,
- cb);
- },
- config, &res, &suggestedConfig));
+class SingleConfigInputStreamTest : public InputStreamTest {};
+TEST_P(SingleConfigInputStreamTest, CloseDeviceWithOpenedInputStreams) {
+ doc::test("Verify that a device can't be closed if there are input streams opened");
+ // Opening of the stream is done in SetUp.
ASSERT_RESULT(Result::INVALID_STATE, getDevice()->close());
- ASSERT_NO_FATAL_FAILURE(helper.close(true /*clear*/, &res));
+ ASSERT_OK(closeStream(true /*clear*/));
ASSERT_OK(getDevice()->close());
ASSERT_TRUE(resetDevice());
}
+INSTANTIATE_TEST_CASE_P(SingleConfigInputStream, SingleConfigInputStreamTest,
+ ::testing::ValuesIn(getInputDeviceSingleConfigParameters()),
+ &DeviceConfigParameterToString);
+GTEST_ALLOW_UNINSTANTIATED_PARAMETERIZED_TEST(SingleConfigInputStreamTest);
TEST_P(AudioPatchHidlTest, UpdatePatchInvalidHandle) {
doc::test("Verify that passing an invalid handle to updateAudioPatch is checked");
diff --git a/audio/core/all-versions/vts/functional/7.0/AudioPrimaryHidlHalTest.cpp b/audio/core/all-versions/vts/functional/7.0/AudioPrimaryHidlHalTest.cpp
index 6bb7995..7fca610 100644
--- a/audio/core/all-versions/vts/functional/7.0/AudioPrimaryHidlHalTest.cpp
+++ b/audio/core/all-versions/vts/functional/7.0/AudioPrimaryHidlHalTest.cpp
@@ -25,7 +25,6 @@
for (auto channelMask : channelMasks) {
for (auto sampleRate : sampleRates) {
AudioConfig config{};
- // leave offloadInfo to 0
config.base.channelMask = toString(channelMask);
config.base.sampleRateHz = sampleRate;
config.base.format = format;
@@ -35,56 +34,158 @@
return configs;
}
+static std::tuple<std::vector<AudioInOutFlag>, bool> generateOutFlags(
+ const xsd::MixPorts::MixPort& mixPort) {
+ static const std::vector<AudioInOutFlag> offloadFlags = {
+ toString(xsd::AudioInOutFlag::AUDIO_OUTPUT_FLAG_COMPRESS_OFFLOAD),
+ toString(xsd::AudioInOutFlag::AUDIO_OUTPUT_FLAG_DIRECT)};
+ std::vector<AudioInOutFlag> flags;
+ bool isOffload = false;
+ if (mixPort.hasFlags()) {
+ auto xsdFlags = mixPort.getFlags();
+ isOffload = std::find(xsdFlags.begin(), xsdFlags.end(),
+ xsd::AudioInOutFlag::AUDIO_OUTPUT_FLAG_COMPRESS_OFFLOAD) !=
+ xsdFlags.end();
+ if (!isOffload) {
+ for (auto flag : xsdFlags) {
+ if (flag != xsd::AudioInOutFlag::AUDIO_OUTPUT_FLAG_PRIMARY) {
+ flags.push_back(toString(flag));
+ }
+ }
+ } else {
+ flags = offloadFlags;
+ }
+ }
+ return {flags, isOffload};
+}
+
+static AudioOffloadInfo generateOffloadInfo(const AudioConfigBase& base) {
+ return AudioOffloadInfo{
+ .base = base,
+ .streamType = toString(xsd::AudioStreamType::AUDIO_STREAM_MUSIC),
+ .usage = toString(xsd::AudioUsage::AUDIO_USAGE_MEDIA),
+ .bitRatePerSecond = 320,
+ .durationMicroseconds = -1,
+ .bitWidth = 16,
+ .bufferSize = 256 // arbitrary value
+ };
+}
+
+static std::vector<DeviceConfigParameter> generateOutputDeviceConfigParameters(
+ bool oneProfilePerDevice) {
+ std::vector<DeviceConfigParameter> result;
+ for (const auto& device : getDeviceParameters()) {
+ auto module =
+ getCachedPolicyConfig().getModuleFromName(std::get<PARAM_DEVICE_NAME>(device));
+ if (!module || !module->getFirstMixPorts()) break;
+ for (const auto& mixPort : module->getFirstMixPorts()->getMixPort()) {
+ if (mixPort.getRole() != xsd::Role::source) continue; // not an output profile
+ auto [flags, isOffload] = generateOutFlags(mixPort);
+ for (const auto& profile : mixPort.getProfile()) {
+ auto configs = combineAudioConfig(profile.getChannelMasks(),
+ profile.getSamplingRates(), profile.getFormat());
+ for (auto& config : configs) {
+ // Some combinations of flags declared in the config file require special
+ // treatment.
+ if (isOffload) {
+ config.offloadInfo.info(generateOffloadInfo(config.base));
+ }
+ result.emplace_back(device, config, flags);
+ if (oneProfilePerDevice) break;
+ }
+ if (oneProfilePerDevice) break;
+ }
+ if (oneProfilePerDevice) break;
+ }
+ }
+ return result;
+}
+
const std::vector<DeviceConfigParameter>& getOutputDeviceConfigParameters() {
- static std::vector<DeviceConfigParameter> parameters = [] {
+ static std::vector<DeviceConfigParameter> parameters =
+ generateOutputDeviceConfigParameters(false);
+ return parameters;
+}
+
+const std::vector<DeviceConfigParameter>& getOutputDeviceSingleConfigParameters() {
+ static std::vector<DeviceConfigParameter> parameters =
+ generateOutputDeviceConfigParameters(true);
+ return parameters;
+}
+
+const std::vector<DeviceConfigParameter>& getOutputDeviceInvalidConfigParameters(
+ bool generateInvalidFlags = true) {
+ static std::vector<DeviceConfigParameter> parameters = [&] {
std::vector<DeviceConfigParameter> result;
- const std::vector<AudioInOutFlag> offloadFlags = {
- toString(xsd::AudioInOutFlag::AUDIO_OUTPUT_FLAG_COMPRESS_OFFLOAD),
- toString(xsd::AudioInOutFlag::AUDIO_OUTPUT_FLAG_DIRECT)};
for (const auto& device : getDeviceParameters()) {
auto module =
getCachedPolicyConfig().getModuleFromName(std::get<PARAM_DEVICE_NAME>(device));
if (!module || !module->getFirstMixPorts()) break;
+ bool hasRegularConfig = false, hasOffloadConfig = false;
for (const auto& mixPort : module->getFirstMixPorts()->getMixPort()) {
if (mixPort.getRole() != xsd::Role::source) continue; // not an output profile
- std::vector<AudioInOutFlag> flags;
- bool isOffload = false;
- if (mixPort.hasFlags()) {
- auto xsdFlags = mixPort.getFlags();
- isOffload =
- std::find(xsdFlags.begin(), xsdFlags.end(),
- xsd::AudioInOutFlag::AUDIO_OUTPUT_FLAG_COMPRESS_OFFLOAD) !=
- xsdFlags.end();
- if (!isOffload) {
- for (auto flag : xsdFlags) {
- if (flag != xsd::AudioInOutFlag::AUDIO_OUTPUT_FLAG_PRIMARY) {
- flags.push_back(toString(flag));
- }
- }
- } else {
- flags = offloadFlags;
- }
- }
+ auto [validFlags, isOffload] = generateOutFlags(mixPort);
+ if ((!isOffload && hasRegularConfig) || (isOffload && hasOffloadConfig)) continue;
for (const auto& profile : mixPort.getProfile()) {
- auto configs =
- combineAudioConfig(profile.getChannelMasks(),
- profile.getSamplingRates(), profile.getFormat());
- for (auto& config : configs) {
- // Some combinations of flags declared in the config file require special
- // treatment.
+ if (!profile.hasFormat() || !profile.hasSamplingRates() ||
+ !profile.hasChannelMasks())
+ continue;
+ AudioConfigBase validBase = {
+ profile.getFormat(),
+ static_cast<uint32_t>(profile.getSamplingRates()[0]),
+ toString(profile.getChannelMasks()[0])};
+ {
+ AudioConfig config{.base = validBase};
+ config.base.channelMask = "random_string";
if (isOffload) {
- config.offloadInfo.base = config.base;
- config.offloadInfo.streamType =
- toString(xsd::AudioStreamType::AUDIO_STREAM_MUSIC);
- config.offloadInfo.usage = toString(xsd::AudioUsage::AUDIO_USAGE_MEDIA);
- config.offloadInfo.bitRatePerSecond = 320;
- config.offloadInfo.durationMicroseconds = -1;
- config.offloadInfo.bitWidth = 16;
- config.offloadInfo.bufferSize = 256; // arbitrary value
+ config.offloadInfo.info(generateOffloadInfo(validBase));
}
+ result.emplace_back(device, config, validFlags);
+ }
+ {
+ AudioConfig config{.base = validBase};
+ config.base.format = "random_string";
+ if (isOffload) {
+ config.offloadInfo.info(generateOffloadInfo(validBase));
+ }
+ result.emplace_back(device, config, validFlags);
+ }
+ if (generateInvalidFlags) {
+ AudioConfig config{.base = validBase};
+ if (isOffload) {
+ config.offloadInfo.info(generateOffloadInfo(validBase));
+ }
+ std::vector<AudioInOutFlag> flags = {"random_string", ""};
result.emplace_back(device, config, flags);
}
+ if (isOffload) {
+ {
+ AudioConfig config{.base = validBase};
+ config.offloadInfo.info(generateOffloadInfo(validBase));
+ config.offloadInfo.info().base.channelMask = "random_string";
+ }
+ {
+ AudioConfig config{.base = validBase};
+ config.offloadInfo.info(generateOffloadInfo(validBase));
+ config.offloadInfo.info().base.format = "random_string";
+ }
+ {
+ AudioConfig config{.base = validBase};
+ config.offloadInfo.info(generateOffloadInfo(validBase));
+ config.offloadInfo.info().streamType = "random_string";
+ }
+ {
+ AudioConfig config{.base = validBase};
+ config.offloadInfo.info(generateOffloadInfo(validBase));
+ config.offloadInfo.info().usage = "random_string";
+ }
+ hasOffloadConfig = true;
+ } else {
+ hasRegularConfig = true;
+ }
+ break;
}
+ if (hasOffloadConfig && hasRegularConfig) break;
}
}
return result;
@@ -92,32 +193,563 @@
return parameters;
}
+static std::vector<DeviceConfigParameter> generateInputDeviceConfigParameters(
+ bool oneProfilePerDevice) {
+ std::vector<DeviceConfigParameter> result;
+ for (const auto& device : getDeviceParameters()) {
+ auto module =
+ getCachedPolicyConfig().getModuleFromName(std::get<PARAM_DEVICE_NAME>(device));
+ if (!module || !module->getFirstMixPorts()) break;
+ for (const auto& mixPort : module->getFirstMixPorts()->getMixPort()) {
+ if (mixPort.getRole() != xsd::Role::sink) continue; // not an input profile
+ std::vector<AudioInOutFlag> flags;
+ if (mixPort.hasFlags()) {
+ std::transform(mixPort.getFlags().begin(), mixPort.getFlags().end(),
+ std::back_inserter(flags), [](auto flag) { return toString(flag); });
+ }
+ for (const auto& profile : mixPort.getProfile()) {
+ auto configs = combineAudioConfig(profile.getChannelMasks(),
+ profile.getSamplingRates(), profile.getFormat());
+ for (const auto& config : configs) {
+ result.emplace_back(device, config, flags);
+ if (oneProfilePerDevice) break;
+ }
+ if (oneProfilePerDevice) break;
+ }
+ if (oneProfilePerDevice) break;
+ }
+ }
+ return result;
+}
+
const std::vector<DeviceConfigParameter>& getInputDeviceConfigParameters() {
- static std::vector<DeviceConfigParameter> parameters = [] {
+ static std::vector<DeviceConfigParameter> parameters =
+ generateInputDeviceConfigParameters(false);
+ return parameters;
+}
+
+const std::vector<DeviceConfigParameter>& getInputDeviceSingleConfigParameters() {
+ static std::vector<DeviceConfigParameter> parameters =
+ generateInputDeviceConfigParameters(true);
+ return parameters;
+}
+
+const std::vector<DeviceConfigParameter>& getInputDeviceInvalidConfigParameters(
+ bool generateInvalidFlags = true) {
+ static std::vector<DeviceConfigParameter> parameters = [&] {
std::vector<DeviceConfigParameter> result;
for (const auto& device : getDeviceParameters()) {
auto module =
getCachedPolicyConfig().getModuleFromName(std::get<PARAM_DEVICE_NAME>(device));
if (!module || !module->getFirstMixPorts()) break;
+ bool hasConfig = false;
for (const auto& mixPort : module->getFirstMixPorts()->getMixPort()) {
if (mixPort.getRole() != xsd::Role::sink) continue; // not an input profile
- std::vector<AudioInOutFlag> flags;
+ std::vector<AudioInOutFlag> validFlags;
if (mixPort.hasFlags()) {
std::transform(mixPort.getFlags().begin(), mixPort.getFlags().end(),
- std::back_inserter(flags),
+ std::back_inserter(validFlags),
[](auto flag) { return toString(flag); });
}
for (const auto& profile : mixPort.getProfile()) {
- auto configs =
- combineAudioConfig(profile.getChannelMasks(),
- profile.getSamplingRates(), profile.getFormat());
- for (const auto& config : configs) {
+ if (!profile.hasFormat() || !profile.hasSamplingRates() ||
+ !profile.hasChannelMasks())
+ continue;
+ AudioConfigBase validBase = {
+ profile.getFormat(),
+ static_cast<uint32_t>(profile.getSamplingRates()[0]),
+ toString(profile.getChannelMasks()[0])};
+ {
+ AudioConfig config{.base = validBase};
+ config.base.channelMask = "random_string";
+ result.emplace_back(device, config, validFlags);
+ }
+ {
+ AudioConfig config{.base = validBase};
+ config.base.format = "random_string";
+ result.emplace_back(device, config, validFlags);
+ }
+ if (generateInvalidFlags) {
+ AudioConfig config{.base = validBase};
+ std::vector<AudioInOutFlag> flags = {"random_string", ""};
result.emplace_back(device, config, flags);
}
+ hasConfig = true;
+ break;
}
+ if (hasConfig) break;
}
}
return result;
}();
return parameters;
}
+
+class InvalidInputConfigNoFlagsTest : public AudioHidlTestWithDeviceConfigParameter {};
+TEST_P(InvalidInputConfigNoFlagsTest, InputBufferSizeTest) {
+ doc::test("Verify that invalid config is rejected by IDevice::getInputBufferSize method.");
+ uint64_t bufferSize;
+ ASSERT_OK(getDevice()->getInputBufferSize(getConfig(), returnIn(res, bufferSize)));
+ EXPECT_EQ(Result::INVALID_ARGUMENTS, res);
+}
+INSTANTIATE_TEST_CASE_P(
+ InputBufferSizeInvalidConfig, InvalidInputConfigNoFlagsTest,
+ ::testing::ValuesIn(getInputDeviceInvalidConfigParameters(false /*generateInvalidFlags*/)),
+ &DeviceConfigParameterToString);
+GTEST_ALLOW_UNINSTANTIATED_PARAMETERIZED_TEST(InvalidInputConfigNoFlagsTest);
+
+static const DeviceAddress& getValidInputDeviceAddress() {
+ static const DeviceAddress valid = {
+ .deviceType = toString(xsd::AudioDevice::AUDIO_DEVICE_IN_DEFAULT)};
+ return valid;
+}
+
+static const DeviceAddress& getValidOutputDeviceAddress() {
+ static const DeviceAddress valid = {
+ .deviceType = toString(xsd::AudioDevice::AUDIO_DEVICE_OUT_DEFAULT)};
+ return valid;
+}
+
+static const DeviceAddress& getInvalidDeviceAddress() {
+ static const DeviceAddress valid = {.deviceType = "random_string"};
+ return valid;
+}
+
+TEST_P(AudioHidlDeviceTest, SetConnectedStateInvalidDeviceAddress) {
+ doc::test("Check that invalid device address is rejected by IDevice::setConnectedState");
+ EXPECT_RESULT(Result::INVALID_ARGUMENTS,
+ getDevice()->setConnectedState(getInvalidDeviceAddress(), true));
+ EXPECT_RESULT(Result::INVALID_ARGUMENTS,
+ getDevice()->setConnectedState(getInvalidDeviceAddress(), false));
+}
+
+static std::vector<AudioPortConfig>& generatePortConfigs(bool valid) {
+ enum { // Note: This is for convenience when deriving "invalid" configs from "valid".
+ PORT_CONF_MINIMAL,
+ PORT_CONF_WITH_GAIN,
+ PORT_CONF_EXT_DEVICE,
+ PORT_CONF_EXT_MIX_SOURCE,
+ PORT_CONF_EXT_MIX_SINK,
+ PORT_CONF_EXT_SESSION
+ };
+ static std::vector<AudioPortConfig> valids = [] {
+ std::vector<AudioPortConfig> result;
+ result.reserve(PORT_CONF_EXT_SESSION + 1);
+ result.push_back(AudioPortConfig{});
+ AudioPortConfig configWithGain{};
+ configWithGain.gain.config(AudioGainConfig{
+ .index = 0,
+ .mode = {toString(xsd::AudioGainMode::AUDIO_GAIN_MODE_JOINT)},
+ .channelMask = toString(xsd::AudioChannelMask::AUDIO_CHANNEL_OUT_MONO),
+ .rampDurationMs = 1});
+ configWithGain.gain.config().values.resize(1);
+ configWithGain.gain.config().values[0] = 1000;
+ result.push_back(std::move(configWithGain));
+ AudioPortConfig configWithPortExtDevice{};
+ configWithPortExtDevice.ext.device(getValidOutputDeviceAddress());
+ result.push_back(std::move(configWithPortExtDevice));
+ AudioPortConfig configWithPortExtMixSource{};
+ configWithPortExtMixSource.ext.mix({});
+ configWithPortExtMixSource.ext.mix().useCase.stream(
+ toString(xsd::AudioStreamType::AUDIO_STREAM_VOICE_CALL));
+ result.push_back(std::move(configWithPortExtMixSource));
+ AudioPortConfig configWithPortExtMixSink{};
+ configWithPortExtMixSink.ext.mix({});
+ configWithPortExtMixSink.ext.mix().useCase.source(
+ toString(xsd::AudioSource::AUDIO_SOURCE_DEFAULT));
+ result.push_back(std::move(configWithPortExtMixSink));
+ AudioPortConfig configWithPortExtSession{};
+ configWithPortExtSession.ext.session(
+ static_cast<AudioSession>(AudioSessionConsts::OUTPUT_MIX));
+ result.push_back(std::move(configWithPortExtSession));
+ return result;
+ }();
+ static std::vector<AudioPortConfig> invalids = [&] {
+ std::vector<AudioPortConfig> result;
+ AudioPortConfig invalidBaseChannelMask = valids[PORT_CONF_MINIMAL];
+ invalidBaseChannelMask.base.channelMask = "random_string";
+ result.push_back(std::move(invalidBaseChannelMask));
+ AudioPortConfig invalidBaseFormat = valids[PORT_CONF_MINIMAL];
+ invalidBaseFormat.base.format = "random_string";
+ result.push_back(std::move(invalidBaseFormat));
+ AudioPortConfig invalidGainMode = valids[PORT_CONF_WITH_GAIN];
+ invalidGainMode.gain.config().mode = {{"random_string"}};
+ result.push_back(std::move(invalidGainMode));
+ AudioPortConfig invalidGainChannelMask = valids[PORT_CONF_WITH_GAIN];
+ invalidGainChannelMask.gain.config().channelMask = "random_string";
+ result.push_back(std::move(invalidGainChannelMask));
+ AudioPortConfig invalidDeviceType = valids[PORT_CONF_EXT_DEVICE];
+ invalidDeviceType.ext.device().deviceType = "random_string";
+ result.push_back(std::move(invalidDeviceType));
+ AudioPortConfig invalidStreamType = valids[PORT_CONF_EXT_MIX_SOURCE];
+ invalidStreamType.ext.mix().useCase.stream() = "random_string";
+ result.push_back(std::move(invalidStreamType));
+ AudioPortConfig invalidSource = valids[PORT_CONF_EXT_MIX_SINK];
+ invalidSource.ext.mix().useCase.source() = "random_string";
+ result.push_back(std::move(invalidSource));
+ return result;
+ }();
+ return valid ? valids : invalids;
+}
+
+TEST_P(AudioHidlDeviceTest, SetAudioPortConfigInvalidArguments) {
+ doc::test("Check that invalid port configs are rejected by IDevice::setAudioPortConfig");
+ for (const auto& invalidConfig : generatePortConfigs(false /*valid*/)) {
+ EXPECT_RESULT(invalidArgsOrNotSupported, getDevice()->setAudioPortConfig(invalidConfig))
+ << ::testing::PrintToString(invalidConfig);
+ }
+}
+
+TEST_P(AudioPatchHidlTest, CreatePatchInvalidArguments) {
+ doc::test("Check that invalid port configs are rejected by IDevice::createAudioPatch");
+ // Note that HAL actually might reject the proposed source / sink combo
+ // due to other reasons than presence of invalid enum-strings.
+ // TODO: Come up with a way to guarantee validity of a source / sink combo.
+ for (const auto& validSource : generatePortConfigs(true /*valid*/)) {
+ for (const auto& invalidSink : generatePortConfigs(false /*valid*/)) {
+ AudioPatchHandle handle;
+ EXPECT_OK(getDevice()->createAudioPatch(hidl_vec<AudioPortConfig>{validSource},
+ hidl_vec<AudioPortConfig>{invalidSink},
+ returnIn(res, handle)));
+ EXPECT_EQ(Result::INVALID_ARGUMENTS, res)
+ << "Source: " << ::testing::PrintToString(validSource)
+ << "; Sink: " << ::testing::PrintToString(invalidSink);
+ }
+ }
+ for (const auto& validSink : generatePortConfigs(true /*valid*/)) {
+ for (const auto& invalidSource : generatePortConfigs(false /*valid*/)) {
+ AudioPatchHandle handle;
+ EXPECT_OK(getDevice()->createAudioPatch(hidl_vec<AudioPortConfig>{invalidSource},
+ hidl_vec<AudioPortConfig>{validSink},
+ returnIn(res, handle)));
+ EXPECT_EQ(Result::INVALID_ARGUMENTS, res)
+ << "Source: " << ::testing::PrintToString(invalidSource)
+ << "; Sink: " << ::testing::PrintToString(validSink);
+ }
+ }
+}
+
+TEST_P(AudioPatchHidlTest, UpdatePatchInvalidArguments) {
+ doc::test("Check that invalid port configs are rejected by IDevice::updateAudioPatch");
+ // Note that HAL actually might reject the proposed source / sink combo
+ // due to other reasons than presence of invalid enum-strings.
+ // TODO: Come up with a way to guarantee validity of a source / sink combo.
+ for (const auto& validSource : generatePortConfigs(true /*valid*/)) {
+ for (const auto& invalidSink : generatePortConfigs(false /*valid*/)) {
+ AudioPatchHandle handle{};
+ EXPECT_OK(getDevice()->updateAudioPatch(handle, hidl_vec<AudioPortConfig>{validSource},
+ hidl_vec<AudioPortConfig>{invalidSink},
+ returnIn(res, handle)));
+ EXPECT_EQ(Result::INVALID_ARGUMENTS, res)
+ << "Source: " << ::testing::PrintToString(validSource)
+ << "; Sink: " << ::testing::PrintToString(invalidSink);
+ }
+ }
+ for (const auto& validSink : generatePortConfigs(true /*valid*/)) {
+ for (const auto& invalidSource : generatePortConfigs(false /*valid*/)) {
+ AudioPatchHandle handle{};
+ EXPECT_OK(getDevice()->updateAudioPatch(
+ handle, hidl_vec<AudioPortConfig>{invalidSource},
+ hidl_vec<AudioPortConfig>{validSink}, returnIn(res, handle)));
+ EXPECT_EQ(Result::INVALID_ARGUMENTS, res)
+ << "Source: " << ::testing::PrintToString(invalidSource)
+ << "; Sink: " << ::testing::PrintToString(validSink);
+ }
+ }
+}
+
+enum { PARAM_DEVICE_CONFIG, PARAM_ADDRESS, PARAM_METADATA };
+enum { INDEX_SINK, INDEX_SOURCE };
+using SinkOrSourceMetadata = std::variant<SinkMetadata, SourceMetadata>;
+using StreamOpenParameter = std::tuple<DeviceConfigParameter, DeviceAddress, SinkOrSourceMetadata>;
+
+static std::string StreamOpenParameterToString(
+ const ::testing::TestParamInfo<StreamOpenParameter>& info) {
+ return DeviceConfigParameterToString(::testing::TestParamInfo<DeviceConfigParameter>{
+ std::get<PARAM_DEVICE_CONFIG>(info.param), info.index}) +
+ "__" +
+ SanitizeStringForGTestName(
+ ::testing::PrintToString(std::get<PARAM_ADDRESS>(info.param))) +
+ "__" +
+ SanitizeStringForGTestName(std::visit(
+ [](auto&& arg) -> std::string { return ::testing::PrintToString(arg); },
+ std::get<PARAM_METADATA>(info.param)));
+}
+
+class StreamOpenTest : public HidlTest, public ::testing::WithParamInterface<StreamOpenParameter> {
+ protected:
+ void SetUp() override {
+ ASSERT_NO_FATAL_FAILURE(HidlTest::SetUp()); // setup base
+ ASSERT_TRUE(getDevicesFactory() != nullptr);
+ ASSERT_TRUE(getDevice() != nullptr);
+ }
+ const std::string& getFactoryName() const override {
+ return std::get<PARAM_FACTORY_NAME>(
+ std::get<PARAM_DEVICE>(std::get<PARAM_DEVICE_CONFIG>(GetParam())));
+ }
+ const std::string& getDeviceName() const override {
+ return std::get<PARAM_DEVICE_NAME>(
+ std::get<PARAM_DEVICE>(std::get<PARAM_DEVICE_CONFIG>(GetParam())));
+ }
+ const AudioConfig& getConfig() const {
+ return std::get<PARAM_CONFIG>(std::get<PARAM_DEVICE_CONFIG>(GetParam()));
+ }
+ const hidl_vec<AudioInOutFlag> getFlags() const {
+ return std::get<PARAM_FLAGS>(std::get<PARAM_DEVICE_CONFIG>(GetParam()));
+ }
+ const DeviceAddress& getDeviceAddress() const { return std::get<PARAM_ADDRESS>(GetParam()); }
+ bool isParamForInputStream() const {
+ return std::get<PARAM_METADATA>(GetParam()).index() == INDEX_SINK;
+ }
+ const SinkMetadata& getSinkMetadata() const {
+ return std::get<INDEX_SINK>(std::get<PARAM_METADATA>(GetParam()));
+ }
+ const SourceMetadata& getSourceMetadata() const {
+ return std::get<INDEX_SOURCE>(std::get<PARAM_METADATA>(GetParam()));
+ }
+};
+
+static const RecordTrackMetadata& getValidRecordTrackMetadata() {
+ static const RecordTrackMetadata valid = {
+ .source = toString(xsd::AudioSource::AUDIO_SOURCE_DEFAULT), .gain = 1};
+ return valid;
+}
+
+static const RecordTrackMetadata& getValidRecordTrackMetadataWithDest() {
+ static const RecordTrackMetadata valid = {
+ .source = toString(xsd::AudioSource::AUDIO_SOURCE_DEFAULT),
+ .gain = 1,
+ .destination = [] {
+ RecordTrackMetadata::Destination dest;
+ dest.device(getValidOutputDeviceAddress());
+ return dest;
+ }()};
+ return valid;
+}
+
+static const RecordTrackMetadata& getInvalidSourceRecordTrackMetadata() {
+ static const RecordTrackMetadata invalid = {.source = "random_string", .gain = 1};
+ return invalid;
+}
+
+static const RecordTrackMetadata& getRecordTrackMetadataWithInvalidDest() {
+ static const RecordTrackMetadata invalid = {
+ .source = toString(xsd::AudioSource::AUDIO_SOURCE_DEFAULT),
+ .gain = 1,
+ .destination = [] {
+ RecordTrackMetadata::Destination dest;
+ dest.device(getInvalidDeviceAddress());
+ return dest;
+ }()};
+ return invalid;
+}
+
+static const RecordTrackMetadata& getInvalidChannelMaskRecordTrackMetadata() {
+ static const RecordTrackMetadata invalid = {
+ .source = toString(xsd::AudioSource::AUDIO_SOURCE_DEFAULT),
+ .gain = 1,
+ .channelMask = "random_string"};
+ return invalid;
+}
+
+static const RecordTrackMetadata& getInvalidTagsRecordTrackMetadata() {
+ static const RecordTrackMetadata invalid = {
+ .source = toString(xsd::AudioSource::AUDIO_SOURCE_DEFAULT),
+ .gain = 1,
+ .tags = {{"random_string"}}};
+ return invalid;
+}
+
+static const PlaybackTrackMetadata& getValidPlaybackTrackMetadata() {
+ static const PlaybackTrackMetadata valid = {
+ .usage = toString(xsd::AudioUsage::AUDIO_USAGE_MEDIA),
+ .contentType = toString(xsd::AudioContentType::AUDIO_CONTENT_TYPE_MUSIC),
+ .gain = 1};
+ return valid;
+}
+
+static const PlaybackTrackMetadata& getInvalidUsagePlaybackTrackMetadata() {
+ static const PlaybackTrackMetadata invalid = {
+ .usage = "random_string",
+ .contentType = toString(xsd::AudioContentType::AUDIO_CONTENT_TYPE_MUSIC),
+ .gain = 1};
+ return invalid;
+}
+
+static const PlaybackTrackMetadata& getInvalidContentTypePlaybackTrackMetadata() {
+ static const PlaybackTrackMetadata invalid = {
+ .usage = toString(xsd::AudioUsage::AUDIO_USAGE_MEDIA),
+ .contentType = "random_string",
+ .gain = 1};
+ return invalid;
+}
+
+static const PlaybackTrackMetadata& getInvalidChannelMaskPlaybackTrackMetadata() {
+ static const PlaybackTrackMetadata invalid = {
+ .usage = toString(xsd::AudioUsage::AUDIO_USAGE_MEDIA),
+ .contentType = toString(xsd::AudioContentType::AUDIO_CONTENT_TYPE_MUSIC),
+ .gain = 1,
+ .channelMask = "random_string"};
+ return invalid;
+}
+
+static const PlaybackTrackMetadata& getInvalidTagsPlaybackTrackMetadata() {
+ static const PlaybackTrackMetadata invalid = {
+ .usage = toString(xsd::AudioUsage::AUDIO_USAGE_MEDIA),
+ .contentType = toString(xsd::AudioContentType::AUDIO_CONTENT_TYPE_MUSIC),
+ .gain = 1,
+ .tags = {{"random_string"}}};
+ return invalid;
+}
+
+static const std::vector<SourceMetadata>& getInvalidSourceMetadatas() {
+ static const std::vector<SourceMetadata> invalids = {
+ SourceMetadata{.tracks = {{getInvalidUsagePlaybackTrackMetadata()}}},
+ SourceMetadata{.tracks = {{getInvalidContentTypePlaybackTrackMetadata()}}},
+ SourceMetadata{.tracks = {{getInvalidChannelMaskPlaybackTrackMetadata()}}},
+ SourceMetadata{.tracks = {{getInvalidTagsPlaybackTrackMetadata()}}},
+ SourceMetadata{.tracks = {{getValidPlaybackTrackMetadata(),
+ getInvalidUsagePlaybackTrackMetadata()}}},
+ SourceMetadata{.tracks = {{getValidPlaybackTrackMetadata(),
+ getInvalidContentTypePlaybackTrackMetadata()}}},
+ SourceMetadata{.tracks = {{getValidPlaybackTrackMetadata(),
+ getInvalidChannelMaskPlaybackTrackMetadata()}}},
+ SourceMetadata{.tracks = {{getValidPlaybackTrackMetadata(),
+ getInvalidTagsPlaybackTrackMetadata()}}}};
+ return invalids;
+}
+static const std::vector<SinkMetadata>& getInvalidSinkMetadatas() {
+ static const std::vector<SinkMetadata> invalids = {
+ SinkMetadata{.tracks = {{getInvalidSourceRecordTrackMetadata()}}},
+ SinkMetadata{.tracks = {{getRecordTrackMetadataWithInvalidDest()}}},
+ SinkMetadata{.tracks = {{getInvalidChannelMaskRecordTrackMetadata()}}},
+ SinkMetadata{.tracks = {{getInvalidTagsRecordTrackMetadata()}}},
+ SinkMetadata{.tracks = {{getValidRecordTrackMetadata(),
+ getInvalidSourceRecordTrackMetadata()}}},
+ SinkMetadata{.tracks = {{getValidRecordTrackMetadata(),
+ getRecordTrackMetadataWithInvalidDest()}}},
+ SinkMetadata{.tracks = {{getValidRecordTrackMetadata(),
+ getInvalidChannelMaskRecordTrackMetadata()}}},
+ SinkMetadata{.tracks = {{getValidRecordTrackMetadata(),
+ getInvalidTagsRecordTrackMetadata()}}}};
+ return invalids;
+}
+template <typename T>
+static inline std::vector<SinkOrSourceMetadata> wrapMetadata(const std::vector<T>& metadata) {
+ return std::vector<SinkOrSourceMetadata>{metadata.begin(), metadata.end()};
+}
+
+TEST_P(StreamOpenTest, OpenInputOrOutputStreamTest) {
+ doc::test(
+ "Verify that invalid arguments are rejected by "
+ "IDevice::open{Input|Output}Stream method.");
+ AudioConfig suggestedConfig{};
+ if (isParamForInputStream()) {
+ sp<IStreamIn> stream;
+ ASSERT_OK(getDevice()->openInputStream(AudioIoHandle{}, getDeviceAddress(), getConfig(),
+ getFlags(), getSinkMetadata(),
+ returnIn(res, stream, suggestedConfig)));
+ ASSERT_TRUE(stream == nullptr);
+ } else {
+ sp<IStreamOut> stream;
+ ASSERT_OK(getDevice()->openOutputStream(AudioIoHandle{}, getDeviceAddress(), getConfig(),
+ getFlags(), getSourceMetadata(),
+ returnIn(res, stream, suggestedConfig)));
+ ASSERT_TRUE(stream == nullptr);
+ }
+ EXPECT_EQ(Result::INVALID_ARGUMENTS, res);
+ EXPECT_EQ(AudioConfig{}, suggestedConfig);
+}
+INSTANTIATE_TEST_CASE_P(
+ InputStreamInvalidConfig, StreamOpenTest,
+ ::testing::Combine(::testing::ValuesIn(getInputDeviceInvalidConfigParameters()),
+ ::testing::Values(getValidInputDeviceAddress()),
+ ::testing::Values(SinkMetadata{
+ .tracks = {{getValidRecordTrackMetadata(),
+ getValidRecordTrackMetadataWithDest()}}})),
+ &StreamOpenParameterToString);
+INSTANTIATE_TEST_CASE_P(
+ InputStreamInvalidAddress, StreamOpenTest,
+ ::testing::Combine(::testing::ValuesIn(getInputDeviceSingleConfigParameters()),
+ ::testing::Values(getInvalidDeviceAddress()),
+ ::testing::Values(SinkMetadata{
+ .tracks = {{getValidRecordTrackMetadata(),
+ getValidRecordTrackMetadataWithDest()}}})),
+ &StreamOpenParameterToString);
+INSTANTIATE_TEST_CASE_P(
+ InputStreamInvalidMetadata, StreamOpenTest,
+ ::testing::Combine(::testing::ValuesIn(getInputDeviceSingleConfigParameters()),
+ ::testing::Values(getValidInputDeviceAddress()),
+ ::testing::ValuesIn(wrapMetadata(getInvalidSinkMetadatas()))),
+ &StreamOpenParameterToString);
+GTEST_ALLOW_UNINSTANTIATED_PARAMETERIZED_TEST(StreamOpenTest);
+
+INSTANTIATE_TEST_CASE_P(
+ OutputStreamInvalidConfig, StreamOpenTest,
+ ::testing::Combine(::testing::ValuesIn(getOutputDeviceInvalidConfigParameters()),
+ ::testing::Values(getValidOutputDeviceAddress()),
+ ::testing::Values(SourceMetadata{
+ .tracks = {{getValidPlaybackTrackMetadata()}}})),
+ &StreamOpenParameterToString);
+INSTANTIATE_TEST_CASE_P(
+ OutputStreamInvalidAddress, StreamOpenTest,
+ ::testing::Combine(::testing::ValuesIn(getOutputDeviceSingleConfigParameters()),
+ ::testing::Values(getInvalidDeviceAddress()),
+ ::testing::Values(SourceMetadata{
+ .tracks = {{getValidPlaybackTrackMetadata()}}})),
+ &StreamOpenParameterToString);
+INSTANTIATE_TEST_CASE_P(
+ OutputStreamInvalidMetadata, StreamOpenTest,
+ ::testing::Combine(::testing::ValuesIn(getOutputDeviceSingleConfigParameters()),
+ ::testing::Values(getValidOutputDeviceAddress()),
+ ::testing::ValuesIn(wrapMetadata(getInvalidSourceMetadatas()))),
+ &StreamOpenParameterToString);
+
+#define TEST_SINGLE_CONFIG_IO_STREAM(test_name, documentation, code) \
+ TEST_P(SingleConfigInputStreamTest, test_name) { \
+ doc::test(documentation); \
+ code; \
+ } \
+ TEST_P(SingleConfigOutputStreamTest, test_name) { \
+ doc::test(documentation); \
+ code; \
+ }
+
+static void testSetDevicesInvalidDeviceAddress(IStream* stream) {
+ ASSERT_RESULT(Result::INVALID_ARGUMENTS, stream->setDevices({getInvalidDeviceAddress()}));
+}
+TEST_SINGLE_CONFIG_IO_STREAM(
+ SetDevicesInvalidDeviceAddress,
+ "Verify that invalid device address is rejected by IStream::setDevices",
+ areAudioPatchesSupported() ? doc::partialTest("Audio patches are supported")
+ : testSetDevicesInvalidDeviceAddress(stream.get()));
+
+static void testSetAudioPropertiesInvalidArguments(IStream* stream, const AudioConfigBase& base) {
+ AudioConfigBase invalidFormat = base;
+ invalidFormat.format = "random_string";
+ ASSERT_RESULT(invalidArgsOrNotSupported, stream->setAudioProperties(invalidFormat));
+
+ AudioConfigBase invalidChannelMask = base;
+ invalidChannelMask.channelMask = "random_string";
+ ASSERT_RESULT(invalidArgsOrNotSupported, stream->setAudioProperties(invalidChannelMask));
+}
+TEST_SINGLE_CONFIG_IO_STREAM(
+ SetAudioPropertiesInvalidArguments,
+ "Verify that invalid arguments are rejected by IStream::setAudioProperties",
+ testSetAudioPropertiesInvalidArguments(stream.get(), audioConfig.base));
+
+TEST_P(SingleConfigOutputStreamTest, UpdateInvalidSourceMetadata) {
+ doc::test("Verify that invalid metadata is rejected by IStreamOut::updateSourceMetadata");
+ for (const auto& metadata : getInvalidSourceMetadatas()) {
+ ASSERT_RESULT(invalidArgsOrNotSupported, stream->updateSourceMetadata(metadata))
+ << ::testing::PrintToString(metadata);
+ }
+}
+
+TEST_P(SingleConfigInputStreamTest, UpdateInvalidSinkMetadata) {
+ doc::test("Verify that invalid metadata is rejected by IStreamIn::updateSinkMetadata");
+ for (const auto& metadata : getInvalidSinkMetadatas()) {
+ ASSERT_RESULT(invalidArgsOrNotSupported, stream->updateSinkMetadata(metadata))
+ << ::testing::PrintToString(metadata);
+ }
+}
diff --git a/audio/core/all-versions/vts/functional/AudioPrimaryHidlHalTest.h b/audio/core/all-versions/vts/functional/AudioPrimaryHidlHalTest.h
index 43c44cb..f145b60 100644
--- a/audio/core/all-versions/vts/functional/AudioPrimaryHidlHalTest.h
+++ b/audio/core/all-versions/vts/functional/AudioPrimaryHidlHalTest.h
@@ -522,7 +522,9 @@
#if MAJOR_VERSION >= 6
const std::vector<DeviceConfigParameter>& getInputDeviceConfigParameters();
+const std::vector<DeviceConfigParameter>& getInputDeviceSingleConfigParameters();
const std::vector<DeviceConfigParameter>& getOutputDeviceConfigParameters();
+const std::vector<DeviceConfigParameter>& getOutputDeviceSingleConfigParameters();
#endif
#if MAJOR_VERSION >= 4
@@ -883,7 +885,7 @@
AudioHidlTestWithDeviceConfigParameter::TearDown();
}
- protected:
+ protected:
AudioConfig audioConfig;
DeviceAddress address = {};
sp<Stream> stream;
@@ -926,6 +928,8 @@
const SourceMetadata initMetadata = {
{ { toString(xsd::AudioUsage::AUDIO_USAGE_MEDIA),
toString(xsd::AudioContentType::AUDIO_CONTENT_TYPE_MUSIC),
+ {},
+ toString(xsd::AudioChannelMask::AUDIO_CHANNEL_OUT_STEREO),
1 /* gain */ } }};
#endif
};
@@ -971,7 +975,7 @@
ASSERT_NO_FATAL_FAILURE(OpenStreamTest::SetUp()); // setup base
#if MAJOR_VERSION <= 6
address.device = AudioDevice::IN_DEFAULT;
-#elif MAJOR_VERSION <= 7
+#elif MAJOR_VERSION >= 7
address.deviceType = toString(xsd::AudioDevice::AUDIO_DEVICE_IN_DEFAULT);
#endif
const AudioConfig& config = getConfig();
@@ -986,12 +990,15 @@
protected:
#if MAJOR_VERSION == 2
- const AudioSource initMetadata = AudioSource::DEFAULT;
+ const AudioSource initMetadata = AudioSource::DEFAULT;
#elif MAJOR_VERSION >= 4 && MAJOR_VERSION <= 6
const SinkMetadata initMetadata = {{ {.source = AudioSource::DEFAULT, .gain = 1 } }};
#elif MAJOR_VERSION >= 7
const SinkMetadata initMetadata = {
- {{.source = toString(xsd::AudioSource::AUDIO_SOURCE_DEFAULT), .gain = 1}}};
+ {{.source = toString(xsd::AudioSource::AUDIO_SOURCE_DEFAULT),
+ .gain = 1,
+ .tags = {},
+ .channelMask = toString(xsd::AudioChannelMask::AUDIO_CHANNEL_IN_MONO)}}};
#endif
};
diff --git a/audio/effect/all-versions/vts/functional/VtsHalAudioEffectTargetTest.cpp b/audio/effect/all-versions/vts/functional/VtsHalAudioEffectTargetTest.cpp
index d39fbcd..35ff869 100644
--- a/audio/effect/all-versions/vts/functional/VtsHalAudioEffectTargetTest.cpp
+++ b/audio/effect/all-versions/vts/functional/VtsHalAudioEffectTargetTest.cpp
@@ -14,6 +14,8 @@
* limitations under the License.
*/
+#include <vector>
+
#define LOG_TAG "AudioEffectHidlHalTest"
#include <android-base/logging.h>
#if MAJOR_VERSION <= 6
@@ -309,6 +311,47 @@
EXPECT_EQ(Result::OK, ret2);
}
+#if MAJOR_VERSION >= 7
+std::vector<EffectBufferConfig> generateInvalidConfigs(const EffectBufferConfig& src) {
+ std::vector<EffectBufferConfig> result;
+ EffectBufferConfig invalidFormat = src;
+ invalidFormat.base.format = "random_string";
+ result.push_back(std::move(invalidFormat));
+ EffectBufferConfig invalidChannelMask = src;
+ invalidChannelMask.base.channelMask = "random_string";
+ result.push_back(std::move(invalidChannelMask));
+ return result;
+}
+
+TEST_P(AudioEffectHidlTest, SetConfigInvalidArguments) {
+ description("Verify that invalid arguments are rejected by SetConfig");
+ Result retval = Result::NOT_INITIALIZED;
+ EffectConfig currentConfig;
+ Return<void> ret = effect->getConfig([&](Result r, const EffectConfig& conf) {
+ retval = r;
+ if (r == Result::OK) {
+ currentConfig = conf;
+ }
+ });
+ EXPECT_TRUE(ret.isOk());
+ EXPECT_EQ(Result::OK, retval);
+ for (const auto& invalidInputCfg : generateInvalidConfigs(currentConfig.inputCfg)) {
+ EffectConfig invalidConfig = currentConfig;
+ invalidConfig.inputCfg = invalidInputCfg;
+ Return<Result> ret = effect->setConfig(invalidConfig, nullptr, nullptr);
+ EXPECT_TRUE(ret.isOk());
+ EXPECT_EQ(Result::INVALID_ARGUMENTS, ret);
+ }
+ for (const auto& invalidOutputCfg : generateInvalidConfigs(currentConfig.outputCfg)) {
+ EffectConfig invalidConfig = currentConfig;
+ invalidConfig.outputCfg = invalidOutputCfg;
+ Return<Result> ret = effect->setConfig(invalidConfig, nullptr, nullptr);
+ EXPECT_TRUE(ret.isOk());
+ EXPECT_EQ(Result::INVALID_ARGUMENTS, ret);
+ }
+}
+#endif
+
TEST_P(AudioEffectHidlTest, GetConfigReverse) {
description("Verify that GetConfigReverse does not crash");
Return<void> ret = effect->getConfigReverse([&](Result, const EffectConfig&) {});
@@ -413,6 +456,16 @@
EXPECT_EQ(Result::OK, ret);
}
+#if MAJOR_VERSION >= 7
+TEST_P(AudioEffectHidlTest, SetDeviceInvalidDeviceAddress) {
+ description("Verify that invalid device address is rejected by SetDevice");
+ DeviceAddress device{.deviceType = "random_string"};
+ Return<Result> ret = effect->setDevice(device);
+ EXPECT_TRUE(ret.isOk());
+ EXPECT_EQ(Result::INVALID_ARGUMENTS, ret);
+}
+#endif
+
TEST_P(AudioEffectHidlTest, SetDevice) {
description("Verify that SetDevice works for an output chain effect");
#if MAJOR_VERSION <= 6
@@ -468,6 +521,17 @@
EXPECT_TRUE(ret.isOk());
}
+#if MAJOR_VERSION >= 7
+TEST_P(AudioEffectHidlTest, SetInputDeviceInvalidDeviceAddress) {
+ description("Verify that invalid device address is rejected by SetInputDevice");
+ DeviceAddress device{.deviceType = "random_string"};
+ Return<Result> ret = effect->setInputDevice(device);
+ EXPECT_TRUE(ret.isOk());
+ EXPECT_TRUE(ret == Result::INVALID_ARGUMENTS || ret == Result::NOT_SUPPORTED)
+ << ::testing::PrintToString(ret);
+}
+#endif
+
TEST_P(AudioEffectHidlTest, SetInputDevice) {
description("Verify that SetInputDevice does not crash");
#if MAJOR_VERSION <= 6
@@ -479,6 +543,16 @@
EXPECT_TRUE(ret.isOk());
}
+#if MAJOR_VERSION >= 7
+TEST_P(AudioEffectHidlTest, SetInvalidAudioSource) {
+ description("Verify that an invalid audio source is rejected by SetAudioSource");
+ Return<Result> ret = effect->setAudioSource("random_string");
+ ASSERT_TRUE(ret.isOk());
+ EXPECT_TRUE(ret == Result::INVALID_ARGUMENTS || ret == Result::NOT_SUPPORTED)
+ << ::testing::PrintToString(ret);
+}
+#endif
+
TEST_P(AudioEffectHidlTest, SetAudioSource) {
description("Verify that SetAudioSource does not crash");
#if MAJOR_VERSION <= 6
diff --git a/authsecret/aidl/Android.bp b/authsecret/aidl/Android.bp
new file mode 100644
index 0000000..0a05034
--- /dev/null
+++ b/authsecret/aidl/Android.bp
@@ -0,0 +1,16 @@
+aidl_interface {
+ name: "android.hardware.authsecret",
+ vendor_available: true,
+ srcs: ["android/hardware/authsecret/*.aidl"],
+ stability: "vintf",
+ backend: {
+ java: {
+ platform_apis: true,
+ },
+ ndk: {
+ vndk: {
+ enabled: true,
+ },
+ },
+ },
+}
diff --git a/authsecret/aidl/aidl_api/android.hardware.authsecret/current/android/hardware/authsecret/IAuthSecret.aidl b/authsecret/aidl/aidl_api/android.hardware.authsecret/current/android/hardware/authsecret/IAuthSecret.aidl
new file mode 100644
index 0000000..14e8325
--- /dev/null
+++ b/authsecret/aidl/aidl_api/android.hardware.authsecret/current/android/hardware/authsecret/IAuthSecret.aidl
@@ -0,0 +1,23 @@
+///////////////////////////////////////////////////////////////////////////////
+// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
+///////////////////////////////////////////////////////////////////////////////
+
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
+//
+// You must not make a backward incompatible change to any AIDL file built
+// with the aidl_interface module type with versions property set. The module
+// type is used to build AIDL files in a way that they can be used across
+// independently updatable components of the system. If a device is shipped
+// with such a backward incompatible change, it has a high risk of breaking
+// later when a module using the interface is updated, e.g., Mainline modules.
+
+package android.hardware.authsecret;
+@VintfStability
+interface IAuthSecret {
+ oneway void setPrimaryUserCredential(in byte[] secret);
+}
diff --git a/authsecret/aidl/android/hardware/authsecret/IAuthSecret.aidl b/authsecret/aidl/android/hardware/authsecret/IAuthSecret.aidl
new file mode 100644
index 0000000..3849ec0
--- /dev/null
+++ b/authsecret/aidl/android/hardware/authsecret/IAuthSecret.aidl
@@ -0,0 +1,47 @@
+/*
+ * Copyright 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.hardware.authsecret;
+
+/**
+ * This security HAL allows vendor components to be cryptographically tied to
+ * the primary user's credential. For example, security hardware can require
+ * proof that the credential is known before applying updates.
+ *
+ */
+@VintfStability
+interface IAuthSecret {
+ /**
+ * When the primary user is unlocked, this method is passed a secret to
+ * prove that is has been successfully unlocked. The primary user can either
+ * be unlocked by a person entering their credential or by another party
+ * using an escrow token e.g. a device administrator.
+ *
+ * The first time this is called, the secret must be used to provision state
+ * that depends on the primary user's secret. The same secret must be passed
+ * on each call until the next factory reset.
+ *
+ * Upon factory reset, any dependence on the secret must be removed as that
+ * secret is now lost and must never be derived again. A new secret must be
+ * created for the new primary user which must be used to newly provision
+ * state the first time this method is called after factory reset.
+ *
+ * The secret must be at least 16 bytes, or the secret must be dropped.
+ *
+ * @param secret blob derived from the primary user's credential.
+ */
+ oneway void setPrimaryUserCredential(in byte[] secret);
+}
diff --git a/authsecret/aidl/default/Android.bp b/authsecret/aidl/default/Android.bp
new file mode 100644
index 0000000..d598344
--- /dev/null
+++ b/authsecret/aidl/default/Android.bp
@@ -0,0 +1,32 @@
+//
+// Copyright (C) 2020 The Android Open Source Project
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+//
+
+cc_binary {
+ name: "android.hardware.authsecret-service.example",
+ relative_install_path: "hw",
+ init_rc: ["android.hardware.authsecret-service.example.rc"],
+ vintf_fragments: ["android.hardware.authsecret-service.example.xml"],
+ vendor: true,
+ srcs: [
+ "service.cpp",
+ "AuthSecret.cpp",
+ ],
+ shared_libs: [
+ "android.hardware.authsecret-ndk_platform",
+ "libbase",
+ "libbinder_ndk",
+ ],
+}
diff --git a/authsecret/aidl/default/AuthSecret.cpp b/authsecret/aidl/default/AuthSecret.cpp
new file mode 100644
index 0000000..9645e4d
--- /dev/null
+++ b/authsecret/aidl/default/AuthSecret.cpp
@@ -0,0 +1,33 @@
+/*
+ * Copyright (C) 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "AuthSecret.h"
+
+namespace aidl {
+namespace android {
+namespace hardware {
+namespace authsecret {
+
+// Methods from ::android::hardware::authsecret::IAuthSecret follow.
+::ndk::ScopedAStatus AuthSecret::setPrimaryUserCredential(const std::vector<uint8_t>& in_secret) {
+ (void)in_secret;
+ return ::ndk::ScopedAStatus::ok();
+}
+
+} // namespace authsecret
+} // namespace hardware
+} // namespace android
+} // aidl
diff --git a/authsecret/aidl/default/AuthSecret.h b/authsecret/aidl/default/AuthSecret.h
new file mode 100644
index 0000000..b40fc48
--- /dev/null
+++ b/authsecret/aidl/default/AuthSecret.h
@@ -0,0 +1,37 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#pragma once
+
+#include <aidl/android/hardware/authsecret/BnAuthSecret.h>
+
+namespace aidl {
+namespace android {
+namespace hardware {
+namespace authsecret {
+
+struct AuthSecret : public BnAuthSecret {
+ AuthSecret() = default;
+
+ // Methods from ::android::hardware::authsecret::IAuthSecret follow.
+ ::ndk::ScopedAStatus setPrimaryUserCredential(const std::vector<uint8_t>& in_secret) override;
+
+};
+
+} // namespace authsecret
+} // namespace hardware
+} // namespace android
+} // aidl
diff --git a/authsecret/aidl/default/android.hardware.authsecret-service.example.rc b/authsecret/aidl/default/android.hardware.authsecret-service.example.rc
new file mode 100644
index 0000000..fef6e24
--- /dev/null
+++ b/authsecret/aidl/default/android.hardware.authsecret-service.example.rc
@@ -0,0 +1,4 @@
+service vendor.authsecret_default /vendor/bin/hw/android.hardware.authsecret-service.example
+ class hal
+ user hsm
+ group hsm
diff --git a/authsecret/aidl/default/android.hardware.authsecret-service.example.xml b/authsecret/aidl/default/android.hardware.authsecret-service.example.xml
new file mode 100644
index 0000000..9d4e162
--- /dev/null
+++ b/authsecret/aidl/default/android.hardware.authsecret-service.example.xml
@@ -0,0 +1,10 @@
+<manifest version="1.0" type="device">
+ <hal format="aidl">
+ <name>android.hardware.authsecret</name>
+ <version>1</version>
+ <interface>
+ <name>IAuthSecret</name>
+ <instance>default</instance>
+ </interface>
+ </hal>
+</manifest>
diff --git a/authsecret/aidl/default/service.cpp b/authsecret/aidl/default/service.cpp
new file mode 100644
index 0000000..efecf10
--- /dev/null
+++ b/authsecret/aidl/default/service.cpp
@@ -0,0 +1,35 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <android-base/logging.h>
+#include <android/binder_manager.h>
+#include <android/binder_process.h>
+
+#include "AuthSecret.h"
+
+using ::aidl::android::hardware::authsecret::AuthSecret;
+
+int main() {
+ ABinderProcess_setThreadPoolMaxThreadCount(0);
+ std::shared_ptr<AuthSecret> authsecret = ndk::SharedRefBase::make<AuthSecret>();
+
+ const std::string instance = std::string() + AuthSecret::descriptor + "/default";
+ binder_status_t status = AServiceManager_addService(authsecret->asBinder().get(), instance.c_str());
+ CHECK(status == STATUS_OK);
+
+ ABinderProcess_joinThreadPool();
+ return -1; // Should never be reached
+}
diff --git a/authsecret/aidl/vts/Android.bp b/authsecret/aidl/vts/Android.bp
new file mode 100644
index 0000000..83a85b2
--- /dev/null
+++ b/authsecret/aidl/vts/Android.bp
@@ -0,0 +1,31 @@
+//
+// Copyright (C) 2018 The Android Open Source Project
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+//
+
+cc_test {
+ name: "VtsHalAuthSecretTargetTest",
+ defaults: [
+ "VtsHalTargetTestDefaults",
+ "use_libaidlvintf_gtest_helper_static",
+ ],
+ srcs: ["VtsHalAuthSecretTargetTest.cpp"],
+ static_libs: ["android.hardware.authsecret-ndk_platform"],
+ shared_libs: ["libbinder_ndk"],
+ test_suites: [
+ "general-tests",
+ "vts",
+ ],
+ require_root: true,
+}
diff --git a/authsecret/aidl/vts/OWNERS b/authsecret/aidl/vts/OWNERS
new file mode 100644
index 0000000..40d95e4
--- /dev/null
+++ b/authsecret/aidl/vts/OWNERS
@@ -0,0 +1,2 @@
+chengyouho@google.com
+frankwoo@google.com
diff --git a/authsecret/aidl/vts/VtsHalAuthSecretTargetTest.cpp b/authsecret/aidl/vts/VtsHalAuthSecretTargetTest.cpp
new file mode 100644
index 0000000..31c2834
--- /dev/null
+++ b/authsecret/aidl/vts/VtsHalAuthSecretTargetTest.cpp
@@ -0,0 +1,96 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include <aidl/Gtest.h>
+#include <aidl/Vintf.h>
+
+#include <aidl/android/hardware/authsecret/IAuthSecret.h>
+#include <android/binder_manager.h>
+#include <android/binder_process.h>
+
+using ::aidl::android::hardware::authsecret::IAuthSecret;
+
+using ::ndk::SpAIBinder;
+
+/**
+ * There is no expected behaviour that can be tested so these tests check the
+ * HAL doesn't crash with different execution orders.
+ */
+class AuthSecretAidlTest : public testing::TestWithParam<std::string> {
+ public:
+ virtual void SetUp() override {
+ authsecret = IAuthSecret::fromBinder(
+ SpAIBinder(AServiceManager_waitForService(GetParam().c_str())));
+ ASSERT_NE(authsecret, nullptr);
+
+ // Notify LSS to generate PIN code '1234' and corresponding secret.
+ (void)system("cmd lock_settings set-pin 1234");
+
+ // All tests must enroll the correct secret first as this cannot be changed
+ // without a factory reset and the order of tests could change.
+ authsecret->setPrimaryUserCredential(CORRECT_SECRET);
+ }
+
+ static void TearDownTestSuite() {
+ // clean up PIN code after testing
+ (void)system("cmd lock_settings clear --old 1234");
+ }
+
+ std::shared_ptr<IAuthSecret> authsecret;
+ std::vector<uint8_t> CORRECT_SECRET{61, 93, 124, 240, 5, 0, 7, 201, 9, 129, 11, 12, 0, 14, 0, 16};
+ std::vector<uint8_t> WRONG_SECRET{1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16};
+};
+
+/* Provision the primary user with a secret. */
+TEST_P(AuthSecretAidlTest, provisionPrimaryUserCredential) {
+ // Secret provisioned by SetUp()
+}
+
+/* Provision the primary user with a secret and pass the secret again. */
+TEST_P(AuthSecretAidlTest, provisionPrimaryUserCredentialAndPassAgain) {
+ // Secret provisioned by SetUp()
+ authsecret->setPrimaryUserCredential(CORRECT_SECRET);
+}
+
+/* Provision the primary user with a secret and pass the secret again repeatedly. */
+TEST_P(AuthSecretAidlTest, provisionPrimaryUserCredentialAndPassAgainMultipleTimes) {
+ // Secret provisioned by SetUp()
+ constexpr int N = 5;
+ for (int i = 0; i < N; ++i) {
+ authsecret->setPrimaryUserCredential(CORRECT_SECRET);
+ }
+}
+
+/* Provision the primary user with a secret and then pass the wrong secret. This
+ * should never happen and is an framework bug if it does. As the secret is
+ * wrong, the HAL implementation may not be able to function correctly but it
+ * should fail gracefully. */
+TEST_P(AuthSecretAidlTest, provisionPrimaryUserCredentialAndWrongSecret) {
+ // Secret provisioned by SetUp()
+ authsecret->setPrimaryUserCredential(WRONG_SECRET);
+}
+
+GTEST_ALLOW_UNINSTANTIATED_PARAMETERIZED_TEST(AuthSecretAidlTest);
+INSTANTIATE_TEST_SUITE_P(
+ PerInstance, AuthSecretAidlTest,
+ testing::ValuesIn(android::getAidlHalInstanceNames(IAuthSecret::descriptor)),
+ android::PrintInstanceNameToString);
+
+int main(int argc, char** argv) {
+ ::testing::InitGoogleTest(&argc, argv);
+ ABinderProcess_setThreadPoolMaxThreadCount(1);
+ ABinderProcess_startThreadPool();
+ return RUN_ALL_TESTS();
+}
diff --git a/bluetooth/1.0/default/test/bluetooth_address_test.cc b/bluetooth/1.0/default/test/bluetooth_address_test.cc
index ee52d33..422d6a3 100644
--- a/bluetooth/1.0/default/test/bluetooth_address_test.cc
+++ b/bluetooth/1.0/default/test/bluetooth_address_test.cc
@@ -14,7 +14,6 @@
// limitations under the License.
//
-#include <cutils/properties.h>
#include <errno.h>
#include <fcntl.h>
#include <gtest/gtest.h>
@@ -39,12 +38,6 @@
"00:00:00:00:00:00";
constexpr uint8_t kZeros_bytes[BluetoothAddress::kBytes] = {0x00, 0x00, 0x00,
0x00, 0x00, 0x00};
-constexpr char kTestAddrBad1[BluetoothAddress::kStringLength + 1] =
- "bb:aa:dd:00:00:01";
-constexpr uint8_t kTestAddrBad1_bytes[BluetoothAddress::kBytes] = {
- 0xbb, 0xaa, 0xdd, 0x00, 0x00, 0x01};
-
-constexpr char kAddrPath[] = "/tmp/my_address_in_a_file.txt";
class BluetoothAddressTest : public ::testing::Test {
public:
@@ -120,45 +113,6 @@
EXPECT_FALSE(memcmp(addrA, addrB, BluetoothAddress::kStringLength) == 0);
}
-TEST_F(BluetoothAddressTest, get_local_address) {
- EXPECT_TRUE(property_set(PERSIST_BDADDR_PROPERTY, "") == 0);
- EXPECT_TRUE(property_set(FACTORY_BDADDR_PROPERTY, "") == 0);
- uint8_t address[BluetoothAddress::kBytes];
-
- // File contains a non-zero Address.
- FileWriteString(kAddrPath, kTestAddr1);
- EXPECT_TRUE(property_set(PROPERTY_BT_BDADDR_PATH, kAddrPath) == 0);
- EXPECT_TRUE(BluetoothAddress::get_local_address(address));
- EXPECT_TRUE(memcmp(address, kTestAddr1_bytes, BluetoothAddress::kBytes) == 0);
-
- // File contains a zero address. A random address will be generated.
- FileWriteString(kAddrPath, kZeros);
- EXPECT_TRUE(property_set(PROPERTY_BT_BDADDR_PATH, kAddrPath) == 0);
- EXPECT_TRUE(property_set(PERSIST_BDADDR_PROPERTY, kTestAddrBad1) == 0);
- EXPECT_TRUE(BluetoothAddress::get_local_address(address));
- EXPECT_TRUE(memcmp(address, kZeros_bytes, BluetoothAddress::kBytes) != 0);
- char prop[PROP_VALUE_MAX] = "Before reading";
- EXPECT_TRUE(property_get(PERSIST_BDADDR_PROPERTY, prop, NULL) ==
- BluetoothAddress::kStringLength);
- char address_str[BluetoothAddress::kStringLength + 1];
- BluetoothAddress::bytes_to_string(address, address_str);
- EXPECT_TRUE(memcmp(address_str, prop, BluetoothAddress::kStringLength) == 0);
-
- // Factory property contains an address.
- EXPECT_TRUE(property_set(PERSIST_BDADDR_PROPERTY, kTestAddrBad1) == 0);
- EXPECT_TRUE(property_set(FACTORY_BDADDR_PROPERTY, kTestAddr1) == 0);
- EXPECT_TRUE(BluetoothAddress::get_local_address(address));
- EXPECT_TRUE(memcmp(address, kTestAddr1_bytes, BluetoothAddress::kBytes) == 0);
-
- // Persistent property contains an address.
- memcpy(address, kTestAddrBad1_bytes, BluetoothAddress::kBytes);
- EXPECT_TRUE(property_set(PERSIST_BDADDR_PROPERTY, kTestAddr1) == 0);
- EXPECT_TRUE(property_set(FACTORY_BDADDR_PROPERTY, "") == 0);
- EXPECT_TRUE(property_set(PROPERTY_BT_BDADDR_PATH, "") == 0);
- EXPECT_TRUE(BluetoothAddress::get_local_address(address));
- EXPECT_TRUE(memcmp(address, kTestAddr1_bytes, BluetoothAddress::kBytes) == 0);
-}
-
} // namespace implementation
} // namespace V1_0
} // namespace bluetooth
diff --git a/bluetooth/audio/2.1/default/LeAudioAudioProvider.cpp b/bluetooth/audio/2.1/default/LeAudioAudioProvider.cpp
index 1fa2dce..9c2b4fe 100644
--- a/bluetooth/audio/2.1/default/LeAudioAudioProvider.cpp
+++ b/bluetooth/audio/2.1/default/LeAudioAudioProvider.cpp
@@ -91,35 +91,30 @@
uint32_t kDataMqSize = 0;
switch (audioConfig.pcmConfig().sampleRate) {
+ case SampleRate::RATE_8000:
+ kDataMqSize = 8000;
+ break;
case SampleRate::RATE_16000:
kDataMqSize = 16000;
break;
case SampleRate::RATE_24000:
kDataMqSize = 24000;
break;
+ case SampleRate::RATE_32000:
+ kDataMqSize = 32000;
+ break;
case SampleRate::RATE_44100:
kDataMqSize = 44100;
break;
case SampleRate::RATE_48000:
kDataMqSize = 48000;
break;
- case SampleRate::RATE_88200:
- kDataMqSize = 88200;
- break;
- case SampleRate::RATE_96000:
- kDataMqSize = 96000;
- break;
- case SampleRate::RATE_176400:
- kDataMqSize = 176400;
- break;
- case SampleRate::RATE_192000:
- kDataMqSize = 192000;
- break;
default:
- /* This should never happen it would be caught while validating
- * parameters.
- */
- break;
+ LOG(WARNING) << __func__ << " - Unsupported sampling frequency="
+ << toString(audioConfig.pcmConfig());
+ _hidl_cb(BluetoothAudioStatus::UNSUPPORTED_CODEC_CONFIGURATION,
+ DataMQ::Descriptor());
+ return Void();
}
/* Number of samples per millisecond */
diff --git a/bluetooth/audio/2.1/default/session/BluetoothAudioSupportedCodecsDB.cpp b/bluetooth/audio/2.1/default/session/BluetoothAudioSupportedCodecsDB.cpp
index d15db49..0937f44 100644
--- a/bluetooth/audio/2.1/default/session/BluetoothAudioSupportedCodecsDB.cpp
+++ b/bluetooth/audio/2.1/default/session/BluetoothAudioSupportedCodecsDB.cpp
@@ -409,12 +409,14 @@
}
bool IsSoftwarePcmConfigurationValid_2_1(const PcmParameters& pcm_config) {
- if ((pcm_config.sampleRate != SampleRate::RATE_44100 &&
- pcm_config.sampleRate != SampleRate::RATE_48000 &&
+ if ((pcm_config.sampleRate != SampleRate::RATE_96000 &&
pcm_config.sampleRate != SampleRate::RATE_88200 &&
- pcm_config.sampleRate != SampleRate::RATE_96000 &&
+ pcm_config.sampleRate != SampleRate::RATE_48000 &&
+ pcm_config.sampleRate != SampleRate::RATE_44100 &&
+ pcm_config.sampleRate != SampleRate::RATE_32000 &&
+ pcm_config.sampleRate != SampleRate::RATE_24000 &&
pcm_config.sampleRate != SampleRate::RATE_16000 &&
- pcm_config.sampleRate != SampleRate::RATE_24000) ||
+ pcm_config.sampleRate != SampleRate::RATE_8000) ||
(pcm_config.bitsPerSample != BitsPerSample::BITS_16 &&
pcm_config.bitsPerSample != BitsPerSample::BITS_24 &&
pcm_config.bitsPerSample != BitsPerSample::BITS_32) ||
diff --git a/bluetooth/audio/2.1/vts/functional/VtsHalBluetoothAudioV2_1TargetTest.cpp b/bluetooth/audio/2.1/vts/functional/VtsHalBluetoothAudioV2_1TargetTest.cpp
index 37d1281..95903d1 100644
--- a/bluetooth/audio/2.1/vts/functional/VtsHalBluetoothAudioV2_1TargetTest.cpp
+++ b/bluetooth/audio/2.1/vts/functional/VtsHalBluetoothAudioV2_1TargetTest.cpp
@@ -1005,8 +1005,10 @@
BluetoothAudioProvidersFactoryHidlTest::TearDown();
}
- static constexpr SampleRate le_audio_output_sample_rates_[3] = {
- SampleRate::RATE_UNKNOWN, SampleRate::RATE_16000, SampleRate::RATE_24000};
+ static constexpr SampleRate le_audio_output_sample_rates_[11] = {
+ SampleRate::RATE_UNKNOWN, SampleRate::RATE_8000, SampleRate::RATE_16000,
+ SampleRate::RATE_24000, SampleRate::RATE_32000, SampleRate::RATE_44100,
+ SampleRate::RATE_48000};
static constexpr BitsPerSample le_audio_output_bits_per_samples_[3] = {
BitsPerSample::BITS_UNKNOWN, BitsPerSample::BITS_16,
BitsPerSample::BITS_24};
@@ -1097,8 +1099,10 @@
BluetoothAudioProvidersFactoryHidlTest::TearDown();
}
- static constexpr SampleRate le_audio_output_sample_rates_[3] = {
- SampleRate::RATE_UNKNOWN, SampleRate::RATE_16000, SampleRate::RATE_24000};
+ static constexpr SampleRate le_audio_output_sample_rates_[11] = {
+ SampleRate::RATE_UNKNOWN, SampleRate::RATE_8000, SampleRate::RATE_16000,
+ SampleRate::RATE_24000, SampleRate::RATE_32000, SampleRate::RATE_44100,
+ SampleRate::RATE_48000};
static constexpr BitsPerSample le_audio_output_bits_per_samples_[3] = {
BitsPerSample::BITS_UNKNOWN, BitsPerSample::BITS_16,
BitsPerSample::BITS_24};
diff --git a/broadcastradio/2.0/vts/functional/VtsHalBroadcastradioV2_0TargetTest.cpp b/broadcastradio/2.0/vts/functional/VtsHalBroadcastradioV2_0TargetTest.cpp
index ca57243..ce50f25 100644
--- a/broadcastradio/2.0/vts/functional/VtsHalBroadcastradioV2_0TargetTest.cpp
+++ b/broadcastradio/2.0/vts/functional/VtsHalBroadcastradioV2_0TargetTest.cpp
@@ -415,7 +415,7 @@
TEST_P(BroadcastRadioHalTest, FmTune) {
ASSERT_TRUE(openSession());
- uint64_t freq = 100100; // 100.1 FM
+ uint64_t freq = 90900; // 90.9 FM
auto sel = make_selector_amfm(freq);
/* TODO(b/69958777): there is a race condition between tune() and onCurrentProgramInfoChanged
diff --git a/common/fmq/aidl/Android.bp b/common/fmq/aidl/Android.bp
index 004adab..9389712 100644
--- a/common/fmq/aidl/Android.bp
+++ b/common/fmq/aidl/Android.bp
@@ -9,6 +9,9 @@
srcs: [
"android/hardware/common/fmq/*.aidl",
],
+ imports: [
+ "android.hardware.common",
+ ],
stability: "vintf",
backend: {
java: {
diff --git a/common/fmq/aidl/aidl_api/android.hardware.common.fmq/current/android/hardware/common/fmq/GrantorDescriptor.aidl b/common/fmq/aidl/aidl_api/android.hardware.common.fmq/current/android/hardware/common/fmq/GrantorDescriptor.aidl
index 7ac1930..0327796 100644
--- a/common/fmq/aidl/aidl_api/android.hardware.common.fmq/current/android/hardware/common/fmq/GrantorDescriptor.aidl
+++ b/common/fmq/aidl/aidl_api/android.hardware.common.fmq/current/android/hardware/common/fmq/GrantorDescriptor.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
@@ -18,6 +19,7 @@
package android.hardware.common.fmq;
@VintfStability
parcelable GrantorDescriptor {
+ int fdIndex;
int offset;
long extent;
}
diff --git a/common/fmq/aidl/aidl_api/android.hardware.common.fmq/current/android/hardware/common/fmq/MQDescriptor.aidl b/common/fmq/aidl/aidl_api/android.hardware.common.fmq/current/android/hardware/common/fmq/MQDescriptor.aidl
index 2607369..56f1de3 100644
--- a/common/fmq/aidl/aidl_api/android.hardware.common.fmq/current/android/hardware/common/fmq/MQDescriptor.aidl
+++ b/common/fmq/aidl/aidl_api/android.hardware.common.fmq/current/android/hardware/common/fmq/MQDescriptor.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
@@ -19,7 +20,7 @@
@VintfStability
parcelable MQDescriptor {
android.hardware.common.fmq.GrantorDescriptor[] grantors;
- ParcelFileDescriptor fileDescriptor;
+ android.hardware.common.NativeHandle handle;
int quantum;
int flags;
}
diff --git a/common/fmq/aidl/aidl_api/android.hardware.common.fmq/current/android/hardware/common/fmq/SynchronizedReadWrite.aidl b/common/fmq/aidl/aidl_api/android.hardware.common.fmq/current/android/hardware/common/fmq/SynchronizedReadWrite.aidl
index 2142bdb..264171d 100644
--- a/common/fmq/aidl/aidl_api/android.hardware.common.fmq/current/android/hardware/common/fmq/SynchronizedReadWrite.aidl
+++ b/common/fmq/aidl/aidl_api/android.hardware.common.fmq/current/android/hardware/common/fmq/SynchronizedReadWrite.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/common/fmq/aidl/aidl_api/android.hardware.common.fmq/current/android/hardware/common/fmq/UnsynchronizedWrite.aidl b/common/fmq/aidl/aidl_api/android.hardware.common.fmq/current/android/hardware/common/fmq/UnsynchronizedWrite.aidl
index 1220674..eaf2ffd 100644
--- a/common/fmq/aidl/aidl_api/android.hardware.common.fmq/current/android/hardware/common/fmq/UnsynchronizedWrite.aidl
+++ b/common/fmq/aidl/aidl_api/android.hardware.common.fmq/current/android/hardware/common/fmq/UnsynchronizedWrite.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/common/fmq/aidl/android/hardware/common/fmq/GrantorDescriptor.aidl b/common/fmq/aidl/android/hardware/common/fmq/GrantorDescriptor.aidl
index ca69d94..672415e 100644
--- a/common/fmq/aidl/android/hardware/common/fmq/GrantorDescriptor.aidl
+++ b/common/fmq/aidl/android/hardware/common/fmq/GrantorDescriptor.aidl
@@ -22,6 +22,10 @@
@VintfStability
parcelable GrantorDescriptor {
/*
+ * Index of file descriptor for this grantor
+ */
+ int fdIndex;
+ /*
* The offset of this descriptor in the shared memory in bytes.
*/
int offset;
diff --git a/common/fmq/aidl/android/hardware/common/fmq/MQDescriptor.aidl b/common/fmq/aidl/android/hardware/common/fmq/MQDescriptor.aidl
index 82917d6..46622f0 100644
--- a/common/fmq/aidl/android/hardware/common/fmq/MQDescriptor.aidl
+++ b/common/fmq/aidl/android/hardware/common/fmq/MQDescriptor.aidl
@@ -16,6 +16,7 @@
package android.hardware.common.fmq;
+import android.hardware.common.NativeHandle;
import android.hardware.common.fmq.GrantorDescriptor;
/*
@@ -34,8 +35,11 @@
* for blocking operations in the shared memory.
*/
GrantorDescriptor[] grantors;
- /* File descriptor for shared memory used in the message queue */
- ParcelFileDescriptor fileDescriptor;
+ /*
+ * NativeHandle that contains the file descriptors for shared memory used
+ * in the message queue
+ */
+ NativeHandle handle;
/* Size of each item, T, in bytes */
int quantum;
/* EventFlag word for blocking operations */
diff --git a/compatibility_matrices/compatibility_matrix.current.xml b/compatibility_matrices/compatibility_matrix.current.xml
index a994b23..66417c2 100644
--- a/compatibility_matrices/compatibility_matrix.current.xml
+++ b/compatibility_matrices/compatibility_matrix.current.xml
@@ -27,6 +27,14 @@
<instance>default</instance>
</interface>
</hal>
+ <hal format="aidl" optional="true">
+ <name>android.hardware.authsecret</name>
+ <version>1</version>
+ <interface>
+ <name>IAuthSecret</name>
+ <instance>default</instance>
+ </interface>
+ </hal>
<hal format="hidl" optional="true">
<name>android.hardware.authsecret</name>
<version>1.0</version>
@@ -250,9 +258,9 @@
<instance>default</instance>
</interface>
</hal>
- <hal format="hidl" optional="true">
+ <hal format="aidl" optional="true">
<name>android.hardware.health.storage</name>
- <version>1.0</version>
+ <version>1</version>
<interface>
<name>IStorage</name>
<instance>default</instance>
@@ -260,11 +268,20 @@
</hal>
<hal format="aidl" optional="true">
<name>android.hardware.identity</name>
+ <version>1-3</version>
<interface>
<name>IIdentityCredentialStore</name>
<instance>default</instance>
</interface>
</hal>
+ <hal format="aidl" optional="true">
+ <name>android.hardware.oemlock</name>
+ <version>1</version>
+ <interface>
+ <name>IOemLock</name>
+ <instance>default</instance>
+ </interface>
+ </hal>
<hal format="hidl" optional="true">
<name>android.hardware.ir</name>
<version>1.0</version>
@@ -418,6 +435,14 @@
</interface>
</hal>
<hal format="hidl" optional="true">
+ <name>android.hardware.radio.config</name>
+ <version>1.3</version>
+ <interface>
+ <name>IRadioConfig</name>
+ <instance>default</instance>
+ </interface>
+ </hal>
+ <hal format="hidl" optional="true">
<name>android.hardware.renderscript</name>
<version>1.0</version>
<interface>
@@ -441,6 +466,20 @@
<regex-instance>SIM[1-9][0-9]*</regex-instance>
</interface>
</hal>
+ <hal format="aidl" optional="true">
+ <name>android.hardware.security.secureclock</name>
+ <interface>
+ <name>ISecureClock</name>
+ <instance>default</instance>
+ </interface>
+ </hal>
+ <hal format="aidl" optional="true">
+ <name>android.hardware.security.sharedsecret</name>
+ <interface>
+ <name>ISharedSecret</name>
+ <instance>default</instance>
+ </interface>
+ </hal>
<hal format="hidl" optional="true">
<name>android.hardware.sensors</name>
<version>1.0</version>
@@ -531,16 +570,16 @@
</interface>
</hal>
<hal format="hidl" optional="true">
- <name>android.hardware.vr</name>
+ <name>android.hardware.weaver</name>
<version>1.0</version>
<interface>
- <name>IVr</name>
+ <name>IWeaver</name>
<instance>default</instance>
</interface>
</hal>
- <hal format="hidl" optional="true">
+ <hal format="aidl" optional="true">
<name>android.hardware.weaver</name>
- <version>1.0</version>
+ <version>1</version>
<interface>
<name>IWeaver</name>
<instance>default</instance>
diff --git a/health/1.0/Android.bp b/health/1.0/Android.bp
index 7845871..7786c08 100644
--- a/health/1.0/Android.bp
+++ b/health/1.0/Android.bp
@@ -5,7 +5,6 @@
root: "android.hardware",
srcs: [
"types.hal",
- "IHealth.hal",
],
interfaces: [
"android.hidl.base@1.0",
diff --git a/health/1.0/IHealth.hal b/health/1.0/IHealth.hal
deleted file mode 100644
index 3828589..0000000
--- a/health/1.0/IHealth.hal
+++ /dev/null
@@ -1,56 +0,0 @@
-/*
- * Copyright (C) 2016 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-package android.hardware.health@1.0;
-
-interface IHealth {
- /**
- * This function lets you change healthd configuration from default if
- * desired. It must be called exactly once at startup time.
- *
- * The configuration values are described in 'struct HealthConfig'.
- * To use default configuration, simply return without modifying the
- * fields of the config parameter.
- *
- * @param default healthd configuration.
- */
- init(HealthConfig config) generates (HealthConfig configOut);
-
- /**
- * This function is a hook to update/change device's HealthInfo (as described
- * in 'struct HealthInfo').
- *
- * 'HealthInfo' describes device's battery and charging status, typically
- * read from kernel. These values may be modified in this call.
- *
- * @param Device Health info as described in 'struct HealthInfo'.
- * @return skipLogging Indication to the caller to add 'or' skip logging the health
- * information. Return 'true' to skip logging the update.
- * @return infoOut HealthInfo to be sent to client code. (May or may
- * not be modified).
- */
- update(HealthInfo info) generates (bool skipLogging, HealthInfo infoOut);
-
- /**
- * This function is called by healthd when framework queries for remaining
- * energy in the Battery through BatteryManager APIs.
- *
- * @return result Result of querying enery counter for the battery.
- * @return energy Battery remaining energy in nanowatt-hours.
- * Must be '0' if result is anything other than Result::SUCCESS.
- */
- energyCounter() generates (Result result, int64_t energy);
-};
diff --git a/health/1.0/default/Android.bp b/health/1.0/default/Android.bp
index aab9cc7..ff4b875 100644
--- a/health/1.0/default/Android.bp
+++ b/health/1.0/default/Android.bp
@@ -17,62 +17,3 @@
],
}
-
-cc_library_static {
- name: "android.hardware.health@1.0-impl-helper",
- vendor: true,
- srcs: ["Health.cpp"],
-
- header_libs: [
- "libbase_headers",
- "libhealthd_headers",
- ],
-
- shared_libs: [
- "libcutils",
- "libhidlbase",
- "liblog",
- "libutils",
- "android.hardware.health@1.0",
- ],
-
- static_libs: [
- "android.hardware.health@1.0-convert",
- ],
-}
-
-cc_library_shared {
- name: "android.hardware.health@1.0-impl",
- vendor: true,
- relative_install_path: "hw",
-
- static_libs: [
- "android.hardware.health@1.0-impl-helper",
- "android.hardware.health@1.0-convert",
- "libhealthd.default",
- ],
-
- shared_libs: [
- "libhidlbase",
- "libutils",
- "android.hardware.health@1.0",
- ],
-}
-
-cc_binary {
- name: "android.hardware.health@1.0-service",
- vendor: true,
- relative_install_path: "hw",
- init_rc: ["android.hardware.health@1.0-service.rc"],
- srcs: ["HealthService.cpp"],
-
- shared_libs: [
- "liblog",
- "libcutils",
- "libdl",
- "libbase",
- "libutils",
- "libhidlbase",
- "android.hardware.health@1.0",
- ],
-}
diff --git a/health/1.0/default/Health.cpp b/health/1.0/default/Health.cpp
deleted file mode 100644
index 1a02956..0000000
--- a/health/1.0/default/Health.cpp
+++ /dev/null
@@ -1,93 +0,0 @@
-/*
- * Copyright (C) 2016 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#define LOG_TAG "health-hal"
-
-#include <Health.h>
-#include <include/hal_conversion.h>
-
-namespace android {
-namespace hardware {
-namespace health {
-namespace V1_0 {
-namespace implementation {
-
-using ::android::hardware::health::V1_0::hal_conversion::convertToHealthConfig;
-using ::android::hardware::health::V1_0::hal_conversion::convertFromHealthConfig;
-using ::android::hardware::health::V1_0::hal_conversion::convertToHealthInfo;
-using ::android::hardware::health::V1_0::hal_conversion::convertFromHealthInfo;
-
-// Methods from ::android::hardware::health::V1_0::IHealth follow.
-Return<void> Health::init(const HealthConfig& config, init_cb _hidl_cb) {
- struct healthd_config healthd_config = {};
- HealthConfig configOut;
-
- // To keep working with existing healthd static HALs,
- // convert the new HealthConfig to the old healthd_config
- // and back.
-
- convertFromHealthConfig(config, &healthd_config);
- healthd_board_init(&healthd_config);
- mGetEnergyCounter = healthd_config.energyCounter;
- convertToHealthConfig(&healthd_config, configOut);
-
- _hidl_cb(configOut);
-
- return Void();
-}
-
-Return<void> Health::update(const HealthInfo& info, update_cb _hidl_cb) {
- struct android::BatteryProperties p = {};
- HealthInfo infoOut;
-
- // To keep working with existing healthd static HALs,
- // convert the new HealthInfo to android::Batteryproperties
- // and back.
-
- convertFromHealthInfo(info, &p);
- int skipLogging = healthd_board_battery_update(&p);
- convertToHealthInfo(&p, infoOut);
-
- _hidl_cb(!!skipLogging, infoOut);
-
- return Void();
-}
-
-Return<void> Health::energyCounter(energyCounter_cb _hidl_cb) {
- int64_t energy = 0;
- Result result = Result::NOT_SUPPORTED;
-
- if (mGetEnergyCounter) {
- int status = mGetEnergyCounter(&energy);
- if (status == 0) {
- result = Result::SUCCESS;
- }
- }
-
- _hidl_cb(result, energy);
-
- return Void();
-}
-
-IHealth* HIDL_FETCH_IHealth(const char* /* name */) {
- return new Health();
-}
-
-} // namespace implementation
-} // namespace V1_0
-} // namespace health
-} // namespace hardware
-} // namespace android
diff --git a/health/1.0/default/Health.h b/health/1.0/default/Health.h
deleted file mode 100644
index ed364c1..0000000
--- a/health/1.0/default/Health.h
+++ /dev/null
@@ -1,57 +0,0 @@
-/*
- * Copyright (C) 2016 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-#ifndef ANDROID_HARDWARE_HEALTH_V1_0_HEALTH_H
-#define ANDROID_HARDWARE_HEALTH_V1_0_HEALTH_H
-
-#include <android/hardware/health/1.0/IHealth.h>
-#include <hidl/Status.h>
-#include <hidl/MQDescriptor.h>
-#include <healthd/healthd.h>
-#include <utils/String8.h>
-
-namespace android {
-namespace hardware {
-namespace health {
-namespace V1_0 {
-namespace implementation {
-
-using ::android::hardware::health::V1_0::HealthInfo;
-using ::android::hardware::health::V1_0::HealthConfig;
-using ::android::hardware::health::V1_0::IHealth;
-using ::android::hardware::Return;
-using ::android::hardware::Void;
-using ::android::hardware::hidl_vec;
-using ::android::hardware::hidl_string;
-using ::android::sp;
-
-struct Health : public IHealth {
- // Methods from ::android::hardware::health::V1_0::IHealth follow.
- Return<void> init(const HealthConfig& config, init_cb _hidl_cb) override;
- Return<void> update(const HealthInfo& info, update_cb _hidl_cb) override;
- Return<void> energyCounter(energyCounter_cb _hidl_cb) override;
-private:
- std::function<int(int64_t *)> mGetEnergyCounter;
-};
-
-extern "C" IHealth* HIDL_FETCH_IHealth(const char* name);
-
-} // namespace implementation
-} // namespace V1_0
-} // namespace health
-} // namespace hardware
-} // namespace android
-
-#endif // ANDROID_HARDWARE_HEALTH_V1_0_HEALTH_H
diff --git a/health/1.0/default/HealthService.cpp b/health/1.0/default/HealthService.cpp
deleted file mode 100644
index 55848d2..0000000
--- a/health/1.0/default/HealthService.cpp
+++ /dev/null
@@ -1,27 +0,0 @@
-/*
- * Copyright 2016 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#define LOG_TAG "android.hardware.health@1.0-service"
-
-#include <android/hardware/health/1.0/IHealth.h>
-#include <hidl/LegacySupport.h>
-
-using android::hardware::health::V1_0::IHealth;
-using android::hardware::defaultPassthroughServiceImplementation;
-
-int main() {
- return defaultPassthroughServiceImplementation<IHealth>();
-}
diff --git a/health/1.0/default/README.md b/health/1.0/default/README.md
deleted file mode 100644
index 1ded7de..0000000
--- a/health/1.0/default/README.md
+++ /dev/null
@@ -1,66 +0,0 @@
-# Implement the 2.1 HAL instead!
-
-It is strongly recommended that you implement the 2.1 HAL directly. See
-`hardware/interfaces/health/2.1/README.md` for more details.
-
-# Implement Health 1.0 HAL
-
-1. Install common binderized service. The binderized service `dlopen()`s
- passthrough implementations on the device, so there is no need to write
- your own.
-
- ```mk
- # Install default binderized implementation to vendor.
- PRODUCT_PACKAGES += android.hardware.health@1.0-service
- ```
-
-1. Add proper VINTF manifest entry to your device manifest. Example:
-
- ```xml
- <hal format="hidl">
- <name>android.hardware.health</name>
- <transport>hwbinder</transport>
- <version>1.0</version>
- <interface>
- <name>IHealth</name>
- <instance>default</instance>
- </interface>
- </hal>
- ```
-
-1. Install the proper passthrough implemetation.
-
- 1. If you want to use the default implementation (with default `libhealthd`),
- add the following to `device.mk`:
-
- ```mk
- PRODUCT_PACKAGES += \
- android.hardware.health@1.0-impl
- ```
-
- 1. Otherwise, if you have a customized `libhealthd.<board>`:
-
- 1. Define your passthrough implementation. Example (replace `<device>`
- and `<board>` accordingly):
-
- ```bp
- cc_library_shared {
- name: "android.hardware.health@1.0-impl-<device>",
- vendor: true,
- relative_install_path: "hw",
-
- static_libs: [
- "android.hardware.health@1.0-impl-helper",
- "android.hardware.health@1.0-convert",
- "libhealthd.<board>",
- ],
- }
- ```
-
- 1. Add to `device.mk`.
-
- ```
- PRODUCT_PACKAGES += android.hardware.health@1.0-impl-<device>
- ```
-
- 1. Define appropriate SELinux permissions.
diff --git a/health/1.0/default/android.hardware.health@1.0-service.rc b/health/1.0/default/android.hardware.health@1.0-service.rc
deleted file mode 100644
index 569dc88..0000000
--- a/health/1.0/default/android.hardware.health@1.0-service.rc
+++ /dev/null
@@ -1,5 +0,0 @@
-service vendor.health-hal-1-0 /vendor/bin/hw/android.hardware.health@1.0-service
- class hal
- user system
- group system
- capabilities WAKE_ALARM BLOCK_SUSPEND
diff --git a/health/1.0/default/include/hal_conversion.h b/health/1.0/default/include/hal_conversion.h
index a92b208..a8ddb73 100644
--- a/health/1.0/default/include/hal_conversion.h
+++ b/health/1.0/default/include/hal_conversion.h
@@ -17,7 +17,7 @@
#ifndef HARDWARE_INTERFACES_HEALTH_V1_0_DEFAULT_INCLUDE_HAL_CONVERSION_H_
#define HARDWARE_INTERFACES_HEALTH_V1_0_DEFAULT_INCLUDE_HAL_CONVERSION_H_
-#include <android/hardware/health/1.0/IHealth.h>
+#include <android/hardware/health/1.0/types.h>
#include <healthd/healthd.h>
namespace android {
diff --git a/health/1.0/default/libhealthd/Android.bp b/health/1.0/default/libhealthd/Android.bp
deleted file mode 100644
index 43463eb..0000000
--- a/health/1.0/default/libhealthd/Android.bp
+++ /dev/null
@@ -1,11 +0,0 @@
-// Copyright 2016 The Android Open Source Project
-
-cc_library_static {
- srcs: ["healthd_board_default.cpp"],
- name: "libhealthd.default",
- vendor_available: true,
- recovery_available: true,
- cflags: ["-Werror"],
- include_dirs: ["system/libbase/include"],
- header_libs: ["libhealthd_headers"],
-}
diff --git a/health/1.0/vts/functional/Android.bp b/health/1.0/vts/functional/Android.bp
deleted file mode 100644
index f4a04a7..0000000
--- a/health/1.0/vts/functional/Android.bp
+++ /dev/null
@@ -1,23 +0,0 @@
-//
-// Copyright (C) 2017 The Android Open Source Project
-//
-// Licensed under the Apache License, Version 2.0 (the "License");
-// you may not use this file except in compliance with the License.
-// You may obtain a copy of the License at
-//
-// http://www.apache.org/licenses/LICENSE-2.0
-//
-// Unless required by applicable law or agreed to in writing, software
-// distributed under the License is distributed on an "AS IS" BASIS,
-// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-// See the License for the specific language governing permissions and
-// limitations under the License.
-//
-
-cc_test {
- name: "VtsHalHealthV1_0TargetTest",
- defaults: ["VtsHalTargetTestDefaults"],
- srcs: ["VtsHalHealthV1_0TargetTest.cpp"],
- static_libs: ["android.hardware.health@1.0"],
- test_suites: ["general-tests", "vts"],
-}
diff --git a/health/1.0/vts/functional/VtsHalHealthV1_0TargetTest.cpp b/health/1.0/vts/functional/VtsHalHealthV1_0TargetTest.cpp
deleted file mode 100644
index 8b3dcc1..0000000
--- a/health/1.0/vts/functional/VtsHalHealthV1_0TargetTest.cpp
+++ /dev/null
@@ -1,65 +0,0 @@
-/*
- * Copyright (C) 2017 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#define LOG_TAG "health_hidl_hal_test"
-
-#include <android/hardware/health/1.0/IHealth.h>
-#include <android/hardware/health/1.0/types.h>
-#include <gtest/gtest.h>
-#include <hidl/GtestPrinter.h>
-#include <hidl/ServiceManagement.h>
-#include <log/log.h>
-
-using HealthConfig = ::android::hardware::health::V1_0::HealthConfig;
-using HealthInfo = ::android::hardware::health::V1_0::HealthInfo;
-using IHealth = ::android::hardware::health::V1_0::IHealth;
-using Result = ::android::hardware::health::V1_0::Result;
-
-using ::android::sp;
-
-class HealthHidlTest : public ::testing::TestWithParam<std::string> {
- public:
- virtual void SetUp() override {
- health = IHealth::getService(GetParam());
- ASSERT_NE(health, nullptr);
- health->init(config,
- [&](const auto& halConfigOut) { config = halConfigOut; });
- }
-
- sp<IHealth> health;
- HealthConfig config;
-};
-
-/**
- * Ensure EnergyCounter call returns positive energy counter or NOT_SUPPORTED
- */
-TEST_P(HealthHidlTest, TestEnergyCounter) {
- Result result;
- int64_t energy = 0;
- health->energyCounter([&](Result ret, int64_t energyOut) {
- result = ret;
- energy = energyOut;
- });
-
- ASSERT_TRUE(result == Result::SUCCESS || result == Result::NOT_SUPPORTED);
- ASSERT_TRUE(result != Result::SUCCESS || energy > 0);
-}
-
-GTEST_ALLOW_UNINSTANTIATED_PARAMETERIZED_TEST(HealthHidlTest);
-INSTANTIATE_TEST_SUITE_P(
- PerInstance, HealthHidlTest,
- testing::ValuesIn(android::hardware::getAllHalInstanceNames(IHealth::descriptor)),
- android::hardware::PrintInstanceNameToString);
diff --git a/health/storage/1.0/default/Android.bp b/health/storage/1.0/default/Android.bp
index 3156dfe..3834244 100644
--- a/health/storage/1.0/default/Android.bp
+++ b/health/storage/1.0/default/Android.bp
@@ -38,6 +38,7 @@
],
static_libs: [
+ "libhealth_storage_impl_common",
"libfstab",
],
diff --git a/health/storage/1.0/default/Storage.cpp b/health/storage/1.0/default/Storage.cpp
index 561deaa..02b6a3d 100644
--- a/health/storage/1.0/default/Storage.cpp
+++ b/health/storage/1.0/default/Storage.cpp
@@ -18,11 +18,8 @@
#include <sstream>
-#include <android-base/chrono_utils.h>
-#include <android-base/file.h>
#include <android-base/logging.h>
-#include <android-base/strings.h>
-#include <fstab/fstab.h>
+#include <health-storage-impl/common.h>
namespace android {
namespace hardware {
@@ -31,69 +28,9 @@
namespace V1_0 {
namespace implementation {
-using base::ReadFileToString;
-using base::Timer;
-using base::Trim;
-using base::WriteStringToFd;
-using base::WriteStringToFile;
-using fs_mgr::Fstab;
-using fs_mgr::ReadDefaultFstab;
-
-std::string getGarbageCollectPath() {
- Fstab fstab;
- ReadDefaultFstab(&fstab);
-
- for (const auto& entry : fstab) {
- if (!entry.sysfs_path.empty()) {
- return entry.sysfs_path + "/manual_gc";
- }
- }
-
- return "";
-}
-
Return<void> Storage::garbageCollect(uint64_t timeoutSeconds,
const sp<IGarbageCollectCallback>& cb) {
- Result result = Result::SUCCESS;
- std::string path = getGarbageCollectPath();
-
- if (path.empty()) {
- LOG(WARNING) << "Cannot find Dev GC path";
- result = Result::UNKNOWN_ERROR;
- } else {
- Timer timer;
- LOG(INFO) << "Start Dev GC on " << path;
- while (1) {
- std::string require;
- if (!ReadFileToString(path, &require)) {
- PLOG(WARNING) << "Reading manual_gc failed in " << path;
- result = Result::IO_ERROR;
- break;
- }
- require = Trim(require);
- if (require == "" || require == "off" || require == "disabled") {
- LOG(DEBUG) << "No more to do Dev GC";
- break;
- }
- LOG(DEBUG) << "Trigger Dev GC on " << path;
- if (!WriteStringToFile("1", path)) {
- PLOG(WARNING) << "Start Dev GC failed on " << path;
- result = Result::IO_ERROR;
- break;
- }
- if (timer.duration() >= std::chrono::seconds(timeoutSeconds)) {
- LOG(WARNING) << "Dev GC timeout";
- // Timeout is not treated as an error. Try next time.
- break;
- }
- sleep(2);
- }
- LOG(INFO) << "Stop Dev GC on " << path;
- if (!WriteStringToFile("0", path)) {
- PLOG(WARNING) << "Stop Dev GC failed on " << path;
- result = Result::IO_ERROR;
- }
- }
+ Result result = GarbageCollect(timeoutSeconds);
if (cb != nullptr) {
auto ret = cb->onFinish(result);
@@ -110,28 +47,7 @@
}
int fd = handle->data[0];
- std::stringstream output;
-
- std::string path = getGarbageCollectPath();
- if (path.empty()) {
- output << "Cannot find Dev GC path";
- } else {
- std::string require;
-
- if (ReadFileToString(path, &require)) {
- output << path << ":" << require << std::endl;
- }
-
- if (WriteStringToFile("0", path)) {
- output << "stop success" << std::endl;
- }
- }
-
- if (!WriteStringToFd(output.str(), fd)) {
- PLOG(WARNING) << "debug: cannot write to fd";
- }
-
- fsync(fd);
+ DebugDump(fd);
return Void();
}
diff --git a/health/storage/1.0/vts/functional/Android.bp b/health/storage/1.0/vts/functional/Android.bp
index 2201031..731ad62 100644
--- a/health/storage/1.0/vts/functional/Android.bp
+++ b/health/storage/1.0/vts/functional/Android.bp
@@ -19,6 +19,9 @@
defaults: ["VtsHalTargetTestDefaults"],
srcs: ["VtsHalHealthStorageV1_0TargetTest.cpp"],
static_libs: ["android.hardware.health.storage@1.0"],
+ header_libs: [
+ "libhealth_storage_test_common_headers",
+ ],
shared_libs: [
"libhidlbase",
],
diff --git a/health/storage/1.0/vts/functional/VtsHalHealthStorageV1_0TargetTest.cpp b/health/storage/1.0/vts/functional/VtsHalHealthStorageV1_0TargetTest.cpp
index 24ddc5d..ddb6b5a 100644
--- a/health/storage/1.0/vts/functional/VtsHalHealthStorageV1_0TargetTest.cpp
+++ b/health/storage/1.0/vts/functional/VtsHalHealthStorageV1_0TargetTest.cpp
@@ -14,14 +14,17 @@
* limitations under the License.
*/
+#include <unistd.h>
+
+#include <thread>
+
#include <android-base/logging.h>
#include <android/hardware/health/storage/1.0/IStorage.h>
#include <gtest/gtest.h>
+#include <health-storage-test/common.h>
#include <hidl/GtestPrinter.h>
#include <hidl/HidlTransportSupport.h>
#include <hidl/ServiceManagement.h>
-#include <unistd.h>
-#include <thread>
namespace android {
namespace hardware {
@@ -29,61 +32,17 @@
namespace storage {
namespace V1_0 {
+using namespace ::android::hardware::health::storage::test;
using ::std::literals::chrono_literals::operator""ms;
#define ASSERT_OK(ret) ASSERT_TRUE(ret.isOk()) << ret.description()
-// Dev GC timeout. This is the timeout used by vold.
-const uint64_t kDevGcTimeoutSec = 120;
-const std::chrono::seconds kDevGcTimeout{kDevGcTimeoutSec};
-// Dev GC timeout tolerance. The HAL may not immediately return after the
-// timeout, so include an acceptable tolerance.
-const std::chrono::seconds kDevGcTolerance{3};
-// Time accounted for RPC calls.
-const std::chrono::milliseconds kRpcTime{1000};
-
-template <typename R>
-std::string toString(std::chrono::duration<R, std::milli> time) {
- return std::to_string(time.count()) + "ms";
-}
-
-/** An atomic boolean flag that indicates whether a task has finished. */
-class Flag {
- public:
- void onFinish() {
- std::unique_lock<std::mutex> lock(mMutex);
- onFinishLocked(&lock);
- }
- template <typename R, typename P>
- bool wait(std::chrono::duration<R, P> duration) {
- std::unique_lock<std::mutex> lock(mMutex);
- return waitLocked(&lock, duration);
- }
-
- protected:
- /** Will unlock. */
- void onFinishLocked(std::unique_lock<std::mutex>* lock) {
- mFinished = true;
- lock->unlock();
- mCv.notify_all();
- }
- template <typename R, typename P>
- bool waitLocked(std::unique_lock<std::mutex>* lock, std::chrono::duration<R, P> duration) {
- mCv.wait_for(*lock, duration, [this] { return mFinished; });
- return mFinished;
- }
-
- bool mFinished{false};
- std::mutex mMutex;
- std::condition_variable mCv;
-};
-
class GcCallback : public IGarbageCollectCallback, public Flag {
- public:
+ public:
Return<void> onFinish(Result result) override {
- std::unique_lock<std::mutex> lock(mMutex);
- mResult = result;
- Flag::onFinishLocked(&lock);
+ std::unique_lock<std::mutex> lock(mutex_);
+ result_ = result;
+ Flag::OnFinishLocked(&lock);
return Void();
}
@@ -93,13 +52,13 @@
*/
template <typename R, typename P>
void waitForResult(std::chrono::duration<R, P> timeout, Result expected) {
- std::unique_lock<std::mutex> lock(mMutex);
- ASSERT_TRUE(waitLocked(&lock, timeout)) << "timeout after " << toString(timeout);
- EXPECT_EQ(expected, mResult);
+ std::unique_lock<std::mutex> lock(mutex_);
+ ASSERT_TRUE(WaitLocked(&lock, timeout)) << "timeout after " << to_string(timeout);
+ EXPECT_EQ(expected, result_);
}
- private:
- Result mResult{Result::UNKNOWN_ERROR};
+ private:
+ Result result_{Result::UNKNOWN_ERROR};
};
class HealthStorageHidlTest : public ::testing::TestWithParam<std::string> {
@@ -127,10 +86,10 @@
auto pingFlag = std::make_shared<Flag>();
std::thread([service, pingFlag] {
service->ping();
- pingFlag->onFinish();
+ pingFlag->OnFinish();
})
.detach();
- return pingFlag->wait(timeout);
+ return pingFlag->Wait(timeout);
}
sp<IStorage> fs;
@@ -147,7 +106,7 @@
// Hold test process because HAL can be single-threaded and doing GC.
ASSERT_TRUE(ping(kDevGcTimeout + kDevGcTolerance + kRpcTime))
<< "Service must be available after "
- << toString(kDevGcTimeout + kDevGcTolerance + kRpcTime);
+ << to_string(kDevGcTimeout + kDevGcTolerance + kRpcTime);
}
/**
diff --git a/health/storage/aidl/Android.bp b/health/storage/aidl/Android.bp
new file mode 100644
index 0000000..c39a46d
--- /dev/null
+++ b/health/storage/aidl/Android.bp
@@ -0,0 +1,33 @@
+// Copyright (C) 2021 The Android Open Source Project
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+aidl_interface {
+ name: "android.hardware.health.storage",
+ vendor_available: true,
+ srcs: ["android/hardware/health/storage/*.aidl"],
+ stability: "vintf",
+ backend: {
+ cpp: {
+ enabled: false,
+ },
+ java: {
+ enabled: false,
+ },
+ ndk: {
+ vndk: {
+ enabled: true,
+ },
+ },
+ },
+}
diff --git a/health/storage/aidl/aidl_api/android.hardware.health.storage/current/android/hardware/health/storage/IGarbageCollectCallback.aidl b/health/storage/aidl/aidl_api/android.hardware.health.storage/current/android/hardware/health/storage/IGarbageCollectCallback.aidl
new file mode 100644
index 0000000..0f382d7
--- /dev/null
+++ b/health/storage/aidl/aidl_api/android.hardware.health.storage/current/android/hardware/health/storage/IGarbageCollectCallback.aidl
@@ -0,0 +1,23 @@
+///////////////////////////////////////////////////////////////////////////////
+// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
+///////////////////////////////////////////////////////////////////////////////
+
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
+//
+// You must not make a backward incompatible change to any AIDL file built
+// with the aidl_interface module type with versions property set. The module
+// type is used to build AIDL files in a way that they can be used across
+// independently updatable components of the system. If a device is shipped
+// with such a backward incompatible change, it has a high risk of breaking
+// later when a module using the interface is updated, e.g., Mainline modules.
+
+package android.hardware.health.storage;
+@VintfStability
+interface IGarbageCollectCallback {
+ oneway void onFinish(in android.hardware.health.storage.Result result);
+}
diff --git a/health/storage/aidl/aidl_api/android.hardware.health.storage/current/android/hardware/health/storage/IStorage.aidl b/health/storage/aidl/aidl_api/android.hardware.health.storage/current/android/hardware/health/storage/IStorage.aidl
new file mode 100644
index 0000000..61f838a
--- /dev/null
+++ b/health/storage/aidl/aidl_api/android.hardware.health.storage/current/android/hardware/health/storage/IStorage.aidl
@@ -0,0 +1,23 @@
+///////////////////////////////////////////////////////////////////////////////
+// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
+///////////////////////////////////////////////////////////////////////////////
+
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
+//
+// You must not make a backward incompatible change to any AIDL file built
+// with the aidl_interface module type with versions property set. The module
+// type is used to build AIDL files in a way that they can be used across
+// independently updatable components of the system. If a device is shipped
+// with such a backward incompatible change, it has a high risk of breaking
+// later when a module using the interface is updated, e.g., Mainline modules.
+
+package android.hardware.health.storage;
+@VintfStability
+interface IStorage {
+ oneway void garbageCollect(in long timeoutSeconds, in android.hardware.health.storage.IGarbageCollectCallback callback);
+}
diff --git a/health/storage/aidl/aidl_api/android.hardware.health.storage/current/android/hardware/health/storage/Result.aidl b/health/storage/aidl/aidl_api/android.hardware.health.storage/current/android/hardware/health/storage/Result.aidl
new file mode 100644
index 0000000..a345808
--- /dev/null
+++ b/health/storage/aidl/aidl_api/android.hardware.health.storage/current/android/hardware/health/storage/Result.aidl
@@ -0,0 +1,25 @@
+///////////////////////////////////////////////////////////////////////////////
+// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
+///////////////////////////////////////////////////////////////////////////////
+
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
+//
+// You must not make a backward incompatible change to any AIDL file built
+// with the aidl_interface module type with versions property set. The module
+// type is used to build AIDL files in a way that they can be used across
+// independently updatable components of the system. If a device is shipped
+// with such a backward incompatible change, it has a high risk of breaking
+// later when a module using the interface is updated, e.g., Mainline modules.
+
+package android.hardware.health.storage;
+@Backing(type="int") @VintfStability
+enum Result {
+ SUCCESS = 0,
+ IO_ERROR = 1,
+ UNKNOWN_ERROR = 2,
+}
diff --git a/health/storage/aidl/android/hardware/health/storage/IGarbageCollectCallback.aidl b/health/storage/aidl/android/hardware/health/storage/IGarbageCollectCallback.aidl
new file mode 100644
index 0000000..ccd1b44
--- /dev/null
+++ b/health/storage/aidl/android/hardware/health/storage/IGarbageCollectCallback.aidl
@@ -0,0 +1,34 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.hardware.health.storage;
+
+import android.hardware.health.storage.Result;
+
+/**
+ * Callback interface to IStorage.garbageCollect.
+ */
+@VintfStability
+interface IGarbageCollectCallback {
+ /**
+ * When garbage collection has finished, the implementation must
+ * invoke this function to indicate the result of the garbage collection.
+ *
+ * @param out result Execution result. See documentation for Result for
+ * details.
+ */
+ oneway void onFinish(in Result result);
+}
diff --git a/health/storage/aidl/android/hardware/health/storage/IStorage.aidl b/health/storage/aidl/android/hardware/health/storage/IStorage.aidl
new file mode 100644
index 0000000..78992a2
--- /dev/null
+++ b/health/storage/aidl/android/hardware/health/storage/IStorage.aidl
@@ -0,0 +1,49 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.hardware.health.storage;
+
+import android.hardware.health.storage.IGarbageCollectCallback;
+
+/**
+ * IStorage is an interface that provides operations on underlying storage
+ * devices, including flash memory.
+ */
+@VintfStability
+interface IStorage {
+ /**
+ * Start garbage collection on the driver of storage devices.
+ *
+ * Garbage collection must be started at regular intervals when it is a good
+ * time for a longer-running cleanup tasks, roughly daily.
+ *
+ * When garbage collection finishes or encounters an error before the
+ * specified timeout, the implementation must call IGarbageCollect.finish
+ * immediately with appropriate result.
+ *
+ * If garbage collection does not finish within the specified timeout,
+ * the implementation must stop garbage collection, and must not call
+ * IGarbageCollect.finish.
+ *
+ * @param timeoutSeconds timeout in seconds. The implementation must
+ * return after the timeout is reached.
+ *
+ * @param callback callback interface. Callback must be null if the client
+ * does not need to receive any callbacks.
+ *
+ */
+ oneway void garbageCollect(in long timeoutSeconds, in IGarbageCollectCallback callback);
+}
diff --git a/health/storage/aidl/android/hardware/health/storage/Result.aidl b/health/storage/aidl/android/hardware/health/storage/Result.aidl
new file mode 100644
index 0000000..73bb779
--- /dev/null
+++ b/health/storage/aidl/android/hardware/health/storage/Result.aidl
@@ -0,0 +1,37 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.hardware.health.storage;
+
+/**
+ * Status values for HAL methods.
+ */
+@VintfStability
+@Backing(type="int")
+enum Result {
+ /**
+ * Execution of the method is successful.
+ */
+ SUCCESS = 0,
+ /**
+ * An IO error is encountered when the HAL communicates with the device.
+ */
+ IO_ERROR,
+ /**
+ * An unknown error is encountered.
+ */
+ UNKNOWN_ERROR,
+}
diff --git a/health/storage/aidl/default/Android.bp b/health/storage/aidl/default/Android.bp
new file mode 100644
index 0000000..68a8ee2
--- /dev/null
+++ b/health/storage/aidl/default/Android.bp
@@ -0,0 +1,53 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+cc_defaults {
+ name: "libhealth_storage_impl_defaults",
+ vendor: true,
+ shared_libs: [
+ "libbase",
+ "libbinder_ndk",
+ "android.hardware.health.storage-unstable-ndk_platform",
+ ],
+ static_libs: [
+ "libfstab",
+ "libhealth_storage_impl_common",
+ ],
+}
+
+cc_library_static {
+ name: "libhealth_storage_default_impl",
+ defaults: ["libhealth_storage_impl_defaults"],
+ srcs: [
+ "Storage.cpp",
+ ],
+ visibility: [
+ ":__subpackages__",
+ "//hardware/interfaces/tests/extension/health/storage:__subpackages__",
+ ],
+}
+
+cc_binary {
+ name: "android.hardware.health.storage-service.default",
+ defaults: ["libhealth_storage_impl_defaults"],
+ relative_install_path: "hw",
+ init_rc: ["health-storage-default.rc"],
+ vintf_fragments: ["health-storage-default.xml"],
+ srcs: ["main.cpp"],
+ static_libs: [
+ "libhealth_storage_default_impl",
+ ],
+}
diff --git a/health/storage/aidl/default/Storage.cpp b/health/storage/aidl/default/Storage.cpp
new file mode 100644
index 0000000..faa4ff6
--- /dev/null
+++ b/health/storage/aidl/default/Storage.cpp
@@ -0,0 +1,54 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "Storage.h"
+
+#include <sstream>
+
+#include <android-base/logging.h>
+#include <health-storage-impl/common.h>
+
+using ::android::hardware::health::storage::DebugDump;
+using ::android::hardware::health::storage::GarbageCollect;
+
+using HResult = android::hardware::health::storage::V1_0::Result;
+using AResult = aidl::android::hardware::health::storage::Result;
+// Ensure static_cast<AResult>(any HResult) works
+static_assert(static_cast<AResult>(HResult::SUCCESS) == AResult::SUCCESS);
+static_assert(static_cast<AResult>(HResult::IO_ERROR) == AResult::IO_ERROR);
+static_assert(static_cast<AResult>(HResult::UNKNOWN_ERROR) == AResult::UNKNOWN_ERROR);
+
+namespace aidl::android::hardware::health::storage {
+
+ndk::ScopedAStatus Storage::garbageCollect(
+ int64_t timeout_seconds, const std::shared_ptr<IGarbageCollectCallback>& callback) {
+ AResult result = static_cast<AResult>(GarbageCollect(static_cast<uint64_t>(timeout_seconds)));
+ if (callback != nullptr) {
+ auto status = callback->onFinish(result);
+ if (!status.isOk()) {
+ LOG(WARNING) << "Cannot return result " << toString(result)
+ << " to callback: " << status.getDescription();
+ }
+ }
+ return ndk::ScopedAStatus::ok();
+}
+
+binder_status_t Storage::dump(int fd, const char**, uint32_t) {
+ DebugDump(fd);
+ return STATUS_OK;
+}
+
+} // namespace aidl::android::hardware::health::storage
diff --git a/health/storage/aidl/default/Storage.h b/health/storage/aidl/default/Storage.h
new file mode 100644
index 0000000..049991b
--- /dev/null
+++ b/health/storage/aidl/default/Storage.h
@@ -0,0 +1,30 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#pragma once
+
+#include <aidl/android/hardware/health/storage/BnStorage.h>
+
+namespace aidl::android::hardware::health::storage {
+
+class Storage : public BnStorage {
+ ndk::ScopedAStatus garbageCollect(
+ int64_t timeout_seconds,
+ const std::shared_ptr<IGarbageCollectCallback>& callback) override;
+ binder_status_t dump(int fd, const char** args, uint32_t num_args) override;
+};
+
+} // namespace aidl::android::hardware::health::storage
diff --git a/health/storage/aidl/default/health-storage-default.rc b/health/storage/aidl/default/health-storage-default.rc
new file mode 100644
index 0000000..fc1cc8b
--- /dev/null
+++ b/health/storage/aidl/default/health-storage-default.rc
@@ -0,0 +1,7 @@
+service vendor.health-storage-default /vendor/bin/hw/android.hardware.health.storage-service.default
+ interface aidl android.hardware.health.storage.IStorage/default
+ oneshot
+ disabled
+ class hal
+ user system
+ group system
diff --git a/health/storage/aidl/default/health-storage-default.xml b/health/storage/aidl/default/health-storage-default.xml
new file mode 100644
index 0000000..14d4901
--- /dev/null
+++ b/health/storage/aidl/default/health-storage-default.xml
@@ -0,0 +1,7 @@
+<manifest version="1.0" type="device">
+ <hal format="aidl">
+ <name>android.hardware.health.storage</name>
+ <version>1</version>
+ <fqname>IStorage/default</fqname>
+ </hal>
+</manifest>
diff --git a/health/storage/aidl/default/main.cpp b/health/storage/aidl/default/main.cpp
new file mode 100644
index 0000000..186b64c
--- /dev/null
+++ b/health/storage/aidl/default/main.cpp
@@ -0,0 +1,37 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <android-base/logging.h>
+#include <android/binder_manager.h>
+#include <android/binder_process.h>
+
+#include "Storage.h"
+
+using aidl::android::hardware::health::storage::Storage;
+using std::string_literals::operator""s;
+
+int main() {
+ ABinderProcess_setThreadPoolMaxThreadCount(0);
+
+ // make a default storage service
+ auto storage = ndk::SharedRefBase::make<Storage>();
+ const std::string name = Storage::descriptor + "/default"s;
+ CHECK_EQ(STATUS_OK,
+ AServiceManager_registerLazyService(storage->asBinder().get(), name.c_str()));
+
+ ABinderProcess_joinThreadPool();
+ return EXIT_FAILURE; // should not reach
+}
diff --git a/health/storage/aidl/vts/functional/Android.bp b/health/storage/aidl/vts/functional/Android.bp
new file mode 100644
index 0000000..86b72a7
--- /dev/null
+++ b/health/storage/aidl/vts/functional/Android.bp
@@ -0,0 +1,37 @@
+// Copyright (C) 2021 The Android Open Source Project
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+cc_test {
+ name: "VtsHalHealthStorageTargetTest",
+ defaults: [
+ "VtsHalTargetTestDefaults",
+ "use_libaidlvintf_gtest_helper_static",
+ ],
+ srcs: [
+ "VtsHalHealthStorageTargetTest.cpp",
+ ],
+ shared_libs: [
+ "libbinder_ndk",
+ ],
+ static_libs: [
+ "android.hardware.health.storage-ndk_platform",
+ ],
+ header_libs: [
+ "libhealth_storage_test_common_headers",
+ ],
+ test_suites: [
+ "vts",
+ ],
+ test_config: "VtsHalHealthStorageTargetTest.xml",
+}
diff --git a/health/storage/aidl/vts/functional/VtsHalHealthStorageTargetTest.cpp b/health/storage/aidl/vts/functional/VtsHalHealthStorageTargetTest.cpp
new file mode 100644
index 0000000..3b6b6b4
--- /dev/null
+++ b/health/storage/aidl/vts/functional/VtsHalHealthStorageTargetTest.cpp
@@ -0,0 +1,136 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <unistd.h>
+
+#include <chrono>
+#include <set>
+#include <string>
+#include <thread>
+
+#include <aidl/Gtest.h>
+#include <aidl/Vintf.h>
+#include <aidl/android/hardware/health/storage/BnGarbageCollectCallback.h>
+#include <aidl/android/hardware/health/storage/IStorage.h>
+#include <android-base/logging.h>
+#include <android/binder_ibinder.h>
+#include <android/binder_manager.h>
+#include <android/binder_process.h>
+#include <gtest/gtest.h>
+#include <health-storage-test/common.h>
+
+namespace aidl::android::hardware::health::storage {
+
+using namespace ::android::hardware::health::storage::test;
+using std::chrono_literals::operator""ms;
+
+#define ASSERT_OK(ret) ASSERT_TRUE(ret.isOk()) << ret.getDescription()
+#define EXPECT_OK(ret) EXPECT_TRUE(ret.isOk()) << ret.getDescription()
+
+class GcCallback : public BnGarbageCollectCallback, public Flag {
+ public:
+ ndk::ScopedAStatus onFinish(Result result) override {
+ std::unique_lock<std::mutex> lock(mutex_);
+ result_ = result;
+ OnFinishLocked(&lock);
+ return ndk::ScopedAStatus::ok();
+ }
+
+ /**
+ * Wait for a specific "timeout". If GC has finished, test that the result
+ * is equal to the "expected" value.
+ */
+ template <typename R, typename P>
+ void WaitForResult(std::chrono::duration<R, P> timeout, Result expected) {
+ std::unique_lock<std::mutex> lock(mutex_);
+ ASSERT_TRUE(WaitLocked(&lock, timeout)) << "timeout after " << to_string(timeout);
+ EXPECT_EQ(expected, result_);
+ }
+
+ private:
+ Result result_{Result::UNKNOWN_ERROR};
+};
+
+class HealthStorageAidl : public testing::TestWithParam<std::string> {
+ public:
+ virtual void SetUp() override {
+ std::string name = GetParam();
+ ASSERT_TRUE(AServiceManager_isDeclared(name.c_str())) << name;
+ ndk::SpAIBinder binder(AServiceManager_waitForService(name.c_str()));
+ ASSERT_NE(binder, nullptr);
+ storage_ = IStorage::fromBinder(binder);
+ ASSERT_NE(storage_, nullptr);
+ }
+
+ virtual void TearDown() override {
+ EXPECT_TRUE(ping(kRpcTime))
+ << "Service is not responsive; expect subsequent tests to fail.";
+ }
+
+ /**
+ * Ping the service and expect it to return after "timeout". Return true
+ * iff the service is responsive within "timeout".
+ */
+ template <typename R, typename P>
+ bool ping(std::chrono::duration<R, P> timeout) {
+ // Ensure the service is responsive after the test.
+ std::shared_ptr<IStorage> service = storage_;
+ auto ping_flag = std::make_shared<Flag>();
+ std::thread([service, ping_flag] {
+ EXPECT_EQ(STATUS_OK, AIBinder_ping(service->asBinder().get()));
+ ping_flag->OnFinish();
+ }).detach();
+ return ping_flag->Wait(timeout);
+ }
+
+ std::shared_ptr<IStorage> storage_;
+};
+
+/**
+ * Ensure garbage collection works on null callback.
+ */
+TEST_P(HealthStorageAidl, GcNullCallback) {
+ ASSERT_OK(storage_->garbageCollect(kDevGcTimeoutSec, nullptr));
+
+ // Hold test process because HAL can be single-threaded and doing GC.
+ ASSERT_TRUE(ping(kDevGcTimeout + kDevGcTolerance + kRpcTime))
+ << "Service must be available after "
+ << to_string(kDevGcTimeout + kDevGcTolerance + kRpcTime);
+}
+
+/**
+ * Ensure garbage collection works on non-null callback.
+ */
+TEST_P(HealthStorageAidl, GcNonNullCallback) {
+ std::shared_ptr<GcCallback> cb = ndk::SharedRefBase::make<GcCallback>();
+ ASSERT_OK(storage_->garbageCollect(kDevGcTimeoutSec, cb));
+ cb->WaitForResult(kDevGcTimeout + kDevGcTolerance + kRpcTime, Result::SUCCESS);
+}
+
+GTEST_ALLOW_UNINSTANTIATED_PARAMETERIZED_TEST(HealthStorageAidl);
+INSTANTIATE_TEST_SUITE_P(
+ HealthStorage, HealthStorageAidl,
+ testing::ValuesIn(::android::getAidlHalInstanceNames(IStorage::descriptor)),
+ ::android::PrintInstanceNameToString);
+
+} // namespace aidl::android::hardware::health::storage
+
+int main(int argc, char** argv) {
+ ::testing::InitGoogleTest(&argc, argv);
+ ABinderProcess_setThreadPoolMaxThreadCount(1);
+ ABinderProcess_startThreadPool();
+ return RUN_ALL_TESTS();
+}
diff --git a/health/storage/aidl/vts/functional/VtsHalHealthStorageTargetTest.xml b/health/storage/aidl/vts/functional/VtsHalHealthStorageTargetTest.xml
new file mode 100644
index 0000000..f8a1c87
--- /dev/null
+++ b/health/storage/aidl/vts/functional/VtsHalHealthStorageTargetTest.xml
@@ -0,0 +1,33 @@
+<?xml version="1.0" encoding="utf-8"?>
+<!-- Copyright (C) 2021 The Android Open Source Project
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+-->
+<configuration description="Runs VtsHalHealthStorageTargetTest.">
+ <option name="test-suite-tag" value="apct" />
+ <option name="test-suite-tag" value="apct-native" />
+
+ <target_preparer class="com.android.tradefed.targetprep.RootTargetPreparer">
+ </target_preparer>
+
+ <target_preparer class="com.android.tradefed.targetprep.PushFilePreparer">
+ <option name="cleanup" value="true" />
+ <option name="push" value="VtsHalHealthStorageTargetTest->/data/local/tmp/VtsHalHealthStorageTargetTest" />
+ </target_preparer>
+
+ <test class="com.android.tradefed.testtype.GTest" >
+ <option name="native-test-device-path" value="/data/local/tmp" />
+ <option name="module-name" value="VtsHalHealthStorageTargetTest" />
+ <option name="native-test-timeout" value="3m" />
+ </test>
+</configuration>
diff --git a/health/storage/impl_common/Android.bp b/health/storage/impl_common/Android.bp
new file mode 100644
index 0000000..e1149c0
--- /dev/null
+++ b/health/storage/impl_common/Android.bp
@@ -0,0 +1,47 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+// Common implementation between HIDL and AIDL HAL.
+cc_library_static {
+ name: "libhealth_storage_impl_common",
+ vendor: true,
+ srcs: [
+ "impl_common.cpp",
+ ],
+ export_include_dirs: [
+ "include",
+ ],
+
+ cflags: [
+ "-Wall",
+ "-Werror",
+ ],
+
+ shared_libs: [
+ "libbase",
+ "libhidlbase",
+ "liblog",
+ "android.hardware.health.storage@1.0",
+ ],
+
+ static_libs: [
+ "libfstab",
+ ],
+
+ export_shared_lib_headers: [
+ "android.hardware.health.storage@1.0",
+ ],
+}
diff --git a/health/storage/impl_common/impl_common.cpp b/health/storage/impl_common/impl_common.cpp
new file mode 100644
index 0000000..6e753d4
--- /dev/null
+++ b/health/storage/impl_common/impl_common.cpp
@@ -0,0 +1,118 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include <health-storage-impl/common.h>
+
+#include <android-base/chrono_utils.h>
+#include <android-base/file.h>
+#include <android-base/logging.h>
+#include <android-base/strings.h>
+#include <fstab/fstab.h>
+
+using ::android::base::ReadFileToString;
+using ::android::base::Timer;
+using ::android::base::Trim;
+using ::android::base::WriteStringToFd;
+using ::android::base::WriteStringToFile;
+using ::android::fs_mgr::Fstab;
+using ::android::fs_mgr::ReadDefaultFstab;
+using ::android::hardware::health::storage::V1_0::Result;
+
+namespace android::hardware::health::storage {
+
+static std::string GetGarbageCollectPath() {
+ Fstab fstab;
+ ReadDefaultFstab(&fstab);
+
+ for (const auto& entry : fstab) {
+ if (!entry.sysfs_path.empty()) {
+ return entry.sysfs_path + "/manual_gc";
+ }
+ }
+
+ return "";
+}
+
+Result GarbageCollect(uint64_t timeout_seconds) {
+ std::string path = GetGarbageCollectPath();
+
+ if (path.empty()) {
+ LOG(WARNING) << "Cannot find Dev GC path";
+ return Result::UNKNOWN_ERROR;
+ }
+
+ Result result = Result::SUCCESS;
+ Timer timer;
+ LOG(INFO) << "Start Dev GC on " << path;
+ while (1) {
+ std::string require;
+ if (!ReadFileToString(path, &require)) {
+ PLOG(WARNING) << "Reading manual_gc failed in " << path;
+ result = Result::IO_ERROR;
+ break;
+ }
+ require = Trim(require);
+ if (require == "" || require == "off" || require == "disabled") {
+ LOG(DEBUG) << "No more to do Dev GC";
+ break;
+ }
+ LOG(DEBUG) << "Trigger Dev GC on " << path;
+ if (!WriteStringToFile("1", path)) {
+ PLOG(WARNING) << "Start Dev GC failed on " << path;
+ result = Result::IO_ERROR;
+ break;
+ }
+ if (timer.duration() >= std::chrono::seconds(timeout_seconds)) {
+ LOG(WARNING) << "Dev GC timeout";
+ // Timeout is not treated as an error. Try next time.
+ break;
+ }
+ sleep(2);
+ }
+ LOG(INFO) << "Stop Dev GC on " << path;
+ if (!WriteStringToFile("0", path)) {
+ PLOG(WARNING) << "Stop Dev GC failed on " << path;
+ result = Result::IO_ERROR;
+ }
+
+ return result;
+}
+
+void DebugDump(int fd) {
+ std::stringstream output;
+
+ std::string path = GetGarbageCollectPath();
+ if (path.empty()) {
+ output << "Cannot find Dev GC path";
+ } else {
+ std::string require;
+
+ if (ReadFileToString(path, &require)) {
+ output << path << ":" << require << std::endl;
+ }
+
+ if (WriteStringToFile("0", path)) {
+ output << "stop success" << std::endl;
+ }
+ }
+
+ if (!WriteStringToFd(output.str(), fd)) {
+ PLOG(WARNING) << "debug: cannot write to fd";
+ }
+
+ fsync(fd);
+}
+
+} // namespace android::hardware::health::storage
diff --git a/health/storage/impl_common/include/health-storage-impl/common.h b/health/storage/impl_common/include/health-storage-impl/common.h
new file mode 100644
index 0000000..c84a6a9
--- /dev/null
+++ b/health/storage/impl_common/include/health-storage-impl/common.h
@@ -0,0 +1,31 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#pragma once
+
+#include <android/hardware/health/storage/1.0/types.h>
+#include <string>
+
+namespace android::hardware::health::storage {
+
+// Run debug on fd
+void DebugDump(int fd);
+
+// Run garbage collection on GetGarbageCollectPath(). Blocks until garbage
+// collect finishes or |timeout_seconds| has reached.
+V1_0::Result GarbageCollect(uint64_t timeout_seconds);
+
+} // namespace android::hardware::health::storage
diff --git a/health/1.0/default/libhealthd/healthd_board_default.cpp b/health/storage/test_common/Android.bp
similarity index 64%
rename from health/1.0/default/libhealthd/healthd_board_default.cpp
rename to health/storage/test_common/Android.bp
index 127f98e..7c6bef4 100644
--- a/health/1.0/default/libhealthd/healthd_board_default.cpp
+++ b/health/storage/test_common/Android.bp
@@ -1,5 +1,5 @@
/*
- * Copyright (C) 2013 The Android Open Source Project
+ * Copyright (C) 2021 The Android Open Source Project
*
* Licensed under the Apache License, Version 2.0 (the "License");
* you may not use this file except in compliance with the License.
@@ -14,15 +14,7 @@
* limitations under the License.
*/
-#include <healthd/healthd.h>
-
-void healthd_board_init(struct healthd_config*)
-{
- // use defaults
-}
-
-int healthd_board_battery_update(struct android::BatteryProperties*)
-{
- // return 0 to log periodic polled battery status to kernel log
- return 0;
+cc_library_headers {
+ name: "libhealth_storage_test_common_headers",
+ export_include_dirs: ["include"],
}
diff --git a/health/storage/test_common/include/health-storage-test/common.h b/health/storage/test_common/include/health-storage-test/common.h
new file mode 100644
index 0000000..dfda830
--- /dev/null
+++ b/health/storage/test_common/include/health-storage-test/common.h
@@ -0,0 +1,69 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#pragma once
+
+#include <chrono>
+#include <string>
+
+namespace android::hardware::health::storage::test {
+
+// Dev GC timeout. This is the timeout used by vold.
+const uint64_t kDevGcTimeoutSec = 120;
+const std::chrono::seconds kDevGcTimeout{kDevGcTimeoutSec};
+// Dev GC timeout tolerance. The HAL may not immediately return after the
+// timeout, so include an acceptable tolerance.
+const std::chrono::seconds kDevGcTolerance{3};
+// Time accounted for RPC calls.
+const std::chrono::milliseconds kRpcTime{1000};
+
+template <typename R>
+std::string to_string(std::chrono::duration<R, std::milli> time) {
+ return std::to_string(time.count()) + "ms";
+}
+
+/** An atomic boolean flag that indicates whether a task has finished. */
+class Flag {
+ public:
+ void OnFinish() {
+ std::unique_lock<std::mutex> lock(mutex_);
+ OnFinishLocked(&lock);
+ }
+ template <typename R, typename P>
+ bool Wait(std::chrono::duration<R, P> duration) {
+ std::unique_lock<std::mutex> lock(mutex_);
+ return WaitLocked(&lock, duration);
+ }
+
+ protected:
+ /** Will unlock. */
+ void OnFinishLocked(std::unique_lock<std::mutex>* lock) {
+ finished_ = true;
+ lock->unlock();
+ cv_.notify_all();
+ }
+ template <typename R, typename P>
+ bool WaitLocked(std::unique_lock<std::mutex>* lock, std::chrono::duration<R, P> duration) {
+ cv_.wait_for(*lock, duration, [this] { return finished_; });
+ return finished_;
+ }
+
+ bool finished_{false};
+ std::mutex mutex_;
+ std::condition_variable cv_;
+};
+
+} // namespace android::hardware::health::storage::test
diff --git a/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/Certificate.aidl b/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/Certificate.aidl
index 7e3002d..d8a8128 100644
--- a/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/Certificate.aidl
+++ b/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/Certificate.aidl
@@ -1,14 +1,29 @@
-///////////////////////////////////////////////////////////////////////////////
+/*
+ * Copyright 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ *////////////////////////////////////////////////////////////////////////////////
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/CipherSuite.aidl b/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/CipherSuite.aidl
index 447203f..2685525 100644
--- a/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/CipherSuite.aidl
+++ b/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/CipherSuite.aidl
@@ -1,14 +1,29 @@
-///////////////////////////////////////////////////////////////////////////////
+/*
+ * Copyright 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ *////////////////////////////////////////////////////////////////////////////////
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/HardwareInformation.aidl b/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/HardwareInformation.aidl
index e1296e0..f8d5a9e 100644
--- a/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/HardwareInformation.aidl
+++ b/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/HardwareInformation.aidl
@@ -1,14 +1,29 @@
-///////////////////////////////////////////////////////////////////////////////
+/*
+ * Copyright 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ *////////////////////////////////////////////////////////////////////////////////
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/IIdentityCredential.aidl b/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/IIdentityCredential.aidl
index 88104d9..a097895 100644
--- a/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/IIdentityCredential.aidl
+++ b/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/IIdentityCredential.aidl
@@ -1,14 +1,29 @@
-///////////////////////////////////////////////////////////////////////////////
+/*
+ * Copyright 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ *////////////////////////////////////////////////////////////////////////////////
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
@@ -18,6 +33,9 @@
package android.hardware.identity;
@VintfStability
interface IIdentityCredential {
+ /**
+ * @deprecated use deleteCredentalWithChallenge() instead.
+ */
byte[] deleteCredential();
byte[] createEphemeralKeyPair();
void setReaderEphemeralPublicKey(in byte[] publicKey);
@@ -29,4 +47,7 @@
android.hardware.identity.Certificate generateSigningKeyPair(out byte[] signingKeyBlob);
void setRequestedNamespaces(in android.hardware.identity.RequestNamespace[] requestNamespaces);
void setVerificationToken(in android.hardware.keymaster.VerificationToken verificationToken);
+ byte[] deleteCredentialWithChallenge(in byte[] challenge);
+ byte[] proveOwnership(in byte[] challenge);
+ android.hardware.identity.IWritableIdentityCredential updateCredential();
}
diff --git a/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/IIdentityCredentialStore.aidl b/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/IIdentityCredentialStore.aidl
index 5dafb76..c6fb3c8 100644
--- a/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/IIdentityCredentialStore.aidl
+++ b/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/IIdentityCredentialStore.aidl
@@ -1,14 +1,29 @@
-///////////////////////////////////////////////////////////////////////////////
+/*
+ * Copyright 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ *////////////////////////////////////////////////////////////////////////////////
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/IWritableIdentityCredential.aidl b/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/IWritableIdentityCredential.aidl
index c5ac9d6..a713462 100644
--- a/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/IWritableIdentityCredential.aidl
+++ b/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/IWritableIdentityCredential.aidl
@@ -1,14 +1,29 @@
-///////////////////////////////////////////////////////////////////////////////
+/*
+ * Copyright 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ *////////////////////////////////////////////////////////////////////////////////
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/RequestDataItem.aidl b/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/RequestDataItem.aidl
index 24ec26a..c9c2b9f 100644
--- a/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/RequestDataItem.aidl
+++ b/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/RequestDataItem.aidl
@@ -1,14 +1,29 @@
-///////////////////////////////////////////////////////////////////////////////
+/*
+ * Copyright 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ *////////////////////////////////////////////////////////////////////////////////
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/RequestNamespace.aidl b/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/RequestNamespace.aidl
index af00f3b..aaf1e20 100644
--- a/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/RequestNamespace.aidl
+++ b/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/RequestNamespace.aidl
@@ -1,14 +1,29 @@
-///////////////////////////////////////////////////////////////////////////////
+/*
+ * Copyright 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ *////////////////////////////////////////////////////////////////////////////////
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/SecureAccessControlProfile.aidl b/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/SecureAccessControlProfile.aidl
index dfc1ad0..695fb3f 100644
--- a/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/SecureAccessControlProfile.aidl
+++ b/identity/aidl/aidl_api/android.hardware.identity/current/android/hardware/identity/SecureAccessControlProfile.aidl
@@ -1,14 +1,29 @@
-///////////////////////////////////////////////////////////////////////////////
+/*
+ * Copyright 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ *////////////////////////////////////////////////////////////////////////////////
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/identity/aidl/android/hardware/identity/IIdentityCredential.aidl b/identity/aidl/android/hardware/identity/IIdentityCredential.aidl
index 702334d..d23f88c 100644
--- a/identity/aidl/android/hardware/identity/IIdentityCredential.aidl
+++ b/identity/aidl/android/hardware/identity/IIdentityCredential.aidl
@@ -19,6 +19,7 @@
import android.hardware.identity.Certificate;
import android.hardware.identity.RequestNamespace;
import android.hardware.identity.SecureAccessControlProfile;
+import android.hardware.identity.IWritableIdentityCredential;
import android.hardware.keymaster.HardwareAuthToken;
import android.hardware.keymaster.VerificationToken;
@@ -40,7 +41,11 @@
* After this method has been called, the persistent storage used for credentialData should
* be deleted.
*
- * @return a COSE_Sign1 signature described above.
+ * This method was deprecated in API version 3 because there's no challenge so freshness
+ * can't be checked. Use deleteCredentalWithChallenge() instead.
+ *
+ * @return a COSE_Sign1 signature described above
+ * @deprecated use deleteCredentalWithChallenge() instead.
*/
byte[] deleteCredential();
@@ -353,6 +358,18 @@
*
* - subjectPublicKeyInfo: must contain attested public key.
*
+ * As of API version 3, the certificate shall also have an X.509 extension at
+ * OID 1.3.6.1.4.1.11129.2.1.26 which shall contain an OCTET STRING with the
+ * bytes of the CBOR with the following CDDL:
+ *
+ * ProofOfBinding = [
+ * "ProofOfBinding",
+ * bstr, // Contains SHA-256(ProofOfProvisioning)
+ * ]
+ *
+ * This CBOR enables an issuer to determine the exact state of the credential it
+ * returns issuer-signed data for.
+ *
* @param out signingKeyBlob contains an AES-GCM-ENC(storageKey, R, signingKey, docType)
* where signingKey is an EC private key in uncompressed form. That is, the returned
* blob is an encrypted copy of the newly-generated private signing key.
@@ -381,4 +398,63 @@
* The verification token. This token is only valid if the timestamp field is non-zero.
*/
void setVerificationToken(in VerificationToken verificationToken);
+
+ /**
+ * Delete a credential.
+ *
+ * This method returns a COSE_Sign1 data structure signed by CredentialKey
+ * with payload set to the ProofOfDeletion CBOR below:
+ *
+ * ProofOfDeletion = [
+ * "ProofOfDeletion", ; tstr
+ * tstr, ; DocType
+ * bstr, ; Challenge
+ * bool ; true if this is a test credential, should
+ * ; always be false.
+ * ]
+ *
+ * After this method has been called, the persistent storage used for credentialData should
+ * be deleted.
+ *
+ * This method was introduced in API version 3.
+ *
+ * @param challenge a challenge set by the issuer to ensure freshness. Maximum size is 32 bytes
+ * and it may be empty. Fails with STATUS_INVALID_DATA if bigger than 32 bytes.
+ * @return a COSE_Sign1 signature described above.
+ */
+ byte[] deleteCredentialWithChallenge(in byte[] challenge);
+
+ /**
+ * Prove ownership of credential.
+ *
+ * This method returns a COSE_Sign1 data structure signed by CredentialKey with payload
+ * set to the ProofOfOwnership CBOR below.
+ *
+ * ProofOfOwnership = [
+ * "ProofOfOwnership", ; tstr
+ * tstr, ; DocType
+ * bstr, ; Challenge
+ * bool ; true if this is a test credential, should
+ * ; always be false.
+ * ]
+ *
+ * This method was introduced in API version 3.
+ *
+ * @param challenge a challenge set by the issuer to ensure freshness. Maximum size is 32 bytes
+ * and it may be empty. Fails with STATUS_INVALID_DATA if bigger than 32 bytes.
+ * @return a COSE_Sign1 signature described above.
+ */
+ byte[] proveOwnership(in byte[] challenge);
+
+ /**
+ * Called to start updating the credential with new data items.
+ *
+ * If the getAttestationCertificate() method is called on the returned object
+ * it fails with the error STATUS_FAILED.
+ *
+ * This method was introduced in API version 3.
+ *
+ * @return an IWritableIdentityCredential
+ */
+ IWritableIdentityCredential updateCredential();
}
diff --git a/identity/aidl/android/hardware/identity/IIdentityCredentialStore.aidl b/identity/aidl/android/hardware/identity/IIdentityCredentialStore.aidl
index 33e25b1..638be79 100644
--- a/identity/aidl/android/hardware/identity/IIdentityCredentialStore.aidl
+++ b/identity/aidl/android/hardware/identity/IIdentityCredentialStore.aidl
@@ -104,6 +104,11 @@
* All binder calls in the HAL may return a ServiceSpecificException with statuses from the
* STATUS_* integers defined in this interface. Each method states which status can be returned
* and under which circumstances.
+ *
+ * The API described here is API version 3 which corresponds to feature version 202101
+ * of the android.security.identity Framework API. An XML file declaring the feature
+ * android.hardware.identity_credential (or android.hardware.identity_credential.direct_access
+ * if implementing the Direct Access HAL) should be included declaring this feature version.
*/
@VintfStability
interface IIdentityCredentialStore {
@@ -230,6 +235,9 @@
* return argument of the same name in finishAddingEntries(), in
* IWritableIdentityCredential.
*
+ * Note that the format of credentialData may depend on the feature version.
+ * Implementations must support credentialData created by an earlier feature version.
+ *
* @return an IIdentityCredential interface that provides operations on the Credential.
*/
IIdentityCredential getCredential(in CipherSuite cipherSuite, in byte[] credentialData);
diff --git a/identity/aidl/android/hardware/identity/IWritableIdentityCredential.aidl b/identity/aidl/android/hardware/identity/IWritableIdentityCredential.aidl
index c48cb66..5f878ee 100644
--- a/identity/aidl/android/hardware/identity/IWritableIdentityCredential.aidl
+++ b/identity/aidl/android/hardware/identity/IWritableIdentityCredential.aidl
@@ -263,7 +263,9 @@
*
* where HBK is a unique hardware-bound key that has never existed outside of the secure
* environment (except it's all zeroes if testCredential is True) and CredentialKeys is
- * the CBOR-encoded structure (in CDDL notation):
+ * the CBOR-encoded structure (in CDDL notation) given below.
+ *
+ * In API versions 1 and 2 it was the following
*
* CredentialKeys = [
* bstr, ; storageKey, a 128-bit AES key
@@ -271,6 +273,17 @@
* ; in uncompressed form
* ]
*
+ * In API version 3 or later it must be the following
+ *
+ * CredentialKeys = [
+ * bstr, ; storageKey, a 128-bit AES key
+ * bstr ; credentialPrivKey, the private key for credentialKey
+ * ; in uncompressed form
+ * bstr ; SHA-256(ProofOfProvisioning)
+ * ]
+ *
+ * Additional elements may be added to the CredentialKeys array in future versions.
+ *
* @param out proofOfProvisioningSignature proves to the IA that the credential was imported
* into the secure hardware without alteration or error. When the final addEntry() call is
* made (when the number of provisioned entries equals the sum of the items in
@@ -321,4 +334,5 @@
* @param expectedProofOfProvisioningSize the expected size of ProofOfProvisioning.
*/
void setExpectedProofOfProvisioningSize(in int expectedProofOfProvisioningSize);
+
}
diff --git a/identity/aidl/default/Android.bp b/identity/aidl/default/Android.bp
index 2eb0faa..8744648 100644
--- a/identity/aidl/default/Android.bp
+++ b/identity/aidl/default/Android.bp
@@ -1,3 +1,68 @@
+cc_library_static {
+ name: "android.hardware.identity-libeic-hal-common",
+ vendor_available: true,
+ srcs: [
+ "common/IdentityCredential.cpp",
+ "common/IdentityCredentialStore.cpp",
+ "common/WritableIdentityCredential.cpp",
+ ],
+ export_include_dirs: [
+ "common",
+ ],
+ cflags: [
+ "-Wall",
+ "-Wextra",
+ "-Wno-deprecated-declarations",
+ ],
+ shared_libs: [
+ "liblog",
+ "libcrypto",
+ "libbinder_ndk",
+ "libkeymaster_messages",
+ ],
+ static_libs: [
+ "libbase",
+ "libcppbor",
+ "libutils",
+ "libsoft_attestation_cert",
+ "libkeymaster_portable",
+ "libsoft_attestation_cert",
+ "libpuresoftkeymasterdevice",
+ "android.hardware.identity-support-lib",
+ "android.hardware.identity-unstable-ndk_platform",
+ "android.hardware.keymaster-unstable-ndk_platform",
+ ],
+}
+
+cc_library_static {
+ name: "android.hardware.identity-libeic-library",
+ vendor_available: true,
+ srcs: [
+ "libeic/EicCbor.c",
+ "libeic/EicPresentation.c",
+ "libeic/EicProvisioning.c",
+ "EicOpsImpl.cc",
+ ],
+ export_include_dirs: [
+ "libeic",
+ ],
+ cflags: [
+ "-DEIC_COMPILATION",
+ "-Wall",
+ "-Wextra",
+ "-DEIC_DEBUG",
+ // Allow using C2x extensions such as omitting parameter names
+ "-Wno-c2x-extensions",
+ ],
+ shared_libs: [
+ "libbase",
+ "libcrypto",
+ ],
+ static_libs: [
+ "android.hardware.identity-support-lib",
+ ],
+}
+
cc_binary {
name: "android.hardware.identity-service.example",
relative_install_path: "hw",
@@ -7,23 +72,40 @@
cflags: [
"-Wall",
"-Wextra",
+ "-g",
],
shared_libs: [
- "libbase",
- "libbinder_ndk",
- "libcppbor",
- "libcrypto",
"liblog",
+ "libcrypto",
+ "libbinder_ndk",
+ "libkeymaster_messages",
+ ],
+ static_libs: [
+ "libbase",
+ "libcppbor",
"libutils",
+ "libsoft_attestation_cert",
+ "libkeymaster_portable",
+ "libsoft_attestation_cert",
+ "libpuresoftkeymasterdevice",
"android.hardware.identity-support-lib",
- "android.hardware.identity-ndk_platform",
- "android.hardware.keymaster-ndk_platform",
+ "android.hardware.identity-unstable-ndk_platform",
+ "android.hardware.keymaster-unstable-ndk_platform",
+ "android.hardware.identity-libeic-hal-common",
+ "android.hardware.identity-libeic-library",
],
srcs: [
- "IdentityCredential.cpp",
- "IdentityCredentialStore.cpp",
- "WritableIdentityCredential.cpp",
- "Util.cpp",
"service.cpp",
+ "FakeSecureHardwareProxy.cpp",
],
+ required: [
+ "android.hardware.identity_credential.xml",
+ ],
+}
+
+prebuilt_etc {
+ name: "android.hardware.identity_credential.xml",
+ sub_dir: "permissions",
+ vendor: true,
+ src: "android.hardware.identity_credential.xml",
}
diff --git a/identity/aidl/default/EicOpsImpl.cc b/identity/aidl/default/EicOpsImpl.cc
new file mode 100644
index 0000000..8ec4cc9
--- /dev/null
+++ b/identity/aidl/default/EicOpsImpl.cc
@@ -0,0 +1,515 @@
+/*
+ * Copyright 2020, The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#define LOG_TAG "EicOpsImpl"
+
+#include <optional>
+#include <tuple>
+#include <vector>
+
+#include <android-base/logging.h>
+#include <android-base/stringprintf.h>
+#include <string.h>
+
+#include <android/hardware/identity/support/IdentityCredentialSupport.h>
+
+#include <openssl/sha.h>
+
+#include <openssl/aes.h>
+#include <openssl/bn.h>
+#include <openssl/crypto.h>
+#include <openssl/ec.h>
+#include <openssl/err.h>
+#include <openssl/evp.h>
+#include <openssl/hkdf.h>
+#include <openssl/hmac.h>
+#include <openssl/objects.h>
+#include <openssl/pem.h>
+#include <openssl/pkcs12.h>
+#include <openssl/rand.h>
+#include <openssl/x509.h>
+#include <openssl/x509_vfy.h>
+
+#include "EicOps.h"
+
+using ::std::map;
+using ::std::optional;
+using ::std::string;
+using ::std::tuple;
+using ::std::vector;
+
+void* eicMemSet(void* s, int c, size_t n) {
+ return memset(s, c, n);
+}
+
+void* eicMemCpy(void* dest, const void* src, size_t n) {
+ return memcpy(dest, src, n);
+}
+
+size_t eicStrLen(const char* s) {
+ return strlen(s);
+}
+
+int eicCryptoMemCmp(const void* s1, const void* s2, size_t n) {
+ return CRYPTO_memcmp(s1, s2, n);
+}
+
+void eicOpsHmacSha256Init(EicHmacSha256Ctx* ctx, const uint8_t* key, size_t keySize) {
+ HMAC_CTX* realCtx = (HMAC_CTX*)ctx;
+ HMAC_CTX_init(realCtx);
+ if (HMAC_Init_ex(realCtx, key, keySize, EVP_sha256(), nullptr /* impl */) != 1) {
+ LOG(ERROR) << "Error initializing HMAC_CTX";
+ }
+}
+
+void eicOpsHmacSha256Update(EicHmacSha256Ctx* ctx, const uint8_t* data, size_t len) {
+ HMAC_CTX* realCtx = (HMAC_CTX*)ctx;
+ if (HMAC_Update(realCtx, data, len) != 1) {
+ LOG(ERROR) << "Error updating HMAC_CTX";
+ }
+}
+
+void eicOpsHmacSha256Final(EicHmacSha256Ctx* ctx, uint8_t digest[EIC_SHA256_DIGEST_SIZE]) {
+ HMAC_CTX* realCtx = (HMAC_CTX*)ctx;
+ unsigned int size = 0;
+ if (HMAC_Final(realCtx, digest, &size) != 1) {
+ LOG(ERROR) << "Error finalizing HMAC_CTX";
+ }
+ if (size != EIC_SHA256_DIGEST_SIZE) {
+ LOG(ERROR) << "Expected 32 bytes from HMAC_Final, got " << size;
+ }
+}
+
+void eicOpsSha256Init(EicSha256Ctx* ctx) {
+ SHA256_CTX* realCtx = (SHA256_CTX*)ctx;
+ SHA256_Init(realCtx);
+}
+
+void eicOpsSha256Update(EicSha256Ctx* ctx, const uint8_t* data, size_t len) {
+ SHA256_CTX* realCtx = (SHA256_CTX*)ctx;
+ SHA256_Update(realCtx, data, len);
+}
+
+void eicOpsSha256Final(EicSha256Ctx* ctx, uint8_t digest[EIC_SHA256_DIGEST_SIZE]) {
+ SHA256_CTX* realCtx = (SHA256_CTX*)ctx;
+ SHA256_Final(digest, realCtx);
+}
+
+bool eicOpsRandom(uint8_t* buf, size_t numBytes) {
+ optional<vector<uint8_t>> bytes = ::android::hardware::identity::support::getRandom(numBytes);
+ if (!bytes.has_value()) {
+ return false;
+ }
+ memcpy(buf, bytes.value().data(), numBytes);
+ return true;
+}
+
+bool eicOpsEncryptAes128Gcm(
+ const uint8_t* key, // Must be 16 bytes
+ const uint8_t* nonce, // Must be 12 bytes
+ const uint8_t* data, // May be NULL if size is 0
+ size_t dataSize,
+ const uint8_t* additionalAuthenticationData, // May be NULL if size is 0
+ size_t additionalAuthenticationDataSize, uint8_t* encryptedData) {
+ vector<uint8_t> cppKey;
+ cppKey.resize(16);
+ memcpy(cppKey.data(), key, 16);
+
+ vector<uint8_t> cppData;
+ cppData.resize(dataSize);
+ if (dataSize > 0) {
+ memcpy(cppData.data(), data, dataSize);
+ }
+
+ vector<uint8_t> cppAAD;
+ cppAAD.resize(additionalAuthenticationDataSize);
+ if (additionalAuthenticationDataSize > 0) {
+ memcpy(cppAAD.data(), additionalAuthenticationData, additionalAuthenticationDataSize);
+ }
+
+ vector<uint8_t> cppNonce;
+ cppNonce.resize(12);
+ memcpy(cppNonce.data(), nonce, 12);
+
+ optional<vector<uint8_t>> cppEncryptedData =
+ android::hardware::identity::support::encryptAes128Gcm(cppKey, cppNonce, cppData,
+ cppAAD);
+ if (!cppEncryptedData.has_value()) {
+ return false;
+ }
+
+ memcpy(encryptedData, cppEncryptedData.value().data(), cppEncryptedData.value().size());
+ return true;
+}
+
+// Decrypts |encryptedData| using |key| and |additionalAuthenticatedData|,
+// returns resulting plaintext in |data| must be of size |encryptedDataSize| - 28.
+//
+// The format of |encryptedData| must be as specified in the
+// encryptAes128Gcm() function.
+bool eicOpsDecryptAes128Gcm(const uint8_t* key, // Must be 16 bytes
+ const uint8_t* encryptedData, size_t encryptedDataSize,
+ const uint8_t* additionalAuthenticationData,
+ size_t additionalAuthenticationDataSize, uint8_t* data) {
+ vector<uint8_t> keyVec;
+ keyVec.resize(16);
+ memcpy(keyVec.data(), key, 16);
+
+ vector<uint8_t> encryptedDataVec;
+ encryptedDataVec.resize(encryptedDataSize);
+ if (encryptedDataSize > 0) {
+ memcpy(encryptedDataVec.data(), encryptedData, encryptedDataSize);
+ }
+
+ vector<uint8_t> aadVec;
+ aadVec.resize(additionalAuthenticationDataSize);
+ if (additionalAuthenticationDataSize > 0) {
+ memcpy(aadVec.data(), additionalAuthenticationData, additionalAuthenticationDataSize);
+ }
+
+ optional<vector<uint8_t>> decryptedDataVec =
+ android::hardware::identity::support::decryptAes128Gcm(keyVec, encryptedDataVec,
+ aadVec);
+ if (!decryptedDataVec.has_value()) {
+ eicDebug("Error decrypting data");
+ return false;
+ }
+ if (decryptedDataVec.value().size() != encryptedDataSize - 28) {
+ eicDebug("Decrypted data is size %zd, expected %zd", decryptedDataVec.value().size(),
+ encryptedDataSize - 28);
+ return false;
+ }
+
+ if (decryptedDataVec.value().size() > 0) {
+ memcpy(data, decryptedDataVec.value().data(), decryptedDataVec.value().size());
+ }
+ return true;
+}
+
+bool eicOpsCreateEcKey(uint8_t privateKey[EIC_P256_PRIV_KEY_SIZE],
+ uint8_t publicKey[EIC_P256_PUB_KEY_SIZE]) {
+ optional<vector<uint8_t>> keyPair = android::hardware::identity::support::createEcKeyPair();
+ if (!keyPair) {
+ eicDebug("Error creating EC keypair");
+ return false;
+ }
+ optional<vector<uint8_t>> privKey =
+ android::hardware::identity::support::ecKeyPairGetPrivateKey(keyPair.value());
+ if (!privKey) {
+ eicDebug("Error extracting private key");
+ return false;
+ }
+ if (privKey.value().size() != EIC_P256_PRIV_KEY_SIZE) {
+ eicDebug("Private key is %zd bytes, expected %zd", privKey.value().size(),
+ (size_t)EIC_P256_PRIV_KEY_SIZE);
+ return false;
+ }
+
+ optional<vector<uint8_t>> pubKey =
+ android::hardware::identity::support::ecKeyPairGetPublicKey(keyPair.value());
+ if (!pubKey) {
+ eicDebug("Error extracting public key");
+ return false;
+ }
+ // ecKeyPairGetPublicKey() returns 0x04 | x | y, we don't want the leading 0x04.
+ if (pubKey.value().size() != EIC_P256_PUB_KEY_SIZE + 1) {
+ eicDebug("Public key is %zd bytes long, expected %zd", pubKey.value().size(),
+ (size_t)EIC_P256_PRIV_KEY_SIZE + 1);
+ return false;
+ }
+
+ memcpy(privateKey, privKey.value().data(), EIC_P256_PRIV_KEY_SIZE);
+ memcpy(publicKey, pubKey.value().data() + 1, EIC_P256_PUB_KEY_SIZE);
+
+ return true;
+}
+
+bool eicOpsCreateCredentialKey(uint8_t privateKey[EIC_P256_PRIV_KEY_SIZE], const uint8_t* challenge,
+ size_t challengeSize, const uint8_t* applicationId,
+ size_t applicationIdSize, bool testCredential, uint8_t* cert,
+ size_t* certSize) {
+ vector<uint8_t> challengeVec(challengeSize);
+ memcpy(challengeVec.data(), challenge, challengeSize);
+
+ vector<uint8_t> applicationIdVec(applicationIdSize);
+ memcpy(applicationIdVec.data(), applicationId, applicationIdSize);
+
+ optional<std::pair<vector<uint8_t>, vector<vector<uint8_t>>>> ret =
+ android::hardware::identity::support::createEcKeyPairAndAttestation(
+ challengeVec, applicationIdVec, testCredential);
+ if (!ret) {
+ eicDebug("Error generating CredentialKey and attestation");
+ return false;
+ }
+
+ // Extract certificate chain.
+ vector<uint8_t> flatChain =
+ android::hardware::identity::support::certificateChainJoin(ret.value().second);
+ if (*certSize < flatChain.size()) {
+ eicDebug("Buffer for certificate is only %zd bytes long, need %zd bytes", *certSize,
+ flatChain.size());
+ return false;
+ }
+ memcpy(cert, flatChain.data(), flatChain.size());
+ *certSize = flatChain.size();
+
+ // Extract private key.
+ optional<vector<uint8_t>> privKey =
+ android::hardware::identity::support::ecKeyPairGetPrivateKey(ret.value().first);
+ if (!privKey) {
+ eicDebug("Error extracting private key");
+ return false;
+ }
+ if (privKey.value().size() != EIC_P256_PRIV_KEY_SIZE) {
+ eicDebug("Private key is %zd bytes, expected %zd", privKey.value().size(),
+ (size_t)EIC_P256_PRIV_KEY_SIZE);
+ return false;
+ }
+
+ memcpy(privateKey, privKey.value().data(), EIC_P256_PRIV_KEY_SIZE);
+
+ return true;
+}
+
+bool eicOpsSignEcKey(const uint8_t publicKey[EIC_P256_PUB_KEY_SIZE],
+ const uint8_t signingKey[EIC_P256_PRIV_KEY_SIZE], unsigned int serial,
+ const char* issuerName, const char* subjectName, time_t validityNotBefore,
+ time_t validityNotAfter, const uint8_t* proofOfBinding,
+ size_t proofOfBindingSize, uint8_t* cert, size_t* certSize) { // inout
+ vector<uint8_t> signingKeyVec(EIC_P256_PRIV_KEY_SIZE);
+ memcpy(signingKeyVec.data(), signingKey, EIC_P256_PRIV_KEY_SIZE);
+
+ vector<uint8_t> pubKeyVec(EIC_P256_PUB_KEY_SIZE + 1);
+ pubKeyVec[0] = 0x04;
+ memcpy(pubKeyVec.data() + 1, publicKey, EIC_P256_PUB_KEY_SIZE);
+
+ string serialDecimal = android::base::StringPrintf("%d", serial);
+
+ map<string, vector<uint8_t>> extensions;
+ if (proofOfBinding != nullptr) {
+ vector<uint8_t> proofOfBindingVec(proofOfBinding, proofOfBinding + proofOfBindingSize);
+ extensions["1.3.6.1.4.1.11129.2.1.26"] = proofOfBindingVec;
+ }
+
+ optional<vector<uint8_t>> certVec =
+ android::hardware::identity::support::ecPublicKeyGenerateCertificate(
+ pubKeyVec, signingKeyVec, serialDecimal, issuerName, subjectName,
+ validityNotBefore, validityNotAfter, extensions);
+ if (!certVec) {
+ eicDebug("Error generating certificate");
+ return false;
+ }
+
+ if (*certSize < certVec.value().size()) {
+ eicDebug("Buffer for certificate is only %zd bytes long, need %zd bytes", *certSize,
+ certVec.value().size());
+ return false;
+ }
+ memcpy(cert, certVec.value().data(), certVec.value().size());
+ *certSize = certVec.value().size();
+
+ return true;
+}
+
+bool eicOpsEcDsa(const uint8_t privateKey[EIC_P256_PRIV_KEY_SIZE],
+ const uint8_t digestOfData[EIC_SHA256_DIGEST_SIZE],
+ uint8_t signature[EIC_ECDSA_P256_SIGNATURE_SIZE]) {
+ vector<uint8_t> privKeyVec(EIC_P256_PRIV_KEY_SIZE);
+ memcpy(privKeyVec.data(), privateKey, EIC_P256_PRIV_KEY_SIZE);
+
+ vector<uint8_t> digestVec(EIC_SHA256_DIGEST_SIZE);
+ memcpy(digestVec.data(), digestOfData, EIC_SHA256_DIGEST_SIZE);
+
+ optional<vector<uint8_t>> derSignature =
+ android::hardware::identity::support::signEcDsaDigest(privKeyVec, digestVec);
+ if (!derSignature) {
+ eicDebug("Error signing data");
+ return false;
+ }
+
+ ECDSA_SIG* sig;
+ const unsigned char* p = derSignature.value().data();
+ sig = d2i_ECDSA_SIG(nullptr, &p, derSignature.value().size());
+ if (sig == nullptr) {
+ eicDebug("Error decoding DER signature");
+ return false;
+ }
+
+ if (BN_bn2binpad(sig->r, signature, 32) != 32) {
+ eicDebug("Error encoding r");
+ return false;
+ }
+ if (BN_bn2binpad(sig->s, signature + 32, 32) != 32) {
+ eicDebug("Error encoding s");
+ return false;
+ }
+
+ return true;
+}
+
+static const uint8_t hbkTest[16] = {0};
+static const uint8_t hbkReal[16] = {0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15};
+
+const uint8_t* eicOpsGetHardwareBoundKey(bool testCredential) {
+ if (testCredential) {
+ return hbkTest;
+ }
+ return hbkReal;
+}
+
+bool eicOpsValidateAuthToken(uint64_t /* challenge */, uint64_t /* secureUserId */,
+ uint64_t /* authenticatorId */, int /* hardwareAuthenticatorType */,
+ uint64_t /* timeStamp */, const uint8_t* /* mac */,
+ size_t /* macSize */, uint64_t /* verificationTokenChallenge */,
+ uint64_t /* verificationTokenTimeStamp */,
+ int /* verificationTokenSecurityLevel */,
+ const uint8_t* /* verificationTokenMac */,
+ size_t /* verificationTokenMacSize */) {
+ // Here's where we would validate the passed-in |authToken| to assure ourselves
+ // that it comes from the e.g. biometric hardware and wasn't made up by an attacker.
+ //
+ // However this involves calculating the MAC which requires access to the to
+ // a pre-shared key which we don't have...
+ //
+ return true;
+}
+
+bool eicOpsX509GetPublicKey(const uint8_t* x509Cert, size_t x509CertSize, uint8_t* publicKey,
+ size_t* publicKeySize) {
+ vector<uint8_t> chain;
+ chain.resize(x509CertSize);
+ memcpy(chain.data(), x509Cert, x509CertSize);
+ optional<vector<uint8_t>> res =
+ android::hardware::identity::support::certificateChainGetTopMostKey(chain);
+ if (!res) {
+ return false;
+ }
+ if (res.value().size() > *publicKeySize) {
+ eicDebug("Public key size is %zd but buffer only has room for %zd bytes",
+ res.value().size(), *publicKeySize);
+ return false;
+ }
+ *publicKeySize = res.value().size();
+ memcpy(publicKey, res.value().data(), *publicKeySize);
+ eicDebug("Extracted %zd bytes public key from %zd bytes X.509 cert", *publicKeySize,
+ x509CertSize);
+ return true;
+}
+
+bool eicOpsX509CertSignedByPublicKey(const uint8_t* x509Cert, size_t x509CertSize,
+ const uint8_t* publicKey, size_t publicKeySize) {
+ vector<uint8_t> certVec(x509Cert, x509Cert + x509CertSize);
+ vector<uint8_t> publicKeyVec(publicKey, publicKey + publicKeySize);
+ return android::hardware::identity::support::certificateSignedByPublicKey(certVec,
+ publicKeyVec);
+}
+
+bool eicOpsEcDsaVerifyWithPublicKey(const uint8_t* digest, size_t digestSize,
+ const uint8_t* signature, size_t signatureSize,
+ const uint8_t* publicKey, size_t publicKeySize) {
+ vector<uint8_t> digestVec(digest, digest + digestSize);
+ vector<uint8_t> signatureVec(signature, signature + signatureSize);
+ vector<uint8_t> publicKeyVec(publicKey, publicKey + publicKeySize);
+
+ vector<uint8_t> derSignature;
+ if (!android::hardware::identity::support::ecdsaSignatureCoseToDer(signatureVec,
+ derSignature)) {
+ LOG(ERROR) << "Error convering signature to DER format";
+ return false;
+ }
+
+ if (!android::hardware::identity::support::checkEcDsaSignature(digestVec, derSignature,
+ publicKeyVec)) {
+ LOG(ERROR) << "Signature check failed";
+ return false;
+ }
+ return true;
+}
+
+bool eicOpsEcdh(const uint8_t publicKey[EIC_P256_PUB_KEY_SIZE],
+ const uint8_t privateKey[EIC_P256_PUB_KEY_SIZE],
+ uint8_t sharedSecret[EIC_P256_COORDINATE_SIZE]) {
+ vector<uint8_t> pubKeyVec(EIC_P256_PUB_KEY_SIZE + 1);
+ pubKeyVec[0] = 0x04;
+ memcpy(pubKeyVec.data() + 1, publicKey, EIC_P256_PUB_KEY_SIZE);
+
+ vector<uint8_t> privKeyVec(EIC_P256_PRIV_KEY_SIZE);
+ memcpy(privKeyVec.data(), privateKey, EIC_P256_PRIV_KEY_SIZE);
+
+ optional<vector<uint8_t>> shared =
+ android::hardware::identity::support::ecdh(pubKeyVec, privKeyVec);
+ if (!shared) {
+ LOG(ERROR) << "Error performing ECDH";
+ return false;
+ }
+ if (shared.value().size() != EIC_P256_COORDINATE_SIZE) {
+ LOG(ERROR) << "Unexpected size of shared secret " << shared.value().size() << " expected "
+ << EIC_P256_COORDINATE_SIZE << " bytes";
+ return false;
+ }
+ memcpy(sharedSecret, shared.value().data(), EIC_P256_COORDINATE_SIZE);
+ return true;
+}
+
+bool eicOpsHkdf(const uint8_t* sharedSecret, size_t sharedSecretSize, const uint8_t* salt,
+ size_t saltSize, const uint8_t* info, size_t infoSize, uint8_t* output,
+ size_t outputSize) {
+ vector<uint8_t> sharedSecretVec(sharedSecretSize);
+ memcpy(sharedSecretVec.data(), sharedSecret, sharedSecretSize);
+ vector<uint8_t> saltVec(saltSize);
+ memcpy(saltVec.data(), salt, saltSize);
+ vector<uint8_t> infoVec(infoSize);
+ memcpy(infoVec.data(), info, infoSize);
+
+ optional<vector<uint8_t>> result = android::hardware::identity::support::hkdf(
+ sharedSecretVec, saltVec, infoVec, outputSize);
+ if (!result) {
+ LOG(ERROR) << "Error performing HKDF";
+ return false;
+ }
+ if (result.value().size() != outputSize) {
+ LOG(ERROR) << "Unexpected size of HKDF " << result.value().size() << " expected "
+ << outputSize;
+ return false;
+ }
+ memcpy(output, result.value().data(), outputSize);
+ return true;
+}
+
+#ifdef EIC_DEBUG
+
+void eicPrint(const char* format, ...) {
+ va_list args;
+ va_start(args, format);
+ vfprintf(stderr, format, args);
+ va_end(args);
+}
+
+void eicHexdump(const char* message, const uint8_t* data, size_t dataSize) {
+ vector<uint8_t> dataVec(dataSize);
+ memcpy(dataVec.data(), data, dataSize);
+ android::hardware::identity::support::hexdump(message, dataVec);
+}
+
+void eicCborPrettyPrint(const uint8_t* cborData, size_t cborDataSize, size_t maxBStrSize) {
+ vector<uint8_t> cborDataVec(cborDataSize);
+ memcpy(cborDataVec.data(), cborData, cborDataSize);
+ string str =
+ android::hardware::identity::support::cborPrettyPrint(cborDataVec, maxBStrSize, {});
+ fprintf(stderr, "%s\n", str.c_str());
+}
+
+#endif // EIC_DEBUG
diff --git a/identity/aidl/default/EicOpsImpl.h b/identity/aidl/default/EicOpsImpl.h
new file mode 100644
index 0000000..333cdce
--- /dev/null
+++ b/identity/aidl/default/EicOpsImpl.h
@@ -0,0 +1,46 @@
+/*
+ * Copyright 2020, The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_HARDWARE_IDENTITY_EIC_OPS_IMPL_H
+#define ANDROID_HARDWARE_IDENTITY_EIC_OPS_IMPL_H
+
+#include <stdbool.h>
+#include <stddef.h>
+#include <stdlib.h>
+
+// Add whatever includes are needed for definitions below.
+//
+
+#include <openssl/hmac.h>
+#include <openssl/sha.h>
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+// Set the following defines to match the implementation of the supplied
+// eicOps*() operations. See EicOps.h for details.
+//
+
+#define EIC_SHA256_CONTEXT_SIZE sizeof(SHA256_CTX)
+
+#define EIC_HMAC_SHA256_CONTEXT_SIZE sizeof(HMAC_CTX)
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif // ANDROID_HARDWARE_IDENTITY_EMBEDDED_IC_H
diff --git a/identity/aidl/default/FakeSecureHardwareProxy.cpp b/identity/aidl/default/FakeSecureHardwareProxy.cpp
new file mode 100644
index 0000000..287ffb8
--- /dev/null
+++ b/identity/aidl/default/FakeSecureHardwareProxy.cpp
@@ -0,0 +1,347 @@
+/*
+ * Copyright 2020, The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#define LOG_TAG "FakeSecureHardwareProxy"
+
+#include "FakeSecureHardwareProxy.h"
+
+#include <android/hardware/identity/support/IdentityCredentialSupport.h>
+
+#include <android-base/logging.h>
+#include <android-base/stringprintf.h>
+#include <string.h>
+
+#include <openssl/sha.h>
+
+#include <openssl/aes.h>
+#include <openssl/bn.h>
+#include <openssl/crypto.h>
+#include <openssl/ec.h>
+#include <openssl/err.h>
+#include <openssl/evp.h>
+#include <openssl/hkdf.h>
+#include <openssl/hmac.h>
+#include <openssl/objects.h>
+#include <openssl/pem.h>
+#include <openssl/pkcs12.h>
+#include <openssl/rand.h>
+#include <openssl/x509.h>
+#include <openssl/x509_vfy.h>
+
+#include <libeic.h>
+
+using ::std::optional;
+using ::std::string;
+using ::std::tuple;
+using ::std::vector;
+
+namespace android::hardware::identity {
+
+// ----------------------------------------------------------------------
+
+FakeSecureHardwareProvisioningProxy::FakeSecureHardwareProvisioningProxy() {}
+
+FakeSecureHardwareProvisioningProxy::~FakeSecureHardwareProvisioningProxy() {}
+
+bool FakeSecureHardwareProvisioningProxy::shutdown() {
+ LOG(INFO) << "FakeSecureHardwarePresentationProxy shutdown";
+ return true;
+}
+
+bool FakeSecureHardwareProvisioningProxy::initialize(bool testCredential) {
+ LOG(INFO) << "FakeSecureHardwareProvisioningProxy created, sizeof(EicProvisioning): "
+ << sizeof(EicProvisioning);
+ return eicProvisioningInit(&ctx_, testCredential);
+}
+
+bool FakeSecureHardwareProvisioningProxy::initializeForUpdate(
+ bool testCredential, string docType, vector<uint8_t> encryptedCredentialKeys) {
+ return eicProvisioningInitForUpdate(&ctx_, testCredential, docType.c_str(),
+ encryptedCredentialKeys.data(),
+ encryptedCredentialKeys.size());
+}
+
+// Returns public key certificate.
+optional<vector<uint8_t>> FakeSecureHardwareProvisioningProxy::createCredentialKey(
+ const vector<uint8_t>& challenge, const vector<uint8_t>& applicationId) {
+ uint8_t publicKeyCert[4096];
+ size_t publicKeyCertSize = sizeof publicKeyCert;
+ if (!eicProvisioningCreateCredentialKey(&ctx_, challenge.data(), challenge.size(),
+ applicationId.data(), applicationId.size(),
+ publicKeyCert, &publicKeyCertSize)) {
+ return {};
+ }
+ vector<uint8_t> pubKeyCert(publicKeyCertSize);
+ memcpy(pubKeyCert.data(), publicKeyCert, publicKeyCertSize);
+ return pubKeyCert;
+}
+
+bool FakeSecureHardwareProvisioningProxy::startPersonalization(
+ int accessControlProfileCount, vector<int> entryCounts, const string& docType,
+ size_t expectedProofOfProvisioningSize) {
+ if (!eicProvisioningStartPersonalization(&ctx_, accessControlProfileCount, entryCounts.data(),
+ entryCounts.size(), docType.c_str(),
+ expectedProofOfProvisioningSize)) {
+ return false;
+ }
+ return true;
+}
+
+// Returns MAC (28 bytes).
+optional<vector<uint8_t>> FakeSecureHardwareProvisioningProxy::addAccessControlProfile(
+ int id, const vector<uint8_t>& readerCertificate, bool userAuthenticationRequired,
+ uint64_t timeoutMillis, uint64_t secureUserId) {
+ vector<uint8_t> mac(28);
+ if (!eicProvisioningAddAccessControlProfile(
+ &ctx_, id, readerCertificate.data(), readerCertificate.size(),
+ userAuthenticationRequired, timeoutMillis, secureUserId, mac.data())) {
+ return {};
+ }
+ return mac;
+}
+
+bool FakeSecureHardwareProvisioningProxy::beginAddEntry(const vector<int>& accessControlProfileIds,
+ const string& nameSpace, const string& name,
+ uint64_t entrySize) {
+ uint8_t scratchSpace[512];
+ return eicProvisioningBeginAddEntry(&ctx_, accessControlProfileIds.data(),
+ accessControlProfileIds.size(), nameSpace.c_str(),
+ name.c_str(), entrySize, scratchSpace, sizeof scratchSpace);
+}
+
+// Returns encryptedContent.
+optional<vector<uint8_t>> FakeSecureHardwareProvisioningProxy::addEntryValue(
+ const vector<int>& accessControlProfileIds, const string& nameSpace, const string& name,
+ const vector<uint8_t>& content) {
+ vector<uint8_t> eicEncryptedContent;
+ uint8_t scratchSpace[512];
+ eicEncryptedContent.resize(content.size() + 28);
+ if (!eicProvisioningAddEntryValue(
+ &ctx_, accessControlProfileIds.data(), accessControlProfileIds.size(),
+ nameSpace.c_str(), name.c_str(), content.data(), content.size(),
+ eicEncryptedContent.data(), scratchSpace, sizeof scratchSpace)) {
+ return {};
+ }
+ return eicEncryptedContent;
+}
+
+// Returns signatureOfToBeSigned (EIC_ECDSA_P256_SIGNATURE_SIZE bytes).
+optional<vector<uint8_t>> FakeSecureHardwareProvisioningProxy::finishAddingEntries() {
+ vector<uint8_t> signatureOfToBeSigned(EIC_ECDSA_P256_SIGNATURE_SIZE);
+ if (!eicProvisioningFinishAddingEntries(&ctx_, signatureOfToBeSigned.data())) {
+ return {};
+ }
+ return signatureOfToBeSigned;
+}
+
+// Returns encryptedCredentialKeys.
+optional<vector<uint8_t>> FakeSecureHardwareProvisioningProxy::finishGetCredentialData(
+ const string& docType) {
+ vector<uint8_t> encryptedCredentialKeys(116);
+ size_t size = encryptedCredentialKeys.size();
+ if (!eicProvisioningFinishGetCredentialData(&ctx_, docType.c_str(),
+ encryptedCredentialKeys.data(), &size)) {
+ return {};
+ }
+ encryptedCredentialKeys.resize(size);
+ return encryptedCredentialKeys;
+}
+
+// ----------------------------------------------------------------------
+
+FakeSecureHardwarePresentationProxy::FakeSecureHardwarePresentationProxy() {}
+
+FakeSecureHardwarePresentationProxy::~FakeSecureHardwarePresentationProxy() {}
+
+bool FakeSecureHardwarePresentationProxy::initialize(bool testCredential, string docType,
+ vector<uint8_t> encryptedCredentialKeys) {
+ LOG(INFO) << "FakeSecureHardwarePresentationProxy created, sizeof(EicPresentation): "
+ << sizeof(EicPresentation);
+ return eicPresentationInit(&ctx_, testCredential, docType.c_str(),
+ encryptedCredentialKeys.data(), encryptedCredentialKeys.size());
+}
+
+// Returns publicKeyCert (1st component) and signingKeyBlob (2nd component)
+optional<pair<vector<uint8_t>, vector<uint8_t>>>
+FakeSecureHardwarePresentationProxy::generateSigningKeyPair(string docType, time_t now) {
+ uint8_t publicKeyCert[512];
+ size_t publicKeyCertSize = sizeof(publicKeyCert);
+ vector<uint8_t> signingKeyBlob(60);
+
+ if (!eicPresentationGenerateSigningKeyPair(&ctx_, docType.c_str(), now, publicKeyCert,
+ &publicKeyCertSize, signingKeyBlob.data())) {
+ return {};
+ }
+
+ vector<uint8_t> cert;
+ cert.resize(publicKeyCertSize);
+ memcpy(cert.data(), publicKeyCert, publicKeyCertSize);
+
+ return std::make_pair(cert, signingKeyBlob);
+}
+
+// Returns private key
+optional<vector<uint8_t>> FakeSecureHardwarePresentationProxy::createEphemeralKeyPair() {
+ vector<uint8_t> priv(EIC_P256_PRIV_KEY_SIZE);
+ if (!eicPresentationCreateEphemeralKeyPair(&ctx_, priv.data())) {
+ return {};
+ }
+ return priv;
+}
+
+optional<uint64_t> FakeSecureHardwarePresentationProxy::createAuthChallenge() {
+ uint64_t challenge;
+ if (!eicPresentationCreateAuthChallenge(&ctx_, &challenge)) {
+ return {};
+ }
+ return challenge;
+}
+
+bool FakeSecureHardwarePresentationProxy::shutdown() {
+ LOG(INFO) << "FakeSecureHardwarePresentationProxy shutdown";
+ return true;
+}
+
+bool FakeSecureHardwarePresentationProxy::pushReaderCert(const vector<uint8_t>& certX509) {
+ return eicPresentationPushReaderCert(&ctx_, certX509.data(), certX509.size());
+}
+
+bool FakeSecureHardwarePresentationProxy::validateRequestMessage(
+ const vector<uint8_t>& sessionTranscript, const vector<uint8_t>& requestMessage,
+ int coseSignAlg, const vector<uint8_t>& readerSignatureOfToBeSigned) {
+ return eicPresentationValidateRequestMessage(
+ &ctx_, sessionTranscript.data(), sessionTranscript.size(), requestMessage.data(),
+ requestMessage.size(), coseSignAlg, readerSignatureOfToBeSigned.data(),
+ readerSignatureOfToBeSigned.size());
+}
+
+bool FakeSecureHardwarePresentationProxy::setAuthToken(
+ uint64_t challenge, uint64_t secureUserId, uint64_t authenticatorId,
+ int hardwareAuthenticatorType, uint64_t timeStamp, const vector<uint8_t>& mac,
+ uint64_t verificationTokenChallenge, uint64_t verificationTokenTimestamp,
+ int verificationTokenSecurityLevel, const vector<uint8_t>& verificationTokenMac) {
+ return eicPresentationSetAuthToken(&ctx_, challenge, secureUserId, authenticatorId,
+ hardwareAuthenticatorType, timeStamp, mac.data(), mac.size(),
+ verificationTokenChallenge, verificationTokenTimestamp,
+ verificationTokenSecurityLevel, verificationTokenMac.data(),
+ verificationTokenMac.size());
+}
+
+optional<bool> FakeSecureHardwarePresentationProxy::validateAccessControlProfile(
+ int id, const vector<uint8_t>& readerCertificate, bool userAuthenticationRequired,
+ int timeoutMillis, uint64_t secureUserId, const vector<uint8_t>& mac) {
+ bool accessGranted = false;
+ if (!eicPresentationValidateAccessControlProfile(&ctx_, id, readerCertificate.data(),
+ readerCertificate.size(),
+ userAuthenticationRequired, timeoutMillis,
+ secureUserId, mac.data(), &accessGranted)) {
+ return {};
+ }
+ return accessGranted;
+}
+
+bool FakeSecureHardwarePresentationProxy::startRetrieveEntries() {
+ return eicPresentationStartRetrieveEntries(&ctx_);
+}
+
+bool FakeSecureHardwarePresentationProxy::calcMacKey(
+ const vector<uint8_t>& sessionTranscript, const vector<uint8_t>& readerEphemeralPublicKey,
+ const vector<uint8_t>& signingKeyBlob, const string& docType,
+ unsigned int numNamespacesWithValues, size_t expectedProofOfProvisioningSize) {
+ if (signingKeyBlob.size() != 60) {
+ eicDebug("Unexpected size %zd of signingKeyBlob, expected 60", signingKeyBlob.size());
+ return false;
+ }
+ return eicPresentationCalcMacKey(&ctx_, sessionTranscript.data(), sessionTranscript.size(),
+ readerEphemeralPublicKey.data(), signingKeyBlob.data(),
+ docType.c_str(), numNamespacesWithValues,
+ expectedProofOfProvisioningSize);
+}
+
+AccessCheckResult FakeSecureHardwarePresentationProxy::startRetrieveEntryValue(
+ const string& nameSpace, const string& name, unsigned int newNamespaceNumEntries,
+ int32_t entrySize, const vector<int32_t>& accessControlProfileIds) {
+ uint8_t scratchSpace[512];
+ EicAccessCheckResult result = eicPresentationStartRetrieveEntryValue(
+ &ctx_, nameSpace.c_str(), name.c_str(), newNamespaceNumEntries, entrySize,
+ accessControlProfileIds.data(), accessControlProfileIds.size(), scratchSpace,
+ sizeof scratchSpace);
+ switch (result) {
+ case EIC_ACCESS_CHECK_RESULT_OK:
+ return AccessCheckResult::kOk;
+ case EIC_ACCESS_CHECK_RESULT_NO_ACCESS_CONTROL_PROFILES:
+ return AccessCheckResult::kNoAccessControlProfiles;
+ case EIC_ACCESS_CHECK_RESULT_FAILED:
+ return AccessCheckResult::kFailed;
+ case EIC_ACCESS_CHECK_RESULT_USER_AUTHENTICATION_FAILED:
+ return AccessCheckResult::kUserAuthenticationFailed;
+ case EIC_ACCESS_CHECK_RESULT_READER_AUTHENTICATION_FAILED:
+ return AccessCheckResult::kReaderAuthenticationFailed;
+ }
+ eicDebug("Unknown result with code %d, returning kFailed", (int)result);
+ return AccessCheckResult::kFailed;
+}
+
+optional<vector<uint8_t>> FakeSecureHardwarePresentationProxy::retrieveEntryValue(
+ const vector<uint8_t>& encryptedContent, const string& nameSpace, const string& name,
+ const vector<int32_t>& accessControlProfileIds) {
+ uint8_t scratchSpace[512];
+ vector<uint8_t> content;
+ content.resize(encryptedContent.size() - 28);
+ if (!eicPresentationRetrieveEntryValue(
+ &ctx_, encryptedContent.data(), encryptedContent.size(), content.data(),
+ nameSpace.c_str(), name.c_str(), accessControlProfileIds.data(),
+ accessControlProfileIds.size(), scratchSpace, sizeof scratchSpace)) {
+ return {};
+ }
+ return content;
+}
+
+optional<vector<uint8_t>> FakeSecureHardwarePresentationProxy::finishRetrieval() {
+ vector<uint8_t> mac(32);
+ size_t macSize = 32;
+ if (!eicPresentationFinishRetrieval(&ctx_, mac.data(), &macSize)) {
+ return {};
+ }
+ mac.resize(macSize);
+ return mac;
+}
+
+optional<vector<uint8_t>> FakeSecureHardwarePresentationProxy::deleteCredential(
+ const string& docType, const vector<uint8_t>& challenge, bool includeChallenge,
+ size_t proofOfDeletionCborSize) {
+ vector<uint8_t> signatureOfToBeSigned(EIC_ECDSA_P256_SIGNATURE_SIZE);
+ if (!eicPresentationDeleteCredential(&ctx_, docType.c_str(), challenge.data(), challenge.size(),
+ includeChallenge, proofOfDeletionCborSize,
+ signatureOfToBeSigned.data())) {
+ return {};
+ }
+ return signatureOfToBeSigned;
+}
+
+optional<vector<uint8_t>> FakeSecureHardwarePresentationProxy::proveOwnership(
+ const string& docType, bool testCredential, const vector<uint8_t>& challenge,
+ size_t proofOfOwnershipCborSize) {
+ vector<uint8_t> signatureOfToBeSigned(EIC_ECDSA_P256_SIGNATURE_SIZE);
+ if (!eicPresentationProveOwnership(&ctx_, docType.c_str(), testCredential, challenge.data(),
+ challenge.size(), proofOfOwnershipCborSize,
+ signatureOfToBeSigned.data())) {
+ return {};
+ }
+ return signatureOfToBeSigned;
+}
+
+} // namespace android::hardware::identity
diff --git a/identity/aidl/default/FakeSecureHardwareProxy.h b/identity/aidl/default/FakeSecureHardwareProxy.h
new file mode 100644
index 0000000..6852c1a
--- /dev/null
+++ b/identity/aidl/default/FakeSecureHardwareProxy.h
@@ -0,0 +1,160 @@
+/*
+ * Copyright 2020, The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_HARDWARE_IDENTITY_FAKESECUREHARDWAREPROXY_H
+#define ANDROID_HARDWARE_IDENTITY_FAKESECUREHARDWAREPROXY_H
+
+#include <libeic/libeic.h>
+
+#include "SecureHardwareProxy.h"
+
+namespace android::hardware::identity {
+
+// This implementation uses libEmbeddedIC in-process.
+//
+class FakeSecureHardwareProvisioningProxy : public SecureHardwareProvisioningProxy {
+ public:
+ FakeSecureHardwareProvisioningProxy();
+ virtual ~FakeSecureHardwareProvisioningProxy();
+
+ bool initialize(bool testCredential) override;
+
+ bool initializeForUpdate(bool testCredential, string docType,
+ vector<uint8_t> encryptedCredentialKeys) override;
+
+ bool shutdown() override;
+
+ // Returns public key certificate.
+ optional<vector<uint8_t>> createCredentialKey(const vector<uint8_t>& challenge,
+ const vector<uint8_t>& applicationId) override;
+
+ bool startPersonalization(int accessControlProfileCount, vector<int> entryCounts,
+ const string& docType,
+ size_t expectedProofOfProvisioningSize) override;
+
+ // Returns MAC (28 bytes).
+ optional<vector<uint8_t>> addAccessControlProfile(int id,
+ const vector<uint8_t>& readerCertificate,
+ bool userAuthenticationRequired,
+ uint64_t timeoutMillis,
+ uint64_t secureUserId) override;
+
+ bool beginAddEntry(const vector<int>& accessControlProfileIds, const string& nameSpace,
+ const string& name, uint64_t entrySize) override;
+
+ // Returns encryptedContent.
+ optional<vector<uint8_t>> addEntryValue(const vector<int>& accessControlProfileIds,
+ const string& nameSpace, const string& name,
+ const vector<uint8_t>& content) override;
+
+ // Returns signatureOfToBeSigned (EIC_ECDSA_P256_SIGNATURE_SIZE bytes).
+ optional<vector<uint8_t>> finishAddingEntries() override;
+
+ // Returns encryptedCredentialKeys (80 bytes).
+ optional<vector<uint8_t>> finishGetCredentialData(const string& docType) override;
+
+ protected:
+ EicProvisioning ctx_;
+};
+
+// This implementation uses libEmbeddedIC in-process.
+//
+class FakeSecureHardwarePresentationProxy : public SecureHardwarePresentationProxy {
+ public:
+ FakeSecureHardwarePresentationProxy();
+ virtual ~FakeSecureHardwarePresentationProxy();
+
+ bool initialize(bool testCredential, string docType,
+ vector<uint8_t> encryptedCredentialKeys) override;
+
+ // Returns publicKeyCert (1st component) and signingKeyBlob (2nd component)
+ optional<pair<vector<uint8_t>, vector<uint8_t>>> generateSigningKeyPair(string docType,
+ time_t now) override;
+
+ // Returns private key
+ optional<vector<uint8_t>> createEphemeralKeyPair() override;
+
+ optional<uint64_t> createAuthChallenge() override;
+
+ bool startRetrieveEntries() override;
+
+ bool setAuthToken(uint64_t challenge, uint64_t secureUserId, uint64_t authenticatorId,
+ int hardwareAuthenticatorType, uint64_t timeStamp, const vector<uint8_t>& mac,
+ uint64_t verificationTokenChallenge, uint64_t verificationTokenTimestamp,
+ int verificationTokenSecurityLevel,
+ const vector<uint8_t>& verificationTokenMac) override;
+
+ bool pushReaderCert(const vector<uint8_t>& certX509) override;
+
+ optional<bool> validateAccessControlProfile(int id, const vector<uint8_t>& readerCertificate,
+ bool userAuthenticationRequired, int timeoutMillis,
+ uint64_t secureUserId,
+ const vector<uint8_t>& mac) override;
+
+ bool validateRequestMessage(const vector<uint8_t>& sessionTranscript,
+ const vector<uint8_t>& requestMessage, int coseSignAlg,
+ const vector<uint8_t>& readerSignatureOfToBeSigned) override;
+
+ bool calcMacKey(const vector<uint8_t>& sessionTranscript,
+ const vector<uint8_t>& readerEphemeralPublicKey,
+ const vector<uint8_t>& signingKeyBlob, const string& docType,
+ unsigned int numNamespacesWithValues,
+ size_t expectedProofOfProvisioningSize) override;
+
+ AccessCheckResult startRetrieveEntryValue(
+ const string& nameSpace, const string& name, unsigned int newNamespaceNumEntries,
+ int32_t entrySize, const vector<int32_t>& accessControlProfileIds) override;
+
+ optional<vector<uint8_t>> retrieveEntryValue(
+ const vector<uint8_t>& encryptedContent, const string& nameSpace, const string& name,
+ const vector<int32_t>& accessControlProfileIds) override;
+
+ optional<vector<uint8_t>> finishRetrieval() override;
+
+ optional<vector<uint8_t>> deleteCredential(const string& docType,
+ const vector<uint8_t>& challenge,
+ bool includeChallenge,
+ size_t proofOfDeletionCborSize) override;
+
+ optional<vector<uint8_t>> proveOwnership(const string& docType, bool testCredential,
+ const vector<uint8_t>& challenge,
+ size_t proofOfOwnershipCborSize) override;
+
+ bool shutdown() override;
+
+ protected:
+ EicPresentation ctx_;
+};
+
+// Factory implementation.
+//
+class FakeSecureHardwareProxyFactory : public SecureHardwareProxyFactory {
+ public:
+ FakeSecureHardwareProxyFactory() {}
+ virtual ~FakeSecureHardwareProxyFactory() {}
+
+ sp<SecureHardwareProvisioningProxy> createProvisioningProxy() override {
+ return new FakeSecureHardwareProvisioningProxy();
+ }
+
+ sp<SecureHardwarePresentationProxy> createPresentationProxy() override {
+ return new FakeSecureHardwarePresentationProxy();
+ }
+};
+
+} // namespace android::hardware::identity
+
+#endif // ANDROID_HARDWARE_IDENTITY_FAKESECUREHARDWAREPROXY_H
diff --git a/identity/aidl/default/Util.cpp b/identity/aidl/default/Util.cpp
deleted file mode 100644
index 66b9f13..0000000
--- a/identity/aidl/default/Util.cpp
+++ /dev/null
@@ -1,108 +0,0 @@
-/*
- * Copyright 2019, The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#define LOG_TAG "Util"
-
-#include "Util.h"
-
-#include <android/hardware/identity/support/IdentityCredentialSupport.h>
-
-#include <string.h>
-
-#include <android-base/logging.h>
-
-#include <cppbor.h>
-#include <cppbor_parse.h>
-
-namespace aidl::android::hardware::identity {
-
-using namespace ::android::hardware::identity;
-
-// This is not a very random HBK but that's OK because this is the SW
-// implementation where it can't be kept secret.
-vector<uint8_t> hardwareBoundKey = {0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15};
-
-const vector<uint8_t>& getHardwareBoundKey() {
- return hardwareBoundKey;
-}
-
-vector<uint8_t> secureAccessControlProfileEncodeCbor(const SecureAccessControlProfile& profile) {
- cppbor::Map map;
- map.add("id", profile.id);
-
- if (profile.readerCertificate.encodedCertificate.size() > 0) {
- map.add("readerCertificate", cppbor::Bstr(profile.readerCertificate.encodedCertificate));
- }
-
- if (profile.userAuthenticationRequired) {
- map.add("userAuthenticationRequired", profile.userAuthenticationRequired);
- map.add("timeoutMillis", profile.timeoutMillis);
- map.add("secureUserId", profile.secureUserId);
- }
-
- return map.encode();
-}
-
-optional<vector<uint8_t>> secureAccessControlProfileCalcMac(
- const SecureAccessControlProfile& profile, const vector<uint8_t>& storageKey) {
- vector<uint8_t> cborData = secureAccessControlProfileEncodeCbor(profile);
-
- optional<vector<uint8_t>> nonce = support::getRandom(12);
- if (!nonce) {
- return {};
- }
- optional<vector<uint8_t>> macO =
- support::encryptAes128Gcm(storageKey, nonce.value(), {}, cborData);
- if (!macO) {
- return {};
- }
- return macO.value();
-}
-
-bool secureAccessControlProfileCheckMac(const SecureAccessControlProfile& profile,
- const vector<uint8_t>& storageKey) {
- vector<uint8_t> cborData = secureAccessControlProfileEncodeCbor(profile);
-
- if (profile.mac.size() < support::kAesGcmIvSize) {
- return false;
- }
- vector<uint8_t> nonce =
- vector<uint8_t>(profile.mac.begin(), profile.mac.begin() + support::kAesGcmIvSize);
- optional<vector<uint8_t>> mac = support::encryptAes128Gcm(storageKey, nonce, {}, cborData);
- if (!mac) {
- return false;
- }
- if (mac.value() != profile.mac) {
- return false;
- }
- return true;
-}
-
-vector<uint8_t> entryCreateAdditionalData(const string& nameSpace, const string& name,
- const vector<int32_t> accessControlProfileIds) {
- cppbor::Map map;
- map.add("Namespace", nameSpace);
- map.add("Name", name);
-
- cppbor::Array acpIds;
- for (auto id : accessControlProfileIds) {
- acpIds.add(id);
- }
- map.add("AccessControlProfileIds", std::move(acpIds));
- return map.encode();
-}
-
-} // namespace aidl::android::hardware::identity
diff --git a/identity/aidl/default/Util.h b/identity/aidl/default/Util.h
deleted file mode 100644
index 9fccba2..0000000
--- a/identity/aidl/default/Util.h
+++ /dev/null
@@ -1,54 +0,0 @@
-/*
- * Copyright 2019, The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#ifndef ANDROID_HARDWARE_IDENTITY_UTIL_H
-#define ANDROID_HARDWARE_IDENTITY_UTIL_H
-
-#include <aidl/android/hardware/identity/BnIdentityCredential.h>
-#include <android/hardware/identity/support/IdentityCredentialSupport.h>
-
-#include <map>
-#include <optional>
-#include <set>
-#include <string>
-#include <vector>
-
-#include <cppbor/cppbor.h>
-
-namespace aidl::android::hardware::identity {
-
-using ::std::optional;
-using ::std::string;
-using ::std::vector;
-
-// Returns the hardware-bound AES-128 key.
-const vector<uint8_t>& getHardwareBoundKey();
-
-// Calculates the MAC for |profile| using |storageKey|.
-optional<vector<uint8_t>> secureAccessControlProfileCalcMac(
- const SecureAccessControlProfile& profile, const vector<uint8_t>& storageKey);
-
-// Checks authenticity of the MAC in |profile| using |storageKey|.
-bool secureAccessControlProfileCheckMac(const SecureAccessControlProfile& profile,
- const vector<uint8_t>& storageKey);
-
-// Creates the AdditionalData CBOR used in the addEntryValue() HIDL method.
-vector<uint8_t> entryCreateAdditionalData(const string& nameSpace, const string& name,
- const vector<int32_t> accessControlProfileIds);
-
-} // namespace aidl::android::hardware::identity
-
-#endif // ANDROID_HARDWARE_IDENTITY_UTIL_H
diff --git a/identity/aidl/default/android.hardware.identity_credential.xml b/identity/aidl/default/android.hardware.identity_credential.xml
new file mode 100644
index 0000000..5149792
--- /dev/null
+++ b/identity/aidl/default/android.hardware.identity_credential.xml
@@ -0,0 +1,18 @@
+<?xml version="1.0" encoding="utf-8"?>
+<!-- Copyright 2021 The Android Open Source Project
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+-->
+<permissions>
+ <feature name="android.hardware.identity_credential" version="202101" />
+</permissions>
diff --git a/identity/aidl/default/IdentityCredential.cpp b/identity/aidl/default/common/IdentityCredential.cpp
similarity index 61%
rename from identity/aidl/default/IdentityCredential.cpp
rename to identity/aidl/default/common/IdentityCredential.cpp
index dfcd4f5..9477997 100644
--- a/identity/aidl/default/IdentityCredential.cpp
+++ b/identity/aidl/default/common/IdentityCredential.cpp
@@ -18,7 +18,6 @@
#include "IdentityCredential.h"
#include "IdentityCredentialStore.h"
-#include "Util.h"
#include <android/hardware/identity/support/IdentityCredentialSupport.h>
@@ -30,6 +29,9 @@
#include <cppbor.h>
#include <cppbor_parse.h>
+#include "FakeSecureHardwareProxy.h"
+#include "WritableIdentityCredential.h"
+
namespace aidl::android::hardware::identity {
using ::aidl::android::hardware::keymaster::Timestamp;
@@ -69,53 +71,52 @@
docType_ = docTypeItem->value();
testCredential_ = testCredentialItem->value();
- vector<uint8_t> hardwareBoundKey;
- if (testCredential_) {
- hardwareBoundKey = support::getTestHardwareBoundKey();
- } else {
- hardwareBoundKey = getHardwareBoundKey();
+ encryptedCredentialKeys_ = encryptedCredentialKeysItem->value();
+ if (!hwProxy_->initialize(testCredential_, docType_, encryptedCredentialKeys_)) {
+ LOG(ERROR) << "hwProxy->initialize failed";
+ return false;
}
- const vector<uint8_t>& encryptedCredentialKeys = encryptedCredentialKeysItem->value();
- const vector<uint8_t> docTypeVec(docType_.begin(), docType_.end());
- optional<vector<uint8_t>> decryptedCredentialKeys =
- support::decryptAes128Gcm(hardwareBoundKey, encryptedCredentialKeys, docTypeVec);
- if (!decryptedCredentialKeys) {
- LOG(ERROR) << "Error decrypting CredentialKeys";
- return IIdentityCredentialStore::STATUS_INVALID_DATA;
- }
-
- auto [dckItem, dckPos, dckMessage] = cppbor::parse(decryptedCredentialKeys.value());
- if (dckItem == nullptr) {
- LOG(ERROR) << "Decrypted CredentialKeys is not valid CBOR: " << dckMessage;
- return IIdentityCredentialStore::STATUS_INVALID_DATA;
- }
- const cppbor::Array* dckArrayItem = dckItem->asArray();
- if (dckArrayItem == nullptr || dckArrayItem->size() != 2) {
- LOG(ERROR) << "Decrypted CredentialKeys is not an array with two elements";
- return IIdentityCredentialStore::STATUS_INVALID_DATA;
- }
- const cppbor::Bstr* storageKeyItem = (*dckArrayItem)[0]->asBstr();
- const cppbor::Bstr* credentialPrivKeyItem = (*dckArrayItem)[1]->asBstr();
- if (storageKeyItem == nullptr || credentialPrivKeyItem == nullptr) {
- LOG(ERROR) << "CredentialKeys unexpected item types";
- return IIdentityCredentialStore::STATUS_INVALID_DATA;
- }
- storageKey_ = storageKeyItem->value();
- credentialPrivKey_ = credentialPrivKeyItem->value();
-
return IIdentityCredentialStore::STATUS_OK;
}
ndk::ScopedAStatus IdentityCredential::deleteCredential(
vector<uint8_t>* outProofOfDeletionSignature) {
- cppbor::Array array = {"ProofOfDeletion", docType_, testCredential_};
- vector<uint8_t> proofOfDeletion = array.encode();
+ return deleteCredentialCommon({}, false, outProofOfDeletionSignature);
+}
- optional<vector<uint8_t>> signature = support::coseSignEcDsa(credentialPrivKey_,
- proofOfDeletion, // payload
- {}, // additionalData
- {}); // certificateChain
+ndk::ScopedAStatus IdentityCredential::deleteCredentialWithChallenge(
+ const vector<uint8_t>& challenge, vector<uint8_t>* outProofOfDeletionSignature) {
+ return deleteCredentialCommon(challenge, true, outProofOfDeletionSignature);
+}
+
+ndk::ScopedAStatus IdentityCredential::deleteCredentialCommon(
+ const vector<uint8_t>& challenge, bool includeChallenge,
+ vector<uint8_t>* outProofOfDeletionSignature) {
+ if (challenge.size() > 32) {
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_INVALID_DATA, "Challenge too big"));
+ }
+
+ cppbor::Array array = {"ProofOfDeletion", docType_, testCredential_};
+ if (includeChallenge) {
+ array = {"ProofOfDeletion", docType_, challenge, testCredential_};
+ }
+
+ vector<uint8_t> proofOfDeletionCbor = array.encode();
+ vector<uint8_t> podDigest = support::sha256(proofOfDeletionCbor);
+
+ optional<vector<uint8_t>> signatureOfToBeSigned = hwProxy_->deleteCredential(
+ docType_, challenge, includeChallenge, proofOfDeletionCbor.size());
+ if (!signatureOfToBeSigned) {
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_FAILED, "Error signing ProofOfDeletion"));
+ }
+
+ optional<vector<uint8_t>> signature =
+ support::coseSignEcDsaWithSignature(signatureOfToBeSigned.value(),
+ proofOfDeletionCbor, // data
+ {}); // certificateChain
if (!signature) {
return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
IIdentityCredentialStore::STATUS_FAILED, "Error signing data"));
@@ -125,23 +126,61 @@
return ndk::ScopedAStatus::ok();
}
-ndk::ScopedAStatus IdentityCredential::createEphemeralKeyPair(vector<uint8_t>* outKeyPair) {
- optional<vector<uint8_t>> kp = support::createEcKeyPair();
- if (!kp) {
+ndk::ScopedAStatus IdentityCredential::proveOwnership(
+ const vector<uint8_t>& challenge, vector<uint8_t>* outProofOfOwnershipSignature) {
+ if (challenge.size() > 32) {
return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
- IIdentityCredentialStore::STATUS_FAILED, "Error creating ephemeral key pair"));
+ IIdentityCredentialStore::STATUS_INVALID_DATA, "Challenge too big"));
+ }
+
+ cppbor::Array array;
+ array = {"ProofOfOwnership", docType_, challenge, testCredential_};
+ vector<uint8_t> proofOfOwnershipCbor = array.encode();
+ vector<uint8_t> podDigest = support::sha256(proofOfOwnershipCbor);
+
+ optional<vector<uint8_t>> signatureOfToBeSigned = hwProxy_->proveOwnership(
+ docType_, testCredential_, challenge, proofOfOwnershipCbor.size());
+ if (!signatureOfToBeSigned) {
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_FAILED, "Error signing ProofOfOwnership"));
+ }
+
+ optional<vector<uint8_t>> signature =
+ support::coseSignEcDsaWithSignature(signatureOfToBeSigned.value(),
+ proofOfOwnershipCbor, // data
+ {}); // certificateChain
+ if (!signature) {
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_FAILED, "Error signing data"));
+ }
+
+ *outProofOfOwnershipSignature = signature.value();
+ return ndk::ScopedAStatus::ok();
+}
+
+ndk::ScopedAStatus IdentityCredential::createEphemeralKeyPair(vector<uint8_t>* outKeyPair) {
+ optional<vector<uint8_t>> ephemeralPriv = hwProxy_->createEphemeralKeyPair();
+ if (!ephemeralPriv) {
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_FAILED, "Error creating ephemeral key"));
+ }
+ optional<vector<uint8_t>> keyPair = support::ecPrivateKeyToKeyPair(ephemeralPriv.value());
+ if (!keyPair) {
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_FAILED, "Error creating ephemeral key-pair"));
}
// Stash public key of this key-pair for later check in startRetrieval().
- optional<vector<uint8_t>> publicKey = support::ecKeyPairGetPublicKey(kp.value());
+ optional<vector<uint8_t>> publicKey = support::ecKeyPairGetPublicKey(keyPair.value());
if (!publicKey) {
+ LOG(ERROR) << "Error getting public part of ephemeral key pair";
return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
IIdentityCredentialStore::STATUS_FAILED,
"Error getting public part of ephemeral key pair"));
}
ephemeralPublicKey_ = publicKey.value();
- *outKeyPair = kp.value();
+ *outKeyPair = keyPair.value();
return ndk::ScopedAStatus::ok();
}
@@ -152,109 +191,15 @@
}
ndk::ScopedAStatus IdentityCredential::createAuthChallenge(int64_t* outChallenge) {
- uint64_t challenge = 0;
- while (challenge == 0) {
- optional<vector<uint8_t>> bytes = support::getRandom(8);
- if (!bytes) {
- return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
- IIdentityCredentialStore::STATUS_FAILED,
- "Error getting random data for challenge"));
- }
-
- challenge = 0;
- for (size_t n = 0; n < bytes.value().size(); n++) {
- challenge |= ((bytes.value())[n] << (n * 8));
- }
+ optional<uint64_t> challenge = hwProxy_->createAuthChallenge();
+ if (!challenge) {
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_FAILED, "Error generating challenge"));
}
-
- *outChallenge = challenge;
- authChallenge_ = challenge;
+ *outChallenge = challenge.value();
return ndk::ScopedAStatus::ok();
}
-// TODO: this could be a lot faster if we did all the splitting and pubkey extraction
-// ahead of time.
-bool checkReaderAuthentication(const SecureAccessControlProfile& profile,
- const vector<uint8_t>& readerCertificateChain) {
- optional<vector<uint8_t>> acpPubKey =
- support::certificateChainGetTopMostKey(profile.readerCertificate.encodedCertificate);
- if (!acpPubKey) {
- LOG(ERROR) << "Error extracting public key from readerCertificate in profile";
- return false;
- }
-
- optional<vector<vector<uint8_t>>> certificatesInChain =
- support::certificateChainSplit(readerCertificateChain);
- if (!certificatesInChain) {
- LOG(ERROR) << "Error splitting readerCertificateChain";
- return false;
- }
- for (const vector<uint8_t>& certInChain : certificatesInChain.value()) {
- optional<vector<uint8_t>> certPubKey = support::certificateChainGetTopMostKey(certInChain);
- if (!certPubKey) {
- LOG(ERROR)
- << "Error extracting public key from certificate in chain presented by reader";
- return false;
- }
- if (acpPubKey.value() == certPubKey.value()) {
- return true;
- }
- }
- return false;
-}
-
-bool checkUserAuthentication(const SecureAccessControlProfile& profile,
- const VerificationToken& verificationToken,
- const HardwareAuthToken& authToken, uint64_t authChallenge) {
- if (profile.secureUserId != authToken.userId) {
- LOG(ERROR) << "secureUserId in profile (" << profile.secureUserId
- << ") differs from userId in authToken (" << authToken.userId << ")";
- return false;
- }
-
- if (verificationToken.timestamp.milliSeconds == 0) {
- LOG(ERROR) << "VerificationToken is not set";
- return false;
- }
- if (authToken.timestamp.milliSeconds == 0) {
- LOG(ERROR) << "AuthToken is not set";
- return false;
- }
-
- if (profile.timeoutMillis == 0) {
- if (authToken.challenge == 0) {
- LOG(ERROR) << "No challenge in authToken";
- return false;
- }
-
- if (authToken.challenge != int64_t(authChallenge)) {
- LOG(ERROR) << "Challenge in authToken (" << uint64_t(authToken.challenge) << ") "
- << "doesn't match the challenge we created (" << authChallenge << ")";
- return false;
- }
- return true;
- }
-
- // Timeout-based user auth follows. The verification token conveys what the
- // time is right now in the environment which generated the auth token. This
- // is what makes it possible to do timeout-based checks.
- //
- const Timestamp now = verificationToken.timestamp;
- if (authToken.timestamp.milliSeconds > now.milliSeconds) {
- LOG(ERROR) << "Timestamp in authToken (" << authToken.timestamp.milliSeconds
- << ") is in the future (now: " << now.milliSeconds << ")";
- return false;
- }
- if (now.milliSeconds > authToken.timestamp.milliSeconds + profile.timeoutMillis) {
- LOG(ERROR) << "Deadline for authToken (" << authToken.timestamp.milliSeconds << " + "
- << profile.timeoutMillis << " = "
- << (authToken.timestamp.milliSeconds + profile.timeoutMillis)
- << ") is in the past (now: " << now.milliSeconds << ")";
- return false;
- }
- return true;
-}
-
ndk::ScopedAStatus IdentityCredential::setRequestedNamespaces(
const vector<RequestNamespace>& requestNamespaces) {
requestNamespaces_ = requestNamespaces;
@@ -284,6 +229,7 @@
}
if (numStartRetrievalCalls_ > 0) {
if (sessionTranscript_ != sessionTranscript) {
+ LOG(ERROR) << "Session Transcript changed";
return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
IIdentityCredentialStore::STATUS_SESSION_TRANSCRIPT_MISMATCH,
"Passed-in SessionTranscript doesn't match previously used SessionTranscript"));
@@ -291,6 +237,40 @@
}
sessionTranscript_ = sessionTranscript;
+ // This resets various state in the TA...
+ if (!hwProxy_->startRetrieveEntries()) {
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_FAILED, "Error starting retrieving entries"));
+ }
+
+ optional<vector<uint8_t>> signatureOfToBeSigned;
+ if (readerSignature.size() > 0) {
+ signatureOfToBeSigned = support::coseSignGetSignature(readerSignature);
+ if (!signatureOfToBeSigned) {
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_READER_SIGNATURE_CHECK_FAILED,
+ "Error extracting signatureOfToBeSigned from COSE_Sign1"));
+ }
+ }
+
+ // Feed the auth token to secure hardware.
+ if (!hwProxy_->setAuthToken(authToken.challenge, authToken.userId, authToken.authenticatorId,
+ int(authToken.authenticatorType), authToken.timestamp.milliSeconds,
+ authToken.mac, verificationToken_.challenge,
+ verificationToken_.timestamp.milliSeconds,
+ int(verificationToken_.securityLevel), verificationToken_.mac)) {
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_INVALID_DATA, "Invalid Auth Token"));
+ }
+
+ // We'll be feeding ACPs interleaved with certificates from the reader
+ // certificate chain...
+ vector<SecureAccessControlProfile> remainingAcps = accessControlProfiles;
+
+ // ... and we'll use those ACPs to build up a 32-bit mask indicating which
+ // of the possible 32 ACPs grants access.
+ uint32_t accessControlProfileMask = 0;
+
// If there is a signature, validate that it was made with the top-most key in the
// certificate chain embedded in the COSE_Sign1 structure.
optional<vector<uint8_t>> readerCertificateChain;
@@ -302,45 +282,113 @@
"Unable to get reader certificate chain from COSE_Sign1"));
}
- if (!support::certificateChainValidate(readerCertificateChain.value())) {
+ // First, feed all the reader certificates to the secure hardware. We start
+ // at the end..
+ optional<vector<vector<uint8_t>>> splitCerts =
+ support::certificateChainSplit(readerCertificateChain.value());
+ if (!splitCerts || splitCerts.value().size() == 0) {
return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
IIdentityCredentialStore::STATUS_READER_SIGNATURE_CHECK_FAILED,
- "Error validating reader certificate chain"));
+ "Error splitting certificate chain from COSE_Sign1"));
+ }
+ for (ssize_t n = splitCerts.value().size() - 1; n >= 0; --n) {
+ const vector<uint8_t>& x509Cert = splitCerts.value()[n];
+ if (!hwProxy_->pushReaderCert(x509Cert)) {
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_READER_SIGNATURE_CHECK_FAILED,
+ StringPrintf("Error validating reader certificate %zd", n).c_str()));
+ }
+
+ // If we have ACPs for that particular certificate, send them to the
+ // TA right now...
+ //
+ // Remember in this case certificate equality is done by comparing public keys,
+ // not bitwise comparison of the certificates.
+ //
+ optional<vector<uint8_t>> x509CertPubKey =
+ support::certificateChainGetTopMostKey(x509Cert);
+ if (!x509CertPubKey) {
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_FAILED,
+ StringPrintf("Error getting public key from reader certificate %zd", n)
+ .c_str()));
+ }
+ vector<SecureAccessControlProfile>::iterator it = remainingAcps.begin();
+ while (it != remainingAcps.end()) {
+ const SecureAccessControlProfile& profile = *it;
+ if (profile.readerCertificate.encodedCertificate.size() == 0) {
+ ++it;
+ continue;
+ }
+ optional<vector<uint8_t>> profilePubKey = support::certificateChainGetTopMostKey(
+ profile.readerCertificate.encodedCertificate);
+ if (!profilePubKey) {
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_FAILED,
+ "Error getting public key from profile"));
+ }
+ if (profilePubKey.value() == x509CertPubKey.value()) {
+ optional<bool> res = hwProxy_->validateAccessControlProfile(
+ profile.id, profile.readerCertificate.encodedCertificate,
+ profile.userAuthenticationRequired, profile.timeoutMillis,
+ profile.secureUserId, profile.mac);
+ if (!res) {
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_INVALID_DATA,
+ "Error validating access control profile"));
+ }
+ if (res.value()) {
+ accessControlProfileMask |= (1 << profile.id);
+ }
+ it = remainingAcps.erase(it);
+ } else {
+ ++it;
+ }
+ }
}
- optional<vector<uint8_t>> readerPublicKey =
- support::certificateChainGetTopMostKey(readerCertificateChain.value());
- if (!readerPublicKey) {
- return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
- IIdentityCredentialStore::STATUS_READER_SIGNATURE_CHECK_FAILED,
- "Unable to get public key from reader certificate chain"));
- }
-
- const vector<uint8_t>& itemsRequestBytes = itemsRequest;
- vector<uint8_t> encodedReaderAuthentication =
- cppbor::Array()
- .add("ReaderAuthentication")
- .add(std::move(sessionTranscriptItem))
- .add(cppbor::Semantic(24, itemsRequestBytes))
- .encode();
- vector<uint8_t> encodedReaderAuthenticationBytes =
- cppbor::Semantic(24, encodedReaderAuthentication).encode();
- if (!support::coseCheckEcDsaSignature(readerSignature,
- encodedReaderAuthenticationBytes, // detached content
- readerPublicKey.value())) {
- return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
- IIdentityCredentialStore::STATUS_READER_SIGNATURE_CHECK_FAILED,
- "readerSignature check failed"));
+ // ... then pass the request message and have the TA check it's signed by the
+ // key in last certificate we pushed.
+ if (sessionTranscript.size() > 0 && itemsRequest.size() > 0 && readerSignature.size() > 0) {
+ optional<vector<uint8_t>> tbsSignature = support::coseSignGetSignature(readerSignature);
+ if (!tbsSignature) {
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_READER_SIGNATURE_CHECK_FAILED,
+ "Error extracting toBeSigned from COSE_Sign1"));
+ }
+ optional<int> coseSignAlg = support::coseSignGetAlg(readerSignature);
+ if (!coseSignAlg) {
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_READER_SIGNATURE_CHECK_FAILED,
+ "Error extracting signature algorithm from COSE_Sign1"));
+ }
+ if (!hwProxy_->validateRequestMessage(sessionTranscript, itemsRequest,
+ coseSignAlg.value(), tbsSignature.value())) {
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_READER_SIGNATURE_CHECK_FAILED,
+ "readerMessage is not signed by top-level certificate"));
+ }
}
}
- // Here's where we would validate the passed-in |authToken| to assure ourselves
- // that it comes from the e.g. biometric hardware and wasn't made up by an attacker.
- //
- // However this involves calculating the MAC. However this requires access
- // to the key needed to a pre-shared key which we don't have...
- //
+ // Feed remaining access control profiles...
+ for (const SecureAccessControlProfile& profile : remainingAcps) {
+ optional<bool> res = hwProxy_->validateAccessControlProfile(
+ profile.id, profile.readerCertificate.encodedCertificate,
+ profile.userAuthenticationRequired, profile.timeoutMillis, profile.secureUserId,
+ profile.mac);
+ if (!res) {
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_INVALID_DATA,
+ "Error validating access control profile"));
+ }
+ if (res.value()) {
+ accessControlProfileMask |= (1 << profile.id);
+ }
+ }
+ // TODO: move this check to the TA
+#if 1
// To prevent replay-attacks, we check that the public part of the ephemeral
// key we previously created, is present in the DeviceEngagement part of
// SessionTranscript as a COSE_Key, in uncompressed form.
@@ -364,6 +412,7 @@
"SessionTranscript (make sure leading zeroes are not used)"));
}
}
+#endif
// itemsRequest: If non-empty, contains request data that may be signed by the
// reader. The content can be defined in the way appropriate for the
@@ -463,30 +512,6 @@
}
}
- // Validate all the access control profiles in the requestData.
- bool haveAuthToken = (authToken.timestamp.milliSeconds != int64_t(0));
- for (const auto& profile : accessControlProfiles) {
- if (!secureAccessControlProfileCheckMac(profile, storageKey_)) {
- LOG(ERROR) << "Error checking MAC for profile";
- return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
- IIdentityCredentialStore::STATUS_INVALID_DATA,
- "Error checking MAC for profile"));
- }
- int accessControlCheck = IIdentityCredentialStore::STATUS_OK;
- if (profile.userAuthenticationRequired) {
- if (!haveAuthToken ||
- !checkUserAuthentication(profile, verificationToken_, authToken, authChallenge_)) {
- accessControlCheck = IIdentityCredentialStore::STATUS_USER_AUTHENTICATION_FAILED;
- }
- } else if (profile.readerCertificate.encodedCertificate.size() > 0) {
- if (!readerCertificateChain ||
- !checkReaderAuthentication(profile, readerCertificateChain.value())) {
- accessControlCheck = IIdentityCredentialStore::STATUS_READER_AUTHENTICATION_FAILED;
- }
- }
- profileIdToAccessCheckResult_[profile.id] = accessControlCheck;
- }
-
deviceNameSpacesMap_ = cppbor::Map();
currentNameSpaceDeviceNameSpacesMap_ = cppbor::Map();
@@ -496,8 +521,36 @@
itemsRequest_ = itemsRequest;
signingKeyBlob_ = signingKeyBlob;
- // Finally, calculate the size of DeviceNameSpaces. We need to know it ahead of time.
- expectedDeviceNameSpacesSize_ = calcDeviceNameSpacesSize();
+ // calculate the size of DeviceNameSpaces. We need to know it ahead of time.
+ calcDeviceNameSpacesSize(accessControlProfileMask);
+
+ // Count the number of non-empty namespaces
+ size_t numNamespacesWithValues = 0;
+ for (size_t n = 0; n < expectedNumEntriesPerNamespace_.size(); n++) {
+ if (expectedNumEntriesPerNamespace_[n] > 0) {
+ numNamespacesWithValues += 1;
+ }
+ }
+
+ // Finally, pass info so the HMAC key can be derived and the TA can start
+ // creating the DeviceNameSpaces CBOR...
+ if (sessionTranscript_.size() > 0 && readerPublicKey_.size() > 0 && signingKeyBlob.size() > 0) {
+ // We expect the reader ephemeral public key to be same size and curve
+ // as the ephemeral key we generated (e.g. P-256 key), otherwise ECDH
+ // won't work. So its length should be 65 bytes and it should be
+ // starting with 0x04.
+ if (readerPublicKey_.size() != 65 || readerPublicKey_[0] != 0x04) {
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_FAILED,
+ "Reader public key is not in expected format"));
+ }
+ vector<uint8_t> pubKeyP256(readerPublicKey_.begin() + 1, readerPublicKey_.end());
+ if (!hwProxy_->calcMacKey(sessionTranscript_, pubKeyP256, signingKeyBlob, docType_,
+ numNamespacesWithValues, expectedDeviceNameSpacesSize_)) {
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_FAILED, "Error starting retrieving entries"));
+ }
+ }
numStartRetrievalCalls_ += 1;
return ndk::ScopedAStatus::ok();
@@ -520,7 +573,7 @@
return 1 + cborNumBytesForLength(value.size()) + value.size();
}
-size_t IdentityCredential::calcDeviceNameSpacesSize() {
+void IdentityCredential::calcDeviceNameSpacesSize(uint32_t accessControlProfileMask) {
/*
* This is how DeviceNameSpaces is defined:
*
@@ -539,7 +592,7 @@
* encoded.
*/
size_t ret = 0;
- size_t numNamespacesWithValues = 0;
+ vector<unsigned int> numEntriesPerNamespace;
for (const RequestNamespace& rns : requestNamespaces_) {
vector<RequestDataItem> itemsToInclude;
@@ -562,13 +615,9 @@
//
bool authorized = false;
for (auto id : rdi.accessControlProfileIds) {
- auto it = profileIdToAccessCheckResult_.find(id);
- if (it != profileIdToAccessCheckResult_.end()) {
- int accessControlForProfile = it->second;
- if (accessControlForProfile == IIdentityCredentialStore::STATUS_OK) {
- authorized = true;
- break;
- }
+ if (accessControlProfileMask & (1 << id)) {
+ authorized = true;
+ break;
}
}
if (!authorized) {
@@ -578,7 +627,10 @@
itemsToInclude.push_back(rdi);
}
- // If no entries are to be in the namespace, we don't include it...
+ numEntriesPerNamespace.push_back(itemsToInclude.size());
+
+ // If no entries are to be in the namespace, we don't include it in
+ // the CBOR...
if (itemsToInclude.size() == 0) {
continue;
}
@@ -597,15 +649,14 @@
// that.
ret += item.size;
}
-
- numNamespacesWithValues++;
}
- // Now that we now the nunber of namespaces with values, we know how many
+ // Now that we know the number of namespaces with values, we know how many
// bytes the DeviceNamespaces map in the beginning is going to take up.
- ret += 1 + cborNumBytesForLength(numNamespacesWithValues);
+ ret += 1 + cborNumBytesForLength(numEntriesPerNamespace.size());
- return ret;
+ expectedDeviceNameSpacesSize_ = ret;
+ expectedNumEntriesPerNamespace_ = numEntriesPerNamespace;
}
ndk::ScopedAStatus IdentityCredential::startRetrieveEntryValue(
@@ -626,9 +677,11 @@
"No more name spaces left to go through"));
}
+ bool newNamespace;
if (currentNameSpace_ == "") {
// First call.
currentNameSpace_ = nameSpace;
+ newNamespace = true;
}
if (nameSpace == currentNameSpace_) {
@@ -655,6 +708,7 @@
requestCountsRemaining_.erase(requestCountsRemaining_.begin());
currentNameSpace_ = nameSpace;
+ newNamespace = true;
}
// It's permissible to have an empty itemsRequest... but if non-empty you can
@@ -674,35 +728,52 @@
}
}
- // Enforce access control.
- //
- // Access is granted if at least one of the profiles grants access.
- //
- // If an item is configured without any profiles, access is denied.
- //
- int accessControl = IIdentityCredentialStore::STATUS_NO_ACCESS_CONTROL_PROFILES;
- for (auto id : accessControlProfileIds) {
- auto search = profileIdToAccessCheckResult_.find(id);
- if (search == profileIdToAccessCheckResult_.end()) {
+ unsigned int newNamespaceNumEntries = 0;
+ if (newNamespace) {
+ if (expectedNumEntriesPerNamespace_.size() == 0) {
return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
IIdentityCredentialStore::STATUS_INVALID_DATA,
- "Requested entry with unvalidated profile id"));
+ "No more populated name spaces left to go through"));
}
- int accessControlForProfile = search->second;
- if (accessControlForProfile == IIdentityCredentialStore::STATUS_OK) {
- accessControl = IIdentityCredentialStore::STATUS_OK;
- break;
- }
- accessControl = accessControlForProfile;
- }
- if (accessControl != IIdentityCredentialStore::STATUS_OK) {
- return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
- int(accessControl), "Access control check failed"));
+ newNamespaceNumEntries = expectedNumEntriesPerNamespace_[0];
+ expectedNumEntriesPerNamespace_.erase(expectedNumEntriesPerNamespace_.begin());
}
- entryAdditionalData_ = entryCreateAdditionalData(nameSpace, name, accessControlProfileIds);
+ // Access control is enforced in the secure hardware.
+ //
+ // ... except for STATUS_NOT_IN_REQUEST_MESSAGE, that's handled above (TODO:
+ // consolidate).
+ //
+ AccessCheckResult res = hwProxy_->startRetrieveEntryValue(
+ nameSpace, name, newNamespaceNumEntries, entrySize, accessControlProfileIds);
+ switch (res) {
+ case AccessCheckResult::kOk:
+ /* Do nothing. */
+ break;
+ case AccessCheckResult::kFailed:
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_FAILED,
+ "Access control check failed (failed)"));
+ break;
+ case AccessCheckResult::kNoAccessControlProfiles:
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_NO_ACCESS_CONTROL_PROFILES,
+ "Access control check failed (no access control profiles)"));
+ break;
+ case AccessCheckResult::kUserAuthenticationFailed:
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_USER_AUTHENTICATION_FAILED,
+ "Access control check failed (user auth)"));
+ break;
+ case AccessCheckResult::kReaderAuthenticationFailed:
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_READER_AUTHENTICATION_FAILED,
+ "Access control check failed (reader auth)"));
+ break;
+ }
currentName_ = name;
+ currentAccessControlProfileIds_ = accessControlProfileIds;
entryRemainingBytes_ = entrySize;
entryValue_.resize(0);
@@ -711,8 +782,8 @@
ndk::ScopedAStatus IdentityCredential::retrieveEntryValue(const vector<uint8_t>& encryptedContent,
vector<uint8_t>* outContent) {
- optional<vector<uint8_t>> content =
- support::decryptAes128Gcm(storageKey_, encryptedContent, entryAdditionalData_);
+ optional<vector<uint8_t>> content = hwProxy_->retrieveEntryValue(
+ encryptedContent, currentNameSpace_, currentName_, currentAccessControlProfileIds_);
if (!content) {
return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
IIdentityCredentialStore::STATUS_INVALID_DATA, "Error decrypting data"));
@@ -777,28 +848,14 @@
optional<vector<uint8_t>> mac;
if (signingKeyBlob_.size() > 0 && sessionTranscript_.size() > 0 &&
readerPublicKey_.size() > 0) {
- vector<uint8_t> docTypeAsBlob(docType_.begin(), docType_.end());
- optional<vector<uint8_t>> signingKey =
- support::decryptAes128Gcm(storageKey_, signingKeyBlob_, docTypeAsBlob);
- if (!signingKey) {
+ optional<vector<uint8_t>> digestToBeMaced = hwProxy_->finishRetrieval();
+ if (!digestToBeMaced || digestToBeMaced.value().size() != 32) {
return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
IIdentityCredentialStore::STATUS_INVALID_DATA,
- "Error decrypting signingKeyBlob"));
+ "Error generating digestToBeMaced"));
}
-
- vector<uint8_t> sessionTranscriptBytes = cppbor::Semantic(24, sessionTranscript_).encode();
- optional<vector<uint8_t>> eMacKey =
- support::calcEMacKey(signingKey.value(), readerPublicKey_, sessionTranscriptBytes);
- if (!eMacKey) {
- return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
- IIdentityCredentialStore::STATUS_FAILED, "Error calculating EMacKey"));
- }
- mac = support::calcMac(sessionTranscript_, docType_, encodedDeviceNameSpaces,
- eMacKey.value());
- if (!mac) {
- return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
- IIdentityCredentialStore::STATUS_FAILED, "Error MACing data"));
- }
+ // Now construct COSE_Mac0 from the returned MAC...
+ mac = support::coseMacWithDigest(digestToBeMaced.value(), {} /* data */);
}
*outMac = mac.value_or(vector<uint8_t>({}));
@@ -808,56 +865,33 @@
ndk::ScopedAStatus IdentityCredential::generateSigningKeyPair(
vector<uint8_t>* outSigningKeyBlob, Certificate* outSigningKeyCertificate) {
- string serialDecimal = "1";
- string issuer = "Android Identity Credential Key";
- string subject = "Android Identity Credential Authentication Key";
- time_t validityNotBefore = time(nullptr);
- time_t validityNotAfter = validityNotBefore + 365 * 24 * 3600;
-
- optional<vector<uint8_t>> signingKeyPKCS8 = support::createEcKeyPair();
- if (!signingKeyPKCS8) {
+ time_t now = time(NULL);
+ optional<pair<vector<uint8_t>, vector<uint8_t>>> pair =
+ hwProxy_->generateSigningKeyPair(docType_, now);
+ if (!pair) {
return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
IIdentityCredentialStore::STATUS_FAILED, "Error creating signingKey"));
}
- optional<vector<uint8_t>> signingPublicKey =
- support::ecKeyPairGetPublicKey(signingKeyPKCS8.value());
- if (!signingPublicKey) {
- return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
- IIdentityCredentialStore::STATUS_FAILED,
- "Error getting public part of signingKey"));
- }
-
- optional<vector<uint8_t>> signingKey = support::ecKeyPairGetPrivateKey(signingKeyPKCS8.value());
- if (!signingKey) {
- return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
- IIdentityCredentialStore::STATUS_FAILED,
- "Error getting private part of signingKey"));
- }
-
- optional<vector<uint8_t>> certificate = support::ecPublicKeyGenerateCertificate(
- signingPublicKey.value(), credentialPrivKey_, serialDecimal, issuer, subject,
- validityNotBefore, validityNotAfter);
- if (!certificate) {
- return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
- IIdentityCredentialStore::STATUS_FAILED, "Error creating signingKey"));
- }
-
- optional<vector<uint8_t>> nonce = support::getRandom(12);
- if (!nonce) {
- return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
- IIdentityCredentialStore::STATUS_FAILED, "Error getting random"));
- }
- vector<uint8_t> docTypeAsBlob(docType_.begin(), docType_.end());
- optional<vector<uint8_t>> encryptedSigningKey = support::encryptAes128Gcm(
- storageKey_, nonce.value(), signingKey.value(), docTypeAsBlob);
- if (!encryptedSigningKey) {
- return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
- IIdentityCredentialStore::STATUS_FAILED, "Error encrypting signingKey"));
- }
- *outSigningKeyBlob = encryptedSigningKey.value();
*outSigningKeyCertificate = Certificate();
- outSigningKeyCertificate->encodedCertificate = certificate.value();
+ outSigningKeyCertificate->encodedCertificate = pair->first;
+
+ *outSigningKeyBlob = pair->second;
+ return ndk::ScopedAStatus::ok();
+}
+
+ndk::ScopedAStatus IdentityCredential::updateCredential(
+ shared_ptr<IWritableIdentityCredential>* outWritableCredential) {
+ sp<SecureHardwareProvisioningProxy> hwProxy = hwProxyFactory_->createProvisioningProxy();
+ shared_ptr<WritableIdentityCredential> wc =
+ ndk::SharedRefBase::make<WritableIdentityCredential>(hwProxy, docType_,
+ testCredential_);
+ if (!wc->initializeForUpdate(encryptedCredentialKeys_)) {
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_FAILED,
+ "Error initializing WritableIdentityCredential for update"));
+ }
+ *outWritableCredential = wc;
return ndk::ScopedAStatus::ok();
}
diff --git a/identity/aidl/default/IdentityCredential.h b/identity/aidl/default/common/IdentityCredential.h
similarity index 75%
rename from identity/aidl/default/IdentityCredential.h
rename to identity/aidl/default/common/IdentityCredential.h
index a8a6409..9913b86 100644
--- a/identity/aidl/default/IdentityCredential.h
+++ b/identity/aidl/default/common/IdentityCredential.h
@@ -29,10 +29,15 @@
#include <cppbor/cppbor.h>
+#include "IdentityCredentialStore.h"
+#include "SecureHardwareProxy.h"
+
namespace aidl::android::hardware::identity {
using ::aidl::android::hardware::keymaster::HardwareAuthToken;
using ::aidl::android::hardware::keymaster::VerificationToken;
+using ::android::sp;
+using ::android::hardware::identity::SecureHardwarePresentationProxy;
using ::std::map;
using ::std::set;
using ::std::string;
@@ -40,10 +45,13 @@
class IdentityCredential : public BnIdentityCredential {
public:
- IdentityCredential(const vector<uint8_t>& credentialData)
- : credentialData_(credentialData),
+ IdentityCredential(sp<SecureHardwareProxyFactory> hwProxyFactory,
+ sp<SecureHardwarePresentationProxy> hwProxy,
+ const vector<uint8_t>& credentialData)
+ : hwProxyFactory_(hwProxyFactory),
+ hwProxy_(hwProxy),
+ credentialData_(credentialData),
numStartRetrievalCalls_(0),
- authChallenge_(0),
expectedDeviceNameSpacesSize_(0) {}
// Parses and decrypts credentialData_, return a status code from
@@ -52,6 +60,11 @@
// Methods from IIdentityCredential follow.
ndk::ScopedAStatus deleteCredential(vector<uint8_t>* outProofOfDeletionSignature) override;
+ ndk::ScopedAStatus deleteCredentialWithChallenge(
+ const vector<uint8_t>& challenge,
+ vector<uint8_t>* outProofOfDeletionSignature) override;
+ ndk::ScopedAStatus proveOwnership(const vector<uint8_t>& challenge,
+ vector<uint8_t>* outProofOfOwnershipSignature) override;
ndk::ScopedAStatus createEphemeralKeyPair(vector<uint8_t>* outKeyPair) override;
ndk::ScopedAStatus setReaderEphemeralPublicKey(const vector<uint8_t>& publicKey) override;
ndk::ScopedAStatus createAuthChallenge(int64_t* outChallenge) override;
@@ -73,16 +86,24 @@
ndk::ScopedAStatus generateSigningKeyPair(vector<uint8_t>* outSigningKeyBlob,
Certificate* outSigningKeyCertificate) override;
+ ndk::ScopedAStatus updateCredential(
+ shared_ptr<IWritableIdentityCredential>* outWritableCredential) override;
+
private:
+ ndk::ScopedAStatus deleteCredentialCommon(const vector<uint8_t>& challenge,
+ bool includeChallenge,
+ vector<uint8_t>* outProofOfDeletionSignature);
+
// Set by constructor
+ sp<SecureHardwareProxyFactory> hwProxyFactory_;
+ sp<SecureHardwarePresentationProxy> hwProxy_;
vector<uint8_t> credentialData_;
int numStartRetrievalCalls_;
// Set by initialize()
string docType_;
bool testCredential_;
- vector<uint8_t> storageKey_;
- vector<uint8_t> credentialPrivKey_;
+ vector<uint8_t> encryptedCredentialKeys_;
// Set by createEphemeralKeyPair()
vector<uint8_t> ephemeralPublicKey_;
@@ -90,9 +111,6 @@
// Set by setReaderEphemeralPublicKey()
vector<uint8_t> readerPublicKey_;
- // Set by createAuthChallenge()
- uint64_t authChallenge_;
-
// Set by setRequestedNamespaces()
vector<RequestNamespace> requestNamespaces_;
@@ -100,7 +118,6 @@
VerificationToken verificationToken_;
// Set at startRetrieval() time.
- map<int32_t, int> profileIdToAccessCheckResult_;
vector<uint8_t> signingKeyBlob_;
vector<uint8_t> sessionTranscript_;
vector<uint8_t> itemsRequest_;
@@ -111,15 +128,16 @@
// Calculated at startRetrieval() time.
size_t expectedDeviceNameSpacesSize_;
+ vector<unsigned int> expectedNumEntriesPerNamespace_;
// Set at startRetrieveEntryValue() time.
string currentNameSpace_;
string currentName_;
+ vector<int32_t> currentAccessControlProfileIds_;
size_t entryRemainingBytes_;
vector<uint8_t> entryValue_;
- vector<uint8_t> entryAdditionalData_;
- size_t calcDeviceNameSpacesSize();
+ void calcDeviceNameSpacesSize(uint32_t accessControlProfileMask);
};
} // namespace aidl::android::hardware::identity
diff --git a/identity/aidl/default/IdentityCredentialStore.cpp b/identity/aidl/default/common/IdentityCredentialStore.cpp
similarity index 89%
rename from identity/aidl/default/IdentityCredentialStore.cpp
rename to identity/aidl/default/common/IdentityCredentialStore.cpp
index 30dc6f3..e6b5466 100644
--- a/identity/aidl/default/IdentityCredentialStore.cpp
+++ b/identity/aidl/default/common/IdentityCredentialStore.cpp
@@ -39,8 +39,9 @@
ndk::ScopedAStatus IdentityCredentialStore::createCredential(
const string& docType, bool testCredential,
shared_ptr<IWritableIdentityCredential>* outWritableCredential) {
+ sp<SecureHardwareProvisioningProxy> hwProxy = hwProxyFactory_->createProvisioningProxy();
shared_ptr<WritableIdentityCredential> wc =
- ndk::SharedRefBase::make<WritableIdentityCredential>(docType, testCredential);
+ ndk::SharedRefBase::make<WritableIdentityCredential>(hwProxy, docType, testCredential);
if (!wc->initialize()) {
return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
IIdentityCredentialStore::STATUS_FAILED,
@@ -60,8 +61,9 @@
"Unsupported cipher suite"));
}
+ sp<SecureHardwarePresentationProxy> hwProxy = hwProxyFactory_->createPresentationProxy();
shared_ptr<IdentityCredential> credential =
- ndk::SharedRefBase::make<IdentityCredential>(credentialData);
+ ndk::SharedRefBase::make<IdentityCredential>(hwProxyFactory_, hwProxy, credentialData);
auto ret = credential->initialize();
if (ret != IIdentityCredentialStore::STATUS_OK) {
return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
diff --git a/identity/aidl/default/IdentityCredentialStore.h b/identity/aidl/default/common/IdentityCredentialStore.h
similarity index 85%
rename from identity/aidl/default/IdentityCredentialStore.h
rename to identity/aidl/default/common/IdentityCredentialStore.h
index 4f3a421..d35e632 100644
--- a/identity/aidl/default/IdentityCredentialStore.h
+++ b/identity/aidl/default/common/IdentityCredentialStore.h
@@ -19,15 +19,20 @@
#include <aidl/android/hardware/identity/BnIdentityCredentialStore.h>
+#include "SecureHardwareProxy.h"
+
namespace aidl::android::hardware::identity {
+using ::android::sp;
+using ::android::hardware::identity::SecureHardwareProxyFactory;
using ::std::shared_ptr;
using ::std::string;
using ::std::vector;
class IdentityCredentialStore : public BnIdentityCredentialStore {
public:
- IdentityCredentialStore() {}
+ IdentityCredentialStore(sp<SecureHardwareProxyFactory> hwProxyFactory)
+ : hwProxyFactory_(hwProxyFactory) {}
// The GCM chunk size used by this implementation is 64 KiB.
static constexpr size_t kGcmChunkSize = 64 * 1024;
@@ -41,6 +46,9 @@
ndk::ScopedAStatus getCredential(CipherSuite cipherSuite, const vector<uint8_t>& credentialData,
shared_ptr<IIdentityCredential>* outCredential) override;
+
+ private:
+ sp<SecureHardwareProxyFactory> hwProxyFactory_;
};
} // namespace aidl::android::hardware::identity
diff --git a/identity/aidl/default/common/SecureHardwareProxy.h b/identity/aidl/default/common/SecureHardwareProxy.h
new file mode 100644
index 0000000..a1ed1ef
--- /dev/null
+++ b/identity/aidl/default/common/SecureHardwareProxy.h
@@ -0,0 +1,183 @@
+/*
+ * Copyright 2020, The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_HARDWARE_IDENTITY_SECUREHARDWAREPROXY_H
+#define ANDROID_HARDWARE_IDENTITY_SECUREHARDWAREPROXY_H
+
+#include <utils/RefBase.h>
+#include <optional>
+#include <string>
+#include <utility>
+#include <vector>
+
+namespace android::hardware::identity {
+
+using ::android::RefBase;
+using ::std::optional;
+using ::std::pair;
+using ::std::string;
+using ::std::vector;
+
+// These classes are used to communicate with Secure Hardware. They mimic the
+// API in libEmbeddedIC 1:1 (except for using C++ types) as each call is intended
+// to be forwarded to the Secure Hardware.
+//
+// Instances are instantiated when a provisioning or presentation session
+// starts. When the session is complete, the shutdown() method is called.
+//
+
+// Forward declare.
+//
+class SecureHardwareProvisioningProxy;
+class SecureHardwarePresentationProxy;
+
+// This is a class used to create proxies.
+//
+class SecureHardwareProxyFactory : public RefBase {
+ public:
+ SecureHardwareProxyFactory() {}
+ virtual ~SecureHardwareProxyFactory() {}
+
+ virtual sp<SecureHardwareProvisioningProxy> createProvisioningProxy() = 0;
+ virtual sp<SecureHardwarePresentationProxy> createPresentationProxy() = 0;
+};
+
+// The proxy used for provisioning.
+//
+class SecureHardwareProvisioningProxy : public RefBase {
+ public:
+ SecureHardwareProvisioningProxy() {}
+ virtual ~SecureHardwareProvisioningProxy() {}
+
+ virtual bool initialize(bool testCredential) = 0;
+
+ virtual bool initializeForUpdate(bool testCredential, string docType,
+ vector<uint8_t> encryptedCredentialKeys) = 0;
+
+ // Returns public key certificate chain with attestation.
+ //
+ // This must return an entire certificate chain and its implementation must
+ // be coordinated with the implementation of eicOpsCreateCredentialKey() on
+ // the TA side (which may return just a single certificate or the entire
+ // chain).
+ virtual optional<vector<uint8_t>> createCredentialKey(const vector<uint8_t>& challenge,
+ const vector<uint8_t>& applicationId) = 0;
+
+ virtual bool startPersonalization(int accessControlProfileCount, vector<int> entryCounts,
+ const string& docType,
+ size_t expectedProofOfProvisioningSize) = 0;
+
+ // Returns MAC (28 bytes).
+ virtual optional<vector<uint8_t>> addAccessControlProfile(
+ int id, const vector<uint8_t>& readerCertificate, bool userAuthenticationRequired,
+ uint64_t timeoutMillis, uint64_t secureUserId) = 0;
+
+ virtual bool beginAddEntry(const vector<int>& accessControlProfileIds, const string& nameSpace,
+ const string& name, uint64_t entrySize) = 0;
+
+ // Returns encryptedContent.
+ virtual optional<vector<uint8_t>> addEntryValue(const vector<int>& accessControlProfileIds,
+ const string& nameSpace, const string& name,
+ const vector<uint8_t>& content) = 0;
+
+ // Returns signatureOfToBeSigned (EIC_ECDSA_P256_SIGNATURE_SIZE bytes).
+ virtual optional<vector<uint8_t>> finishAddingEntries() = 0;
+
+ // Returns encryptedCredentialKeys (80 bytes).
+ virtual optional<vector<uint8_t>> finishGetCredentialData(const string& docType) = 0;
+
+ virtual bool shutdown() = 0;
+};
+
+enum AccessCheckResult {
+ kOk,
+ kFailed,
+ kNoAccessControlProfiles,
+ kUserAuthenticationFailed,
+ kReaderAuthenticationFailed,
+};
+
+// The proxy used for presentation.
+//
+class SecureHardwarePresentationProxy : public RefBase {
+ public:
+ SecureHardwarePresentationProxy() {}
+ virtual ~SecureHardwarePresentationProxy() {}
+
+ virtual bool initialize(bool testCredential, string docType,
+ vector<uint8_t> encryptedCredentialKeys) = 0;
+
+ // Returns publicKeyCert (1st component) and signingKeyBlob (2nd component)
+ virtual optional<pair<vector<uint8_t>, vector<uint8_t>>> generateSigningKeyPair(string docType,
+ time_t now) = 0;
+
+ // Returns private key
+ virtual optional<vector<uint8_t>> createEphemeralKeyPair() = 0;
+
+ virtual optional<uint64_t> createAuthChallenge() = 0;
+
+ virtual bool startRetrieveEntries() = 0;
+
+ virtual bool setAuthToken(uint64_t challenge, uint64_t secureUserId, uint64_t authenticatorId,
+ int hardwareAuthenticatorType, uint64_t timeStamp,
+ const vector<uint8_t>& mac, uint64_t verificationTokenChallenge,
+ uint64_t verificationTokenTimestamp,
+ int verificationTokenSecurityLevel,
+ const vector<uint8_t>& verificationTokenMac) = 0;
+
+ virtual bool pushReaderCert(const vector<uint8_t>& certX509) = 0;
+
+ virtual optional<bool> validateAccessControlProfile(int id,
+ const vector<uint8_t>& readerCertificate,
+ bool userAuthenticationRequired,
+ int timeoutMillis, uint64_t secureUserId,
+ const vector<uint8_t>& mac) = 0;
+
+ virtual bool validateRequestMessage(const vector<uint8_t>& sessionTranscript,
+ const vector<uint8_t>& requestMessage, int coseSignAlg,
+ const vector<uint8_t>& readerSignatureOfToBeSigned) = 0;
+
+ virtual bool calcMacKey(const vector<uint8_t>& sessionTranscript,
+ const vector<uint8_t>& readerEphemeralPublicKey,
+ const vector<uint8_t>& signingKeyBlob, const string& docType,
+ unsigned int numNamespacesWithValues,
+ size_t expectedProofOfProvisioningSize) = 0;
+
+ virtual AccessCheckResult startRetrieveEntryValue(
+ const string& nameSpace, const string& name, unsigned int newNamespaceNumEntries,
+ int32_t entrySize, const vector<int32_t>& accessControlProfileIds) = 0;
+
+ virtual optional<vector<uint8_t>> retrieveEntryValue(
+ const vector<uint8_t>& encryptedContent, const string& nameSpace, const string& name,
+ const vector<int32_t>& accessControlProfileIds) = 0;
+
+ virtual optional<vector<uint8_t>> finishRetrieval();
+
+ virtual optional<vector<uint8_t>> deleteCredential(const string& docType,
+ const vector<uint8_t>& challenge,
+ bool includeChallenge,
+ size_t proofOfDeletionCborSize) = 0;
+
+ virtual optional<vector<uint8_t>> proveOwnership(const string& docType, bool testCredential,
+ const vector<uint8_t>& challenge,
+ size_t proofOfOwnershipCborSize) = 0;
+
+ virtual bool shutdown() = 0;
+};
+
+} // namespace android::hardware::identity
+
+#endif // ANDROID_HARDWARE_IDENTITY_SECUREHARDWAREPROXY_H
diff --git a/identity/aidl/default/WritableIdentityCredential.cpp b/identity/aidl/default/common/WritableIdentityCredential.cpp
similarity index 70%
rename from identity/aidl/default/WritableIdentityCredential.cpp
rename to identity/aidl/default/common/WritableIdentityCredential.cpp
index 141b4de..2d897c7 100644
--- a/identity/aidl/default/WritableIdentityCredential.cpp
+++ b/identity/aidl/default/common/WritableIdentityCredential.cpp
@@ -17,7 +17,6 @@
#define LOG_TAG "WritableIdentityCredential"
#include "WritableIdentityCredential.h"
-#include "IdentityCredentialStore.h"
#include <android/hardware/identity/support/IdentityCredentialSupport.h>
@@ -30,8 +29,8 @@
#include <utility>
#include "IdentityCredentialStore.h"
-#include "Util.h"
-#include "WritableIdentityCredential.h"
+
+#include "FakeSecureHardwareProxy.h"
namespace aidl::android::hardware::identity {
@@ -40,74 +39,68 @@
using namespace ::android::hardware::identity;
bool WritableIdentityCredential::initialize() {
- optional<vector<uint8_t>> random = support::getRandom(16);
- if (!random) {
- LOG(ERROR) << "Error creating storageKey";
+ if (!hwProxy_->initialize(testCredential_)) {
+ LOG(ERROR) << "hwProxy->initialize() failed";
return false;
}
- storageKey_ = random.value();
startPersonalizationCalled_ = false;
firstEntry_ = true;
return true;
}
-// This function generates the attestation certificate using the passed in
-// |attestationApplicationId| and |attestationChallenge|. It will generate an
-// attestation certificate with current time and expires one year from now. The
-// certificate shall contain all values as specified in hal.
+// Used when updating a credential. Returns false on failure.
+bool WritableIdentityCredential::initializeForUpdate(
+ const vector<uint8_t>& encryptedCredentialKeys) {
+ if (!hwProxy_->initializeForUpdate(testCredential_, docType_, encryptedCredentialKeys)) {
+ LOG(ERROR) << "hwProxy->initializeForUpdate() failed";
+ return false;
+ }
+ startPersonalizationCalled_ = false;
+ firstEntry_ = true;
+
+ return true;
+}
+
+WritableIdentityCredential::~WritableIdentityCredential() {}
+
ndk::ScopedAStatus WritableIdentityCredential::getAttestationCertificate(
- const vector<uint8_t>& attestationApplicationId, //
- const vector<uint8_t>& attestationChallenge, //
- vector<Certificate>* outCertificateChain) {
- if (!credentialPrivKey_.empty() || !credentialPubKey_.empty() || !certificateChain_.empty()) {
+ const vector<uint8_t>& attestationApplicationId,
+ const vector<uint8_t>& attestationChallenge, vector<Certificate>* outCertificateChain) {
+ if (getAttestationCertificateAlreadyCalled_) {
return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
IIdentityCredentialStore::STATUS_FAILED,
"Error attestation certificate previously generated"));
}
+ getAttestationCertificateAlreadyCalled_ = true;
+
if (attestationChallenge.empty()) {
return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
IIdentityCredentialStore::STATUS_INVALID_DATA, "Challenge can not be empty"));
}
- vector<uint8_t> challenge(attestationChallenge.begin(), attestationChallenge.end());
- vector<uint8_t> appId(attestationApplicationId.begin(), attestationApplicationId.end());
-
- optional<std::pair<vector<uint8_t>, vector<vector<uint8_t>>>> keyAttestationPair =
- support::createEcKeyPairAndAttestation(challenge, appId, testCredential_);
- if (!keyAttestationPair) {
- LOG(ERROR) << "Error creating credentialKey and attestation";
+ optional<vector<uint8_t>> certChain =
+ hwProxy_->createCredentialKey(attestationChallenge, attestationApplicationId);
+ if (!certChain) {
return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
IIdentityCredentialStore::STATUS_FAILED,
- "Error creating credentialKey and attestation"));
+ "Error generating attestation certificate chain"));
}
- vector<uint8_t> keyPair = keyAttestationPair.value().first;
- certificateChain_ = keyAttestationPair.value().second;
-
- optional<vector<uint8_t>> pubKey = support::ecKeyPairGetPublicKey(keyPair);
- if (!pubKey) {
+ optional<vector<vector<uint8_t>>> certs = support::certificateChainSplit(certChain.value());
+ if (!certs) {
return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
IIdentityCredentialStore::STATUS_FAILED,
- "Error getting public part of credentialKey"));
+ "Error splitting chain into separate certificates"));
}
- credentialPubKey_ = pubKey.value();
- optional<vector<uint8_t>> privKey = support::ecKeyPairGetPrivateKey(keyPair);
- if (!privKey) {
- return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
- IIdentityCredentialStore::STATUS_FAILED,
- "Error getting private part of credentialKey"));
- }
- credentialPrivKey_ = privKey.value();
-
- // convert from vector<vector<uint8_t>>> to vector<Certificate>*
*outCertificateChain = vector<Certificate>();
- for (const vector<uint8_t>& cert : certificateChain_) {
+ for (const vector<uint8_t>& cert : certs.value()) {
Certificate c = Certificate();
c.encodedCertificate = cert;
outCertificateChain->push_back(std::move(c));
}
+
return ndk::ScopedAStatus::ok();
}
@@ -123,8 +116,8 @@
return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
IIdentityCredentialStore::STATUS_FAILED, "startPersonalization called already"));
}
-
startPersonalizationCalled_ = true;
+
numAccessControlProfileRemaining_ = accessControlProfileCount;
remainingEntryCounts_ = entryCounts;
entryNameSpace_ = "";
@@ -133,6 +126,12 @@
signedDataNamespaces_ = cppbor::Map();
signedDataCurrentNamespace_ = cppbor::Array();
+ if (!hwProxy_->startPersonalization(accessControlProfileCount, entryCounts, docType_,
+ expectedProofOfProvisioningSize_)) {
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_FAILED, "eicStartPersonalization"));
+ }
+
return ndk::ScopedAStatus::ok();
}
@@ -140,8 +139,6 @@
int32_t id, const Certificate& readerCertificate, bool userAuthenticationRequired,
int64_t timeoutMillis, int64_t secureUserId,
SecureAccessControlProfile* outSecureAccessControlProfile) {
- SecureAccessControlProfile profile;
-
if (numAccessControlProfileRemaining_ == 0) {
return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
IIdentityCredentialStore::STATUS_INVALID_DATA,
@@ -169,25 +166,21 @@
"userAuthenticationRequired is false but timeout is non-zero"));
}
- // If |userAuthenticationRequired| is true, then |secureUserId| must be non-zero.
- if (userAuthenticationRequired && secureUserId == 0) {
+ optional<vector<uint8_t>> mac = hwProxy_->addAccessControlProfile(
+ id, readerCertificate.encodedCertificate, userAuthenticationRequired, timeoutMillis,
+ secureUserId);
+ if (!mac) {
return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
- IIdentityCredentialStore::STATUS_INVALID_DATA,
- "userAuthenticationRequired is true but secureUserId is zero"));
+ IIdentityCredentialStore::STATUS_FAILED, "eicAddAccessControlProfile"));
}
+ SecureAccessControlProfile profile;
profile.id = id;
profile.readerCertificate = readerCertificate;
profile.userAuthenticationRequired = userAuthenticationRequired;
profile.timeoutMillis = timeoutMillis;
profile.secureUserId = secureUserId;
- optional<vector<uint8_t>> mac = secureAccessControlProfileCalcMac(profile, storageKey_);
- if (!mac) {
- return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
- IIdentityCredentialStore::STATUS_FAILED, "Error calculating MAC for profile"));
- }
profile.mac = mac.value();
-
cppbor::Map profileMap;
profileMap.add("id", profile.id);
if (profile.readerCertificate.encodedCertificate.size() > 0) {
@@ -261,14 +254,18 @@
remainingEntryCounts_[0] -= 1;
}
- entryAdditionalData_ = entryCreateAdditionalData(nameSpace, name, accessControlProfileIds);
-
entryRemainingBytes_ = entrySize;
entryNameSpace_ = nameSpace;
entryName_ = name;
entryAccessControlProfileIds_ = accessControlProfileIds;
entryBytes_.resize(0);
// LOG(INFO) << "name=" << name << " entrySize=" << entrySize;
+
+ if (!hwProxy_->beginAddEntry(accessControlProfileIds, nameSpace, name, entrySize)) {
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_FAILED, "eicBeginAddEntry"));
+ }
+
return ndk::ScopedAStatus::ok();
}
@@ -297,16 +294,11 @@
}
}
- optional<vector<uint8_t>> nonce = support::getRandom(12);
- if (!nonce) {
- return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
- IIdentityCredentialStore::STATUS_FAILED, "Error getting nonce"));
- }
- optional<vector<uint8_t>> encryptedContent =
- support::encryptAes128Gcm(storageKey_, nonce.value(), content, entryAdditionalData_);
+ optional<vector<uint8_t>> encryptedContent = hwProxy_->addEntryValue(
+ entryAccessControlProfileIds_, entryNameSpace_, entryName_, content);
if (!encryptedContent) {
return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
- IIdentityCredentialStore::STATUS_FAILED, "Error encrypting content"));
+ IIdentityCredentialStore::STATUS_FAILED, "eicAddEntryValue"));
}
if (entryRemainingBytes_ == 0) {
@@ -332,50 +324,6 @@
return ndk::ScopedAStatus::ok();
}
-// Writes CBOR-encoded structure to |credentialKeys| containing |storageKey| and
-// |credentialPrivKey|.
-static bool generateCredentialKeys(const vector<uint8_t>& storageKey,
- const vector<uint8_t>& credentialPrivKey,
- vector<uint8_t>& credentialKeys) {
- if (storageKey.size() != 16) {
- LOG(ERROR) << "Size of storageKey is not 16";
- return false;
- }
-
- cppbor::Array array;
- array.add(cppbor::Bstr(storageKey));
- array.add(cppbor::Bstr(credentialPrivKey));
- credentialKeys = array.encode();
- return true;
-}
-
-// Writes CBOR-encoded structure to |credentialData| containing |docType|,
-// |testCredential| and |credentialKeys|. The latter element will be stored in
-// encrypted form, using |hardwareBoundKey| as the encryption key.
-bool generateCredentialData(const vector<uint8_t>& hardwareBoundKey, const string& docType,
- bool testCredential, const vector<uint8_t>& credentialKeys,
- vector<uint8_t>& credentialData) {
- optional<vector<uint8_t>> nonce = support::getRandom(12);
- if (!nonce) {
- LOG(ERROR) << "Error getting random";
- return false;
- }
- vector<uint8_t> docTypeAsVec(docType.begin(), docType.end());
- optional<vector<uint8_t>> credentialBlob = support::encryptAes128Gcm(
- hardwareBoundKey, nonce.value(), credentialKeys, docTypeAsVec);
- if (!credentialBlob) {
- LOG(ERROR) << "Error encrypting CredentialKeys blob";
- return false;
- }
-
- cppbor::Array array;
- array.add(docType);
- array.add(testCredential);
- array.add(cppbor::Bstr(credentialBlob.value()));
- credentialData = array.encode();
- return true;
-}
-
ndk::ScopedAStatus WritableIdentityCredential::finishAddingEntries(
vector<uint8_t>* outCredentialData, vector<uint8_t>* outProofOfProvisioningSignature) {
if (numAccessControlProfileRemaining_ != 0) {
@@ -411,31 +359,37 @@
.c_str()));
}
- optional<vector<uint8_t>> signature = support::coseSignEcDsa(credentialPrivKey_,
- encodedCbor, // payload
- {}, // additionalData
- {}); // certificateChain
+ optional<vector<uint8_t>> signatureOfToBeSigned = hwProxy_->finishAddingEntries();
+ if (!signatureOfToBeSigned) {
+ return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
+ IIdentityCredentialStore::STATUS_FAILED, "eicFinishAddingEntries"));
+ }
+
+ optional<vector<uint8_t>> signature =
+ support::coseSignEcDsaWithSignature(signatureOfToBeSigned.value(),
+ encodedCbor, // data
+ {}); // certificateChain
if (!signature) {
return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
IIdentityCredentialStore::STATUS_FAILED, "Error signing data"));
}
- vector<uint8_t> credentialKeys;
- if (!generateCredentialKeys(storageKey_, credentialPrivKey_, credentialKeys)) {
+ optional<vector<uint8_t>> encryptedCredentialKeys = hwProxy_->finishGetCredentialData(docType_);
+ if (!encryptedCredentialKeys) {
return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
- IIdentityCredentialStore::STATUS_FAILED, "Error generating CredentialKeys"));
+ IIdentityCredentialStore::STATUS_FAILED,
+ "Error generating encrypted CredentialKeys"));
}
-
- vector<uint8_t> credentialData;
- if (!generateCredentialData(
- testCredential_ ? support::getTestHardwareBoundKey() : getHardwareBoundKey(),
- docType_, testCredential_, credentialKeys, credentialData)) {
- return ndk::ScopedAStatus(AStatus_fromServiceSpecificErrorWithMessage(
- IIdentityCredentialStore::STATUS_FAILED, "Error generating CredentialData"));
- }
+ cppbor::Array array;
+ array.add(docType_);
+ array.add(testCredential_);
+ array.add(encryptedCredentialKeys.value());
+ vector<uint8_t> credentialData = array.encode();
*outCredentialData = credentialData;
*outProofOfProvisioningSignature = signature.value();
+ hwProxy_->shutdown();
+
return ndk::ScopedAStatus::ok();
}
diff --git a/identity/aidl/default/WritableIdentityCredential.h b/identity/aidl/default/common/WritableIdentityCredential.h
similarity index 78%
rename from identity/aidl/default/WritableIdentityCredential.h
rename to identity/aidl/default/common/WritableIdentityCredential.h
index 5645852..36ad430 100644
--- a/identity/aidl/default/WritableIdentityCredential.h
+++ b/identity/aidl/default/common/WritableIdentityCredential.h
@@ -23,21 +23,35 @@
#include <cppbor.h>
#include <set>
+#include "IdentityCredentialStore.h"
+#include "SecureHardwareProxy.h"
+
namespace aidl::android::hardware::identity {
+using ::android::sp;
+using ::android::hardware::identity::SecureHardwareProvisioningProxy;
using ::std::set;
using ::std::string;
using ::std::vector;
class WritableIdentityCredential : public BnWritableIdentityCredential {
public:
- WritableIdentityCredential(const string& docType, bool testCredential)
- : docType_(docType), testCredential_(testCredential) {}
+ // For a new credential, call initialize() right after construction.
+ //
+ // For an updated credential, call initializeForUpdate() right after construction.
+ //
+ WritableIdentityCredential(sp<SecureHardwareProvisioningProxy> hwProxy, const string& docType,
+ bool testCredential)
+ : hwProxy_(hwProxy), docType_(docType), testCredential_(testCredential) {}
- // Creates the Credential Key. Returns false on failure. Must be called
- // right after construction.
+ ~WritableIdentityCredential();
+
+ // Creates the Credential Key. Returns false on failure.
bool initialize();
+ // Used when updating a credential. Returns false on failure.
+ bool initializeForUpdate(const vector<uint8_t>& encryptedCredentialKeys);
+
// Methods from IWritableIdentityCredential follow.
ndk::ScopedAStatus getAttestationCertificate(const vector<uint8_t>& attestationApplicationId,
const vector<uint8_t>& attestationChallenge,
@@ -57,7 +71,6 @@
ndk::ScopedAStatus beginAddEntry(const vector<int32_t>& accessControlProfileIds,
const string& nameSpace, const string& name,
int32_t entrySize) override;
-
ndk::ScopedAStatus addEntryValue(const vector<uint8_t>& content,
vector<uint8_t>* outEncryptedContent) override;
@@ -66,18 +79,17 @@
vector<uint8_t>* outProofOfProvisioningSignature) override;
private:
+ // Set by constructor.
+ sp<SecureHardwareProvisioningProxy> hwProxy_;
string docType_;
bool testCredential_;
// This is set in initialize().
- vector<uint8_t> storageKey_;
bool startPersonalizationCalled_;
bool firstEntry_;
- // These are set in getAttestationCertificate().
- vector<uint8_t> credentialPrivKey_;
- vector<uint8_t> credentialPubKey_;
- vector<vector<uint8_t>> certificateChain_;
+ // This is set in getAttestationCertificate().
+ bool getAttestationCertificateAlreadyCalled_ = false;
// These fields are initialized during startPersonalization()
size_t numAccessControlProfileRemaining_;
@@ -92,7 +104,6 @@
// These fields are initialized during beginAddEntry()
size_t entryRemainingBytes_;
- vector<uint8_t> entryAdditionalData_;
string entryNameSpace_;
string entryName_;
vector<int32_t> entryAccessControlProfileIds_;
diff --git a/identity/aidl/default/identity-default.xml b/identity/aidl/default/identity-default.xml
index a47d354..a074250 100644
--- a/identity/aidl/default/identity-default.xml
+++ b/identity/aidl/default/identity-default.xml
@@ -1,6 +1,7 @@
<manifest version="1.0" type="device">
<hal format="aidl">
<name>android.hardware.identity</name>
+ <version>3</version>
<interface>
<name>IIdentityCredentialStore</name>
<instance>default</instance>
diff --git a/identity/aidl/default/libeic/EicCbor.c b/identity/aidl/default/libeic/EicCbor.c
new file mode 100644
index 0000000..fe131eb
--- /dev/null
+++ b/identity/aidl/default/libeic/EicCbor.c
@@ -0,0 +1,245 @@
+/*
+ * Copyright 2020, The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "EicCbor.h"
+
+void eicCborInit(EicCbor* cbor, uint8_t* buffer, size_t bufferSize) {
+ eicMemSet(cbor, '\0', sizeof(EicCbor));
+ cbor->size = 0;
+ cbor->bufferSize = bufferSize;
+ cbor->buffer = buffer;
+ cbor->digestType = EIC_CBOR_DIGEST_TYPE_SHA256;
+ eicOpsSha256Init(&cbor->digester.sha256);
+}
+
+void eicCborInitHmacSha256(EicCbor* cbor, uint8_t* buffer, size_t bufferSize,
+ const uint8_t* hmacKey, size_t hmacKeySize) {
+ eicMemSet(cbor, '\0', sizeof(EicCbor));
+ cbor->size = 0;
+ cbor->bufferSize = bufferSize;
+ cbor->buffer = buffer;
+ cbor->digestType = EIC_CBOR_DIGEST_TYPE_HMAC_SHA256;
+ eicOpsHmacSha256Init(&cbor->digester.hmacSha256, hmacKey, hmacKeySize);
+}
+
+void eicCborEnableSecondaryDigesterSha256(EicCbor* cbor, EicSha256Ctx* sha256) {
+ cbor->secondaryDigesterSha256 = sha256;
+}
+
+void eicCborFinal(EicCbor* cbor, uint8_t digest[EIC_SHA256_DIGEST_SIZE]) {
+ switch (cbor->digestType) {
+ case EIC_CBOR_DIGEST_TYPE_SHA256:
+ eicOpsSha256Final(&cbor->digester.sha256, digest);
+ break;
+ case EIC_CBOR_DIGEST_TYPE_HMAC_SHA256:
+ eicOpsHmacSha256Final(&cbor->digester.hmacSha256, digest);
+ break;
+ }
+}
+
+void eicCborAppend(EicCbor* cbor, const uint8_t* data, size_t size) {
+ switch (cbor->digestType) {
+ case EIC_CBOR_DIGEST_TYPE_SHA256:
+ eicOpsSha256Update(&cbor->digester.sha256, data, size);
+ break;
+ case EIC_CBOR_DIGEST_TYPE_HMAC_SHA256:
+ eicOpsHmacSha256Update(&cbor->digester.hmacSha256, data, size);
+ break;
+ }
+ if (cbor->secondaryDigesterSha256 != NULL) {
+ eicOpsSha256Update(cbor->secondaryDigesterSha256, data, size);
+ }
+
+ if (cbor->size >= cbor->bufferSize) {
+ cbor->size += size;
+ return;
+ }
+
+ size_t numBytesLeft = cbor->bufferSize - cbor->size;
+ size_t numBytesToCopy = size;
+ if (numBytesToCopy > numBytesLeft) {
+ numBytesToCopy = numBytesLeft;
+ }
+ eicMemCpy(cbor->buffer + cbor->size, data, numBytesToCopy);
+
+ cbor->size += size;
+}
+
+size_t eicCborAdditionalLengthBytesFor(size_t size) {
+ if (size < 24) {
+ return 0;
+ } else if (size <= 0xff) {
+ return 1;
+ } else if (size <= 0xffff) {
+ return 2;
+ } else if (size <= 0xffffffff) {
+ return 4;
+ }
+ return 8;
+}
+
+void eicCborBegin(EicCbor* cbor, int majorType, size_t size) {
+ uint8_t data[9];
+
+ if (size < 24) {
+ data[0] = (majorType << 5) | size;
+ eicCborAppend(cbor, data, 1);
+ } else if (size <= 0xff) {
+ data[0] = (majorType << 5) | 24;
+ data[1] = size;
+ eicCborAppend(cbor, data, 2);
+ } else if (size <= 0xffff) {
+ data[0] = (majorType << 5) | 25;
+ data[1] = size >> 8;
+ data[2] = size & 0xff;
+ eicCborAppend(cbor, data, 3);
+ } else if (size <= 0xffffffff) {
+ data[0] = (majorType << 5) | 26;
+ data[1] = (size >> 24) & 0xff;
+ data[2] = (size >> 16) & 0xff;
+ data[3] = (size >> 8) & 0xff;
+ data[4] = size & 0xff;
+ eicCborAppend(cbor, data, 5);
+ } else {
+ data[0] = (majorType << 5) | 24;
+ data[1] = (((uint64_t)size) >> 56) & 0xff;
+ data[2] = (((uint64_t)size) >> 48) & 0xff;
+ data[3] = (((uint64_t)size) >> 40) & 0xff;
+ data[4] = (((uint64_t)size) >> 32) & 0xff;
+ data[5] = (((uint64_t)size) >> 24) & 0xff;
+ data[6] = (((uint64_t)size) >> 16) & 0xff;
+ data[7] = (((uint64_t)size) >> 8) & 0xff;
+ data[8] = ((uint64_t)size) & 0xff;
+ eicCborAppend(cbor, data, 9);
+ }
+}
+
+void eicCborAppendByteString(EicCbor* cbor, const uint8_t* data, size_t dataSize) {
+ eicCborBegin(cbor, EIC_CBOR_MAJOR_TYPE_BYTE_STRING, dataSize);
+ eicCborAppend(cbor, data, dataSize);
+}
+
+void eicCborAppendString(EicCbor* cbor, const char* str) {
+ size_t length = eicStrLen(str);
+ eicCborBegin(cbor, EIC_CBOR_MAJOR_TYPE_STRING, length);
+ eicCborAppend(cbor, (const uint8_t*)str, length);
+}
+
+void eicCborAppendSimple(EicCbor* cbor, uint8_t simpleValue) {
+ eicCborBegin(cbor, EIC_CBOR_MAJOR_TYPE_SIMPLE, simpleValue);
+}
+
+void eicCborAppendBool(EicCbor* cbor, bool value) {
+ uint8_t simpleValue = value ? EIC_CBOR_SIMPLE_VALUE_TRUE : EIC_CBOR_SIMPLE_VALUE_FALSE;
+ eicCborAppendSimple(cbor, simpleValue);
+}
+
+void eicCborAppendSemantic(EicCbor* cbor, uint64_t value) {
+ size_t encoded = value;
+ eicCborBegin(cbor, EIC_CBOR_MAJOR_TYPE_SEMANTIC, encoded);
+}
+
+void eicCborAppendUnsigned(EicCbor* cbor, uint64_t value) {
+ size_t encoded = value;
+ eicCborBegin(cbor, EIC_CBOR_MAJOR_TYPE_UNSIGNED, encoded);
+}
+
+void eicCborAppendNumber(EicCbor* cbor, int64_t value) {
+ if (value < 0) {
+ size_t encoded = -1 - value;
+ eicCborBegin(cbor, EIC_CBOR_MAJOR_TYPE_NEGATIVE, encoded);
+ } else {
+ eicCborAppendUnsigned(cbor, value);
+ }
+}
+
+void eicCborAppendArray(EicCbor* cbor, size_t numElements) {
+ eicCborBegin(cbor, EIC_CBOR_MAJOR_TYPE_ARRAY, numElements);
+}
+
+void eicCborAppendMap(EicCbor* cbor, size_t numPairs) {
+ eicCborBegin(cbor, EIC_CBOR_MAJOR_TYPE_MAP, numPairs);
+}
+
+bool eicCborCalcAccessControl(EicCbor* cborBuilder, int id, const uint8_t* readerCertificate,
+ size_t readerCertificateSize, bool userAuthenticationRequired,
+ uint64_t timeoutMillis, uint64_t secureUserId) {
+ size_t numPairs = 1;
+ if (readerCertificateSize > 0) {
+ numPairs += 1;
+ }
+ if (userAuthenticationRequired) {
+ numPairs += 2;
+ if (secureUserId > 0) {
+ numPairs += 1;
+ }
+ }
+ eicCborAppendMap(cborBuilder, numPairs);
+ eicCborAppendString(cborBuilder, "id");
+ eicCborAppendUnsigned(cborBuilder, id);
+ if (readerCertificateSize > 0) {
+ eicCborAppendString(cborBuilder, "readerCertificate");
+ eicCborAppendByteString(cborBuilder, readerCertificate, readerCertificateSize);
+ }
+ if (userAuthenticationRequired) {
+ eicCborAppendString(cborBuilder, "userAuthenticationRequired");
+ eicCborAppendBool(cborBuilder, userAuthenticationRequired);
+ eicCborAppendString(cborBuilder, "timeoutMillis");
+ eicCborAppendUnsigned(cborBuilder, timeoutMillis);
+ if (secureUserId > 0) {
+ eicCborAppendString(cborBuilder, "secureUserId");
+ eicCborAppendUnsigned(cborBuilder, secureUserId);
+ }
+ }
+
+ if (cborBuilder->size > cborBuilder->bufferSize) {
+ eicDebug("Buffer for ACP CBOR is too small (%zd) - need %zd bytes", cborBuilder->bufferSize,
+ cborBuilder->size);
+ return false;
+ }
+
+ return true;
+}
+
+bool eicCborCalcEntryAdditionalData(const int* accessControlProfileIds,
+ size_t numAccessControlProfileIds, const char* nameSpace,
+ const char* name, uint8_t* cborBuffer, size_t cborBufferSize,
+ size_t* outAdditionalDataCborSize,
+ uint8_t additionalDataSha256[EIC_SHA256_DIGEST_SIZE]) {
+ EicCbor cborBuilder;
+
+ eicCborInit(&cborBuilder, cborBuffer, cborBufferSize);
+ eicCborAppendMap(&cborBuilder, 3);
+ eicCborAppendString(&cborBuilder, "Namespace");
+ eicCborAppendString(&cborBuilder, nameSpace);
+ eicCborAppendString(&cborBuilder, "Name");
+ eicCborAppendString(&cborBuilder, name);
+ eicCborAppendString(&cborBuilder, "AccessControlProfileIds");
+ eicCborAppendArray(&cborBuilder, numAccessControlProfileIds);
+ for (size_t n = 0; n < numAccessControlProfileIds; n++) {
+ eicCborAppendNumber(&cborBuilder, accessControlProfileIds[n]);
+ }
+ if (cborBuilder.size > cborBufferSize) {
+ eicDebug("Not enough space for additionalData - buffer is only %zd bytes, content is %zd",
+ cborBufferSize, cborBuilder.size);
+ return false;
+ }
+ if (outAdditionalDataCborSize != NULL) {
+ *outAdditionalDataCborSize = cborBuilder.size;
+ }
+ eicCborFinal(&cborBuilder, additionalDataSha256);
+ return true;
+}
diff --git a/identity/aidl/default/libeic/EicCbor.h b/identity/aidl/default/libeic/EicCbor.h
new file mode 100644
index 0000000..9c0f531
--- /dev/null
+++ b/identity/aidl/default/libeic/EicCbor.h
@@ -0,0 +1,167 @@
+/*
+ * Copyright 2020, The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#if !defined(EIC_INSIDE_LIBEIC_H) && !defined(EIC_COMPILATION)
+#error "Never include this file directly, include libeic.h instead."
+#endif
+
+#ifndef ANDROID_HARDWARE_IDENTITY_EIC_CBOR_H
+#define ANDROID_HARDWARE_IDENTITY_EIC_CBOR_H
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#include "EicOps.h"
+
+typedef enum {
+ EIC_CBOR_DIGEST_TYPE_SHA256,
+ EIC_CBOR_DIGEST_TYPE_HMAC_SHA256,
+} EicCborDigestType;
+
+/* EicCbor is a utility class to build CBOR data structures and calculate
+ * digests on the fly.
+ */
+typedef struct {
+ // Contains the size of the built CBOR, even if it exceeds bufferSize (will
+ // never write to buffer beyond bufferSize though)
+ size_t size;
+
+ // The size of the buffer. Is zero if no data is recorded in which case
+ // only digesting is performed.
+ size_t bufferSize;
+
+ // Whether we're producing a SHA-256 or HMAC-SHA256 digest.
+ EicCborDigestType digestType;
+
+ // The SHA-256 digester object.
+ union {
+ EicSha256Ctx sha256;
+ EicHmacSha256Ctx hmacSha256;
+ } digester;
+
+ // The secondary digester, may be unset.
+ EicSha256Ctx* secondaryDigesterSha256;
+
+ // The buffer used for building up CBOR or NULL if bufferSize is 0.
+ uint8_t* buffer;
+} EicCbor;
+
+/* Initializes an EicCbor.
+ *
+ * The given buffer will be used, up to bufferSize.
+ *
+ * If bufferSize is 0, buffer may be NULL.
+ */
+void eicCborInit(EicCbor* cbor, uint8_t* buffer, size_t bufferSize);
+
+/* Like eicCborInit() but uses HMAC-SHA256 instead of SHA-256.
+ */
+void eicCborInitHmacSha256(EicCbor* cbor, uint8_t* buffer, size_t bufferSize,
+ const uint8_t* hmacKey, size_t hmacKeySize);
+
+/* Enables a secondary digester.
+ *
+ * May be enabled midway through processing, this can be used to e.g. calculate
+ * a digest of Sig_structure (for COSE_Sign1) and a separate digest of its
+ * payload.
+ */
+void eicCborEnableSecondaryDigesterSha256(EicCbor* cbor, EicSha256Ctx* sha256);
+
+/* Finishes building CBOR and returns the digest. */
+void eicCborFinal(EicCbor* cbor, uint8_t digest[EIC_SHA256_DIGEST_SIZE]);
+
+/* Appends CBOR data to the EicCbor. */
+void eicCborAppend(EicCbor* cbor, const uint8_t* data, size_t size);
+
+#define EIC_CBOR_MAJOR_TYPE_UNSIGNED 0
+#define EIC_CBOR_MAJOR_TYPE_NEGATIVE 1
+#define EIC_CBOR_MAJOR_TYPE_BYTE_STRING 2
+#define EIC_CBOR_MAJOR_TYPE_STRING 3
+#define EIC_CBOR_MAJOR_TYPE_ARRAY 4
+#define EIC_CBOR_MAJOR_TYPE_MAP 5
+#define EIC_CBOR_MAJOR_TYPE_SEMANTIC 6
+#define EIC_CBOR_MAJOR_TYPE_SIMPLE 7
+
+#define EIC_CBOR_SIMPLE_VALUE_FALSE 20
+#define EIC_CBOR_SIMPLE_VALUE_TRUE 21
+
+#define EIC_CBOR_SEMANTIC_TAG_ENCODED_CBOR 24
+
+/* Begins a new CBOR value. */
+void eicCborBegin(EicCbor* cbor, int majorType, size_t size);
+
+/* Appends a bytestring. */
+void eicCborAppendByteString(EicCbor* cbor, const uint8_t* data, size_t dataSize);
+
+/* Appends a NUL-terminated UTF-8 string. */
+void eicCborAppendString(EicCbor* cbor, const char* str);
+
+/* Appends a simple value. */
+void eicCborAppendSimple(EicCbor* cbor, uint8_t simpleValue);
+
+/* Appends a boolean. */
+void eicCborAppendBool(EicCbor* cbor, bool value);
+
+/* Appends a semantic */
+void eicCborAppendSemantic(EicCbor* cbor, uint64_t value);
+
+/* Appends an unsigned number. */
+void eicCborAppendUnsigned(EicCbor* cbor, uint64_t value);
+
+/* Appends a number. */
+void eicCborAppendNumber(EicCbor* cbor, int64_t value);
+
+/* Starts appending an array.
+ *
+ * After this numElements CBOR elements must follow.
+ */
+void eicCborAppendArray(EicCbor* cbor, size_t numElements);
+
+/* Starts appending a map.
+ *
+ * After this numPairs pairs of CBOR elements must follow.
+ */
+void eicCborAppendMap(EicCbor* cbor, size_t numPairs);
+
+/* Calculates how many bytes are needed to store a size. */
+size_t eicCborAdditionalLengthBytesFor(size_t size);
+
+bool eicCborCalcAccessControl(EicCbor* cborBuilder, int id, const uint8_t* readerCertificate,
+ size_t readerCertificateSize, bool userAuthenticationRequired,
+ uint64_t timeoutMillis, uint64_t secureUserId);
+
+bool eicCborCalcEntryAdditionalData(const int* accessControlProfileIds,
+ size_t numAccessControlProfileIds, const char* nameSpace,
+ const char* name, uint8_t* cborBuffer, size_t cborBufferSize,
+ size_t* outAdditionalDataCborSize,
+ uint8_t additionalDataSha256[EIC_SHA256_DIGEST_SIZE]);
+
+// The maximum size of an encoded Secure Access Control Profile that we
+// support. Since the SACP may contain a reader certificate chain these can get
+// pretty big.
+//
+// Currently we allocate space on the stack for this structure which is why we
+// have a maximum size. We can get rid of the maximum size by incrementally
+// building/verifying the SACP. TODO: actually do this.
+//
+#define EIC_MAX_CBOR_SIZE_FOR_ACCESS_CONTROL_PROFILE 512
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif // ANDROID_HARDWARE_IDENTITY_EIC_CBOR_H
diff --git a/identity/aidl/default/libeic/EicOps.h b/identity/aidl/default/libeic/EicOps.h
new file mode 100644
index 0000000..d4fcf0e
--- /dev/null
+++ b/identity/aidl/default/libeic/EicOps.h
@@ -0,0 +1,302 @@
+/*
+ * Copyright 2020, The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#if !defined(EIC_INSIDE_LIBEIC_H) && !defined(EIC_COMPILATION)
+#error "Never include this file directly, include libeic.h instead."
+#endif
+
+#ifndef ANDROID_HARDWARE_IDENTITY_EIC_OPS_H
+#define ANDROID_HARDWARE_IDENTITY_EIC_OPS_H
+
+#include <stdarg.h>
+#include <stdbool.h>
+#include <stddef.h>
+#include <stdlib.h>
+
+// Uncomment or define if debug messages are needed.
+//
+//#define EIC_DEBUG
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+// The following defines must be set to something appropriate
+//
+// EIC_SHA256_CONTEXT_SIZE - the size of EicSha256Ctx
+// EIC_HMAC_SHA256_CONTEXT_SIZE - the size of EicHmacSha256Ctx
+//
+// For example, if EicSha256Ctx is implemented using BoringSSL this would be defined
+// as sizeof(SHA256_CTX).
+//
+// We expect the implementation to provide a header file with the name
+// EicOpsImpl.h to do all this.
+//
+#include "EicOpsImpl.h"
+
+#define EIC_SHA256_DIGEST_SIZE 32
+
+// The size of a P-256 private key.
+//
+#define EIC_P256_PRIV_KEY_SIZE 32
+
+// The size of a P-256 public key in uncompressed form.
+//
+// The public key is stored in uncompressed form, first the X coordinate, then
+// the Y coordinate.
+//
+#define EIC_P256_PUB_KEY_SIZE 64
+
+// Size of one of the coordinates in a curve-point.
+//
+#define EIC_P256_COORDINATE_SIZE 32
+
+// The size of an ECSDA signature using P-256.
+//
+// The R and S values are stored here, first R then S.
+//
+#define EIC_ECDSA_P256_SIGNATURE_SIZE 64
+
+#define EIC_AES_128_KEY_SIZE 16
+
+// The following are definitions of implementation functions the
+// underlying platform must provide.
+//
+
+struct EicSha256Ctx {
+ uint8_t reserved[EIC_SHA256_CONTEXT_SIZE];
+};
+typedef struct EicSha256Ctx EicSha256Ctx;
+
+struct EicHmacSha256Ctx {
+ uint8_t reserved[EIC_HMAC_SHA256_CONTEXT_SIZE];
+};
+typedef struct EicHmacSha256Ctx EicHmacSha256Ctx;
+
+#ifdef EIC_DEBUG
+// Debug macro. Don't include a new-line in message.
+//
+#define eicDebug(...) \
+ do { \
+ eicPrint("%s:%d: ", __FILE__, __LINE__); \
+ eicPrint(__VA_ARGS__); \
+ eicPrint("\n"); \
+ } while (0)
+#else
+#define eicDebug(...) \
+ do { \
+ } while (0)
+#endif
+
+// Prints message which should include new-line character. Can be no-op.
+//
+// Don't use this from code, use eicDebug() instead.
+//
+#ifdef EIC_DEBUG
+void eicPrint(const char* format, ...);
+#else
+inline void eicPrint(const char*, ...) {}
+#endif
+
+// Dumps data as pretty-printed hex. Can be no-op.
+//
+#ifdef EIC_DEBUG
+void eicHexdump(const char* message, const uint8_t* data, size_t dataSize);
+#else
+inline void eicHexdump(const char*, const uint8_t*, size_t) {}
+#endif
+
+// Pretty-prints encoded CBOR. Can be no-op.
+//
+// If a byte-string is larger than |maxBStrSize| its contents will not be
+// printed, instead the value of the form "<bstr size=1099016
+// sha1=ef549cca331f73dfae2090e6a37c04c23f84b07b>" will be printed. Pass zero
+// for |maxBStrSize| to disable this.
+//
+#ifdef EIC_DEBUG
+void eicCborPrettyPrint(const uint8_t* cborData, size_t cborDataSize, size_t maxBStrSize);
+#else
+inline void eicCborPrettyPrint(const uint8_t*, size_t, size_t) {}
+#endif
+
+// Memory setting, see memset(3).
+void* eicMemSet(void* s, int c, size_t n);
+
+// Memory copying, see memcpy(3).
+void* eicMemCpy(void* dest, const void* src, size_t n);
+
+// String length, see strlen(3).
+size_t eicStrLen(const char* s);
+
+// Memory compare, see CRYPTO_memcmp(3SSL)
+//
+// It takes an amount of time dependent on len, but independent of the contents of the
+// memory regions pointed to by s1 and s2.
+//
+int eicCryptoMemCmp(const void* s1, const void* s2, size_t n);
+
+// Random number generation.
+bool eicOpsRandom(uint8_t* buf, size_t numBytes);
+
+// If |testCredential| is true, returns the 128-bit AES Hardware-Bound Key (16 bytes).
+//
+// Otherwise returns all zeroes (16 bytes).
+//
+const uint8_t* eicOpsGetHardwareBoundKey(bool testCredential);
+
+// Encrypts |data| with |key| and |additionalAuthenticatedData| using |nonce|,
+// returns the resulting (nonce || ciphertext || tag) in |encryptedData| which
+// must be of size |dataSize| + 28.
+bool eicOpsEncryptAes128Gcm(
+ const uint8_t* key, // Must be 16 bytes
+ const uint8_t* nonce, // Must be 12 bytes
+ const uint8_t* data, // May be NULL if size is 0
+ size_t dataSize,
+ const uint8_t* additionalAuthenticationData, // May be NULL if size is 0
+ size_t additionalAuthenticationDataSize, uint8_t* encryptedData);
+
+// Decrypts |encryptedData| using |key| and |additionalAuthenticatedData|,
+// returns resulting plaintext in |data| must be of size |encryptedDataSize| - 28.
+//
+// The format of |encryptedData| must be as specified in the
+// encryptAes128Gcm() function.
+bool eicOpsDecryptAes128Gcm(const uint8_t* key, // Must be 16 bytes
+ const uint8_t* encryptedData, size_t encryptedDataSize,
+ const uint8_t* additionalAuthenticationData,
+ size_t additionalAuthenticationDataSize, uint8_t* data);
+
+// Creates an EC key using the P-256 curve. The private key is written to
+// |privateKey|. The public key is written to |publicKey|.
+//
+bool eicOpsCreateEcKey(uint8_t privateKey[EIC_P256_PRIV_KEY_SIZE],
+ uint8_t publicKey[EIC_P256_PUB_KEY_SIZE]);
+
+// Generates CredentialKey plus an attestation certificate.
+//
+// The attestation certificate will be signed by the attestation keys the secure
+// area has been provisioned with. The given |challenge| and |applicationId|
+// will be used as will |testCredential|.
+//
+// The generated certificate will be in X.509 format and returned in |cert|
+// and |certSize| must be set to the size of this array and this function will
+// set it to the size of the certification chain on successfully return.
+//
+// This may return either a single certificate or an entire certificate
+// chain. If it returns only a single certificate, the implementation of
+// SecureHardwareProvisioningProxy::createCredentialKey() should amend the
+// remainder of the certificate chain on the HAL side.
+//
+bool eicOpsCreateCredentialKey(uint8_t privateKey[EIC_P256_PRIV_KEY_SIZE], const uint8_t* challenge,
+ size_t challengeSize, const uint8_t* applicationId,
+ size_t applicationIdSize, bool testCredential, uint8_t* cert,
+ size_t* certSize); // inout
+
+// Generate an X.509 certificate for the key identified by |publicKey| which
+// must be of the form returned by eicOpsCreateEcKey().
+//
+// If proofOfBinding is not NULL, it will be included as an OCTET_STRING
+// X.509 extension at OID 1.3.6.1.4.1.11129.2.1.26.
+//
+// The certificate will be signed by the key identified by |signingKey| which
+// must be of the form returned by eicOpsCreateEcKey().
+//
+bool eicOpsSignEcKey(const uint8_t publicKey[EIC_P256_PUB_KEY_SIZE],
+ const uint8_t signingKey[EIC_P256_PRIV_KEY_SIZE], unsigned int serial,
+ const char* issuerName, const char* subjectName, time_t validityNotBefore,
+ time_t validityNotAfter, const uint8_t* proofOfBinding,
+ size_t proofOfBindingSize, uint8_t* cert, size_t* certSize); // inout
+
+// Uses |privateKey| to create an ECDSA signature of some data (the SHA-256 must
+// be given by |digestOfData|). Returns the signature in |signature|.
+//
+bool eicOpsEcDsa(const uint8_t privateKey[EIC_P256_PRIV_KEY_SIZE],
+ const uint8_t digestOfData[EIC_SHA256_DIGEST_SIZE],
+ uint8_t signature[EIC_ECDSA_P256_SIGNATURE_SIZE]);
+
+// Performs Elliptic Curve Diffie-Helman.
+//
+bool eicOpsEcdh(const uint8_t publicKey[EIC_P256_PUB_KEY_SIZE],
+ const uint8_t privateKey[EIC_P256_PRIV_KEY_SIZE],
+ uint8_t sharedSecret[EIC_P256_COORDINATE_SIZE]);
+
+// Performs HKDF.
+//
+bool eicOpsHkdf(const uint8_t* sharedSecret, size_t sharedSecretSize, const uint8_t* salt,
+ size_t saltSize, const uint8_t* info, size_t infoSize, uint8_t* output,
+ size_t outputSize);
+
+// SHA-256 functions.
+void eicOpsSha256Init(EicSha256Ctx* ctx);
+void eicOpsSha256Update(EicSha256Ctx* ctx, const uint8_t* data, size_t len);
+void eicOpsSha256Final(EicSha256Ctx* ctx, uint8_t digest[EIC_SHA256_DIGEST_SIZE]);
+
+// HMAC SHA-256 functions.
+void eicOpsHmacSha256Init(EicHmacSha256Ctx* ctx, const uint8_t* key, size_t keySize);
+void eicOpsHmacSha256Update(EicHmacSha256Ctx* ctx, const uint8_t* data, size_t len);
+void eicOpsHmacSha256Final(EicHmacSha256Ctx* ctx, uint8_t digest[EIC_SHA256_DIGEST_SIZE]);
+
+// Extracts the public key in the given X.509 certificate.
+//
+// If the key is not an EC key, this function fails.
+//
+// Otherwise the public key is stored in uncompressed form in |publicKey| which
+// size should be set in |publicKeySize|. On successful return |publicKeySize|
+// is set to the length of the key. If there is not enough space, the function
+// fails.
+//
+// (The public key returned is not necessarily a P-256 key, even if it is note
+// that its size is not EIC_P256_PUBLIC_KEY_SIZE because of the leading 0x04.)
+//
+bool eicOpsX509GetPublicKey(const uint8_t* x509Cert, size_t x509CertSize, uint8_t* publicKey,
+ size_t* publicKeySize);
+
+// Checks that the X.509 certificate given by |x509Cert| is signed by the public
+// key given by |publicKey| which must be an EC key in uncompressed form (e.g.
+// same formatt as returned by eicOpsX509GetPublicKey()).
+//
+bool eicOpsX509CertSignedByPublicKey(const uint8_t* x509Cert, size_t x509CertSize,
+ const uint8_t* publicKey, size_t publicKeySize);
+
+// Checks that |signature| is a signature of some data (given by |digest|),
+// signed by the public key given by |publicKey|.
+//
+// The key must be an EC key in uncompressed form (e.g. same format as returned
+// by eicOpsX509GetPublicKey()).
+//
+// The format of the signature is the same encoding as the 'signature' field of
+// COSE_Sign1 - that is, it's the R and S integers both with the same length as
+// the key-size.
+//
+// The size of digest must match the size of the key.
+//
+bool eicOpsEcDsaVerifyWithPublicKey(const uint8_t* digest, size_t digestSize,
+ const uint8_t* signature, size_t signatureSize,
+ const uint8_t* publicKey, size_t publicKeySize);
+
+// Validates that the passed in data constitutes a valid auth- and verification tokens.
+//
+bool eicOpsValidateAuthToken(uint64_t challenge, uint64_t secureUserId, uint64_t authenticatorId,
+ int hardwareAuthenticatorType, uint64_t timeStamp, const uint8_t* mac,
+ size_t macSize, uint64_t verificationTokenChallenge,
+ uint64_t verificationTokenTimeStamp,
+ int verificationTokenSecurityLevel,
+ const uint8_t* verificationTokenMac, size_t verificationTokenMacSize);
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif // ANDROID_HARDWARE_IDENTITY_EIC_OPS_H
diff --git a/identity/aidl/default/libeic/EicPresentation.c b/identity/aidl/default/libeic/EicPresentation.c
new file mode 100644
index 0000000..5e9a280
--- /dev/null
+++ b/identity/aidl/default/libeic/EicPresentation.c
@@ -0,0 +1,850 @@
+/*
+ * Copyright 2020, The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "EicPresentation.h"
+
+#include <inttypes.h>
+
+bool eicPresentationInit(EicPresentation* ctx, bool testCredential, const char* docType,
+ const uint8_t* encryptedCredentialKeys,
+ size_t encryptedCredentialKeysSize) {
+ uint8_t credentialKeys[86];
+ bool expectPopSha256 = false;
+
+ // For feature version 202009 it's 52 bytes long and for feature version 202101 it's 86
+ // bytes (the additional data is the ProofOfProvisioning SHA-256). We need
+ // to support loading all feature versions.
+ //
+ if (encryptedCredentialKeysSize == 52 + 28) {
+ /* do nothing */
+ } else if (encryptedCredentialKeysSize == 86 + 28) {
+ expectPopSha256 = true;
+ } else {
+ eicDebug("Unexpected size %zd for encryptedCredentialKeys", encryptedCredentialKeysSize);
+ return false;
+ }
+
+ eicMemSet(ctx, '\0', sizeof(EicPresentation));
+
+ if (!eicOpsDecryptAes128Gcm(eicOpsGetHardwareBoundKey(testCredential), encryptedCredentialKeys,
+ encryptedCredentialKeysSize,
+ // DocType is the additionalAuthenticatedData
+ (const uint8_t*)docType, eicStrLen(docType), credentialKeys)) {
+ eicDebug("Error decrypting CredentialKeys");
+ return false;
+ }
+
+ // It's supposed to look like this;
+ //
+ // Feature version 202009:
+ //
+ // CredentialKeys = [
+ // bstr, ; storageKey, a 128-bit AES key
+ // bstr, ; credentialPrivKey, the private key for credentialKey
+ // ]
+ //
+ // Feature version 202101:
+ //
+ // CredentialKeys = [
+ // bstr, ; storageKey, a 128-bit AES key
+ // bstr, ; credentialPrivKey, the private key for credentialKey
+ // bstr ; proofOfProvisioning SHA-256
+ // ]
+ //
+ // where storageKey is 16 bytes, credentialPrivateKey is 32 bytes, and proofOfProvisioning
+ // SHA-256 is 32 bytes.
+ //
+ if (credentialKeys[0] != (expectPopSha256 ? 0x83 : 0x82) || // array of two or three elements
+ credentialKeys[1] != 0x50 || // 16-byte bstr
+ credentialKeys[18] != 0x58 || credentialKeys[19] != 0x20) { // 32-byte bstr
+ eicDebug("Invalid CBOR for CredentialKeys");
+ return false;
+ }
+ if (expectPopSha256) {
+ if (credentialKeys[52] != 0x58 || credentialKeys[53] != 0x20) { // 32-byte bstr
+ eicDebug("Invalid CBOR for CredentialKeys");
+ return false;
+ }
+ }
+ eicMemCpy(ctx->storageKey, credentialKeys + 2, EIC_AES_128_KEY_SIZE);
+ eicMemCpy(ctx->credentialPrivateKey, credentialKeys + 20, EIC_P256_PRIV_KEY_SIZE);
+ ctx->testCredential = testCredential;
+ if (expectPopSha256) {
+ eicMemCpy(ctx->proofOfProvisioningSha256, credentialKeys + 54, EIC_SHA256_DIGEST_SIZE);
+ }
+ return true;
+}
+
+bool eicPresentationGenerateSigningKeyPair(EicPresentation* ctx, const char* docType, time_t now,
+ uint8_t* publicKeyCert, size_t* publicKeyCertSize,
+ uint8_t signingKeyBlob[60]) {
+ uint8_t signingKeyPriv[EIC_P256_PRIV_KEY_SIZE];
+ uint8_t signingKeyPub[EIC_P256_PUB_KEY_SIZE];
+ uint8_t cborBuf[64];
+
+ // Generate the ProofOfBinding CBOR to include in the X.509 certificate in
+ // IdentityCredentialAuthenticationKeyExtension CBOR. This CBOR is defined
+ // by the following CDDL
+ //
+ // ProofOfBinding = [
+ // "ProofOfBinding",
+ // bstr, // Contains the SHA-256 of ProofOfProvisioning
+ // ]
+ //
+ // This array may grow in the future if other information needs to be
+ // conveyed.
+ //
+ // The bytes of ProofOfBinding is is represented as an OCTET_STRING
+ // and stored at OID 1.3.6.1.4.1.11129.2.1.26.
+ //
+
+ EicCbor cbor;
+ eicCborInit(&cbor, cborBuf, sizeof cborBuf);
+ eicCborAppendArray(&cbor, 2);
+ eicCborAppendString(&cbor, "ProofOfBinding");
+ eicCborAppendByteString(&cbor, ctx->proofOfProvisioningSha256, EIC_SHA256_DIGEST_SIZE);
+ if (cbor.size > sizeof(cborBuf)) {
+ eicDebug("Exceeded buffer size");
+ return false;
+ }
+ const uint8_t* proofOfBinding = cborBuf;
+ size_t proofOfBindingSize = cbor.size;
+
+ if (!eicOpsCreateEcKey(signingKeyPriv, signingKeyPub)) {
+ eicDebug("Error creating signing key");
+ return false;
+ }
+
+ const int secondsInOneYear = 365 * 24 * 60 * 60;
+ time_t validityNotBefore = now;
+ time_t validityNotAfter = now + secondsInOneYear; // One year from now.
+ if (!eicOpsSignEcKey(signingKeyPub, ctx->credentialPrivateKey, 1,
+ "Android Identity Credential Key", // issuer CN
+ "Android Identity Credential Authentication Key", // subject CN
+ validityNotBefore, validityNotAfter, proofOfBinding, proofOfBindingSize,
+ publicKeyCert, publicKeyCertSize)) {
+ eicDebug("Error creating certificate for signing key");
+ return false;
+ }
+
+ uint8_t nonce[12];
+ if (!eicOpsRandom(nonce, 12)) {
+ eicDebug("Error getting random");
+ return false;
+ }
+ if (!eicOpsEncryptAes128Gcm(ctx->storageKey, nonce, signingKeyPriv, sizeof(signingKeyPriv),
+ // DocType is the additionalAuthenticatedData
+ (const uint8_t*)docType, eicStrLen(docType), signingKeyBlob)) {
+ eicDebug("Error encrypting signing key");
+ return false;
+ }
+
+ return true;
+}
+
+bool eicPresentationCreateEphemeralKeyPair(EicPresentation* ctx,
+ uint8_t ephemeralPrivateKey[EIC_P256_PRIV_KEY_SIZE]) {
+ uint8_t ephemeralPublicKey[EIC_P256_PUB_KEY_SIZE];
+ if (!eicOpsCreateEcKey(ctx->ephemeralPrivateKey, ephemeralPublicKey)) {
+ eicDebug("Error creating ephemeral key");
+ return false;
+ }
+ eicMemCpy(ephemeralPrivateKey, ctx->ephemeralPrivateKey, EIC_P256_PRIV_KEY_SIZE);
+ return true;
+}
+
+bool eicPresentationCreateAuthChallenge(EicPresentation* ctx, uint64_t* authChallenge) {
+ do {
+ if (!eicOpsRandom((uint8_t*)&(ctx->authChallenge), sizeof(uint64_t))) {
+ eicDebug("Failed generating random challenge");
+ return false;
+ }
+ } while (ctx->authChallenge == 0);
+ eicDebug("Created auth challenge %" PRIu64, ctx->authChallenge);
+ *authChallenge = ctx->authChallenge;
+ return true;
+}
+
+// From "COSE Algorithms" registry
+//
+#define COSE_ALG_ECDSA_256 -7
+
+bool eicPresentationValidateRequestMessage(EicPresentation* ctx, const uint8_t* sessionTranscript,
+ size_t sessionTranscriptSize,
+ const uint8_t* requestMessage, size_t requestMessageSize,
+ int coseSignAlg,
+ const uint8_t* readerSignatureOfToBeSigned,
+ size_t readerSignatureOfToBeSignedSize) {
+ if (ctx->readerPublicKeySize == 0) {
+ eicDebug("No public key for reader");
+ return false;
+ }
+
+ // Right now we only support ECDSA with SHA-256 (e.g. ES256).
+ //
+ if (coseSignAlg != COSE_ALG_ECDSA_256) {
+ eicDebug(
+ "COSE Signature algorithm for reader signature is %d, "
+ "only ECDSA with SHA-256 is supported right now",
+ coseSignAlg);
+ return false;
+ }
+
+ // What we're going to verify is the COSE ToBeSigned structure which
+ // looks like the following:
+ //
+ // Sig_structure = [
+ // context : "Signature" / "Signature1" / "CounterSignature",
+ // body_protected : empty_or_serialized_map,
+ // ? sign_protected : empty_or_serialized_map,
+ // external_aad : bstr,
+ // payload : bstr
+ // ]
+ //
+ // So we're going to build that CBOR...
+ //
+ EicCbor cbor;
+ eicCborInit(&cbor, NULL, 0);
+ eicCborAppendArray(&cbor, 4);
+ eicCborAppendString(&cbor, "Signature1");
+
+ // The COSE Encoded protected headers is just a single field with
+ // COSE_LABEL_ALG (1) -> coseSignAlg (e.g. -7). For simplicitly we just
+ // hard-code the CBOR encoding:
+ static const uint8_t coseEncodedProtectedHeaders[] = {0xa1, 0x01, 0x26};
+ eicCborAppendByteString(&cbor, coseEncodedProtectedHeaders,
+ sizeof(coseEncodedProtectedHeaders));
+
+ // External_aad is the empty bstr
+ static const uint8_t externalAad[0] = {};
+ eicCborAppendByteString(&cbor, externalAad, sizeof(externalAad));
+
+ // For the payload, the _encoded_ form follows here. We handle this by simply
+ // opening a bstr, and then writing the CBOR. This requires us to know the
+ // size of said bstr, ahead of time... the CBOR to be written is
+ //
+ // ReaderAuthentication = [
+ // "ReaderAuthentication",
+ // SessionTranscript,
+ // ItemsRequestBytes
+ // ]
+ //
+ // ItemsRequestBytes = #6.24(bstr .cbor ItemsRequest)
+ //
+ // ReaderAuthenticationBytes = #6.24(bstr .cbor ReaderAuthentication)
+ //
+ // which is easily calculated below
+ //
+ size_t calculatedSize = 0;
+ calculatedSize += 1; // Array of size 3
+ calculatedSize += 1; // "ReaderAuthentication" less than 24 bytes
+ calculatedSize += sizeof("ReaderAuthentication") - 1; // Don't include trailing NUL
+ calculatedSize += sessionTranscriptSize; // Already CBOR encoded
+ calculatedSize += 2; // Semantic tag EIC_CBOR_SEMANTIC_TAG_ENCODED_CBOR (24)
+ calculatedSize += 1 + eicCborAdditionalLengthBytesFor(requestMessageSize);
+ calculatedSize += requestMessageSize;
+
+ // However note that we're authenticating ReaderAuthenticationBytes which
+ // is a tagged bstr of the bytes of ReaderAuthentication. So need to get
+ // that in front.
+ size_t rabCalculatedSize = 0;
+ rabCalculatedSize += 2; // Semantic tag EIC_CBOR_SEMANTIC_TAG_ENCODED_CBOR (24)
+ rabCalculatedSize += 1 + eicCborAdditionalLengthBytesFor(calculatedSize);
+ rabCalculatedSize += calculatedSize;
+
+ // Begin the bytestring for ReaderAuthenticationBytes;
+ eicCborBegin(&cbor, EIC_CBOR_MAJOR_TYPE_BYTE_STRING, rabCalculatedSize);
+
+ eicCborAppendSemantic(&cbor, EIC_CBOR_SEMANTIC_TAG_ENCODED_CBOR);
+
+ // Begins the bytestring for ReaderAuthentication;
+ eicCborBegin(&cbor, EIC_CBOR_MAJOR_TYPE_BYTE_STRING, calculatedSize);
+
+ // And now that we know the size, let's fill it in...
+ //
+ size_t payloadOffset = cbor.size;
+ eicCborBegin(&cbor, EIC_CBOR_MAJOR_TYPE_ARRAY, 3);
+ eicCborAppendString(&cbor, "ReaderAuthentication");
+ eicCborAppend(&cbor, sessionTranscript, sessionTranscriptSize);
+ eicCborAppendSemantic(&cbor, EIC_CBOR_SEMANTIC_TAG_ENCODED_CBOR);
+ eicCborBegin(&cbor, EIC_CBOR_MAJOR_TYPE_BYTE_STRING, requestMessageSize);
+ eicCborAppend(&cbor, requestMessage, requestMessageSize);
+
+ if (cbor.size != payloadOffset + calculatedSize) {
+ eicDebug("CBOR size is %zd but we expected %zd", cbor.size, payloadOffset + calculatedSize);
+ return false;
+ }
+ uint8_t toBeSignedDigest[EIC_SHA256_DIGEST_SIZE];
+ eicCborFinal(&cbor, toBeSignedDigest);
+
+ if (!eicOpsEcDsaVerifyWithPublicKey(
+ toBeSignedDigest, EIC_SHA256_DIGEST_SIZE, readerSignatureOfToBeSigned,
+ readerSignatureOfToBeSignedSize, ctx->readerPublicKey, ctx->readerPublicKeySize)) {
+ eicDebug("Request message is not signed by public key");
+ return false;
+ }
+ ctx->requestMessageValidated = true;
+ return true;
+}
+
+// Validates the next certificate in the reader certificate chain.
+bool eicPresentationPushReaderCert(EicPresentation* ctx, const uint8_t* certX509,
+ size_t certX509Size) {
+ // If we had a previous certificate, use its public key to validate this certificate.
+ if (ctx->readerPublicKeySize > 0) {
+ if (!eicOpsX509CertSignedByPublicKey(certX509, certX509Size, ctx->readerPublicKey,
+ ctx->readerPublicKeySize)) {
+ eicDebug("Certificate is not signed by public key in the previous certificate");
+ return false;
+ }
+ }
+
+ // Store the key of this certificate, this is used to validate the next certificate
+ // and also ACPs with certificates that use the same public key...
+ ctx->readerPublicKeySize = EIC_PRESENTATION_MAX_READER_PUBLIC_KEY_SIZE;
+ if (!eicOpsX509GetPublicKey(certX509, certX509Size, ctx->readerPublicKey,
+ &ctx->readerPublicKeySize)) {
+ eicDebug("Error extracting public key from certificate");
+ return false;
+ }
+ if (ctx->readerPublicKeySize == 0) {
+ eicDebug("Zero-length public key in certificate");
+ return false;
+ }
+
+ return true;
+}
+
+bool eicPresentationSetAuthToken(EicPresentation* ctx, uint64_t challenge, uint64_t secureUserId,
+ uint64_t authenticatorId, int hardwareAuthenticatorType,
+ uint64_t timeStamp, const uint8_t* mac, size_t macSize,
+ uint64_t verificationTokenChallenge,
+ uint64_t verificationTokenTimestamp,
+ int verificationTokenSecurityLevel,
+ const uint8_t* verificationTokenMac,
+ size_t verificationTokenMacSize) {
+ if (!eicOpsValidateAuthToken(
+ challenge, secureUserId, authenticatorId, hardwareAuthenticatorType, timeStamp, mac,
+ macSize, verificationTokenChallenge, verificationTokenTimestamp,
+ verificationTokenSecurityLevel, verificationTokenMac, verificationTokenMacSize)) {
+ return false;
+ }
+ ctx->authTokenChallenge = challenge;
+ ctx->authTokenSecureUserId = secureUserId;
+ ctx->authTokenTimestamp = timeStamp;
+ ctx->verificationTokenTimestamp = verificationTokenTimestamp;
+ return true;
+}
+
+static bool checkUserAuth(EicPresentation* ctx, bool userAuthenticationRequired, int timeoutMillis,
+ uint64_t secureUserId) {
+ if (!userAuthenticationRequired) {
+ return true;
+ }
+
+ if (secureUserId != ctx->authTokenSecureUserId) {
+ eicDebug("secureUserId in profile differs from userId in authToken");
+ return false;
+ }
+
+ if (timeoutMillis == 0) {
+ if (ctx->authTokenChallenge == 0) {
+ eicDebug("No challenge in authToken");
+ return false;
+ }
+
+ // If we didn't create a challenge, too bad but user auth with
+ // timeoutMillis set to 0 needs it.
+ if (ctx->authChallenge == 0) {
+ eicDebug("No challenge was created for this session");
+ return false;
+ }
+ if (ctx->authTokenChallenge != ctx->authChallenge) {
+ eicDebug("Challenge in authToken (%" PRIu64
+ ") doesn't match the challenge "
+ "that was created (%" PRIu64 ") for this session",
+ ctx->authTokenChallenge, ctx->authChallenge);
+ return false;
+ }
+ }
+
+ uint64_t now = ctx->verificationTokenTimestamp;
+ if (ctx->authTokenTimestamp > now) {
+ eicDebug("Timestamp in authToken is in the future");
+ return false;
+ }
+
+ if (timeoutMillis > 0) {
+ if (now > ctx->authTokenTimestamp + timeoutMillis) {
+ eicDebug("Deadline for authToken is in the past");
+ return false;
+ }
+ }
+
+ return true;
+}
+
+static bool checkReaderAuth(EicPresentation* ctx, const uint8_t* readerCertificate,
+ size_t readerCertificateSize) {
+ uint8_t publicKey[EIC_PRESENTATION_MAX_READER_PUBLIC_KEY_SIZE];
+ size_t publicKeySize;
+
+ if (readerCertificateSize == 0) {
+ return true;
+ }
+
+ // Remember in this case certificate equality is done by comparing public
+ // keys, not bitwise comparison of the certificates.
+ //
+ publicKeySize = EIC_PRESENTATION_MAX_READER_PUBLIC_KEY_SIZE;
+ if (!eicOpsX509GetPublicKey(readerCertificate, readerCertificateSize, publicKey,
+ &publicKeySize)) {
+ eicDebug("Error extracting public key from certificate");
+ return false;
+ }
+ if (publicKeySize == 0) {
+ eicDebug("Zero-length public key in certificate");
+ return false;
+ }
+
+ if ((ctx->readerPublicKeySize != publicKeySize) ||
+ (eicCryptoMemCmp(ctx->readerPublicKey, publicKey, ctx->readerPublicKeySize) != 0)) {
+ return false;
+ }
+ return true;
+}
+
+// Note: This function returns false _only_ if an error occurred check for access, _not_
+// whether access is granted. Whether access is granted is returned in |accessGranted|.
+//
+bool eicPresentationValidateAccessControlProfile(EicPresentation* ctx, int id,
+ const uint8_t* readerCertificate,
+ size_t readerCertificateSize,
+ bool userAuthenticationRequired, int timeoutMillis,
+ uint64_t secureUserId, const uint8_t mac[28],
+ bool* accessGranted) {
+ *accessGranted = false;
+
+ if (id < 0 || id >= 32) {
+ eicDebug("id value of %d is out of allowed range [0, 32[", id);
+ return false;
+ }
+
+ // Validate the MAC
+ uint8_t cborBuffer[EIC_MAX_CBOR_SIZE_FOR_ACCESS_CONTROL_PROFILE];
+ EicCbor cborBuilder;
+ eicCborInit(&cborBuilder, cborBuffer, EIC_MAX_CBOR_SIZE_FOR_ACCESS_CONTROL_PROFILE);
+ if (!eicCborCalcAccessControl(&cborBuilder, id, readerCertificate, readerCertificateSize,
+ userAuthenticationRequired, timeoutMillis, secureUserId)) {
+ return false;
+ }
+ if (!eicOpsDecryptAes128Gcm(ctx->storageKey, mac, 28, cborBuilder.buffer, cborBuilder.size,
+ NULL)) {
+ eicDebug("MAC for AccessControlProfile doesn't match");
+ return false;
+ }
+
+ bool passedUserAuth =
+ checkUserAuth(ctx, userAuthenticationRequired, timeoutMillis, secureUserId);
+ bool passedReaderAuth = checkReaderAuth(ctx, readerCertificate, readerCertificateSize);
+
+ ctx->accessControlProfileMaskValidated |= (1 << id);
+ if (readerCertificateSize > 0) {
+ ctx->accessControlProfileMaskUsesReaderAuth |= (1 << id);
+ }
+ if (!passedReaderAuth) {
+ ctx->accessControlProfileMaskFailedReaderAuth |= (1 << id);
+ }
+ if (!passedUserAuth) {
+ ctx->accessControlProfileMaskFailedUserAuth |= (1 << id);
+ }
+
+ if (passedUserAuth && passedReaderAuth) {
+ *accessGranted = true;
+ eicDebug("Access granted for id %d", id);
+ }
+ return true;
+}
+
+bool eicPresentationCalcMacKey(EicPresentation* ctx, const uint8_t* sessionTranscript,
+ size_t sessionTranscriptSize,
+ const uint8_t readerEphemeralPublicKey[EIC_P256_PUB_KEY_SIZE],
+ const uint8_t signingKeyBlob[60], const char* docType,
+ unsigned int numNamespacesWithValues,
+ size_t expectedDeviceNamespacesSize) {
+ uint8_t signingKeyPriv[EIC_P256_PRIV_KEY_SIZE];
+ if (!eicOpsDecryptAes128Gcm(ctx->storageKey, signingKeyBlob, 60, (const uint8_t*)docType,
+ eicStrLen(docType), signingKeyPriv)) {
+ eicDebug("Error decrypting signingKeyBlob");
+ return false;
+ }
+
+ uint8_t sharedSecret[EIC_P256_COORDINATE_SIZE];
+ if (!eicOpsEcdh(readerEphemeralPublicKey, signingKeyPriv, sharedSecret)) {
+ eicDebug("ECDH failed");
+ return false;
+ }
+
+ EicCbor cbor;
+ eicCborInit(&cbor, NULL, 0);
+ eicCborAppendSemantic(&cbor, EIC_CBOR_SEMANTIC_TAG_ENCODED_CBOR);
+ eicCborAppendByteString(&cbor, sessionTranscript, sessionTranscriptSize);
+ uint8_t salt[EIC_SHA256_DIGEST_SIZE];
+ eicCborFinal(&cbor, salt);
+
+ const uint8_t info[7] = {'E', 'M', 'a', 'c', 'K', 'e', 'y'};
+ uint8_t derivedKey[32];
+ if (!eicOpsHkdf(sharedSecret, EIC_P256_COORDINATE_SIZE, salt, sizeof(salt), info, sizeof(info),
+ derivedKey, sizeof(derivedKey))) {
+ eicDebug("HKDF failed");
+ return false;
+ }
+
+ eicCborInitHmacSha256(&ctx->cbor, NULL, 0, derivedKey, sizeof(derivedKey));
+ ctx->buildCbor = true;
+
+ // What we're going to calculate the HMAC-SHA256 is the COSE ToBeMaced
+ // structure which looks like the following:
+ //
+ // MAC_structure = [
+ // context : "MAC" / "MAC0",
+ // protected : empty_or_serialized_map,
+ // external_aad : bstr,
+ // payload : bstr
+ // ]
+ //
+ eicCborAppendArray(&ctx->cbor, 4);
+ eicCborAppendString(&ctx->cbor, "MAC0");
+
+ // The COSE Encoded protected headers is just a single field with
+ // COSE_LABEL_ALG (1) -> COSE_ALG_HMAC_256_256 (5). For simplicitly we just
+ // hard-code the CBOR encoding:
+ static const uint8_t coseEncodedProtectedHeaders[] = {0xa1, 0x01, 0x05};
+ eicCborAppendByteString(&ctx->cbor, coseEncodedProtectedHeaders,
+ sizeof(coseEncodedProtectedHeaders));
+
+ // We currently don't support Externally Supplied Data (RFC 8152 section 4.3)
+ // so external_aad is the empty bstr
+ static const uint8_t externalAad[0] = {};
+ eicCborAppendByteString(&ctx->cbor, externalAad, sizeof(externalAad));
+
+ // For the payload, the _encoded_ form follows here. We handle this by simply
+ // opening a bstr, and then writing the CBOR. This requires us to know the
+ // size of said bstr, ahead of time... the CBOR to be written is
+ //
+ // DeviceAuthentication = [
+ // "DeviceAuthentication",
+ // SessionTranscript,
+ // DocType, ; DocType as used in Documents structure in OfflineResponse
+ // DeviceNameSpacesBytes
+ // ]
+ //
+ // DeviceNameSpacesBytes = #6.24(bstr .cbor DeviceNameSpaces)
+ //
+ // DeviceAuthenticationBytes = #6.24(bstr .cbor DeviceAuthentication)
+ //
+ // which is easily calculated below
+ //
+ size_t calculatedSize = 0;
+ calculatedSize += 1; // Array of size 4
+ calculatedSize += 1; // "DeviceAuthentication" less than 24 bytes
+ calculatedSize += sizeof("DeviceAuthentication") - 1; // Don't include trailing NUL
+ calculatedSize += sessionTranscriptSize; // Already CBOR encoded
+ size_t docTypeLen = eicStrLen(docType);
+ calculatedSize += 1 + eicCborAdditionalLengthBytesFor(docTypeLen) + docTypeLen;
+ calculatedSize += 2; // Semantic tag EIC_CBOR_SEMANTIC_TAG_ENCODED_CBOR (24)
+ calculatedSize += 1 + eicCborAdditionalLengthBytesFor(expectedDeviceNamespacesSize);
+ calculatedSize += expectedDeviceNamespacesSize;
+
+ // However note that we're authenticating DeviceAuthenticationBytes which
+ // is a tagged bstr of the bytes of DeviceAuthentication. So need to get
+ // that in front.
+ size_t dabCalculatedSize = 0;
+ dabCalculatedSize += 2; // Semantic tag EIC_CBOR_SEMANTIC_TAG_ENCODED_CBOR (24)
+ dabCalculatedSize += 1 + eicCborAdditionalLengthBytesFor(calculatedSize);
+ dabCalculatedSize += calculatedSize;
+
+ // Begin the bytestring for DeviceAuthenticationBytes;
+ eicCborBegin(&ctx->cbor, EIC_CBOR_MAJOR_TYPE_BYTE_STRING, dabCalculatedSize);
+
+ eicCborAppendSemantic(&ctx->cbor, EIC_CBOR_SEMANTIC_TAG_ENCODED_CBOR);
+
+ // Begins the bytestring for DeviceAuthentication;
+ eicCborBegin(&ctx->cbor, EIC_CBOR_MAJOR_TYPE_BYTE_STRING, calculatedSize);
+
+ eicCborAppendArray(&ctx->cbor, 4);
+ eicCborAppendString(&ctx->cbor, "DeviceAuthentication");
+ eicCborAppend(&ctx->cbor, sessionTranscript, sessionTranscriptSize);
+ eicCborAppendString(&ctx->cbor, docType);
+
+ // For the payload, the _encoded_ form follows here. We handle this by simply
+ // opening a bstr, and then writing the CBOR. This requires us to know the
+ // size of said bstr, ahead of time.
+ eicCborAppendSemantic(&ctx->cbor, EIC_CBOR_SEMANTIC_TAG_ENCODED_CBOR);
+ eicCborBegin(&ctx->cbor, EIC_CBOR_MAJOR_TYPE_BYTE_STRING, expectedDeviceNamespacesSize);
+ ctx->expectedCborSizeAtEnd = expectedDeviceNamespacesSize + ctx->cbor.size;
+
+ eicCborAppendMap(&ctx->cbor, numNamespacesWithValues);
+ return true;
+}
+
+bool eicPresentationStartRetrieveEntries(EicPresentation* ctx) {
+ // HAL may use this object multiple times to retrieve data so need to reset various
+ // state objects here.
+ ctx->requestMessageValidated = false;
+ ctx->buildCbor = false;
+ ctx->accessControlProfileMaskValidated = 0;
+ ctx->accessControlProfileMaskUsesReaderAuth = 0;
+ ctx->accessControlProfileMaskFailedReaderAuth = 0;
+ ctx->accessControlProfileMaskFailedUserAuth = 0;
+ ctx->readerPublicKeySize = 0;
+ return true;
+}
+
+EicAccessCheckResult eicPresentationStartRetrieveEntryValue(
+ EicPresentation* ctx, const char* nameSpace, const char* name,
+ unsigned int newNamespaceNumEntries, int32_t /* entrySize */,
+ const int* accessControlProfileIds, size_t numAccessControlProfileIds,
+ uint8_t* scratchSpace, size_t scratchSpaceSize) {
+ uint8_t* additionalDataCbor = scratchSpace;
+ const size_t additionalDataCborBufSize = scratchSpaceSize;
+ size_t additionalDataCborSize;
+
+ if (newNamespaceNumEntries > 0) {
+ eicCborAppendString(&ctx->cbor, nameSpace);
+ eicCborAppendMap(&ctx->cbor, newNamespaceNumEntries);
+ }
+
+ // We'll need to calc and store a digest of additionalData to check that it's the same
+ // additionalData being passed in for every eicPresentationRetrieveEntryValue() call...
+ if (!eicCborCalcEntryAdditionalData(accessControlProfileIds, numAccessControlProfileIds,
+ nameSpace, name, additionalDataCbor,
+ additionalDataCborBufSize, &additionalDataCborSize,
+ ctx->additionalDataSha256)) {
+ return EIC_ACCESS_CHECK_RESULT_FAILED;
+ }
+
+ if (numAccessControlProfileIds == 0) {
+ return EIC_ACCESS_CHECK_RESULT_NO_ACCESS_CONTROL_PROFILES;
+ }
+
+ // Access is granted if at least one of the profiles grants access.
+ //
+ // If an item is configured without any profiles, access is denied.
+ //
+ EicAccessCheckResult result = EIC_ACCESS_CHECK_RESULT_FAILED;
+ for (size_t n = 0; n < numAccessControlProfileIds; n++) {
+ int id = accessControlProfileIds[n];
+ uint32_t idBitMask = (1 << id);
+
+ // If the access control profile wasn't validated, this is an error and we
+ // fail immediately.
+ bool validated = ((ctx->accessControlProfileMaskValidated & idBitMask) != 0);
+ if (!validated) {
+ eicDebug("No ACP for profile id %d", id);
+ return EIC_ACCESS_CHECK_RESULT_FAILED;
+ }
+
+ // Otherwise, we _did_ validate the profile. If none of the checks
+ // failed, we're done
+ bool failedUserAuth = ((ctx->accessControlProfileMaskFailedUserAuth & idBitMask) != 0);
+ bool failedReaderAuth = ((ctx->accessControlProfileMaskFailedReaderAuth & idBitMask) != 0);
+ if (!failedUserAuth && !failedReaderAuth) {
+ result = EIC_ACCESS_CHECK_RESULT_OK;
+ break;
+ }
+ // One of the checks failed, convey which one
+ if (failedUserAuth) {
+ result = EIC_ACCESS_CHECK_RESULT_USER_AUTHENTICATION_FAILED;
+ } else {
+ result = EIC_ACCESS_CHECK_RESULT_READER_AUTHENTICATION_FAILED;
+ }
+ }
+ eicDebug("Result %d for name %s", result, name);
+
+ if (result == EIC_ACCESS_CHECK_RESULT_OK) {
+ eicCborAppendString(&ctx->cbor, name);
+ }
+ return result;
+}
+
+// Note: |content| must be big enough to hold |encryptedContentSize| - 28 bytes.
+bool eicPresentationRetrieveEntryValue(EicPresentation* ctx, const uint8_t* encryptedContent,
+ size_t encryptedContentSize, uint8_t* content,
+ const char* nameSpace, const char* name,
+ const int* accessControlProfileIds,
+ size_t numAccessControlProfileIds, uint8_t* scratchSpace,
+ size_t scratchSpaceSize) {
+ uint8_t* additionalDataCbor = scratchSpace;
+ const size_t additionalDataCborBufSize = scratchSpaceSize;
+ size_t additionalDataCborSize;
+
+ uint8_t calculatedSha256[EIC_SHA256_DIGEST_SIZE];
+ if (!eicCborCalcEntryAdditionalData(accessControlProfileIds, numAccessControlProfileIds,
+ nameSpace, name, additionalDataCbor,
+ additionalDataCborBufSize, &additionalDataCborSize,
+ calculatedSha256)) {
+ return false;
+ }
+ if (eicCryptoMemCmp(calculatedSha256, ctx->additionalDataSha256, EIC_SHA256_DIGEST_SIZE) != 0) {
+ eicDebug("SHA-256 mismatch of additionalData");
+ return false;
+ }
+
+ if (!eicOpsDecryptAes128Gcm(ctx->storageKey, encryptedContent, encryptedContentSize,
+ additionalDataCbor, additionalDataCborSize, content)) {
+ eicDebug("Error decrypting content");
+ return false;
+ }
+
+ eicCborAppend(&ctx->cbor, content, encryptedContentSize - 28);
+
+ return true;
+}
+
+bool eicPresentationFinishRetrieval(EicPresentation* ctx, uint8_t* digestToBeMaced,
+ size_t* digestToBeMacedSize) {
+ if (!ctx->buildCbor) {
+ *digestToBeMacedSize = 0;
+ return true;
+ }
+ if (*digestToBeMacedSize != 32) {
+ return false;
+ }
+
+ // This verifies that the correct expectedDeviceNamespacesSize value was
+ // passed in at eicPresentationCalcMacKey() time.
+ if (ctx->cbor.size != ctx->expectedCborSizeAtEnd) {
+ eicDebug("CBOR size is %zd, was expecting %zd", ctx->cbor.size, ctx->expectedCborSizeAtEnd);
+ return false;
+ }
+ eicCborFinal(&ctx->cbor, digestToBeMaced);
+ return true;
+}
+
+bool eicPresentationDeleteCredential(EicPresentation* ctx, const char* docType,
+ const uint8_t* challenge, size_t challengeSize,
+ bool includeChallenge, size_t proofOfDeletionCborSize,
+ uint8_t signatureOfToBeSigned[EIC_ECDSA_P256_SIGNATURE_SIZE]) {
+ EicCbor cbor;
+
+ eicCborInit(&cbor, NULL, 0);
+
+ // What we're going to sign is the COSE ToBeSigned structure which
+ // looks like the following:
+ //
+ // Sig_structure = [
+ // context : "Signature" / "Signature1" / "CounterSignature",
+ // body_protected : empty_or_serialized_map,
+ // ? sign_protected : empty_or_serialized_map,
+ // external_aad : bstr,
+ // payload : bstr
+ // ]
+ //
+ eicCborAppendArray(&cbor, 4);
+ eicCborAppendString(&cbor, "Signature1");
+
+ // The COSE Encoded protected headers is just a single field with
+ // COSE_LABEL_ALG (1) -> COSE_ALG_ECSDA_256 (-7). For simplicitly we just
+ // hard-code the CBOR encoding:
+ static const uint8_t coseEncodedProtectedHeaders[] = {0xa1, 0x01, 0x26};
+ eicCborAppendByteString(&cbor, coseEncodedProtectedHeaders,
+ sizeof(coseEncodedProtectedHeaders));
+
+ // We currently don't support Externally Supplied Data (RFC 8152 section 4.3)
+ // so external_aad is the empty bstr
+ static const uint8_t externalAad[0] = {};
+ eicCborAppendByteString(&cbor, externalAad, sizeof(externalAad));
+
+ // For the payload, the _encoded_ form follows here. We handle this by simply
+ // opening a bstr, and then writing the CBOR. This requires us to know the
+ // size of said bstr, ahead of time.
+ eicCborBegin(&cbor, EIC_CBOR_MAJOR_TYPE_BYTE_STRING, proofOfDeletionCborSize);
+
+ // Finally, the CBOR that we're actually signing.
+ eicCborAppendArray(&cbor, includeChallenge ? 4 : 3);
+ eicCborAppendString(&cbor, "ProofOfDeletion");
+ eicCborAppendString(&cbor, docType);
+ if (includeChallenge) {
+ eicCborAppendByteString(&cbor, challenge, challengeSize);
+ }
+ eicCborAppendBool(&cbor, ctx->testCredential);
+
+ uint8_t cborSha256[EIC_SHA256_DIGEST_SIZE];
+ eicCborFinal(&cbor, cborSha256);
+ if (!eicOpsEcDsa(ctx->credentialPrivateKey, cborSha256, signatureOfToBeSigned)) {
+ eicDebug("Error signing proofOfDeletion");
+ return false;
+ }
+
+ return true;
+}
+
+bool eicPresentationProveOwnership(EicPresentation* ctx, const char* docType, bool testCredential,
+ const uint8_t* challenge, size_t challengeSize,
+ size_t proofOfOwnershipCborSize,
+ uint8_t signatureOfToBeSigned[EIC_ECDSA_P256_SIGNATURE_SIZE]) {
+ EicCbor cbor;
+
+ eicCborInit(&cbor, NULL, 0);
+
+ // What we're going to sign is the COSE ToBeSigned structure which
+ // looks like the following:
+ //
+ // Sig_structure = [
+ // context : "Signature" / "Signature1" / "CounterSignature",
+ // body_protected : empty_or_serialized_map,
+ // ? sign_protected : empty_or_serialized_map,
+ // external_aad : bstr,
+ // payload : bstr
+ // ]
+ //
+ eicCborAppendArray(&cbor, 4);
+ eicCborAppendString(&cbor, "Signature1");
+
+ // The COSE Encoded protected headers is just a single field with
+ // COSE_LABEL_ALG (1) -> COSE_ALG_ECSDA_256 (-7). For simplicitly we just
+ // hard-code the CBOR encoding:
+ static const uint8_t coseEncodedProtectedHeaders[] = {0xa1, 0x01, 0x26};
+ eicCborAppendByteString(&cbor, coseEncodedProtectedHeaders,
+ sizeof(coseEncodedProtectedHeaders));
+
+ // We currently don't support Externally Supplied Data (RFC 8152 section 4.3)
+ // so external_aad is the empty bstr
+ static const uint8_t externalAad[0] = {};
+ eicCborAppendByteString(&cbor, externalAad, sizeof(externalAad));
+
+ // For the payload, the _encoded_ form follows here. We handle this by simply
+ // opening a bstr, and then writing the CBOR. This requires us to know the
+ // size of said bstr, ahead of time.
+ eicCborBegin(&cbor, EIC_CBOR_MAJOR_TYPE_BYTE_STRING, proofOfOwnershipCborSize);
+
+ // Finally, the CBOR that we're actually signing.
+ eicCborAppendArray(&cbor, 4);
+ eicCborAppendString(&cbor, "ProofOfOwnership");
+ eicCborAppendString(&cbor, docType);
+ eicCborAppendByteString(&cbor, challenge, challengeSize);
+ eicCborAppendBool(&cbor, testCredential);
+
+ uint8_t cborSha256[EIC_SHA256_DIGEST_SIZE];
+ eicCborFinal(&cbor, cborSha256);
+ if (!eicOpsEcDsa(ctx->credentialPrivateKey, cborSha256, signatureOfToBeSigned)) {
+ eicDebug("Error signing proofOfDeletion");
+ return false;
+ }
+
+ return true;
+}
diff --git a/identity/aidl/default/libeic/EicPresentation.h b/identity/aidl/default/libeic/EicPresentation.h
new file mode 100644
index 0000000..7cad068
--- /dev/null
+++ b/identity/aidl/default/libeic/EicPresentation.h
@@ -0,0 +1,246 @@
+/*
+ * Copyright 2020, The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#if !defined(EIC_INSIDE_LIBEIC_H) && !defined(EIC_COMPILATION)
+#error "Never include this file directly, include libeic.h instead."
+#endif
+
+#ifndef ANDROID_HARDWARE_IDENTITY_EIC_PRESENTATION_H
+#define ANDROID_HARDWARE_IDENTITY_EIC_PRESENTATION_H
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#include "EicCbor.h"
+
+// The maximum size we support for public keys in reader certificates.
+#define EIC_PRESENTATION_MAX_READER_PUBLIC_KEY_SIZE 65
+
+typedef struct {
+ int featureLevel;
+
+ uint8_t storageKey[EIC_AES_128_KEY_SIZE];
+ uint8_t credentialPrivateKey[EIC_P256_PRIV_KEY_SIZE];
+
+ uint8_t ephemeralPrivateKey[EIC_P256_PRIV_KEY_SIZE];
+
+ // The challenge generated with eicPresentationCreateAuthChallenge()
+ uint64_t authChallenge;
+
+ // Set by eicPresentationSetAuthToken() and contains the fields
+ // from the passed in authToken and verificationToken.
+ //
+ uint64_t authTokenChallenge;
+ uint64_t authTokenSecureUserId;
+ uint64_t authTokenTimestamp;
+ uint64_t verificationTokenTimestamp;
+
+ // The public key for the reader.
+ //
+ // (During the process of pushing reader certificates, this is also used to store
+ // the public key of the previously pushed certificate.)
+ //
+ uint8_t readerPublicKey[EIC_PRESENTATION_MAX_READER_PUBLIC_KEY_SIZE];
+ size_t readerPublicKeySize;
+
+ // This is set to true only if eicPresentationValidateRequestMessage() successfully
+ // validated the requestMessage.
+ //
+ // Why even record this? Because there's no requirement the HAL actually calls that
+ // function and we validate ACPs before it's called... so it's possible that a
+ // compromised HAL could trick us into marking ACPs as authorized while they in fact
+ // aren't.
+ bool requestMessageValidated;
+ bool buildCbor;
+
+ // Set to true initialized as a test credential.
+ bool testCredential;
+
+ // These are bitmasks indicating which of the possible 32 access control profiles are
+ // authorized. They are built up by eicPresentationValidateAccessControlProfile().
+ //
+ uint32_t accessControlProfileMaskValidated; // True if the profile was validated.
+ uint32_t accessControlProfileMaskUsesReaderAuth; // True if the ACP is using reader auth
+ uint32_t accessControlProfileMaskFailedReaderAuth; // True if failed reader auth
+ uint32_t accessControlProfileMaskFailedUserAuth; // True if failed user auth
+
+ // SHA-256 for AdditionalData, updated for each entry.
+ uint8_t additionalDataSha256[EIC_SHA256_DIGEST_SIZE];
+
+ // SHA-256 of ProofOfProvisioning. Set to NUL-bytes or initialized from CredentialKeys data
+ // if credential was created with feature version 202101 or later.
+ uint8_t proofOfProvisioningSha256[EIC_SHA256_DIGEST_SIZE];
+
+ size_t expectedCborSizeAtEnd;
+ EicCbor cbor;
+} EicPresentation;
+
+bool eicPresentationInit(EicPresentation* ctx, bool testCredential, const char* docType,
+ const uint8_t* encryptedCredentialKeys,
+ size_t encryptedCredentialKeysSize);
+
+bool eicPresentationGenerateSigningKeyPair(EicPresentation* ctx, const char* docType, time_t now,
+ uint8_t* publicKeyCert, size_t* publicKeyCertSize,
+ uint8_t signingKeyBlob[60]);
+
+// Create an ephemeral key-pair.
+//
+// The private key is stored in |ctx->ephemeralPrivateKey| and also returned in
+// |ephemeralPrivateKey|.
+//
+bool eicPresentationCreateEphemeralKeyPair(EicPresentation* ctx,
+ uint8_t ephemeralPrivateKey[EIC_P256_PRIV_KEY_SIZE]);
+
+// Returns a non-zero challenge in |authChallenge|.
+bool eicPresentationCreateAuthChallenge(EicPresentation* ctx, uint64_t* authChallenge);
+
+// Starts retrieveing entries.
+//
+bool eicPresentationStartRetrieveEntries(EicPresentation* ctx);
+
+// Sets the auth-token.
+bool eicPresentationSetAuthToken(EicPresentation* ctx, uint64_t challenge, uint64_t secureUserId,
+ uint64_t authenticatorId, int hardwareAuthenticatorType,
+ uint64_t timeStamp, const uint8_t* mac, size_t macSize,
+ uint64_t verificationTokenChallenge,
+ uint64_t verificationTokenTimeStamp,
+ int verificationTokenSecurityLevel,
+ const uint8_t* verificationTokenMac,
+ size_t verificationTokenMacSize);
+
+// Function to push certificates in the reader certificate chain.
+//
+// This should start with the root certificate (e.g. the last in the chain) and
+// continue up the chain, ending with the certificate for the reader.
+//
+// Calls to this function should be interleaved with calls to the
+// eicPresentationValidateAccessControlProfile() function, see below.
+//
+bool eicPresentationPushReaderCert(EicPresentation* ctx, const uint8_t* certX509,
+ size_t certX509Size);
+
+// Checks an access control profile.
+//
+// Returns false if an error occurred while checking the profile (e.g. MAC doesn't check out).
+//
+// Returns in |accessGranted| whether access is granted.
+//
+// If |readerCertificate| is non-empty and the public key of one of those
+// certificates appear in the chain presented by the reader, this function must
+// be called after pushing that certificate using
+// eicPresentationPushReaderCert().
+//
+bool eicPresentationValidateAccessControlProfile(EicPresentation* ctx, int id,
+ const uint8_t* readerCertificate,
+ size_t readerCertificateSize,
+ bool userAuthenticationRequired, int timeoutMillis,
+ uint64_t secureUserId, const uint8_t mac[28],
+ bool* accessGranted);
+
+// Validates that the given requestMessage is signed by the public key in the
+// certificate last set with eicPresentationPushReaderCert().
+//
+// The format of the signature is the same encoding as the 'signature' field of
+// COSE_Sign1 - that is, it's the R and S integers both with the same length as
+// the key-size.
+//
+// Must be called after eicPresentationPushReaderCert() have been used to push
+// the final certificate. Which is the certificate of the reader itself.
+//
+bool eicPresentationValidateRequestMessage(EicPresentation* ctx, const uint8_t* sessionTranscript,
+ size_t sessionTranscriptSize,
+ const uint8_t* requestMessage, size_t requestMessageSize,
+ int coseSignAlg,
+ const uint8_t* readerSignatureOfToBeSigned,
+ size_t readerSignatureOfToBeSignedSize);
+
+typedef enum {
+ // Returned if access is granted.
+ EIC_ACCESS_CHECK_RESULT_OK,
+
+ // Returned if an error occurred checking for access.
+ EIC_ACCESS_CHECK_RESULT_FAILED,
+
+ // Returned if access was denied because item is configured without any
+ // access control profiles.
+ EIC_ACCESS_CHECK_RESULT_NO_ACCESS_CONTROL_PROFILES,
+
+ // Returned if access was denied because of user authentication.
+ EIC_ACCESS_CHECK_RESULT_USER_AUTHENTICATION_FAILED,
+
+ // Returned if access was denied because of reader authentication.
+ EIC_ACCESS_CHECK_RESULT_READER_AUTHENTICATION_FAILED,
+} EicAccessCheckResult;
+
+// Passes enough information to calculate the MACing key
+//
+bool eicPresentationCalcMacKey(EicPresentation* ctx, const uint8_t* sessionTranscript,
+ size_t sessionTranscriptSize,
+ const uint8_t readerEphemeralPublicKey[EIC_P256_PUB_KEY_SIZE],
+ const uint8_t signingKeyBlob[60], const char* docType,
+ unsigned int numNamespacesWithValues,
+ size_t expectedDeviceNamespacesSize);
+
+// The scratchSpace should be set to a buffer at least 512 bytes (ideally 1024
+// bytes, the bigger the better). It's done this way to avoid allocating stack
+// space.
+//
+EicAccessCheckResult eicPresentationStartRetrieveEntryValue(
+ EicPresentation* ctx, const char* nameSpace, const char* name,
+ unsigned int newNamespaceNumEntries, int32_t entrySize, const int* accessControlProfileIds,
+ size_t numAccessControlProfileIds, uint8_t* scratchSpace, size_t scratchSpaceSize);
+
+// Note: |content| must be big enough to hold |encryptedContentSize| - 28 bytes.
+//
+// The scratchSpace should be set to a buffer at least 512 bytes. It's done this way to
+// avoid allocating stack space.
+//
+bool eicPresentationRetrieveEntryValue(EicPresentation* ctx, const uint8_t* encryptedContent,
+ size_t encryptedContentSize, uint8_t* content,
+ const char* nameSpace, const char* name,
+ const int* accessControlProfileIds,
+ size_t numAccessControlProfileIds, uint8_t* scratchSpace,
+ size_t scratchSpaceSize);
+
+// Returns the HMAC-SHA256 of |ToBeMaced| as per RFC 8051 "6.3. How to Compute
+// and Verify a MAC".
+bool eicPresentationFinishRetrieval(EicPresentation* ctx, uint8_t* digestToBeMaced,
+ size_t* digestToBeMacedSize);
+
+// The data returned in |signatureOfToBeSigned| contains the ECDSA signature of
+// the ToBeSigned CBOR from RFC 8051 "4.4. Signing and Verification Process"
+// where content is set to the ProofOfDeletion CBOR.
+//
+bool eicPresentationDeleteCredential(EicPresentation* ctx, const char* docType,
+ const uint8_t* challenge, size_t challengeSize,
+ bool includeChallenge, size_t proofOfDeletionCborSize,
+ uint8_t signatureOfToBeSigned[EIC_ECDSA_P256_SIGNATURE_SIZE]);
+
+// The data returned in |signatureOfToBeSigned| contains the ECDSA signature of
+// the ToBeSigned CBOR from RFC 8051 "4.4. Signing and Verification Process"
+// where content is set to the ProofOfOwnership CBOR.
+//
+bool eicPresentationProveOwnership(EicPresentation* ctx, const char* docType, bool testCredential,
+ const uint8_t* challenge, size_t challengeSize,
+ size_t proofOfOwnershipCborSize,
+ uint8_t signatureOfToBeSigned[EIC_ECDSA_P256_SIGNATURE_SIZE]);
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif // ANDROID_HARDWARE_IDENTITY_EIC_PRESENTATION_H
diff --git a/identity/aidl/default/libeic/EicProvisioning.c b/identity/aidl/default/libeic/EicProvisioning.c
new file mode 100644
index 0000000..3b4148e
--- /dev/null
+++ b/identity/aidl/default/libeic/EicProvisioning.c
@@ -0,0 +1,377 @@
+/*
+ * Copyright 2020, The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "EicProvisioning.h"
+
+bool eicProvisioningInit(EicProvisioning* ctx, bool testCredential) {
+ eicMemSet(ctx, '\0', sizeof(EicProvisioning));
+ ctx->testCredential = testCredential;
+ if (!eicOpsRandom(ctx->storageKey, EIC_AES_128_KEY_SIZE)) {
+ return false;
+ }
+
+ return true;
+}
+
+bool eicProvisioningInitForUpdate(EicProvisioning* ctx, bool testCredential, const char* docType,
+ const uint8_t* encryptedCredentialKeys,
+ size_t encryptedCredentialKeysSize) {
+ uint8_t credentialKeys[86];
+
+ // For feature version 202009 it's 52 bytes long and for feature version 202101 it's 86
+ // bytes (the additional data is the ProofOfProvisioning SHA-256). We need
+ // to support loading all feature versions.
+ //
+ bool expectPopSha256 = false;
+ if (encryptedCredentialKeysSize == 52 + 28) {
+ /* do nothing */
+ } else if (encryptedCredentialKeysSize == 86 + 28) {
+ expectPopSha256 = true;
+ } else {
+ eicDebug("Unexpected size %zd for encryptedCredentialKeys", encryptedCredentialKeysSize);
+ return false;
+ }
+
+ eicMemSet(ctx, '\0', sizeof(EicProvisioning));
+ ctx->testCredential = testCredential;
+
+ if (!eicOpsDecryptAes128Gcm(eicOpsGetHardwareBoundKey(testCredential), encryptedCredentialKeys,
+ encryptedCredentialKeysSize,
+ // DocType is the additionalAuthenticatedData
+ (const uint8_t*)docType, eicStrLen(docType), credentialKeys)) {
+ eicDebug("Error decrypting CredentialKeys");
+ return false;
+ }
+
+ // It's supposed to look like this;
+ //
+ // Feature version 202009:
+ //
+ // CredentialKeys = [
+ // bstr, ; storageKey, a 128-bit AES key
+ // bstr, ; credentialPrivKey, the private key for credentialKey
+ // ]
+ //
+ // Feature version 202101:
+ //
+ // CredentialKeys = [
+ // bstr, ; storageKey, a 128-bit AES key
+ // bstr, ; credentialPrivKey, the private key for credentialKey
+ // bstr ; proofOfProvisioning SHA-256
+ // ]
+ //
+ // where storageKey is 16 bytes, credentialPrivateKey is 32 bytes, and proofOfProvisioning
+ // SHA-256 is 32 bytes.
+ //
+ if (credentialKeys[0] != (expectPopSha256 ? 0x83 : 0x82) || // array of two or three elements
+ credentialKeys[1] != 0x50 || // 16-byte bstr
+ credentialKeys[18] != 0x58 || credentialKeys[19] != 0x20) { // 32-byte bstr
+ eicDebug("Invalid CBOR for CredentialKeys");
+ return false;
+ }
+ if (expectPopSha256) {
+ if (credentialKeys[52] != 0x58 || credentialKeys[53] != 0x20) { // 32-byte bstr
+ eicDebug("Invalid CBOR for CredentialKeys");
+ return false;
+ }
+ }
+ eicMemCpy(ctx->storageKey, credentialKeys + 2, EIC_AES_128_KEY_SIZE);
+ eicMemCpy(ctx->credentialPrivateKey, credentialKeys + 20, EIC_P256_PRIV_KEY_SIZE);
+ // Note: We don't care about the previous ProofOfProvisioning SHA-256
+ ctx->isUpdate = true;
+ return true;
+}
+
+bool eicProvisioningCreateCredentialKey(EicProvisioning* ctx, const uint8_t* challenge,
+ size_t challengeSize, const uint8_t* applicationId,
+ size_t applicationIdSize, uint8_t* publicKeyCert,
+ size_t* publicKeyCertSize) {
+ if (ctx->isUpdate) {
+ eicDebug("Cannot create CredentialKey on update");
+ return false;
+ }
+
+ if (!eicOpsCreateCredentialKey(ctx->credentialPrivateKey, challenge, challengeSize,
+ applicationId, applicationIdSize, ctx->testCredential,
+ publicKeyCert, publicKeyCertSize)) {
+ return false;
+ }
+ return true;
+}
+
+bool eicProvisioningStartPersonalization(EicProvisioning* ctx, int accessControlProfileCount,
+ const int* entryCounts, size_t numEntryCounts,
+ const char* docType,
+ size_t expectedProofOfProvisioningSize) {
+ if (numEntryCounts >= EIC_MAX_NUM_NAMESPACES) {
+ return false;
+ }
+ if (accessControlProfileCount >= EIC_MAX_NUM_ACCESS_CONTROL_PROFILE_IDS) {
+ return false;
+ }
+
+ ctx->numEntryCounts = numEntryCounts;
+ if (numEntryCounts > EIC_MAX_NUM_NAMESPACES) {
+ return false;
+ }
+ for (size_t n = 0; n < numEntryCounts; n++) {
+ if (entryCounts[n] >= 256) {
+ return false;
+ }
+ ctx->entryCounts[n] = entryCounts[n];
+ }
+ ctx->curNamespace = -1;
+ ctx->curNamespaceNumProcessed = 0;
+
+ eicCborInit(&ctx->cbor, NULL, 0);
+
+ // What we're going to sign is the COSE ToBeSigned structure which
+ // looks like the following:
+ //
+ // Sig_structure = [
+ // context : "Signature" / "Signature1" / "CounterSignature",
+ // body_protected : empty_or_serialized_map,
+ // ? sign_protected : empty_or_serialized_map,
+ // external_aad : bstr,
+ // payload : bstr
+ // ]
+ //
+ eicCborAppendArray(&ctx->cbor, 4);
+ eicCborAppendString(&ctx->cbor, "Signature1");
+
+ // The COSE Encoded protected headers is just a single field with
+ // COSE_LABEL_ALG (1) -> COSE_ALG_ECSDA_256 (-7). For simplicitly we just
+ // hard-code the CBOR encoding:
+ static const uint8_t coseEncodedProtectedHeaders[] = {0xa1, 0x01, 0x26};
+ eicCborAppendByteString(&ctx->cbor, coseEncodedProtectedHeaders,
+ sizeof(coseEncodedProtectedHeaders));
+
+ // We currently don't support Externally Supplied Data (RFC 8152 section 4.3)
+ // so external_aad is the empty bstr
+ static const uint8_t externalAad[0] = {};
+ eicCborAppendByteString(&ctx->cbor, externalAad, sizeof(externalAad));
+
+ // For the payload, the _encoded_ form follows here. We handle this by simply
+ // opening a bstr, and then writing the CBOR. This requires us to know the
+ // size of said bstr, ahead of time.
+ eicCborBegin(&ctx->cbor, EIC_CBOR_MAJOR_TYPE_BYTE_STRING, expectedProofOfProvisioningSize);
+ ctx->expectedCborSizeAtEnd = expectedProofOfProvisioningSize + ctx->cbor.size;
+
+ eicOpsSha256Init(&ctx->proofOfProvisioningDigester);
+ eicCborEnableSecondaryDigesterSha256(&ctx->cbor, &ctx->proofOfProvisioningDigester);
+
+ eicCborAppendArray(&ctx->cbor, 5);
+ eicCborAppendString(&ctx->cbor, "ProofOfProvisioning");
+ eicCborAppendString(&ctx->cbor, docType);
+
+ eicCborAppendArray(&ctx->cbor, accessControlProfileCount);
+
+ return true;
+}
+
+bool eicProvisioningAddAccessControlProfile(EicProvisioning* ctx, int id,
+ const uint8_t* readerCertificate,
+ size_t readerCertificateSize,
+ bool userAuthenticationRequired, uint64_t timeoutMillis,
+ uint64_t secureUserId, uint8_t outMac[28]) {
+ uint8_t cborBuffer[EIC_MAX_CBOR_SIZE_FOR_ACCESS_CONTROL_PROFILE];
+ EicCbor cborBuilder;
+
+ eicCborInit(&cborBuilder, cborBuffer, EIC_MAX_CBOR_SIZE_FOR_ACCESS_CONTROL_PROFILE);
+
+ if (!eicCborCalcAccessControl(&cborBuilder, id, readerCertificate, readerCertificateSize,
+ userAuthenticationRequired, timeoutMillis, secureUserId)) {
+ return false;
+ }
+
+ // Calculate and return MAC
+ uint8_t nonce[12];
+ if (!eicOpsRandom(nonce, 12)) {
+ return false;
+ }
+ if (!eicOpsEncryptAes128Gcm(ctx->storageKey, nonce, NULL, 0, cborBuilder.buffer,
+ cborBuilder.size, outMac)) {
+ return false;
+ }
+
+ // The ACP CBOR in the provisioning receipt doesn't include secureUserId so build
+ // it again.
+ eicCborInit(&cborBuilder, cborBuffer, EIC_MAX_CBOR_SIZE_FOR_ACCESS_CONTROL_PROFILE);
+ if (!eicCborCalcAccessControl(&cborBuilder, id, readerCertificate, readerCertificateSize,
+ userAuthenticationRequired, timeoutMillis,
+ 0 /* secureUserId */)) {
+ return false;
+ }
+
+ // Append the CBOR from the local builder to the digester.
+ eicCborAppend(&ctx->cbor, cborBuilder.buffer, cborBuilder.size);
+
+ return true;
+}
+
+bool eicProvisioningBeginAddEntry(EicProvisioning* ctx, const int* accessControlProfileIds,
+ size_t numAccessControlProfileIds, const char* nameSpace,
+ const char* name, uint64_t entrySize, uint8_t* scratchSpace,
+ size_t scratchSpaceSize) {
+ uint8_t* additionalDataCbor = scratchSpace;
+ const size_t additionalDataCborBufSize = scratchSpaceSize;
+ size_t additionalDataCborSize;
+
+ // We'll need to calc and store a digest of additionalData to check that it's the same
+ // additionalData being passed in for every eicProvisioningAddEntryValue() call...
+ if (!eicCborCalcEntryAdditionalData(accessControlProfileIds, numAccessControlProfileIds,
+ nameSpace, name, additionalDataCbor,
+ additionalDataCborBufSize, &additionalDataCborSize,
+ ctx->additionalDataSha256)) {
+ return false;
+ }
+
+ if (ctx->curNamespace == -1) {
+ ctx->curNamespace = 0;
+ ctx->curNamespaceNumProcessed = 0;
+ // Opens the main map: { * Namespace => [ + Entry ] }
+ eicCborAppendMap(&ctx->cbor, ctx->numEntryCounts);
+ eicCborAppendString(&ctx->cbor, nameSpace);
+ // Opens the per-namespace array: [ + Entry ]
+ eicCborAppendArray(&ctx->cbor, ctx->entryCounts[ctx->curNamespace]);
+ }
+
+ if (ctx->curNamespaceNumProcessed == ctx->entryCounts[ctx->curNamespace]) {
+ ctx->curNamespace += 1;
+ ctx->curNamespaceNumProcessed = 0;
+ eicCborAppendString(&ctx->cbor, nameSpace);
+ // Opens the per-namespace array: [ + Entry ]
+ eicCborAppendArray(&ctx->cbor, ctx->entryCounts[ctx->curNamespace]);
+ }
+
+ eicCborAppendMap(&ctx->cbor, 3);
+ eicCborAppendString(&ctx->cbor, "name");
+ eicCborAppendString(&ctx->cbor, name);
+
+ ctx->curEntrySize = entrySize;
+ ctx->curEntryNumBytesReceived = 0;
+
+ eicCborAppendString(&ctx->cbor, "value");
+
+ ctx->curNamespaceNumProcessed += 1;
+ return true;
+}
+
+bool eicProvisioningAddEntryValue(EicProvisioning* ctx, const int* accessControlProfileIds,
+ size_t numAccessControlProfileIds, const char* nameSpace,
+ const char* name, const uint8_t* content, size_t contentSize,
+ uint8_t* outEncryptedContent, uint8_t* scratchSpace,
+ size_t scratchSpaceSize) {
+ uint8_t* additionalDataCbor = scratchSpace;
+ const size_t additionalDataCborBufSize = scratchSpaceSize;
+ size_t additionalDataCborSize;
+
+ uint8_t calculatedSha256[EIC_SHA256_DIGEST_SIZE];
+ if (!eicCborCalcEntryAdditionalData(accessControlProfileIds, numAccessControlProfileIds,
+ nameSpace, name, additionalDataCbor,
+ additionalDataCborBufSize, &additionalDataCborSize,
+ calculatedSha256)) {
+ return false;
+ }
+ if (eicCryptoMemCmp(calculatedSha256, ctx->additionalDataSha256, EIC_SHA256_DIGEST_SIZE) != 0) {
+ eicDebug("SHA-256 mismatch of additionalData");
+ return false;
+ }
+
+ eicCborAppend(&ctx->cbor, content, contentSize);
+
+ uint8_t nonce[12];
+ if (!eicOpsRandom(nonce, 12)) {
+ return false;
+ }
+ if (!eicOpsEncryptAes128Gcm(ctx->storageKey, nonce, content, contentSize, additionalDataCbor,
+ additionalDataCborSize, outEncryptedContent)) {
+ return false;
+ }
+
+ // If done with this entry, close the map
+ ctx->curEntryNumBytesReceived += contentSize;
+ if (ctx->curEntryNumBytesReceived == ctx->curEntrySize) {
+ eicCborAppendString(&ctx->cbor, "accessControlProfiles");
+ eicCborAppendArray(&ctx->cbor, numAccessControlProfileIds);
+ for (size_t n = 0; n < numAccessControlProfileIds; n++) {
+ eicCborAppendNumber(&ctx->cbor, accessControlProfileIds[n]);
+ }
+ }
+ return true;
+}
+
+bool eicProvisioningFinishAddingEntries(
+ EicProvisioning* ctx, uint8_t signatureOfToBeSigned[EIC_ECDSA_P256_SIGNATURE_SIZE]) {
+ uint8_t cborSha256[EIC_SHA256_DIGEST_SIZE];
+
+ eicCborAppendBool(&ctx->cbor, ctx->testCredential);
+ eicCborFinal(&ctx->cbor, cborSha256);
+
+ // This verifies that the correct expectedProofOfProvisioningSize value was
+ // passed in at eicStartPersonalization() time.
+ if (ctx->cbor.size != ctx->expectedCborSizeAtEnd) {
+ eicDebug("CBOR size is %zd, was expecting %zd", ctx->cbor.size, ctx->expectedCborSizeAtEnd);
+ return false;
+ }
+
+ if (!eicOpsEcDsa(ctx->credentialPrivateKey, cborSha256, signatureOfToBeSigned)) {
+ eicDebug("Error signing proofOfProvisioning");
+ return false;
+ }
+
+ return true;
+}
+
+bool eicProvisioningFinishGetCredentialData(EicProvisioning* ctx, const char* docType,
+ uint8_t* encryptedCredentialKeys,
+ size_t* encryptedCredentialKeysSize) {
+ EicCbor cbor;
+ uint8_t cborBuf[86];
+
+ if (*encryptedCredentialKeysSize < 86 + 28) {
+ eicDebug("encryptedCredentialKeysSize is %zd which is insufficient");
+ return false;
+ }
+
+ eicCborInit(&cbor, cborBuf, sizeof(cborBuf));
+ eicCborAppendArray(&cbor, 3);
+ eicCborAppendByteString(&cbor, ctx->storageKey, EIC_AES_128_KEY_SIZE);
+ eicCborAppendByteString(&cbor, ctx->credentialPrivateKey, EIC_P256_PRIV_KEY_SIZE);
+ uint8_t popSha256[EIC_SHA256_DIGEST_SIZE];
+ eicOpsSha256Final(&ctx->proofOfProvisioningDigester, popSha256);
+ eicCborAppendByteString(&cbor, popSha256, EIC_SHA256_DIGEST_SIZE);
+ if (cbor.size > sizeof(cborBuf)) {
+ eicDebug("Exceeded buffer size");
+ return false;
+ }
+
+ uint8_t nonce[12];
+ if (!eicOpsRandom(nonce, 12)) {
+ eicDebug("Error getting random");
+ return false;
+ }
+ if (!eicOpsEncryptAes128Gcm(
+ eicOpsGetHardwareBoundKey(ctx->testCredential), nonce, cborBuf, cbor.size,
+ // DocType is the additionalAuthenticatedData
+ (const uint8_t*)docType, eicStrLen(docType), encryptedCredentialKeys)) {
+ eicDebug("Error encrypting CredentialKeys");
+ return false;
+ }
+ *encryptedCredentialKeysSize = cbor.size + 28;
+
+ return true;
+}
diff --git a/identity/aidl/default/libeic/EicProvisioning.h b/identity/aidl/default/libeic/EicProvisioning.h
new file mode 100644
index 0000000..f064787
--- /dev/null
+++ b/identity/aidl/default/libeic/EicProvisioning.h
@@ -0,0 +1,138 @@
+/*
+ * Copyright 2020, The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#if !defined(EIC_INSIDE_LIBEIC_H) && !defined(EIC_COMPILATION)
+#error "Never include this file directly, include libeic.h instead."
+#endif
+
+#ifndef ANDROID_HARDWARE_IDENTITY_EIC_PROVISIONING_H
+#define ANDROID_HARDWARE_IDENTITY_EIC_PROVISIONING_H
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#include "EicCbor.h"
+
+#define EIC_MAX_NUM_NAMESPACES 32
+#define EIC_MAX_NUM_ACCESS_CONTROL_PROFILE_IDS 32
+
+typedef struct {
+ // Set by eicCreateCredentialKey() OR eicProvisioningInitForUpdate()
+ uint8_t credentialPrivateKey[EIC_P256_PRIV_KEY_SIZE];
+
+ int numEntryCounts;
+ uint8_t entryCounts[EIC_MAX_NUM_NAMESPACES];
+
+ int curNamespace;
+ int curNamespaceNumProcessed;
+
+ size_t curEntrySize;
+ size_t curEntryNumBytesReceived;
+
+ // Set by eicProvisioningInit() OR eicProvisioningInitForUpdate()
+ uint8_t storageKey[EIC_AES_128_KEY_SIZE];
+
+ size_t expectedCborSizeAtEnd;
+
+ // SHA-256 for AdditionalData, updated for each entry.
+ uint8_t additionalDataSha256[EIC_SHA256_DIGEST_SIZE];
+
+ // Digester just for ProofOfProvisioning (without Sig_structure).
+ EicSha256Ctx proofOfProvisioningDigester;
+
+ EicCbor cbor;
+
+ bool testCredential;
+
+ // Set to true if this is an update.
+ bool isUpdate;
+} EicProvisioning;
+
+bool eicProvisioningInit(EicProvisioning* ctx, bool testCredential);
+
+bool eicProvisioningInitForUpdate(EicProvisioning* ctx, bool testCredential, const char* docType,
+ const uint8_t* encryptedCredentialKeys,
+ size_t encryptedCredentialKeysSize);
+
+bool eicProvisioningCreateCredentialKey(EicProvisioning* ctx, const uint8_t* challenge,
+ size_t challengeSize, const uint8_t* applicationId,
+ size_t applicationIdSize, uint8_t* publicKeyCert,
+ size_t* publicKeyCertSize);
+
+bool eicProvisioningStartPersonalization(EicProvisioning* ctx, int accessControlProfileCount,
+ const int* entryCounts, size_t numEntryCounts,
+ const char* docType,
+ size_t expectedProofOfProvisioningingSize);
+
+bool eicProvisioningAddAccessControlProfile(EicProvisioning* ctx, int id,
+ const uint8_t* readerCertificate,
+ size_t readerCertificateSize,
+ bool userAuthenticationRequired, uint64_t timeoutMillis,
+ uint64_t secureUserId, uint8_t outMac[28]);
+
+// The scratchSpace should be set to a buffer at least 512 bytes. It's done this way to
+// avoid allocating stack space.
+//
+bool eicProvisioningBeginAddEntry(EicProvisioning* ctx, const int* accessControlProfileIds,
+ size_t numAccessControlProfileIds, const char* nameSpace,
+ const char* name, uint64_t entrySize, uint8_t* scratchSpace,
+ size_t scratchSpaceSize);
+
+// The outEncryptedContent array must be contentSize + 28 bytes long.
+//
+// The scratchSpace should be set to a buffer at least 512 bytes. It's done this way to
+// avoid allocating stack space.
+//
+bool eicProvisioningAddEntryValue(EicProvisioning* ctx, const int* accessControlProfileIds,
+ size_t numAccessControlProfileIds, const char* nameSpace,
+ const char* name, const uint8_t* content, size_t contentSize,
+ uint8_t* outEncryptedContent, uint8_t* scratchSpace,
+ size_t scratchSpaceSize);
+
+// The data returned in |signatureOfToBeSigned| contains the ECDSA signature of
+// the ToBeSigned CBOR from RFC 8051 "4.4. Signing and Verification Process"
+// where content is set to the ProofOfProvisioninging CBOR.
+//
+bool eicProvisioningFinishAddingEntries(
+ EicProvisioning* ctx, uint8_t signatureOfToBeSigned[EIC_ECDSA_P256_SIGNATURE_SIZE]);
+
+//
+//
+// The |encryptedCredentialKeys| array is set to AES-GCM-ENC(HBK, R, CredentialKeys, docType)
+// where
+//
+// CredentialKeys = [
+// bstr, ; storageKey, a 128-bit AES key
+// bstr ; credentialPrivKey, the private key for credentialKey
+// bstr ; SHA-256(ProofOfProvisioning)
+// ]
+//
+// for feature version 202101. For feature version 202009 the third field was not present.
+//
+// Since |storageKey| is 16 bytes and |credentialPrivKey| is 32 bytes, the
+// encoded CBOR for CredentialKeys is 86 bytes and consequently
+// |encryptedCredentialKeys| will be no longer than 86 + 28 = 114 bytes.
+//
+bool eicProvisioningFinishGetCredentialData(EicProvisioning* ctx, const char* docType,
+ uint8_t* encryptedCredentialKeys,
+ size_t* encryptedCredentialKeysSize);
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif // ANDROID_HARDWARE_IDENTITY_EIC_PROVISIONING_H
diff --git a/identity/aidl/default/libeic/libeic.h b/identity/aidl/default/libeic/libeic.h
new file mode 100644
index 0000000..88abef8
--- /dev/null
+++ b/identity/aidl/default/libeic/libeic.h
@@ -0,0 +1,39 @@
+/*
+ * Copyright 2020, The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_HARDWARE_IDENTITY_LIBEIC_H
+#define ANDROID_HARDWARE_IDENTITY_LIBEIC_H
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+/* The EIC_INSIDE_LIBEIC_H preprocessor symbol is used to enforce
+ * library users to include only this file. All public interfaces, and
+ * only public interfaces, must be included here.
+ */
+#define EIC_INSIDE_LIBEIC_H
+#include "EicCbor.h"
+#include "EicOps.h"
+#include "EicPresentation.h"
+#include "EicProvisioning.h"
+#undef EIC_INSIDE_LIBEIC_H
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif // ANDROID_HARDWARE_IDENTITY_LIBEIC_H
diff --git a/identity/aidl/default/service.cpp b/identity/aidl/default/service.cpp
index bf95df5..c290c08 100644
--- a/identity/aidl/default/service.cpp
+++ b/identity/aidl/default/service.cpp
@@ -22,20 +22,26 @@
#include "IdentityCredentialStore.h"
+#include "FakeSecureHardwareProxy.h"
+
+using ::android::sp;
using ::android::base::InitLogging;
using ::android::base::StderrLogger;
-using aidl::android::hardware::identity::IdentityCredentialStore;
+using ::aidl::android::hardware::identity::IdentityCredentialStore;
+using ::android::hardware::identity::FakeSecureHardwareProxyFactory;
+using ::android::hardware::identity::SecureHardwareProxyFactory;
int main(int /*argc*/, char* argv[]) {
InitLogging(argv, StderrLogger);
+ sp<SecureHardwareProxyFactory> hwProxyFactory = new FakeSecureHardwareProxyFactory();
+
ABinderProcess_setThreadPoolMaxThreadCount(0);
std::shared_ptr<IdentityCredentialStore> store =
- ndk::SharedRefBase::make<IdentityCredentialStore>();
+ ndk::SharedRefBase::make<IdentityCredentialStore>(hwProxyFactory);
const std::string instance = std::string() + IdentityCredentialStore::descriptor + "/default";
- LOG(INFO) << "instance: " << instance;
binder_status_t status = AServiceManager_addService(store->asBinder().get(), instance.c_str());
CHECK(status == STATUS_OK);
diff --git a/identity/aidl/vts/Android.bp b/identity/aidl/vts/Android.bp
index 03966de..f1b1bcf 100644
--- a/identity/aidl/vts/Android.bp
+++ b/identity/aidl/vts/Android.bp
@@ -4,13 +4,21 @@
"VtsHalTargetTestDefaults",
"use_libaidlvintf_gtest_helper_static",
],
+ cflags: [
+ "-Wno-deprecated-declarations",
+ ],
srcs: [
- "VtsHalIdentityEndToEndTest.cpp",
"VtsIWritableIdentityCredentialTests.cpp",
- "VtsIdentityTestUtils.cpp",
+ "Util.cpp",
"VtsAttestationTests.cpp",
"UserAuthTests.cpp",
"ReaderAuthTests.cpp",
+ "DeleteCredentialTests.cpp",
+ "ProveOwnershipTests.cpp",
+ "UpdateCredentialTests.cpp",
+ "EndToEndTests.cpp",
+ "TestCredentialTests.cpp",
+ "AuthenticationKeyTests.cpp",
],
shared_libs: [
"libbinder",
@@ -22,9 +30,9 @@
"libpuresoftkeymasterdevice",
"android.hardware.keymaster@4.0",
"android.hardware.identity-support-lib",
- "android.hardware.identity-cpp",
- "android.hardware.keymaster-cpp",
- "android.hardware.keymaster-ndk_platform",
+ "android.hardware.identity-unstable-cpp",
+ "android.hardware.keymaster-unstable-cpp",
+ "android.hardware.keymaster-unstable-ndk_platform",
"libkeymaster4support",
"libkeymaster4_1support",
],
diff --git a/identity/aidl/vts/AuthenticationKeyTests.cpp b/identity/aidl/vts/AuthenticationKeyTests.cpp
new file mode 100644
index 0000000..bda3e70
--- /dev/null
+++ b/identity/aidl/vts/AuthenticationKeyTests.cpp
@@ -0,0 +1,194 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#define LOG_TAG "TestCredentialTests"
+
+#include <aidl/Gtest.h>
+#include <aidl/Vintf.h>
+#include <aidl/android/hardware/keymaster/HardwareAuthToken.h>
+#include <aidl/android/hardware/keymaster/VerificationToken.h>
+#include <android-base/logging.h>
+#include <android/hardware/identity/IIdentityCredentialStore.h>
+#include <android/hardware/identity/support/IdentityCredentialSupport.h>
+#include <binder/IServiceManager.h>
+#include <binder/ProcessState.h>
+#include <cppbor.h>
+#include <cppbor_parse.h>
+#include <gtest/gtest.h>
+#include <future>
+#include <map>
+#include <utility>
+
+#include "Util.h"
+
+namespace android::hardware::identity {
+
+using std::endl;
+using std::make_pair;
+using std::map;
+using std::optional;
+using std::pair;
+using std::string;
+using std::tie;
+using std::vector;
+
+using ::android::sp;
+using ::android::String16;
+using ::android::binder::Status;
+
+using ::android::hardware::keymaster::HardwareAuthToken;
+using ::android::hardware::keymaster::VerificationToken;
+
+class AuthenticationKeyTests : public testing::TestWithParam<string> {
+ public:
+ virtual void SetUp() override {
+ string halInstanceName = GetParam();
+ credentialStore_ = android::waitForDeclaredService<IIdentityCredentialStore>(
+ String16(halInstanceName.c_str()));
+ ASSERT_NE(credentialStore_, nullptr);
+ halApiVersion_ = credentialStore_->getInterfaceVersion();
+ }
+
+ sp<IIdentityCredentialStore> credentialStore_;
+ int halApiVersion_;
+};
+
+TEST_P(AuthenticationKeyTests, proofOfProvisionInAuthKeyCert) {
+ if (halApiVersion_ < 3) {
+ GTEST_SKIP() << "Need HAL API version 3, have " << halApiVersion_;
+ }
+
+ string docType = "org.iso.18013-5.2019.mdl";
+ sp<IWritableIdentityCredential> wc;
+ ASSERT_TRUE(credentialStore_
+ ->createCredential(docType,
+ true, // testCredential
+ &wc)
+ .isOk());
+
+ vector<uint8_t> attestationApplicationId = {};
+ vector<uint8_t> attestationChallenge = {1};
+ vector<Certificate> certChain;
+ ASSERT_TRUE(wc->getAttestationCertificate(attestationApplicationId, attestationChallenge,
+ &certChain)
+ .isOk());
+
+ optional<vector<uint8_t>> optCredentialPubKey =
+ support::certificateChainGetTopMostKey(certChain[0].encodedCertificate);
+ ASSERT_TRUE(optCredentialPubKey);
+ vector<uint8_t> credentialPubKey;
+ credentialPubKey = optCredentialPubKey.value();
+
+ size_t proofOfProvisioningSize = 112;
+ // Not in v1 HAL, may fail
+ wc->setExpectedProofOfProvisioningSize(proofOfProvisioningSize);
+
+ ASSERT_TRUE(wc->startPersonalization(1 /* numAccessControlProfiles */,
+ {1} /* numDataElementsPerNamespace */)
+ .isOk());
+
+ // Access control profile 0: open access - don't care about the returned SACP
+ SecureAccessControlProfile sacp;
+ ASSERT_TRUE(wc->addAccessControlProfile(1, {}, false, 0, 0, &sacp).isOk());
+
+ // Single entry - don't care about the returned encrypted data
+ vector<uint8_t> encryptedData;
+ vector<uint8_t> tstrLastName = cppbor::Tstr("Turing").encode();
+ ASSERT_TRUE(wc->beginAddEntry({1}, "ns", "Last name", tstrLastName.size()).isOk());
+ ASSERT_TRUE(wc->addEntryValue(tstrLastName, &encryptedData).isOk());
+
+ vector<uint8_t> proofOfProvisioningSignature;
+ vector<uint8_t> credentialData;
+ Status status = wc->finishAddingEntries(&credentialData, &proofOfProvisioningSignature);
+ EXPECT_TRUE(status.isOk()) << status.exceptionCode() << ": " << status.exceptionMessage();
+
+ optional<vector<uint8_t>> proofOfProvisioning =
+ support::coseSignGetPayload(proofOfProvisioningSignature);
+ ASSERT_TRUE(proofOfProvisioning);
+ string cborPretty = support::cborPrettyPrint(proofOfProvisioning.value(), 32, {});
+ EXPECT_EQ(
+ "[\n"
+ " 'ProofOfProvisioning',\n"
+ " 'org.iso.18013-5.2019.mdl',\n"
+ " [\n"
+ " {\n"
+ " 'id' : 1,\n"
+ " },\n"
+ " ],\n"
+ " {\n"
+ " 'ns' : [\n"
+ " {\n"
+ " 'name' : 'Last name',\n"
+ " 'value' : 'Turing',\n"
+ " 'accessControlProfiles' : [1, ],\n"
+ " },\n"
+ " ],\n"
+ " },\n"
+ " true,\n"
+ "]",
+ cborPretty);
+ // Make sure it's signed by the CredentialKey in the returned cert chain.
+ EXPECT_TRUE(support::coseCheckEcDsaSignature(proofOfProvisioningSignature,
+ {}, // Additional data
+ credentialPubKey));
+
+ // Now get a credential and have it create AuthenticationKey so we can check
+ // the certificate.
+ sp<IIdentityCredential> credential;
+ ASSERT_TRUE(credentialStore_
+ ->getCredential(
+ CipherSuite::CIPHERSUITE_ECDHE_HKDF_ECDSA_WITH_AES_256_GCM_SHA256,
+ credentialData, &credential)
+ .isOk());
+ vector<uint8_t> signingKeyBlob;
+ Certificate signingKeyCertificate;
+ ASSERT_TRUE(credential->generateSigningKeyPair(&signingKeyBlob, &signingKeyCertificate).isOk());
+ optional<vector<uint8_t>> signingPubKey =
+ support::certificateChainGetTopMostKey(signingKeyCertificate.encodedCertificate);
+ EXPECT_TRUE(signingPubKey);
+
+ // SHA-256(ProofOfProvisioning) is embedded in CBOR with the following CDDL
+ //
+ // ProofOfBinding = [
+ // "ProofOfBinding",
+ // bstr, // Contains the SHA-256 of ProofOfProvisioning
+ // ]
+ //
+ // Check that.
+ //
+ optional<vector<uint8_t>> proofOfBinding = support::certificateGetExtension(
+ signingKeyCertificate.encodedCertificate, "1.3.6.1.4.1.11129.2.1.26");
+ ASSERT_TRUE(proofOfBinding);
+ auto [item, _, message] = cppbor::parse(proofOfBinding.value());
+ ASSERT_NE(item, nullptr) << message;
+ const cppbor::Array* arrayItem = item->asArray();
+ ASSERT_NE(arrayItem, nullptr);
+ ASSERT_EQ(arrayItem->size(), 2);
+ const cppbor::Tstr* strItem = (*arrayItem)[0]->asTstr();
+ ASSERT_NE(strItem, nullptr);
+ EXPECT_EQ(strItem->value(), "ProofOfBinding");
+ const cppbor::Bstr* popSha256Item = (*arrayItem)[1]->asBstr();
+ ASSERT_NE(popSha256Item, nullptr);
+ EXPECT_EQ(popSha256Item->value(), support::sha256(proofOfProvisioning.value()));
+}
+
+GTEST_ALLOW_UNINSTANTIATED_PARAMETERIZED_TEST(AuthenticationKeyTests);
+INSTANTIATE_TEST_SUITE_P(
+ Identity, AuthenticationKeyTests,
+ testing::ValuesIn(android::getAidlHalInstanceNames(IIdentityCredentialStore::descriptor)),
+ android::PrintInstanceNameToString);
+
+} // namespace android::hardware::identity
diff --git a/identity/aidl/vts/DeleteCredentialTests.cpp b/identity/aidl/vts/DeleteCredentialTests.cpp
new file mode 100644
index 0000000..1d30067
--- /dev/null
+++ b/identity/aidl/vts/DeleteCredentialTests.cpp
@@ -0,0 +1,169 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#define LOG_TAG "DeleteCredentialTests"
+
+#include <aidl/Gtest.h>
+#include <aidl/Vintf.h>
+#include <aidl/android/hardware/keymaster/HardwareAuthToken.h>
+#include <aidl/android/hardware/keymaster/VerificationToken.h>
+#include <android-base/logging.h>
+#include <android/hardware/identity/IIdentityCredentialStore.h>
+#include <android/hardware/identity/support/IdentityCredentialSupport.h>
+#include <binder/IServiceManager.h>
+#include <binder/ProcessState.h>
+#include <cppbor.h>
+#include <cppbor_parse.h>
+#include <gtest/gtest.h>
+#include <future>
+#include <map>
+#include <utility>
+
+#include "Util.h"
+
+namespace android::hardware::identity {
+
+using std::endl;
+using std::make_pair;
+using std::map;
+using std::optional;
+using std::pair;
+using std::string;
+using std::tie;
+using std::vector;
+
+using ::android::sp;
+using ::android::String16;
+using ::android::binder::Status;
+
+using ::android::hardware::keymaster::HardwareAuthToken;
+using ::android::hardware::keymaster::VerificationToken;
+
+class DeleteCredentialTests : public testing::TestWithParam<string> {
+ public:
+ virtual void SetUp() override {
+ credentialStore_ = android::waitForDeclaredService<IIdentityCredentialStore>(
+ String16(GetParam().c_str()));
+ ASSERT_NE(credentialStore_, nullptr);
+ halApiVersion_ = credentialStore_->getInterfaceVersion();
+ }
+
+ void provisionData();
+
+ // Set by provisionData
+ vector<uint8_t> credentialData_;
+ vector<uint8_t> credentialPubKey_;
+
+ sp<IIdentityCredentialStore> credentialStore_;
+ int halApiVersion_;
+};
+
+void DeleteCredentialTests::provisionData() {
+ string docType = "org.iso.18013-5.2019.mdl";
+ bool testCredential = true;
+ sp<IWritableIdentityCredential> wc;
+ ASSERT_TRUE(credentialStore_->createCredential(docType, testCredential, &wc).isOk());
+
+ vector<uint8_t> attestationApplicationId = {};
+ vector<uint8_t> attestationChallenge = {1};
+ vector<Certificate> certChain;
+ ASSERT_TRUE(wc->getAttestationCertificate(attestationApplicationId, attestationChallenge,
+ &certChain)
+ .isOk());
+
+ optional<vector<uint8_t>> optCredentialPubKey =
+ support::certificateChainGetTopMostKey(certChain[0].encodedCertificate);
+ ASSERT_TRUE(optCredentialPubKey);
+ credentialPubKey_ = optCredentialPubKey.value();
+
+ size_t proofOfProvisioningSize = 106;
+ // Not in v1 HAL, may fail
+ wc->setExpectedProofOfProvisioningSize(proofOfProvisioningSize);
+
+ ASSERT_TRUE(wc->startPersonalization(1 /* numAccessControlProfiles */,
+ {1} /* numDataElementsPerNamespace */)
+ .isOk());
+
+ // Access control profile 0: open access - don't care about the returned SACP
+ SecureAccessControlProfile sacp;
+ ASSERT_TRUE(wc->addAccessControlProfile(1, {}, false, 0, 0, &sacp).isOk());
+
+ // Single entry - don't care about the returned encrypted data
+ ASSERT_TRUE(wc->beginAddEntry({0}, "ns", "Some Data", 1).isOk());
+ vector<uint8_t> encryptedData;
+ ASSERT_TRUE(wc->addEntryValue({9}, &encryptedData).isOk());
+
+ vector<uint8_t> proofOfProvisioningSignature;
+ Status status = wc->finishAddingEntries(&credentialData_, &proofOfProvisioningSignature);
+ EXPECT_TRUE(status.isOk()) << status.exceptionCode() << ": " << status.exceptionMessage();
+}
+
+TEST_P(DeleteCredentialTests, Delete) {
+ provisionData();
+
+ sp<IIdentityCredential> credential;
+ ASSERT_TRUE(credentialStore_
+ ->getCredential(
+ CipherSuite::CIPHERSUITE_ECDHE_HKDF_ECDSA_WITH_AES_256_GCM_SHA256,
+ credentialData_, &credential)
+ .isOk());
+
+ vector<uint8_t> proofOfDeletionSignature;
+ ASSERT_TRUE(credential->deleteCredential(&proofOfDeletionSignature).isOk());
+ optional<vector<uint8_t>> proofOfDeletion =
+ support::coseSignGetPayload(proofOfDeletionSignature);
+ ASSERT_TRUE(proofOfDeletion);
+ string cborPretty = support::cborPrettyPrint(proofOfDeletion.value(), 32, {});
+ EXPECT_EQ("['ProofOfDeletion', 'org.iso.18013-5.2019.mdl', true, ]", cborPretty);
+ EXPECT_TRUE(support::coseCheckEcDsaSignature(proofOfDeletionSignature, {}, // Additional data
+ credentialPubKey_));
+}
+
+TEST_P(DeleteCredentialTests, DeleteWithChallenge) {
+ if (halApiVersion_ < 3) {
+ GTEST_SKIP() << "Need HAL API version 3, have " << halApiVersion_;
+ }
+
+ provisionData();
+
+ sp<IIdentityCredential> credential;
+ ASSERT_TRUE(credentialStore_
+ ->getCredential(
+ CipherSuite::CIPHERSUITE_ECDHE_HKDF_ECDSA_WITH_AES_256_GCM_SHA256,
+ credentialData_, &credential)
+ .isOk());
+
+ vector<uint8_t> challenge = {65, 66, 67};
+ vector<uint8_t> proofOfDeletionSignature;
+ ASSERT_TRUE(
+ credential->deleteCredentialWithChallenge(challenge, &proofOfDeletionSignature).isOk());
+ optional<vector<uint8_t>> proofOfDeletion =
+ support::coseSignGetPayload(proofOfDeletionSignature);
+ ASSERT_TRUE(proofOfDeletion);
+ string cborPretty = support::cborPrettyPrint(proofOfDeletion.value(), 32, {});
+ EXPECT_EQ("['ProofOfDeletion', 'org.iso.18013-5.2019.mdl', {0x41, 0x42, 0x43}, true, ]",
+ cborPretty);
+ EXPECT_TRUE(support::coseCheckEcDsaSignature(proofOfDeletionSignature, {}, // Additional data
+ credentialPubKey_));
+}
+
+GTEST_ALLOW_UNINSTANTIATED_PARAMETERIZED_TEST(DeleteCredentialTests);
+INSTANTIATE_TEST_SUITE_P(
+ Identity, DeleteCredentialTests,
+ testing::ValuesIn(android::getAidlHalInstanceNames(IIdentityCredentialStore::descriptor)),
+ android::PrintInstanceNameToString);
+
+} // namespace android::hardware::identity
diff --git a/identity/aidl/vts/VtsHalIdentityEndToEndTest.cpp b/identity/aidl/vts/EndToEndTests.cpp
similarity index 93%
rename from identity/aidl/vts/VtsHalIdentityEndToEndTest.cpp
rename to identity/aidl/vts/EndToEndTests.cpp
index cdecb97..5798b4c 100644
--- a/identity/aidl/vts/VtsHalIdentityEndToEndTest.cpp
+++ b/identity/aidl/vts/EndToEndTests.cpp
@@ -29,7 +29,7 @@
#include <map>
#include <tuple>
-#include "VtsIdentityTestUtils.h"
+#include "Util.h"
namespace android::hardware::identity {
@@ -50,18 +50,20 @@
using test_utils::validateAttestationCertificate;
-class IdentityAidl : public testing::TestWithParam<std::string> {
+class EndToEndTests : public testing::TestWithParam<std::string> {
public:
virtual void SetUp() override {
credentialStore_ = android::waitForDeclaredService<IIdentityCredentialStore>(
String16(GetParam().c_str()));
ASSERT_NE(credentialStore_, nullptr);
+ halApiVersion_ = credentialStore_->getInterfaceVersion();
}
sp<IIdentityCredentialStore> credentialStore_;
+ int halApiVersion_;
};
-TEST_P(IdentityAidl, hardwareInformation) {
+TEST_P(EndToEndTests, hardwareInformation) {
HardwareInformation info;
ASSERT_TRUE(credentialStore_->getHardwareInformation(&info).isOk());
ASSERT_GT(info.credentialStoreName.size(), 0);
@@ -69,20 +71,21 @@
ASSERT_GE(info.dataChunkSize, 256);
}
-tuple<bool, string, vector<uint8_t>, vector<uint8_t>> extractFromTestCredentialData(
- const vector<uint8_t>& credentialData) {
+tuple<bool, string, vector<uint8_t>, vector<uint8_t>, vector<uint8_t>>
+extractFromTestCredentialData(const vector<uint8_t>& credentialData) {
string docType;
vector<uint8_t> storageKey;
vector<uint8_t> credentialPrivKey;
+ vector<uint8_t> sha256Pop;
auto [item, _, message] = cppbor::parse(credentialData);
if (item == nullptr) {
- return make_tuple(false, docType, storageKey, credentialPrivKey);
+ return make_tuple(false, docType, storageKey, credentialPrivKey, sha256Pop);
}
const cppbor::Array* arrayItem = item->asArray();
if (arrayItem == nullptr || arrayItem->size() != 3) {
- return make_tuple(false, docType, storageKey, credentialPrivKey);
+ return make_tuple(false, docType, storageKey, credentialPrivKey, sha256Pop);
}
const cppbor::Tstr* docTypeItem = (*arrayItem)[0]->asTstr();
@@ -92,7 +95,7 @@
const cppbor::Bstr* encryptedCredentialKeysItem = (*arrayItem)[2]->asBstr();
if (docTypeItem == nullptr || testCredentialItem == nullptr ||
encryptedCredentialKeysItem == nullptr) {
- return make_tuple(false, docType, storageKey, credentialPrivKey);
+ return make_tuple(false, docType, storageKey, credentialPrivKey, sha256Pop);
}
docType = docTypeItem->value();
@@ -103,28 +106,38 @@
optional<vector<uint8_t>> decryptedCredentialKeys =
support::decryptAes128Gcm(hardwareBoundKey, encryptedCredentialKeys, docTypeVec);
if (!decryptedCredentialKeys) {
- return make_tuple(false, docType, storageKey, credentialPrivKey);
+ return make_tuple(false, docType, storageKey, credentialPrivKey, sha256Pop);
}
auto [dckItem, dckPos, dckMessage] = cppbor::parse(decryptedCredentialKeys.value());
if (dckItem == nullptr) {
- return make_tuple(false, docType, storageKey, credentialPrivKey);
+ return make_tuple(false, docType, storageKey, credentialPrivKey, sha256Pop);
}
const cppbor::Array* dckArrayItem = dckItem->asArray();
- if (dckArrayItem == nullptr || dckArrayItem->size() != 2) {
- return make_tuple(false, docType, storageKey, credentialPrivKey);
+ if (dckArrayItem == nullptr) {
+ return make_tuple(false, docType, storageKey, credentialPrivKey, sha256Pop);
+ }
+ if (dckArrayItem->size() < 2) {
+ return make_tuple(false, docType, storageKey, credentialPrivKey, sha256Pop);
}
const cppbor::Bstr* storageKeyItem = (*dckArrayItem)[0]->asBstr();
const cppbor::Bstr* credentialPrivKeyItem = (*dckArrayItem)[1]->asBstr();
if (storageKeyItem == nullptr || credentialPrivKeyItem == nullptr) {
- return make_tuple(false, docType, storageKey, credentialPrivKey);
+ return make_tuple(false, docType, storageKey, credentialPrivKey, sha256Pop);
}
storageKey = storageKeyItem->value();
credentialPrivKey = credentialPrivKeyItem->value();
- return make_tuple(true, docType, storageKey, credentialPrivKey);
+ if (dckArrayItem->size() == 3) {
+ const cppbor::Bstr* sha256PopItem = (*dckArrayItem)[2]->asBstr();
+ if (sha256PopItem == nullptr) {
+ return make_tuple(false, docType, storageKey, credentialPrivKey, sha256Pop);
+ }
+ sha256Pop = sha256PopItem->value();
+ }
+ return make_tuple(true, docType, storageKey, credentialPrivKey, sha256Pop);
}
-TEST_P(IdentityAidl, createAndRetrieveCredential) {
+TEST_P(EndToEndTests, createAndRetrieveCredential) {
// First, generate a key-pair for the reader since its public key will be
// part of the request data.
vector<uint8_t> readerKey;
@@ -277,8 +290,9 @@
// Extract doctype, storage key, and credentialPrivKey from credentialData... this works
// only because we asked for a test-credential meaning that the HBK is all zeroes.
- auto [exSuccess, exDocType, exStorageKey, exCredentialPrivKey] =
+ auto [exSuccess, exDocType, exStorageKey, exCredentialPrivKey, exSha256Pop] =
extractFromTestCredentialData(credentialData);
+
ASSERT_TRUE(exSuccess);
ASSERT_EQ(exDocType, "org.iso.18013-5.2019.mdl");
// ... check that the public key derived from the private key matches what was
@@ -291,6 +305,13 @@
ASSERT_TRUE(exCredentialPubKey);
ASSERT_EQ(exCredentialPubKey.value(), credentialPubKey.value());
+ // Starting with API version 3 (feature version 202101) we require SHA-256(ProofOfProvisioning)
+ // to be in CredentialKeys (which is stored encrypted in CredentialData). Check
+ // that it's there with the expected value.
+ if (halApiVersion_ >= 3) {
+ ASSERT_EQ(exSha256Pop, support::sha256(proofOfProvisioning.value()));
+ }
+
// Now that the credential has been provisioned, read it back and check the
// correct data is returned.
sp<IIdentityCredential> credential;
@@ -498,13 +519,11 @@
EXPECT_EQ(mac, calculatedMac);
}
-GTEST_ALLOW_UNINSTANTIATED_PARAMETERIZED_TEST(IdentityAidl);
+GTEST_ALLOW_UNINSTANTIATED_PARAMETERIZED_TEST(EndToEndTests);
INSTANTIATE_TEST_SUITE_P(
- Identity, IdentityAidl,
+ Identity, EndToEndTests,
testing::ValuesIn(android::getAidlHalInstanceNames(IIdentityCredentialStore::descriptor)),
android::PrintInstanceNameToString);
-// INSTANTIATE_TEST_SUITE_P(Identity, IdentityAidl,
-// testing::Values("android.hardware.identity.IIdentityCredentialStore/default"));
} // namespace android::hardware::identity
diff --git a/identity/aidl/vts/ProveOwnershipTests.cpp b/identity/aidl/vts/ProveOwnershipTests.cpp
new file mode 100644
index 0000000..d1a3d39
--- /dev/null
+++ b/identity/aidl/vts/ProveOwnershipTests.cpp
@@ -0,0 +1,146 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#define LOG_TAG "ProveOwnershipTests"
+
+#include <aidl/Gtest.h>
+#include <aidl/Vintf.h>
+#include <aidl/android/hardware/keymaster/HardwareAuthToken.h>
+#include <aidl/android/hardware/keymaster/VerificationToken.h>
+#include <android-base/logging.h>
+#include <android/hardware/identity/IIdentityCredentialStore.h>
+#include <android/hardware/identity/support/IdentityCredentialSupport.h>
+#include <binder/IServiceManager.h>
+#include <binder/ProcessState.h>
+#include <cppbor.h>
+#include <cppbor_parse.h>
+#include <gtest/gtest.h>
+#include <future>
+#include <map>
+#include <utility>
+
+#include "Util.h"
+
+namespace android::hardware::identity {
+
+using std::endl;
+using std::make_pair;
+using std::map;
+using std::optional;
+using std::pair;
+using std::string;
+using std::tie;
+using std::vector;
+
+using ::android::sp;
+using ::android::String16;
+using ::android::binder::Status;
+
+using ::android::hardware::keymaster::HardwareAuthToken;
+using ::android::hardware::keymaster::VerificationToken;
+
+class ProveOwnershipTests : public testing::TestWithParam<string> {
+ public:
+ virtual void SetUp() override {
+ credentialStore_ = android::waitForDeclaredService<IIdentityCredentialStore>(
+ String16(GetParam().c_str()));
+ ASSERT_NE(credentialStore_, nullptr);
+ halApiVersion_ = credentialStore_->getInterfaceVersion();
+ }
+
+ void provisionData();
+
+ // Set by provisionData
+ vector<uint8_t> credentialData_;
+ vector<uint8_t> credentialPubKey_;
+
+ sp<IIdentityCredentialStore> credentialStore_;
+ int halApiVersion_;
+};
+
+void ProveOwnershipTests::provisionData() {
+ string docType = "org.iso.18013-5.2019.mdl";
+ bool testCredential = true;
+ sp<IWritableIdentityCredential> wc;
+ ASSERT_TRUE(credentialStore_->createCredential(docType, testCredential, &wc).isOk());
+
+ vector<uint8_t> attestationApplicationId = {};
+ vector<uint8_t> attestationChallenge = {1};
+ vector<Certificate> certChain;
+ ASSERT_TRUE(wc->getAttestationCertificate(attestationApplicationId, attestationChallenge,
+ &certChain)
+ .isOk());
+
+ optional<vector<uint8_t>> optCredentialPubKey =
+ support::certificateChainGetTopMostKey(certChain[0].encodedCertificate);
+ ASSERT_TRUE(optCredentialPubKey);
+ credentialPubKey_ = optCredentialPubKey.value();
+
+ size_t proofOfProvisioningSize = 106;
+ // Not in v1 HAL, may fail
+ wc->setExpectedProofOfProvisioningSize(proofOfProvisioningSize);
+
+ ASSERT_TRUE(wc->startPersonalization(1 /* numAccessControlProfiles */,
+ {1} /* numDataElementsPerNamespace */)
+ .isOk());
+
+ // Access control profile 0: open access - don't care about the returned SACP
+ SecureAccessControlProfile sacp;
+ ASSERT_TRUE(wc->addAccessControlProfile(1, {}, false, 0, 0, &sacp).isOk());
+
+ // Single entry - don't care about the returned encrypted data
+ ASSERT_TRUE(wc->beginAddEntry({0}, "ns", "Some Data", 1).isOk());
+ vector<uint8_t> encryptedData;
+ ASSERT_TRUE(wc->addEntryValue({9}, &encryptedData).isOk());
+
+ vector<uint8_t> proofOfProvisioningSignature;
+ Status status = wc->finishAddingEntries(&credentialData_, &proofOfProvisioningSignature);
+ EXPECT_TRUE(status.isOk()) << status.exceptionCode() << ": " << status.exceptionMessage();
+}
+
+TEST_P(ProveOwnershipTests, proveOwnership) {
+ if (halApiVersion_ < 3) {
+ GTEST_SKIP() << "Need HAL API version 3, have " << halApiVersion_;
+ }
+
+ provisionData();
+
+ sp<IIdentityCredential> credential;
+ ASSERT_TRUE(credentialStore_
+ ->getCredential(
+ CipherSuite::CIPHERSUITE_ECDHE_HKDF_ECDSA_WITH_AES_256_GCM_SHA256,
+ credentialData_, &credential)
+ .isOk());
+
+ vector<uint8_t> challenge = {17, 18};
+ vector<uint8_t> proofOfOwnershipSignature;
+ ASSERT_TRUE(credential->proveOwnership(challenge, &proofOfOwnershipSignature).isOk());
+ optional<vector<uint8_t>> proofOfOwnership =
+ support::coseSignGetPayload(proofOfOwnershipSignature);
+ ASSERT_TRUE(proofOfOwnership);
+ string cborPretty = support::cborPrettyPrint(proofOfOwnership.value(), 32, {});
+ EXPECT_EQ("['ProofOfOwnership', 'org.iso.18013-5.2019.mdl', {0x11, 0x12}, true, ]", cborPretty);
+ EXPECT_TRUE(support::coseCheckEcDsaSignature(proofOfOwnershipSignature, {}, // Additional data
+ credentialPubKey_));
+}
+
+GTEST_ALLOW_UNINSTANTIATED_PARAMETERIZED_TEST(ProveOwnershipTests);
+INSTANTIATE_TEST_SUITE_P(
+ Identity, ProveOwnershipTests,
+ testing::ValuesIn(android::getAidlHalInstanceNames(IIdentityCredentialStore::descriptor)),
+ android::PrintInstanceNameToString);
+
+} // namespace android::hardware::identity
diff --git a/identity/aidl/vts/ReaderAuthTests.cpp b/identity/aidl/vts/ReaderAuthTests.cpp
index 0a9fdc0..7656c8e 100644
--- a/identity/aidl/vts/ReaderAuthTests.cpp
+++ b/identity/aidl/vts/ReaderAuthTests.cpp
@@ -32,7 +32,7 @@
#include <map>
#include <utility>
-#include "VtsIdentityTestUtils.h"
+#include "Util.h"
namespace android::hardware::identity {
@@ -123,9 +123,9 @@
const vector<uint8_t>& signingKey) {
time_t validityNotBefore = 0;
time_t validityNotAfter = 0xffffffff;
- optional<vector<uint8_t>> cert =
- support::ecPublicKeyGenerateCertificate(publicKey, signingKey, "24601", "Issuer",
- "Subject", validityNotBefore, validityNotAfter);
+ optional<vector<uint8_t>> cert = support::ecPublicKeyGenerateCertificate(
+ publicKey, signingKey, "24601", "Issuer", "Subject", validityNotBefore,
+ validityNotAfter, {});
return cert.value();
}
diff --git a/identity/aidl/vts/TestCredentialTests.cpp b/identity/aidl/vts/TestCredentialTests.cpp
new file mode 100644
index 0000000..d53de3b
--- /dev/null
+++ b/identity/aidl/vts/TestCredentialTests.cpp
@@ -0,0 +1,204 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#define LOG_TAG "TestCredentialTests"
+
+#include <aidl/Gtest.h>
+#include <aidl/Vintf.h>
+#include <aidl/android/hardware/keymaster/HardwareAuthToken.h>
+#include <aidl/android/hardware/keymaster/VerificationToken.h>
+#include <android-base/logging.h>
+#include <android/hardware/identity/IIdentityCredentialStore.h>
+#include <android/hardware/identity/support/IdentityCredentialSupport.h>
+#include <binder/IServiceManager.h>
+#include <binder/ProcessState.h>
+#include <cppbor.h>
+#include <cppbor_parse.h>
+#include <gtest/gtest.h>
+#include <future>
+#include <map>
+#include <utility>
+
+#include "Util.h"
+
+namespace android::hardware::identity {
+
+using std::endl;
+using std::make_pair;
+using std::map;
+using std::optional;
+using std::pair;
+using std::string;
+using std::tie;
+using std::vector;
+
+using ::android::sp;
+using ::android::String16;
+using ::android::binder::Status;
+
+using ::android::hardware::keymaster::HardwareAuthToken;
+using ::android::hardware::keymaster::VerificationToken;
+
+class TestCredentialTests : public testing::TestWithParam<string> {
+ public:
+ virtual void SetUp() override {
+ string halInstanceName = GetParam();
+ credentialStore_ = android::waitForDeclaredService<IIdentityCredentialStore>(
+ String16(halInstanceName.c_str()));
+ ASSERT_NE(credentialStore_, nullptr);
+ halApiVersion_ = credentialStore_->getInterfaceVersion();
+ }
+
+ sp<IIdentityCredentialStore> credentialStore_;
+ int halApiVersion_;
+};
+
+TEST_P(TestCredentialTests, testCredential) {
+ string docType = "org.iso.18013-5.2019.mdl";
+ sp<IWritableIdentityCredential> wc;
+ ASSERT_TRUE(credentialStore_
+ ->createCredential(docType,
+ true, // testCredential
+ &wc)
+ .isOk());
+
+ vector<uint8_t> attestationApplicationId = {};
+ vector<uint8_t> attestationChallenge = {1};
+ vector<Certificate> certChain;
+ ASSERT_TRUE(wc->getAttestationCertificate(attestationApplicationId, attestationChallenge,
+ &certChain)
+ .isOk());
+
+ optional<vector<uint8_t>> optCredentialPubKey =
+ support::certificateChainGetTopMostKey(certChain[0].encodedCertificate);
+ ASSERT_TRUE(optCredentialPubKey);
+ vector<uint8_t> credentialPubKey;
+ credentialPubKey = optCredentialPubKey.value();
+
+ size_t proofOfProvisioningSize = 112;
+ // Not in v1 HAL, may fail
+ wc->setExpectedProofOfProvisioningSize(proofOfProvisioningSize);
+
+ ASSERT_TRUE(wc->startPersonalization(1 /* numAccessControlProfiles */,
+ {1} /* numDataElementsPerNamespace */)
+ .isOk());
+
+ // Access control profile 0: open access - don't care about the returned SACP
+ SecureAccessControlProfile sacp;
+ ASSERT_TRUE(wc->addAccessControlProfile(1, {}, false, 0, 0, &sacp).isOk());
+
+ // Single entry - don't care about the returned encrypted data
+ vector<uint8_t> encryptedData;
+ vector<uint8_t> tstrLastName = cppbor::Tstr("Turing").encode();
+ ASSERT_TRUE(wc->beginAddEntry({1}, "ns", "Last name", tstrLastName.size()).isOk());
+ ASSERT_TRUE(wc->addEntryValue(tstrLastName, &encryptedData).isOk());
+
+ vector<uint8_t> proofOfProvisioningSignature;
+ vector<uint8_t> credentialData;
+ Status status = wc->finishAddingEntries(&credentialData, &proofOfProvisioningSignature);
+ EXPECT_TRUE(status.isOk()) << status.exceptionCode() << ": " << status.exceptionMessage();
+
+ optional<vector<uint8_t>> proofOfProvisioning =
+ support::coseSignGetPayload(proofOfProvisioningSignature);
+ ASSERT_TRUE(proofOfProvisioning);
+ string cborPretty = support::cborPrettyPrint(proofOfProvisioning.value(), 32, {});
+ EXPECT_EQ(
+ "[\n"
+ " 'ProofOfProvisioning',\n"
+ " 'org.iso.18013-5.2019.mdl',\n"
+ " [\n"
+ " {\n"
+ " 'id' : 1,\n"
+ " },\n"
+ " ],\n"
+ " {\n"
+ " 'ns' : [\n"
+ " {\n"
+ " 'name' : 'Last name',\n"
+ " 'value' : 'Turing',\n"
+ " 'accessControlProfiles' : [1, ],\n"
+ " },\n"
+ " ],\n"
+ " },\n"
+ " true,\n"
+ "]",
+ cborPretty);
+ // Make sure it's signed by the CredentialKey in the returned cert chain.
+ EXPECT_TRUE(support::coseCheckEcDsaSignature(proofOfProvisioningSignature,
+ {}, // Additional data
+ credentialPubKey));
+
+ // Now analyze credentialData..
+ auto [item, _, message] = cppbor::parse(credentialData);
+ ASSERT_NE(item, nullptr);
+ const cppbor::Array* arrayItem = item->asArray();
+ ASSERT_NE(arrayItem, nullptr);
+ ASSERT_EQ(arrayItem->size(), 3);
+ const cppbor::Tstr* docTypeItem = (*arrayItem)[0]->asTstr();
+ const cppbor::Bool* testCredentialItem =
+ ((*arrayItem)[1]->asSimple() != nullptr ? ((*arrayItem)[1]->asSimple()->asBool())
+ : nullptr);
+ EXPECT_EQ(docTypeItem->value(), docType);
+ EXPECT_EQ(testCredentialItem->value(), true);
+
+ vector<uint8_t> hardwareBoundKey = support::getTestHardwareBoundKey();
+ const cppbor::Bstr* encryptedCredentialKeysItem = (*arrayItem)[2]->asBstr();
+ const vector<uint8_t>& encryptedCredentialKeys = encryptedCredentialKeysItem->value();
+ const vector<uint8_t> docTypeVec(docType.begin(), docType.end());
+ optional<vector<uint8_t>> decryptedCredentialKeys =
+ support::decryptAes128Gcm(hardwareBoundKey, encryptedCredentialKeys, docTypeVec);
+ ASSERT_TRUE(decryptedCredentialKeys);
+ auto [dckItem, dckPos, dckMessage] = cppbor::parse(decryptedCredentialKeys.value());
+ ASSERT_NE(dckItem, nullptr) << dckMessage;
+ const cppbor::Array* dckArrayItem = dckItem->asArray();
+ ASSERT_NE(dckArrayItem, nullptr);
+ // In HAL API version 1 and 2 this array has two items, in version 3 and later it has three.
+ if (halApiVersion_ < 3) {
+ ASSERT_EQ(dckArrayItem->size(), 2);
+ } else {
+ ASSERT_EQ(dckArrayItem->size(), 3);
+ }
+ const cppbor::Bstr* storageKeyItem = (*dckArrayItem)[0]->asBstr();
+ const vector<uint8_t> storageKey = storageKeyItem->value();
+ // const cppbor::Bstr* credentialPrivKeyItem = (*dckArrayItem)[1]->asBstr();
+ // const vector<uint8_t> credentialPrivKey = credentialPrivKeyItem->value();
+
+ // Check storageKey can be used to decrypt |encryptedData| to |tstrLastName|
+ vector<uint8_t> additionalData = cppbor::Map()
+ .add("Namespace", "ns")
+ .add("Name", "Last name")
+ .add("AccessControlProfileIds", cppbor::Array().add(1))
+ .encode();
+ optional<vector<uint8_t>> decryptedDataItemValue =
+ support::decryptAes128Gcm(storageKey, encryptedData, additionalData);
+ ASSERT_TRUE(decryptedDataItemValue);
+ EXPECT_EQ(decryptedDataItemValue.value(), tstrLastName);
+
+ // Check that SHA-256(ProofOfProvisioning) matches (only in HAL API version 3)
+ if (halApiVersion_ >= 3) {
+ const cppbor::Bstr* popSha256Item = (*dckArrayItem)[2]->asBstr();
+ const vector<uint8_t> popSha256 = popSha256Item->value();
+ ASSERT_EQ(popSha256, support::sha256(proofOfProvisioning.value()));
+ }
+}
+
+GTEST_ALLOW_UNINSTANTIATED_PARAMETERIZED_TEST(TestCredentialTests);
+INSTANTIATE_TEST_SUITE_P(
+ Identity, TestCredentialTests,
+ testing::ValuesIn(android::getAidlHalInstanceNames(IIdentityCredentialStore::descriptor)),
+ android::PrintInstanceNameToString);
+
+} // namespace android::hardware::identity
diff --git a/identity/aidl/vts/UpdateCredentialTests.cpp b/identity/aidl/vts/UpdateCredentialTests.cpp
new file mode 100644
index 0000000..9c5ca55
--- /dev/null
+++ b/identity/aidl/vts/UpdateCredentialTests.cpp
@@ -0,0 +1,232 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#define LOG_TAG "UpdateCredentialTests"
+
+#include <aidl/Gtest.h>
+#include <aidl/Vintf.h>
+#include <aidl/android/hardware/keymaster/HardwareAuthToken.h>
+#include <aidl/android/hardware/keymaster/VerificationToken.h>
+#include <android-base/logging.h>
+#include <android/hardware/identity/IIdentityCredentialStore.h>
+#include <android/hardware/identity/support/IdentityCredentialSupport.h>
+#include <binder/IServiceManager.h>
+#include <binder/ProcessState.h>
+#include <cppbor.h>
+#include <cppbor_parse.h>
+#include <gtest/gtest.h>
+#include <future>
+#include <map>
+#include <utility>
+
+#include "Util.h"
+
+namespace android::hardware::identity {
+
+using std::endl;
+using std::make_pair;
+using std::map;
+using std::optional;
+using std::pair;
+using std::string;
+using std::tie;
+using std::vector;
+
+using ::android::sp;
+using ::android::String16;
+using ::android::binder::Status;
+
+using ::android::hardware::keymaster::HardwareAuthToken;
+using ::android::hardware::keymaster::VerificationToken;
+
+class UpdateCredentialTests : public testing::TestWithParam<string> {
+ public:
+ virtual void SetUp() override {
+ credentialStore_ = android::waitForDeclaredService<IIdentityCredentialStore>(
+ String16(GetParam().c_str()));
+ ASSERT_NE(credentialStore_, nullptr);
+ halApiVersion_ = credentialStore_->getInterfaceVersion();
+ }
+
+ void provisionData();
+
+ // Set by provisionData
+ vector<uint8_t> credentialData_;
+ vector<uint8_t> credentialPubKey_;
+
+ sp<IIdentityCredentialStore> credentialStore_;
+ int halApiVersion_;
+};
+
+void UpdateCredentialTests::provisionData() {
+ string docType = "org.iso.18013-5.2019.mdl";
+ bool testCredential = true;
+ sp<IWritableIdentityCredential> wc;
+ ASSERT_TRUE(credentialStore_->createCredential(docType, testCredential, &wc).isOk());
+
+ vector<uint8_t> attestationApplicationId = {};
+ vector<uint8_t> attestationChallenge = {1};
+ vector<Certificate> certChain;
+ ASSERT_TRUE(wc->getAttestationCertificate(attestationApplicationId, attestationChallenge,
+ &certChain)
+ .isOk());
+
+ optional<vector<uint8_t>> optCredentialPubKey =
+ support::certificateChainGetTopMostKey(certChain[0].encodedCertificate);
+ ASSERT_TRUE(optCredentialPubKey);
+ credentialPubKey_ = optCredentialPubKey.value();
+
+ size_t proofOfProvisioningSize = 112;
+ // Not in v1 HAL, may fail
+ wc->setExpectedProofOfProvisioningSize(proofOfProvisioningSize);
+
+ ASSERT_TRUE(wc->startPersonalization(1 /* numAccessControlProfiles */,
+ {1} /* numDataElementsPerNamespace */)
+ .isOk());
+
+ // Access control profile 0: open access - don't care about the returned SACP
+ SecureAccessControlProfile sacp;
+ ASSERT_TRUE(wc->addAccessControlProfile(1, {}, false, 0, 0, &sacp).isOk());
+
+ // Single entry - don't care about the returned encrypted data
+ vector<uint8_t> encryptedData;
+ vector<uint8_t> tstrLastName = cppbor::Tstr("Prince").encode();
+ ASSERT_TRUE(wc->beginAddEntry({1}, "ns", "Last name", tstrLastName.size()).isOk());
+ ASSERT_TRUE(wc->addEntryValue(tstrLastName, &encryptedData).isOk());
+
+ vector<uint8_t> proofOfProvisioningSignature;
+ Status status = wc->finishAddingEntries(&credentialData_, &proofOfProvisioningSignature);
+ EXPECT_TRUE(status.isOk()) << status.exceptionCode() << ": " << status.exceptionMessage();
+
+ optional<vector<uint8_t>> proofOfProvisioning =
+ support::coseSignGetPayload(proofOfProvisioningSignature);
+ ASSERT_TRUE(proofOfProvisioning);
+ string cborPretty = support::cborPrettyPrint(proofOfProvisioning.value(), 32, {});
+ EXPECT_EQ(
+ "[\n"
+ " 'ProofOfProvisioning',\n"
+ " 'org.iso.18013-5.2019.mdl',\n"
+ " [\n"
+ " {\n"
+ " 'id' : 1,\n"
+ " },\n"
+ " ],\n"
+ " {\n"
+ " 'ns' : [\n"
+ " {\n"
+ " 'name' : 'Last name',\n"
+ " 'value' : 'Prince',\n"
+ " 'accessControlProfiles' : [1, ],\n"
+ " },\n"
+ " ],\n"
+ " },\n"
+ " true,\n"
+ "]",
+ cborPretty);
+ // Make sure it's signed by the CredentialKey in the returned cert chain.
+ EXPECT_TRUE(support::coseCheckEcDsaSignature(proofOfProvisioningSignature,
+ {}, // Additional data
+ credentialPubKey_));
+}
+
+TEST_P(UpdateCredentialTests, updateCredential) {
+ if (halApiVersion_ < 3) {
+ GTEST_SKIP() << "Need HAL API version 3, have " << halApiVersion_;
+ }
+
+ provisionData();
+
+ sp<IIdentityCredential> credential;
+ ASSERT_TRUE(credentialStore_
+ ->getCredential(
+ CipherSuite::CIPHERSUITE_ECDHE_HKDF_ECDSA_WITH_AES_256_GCM_SHA256,
+ credentialData_, &credential)
+ .isOk());
+
+ sp<IWritableIdentityCredential> wc;
+ ASSERT_TRUE(credential->updateCredential(&wc).isOk());
+
+ // Getting an attestation cert should fail (because it's an update).
+ vector<uint8_t> attestationApplicationId = {};
+ vector<uint8_t> attestationChallenge = {1};
+ vector<Certificate> certChain;
+ Status result = wc->getAttestationCertificate(attestationApplicationId, attestationChallenge,
+ &certChain);
+ ASSERT_FALSE(result.isOk());
+ EXPECT_EQ(binder::Status::EX_SERVICE_SPECIFIC, result.exceptionCode());
+ EXPECT_EQ(IIdentityCredentialStore::STATUS_FAILED, result.serviceSpecificErrorCode());
+
+ // Now provision some new data...
+ //
+ size_t proofOfProvisioningSize = 117;
+ // Not in v1 HAL, may fail
+ wc->setExpectedProofOfProvisioningSize(proofOfProvisioningSize);
+
+ ASSERT_TRUE(wc->startPersonalization(1 /* numAccessControlProfiles */,
+ {1} /* numDataElementsPerNamespace */)
+ .isOk());
+
+ // Access control profile 0: open access - don't care about the returned SACP
+ SecureAccessControlProfile sacp;
+ ASSERT_TRUE(wc->addAccessControlProfile(2, {}, false, 0, 0, &sacp).isOk());
+
+ // Single entry - don't care about the returned encrypted data
+ vector<uint8_t> encryptedData;
+ vector<uint8_t> tstrLastName = cppbor::Tstr("T.A.F.K.A.P").encode();
+ ASSERT_TRUE(wc->beginAddEntry({2}, "ns", "Last name", tstrLastName.size()).isOk());
+ ASSERT_TRUE(wc->addEntryValue(tstrLastName, &encryptedData).isOk());
+
+ vector<uint8_t> proofOfProvisioningSignature;
+ Status status = wc->finishAddingEntries(&credentialData_, &proofOfProvisioningSignature);
+ EXPECT_TRUE(status.isOk()) << status.exceptionCode() << ": " << status.exceptionMessage();
+ optional<vector<uint8_t>> proofOfProvisioning =
+ support::coseSignGetPayload(proofOfProvisioningSignature);
+ ASSERT_TRUE(proofOfProvisioning);
+ string cborPretty = support::cborPrettyPrint(proofOfProvisioning.value(), 32, {});
+ EXPECT_EQ(
+ "[\n"
+ " 'ProofOfProvisioning',\n"
+ " 'org.iso.18013-5.2019.mdl',\n"
+ " [\n"
+ " {\n"
+ " 'id' : 2,\n"
+ " },\n"
+ " ],\n"
+ " {\n"
+ " 'ns' : [\n"
+ " {\n"
+ " 'name' : 'Last name',\n"
+ " 'value' : 'T.A.F.K.A.P',\n"
+ " 'accessControlProfiles' : [2, ],\n"
+ " },\n"
+ " ],\n"
+ " },\n"
+ " true,\n"
+ "]",
+ cborPretty);
+ // Make sure it's signed by the same CredentialKey we originally provisioned with.
+ EXPECT_TRUE(support::coseCheckEcDsaSignature(proofOfProvisioningSignature,
+ {}, // Additional data
+ credentialPubKey_));
+}
+
+GTEST_ALLOW_UNINSTANTIATED_PARAMETERIZED_TEST(UpdateCredentialTests);
+INSTANTIATE_TEST_SUITE_P(
+ Identity, UpdateCredentialTests,
+ testing::ValuesIn(android::getAidlHalInstanceNames(IIdentityCredentialStore::descriptor)),
+ android::PrintInstanceNameToString);
+
+} // namespace android::hardware::identity
diff --git a/identity/aidl/vts/UserAuthTests.cpp b/identity/aidl/vts/UserAuthTests.cpp
index 327493c..ef89d1c 100644
--- a/identity/aidl/vts/UserAuthTests.cpp
+++ b/identity/aidl/vts/UserAuthTests.cpp
@@ -32,7 +32,7 @@
#include <map>
#include <utility>
-#include "VtsIdentityTestUtils.h"
+#include "Util.h"
namespace android::hardware::identity {
@@ -145,7 +145,7 @@
EXPECT_TRUE(status.isOk()) << status.exceptionCode() << ": " << status.exceptionMessage();
}
-// From ReaderAuthTest.cpp - TODO: consolidate with VtsIdentityTestUtils.h
+// From ReaderAuthTest.cpp - TODO: consolidate with Util.h
pair<vector<uint8_t>, vector<uint8_t>> generateReaderKey();
vector<uint8_t> generateReaderCert(const vector<uint8_t>& publicKey,
const vector<uint8_t>& signingKey);
diff --git a/identity/aidl/vts/VtsIdentityTestUtils.cpp b/identity/aidl/vts/Util.cpp
similarity index 98%
rename from identity/aidl/vts/VtsIdentityTestUtils.cpp
rename to identity/aidl/vts/Util.cpp
index 3b10651..1148cb0 100644
--- a/identity/aidl/vts/VtsIdentityTestUtils.cpp
+++ b/identity/aidl/vts/Util.cpp
@@ -14,15 +14,18 @@
* limitations under the License.
*/
-#define LOG_TAG "VtsIdentityTestUtils"
+#define LOG_TAG "Util"
-#include "VtsIdentityTestUtils.h"
+#include "Util.h"
+
+#include <android-base/logging.h>
#include <aidl/Gtest.h>
-#include <android-base/logging.h>
+#include <android-base/stringprintf.h>
#include <keymaster/km_openssl/openssl_utils.h>
#include <keymasterV4_1/attestation_record.h>
#include <charconv>
+
#include <map>
namespace android::hardware::identity::test_utils {
@@ -35,6 +38,7 @@
using ::android::sp;
using ::android::String16;
+using ::android::base::StringPrintf;
using ::android::binder::Status;
using ::keymaster::X509_Ptr;
@@ -86,7 +90,7 @@
return support::ecPublicKeyGenerateCertificate(readerPublicKey.value(), readerKey.value(),
serialDecimal, issuer, subject,
- validityNotBefore, validityNotAfter);
+ validityNotBefore, validityNotAfter, {});
}
optional<vector<SecureAccessControlProfile>> addAccessControlProfiles(
diff --git a/identity/aidl/vts/VtsIdentityTestUtils.h b/identity/aidl/vts/Util.h
similarity index 99%
rename from identity/aidl/vts/VtsIdentityTestUtils.h
rename to identity/aidl/vts/Util.h
index 85c24f8..80e52a2 100644
--- a/identity/aidl/vts/VtsIdentityTestUtils.h
+++ b/identity/aidl/vts/Util.h
@@ -21,6 +21,7 @@
#include <android/hardware/identity/support/IdentityCredentialSupport.h>
#include <cppbor.h>
#include <cppbor_parse.h>
+#include <gtest/gtest.h>
namespace android::hardware::identity::test_utils {
diff --git a/identity/aidl/vts/VtsAttestationTests.cpp b/identity/aidl/vts/VtsAttestationTests.cpp
index 5529853..e12fe05 100644
--- a/identity/aidl/vts/VtsAttestationTests.cpp
+++ b/identity/aidl/vts/VtsAttestationTests.cpp
@@ -29,7 +29,7 @@
#include <future>
#include <map>
-#include "VtsIdentityTestUtils.h"
+#include "Util.h"
namespace android::hardware::identity {
diff --git a/identity/aidl/vts/VtsIWritableIdentityCredentialTests.cpp b/identity/aidl/vts/VtsIWritableIdentityCredentialTests.cpp
index 56e17ba..cc63c48 100644
--- a/identity/aidl/vts/VtsIWritableIdentityCredentialTests.cpp
+++ b/identity/aidl/vts/VtsIWritableIdentityCredentialTests.cpp
@@ -29,7 +29,7 @@
#include <future>
#include <map>
-#include "VtsIdentityTestUtils.h"
+#include "Util.h"
namespace android::hardware::identity {
@@ -182,7 +182,7 @@
false /* testCredential */));
// Verify set a large number of profile count and entry count is ok
- const vector<int32_t> entryCounts = {3000};
+ const vector<int32_t> entryCounts = {255};
writableCredential->setExpectedProofOfProvisioningSize(123456);
result = writableCredential->startPersonalization(25, entryCounts);
EXPECT_TRUE(result.isOk()) << result.exceptionCode() << "; " << result.exceptionMessage()
diff --git a/identity/support/include/android/hardware/identity/support/IdentityCredentialSupport.h b/identity/support/include/android/hardware/identity/support/IdentityCredentialSupport.h
index 3aa5bb6..3b91de6 100644
--- a/identity/support/include/android/hardware/identity/support/IdentityCredentialSupport.h
+++ b/identity/support/include/android/hardware/identity/support/IdentityCredentialSupport.h
@@ -18,6 +18,7 @@
#define IDENTITY_SUPPORT_INCLUDE_IDENTITY_CREDENTIAL_UTILS_H_
#include <cstdint>
+#include <map>
#include <optional>
#include <string>
#include <tuple>
@@ -29,11 +30,12 @@
namespace identity {
namespace support {
+using ::std::map;
using ::std::optional;
+using ::std::pair;
using ::std::string;
using ::std::tuple;
using ::std::vector;
-using ::std::pair;
// The semantic tag for a bstr which includes Encoded CBOR (RFC 7049, section 2.4)
const int kSemanticTagEncodedCbor = 24;
@@ -221,6 +223,11 @@
//
optional<pair<time_t, time_t>> certificateGetValidity(const vector<uint8_t>& x509Certificate);
+// Looks for an extension with OID in |oidStr| which must be an stored as an OCTET STRING.
+//
+optional<vector<uint8_t>> certificateGetExtension(const vector<uint8_t>& x509Certificate,
+ const string& oidStr);
+
// Generates a X.509 certificate for |publicKey| (which must be in the format
// returned by ecKeyPairGetPublicKey()).
//
@@ -230,7 +237,8 @@
optional<vector<uint8_t>> ecPublicKeyGenerateCertificate(
const vector<uint8_t>& publicKey, const vector<uint8_t>& signingKey,
const string& serialDecimal, const string& issuer, const string& subject,
- time_t validityNotBefore, time_t validityNotAfter);
+ time_t validityNotBefore, time_t validityNotAfter,
+ const map<string, vector<uint8_t>>& extensions);
// Performs Elliptic-curve Diffie-Helman using |publicKey| (which must be in the
// format returned by ecKeyPairGetPublicKey()) and |privateKey| (which must be
diff --git a/identity/support/src/IdentityCredentialSupport.cpp b/identity/support/src/IdentityCredentialSupport.cpp
index 093120d..38348ac 100644
--- a/identity/support/src/IdentityCredentialSupport.cpp
+++ b/identity/support/src/IdentityCredentialSupport.cpp
@@ -344,15 +344,22 @@
// Crypto functionality / abstraction.
// ---------------------------------------------------------------------------
-struct EVP_CIPHER_CTX_Deleter {
- void operator()(EVP_CIPHER_CTX* ctx) const {
- if (ctx != nullptr) {
- EVP_CIPHER_CTX_free(ctx);
- }
- }
-};
-
-using EvpCipherCtxPtr = unique_ptr<EVP_CIPHER_CTX, EVP_CIPHER_CTX_Deleter>;
+using EvpCipherCtxPtr = bssl::UniquePtr<EVP_CIPHER_CTX>;
+using EC_KEY_Ptr = bssl::UniquePtr<EC_KEY>;
+using EVP_PKEY_Ptr = bssl::UniquePtr<EVP_PKEY>;
+using EVP_PKEY_CTX_Ptr = bssl::UniquePtr<EVP_PKEY_CTX>;
+using EC_GROUP_Ptr = bssl::UniquePtr<EC_GROUP>;
+using EC_POINT_Ptr = bssl::UniquePtr<EC_POINT>;
+using ECDSA_SIG_Ptr = bssl::UniquePtr<ECDSA_SIG>;
+using X509_Ptr = bssl::UniquePtr<X509>;
+using PKCS12_Ptr = bssl::UniquePtr<PKCS12>;
+using BIGNUM_Ptr = bssl::UniquePtr<BIGNUM>;
+using ASN1_INTEGER_Ptr = bssl::UniquePtr<ASN1_INTEGER>;
+using ASN1_TIME_Ptr = bssl::UniquePtr<ASN1_TIME>;
+using ASN1_OCTET_STRING_Ptr = bssl::UniquePtr<ASN1_OCTET_STRING>;
+using ASN1_OBJECT_Ptr = bssl::UniquePtr<ASN1_OBJECT>;
+using X509_NAME_Ptr = bssl::UniquePtr<X509_NAME>;
+using X509_EXTENSION_Ptr = bssl::UniquePtr<X509_EXTENSION>;
// bool getRandom(size_t numBytes, vector<uint8_t>& output) {
optional<vector<uint8_t>> getRandom(size_t numBytes) {
@@ -534,115 +541,6 @@
return encryptedData;
}
-struct EC_KEY_Deleter {
- void operator()(EC_KEY* key) const {
- if (key != nullptr) {
- EC_KEY_free(key);
- }
- }
-};
-using EC_KEY_Ptr = unique_ptr<EC_KEY, EC_KEY_Deleter>;
-
-struct EVP_PKEY_Deleter {
- void operator()(EVP_PKEY* key) const {
- if (key != nullptr) {
- EVP_PKEY_free(key);
- }
- }
-};
-using EVP_PKEY_Ptr = unique_ptr<EVP_PKEY, EVP_PKEY_Deleter>;
-
-struct EVP_PKEY_CTX_Deleter {
- void operator()(EVP_PKEY_CTX* ctx) const {
- if (ctx != nullptr) {
- EVP_PKEY_CTX_free(ctx);
- }
- }
-};
-using EVP_PKEY_CTX_Ptr = unique_ptr<EVP_PKEY_CTX, EVP_PKEY_CTX_Deleter>;
-
-struct EC_GROUP_Deleter {
- void operator()(EC_GROUP* group) const {
- if (group != nullptr) {
- EC_GROUP_free(group);
- }
- }
-};
-using EC_GROUP_Ptr = unique_ptr<EC_GROUP, EC_GROUP_Deleter>;
-
-struct EC_POINT_Deleter {
- void operator()(EC_POINT* point) const {
- if (point != nullptr) {
- EC_POINT_free(point);
- }
- }
-};
-
-using EC_POINT_Ptr = unique_ptr<EC_POINT, EC_POINT_Deleter>;
-
-struct ECDSA_SIG_Deleter {
- void operator()(ECDSA_SIG* sig) const {
- if (sig != nullptr) {
- ECDSA_SIG_free(sig);
- }
- }
-};
-using ECDSA_SIG_Ptr = unique_ptr<ECDSA_SIG, ECDSA_SIG_Deleter>;
-
-struct X509_Deleter {
- void operator()(X509* x509) const {
- if (x509 != nullptr) {
- X509_free(x509);
- }
- }
-};
-using X509_Ptr = unique_ptr<X509, X509_Deleter>;
-
-struct PKCS12_Deleter {
- void operator()(PKCS12* pkcs12) const {
- if (pkcs12 != nullptr) {
- PKCS12_free(pkcs12);
- }
- }
-};
-using PKCS12_Ptr = unique_ptr<PKCS12, PKCS12_Deleter>;
-
-struct BIGNUM_Deleter {
- void operator()(BIGNUM* bignum) const {
- if (bignum != nullptr) {
- BN_free(bignum);
- }
- }
-};
-using BIGNUM_Ptr = unique_ptr<BIGNUM, BIGNUM_Deleter>;
-
-struct ASN1_INTEGER_Deleter {
- void operator()(ASN1_INTEGER* value) const {
- if (value != nullptr) {
- ASN1_INTEGER_free(value);
- }
- }
-};
-using ASN1_INTEGER_Ptr = unique_ptr<ASN1_INTEGER, ASN1_INTEGER_Deleter>;
-
-struct ASN1_TIME_Deleter {
- void operator()(ASN1_TIME* value) const {
- if (value != nullptr) {
- ASN1_TIME_free(value);
- }
- }
-};
-using ASN1_TIME_Ptr = unique_ptr<ASN1_TIME, ASN1_TIME_Deleter>;
-
-struct X509_NAME_Deleter {
- void operator()(X509_NAME* value) const {
- if (value != nullptr) {
- X509_NAME_free(value);
- }
- }
-};
-using X509_NAME_Ptr = unique_ptr<X509_NAME, X509_NAME_Deleter>;
-
vector<uint8_t> certificateChainJoin(const vector<vector<uint8_t>>& certificateChain) {
vector<uint8_t> ret;
for (const vector<uint8_t>& certificate : certificateChain) {
@@ -1221,8 +1119,19 @@
return {};
}
vector<uint8_t> privateKey;
- privateKey.resize(BN_num_bytes(bignum));
- BN_bn2bin(bignum, privateKey.data());
+
+ // Note that this may return fewer than 32 bytes so pad with zeroes since we
+ // want to always return 32 bytes.
+ size_t numBytes = BN_num_bytes(bignum);
+ if (numBytes > 32) {
+ LOG(ERROR) << "Size is " << numBytes << ", expected this to be 32 or less";
+ return {};
+ }
+ privateKey.resize(32);
+ for (size_t n = 0; n < 32 - numBytes; n++) {
+ privateKey[n] = 0x00;
+ }
+ BN_bn2bin(bignum, privateKey.data() + 32 - numBytes);
return privateKey;
}
@@ -1379,7 +1288,8 @@
optional<vector<uint8_t>> ecPublicKeyGenerateCertificate(
const vector<uint8_t>& publicKey, const vector<uint8_t>& signingKey,
const string& serialDecimal, const string& issuer, const string& subject,
- time_t validityNotBefore, time_t validityNotAfter) {
+ time_t validityNotBefore, time_t validityNotAfter,
+ const map<string, vector<uint8_t>>& extensions) {
auto group = EC_GROUP_Ptr(EC_GROUP_new_by_curve_name(NID_X9_62_prime256v1));
auto point = EC_POINT_Ptr(EC_POINT_new(group.get()));
if (EC_POINT_oct2point(group.get(), point.get(), publicKey.data(), publicKey.size(), nullptr) !=
@@ -1482,6 +1392,32 @@
return {};
}
+ for (auto const& [oidStr, blob] : extensions) {
+ ASN1_OBJECT_Ptr oid(
+ OBJ_txt2obj(oidStr.c_str(), 1)); // accept numerical dotted string form only
+ if (!oid.get()) {
+ LOG(ERROR) << "Error setting OID";
+ return {};
+ }
+ ASN1_OCTET_STRING_Ptr octetString(ASN1_OCTET_STRING_new());
+ if (!ASN1_OCTET_STRING_set(octetString.get(), blob.data(), blob.size())) {
+ LOG(ERROR) << "Error setting octet string for extension";
+ return {};
+ }
+
+ X509_EXTENSION_Ptr extension = X509_EXTENSION_Ptr(X509_EXTENSION_new());
+ extension.reset(X509_EXTENSION_create_by_OBJ(nullptr, oid.get(), 0 /* not critical */,
+ octetString.get()));
+ if (!extension.get()) {
+ LOG(ERROR) << "Error setting extension";
+ return {};
+ }
+ if (!X509_add_ext(x509.get(), extension.get(), -1)) {
+ LOG(ERROR) << "Error adding extension";
+ return {};
+ }
+ }
+
if (X509_sign(x509.get(), privPkey.get(), EVP_sha256()) == 0) {
LOG(ERROR) << "Error signing X509 certificate";
return {};
@@ -1650,6 +1586,44 @@
return publicKey;
}
+optional<vector<uint8_t>> certificateGetExtension(const vector<uint8_t>& x509Certificate,
+ const string& oidStr) {
+ vector<X509_Ptr> certs;
+ if (!parseX509Certificates(x509Certificate, certs)) {
+ return {};
+ }
+ if (certs.size() < 1) {
+ LOG(ERROR) << "No certificates in chain";
+ return {};
+ }
+
+ ASN1_OBJECT_Ptr oid(
+ OBJ_txt2obj(oidStr.c_str(), 1)); // accept numerical dotted string form only
+ if (!oid.get()) {
+ LOG(ERROR) << "Error setting OID";
+ return {};
+ }
+
+ int location = X509_get_ext_by_OBJ(certs[0].get(), oid.get(), -1 /* search from beginning */);
+ if (location == -1) {
+ return {};
+ }
+
+ X509_EXTENSION* ext = X509_get_ext(certs[0].get(), location);
+ if (ext == nullptr) {
+ return {};
+ }
+
+ ASN1_OCTET_STRING* octetString = X509_EXTENSION_get_data(ext);
+ if (octetString == nullptr) {
+ return {};
+ }
+ vector<uint8_t> result;
+ result.resize(octetString->length);
+ memcpy(result.data(), octetString->data, octetString->length);
+ return result;
+}
+
optional<pair<size_t, size_t>> certificateFindPublicKey(const vector<uint8_t>& x509Certificate) {
vector<X509_Ptr> certs;
if (!parseX509Certificates(x509Certificate, certs)) {
diff --git a/identity/support/tests/IdentityCredentialSupportTest.cpp b/identity/support/tests/IdentityCredentialSupportTest.cpp
index 266f263..509133c 100644
--- a/identity/support/tests/IdentityCredentialSupportTest.cpp
+++ b/identity/support/tests/IdentityCredentialSupportTest.cpp
@@ -271,7 +271,7 @@
optional<vector<uint8_t>> pubKey = support::ecKeyPairGetPublicKey(keyPair.value());
optional<vector<uint8_t>> cert = support::ecPublicKeyGenerateCertificate(
- pubKey.value(), privKey.value(), "0001", "someIssuer", "someSubject", 0, 0);
+ pubKey.value(), privKey.value(), "0001", "someIssuer", "someSubject", 0, 0, {});
certs.push_back(cert.value());
}
return support::certificateChainJoin(certs);
@@ -338,7 +338,7 @@
ASSERT_TRUE(pubKey);
optional<vector<uint8_t>> cert = support::ecPublicKeyGenerateCertificate(
- pubKey.value(), privKey.value(), "0001", "someIssuer", "someSubject", 0, 0);
+ pubKey.value(), privKey.value(), "0001", "someIssuer", "someSubject", 0, 0, {});
optional<vector<uint8_t>> extractedPubKey =
support::certificateChainGetTopMostKey(cert.value());
@@ -358,7 +358,7 @@
optional<vector<uint8_t>> otherPubKey = support::ecKeyPairGetPublicKey(keyPair.value());
ASSERT_TRUE(otherPubKey);
optional<vector<uint8_t>> otherCert = support::ecPublicKeyGenerateCertificate(
- otherPubKey.value(), privKey.value(), "0001", "someIssuer", "someSubject", 0, 0);
+ otherPubKey.value(), privKey.value(), "0001", "someIssuer", "someSubject", 0, 0, {});
// Now both cert and otherCert are two distinct certificates. Let's make a
// chain and check that certificateChainSplit() works as expected.
diff --git a/keymaster/4.1/default/OWNERS b/keymaster/4.1/default/OWNERS
index 335660d..2b2ad2a 100644
--- a/keymaster/4.1/default/OWNERS
+++ b/keymaster/4.1/default/OWNERS
@@ -1,2 +1,4 @@
+jbires@google.com
jdanis@google.com
swillden@google.com
+zeuthen@google.com
\ No newline at end of file
diff --git a/keymaster/4.1/support/OWNERS b/keymaster/4.1/support/OWNERS
index a9efe66..2b2ad2a 100644
--- a/keymaster/4.1/support/OWNERS
+++ b/keymaster/4.1/support/OWNERS
@@ -1,3 +1,4 @@
+jbires@google.com
jdanis@google.com
swillden@google.com
-jbires@google.com
+zeuthen@google.com
\ No newline at end of file
diff --git a/keymaster/4.1/vts/OWNERS b/keymaster/4.1/vts/OWNERS
index 335660d..2b2ad2a 100644
--- a/keymaster/4.1/vts/OWNERS
+++ b/keymaster/4.1/vts/OWNERS
@@ -1,2 +1,4 @@
+jbires@google.com
jdanis@google.com
swillden@google.com
+zeuthen@google.com
\ No newline at end of file
diff --git a/neuralnetworks/1.0/utils/Android.bp b/neuralnetworks/1.0/utils/Android.bp
index 4d61fc0..d033617 100644
--- a/neuralnetworks/1.0/utils/Android.bp
+++ b/neuralnetworks/1.0/utils/Android.bp
@@ -32,3 +32,29 @@
"neuralnetworks_utils_hal_common",
],
}
+
+cc_test {
+ name: "neuralnetworks_utils_hal_1_0_test",
+ srcs: ["test/*.cpp"],
+ static_libs: [
+ "android.hardware.neuralnetworks@1.0",
+ "libgmock",
+ "libneuralnetworks_common",
+ "neuralnetworks_types",
+ "neuralnetworks_utils_hal_common",
+ "neuralnetworks_utils_hal_1_0",
+ ],
+ shared_libs: [
+ "android.hidl.allocator@1.0",
+ "android.hidl.memory@1.0",
+ "libbase",
+ "libcutils",
+ "libfmq",
+ "libhidlbase",
+ "libhidlmemory",
+ "liblog",
+ "libnativewindow",
+ "libutils",
+ ],
+ test_suites: ["general-tests"],
+}
diff --git a/neuralnetworks/1.0/utils/include/nnapi/hal/1.0/Burst.h b/neuralnetworks/1.0/utils/include/nnapi/hal/1.0/Burst.h
new file mode 100644
index 0000000..f2cbe93
--- /dev/null
+++ b/neuralnetworks/1.0/utils/include/nnapi/hal/1.0/Burst.h
@@ -0,0 +1,55 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_0_UTILS_BURST_H
+#define ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_0_UTILS_BURST_H
+
+#include <nnapi/IBurst.h>
+#include <nnapi/IPreparedModel.h>
+#include <nnapi/Result.h>
+#include <nnapi/Types.h>
+
+#include <memory>
+#include <optional>
+#include <utility>
+
+// See hardware/interfaces/neuralnetworks/utils/README.md for more information on HIDL interface
+// lifetimes across processes and for protecting asynchronous calls across HIDL.
+
+namespace android::hardware::neuralnetworks::V1_0::utils {
+
+// Class that adapts nn::IPreparedModel to nn::IBurst.
+class Burst final : public nn::IBurst {
+ struct PrivateConstructorTag {};
+
+ public:
+ static nn::GeneralResult<std::shared_ptr<const Burst>> create(
+ nn::SharedPreparedModel preparedModel);
+
+ Burst(PrivateConstructorTag tag, nn::SharedPreparedModel preparedModel);
+
+ OptionalCacheHold cacheMemory(const nn::Memory& memory) const override;
+
+ nn::ExecutionResult<std::pair<std::vector<nn::OutputShape>, nn::Timing>> execute(
+ const nn::Request& request, nn::MeasureTiming measure) const override;
+
+ private:
+ const nn::SharedPreparedModel kPreparedModel;
+};
+
+} // namespace android::hardware::neuralnetworks::V1_0::utils
+
+#endif // ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_0_UTILS_BURST_H
diff --git a/neuralnetworks/1.0/utils/include/nnapi/hal/1.0/Device.h b/neuralnetworks/1.0/utils/include/nnapi/hal/1.0/Device.h
index db3b2ad..4681b9e 100644
--- a/neuralnetworks/1.0/utils/include/nnapi/hal/1.0/Device.h
+++ b/neuralnetworks/1.0/utils/include/nnapi/hal/1.0/Device.h
@@ -52,6 +52,7 @@
const std::string& getVersionString() const override;
nn::Version getFeatureLevel() const override;
nn::DeviceType getType() const override;
+ bool isUpdatable() const override;
const std::vector<nn::Extension>& getSupportedExtensions() const override;
const nn::Capabilities& getCapabilities() const override;
std::pair<uint32_t, uint32_t> getNumberOfCacheFilesNeeded() const override;
diff --git a/neuralnetworks/1.0/utils/include/nnapi/hal/1.0/PreparedModel.h b/neuralnetworks/1.0/utils/include/nnapi/hal/1.0/PreparedModel.h
index 2de1828..8853eea 100644
--- a/neuralnetworks/1.0/utils/include/nnapi/hal/1.0/PreparedModel.h
+++ b/neuralnetworks/1.0/utils/include/nnapi/hal/1.0/PreparedModel.h
@@ -35,7 +35,8 @@
namespace android::hardware::neuralnetworks::V1_0::utils {
// Class that adapts V1_0::IPreparedModel to nn::IPreparedModel.
-class PreparedModel final : public nn::IPreparedModel {
+class PreparedModel final : public nn::IPreparedModel,
+ public std::enable_shared_from_this<PreparedModel> {
struct PrivateConstructorTag {};
public:
@@ -56,6 +57,8 @@
const nn::OptionalDuration& loopTimeoutDuration,
const nn::OptionalDuration& timeoutDurationAfterFence) const override;
+ nn::GeneralResult<nn::SharedBurst> configureExecutionBurst() const override;
+
std::any getUnderlyingResource() const override;
private:
diff --git a/neuralnetworks/1.0/utils/src/Burst.cpp b/neuralnetworks/1.0/utils/src/Burst.cpp
new file mode 100644
index 0000000..384bd9b
--- /dev/null
+++ b/neuralnetworks/1.0/utils/src/Burst.cpp
@@ -0,0 +1,55 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "Burst.h"
+
+#include <android-base/logging.h>
+#include <nnapi/IBurst.h>
+#include <nnapi/IPreparedModel.h>
+#include <nnapi/Result.h>
+#include <nnapi/Types.h>
+
+#include <memory>
+#include <optional>
+#include <utility>
+
+namespace android::hardware::neuralnetworks::V1_0::utils {
+
+nn::GeneralResult<std::shared_ptr<const Burst>> Burst::create(
+ nn::SharedPreparedModel preparedModel) {
+ if (preparedModel == nullptr) {
+ return NN_ERROR(nn::ErrorStatus::GENERAL_FAILURE)
+ << "V1_0::utils::Burst::create must have non-null preparedModel";
+ }
+
+ return std::make_shared<const Burst>(PrivateConstructorTag{}, std::move(preparedModel));
+}
+
+Burst::Burst(PrivateConstructorTag /*tag*/, nn::SharedPreparedModel preparedModel)
+ : kPreparedModel(std::move(preparedModel)) {
+ CHECK(kPreparedModel != nullptr);
+}
+
+Burst::OptionalCacheHold Burst::cacheMemory(const nn::Memory& /*memory*/) const {
+ return nullptr;
+}
+
+nn::ExecutionResult<std::pair<std::vector<nn::OutputShape>, nn::Timing>> Burst::execute(
+ const nn::Request& request, nn::MeasureTiming measure) const {
+ return kPreparedModel->execute(request, measure, {}, {});
+}
+
+} // namespace android::hardware::neuralnetworks::V1_0::utils
diff --git a/neuralnetworks/1.0/utils/src/Device.cpp b/neuralnetworks/1.0/utils/src/Device.cpp
index 93bd81a..bb31a26 100644
--- a/neuralnetworks/1.0/utils/src/Device.cpp
+++ b/neuralnetworks/1.0/utils/src/Device.cpp
@@ -106,6 +106,10 @@
return nn::DeviceType::OTHER;
}
+bool Device::isUpdatable() const {
+ return false;
+}
+
const std::vector<nn::Extension>& Device::getSupportedExtensions() const {
return kExtensions;
}
diff --git a/neuralnetworks/1.0/utils/src/PreparedModel.cpp b/neuralnetworks/1.0/utils/src/PreparedModel.cpp
index c0c22fb..858571d 100644
--- a/neuralnetworks/1.0/utils/src/PreparedModel.cpp
+++ b/neuralnetworks/1.0/utils/src/PreparedModel.cpp
@@ -16,6 +16,7 @@
#include "PreparedModel.h"
+#include "Burst.h"
#include "Callbacks.h"
#include "Conversions.h"
#include "Utils.h"
@@ -90,6 +91,10 @@
<< "IPreparedModel::executeFenced is not supported on 1.0 HAL service";
}
+nn::GeneralResult<nn::SharedBurst> PreparedModel::configureExecutionBurst() const {
+ return Burst::create(shared_from_this());
+}
+
std::any PreparedModel::getUnderlyingResource() const {
sp<V1_0::IPreparedModel> resource = kPreparedModel;
return resource;
diff --git a/neuralnetworks/1.0/utils/test/DeviceTest.cpp b/neuralnetworks/1.0/utils/test/DeviceTest.cpp
new file mode 100644
index 0000000..e881da2
--- /dev/null
+++ b/neuralnetworks/1.0/utils/test/DeviceTest.cpp
@@ -0,0 +1,524 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "MockDevice.h"
+#include "MockPreparedModel.h"
+
+#include <android/hardware/neuralnetworks/1.0/IDevice.h>
+#include <gmock/gmock.h>
+#include <gtest/gtest.h>
+#include <nnapi/IDevice.h>
+#include <nnapi/TypeUtils.h>
+#include <nnapi/Types.h>
+#include <nnapi/hal/1.0/Device.h>
+
+#include <functional>
+#include <memory>
+#include <string>
+
+namespace android::hardware::neuralnetworks::V1_0::utils {
+namespace {
+
+using ::testing::_;
+using ::testing::Invoke;
+using ::testing::InvokeWithoutArgs;
+
+const nn::Model kSimpleModel = {
+ .main = {.operands = {{.type = nn::OperandType::TENSOR_FLOAT32,
+ .dimensions = {1},
+ .lifetime = nn::Operand::LifeTime::SUBGRAPH_INPUT},
+ {.type = nn::OperandType::TENSOR_FLOAT32,
+ .dimensions = {1},
+ .lifetime = nn::Operand::LifeTime::SUBGRAPH_OUTPUT}},
+ .operations = {{.type = nn::OperationType::RELU, .inputs = {0}, .outputs = {1}}},
+ .inputIndexes = {0},
+ .outputIndexes = {1}}};
+
+const std::string kName = "Google-MockV1";
+const std::string kInvalidName = "";
+const sp<V1_0::IDevice> kInvalidDevice;
+constexpr V1_0::PerformanceInfo kNoPerformanceInfo = {
+ .execTime = std::numeric_limits<float>::max(),
+ .powerUsage = std::numeric_limits<float>::max()};
+
+template <typename... Args>
+auto makeCallbackReturn(Args&&... args) {
+ return [argPack = std::make_tuple(std::forward<Args>(args)...)](const auto& cb) {
+ std::apply(cb, argPack);
+ return Void();
+ };
+}
+
+sp<MockDevice> createMockDevice() {
+ const auto mockDevice = MockDevice::create();
+
+ // Setup default actions for each relevant call.
+ const auto getCapabilities_ret = makeCallbackReturn(
+ V1_0::ErrorStatus::NONE, V1_0::Capabilities{
+ .float32Performance = kNoPerformanceInfo,
+ .quantized8Performance = kNoPerformanceInfo,
+ });
+
+ // Setup default actions for each relevant call.
+ ON_CALL(*mockDevice, getCapabilities(_)).WillByDefault(Invoke(getCapabilities_ret));
+
+ // These EXPECT_CALL(...).Times(testing::AnyNumber()) calls are to suppress warnings on the
+ // uninteresting methods calls.
+ EXPECT_CALL(*mockDevice, getCapabilities(_)).Times(testing::AnyNumber());
+
+ return mockDevice;
+}
+
+auto makePreparedModelReturn(V1_0::ErrorStatus launchStatus, V1_0::ErrorStatus returnStatus,
+ const sp<V1_0::utils::MockPreparedModel>& preparedModel) {
+ return [launchStatus, returnStatus, preparedModel](const V1_0::Model& /*model*/,
+ const sp<V1_0::IPreparedModelCallback>& cb)
+ -> hardware::Return<V1_0::ErrorStatus> {
+ cb->notify(returnStatus, preparedModel).isOk();
+ return launchStatus;
+ };
+}
+
+std::function<hardware::Status()> makeTransportFailure(status_t status) {
+ return [status] { return hardware::Status::fromStatusT(status); };
+}
+
+const auto makeGeneralTransportFailure = makeTransportFailure(NO_MEMORY);
+const auto makeDeadObjectFailure = makeTransportFailure(DEAD_OBJECT);
+
+} // namespace
+
+TEST(DeviceTest, invalidName) {
+ // run test
+ const auto device = MockDevice::create();
+ const auto result = Device::create(kInvalidName, device);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::INVALID_ARGUMENT);
+}
+
+TEST(DeviceTest, invalidDevice) {
+ // run test
+ const auto result = Device::create(kName, kInvalidDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::INVALID_ARGUMENT);
+}
+
+TEST(DeviceTest, getCapabilitiesError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto ret = makeCallbackReturn(V1_0::ErrorStatus::GENERAL_FAILURE,
+ V1_0::Capabilities{
+ .float32Performance = kNoPerformanceInfo,
+ .quantized8Performance = kNoPerformanceInfo,
+ });
+ EXPECT_CALL(*mockDevice, getCapabilities(_)).Times(1).WillOnce(Invoke(ret));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getCapabilitiesTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, getCapabilities(_))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getCapabilitiesDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, getCapabilities(_))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, linkToDeathError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto ret = []() -> Return<bool> { return false; };
+ EXPECT_CALL(*mockDevice, linkToDeathRet()).Times(1).WillOnce(InvokeWithoutArgs(ret));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, linkToDeathTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, linkToDeathRet())
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, linkToDeathDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, linkToDeathRet())
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, getName) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+
+ // run test
+ const auto& name = device->getName();
+
+ // verify result
+ EXPECT_EQ(name, kName);
+}
+
+TEST(DeviceTest, getFeatureLevel) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+
+ // run test
+ const auto featureLevel = device->getFeatureLevel();
+
+ // verify result
+ EXPECT_EQ(featureLevel, nn::Version::ANDROID_OC_MR1);
+}
+
+TEST(DeviceTest, getCachedData) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto result = Device::create(kName, mockDevice);
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ const auto& device = result.value();
+
+ // run test and verify results
+ EXPECT_EQ(device->getVersionString(), device->getVersionString());
+ EXPECT_EQ(device->getType(), device->getType());
+ EXPECT_EQ(device->getSupportedExtensions(), device->getSupportedExtensions());
+ EXPECT_EQ(device->getNumberOfCacheFilesNeeded(), device->getNumberOfCacheFilesNeeded());
+ EXPECT_EQ(device->getCapabilities(), device->getCapabilities());
+}
+
+TEST(DeviceTest, wait) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto ret = []() -> Return<void> { return {}; };
+ EXPECT_CALL(*mockDevice, ping()).Times(1).WillOnce(InvokeWithoutArgs(ret));
+ const auto device = Device::create(kName, mockDevice).value();
+
+ // run test
+ const auto result = device->wait();
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(DeviceTest, waitTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, ping())
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+ const auto device = Device::create(kName, mockDevice).value();
+
+ // run test
+ const auto result = device->wait();
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, waitDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, ping()).Times(1).WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+ const auto device = Device::create(kName, mockDevice).value();
+
+ // run test
+ const auto result = device->wait();
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, getSupportedOperations) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ const auto ret = [](const auto& model, const auto& cb) {
+ cb(V1_0::ErrorStatus::NONE, std::vector<bool>(model.operations.size(), true));
+ return hardware::Void();
+ };
+ EXPECT_CALL(*mockDevice, getSupportedOperations(_, _)).Times(1).WillOnce(Invoke(ret));
+
+ // run test
+ const auto result = device->getSupportedOperations(kSimpleModel);
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ const auto& supportedOperations = result.value();
+ EXPECT_EQ(supportedOperations.size(), kSimpleModel.main.operations.size());
+ EXPECT_THAT(supportedOperations, Each(testing::IsTrue()));
+}
+
+TEST(DeviceTest, getSupportedOperationsError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ const auto ret = [](const auto& /*model*/, const auto& cb) {
+ cb(V1_0::ErrorStatus::GENERAL_FAILURE, {});
+ return hardware::Void();
+ };
+ EXPECT_CALL(*mockDevice, getSupportedOperations(_, _)).Times(1).WillOnce(Invoke(ret));
+
+ // run test
+ const auto result = device->getSupportedOperations(kSimpleModel);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getSupportedOperationsTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, getSupportedOperations(_, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = device->getSupportedOperations(kSimpleModel);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getSupportedOperationsDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, getSupportedOperations(_, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = device->getSupportedOperations(kSimpleModel);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, prepareModel) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ const auto mockPreparedModel = V1_0::utils::MockPreparedModel::create();
+ EXPECT_CALL(*mockDevice, prepareModel(_, _))
+ .Times(1)
+ .WillOnce(Invoke(makePreparedModelReturn(V1_0::ErrorStatus::NONE,
+ V1_0::ErrorStatus::NONE, mockPreparedModel)));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ EXPECT_NE(result.value(), nullptr);
+}
+
+TEST(DeviceTest, prepareModelLaunchError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModel(_, _))
+ .Times(1)
+ .WillOnce(Invoke(makePreparedModelReturn(V1_0::ErrorStatus::GENERAL_FAILURE,
+ V1_0::ErrorStatus::GENERAL_FAILURE, nullptr)));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, prepareModelReturnError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModel(_, _))
+ .Times(1)
+ .WillOnce(Invoke(makePreparedModelReturn(V1_0::ErrorStatus::NONE,
+ V1_0::ErrorStatus::GENERAL_FAILURE, nullptr)));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, prepareModelNullptrError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModel(_, _))
+ .Times(1)
+ .WillOnce(Invoke(makePreparedModelReturn(V1_0::ErrorStatus::NONE,
+ V1_0::ErrorStatus::NONE, nullptr)));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, prepareModelTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModel(_, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, prepareModelDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModel(_, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, prepareModelAsyncCrash) {
+ // setup test
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ const auto ret = [&mockDevice]() -> hardware::Return<V1_0::ErrorStatus> {
+ mockDevice->simulateCrash();
+ return V1_0::ErrorStatus::NONE;
+ };
+ EXPECT_CALL(*mockDevice, prepareModel(_, _)).Times(1).WillOnce(InvokeWithoutArgs(ret));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, prepareModelFromCacheNotSupported) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+
+ // run test
+ const auto result = device->prepareModelFromCache({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, allocateNotSupported) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+
+ // run test
+ const auto result = device->allocate({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+} // namespace android::hardware::neuralnetworks::V1_0::utils
diff --git a/neuralnetworks/1.0/utils/test/MockDevice.h b/neuralnetworks/1.0/utils/test/MockDevice.h
new file mode 100644
index 0000000..0fb59e3
--- /dev/null
+++ b/neuralnetworks/1.0/utils/test/MockDevice.h
@@ -0,0 +1,86 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_0_UTILS_TEST_MOCK_DEVICE
+#define ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_0_UTILS_TEST_MOCK_DEVICE
+
+#include <android/hardware/neuralnetworks/1.0/IDevice.h>
+#include <gmock/gmock.h>
+#include <gtest/gtest.h>
+#include <hidl/Status.h>
+
+namespace android::hardware::neuralnetworks::V1_0::utils {
+
+class MockDevice final : public IDevice {
+ public:
+ static sp<MockDevice> create();
+
+ // IBase methods below.
+ MOCK_METHOD(Return<void>, ping, (), (override));
+ MOCK_METHOD(Return<bool>, linkToDeathRet, ());
+ Return<bool> linkToDeath(const sp<hidl_death_recipient>& recipient, uint64_t /*cookie*/);
+
+ // V1_0 methods below.
+ MOCK_METHOD(Return<void>, getCapabilities, (getCapabilities_cb cb), (override));
+ MOCK_METHOD(Return<void>, getSupportedOperations,
+ (const V1_0::Model& model, getSupportedOperations_cb cb), (override));
+ MOCK_METHOD(Return<V1_0::ErrorStatus>, prepareModel,
+ (const V1_0::Model& model, const sp<V1_0::IPreparedModelCallback>& callback),
+ (override));
+ MOCK_METHOD(Return<V1_0::DeviceStatus>, getStatus, (), (override));
+
+ // Helper methods.
+ void simulateCrash();
+
+ private:
+ sp<hidl_death_recipient> mDeathRecipient;
+};
+
+inline sp<MockDevice> MockDevice::create() {
+ auto mockDevice = sp<MockDevice>::make();
+
+ // Setup default actions for each relevant call.
+ const auto ret = []() -> Return<bool> { return true; };
+
+ // Setup default actions for each relevant call.
+ ON_CALL(*mockDevice, linkToDeathRet()).WillByDefault(testing::Invoke(ret));
+
+ // These EXPECT_CALL(...).Times(testing::AnyNumber()) calls are to suppress warnings on the
+ // uninteresting methods calls.
+ EXPECT_CALL(*mockDevice, linkToDeathRet()).Times(testing::AnyNumber());
+
+ return mockDevice;
+}
+
+inline Return<bool> MockDevice::linkToDeath(const sp<hidl_death_recipient>& recipient,
+ uint64_t /*cookie*/) {
+ mDeathRecipient = recipient;
+ return linkToDeathRet();
+}
+
+inline void MockDevice::simulateCrash() {
+ ASSERT_NE(nullptr, mDeathRecipient.get());
+
+ // Currently, the utils::Device will not use the `cookie` or `who` arguments, so we pass in 0
+ // and nullptr for these arguments instead. Normally, they are used by the hidl_death_recipient
+ // to determine which object is dead. However, the utils::Device code only pairs a single death
+ // recipient with a single HIDL interface object, so these arguments are redundant.
+ mDeathRecipient->serviceDied(0, nullptr);
+}
+
+} // namespace android::hardware::neuralnetworks::V1_0::utils
+
+#endif // ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_0_UTILS_TEST_MOCK_DEVICE
diff --git a/neuralnetworks/1.0/utils/test/MockPreparedModel.h b/neuralnetworks/1.0/utils/test/MockPreparedModel.h
new file mode 100644
index 0000000..7a48a83
--- /dev/null
+++ b/neuralnetworks/1.0/utils/test/MockPreparedModel.h
@@ -0,0 +1,85 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_0_UTILS_TEST_MOCK_PREPARED_MODEL
+#define ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_0_UTILS_TEST_MOCK_PREPARED_MODEL
+
+#include <android/hardware/neuralnetworks/1.0/IPreparedModel.h>
+#include <gmock/gmock.h>
+#include <gtest/gtest.h>
+#include <hidl/HidlSupport.h>
+#include <hidl/Status.h>
+
+namespace android::hardware::neuralnetworks::V1_0::utils {
+
+class MockPreparedModel final : public IPreparedModel {
+ public:
+ static sp<MockPreparedModel> create();
+
+ // IBase methods below.
+ MOCK_METHOD(Return<void>, ping, (), (override));
+ MOCK_METHOD(Return<bool>, linkToDeathRet, ());
+ Return<bool> linkToDeath(const sp<hidl_death_recipient>& recipient,
+ uint64_t /*cookie*/) override;
+
+ // V1_0 methods below.
+ MOCK_METHOD(Return<V1_0::ErrorStatus>, execute,
+ (const V1_0::Request& request, const sp<V1_0::IExecutionCallback>& callback),
+ (override));
+
+ // Helper methods.
+ void simulateCrash();
+
+ private:
+ sp<hidl_death_recipient> mDeathRecipient;
+};
+
+inline sp<MockPreparedModel> MockPreparedModel::create() {
+ auto mockPreparedModel = sp<MockPreparedModel>::make();
+
+ // Setup default actions for each relevant call.
+ const auto ret = []() -> Return<bool> { return true; };
+
+ // Setup default actions for each relevant call.
+ ON_CALL(*mockPreparedModel, linkToDeathRet()).WillByDefault(testing::Invoke(ret));
+
+ // These EXPECT_CALL(...).Times(testing::AnyNumber()) calls are to suppress warnings on the
+ // uninteresting methods calls.
+ EXPECT_CALL(*mockPreparedModel, linkToDeathRet()).Times(testing::AnyNumber());
+
+ return mockPreparedModel;
+}
+
+inline Return<bool> MockPreparedModel::linkToDeath(const sp<hidl_death_recipient>& recipient,
+ uint64_t /*cookie*/) {
+ mDeathRecipient = recipient;
+ return linkToDeathRet();
+}
+
+inline void MockPreparedModel::simulateCrash() {
+ ASSERT_NE(nullptr, mDeathRecipient.get());
+
+ // Currently, the utils::PreparedModel will not use the `cookie` or `who` arguments, so we pass
+ // in 0 and nullptr for these arguments instead. Normally, they are used by the
+ // hidl_death_recipient to determine which object is dead. However, the utils::PreparedModel
+ // code only pairs a single death recipient with a single HIDL interface object, so these
+ // arguments are redundant.
+ mDeathRecipient->serviceDied(0, nullptr);
+}
+
+} // namespace android::hardware::neuralnetworks::V1_0::utils
+
+#endif // ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_0_UTILS_TEST_MOCK_PREPARED_MODEL
diff --git a/neuralnetworks/1.0/utils/test/PreparedModelTest.cpp b/neuralnetworks/1.0/utils/test/PreparedModelTest.cpp
new file mode 100644
index 0000000..a5cbc72
--- /dev/null
+++ b/neuralnetworks/1.0/utils/test/PreparedModelTest.cpp
@@ -0,0 +1,243 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "MockPreparedModel.h"
+
+#include <android/hardware/neuralnetworks/1.0/IExecutionCallback.h>
+#include <gmock/gmock.h>
+#include <gtest/gtest.h>
+#include <nnapi/IPreparedModel.h>
+#include <nnapi/TypeUtils.h>
+#include <nnapi/Types.h>
+#include <nnapi/hal/1.0/PreparedModel.h>
+
+#include <functional>
+#include <memory>
+
+namespace android::hardware::neuralnetworks::V1_0::utils {
+namespace {
+
+using ::testing::_;
+using ::testing::Invoke;
+using ::testing::InvokeWithoutArgs;
+
+const sp<V1_0::IPreparedModel> kInvalidPreparedModel;
+
+sp<MockPreparedModel> createMockPreparedModel() {
+ return MockPreparedModel::create();
+}
+
+auto makeExecute(V1_0::ErrorStatus launchStatus, V1_0::ErrorStatus returnStatus) {
+ return [launchStatus, returnStatus](
+ const V1_0::Request& /*request*/,
+ const sp<V1_0::IExecutionCallback>& cb) -> Return<V1_0::ErrorStatus> {
+ cb->notify(returnStatus);
+ return launchStatus;
+ };
+}
+
+std::function<hardware::Status()> makeTransportFailure(status_t status) {
+ return [status] { return hardware::Status::fromStatusT(status); };
+}
+
+const auto makeGeneralTransportFailure = makeTransportFailure(NO_MEMORY);
+const auto makeDeadObjectFailure = makeTransportFailure(DEAD_OBJECT);
+
+} // namespace
+
+TEST(PreparedModelTest, invalidPreparedModel) {
+ // run test
+ const auto result = PreparedModel::create(kInvalidPreparedModel);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(PreparedModelTest, linkToDeathError) {
+ // setup call
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto ret = []() -> Return<bool> { return false; };
+ EXPECT_CALL(*mockPreparedModel, linkToDeathRet()).Times(1).WillOnce(InvokeWithoutArgs(ret));
+
+ // run test
+ const auto result = PreparedModel::create(mockPreparedModel);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(PreparedModelTest, linkToDeathTransportFailure) {
+ // setup call
+ const auto mockPreparedModel = createMockPreparedModel();
+ EXPECT_CALL(*mockPreparedModel, linkToDeathRet())
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = PreparedModel::create(mockPreparedModel);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(PreparedModelTest, linkToDeathDeadObject) {
+ // setup call
+ const auto mockPreparedModel = createMockPreparedModel();
+ EXPECT_CALL(*mockPreparedModel, linkToDeathRet())
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = PreparedModel::create(mockPreparedModel);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(PreparedModelTest, execute) {
+ // setup call
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel = PreparedModel::create(mockPreparedModel).value();
+ EXPECT_CALL(*mockPreparedModel, execute(_, _))
+ .Times(1)
+ .WillOnce(Invoke(makeExecute(V1_0::ErrorStatus::NONE, V1_0::ErrorStatus::NONE)));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ EXPECT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(PreparedModelTest, executeLaunchError) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel = PreparedModel::create(mockPreparedModel).value();
+ EXPECT_CALL(*mockPreparedModel, execute(_, _))
+ .Times(1)
+ .WillOnce(Invoke(makeExecute(V1_0::ErrorStatus::GENERAL_FAILURE,
+ V1_0::ErrorStatus::GENERAL_FAILURE)));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(PreparedModelTest, executeReturnError) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel = PreparedModel::create(mockPreparedModel).value();
+ EXPECT_CALL(*mockPreparedModel, execute(_, _))
+ .Times(1)
+ .WillOnce(Invoke(
+ makeExecute(V1_0::ErrorStatus::NONE, V1_0::ErrorStatus::GENERAL_FAILURE)));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(PreparedModelTest, executeTransportFailure) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel = PreparedModel::create(mockPreparedModel).value();
+ EXPECT_CALL(*mockPreparedModel, execute(_, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(PreparedModelTest, executeDeadObject) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel = PreparedModel::create(mockPreparedModel).value();
+ EXPECT_CALL(*mockPreparedModel, execute(_, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(PreparedModelTest, executeCrash) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel = PreparedModel::create(mockPreparedModel).value();
+ const auto ret = [&mockPreparedModel]() -> hardware::Return<V1_0::ErrorStatus> {
+ mockPreparedModel->simulateCrash();
+ return V1_0::ErrorStatus::NONE;
+ };
+ EXPECT_CALL(*mockPreparedModel, execute(_, _)).Times(1).WillOnce(InvokeWithoutArgs(ret));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(PreparedModelTest, executeFencedNotSupported) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel = PreparedModel::create(mockPreparedModel).value();
+
+ // run test
+ const auto result = preparedModel->executeFenced({}, {}, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+// TODO: test burst execution if/when it is added to nn::IPreparedModel.
+
+TEST(PreparedModelTest, getUnderlyingResource) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel = PreparedModel::create(mockPreparedModel).value();
+
+ // run test
+ const auto resource = preparedModel->getUnderlyingResource();
+
+ // verify resource
+ const sp<V1_0::IPreparedModel>* maybeMock = std::any_cast<sp<V1_0::IPreparedModel>>(&resource);
+ ASSERT_NE(maybeMock, nullptr);
+ EXPECT_EQ(maybeMock->get(), mockPreparedModel.get());
+}
+
+} // namespace android::hardware::neuralnetworks::V1_0::utils
diff --git a/neuralnetworks/1.0/vts/functional/AndroidTest.xml b/neuralnetworks/1.0/vts/functional/AndroidTest.xml
index 13671f9..9dd85ae 100644
--- a/neuralnetworks/1.0/vts/functional/AndroidTest.xml
+++ b/neuralnetworks/1.0/vts/functional/AndroidTest.xml
@@ -28,5 +28,6 @@
<test class="com.android.tradefed.testtype.GTest" >
<option name="native-test-device-path" value="/data/local/tmp" />
<option name="module-name" value="VtsHalNeuralnetworksV1_0TargetTest" />
+ <option name="native-test-timeout" value="20m" />
</test>
</configuration>
diff --git a/neuralnetworks/1.1/utils/Android.bp b/neuralnetworks/1.1/utils/Android.bp
index 909575b..fe0c80a 100644
--- a/neuralnetworks/1.1/utils/Android.bp
+++ b/neuralnetworks/1.1/utils/Android.bp
@@ -34,3 +34,31 @@
"neuralnetworks_utils_hal_common",
],
}
+
+cc_test {
+ name: "neuralnetworks_utils_hal_1_1_test",
+ srcs: ["test/*.cpp"],
+ static_libs: [
+ "android.hardware.neuralnetworks@1.0",
+ "android.hardware.neuralnetworks@1.1",
+ "libgmock",
+ "libneuralnetworks_common",
+ "neuralnetworks_types",
+ "neuralnetworks_utils_hal_common",
+ "neuralnetworks_utils_hal_1_0",
+ "neuralnetworks_utils_hal_1_1",
+ ],
+ shared_libs: [
+ "android.hidl.allocator@1.0",
+ "android.hidl.memory@1.0",
+ "libbase",
+ "libcutils",
+ "libfmq",
+ "libhidlbase",
+ "libhidlmemory",
+ "liblog",
+ "libnativewindow",
+ "libutils",
+ ],
+ test_suites: ["general-tests"],
+}
diff --git a/neuralnetworks/1.1/utils/include/nnapi/hal/1.1/Device.h b/neuralnetworks/1.1/utils/include/nnapi/hal/1.1/Device.h
index 5e224b5..3aec8ee 100644
--- a/neuralnetworks/1.1/utils/include/nnapi/hal/1.1/Device.h
+++ b/neuralnetworks/1.1/utils/include/nnapi/hal/1.1/Device.h
@@ -52,6 +52,7 @@
const std::string& getVersionString() const override;
nn::Version getFeatureLevel() const override;
nn::DeviceType getType() const override;
+ bool isUpdatable() const override;
const std::vector<nn::Extension>& getSupportedExtensions() const override;
const nn::Capabilities& getCapabilities() const override;
std::pair<uint32_t, uint32_t> getNumberOfCacheFilesNeeded() const override;
diff --git a/neuralnetworks/1.1/utils/src/Device.cpp b/neuralnetworks/1.1/utils/src/Device.cpp
index 3197ef4..d2ef57f 100644
--- a/neuralnetworks/1.1/utils/src/Device.cpp
+++ b/neuralnetworks/1.1/utils/src/Device.cpp
@@ -106,6 +106,10 @@
return nn::DeviceType::UNKNOWN;
}
+bool Device::isUpdatable() const {
+ return false;
+}
+
const std::vector<nn::Extension>& Device::getSupportedExtensions() const {
return kExtensions;
}
diff --git a/neuralnetworks/1.1/utils/test/DeviceTest.cpp b/neuralnetworks/1.1/utils/test/DeviceTest.cpp
new file mode 100644
index 0000000..41e0e30
--- /dev/null
+++ b/neuralnetworks/1.1/utils/test/DeviceTest.cpp
@@ -0,0 +1,534 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "MockDevice.h"
+#include "MockPreparedModel.h"
+
+#include <android/hardware/neuralnetworks/1.1/IDevice.h>
+#include <gmock/gmock.h>
+#include <gtest/gtest.h>
+#include <nnapi/IDevice.h>
+#include <nnapi/TypeUtils.h>
+#include <nnapi/Types.h>
+#include <nnapi/hal/1.1/Device.h>
+
+#include <functional>
+#include <memory>
+#include <string>
+
+namespace android::hardware::neuralnetworks::V1_1::utils {
+namespace {
+
+using ::testing::_;
+using ::testing::Invoke;
+using ::testing::InvokeWithoutArgs;
+
+const nn::Model kSimpleModel = {
+ .main = {.operands = {{.type = nn::OperandType::TENSOR_FLOAT32,
+ .dimensions = {1},
+ .lifetime = nn::Operand::LifeTime::SUBGRAPH_INPUT},
+ {.type = nn::OperandType::TENSOR_FLOAT32,
+ .dimensions = {1},
+ .lifetime = nn::Operand::LifeTime::SUBGRAPH_OUTPUT}},
+ .operations = {{.type = nn::OperationType::RELU, .inputs = {0}, .outputs = {1}}},
+ .inputIndexes = {0},
+ .outputIndexes = {1}}};
+
+const std::string kName = "Google-MockV1";
+const std::string kInvalidName = "";
+const sp<V1_1::IDevice> kInvalidDevice;
+constexpr V1_0::PerformanceInfo kNoPerformanceInfo = {
+ .execTime = std::numeric_limits<float>::max(),
+ .powerUsage = std::numeric_limits<float>::max()};
+
+template <typename... Args>
+auto makeCallbackReturn(Args&&... args) {
+ return [argPack = std::make_tuple(std::forward<Args>(args)...)](const auto& cb) {
+ std::apply(cb, argPack);
+ return Void();
+ };
+}
+
+sp<MockDevice> createMockDevice() {
+ const auto mockDevice = MockDevice::create();
+
+ // Setup default actions for each relevant call.
+ const auto getCapabilities_ret =
+ makeCallbackReturn(V1_0::ErrorStatus::NONE,
+ V1_1::Capabilities{
+ .float32Performance = kNoPerformanceInfo,
+ .quantized8Performance = kNoPerformanceInfo,
+ .relaxedFloat32toFloat16Performance = kNoPerformanceInfo,
+ });
+
+ // Setup default actions for each relevant call.
+ ON_CALL(*mockDevice, getCapabilities_1_1(_)).WillByDefault(Invoke(getCapabilities_ret));
+
+ // Ensure that older calls are not used.
+ EXPECT_CALL(*mockDevice, getCapabilities(_)).Times(0);
+ EXPECT_CALL(*mockDevice, getSupportedOperations(_, _)).Times(0);
+ EXPECT_CALL(*mockDevice, prepareModel(_, _)).Times(0);
+
+ // These EXPECT_CALL(...).Times(testing::AnyNumber()) calls are to suppress warnings on the
+ // uninteresting methods calls.
+ EXPECT_CALL(*mockDevice, getCapabilities_1_1(_)).Times(testing::AnyNumber());
+
+ return mockDevice;
+}
+
+auto makePreparedModelReturn(V1_0::ErrorStatus launchStatus, V1_0::ErrorStatus returnStatus,
+ const sp<V1_0::utils::MockPreparedModel>& preparedModel) {
+ return [launchStatus, returnStatus, preparedModel](const V1_1::Model& /*model*/,
+ V1_1::ExecutionPreference /*preference*/,
+ const sp<V1_0::IPreparedModelCallback>& cb)
+ -> hardware::Return<V1_0::ErrorStatus> {
+ cb->notify(returnStatus, preparedModel).isOk();
+ return launchStatus;
+ };
+}
+
+std::function<hardware::Status()> makeTransportFailure(status_t status) {
+ return [status] { return hardware::Status::fromStatusT(status); };
+}
+
+const auto makeGeneralTransportFailure = makeTransportFailure(NO_MEMORY);
+const auto makeDeadObjectFailure = makeTransportFailure(DEAD_OBJECT);
+
+} // namespace
+
+TEST(DeviceTest, invalidName) {
+ // run test
+ const auto device = MockDevice::create();
+ const auto result = Device::create(kInvalidName, device);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::INVALID_ARGUMENT);
+}
+
+TEST(DeviceTest, invalidDevice) {
+ // run test
+ const auto result = Device::create(kName, kInvalidDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::INVALID_ARGUMENT);
+}
+
+TEST(DeviceTest, getCapabilitiesError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto ret =
+ makeCallbackReturn(V1_0::ErrorStatus::GENERAL_FAILURE,
+ V1_1::Capabilities{
+ .float32Performance = kNoPerformanceInfo,
+ .quantized8Performance = kNoPerformanceInfo,
+ .relaxedFloat32toFloat16Performance = kNoPerformanceInfo,
+ });
+ EXPECT_CALL(*mockDevice, getCapabilities_1_1(_)).Times(1).WillOnce(Invoke(ret));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getCapabilitiesTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, getCapabilities_1_1(_))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getCapabilitiesDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, getCapabilities_1_1(_))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, linkToDeathError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto ret = []() -> Return<bool> { return false; };
+ EXPECT_CALL(*mockDevice, linkToDeathRet()).Times(1).WillOnce(InvokeWithoutArgs(ret));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, linkToDeathTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, linkToDeathRet())
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, linkToDeathDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, linkToDeathRet())
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, getName) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+
+ // run test
+ const auto& name = device->getName();
+
+ // verify result
+ EXPECT_EQ(name, kName);
+}
+
+TEST(DeviceTest, getFeatureLevel) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+
+ // run test
+ const auto featureLevel = device->getFeatureLevel();
+
+ // verify result
+ EXPECT_EQ(featureLevel, nn::Version::ANDROID_P);
+}
+
+TEST(DeviceTest, getCachedData) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto result = Device::create(kName, mockDevice);
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ const auto& device = result.value();
+
+ // run test and verify results
+ EXPECT_EQ(device->getVersionString(), device->getVersionString());
+ EXPECT_EQ(device->getType(), device->getType());
+ EXPECT_EQ(device->getSupportedExtensions(), device->getSupportedExtensions());
+ EXPECT_EQ(device->getNumberOfCacheFilesNeeded(), device->getNumberOfCacheFilesNeeded());
+ EXPECT_EQ(device->getCapabilities(), device->getCapabilities());
+}
+
+TEST(DeviceTest, wait) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto ret = []() -> Return<void> { return {}; };
+ EXPECT_CALL(*mockDevice, ping()).Times(1).WillOnce(InvokeWithoutArgs(ret));
+ const auto device = Device::create(kName, mockDevice).value();
+
+ // run test
+ const auto result = device->wait();
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(DeviceTest, waitTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, ping())
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+ const auto device = Device::create(kName, mockDevice).value();
+
+ // run test
+ const auto result = device->wait();
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, waitDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, ping()).Times(1).WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+ const auto device = Device::create(kName, mockDevice).value();
+
+ // run test
+ const auto result = device->wait();
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, getSupportedOperations) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ const auto ret = [](const auto& model, const auto& cb) {
+ cb(V1_0::ErrorStatus::NONE, std::vector<bool>(model.operations.size(), true));
+ return hardware::Void();
+ };
+ EXPECT_CALL(*mockDevice, getSupportedOperations_1_1(_, _)).Times(1).WillOnce(Invoke(ret));
+
+ // run test
+ const auto result = device->getSupportedOperations(kSimpleModel);
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ const auto& supportedOperations = result.value();
+ EXPECT_EQ(supportedOperations.size(), kSimpleModel.main.operations.size());
+ EXPECT_THAT(supportedOperations, Each(testing::IsTrue()));
+}
+
+TEST(DeviceTest, getSupportedOperationsError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ const auto ret = [](const auto& /*model*/, const auto& cb) {
+ cb(V1_0::ErrorStatus::GENERAL_FAILURE, {});
+ return hardware::Void();
+ };
+ EXPECT_CALL(*mockDevice, getSupportedOperations_1_1(_, _)).Times(1).WillOnce(Invoke(ret));
+
+ // run test
+ const auto result = device->getSupportedOperations(kSimpleModel);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getSupportedOperationsTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, getSupportedOperations_1_1(_, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = device->getSupportedOperations(kSimpleModel);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getSupportedOperationsDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, getSupportedOperations_1_1(_, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = device->getSupportedOperations(kSimpleModel);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, prepareModel) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ const auto mockPreparedModel = V1_0::utils::MockPreparedModel::create();
+ EXPECT_CALL(*mockDevice, prepareModel_1_1(_, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makePreparedModelReturn(V1_0::ErrorStatus::NONE,
+ V1_0::ErrorStatus::NONE, mockPreparedModel)));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ EXPECT_NE(result.value(), nullptr);
+}
+
+TEST(DeviceTest, prepareModelLaunchError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModel_1_1(_, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makePreparedModelReturn(V1_0::ErrorStatus::GENERAL_FAILURE,
+ V1_0::ErrorStatus::GENERAL_FAILURE, nullptr)));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, prepareModelReturnError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModel_1_1(_, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makePreparedModelReturn(V1_0::ErrorStatus::NONE,
+ V1_0::ErrorStatus::GENERAL_FAILURE, nullptr)));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, prepareModelNullptrError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModel_1_1(_, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makePreparedModelReturn(V1_0::ErrorStatus::NONE,
+ V1_0::ErrorStatus::NONE, nullptr)));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, prepareModelTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModel_1_1(_, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, prepareModelDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModel_1_1(_, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, prepareModelAsyncCrash) {
+ // setup test
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ const auto ret = [&mockDevice]() -> hardware::Return<V1_0::ErrorStatus> {
+ mockDevice->simulateCrash();
+ return V1_0::ErrorStatus::NONE;
+ };
+ EXPECT_CALL(*mockDevice, prepareModel_1_1(_, _, _)).Times(1).WillOnce(InvokeWithoutArgs(ret));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, prepareModelFromCacheNotSupported) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+
+ // run test
+ const auto result = device->prepareModelFromCache({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, allocateNotSupported) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+
+ // run test
+ const auto result = device->allocate({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+} // namespace android::hardware::neuralnetworks::V1_1::utils
diff --git a/neuralnetworks/1.1/utils/test/MockDevice.h b/neuralnetworks/1.1/utils/test/MockDevice.h
new file mode 100644
index 0000000..3b92e58
--- /dev/null
+++ b/neuralnetworks/1.1/utils/test/MockDevice.h
@@ -0,0 +1,95 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_1_UTILS_TEST_MOCK_DEVICE
+#define ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_1_UTILS_TEST_MOCK_DEVICE
+
+#include <android/hardware/neuralnetworks/1.1/IDevice.h>
+#include <gmock/gmock.h>
+#include <gtest/gtest.h>
+#include <hidl/Status.h>
+
+namespace android::hardware::neuralnetworks::V1_1::utils {
+
+class MockDevice final : public IDevice {
+ public:
+ static sp<MockDevice> create();
+
+ // IBase methods below.
+ MOCK_METHOD(Return<void>, ping, (), (override));
+ MOCK_METHOD(Return<bool>, linkToDeathRet, ());
+ Return<bool> linkToDeath(const sp<hidl_death_recipient>& recipient, uint64_t /*cookie*/);
+
+ // V1_0 methods below.
+ MOCK_METHOD(Return<void>, getCapabilities, (getCapabilities_cb cb), (override));
+ MOCK_METHOD(Return<void>, getSupportedOperations,
+ (const V1_0::Model& model, getSupportedOperations_cb cb), (override));
+ MOCK_METHOD(Return<V1_0::ErrorStatus>, prepareModel,
+ (const V1_0::Model& model, const sp<V1_0::IPreparedModelCallback>& callback),
+ (override));
+ MOCK_METHOD(Return<V1_0::DeviceStatus>, getStatus, (), (override));
+
+ // V1_1 methods below.
+ MOCK_METHOD(Return<void>, getCapabilities_1_1, (getCapabilities_1_1_cb cb), (override));
+ MOCK_METHOD(Return<void>, getSupportedOperations_1_1,
+ (const V1_1::Model& model, getSupportedOperations_1_1_cb cb), (override));
+ MOCK_METHOD(Return<V1_0::ErrorStatus>, prepareModel_1_1,
+ (const V1_1::Model& model, V1_1::ExecutionPreference preference,
+ const sp<V1_0::IPreparedModelCallback>& callback),
+ (override));
+
+ // Helper methods.
+ void simulateCrash();
+
+ private:
+ sp<hidl_death_recipient> mDeathRecipient;
+};
+
+inline sp<MockDevice> MockDevice::create() {
+ auto mockDevice = sp<MockDevice>::make();
+
+ // Setup default actions for each relevant call.
+ const auto ret = []() -> Return<bool> { return true; };
+
+ // Setup default actions for each relevant call.
+ ON_CALL(*mockDevice, linkToDeathRet()).WillByDefault(testing::Invoke(ret));
+
+ // These EXPECT_CALL(...).Times(testing::AnyNumber()) calls are to suppress warnings on the
+ // uninteresting methods calls.
+ EXPECT_CALL(*mockDevice, linkToDeathRet()).Times(testing::AnyNumber());
+
+ return mockDevice;
+}
+
+inline Return<bool> MockDevice::linkToDeath(const sp<hidl_death_recipient>& recipient,
+ uint64_t /*cookie*/) {
+ mDeathRecipient = recipient;
+ return linkToDeathRet();
+}
+
+inline void MockDevice::simulateCrash() {
+ ASSERT_NE(nullptr, mDeathRecipient.get());
+
+ // Currently, the utils::Device will not use the `cookie` or `who` arguments, so we pass in 0
+ // and nullptr for these arguments instead. Normally, they are used by the hidl_death_recipient
+ // to determine which object is dead. However, the utils::Device code only pairs a single death
+ // recipient with a single HIDL interface object, so these arguments are redundant.
+ mDeathRecipient->serviceDied(0, nullptr);
+}
+
+} // namespace android::hardware::neuralnetworks::V1_1::utils
+
+#endif // ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_1_UTILS_TEST_MOCK_DEVICE
diff --git a/neuralnetworks/1.1/utils/test/MockPreparedModel.h b/neuralnetworks/1.1/utils/test/MockPreparedModel.h
new file mode 100644
index 0000000..aba731e
--- /dev/null
+++ b/neuralnetworks/1.1/utils/test/MockPreparedModel.h
@@ -0,0 +1,44 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_1_UTILS_TEST_MOCK_PREPARED_MODEL
+#define ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_1_UTILS_TEST_MOCK_PREPARED_MODEL
+
+#include <android/hardware/neuralnetworks/1.0/IPreparedModel.h>
+#include <gmock/gmock.h>
+#include <gtest/gtest.h>
+#include <hidl/HidlSupport.h>
+#include <hidl/Status.h>
+
+namespace android::hardware::neuralnetworks::V1_0::utils {
+
+class MockPreparedModel final : public IPreparedModel {
+ public:
+ static sp<MockPreparedModel> create();
+
+ // V1_0 methods below.
+ MOCK_METHOD(Return<V1_0::ErrorStatus>, execute,
+ (const V1_0::Request& request, const sp<V1_0::IExecutionCallback>& callback),
+ (override));
+};
+
+inline sp<MockPreparedModel> MockPreparedModel::create() {
+ return sp<MockPreparedModel>::make();
+}
+
+} // namespace android::hardware::neuralnetworks::V1_0::utils
+
+#endif // ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_1_UTILS_TEST_MOCK_PREPARED_MODEL
diff --git a/neuralnetworks/1.1/vts/functional/AndroidTest.xml b/neuralnetworks/1.1/vts/functional/AndroidTest.xml
index cfde60c..74001f9 100644
--- a/neuralnetworks/1.1/vts/functional/AndroidTest.xml
+++ b/neuralnetworks/1.1/vts/functional/AndroidTest.xml
@@ -28,5 +28,6 @@
<test class="com.android.tradefed.testtype.GTest" >
<option name="native-test-device-path" value="/data/local/tmp" />
<option name="module-name" value="VtsHalNeuralnetworksV1_1TargetTest" />
+ <option name="native-test-timeout" value="20m" />
</test>
</configuration>
diff --git a/neuralnetworks/1.2/utils/Android.bp b/neuralnetworks/1.2/utils/Android.bp
index 22e8659..6959056 100644
--- a/neuralnetworks/1.2/utils/Android.bp
+++ b/neuralnetworks/1.2/utils/Android.bp
@@ -18,6 +18,7 @@
name: "neuralnetworks_utils_hal_1_2",
defaults: ["neuralnetworks_utils_defaults"],
srcs: ["src/*"],
+ exclude_srcs: ["src/ExecutionBurst*"],
local_include_dirs: ["include/nnapi/hal/1.2/"],
export_include_dirs: ["include"],
cflags: ["-Wthread-safety"],
@@ -36,3 +37,33 @@
"neuralnetworks_utils_hal_common",
],
}
+
+cc_test {
+ name: "neuralnetworks_utils_hal_1_2_test",
+ srcs: ["test/*.cpp"],
+ static_libs: [
+ "android.hardware.neuralnetworks@1.0",
+ "android.hardware.neuralnetworks@1.1",
+ "android.hardware.neuralnetworks@1.2",
+ "libgmock",
+ "libneuralnetworks_common",
+ "neuralnetworks_types",
+ "neuralnetworks_utils_hal_common",
+ "neuralnetworks_utils_hal_1_0",
+ "neuralnetworks_utils_hal_1_1",
+ "neuralnetworks_utils_hal_1_2",
+ ],
+ shared_libs: [
+ "android.hidl.allocator@1.0",
+ "android.hidl.memory@1.0",
+ "libbase",
+ "libcutils",
+ "libfmq",
+ "libhidlbase",
+ "libhidlmemory",
+ "liblog",
+ "libnativewindow",
+ "libutils",
+ ],
+ test_suites: ["general-tests"],
+}
diff --git a/neuralnetworks/1.2/utils/include/nnapi/hal/1.2/Device.h b/neuralnetworks/1.2/utils/include/nnapi/hal/1.2/Device.h
index b4bef5e..489f857 100644
--- a/neuralnetworks/1.2/utils/include/nnapi/hal/1.2/Device.h
+++ b/neuralnetworks/1.2/utils/include/nnapi/hal/1.2/Device.h
@@ -71,6 +71,7 @@
const std::string& getVersionString() const override;
nn::Version getFeatureLevel() const override;
nn::DeviceType getType() const override;
+ bool isUpdatable() const override;
const std::vector<nn::Extension>& getSupportedExtensions() const override;
const nn::Capabilities& getCapabilities() const override;
std::pair<uint32_t, uint32_t> getNumberOfCacheFilesNeeded() const override;
diff --git a/neuralnetworks/1.2/utils/include/nnapi/hal/1.2/ExecutionBurstController.h b/neuralnetworks/1.2/utils/include/nnapi/hal/1.2/ExecutionBurstController.h
new file mode 100644
index 0000000..5356a91
--- /dev/null
+++ b/neuralnetworks/1.2/utils/include/nnapi/hal/1.2/ExecutionBurstController.h
@@ -0,0 +1,185 @@
+/*
+ * Copyright (C) 2019 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_FRAMEWORKS_ML_NN_COMMON_EXECUTION_BURST_CONTROLLER_H
+#define ANDROID_FRAMEWORKS_ML_NN_COMMON_EXECUTION_BURST_CONTROLLER_H
+
+#include "ExecutionBurstUtils.h"
+
+#include <android-base/macros.h>
+#include <android/hardware/neuralnetworks/1.0/types.h>
+#include <android/hardware/neuralnetworks/1.1/types.h>
+#include <android/hardware/neuralnetworks/1.2/IBurstCallback.h>
+#include <android/hardware/neuralnetworks/1.2/IBurstContext.h>
+#include <android/hardware/neuralnetworks/1.2/IPreparedModel.h>
+#include <android/hardware/neuralnetworks/1.2/types.h>
+#include <fmq/MessageQueue.h>
+#include <hidl/MQDescriptor.h>
+
+#include <atomic>
+#include <chrono>
+#include <map>
+#include <memory>
+#include <mutex>
+#include <stack>
+#include <tuple>
+#include <utility>
+#include <vector>
+
+namespace android::nn {
+
+/**
+ * The ExecutionBurstController class manages both the serialization and
+ * deserialization of data across FMQ, making it appear to the runtime as a
+ * regular synchronous inference. Additionally, this class manages the burst's
+ * memory cache.
+ */
+class ExecutionBurstController {
+ DISALLOW_IMPLICIT_CONSTRUCTORS(ExecutionBurstController);
+
+ public:
+ /**
+ * NN runtime burst callback object and memory cache.
+ *
+ * ExecutionBurstCallback associates a hidl_memory object with a slot number
+ * to be passed across FMQ. The ExecutionBurstServer can use this callback
+ * to retrieve this hidl_memory corresponding to the slot via HIDL.
+ *
+ * Whenever a hidl_memory object is copied, it will duplicate the underlying
+ * file descriptor. Because the NN runtime currently copies the hidl_memory
+ * on each execution, it is difficult to associate hidl_memory objects with
+ * previously cached hidl_memory objects. For this reason, callers of this
+ * class must pair each hidl_memory object with an associated key. For
+ * efficiency, if two hidl_memory objects represent the same underlying
+ * buffer, they must use the same key.
+ */
+ class ExecutionBurstCallback : public hardware::neuralnetworks::V1_2::IBurstCallback {
+ DISALLOW_COPY_AND_ASSIGN(ExecutionBurstCallback);
+
+ public:
+ ExecutionBurstCallback() = default;
+
+ hardware::Return<void> getMemories(const hardware::hidl_vec<int32_t>& slots,
+ getMemories_cb cb) override;
+
+ /**
+ * This function performs one of two different actions:
+ * 1) If a key corresponding to a memory resource is unrecognized by the
+ * ExecutionBurstCallback object, the ExecutionBurstCallback object
+ * will allocate a slot, bind the memory to the slot, and return the
+ * slot identifier.
+ * 2) If a key corresponding to a memory resource is recognized by the
+ * ExecutionBurstCallback object, the ExecutionBurstCallback object
+ * will return the existing slot identifier.
+ *
+ * @param memories Memory resources used in an inference.
+ * @param keys Unique identifiers where each element corresponds to a
+ * memory resource element in "memories".
+ * @return Unique slot identifiers where each returned slot element
+ * corresponds to a memory resource element in "memories".
+ */
+ std::vector<int32_t> getSlots(const hardware::hidl_vec<hardware::hidl_memory>& memories,
+ const std::vector<intptr_t>& keys);
+
+ /*
+ * This function performs two different actions:
+ * 1) Removes an entry from the cache (if present), including the local
+ * storage of the hidl_memory object. Note that this call does not
+ * free any corresponding hidl_memory object in ExecutionBurstServer,
+ * which is separately freed via IBurstContext::freeMemory.
+ * 2) Return whether a cache entry was removed and which slot was removed if
+ * found. If the key did not to correspond to any entry in the cache, a
+ * slot number of 0 is returned. The slot number and whether the entry
+ * existed is useful so the same slot can be freed in the
+ * ExecutionBurstServer's cache via IBurstContext::freeMemory.
+ */
+ std::pair<bool, int32_t> freeMemory(intptr_t key);
+
+ private:
+ int32_t getSlotLocked(const hardware::hidl_memory& memory, intptr_t key);
+ int32_t allocateSlotLocked();
+
+ std::mutex mMutex;
+ std::stack<int32_t, std::vector<int32_t>> mFreeSlots;
+ std::map<intptr_t, int32_t> mMemoryIdToSlot;
+ std::vector<hardware::hidl_memory> mMemoryCache;
+ };
+
+ /**
+ * Creates a burst controller on a prepared model.
+ *
+ * Prefer this over ExecutionBurstController's constructor.
+ *
+ * @param preparedModel Model prepared for execution to execute on.
+ * @param pollingTimeWindow How much time (in microseconds) the
+ * ExecutionBurstController is allowed to poll the FMQ before waiting on
+ * the blocking futex. Polling may result in lower latencies at the
+ * potential cost of more power usage.
+ * @return ExecutionBurstController Execution burst controller object.
+ */
+ static std::unique_ptr<ExecutionBurstController> create(
+ const sp<hardware::neuralnetworks::V1_2::IPreparedModel>& preparedModel,
+ std::chrono::microseconds pollingTimeWindow);
+
+ // prefer calling ExecutionBurstController::create
+ ExecutionBurstController(const std::shared_ptr<RequestChannelSender>& requestChannelSender,
+ const std::shared_ptr<ResultChannelReceiver>& resultChannelReceiver,
+ const sp<hardware::neuralnetworks::V1_2::IBurstContext>& burstContext,
+ const sp<ExecutionBurstCallback>& callback,
+ const sp<hardware::hidl_death_recipient>& deathHandler = nullptr);
+
+ // explicit destructor to unregister the death recipient
+ ~ExecutionBurstController();
+
+ /**
+ * Execute a request on a model.
+ *
+ * @param request Arguments to be executed on a model.
+ * @param measure Whether to collect timing measurements, either YES or NO
+ * @param memoryIds Identifiers corresponding to each memory object in the
+ * request's pools.
+ * @return A tuple of:
+ * - result code of the execution
+ * - dynamic output shapes from the execution
+ * - any execution time measurements of the execution
+ * - whether or not a failed burst execution should be re-run using a
+ * different path (e.g., IPreparedModel::executeSynchronously)
+ */
+ std::tuple<int, std::vector<hardware::neuralnetworks::V1_2::OutputShape>,
+ hardware::neuralnetworks::V1_2::Timing, bool>
+ compute(const hardware::neuralnetworks::V1_0::Request& request,
+ hardware::neuralnetworks::V1_2::MeasureTiming measure,
+ const std::vector<intptr_t>& memoryIds);
+
+ /**
+ * Propagate a user's freeing of memory to the service.
+ *
+ * @param key Key corresponding to the memory object.
+ */
+ void freeMemory(intptr_t key);
+
+ private:
+ std::mutex mMutex;
+ const std::shared_ptr<RequestChannelSender> mRequestChannelSender;
+ const std::shared_ptr<ResultChannelReceiver> mResultChannelReceiver;
+ const sp<hardware::neuralnetworks::V1_2::IBurstContext> mBurstContext;
+ const sp<ExecutionBurstCallback> mMemoryCache;
+ const sp<hardware::hidl_death_recipient> mDeathHandler;
+};
+
+} // namespace android::nn
+
+#endif // ANDROID_FRAMEWORKS_ML_NN_COMMON_EXECUTION_BURST_CONTROLLER_H
diff --git a/neuralnetworks/1.2/utils/include/nnapi/hal/1.2/ExecutionBurstServer.h b/neuralnetworks/1.2/utils/include/nnapi/hal/1.2/ExecutionBurstServer.h
new file mode 100644
index 0000000..2e109b2
--- /dev/null
+++ b/neuralnetworks/1.2/utils/include/nnapi/hal/1.2/ExecutionBurstServer.h
@@ -0,0 +1,208 @@
+/*
+ * Copyright (C) 2019 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_FRAMEWORKS_ML_NN_COMMON_EXECUTION_BURST_SERVER_H
+#define ANDROID_FRAMEWORKS_ML_NN_COMMON_EXECUTION_BURST_SERVER_H
+
+#include "ExecutionBurstUtils.h"
+
+#include <android-base/macros.h>
+#include <android/hardware/neuralnetworks/1.0/types.h>
+#include <android/hardware/neuralnetworks/1.1/types.h>
+#include <android/hardware/neuralnetworks/1.2/IBurstCallback.h>
+#include <android/hardware/neuralnetworks/1.2/IPreparedModel.h>
+#include <android/hardware/neuralnetworks/1.2/types.h>
+#include <fmq/MessageQueue.h>
+#include <hidl/MQDescriptor.h>
+
+#include <atomic>
+#include <chrono>
+#include <memory>
+#include <optional>
+#include <thread>
+#include <tuple>
+#include <vector>
+
+namespace android::nn {
+
+/**
+ * The ExecutionBurstServer class is responsible for waiting for and
+ * deserializing a request object from a FMQ, performing the inference, and
+ * serializing the result back across another FMQ.
+ */
+class ExecutionBurstServer : public hardware::neuralnetworks::V1_2::IBurstContext {
+ DISALLOW_IMPLICIT_CONSTRUCTORS(ExecutionBurstServer);
+
+ public:
+ /**
+ * IBurstExecutorWithCache is a callback object passed to
+ * ExecutionBurstServer's factory function that is used to perform an
+ * execution. Because some memory resources are needed across multiple
+ * executions, this object also contains a local cache that can directly be
+ * used in the execution.
+ *
+ * ExecutionBurstServer will never access its IBurstExecutorWithCache object
+ * with concurrent calls.
+ */
+ class IBurstExecutorWithCache {
+ DISALLOW_COPY_AND_ASSIGN(IBurstExecutorWithCache);
+
+ public:
+ IBurstExecutorWithCache() = default;
+ virtual ~IBurstExecutorWithCache() = default;
+
+ /**
+ * Checks if a cache entry specified by a slot is present in the cache.
+ *
+ * @param slot Identifier of the cache entry.
+ * @return 'true' if the cache entry is present in the cache, 'false'
+ * otherwise.
+ */
+ virtual bool isCacheEntryPresent(int32_t slot) const = 0;
+
+ /**
+ * Adds an entry specified by a slot to the cache.
+ *
+ * The caller of this function must ensure that the cache entry that is
+ * being added is not already present in the cache. This can be checked
+ * via isCacheEntryPresent.
+ *
+ * @param memory Memory resource to be cached.
+ * @param slot Slot identifier corresponding to the memory resource.
+ */
+ virtual void addCacheEntry(const hardware::hidl_memory& memory, int32_t slot) = 0;
+
+ /**
+ * Removes an entry specified by a slot from the cache.
+ *
+ * If the cache entry corresponding to the slot number does not exist,
+ * the call does nothing.
+ *
+ * @param slot Slot identifier corresponding to the memory resource.
+ */
+ virtual void removeCacheEntry(int32_t slot) = 0;
+
+ /**
+ * Perform an execution.
+ *
+ * @param request Request object with inputs and outputs specified.
+ * Request::pools is empty, and DataLocation::poolIndex instead
+ * refers to the 'slots' argument as if it were Request::pools.
+ * @param slots Slots corresponding to the cached memory entries to be
+ * used.
+ * @param measure Whether timing information is requested for the
+ * execution.
+ * @return Result of the execution, including the status of the
+ * execution, dynamic output shapes, and any timing information.
+ */
+ virtual std::tuple<hardware::neuralnetworks::V1_0::ErrorStatus,
+ hardware::hidl_vec<hardware::neuralnetworks::V1_2::OutputShape>,
+ hardware::neuralnetworks::V1_2::Timing>
+ execute(const hardware::neuralnetworks::V1_0::Request& request,
+ const std::vector<int32_t>& slots,
+ hardware::neuralnetworks::V1_2::MeasureTiming measure) = 0;
+ };
+
+ /**
+ * Create automated context to manage FMQ-based executions.
+ *
+ * This function is intended to be used by a service to automatically:
+ * 1) Receive data from a provided FMQ
+ * 2) Execute a model with the given information
+ * 3) Send the result to the created FMQ
+ *
+ * @param callback Callback used to retrieve memories corresponding to
+ * unrecognized slots.
+ * @param requestChannel Input FMQ channel through which the client passes the
+ * request to the service.
+ * @param resultChannel Output FMQ channel from which the client can retrieve
+ * the result of the execution.
+ * @param executorWithCache Object which maintains a local cache of the
+ * memory pools and executes using the cached memory pools.
+ * @param pollingTimeWindow How much time (in microseconds) the
+ * ExecutionBurstServer is allowed to poll the FMQ before waiting on
+ * the blocking futex. Polling may result in lower latencies at the
+ * potential cost of more power usage.
+ * @result IBurstContext Handle to the burst context.
+ */
+ static sp<ExecutionBurstServer> create(
+ const sp<hardware::neuralnetworks::V1_2::IBurstCallback>& callback,
+ const FmqRequestDescriptor& requestChannel, const FmqResultDescriptor& resultChannel,
+ std::shared_ptr<IBurstExecutorWithCache> executorWithCache,
+ std::chrono::microseconds pollingTimeWindow = std::chrono::microseconds{0});
+
+ /**
+ * Create automated context to manage FMQ-based executions.
+ *
+ * This function is intended to be used by a service to automatically:
+ * 1) Receive data from a provided FMQ
+ * 2) Execute a model with the given information
+ * 3) Send the result to the created FMQ
+ *
+ * @param callback Callback used to retrieve memories corresponding to
+ * unrecognized slots.
+ * @param requestChannel Input FMQ channel through which the client passes the
+ * request to the service.
+ * @param resultChannel Output FMQ channel from which the client can retrieve
+ * the result of the execution.
+ * @param preparedModel PreparedModel that the burst object was created from.
+ * IPreparedModel::executeSynchronously will be used to perform the
+ * execution.
+ * @param pollingTimeWindow How much time (in microseconds) the
+ * ExecutionBurstServer is allowed to poll the FMQ before waiting on
+ * the blocking futex. Polling may result in lower latencies at the
+ * potential cost of more power usage.
+ * @result IBurstContext Handle to the burst context.
+ */
+ static sp<ExecutionBurstServer> create(
+ const sp<hardware::neuralnetworks::V1_2::IBurstCallback>& callback,
+ const FmqRequestDescriptor& requestChannel, const FmqResultDescriptor& resultChannel,
+ hardware::neuralnetworks::V1_2::IPreparedModel* preparedModel,
+ std::chrono::microseconds pollingTimeWindow = std::chrono::microseconds{0});
+
+ ExecutionBurstServer(const sp<hardware::neuralnetworks::V1_2::IBurstCallback>& callback,
+ std::unique_ptr<RequestChannelReceiver> requestChannel,
+ std::unique_ptr<ResultChannelSender> resultChannel,
+ std::shared_ptr<IBurstExecutorWithCache> cachedExecutor);
+ ~ExecutionBurstServer();
+
+ // Used by the NN runtime to preemptively remove any stored memory.
+ hardware::Return<void> freeMemory(int32_t slot) override;
+
+ private:
+ // Ensures all cache entries contained in mExecutorWithCache are present in
+ // the cache. If they are not present, they are retrieved (via
+ // IBurstCallback::getMemories) and added to mExecutorWithCache.
+ //
+ // This method is locked via mMutex when it is called.
+ void ensureCacheEntriesArePresentLocked(const std::vector<int32_t>& slots);
+
+ // Work loop that will continue processing execution requests until the
+ // ExecutionBurstServer object is freed.
+ void task();
+
+ std::thread mWorker;
+ std::mutex mMutex;
+ std::atomic<bool> mTeardown{false};
+ const sp<hardware::neuralnetworks::V1_2::IBurstCallback> mCallback;
+ const std::unique_ptr<RequestChannelReceiver> mRequestChannelReceiver;
+ const std::unique_ptr<ResultChannelSender> mResultChannelSender;
+ const std::shared_ptr<IBurstExecutorWithCache> mExecutorWithCache;
+};
+
+} // namespace android::nn
+
+#endif // ANDROID_FRAMEWORKS_ML_NN_COMMON_EXECUTION_BURST_SERVER_H
diff --git a/neuralnetworks/1.2/utils/include/nnapi/hal/1.2/ExecutionBurstUtils.h b/neuralnetworks/1.2/utils/include/nnapi/hal/1.2/ExecutionBurstUtils.h
new file mode 100644
index 0000000..8a41591
--- /dev/null
+++ b/neuralnetworks/1.2/utils/include/nnapi/hal/1.2/ExecutionBurstUtils.h
@@ -0,0 +1,335 @@
+/*
+ * Copyright (C) 2019 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_2_UTILS_EXECUTION_BURST_UTILS_H
+#define ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_2_UTILS_EXECUTION_BURST_UTILS_H
+
+#include <android/hardware/neuralnetworks/1.0/types.h>
+#include <android/hardware/neuralnetworks/1.1/types.h>
+#include <android/hardware/neuralnetworks/1.2/types.h>
+#include <fmq/MessageQueue.h>
+#include <hidl/MQDescriptor.h>
+
+#include <atomic>
+#include <chrono>
+#include <memory>
+#include <optional>
+#include <tuple>
+#include <utility>
+#include <vector>
+
+namespace android::hardware::neuralnetworks::V1_2::utils {
+
+/**
+ * Number of elements in the FMQ.
+ */
+constexpr const size_t kExecutionBurstChannelLength = 1024;
+
+using FmqRequestDescriptor = MQDescriptorSync<FmqRequestDatum>;
+using FmqResultDescriptor = MQDescriptorSync<FmqResultDatum>;
+
+/**
+ * Function to serialize a request.
+ *
+ * Prefer calling RequestChannelSender::send.
+ *
+ * @param request Request object without the pool information.
+ * @param measure Whether to collect timing information for the execution.
+ * @param memoryIds Slot identifiers corresponding to memory resources for the
+ * request.
+ * @return Serialized FMQ request data.
+ */
+std::vector<hardware::neuralnetworks::V1_2::FmqRequestDatum> serialize(
+ const hardware::neuralnetworks::V1_0::Request& request,
+ hardware::neuralnetworks::V1_2::MeasureTiming measure, const std::vector<int32_t>& slots);
+
+/**
+ * Deserialize the FMQ request data.
+ *
+ * The three resulting fields are the Request object (where Request::pools is
+ * empty), slot identifiers (which are stand-ins for Request::pools), and
+ * whether timing information must be collected for the run.
+ *
+ * @param data Serialized FMQ request data.
+ * @return Request object if successfully deserialized, std::nullopt otherwise.
+ */
+std::optional<std::tuple<hardware::neuralnetworks::V1_0::Request, std::vector<int32_t>,
+ hardware::neuralnetworks::V1_2::MeasureTiming>>
+deserialize(const std::vector<hardware::neuralnetworks::V1_2::FmqRequestDatum>& data);
+
+/**
+ * Function to serialize results.
+ *
+ * Prefer calling ResultChannelSender::send.
+ *
+ * @param errorStatus Status of the execution.
+ * @param outputShapes Dynamic shapes of the output tensors.
+ * @param timing Timing information of the execution.
+ * @return Serialized FMQ result data.
+ */
+std::vector<hardware::neuralnetworks::V1_2::FmqResultDatum> serialize(
+ hardware::neuralnetworks::V1_0::ErrorStatus errorStatus,
+ const std::vector<hardware::neuralnetworks::V1_2::OutputShape>& outputShapes,
+ hardware::neuralnetworks::V1_2::Timing timing);
+
+/**
+ * Deserialize the FMQ result data.
+ *
+ * The three resulting fields are the status of the execution, the dynamic
+ * shapes of the output tensors, and the timing information of the execution.
+ *
+ * @param data Serialized FMQ result data.
+ * @return Result object if successfully deserialized, std::nullopt otherwise.
+ */
+std::optional<std::tuple<hardware::neuralnetworks::V1_0::ErrorStatus,
+ std::vector<hardware::neuralnetworks::V1_2::OutputShape>,
+ hardware::neuralnetworks::V1_2::Timing>>
+deserialize(const std::vector<hardware::neuralnetworks::V1_2::FmqResultDatum>& data);
+
+/**
+ * Convert result code to error status.
+ *
+ * @param resultCode Result code to be converted.
+ * @return ErrorStatus Resultant error status.
+ */
+hardware::neuralnetworks::V1_0::ErrorStatus legacyConvertResultCodeToErrorStatus(int resultCode);
+
+/**
+ * RequestChannelSender is responsible for serializing the result packet of
+ * information, sending it on the result channel, and signaling that the data is
+ * available.
+ */
+class RequestChannelSender {
+ using FmqRequestDescriptor =
+ hardware::MQDescriptorSync<hardware::neuralnetworks::V1_2::FmqRequestDatum>;
+ using FmqRequestChannel =
+ hardware::MessageQueue<hardware::neuralnetworks::V1_2::FmqRequestDatum,
+ hardware::kSynchronizedReadWrite>;
+
+ public:
+ /**
+ * Create the sending end of a request channel.
+ *
+ * Prefer this call over the constructor.
+ *
+ * @param channelLength Number of elements in the FMQ.
+ * @return A pair of ResultChannelReceiver and the FMQ descriptor on
+ * successful creation, both nullptr otherwise.
+ */
+ static std::pair<std::unique_ptr<RequestChannelSender>, const FmqRequestDescriptor*> create(
+ size_t channelLength);
+
+ /**
+ * Send the request to the channel.
+ *
+ * @param request Request object without the pool information.
+ * @param measure Whether to collect timing information for the execution.
+ * @param memoryIds Slot identifiers corresponding to memory resources for
+ * the request.
+ * @return 'true' on successful send, 'false' otherwise.
+ */
+ bool send(const hardware::neuralnetworks::V1_0::Request& request,
+ hardware::neuralnetworks::V1_2::MeasureTiming measure,
+ const std::vector<int32_t>& slots);
+
+ /**
+ * Method to mark the channel as invalid, causing all future calls to
+ * RequestChannelSender::send to immediately return false without attempting
+ * to send a message across the FMQ.
+ */
+ void invalidate();
+
+ // prefer calling RequestChannelSender::send
+ bool sendPacket(const std::vector<hardware::neuralnetworks::V1_2::FmqRequestDatum>& packet);
+
+ RequestChannelSender(std::unique_ptr<FmqRequestChannel> fmqRequestChannel);
+
+ private:
+ const std::unique_ptr<FmqRequestChannel> mFmqRequestChannel;
+ std::atomic<bool> mValid{true};
+};
+
+/**
+ * RequestChannelReceiver is responsible for waiting on the channel until the
+ * packet is available, extracting the packet from the channel, and
+ * deserializing the packet.
+ *
+ * Because the receiver can wait on a packet that may never come (e.g., because
+ * the sending side of the packet has been closed), this object can be
+ * invalidated, unblocking the receiver.
+ */
+class RequestChannelReceiver {
+ using FmqRequestChannel =
+ hardware::MessageQueue<hardware::neuralnetworks::V1_2::FmqRequestDatum,
+ hardware::kSynchronizedReadWrite>;
+
+ public:
+ /**
+ * Create the receiving end of a request channel.
+ *
+ * Prefer this call over the constructor.
+ *
+ * @param requestChannel Descriptor for the request channel.
+ * @param pollingTimeWindow How much time (in microseconds) the
+ * RequestChannelReceiver is allowed to poll the FMQ before waiting on
+ * the blocking futex. Polling may result in lower latencies at the
+ * potential cost of more power usage.
+ * @return RequestChannelReceiver on successful creation, nullptr otherwise.
+ */
+ static std::unique_ptr<RequestChannelReceiver> create(
+ const FmqRequestDescriptor& requestChannel,
+ std::chrono::microseconds pollingTimeWindow);
+
+ /**
+ * Get the request from the channel.
+ *
+ * This method will block until either:
+ * 1) The packet has been retrieved, or
+ * 2) The receiver has been invalidated
+ *
+ * @return Request object if successfully received, std::nullopt if error or
+ * if the receiver object was invalidated.
+ */
+ std::optional<std::tuple<hardware::neuralnetworks::V1_0::Request, std::vector<int32_t>,
+ hardware::neuralnetworks::V1_2::MeasureTiming>>
+ getBlocking();
+
+ /**
+ * Method to mark the channel as invalid, unblocking any current or future
+ * calls to RequestChannelReceiver::getBlocking.
+ */
+ void invalidate();
+
+ RequestChannelReceiver(std::unique_ptr<FmqRequestChannel> fmqRequestChannel,
+ std::chrono::microseconds pollingTimeWindow);
+
+ private:
+ std::optional<std::vector<hardware::neuralnetworks::V1_2::FmqRequestDatum>> getPacketBlocking();
+
+ const std::unique_ptr<FmqRequestChannel> mFmqRequestChannel;
+ std::atomic<bool> mTeardown{false};
+ const std::chrono::microseconds kPollingTimeWindow;
+};
+
+/**
+ * ResultChannelSender is responsible for serializing the result packet of
+ * information, sending it on the result channel, and signaling that the data is
+ * available.
+ */
+class ResultChannelSender {
+ using FmqResultChannel = hardware::MessageQueue<hardware::neuralnetworks::V1_2::FmqResultDatum,
+ hardware::kSynchronizedReadWrite>;
+
+ public:
+ /**
+ * Create the sending end of a result channel.
+ *
+ * Prefer this call over the constructor.
+ *
+ * @param resultChannel Descriptor for the result channel.
+ * @return ResultChannelSender on successful creation, nullptr otherwise.
+ */
+ static std::unique_ptr<ResultChannelSender> create(const FmqResultDescriptor& resultChannel);
+
+ /**
+ * Send the result to the channel.
+ *
+ * @param errorStatus Status of the execution.
+ * @param outputShapes Dynamic shapes of the output tensors.
+ * @param timing Timing information of the execution.
+ * @return 'true' on successful send, 'false' otherwise.
+ */
+ bool send(hardware::neuralnetworks::V1_0::ErrorStatus errorStatus,
+ const std::vector<hardware::neuralnetworks::V1_2::OutputShape>& outputShapes,
+ hardware::neuralnetworks::V1_2::Timing timing);
+
+ // prefer calling ResultChannelSender::send
+ bool sendPacket(const std::vector<hardware::neuralnetworks::V1_2::FmqResultDatum>& packet);
+
+ ResultChannelSender(std::unique_ptr<FmqResultChannel> fmqResultChannel);
+
+ private:
+ const std::unique_ptr<FmqResultChannel> mFmqResultChannel;
+};
+
+/**
+ * ResultChannelReceiver is responsible for waiting on the channel until the
+ * packet is available, extracting the packet from the channel, and
+ * deserializing the packet.
+ *
+ * Because the receiver can wait on a packet that may never come (e.g., because
+ * the sending side of the packet has been closed), this object can be
+ * invalidated, unblocking the receiver.
+ */
+class ResultChannelReceiver {
+ using FmqResultDescriptor =
+ hardware::MQDescriptorSync<hardware::neuralnetworks::V1_2::FmqResultDatum>;
+ using FmqResultChannel = hardware::MessageQueue<hardware::neuralnetworks::V1_2::FmqResultDatum,
+ hardware::kSynchronizedReadWrite>;
+
+ public:
+ /**
+ * Create the receiving end of a result channel.
+ *
+ * Prefer this call over the constructor.
+ *
+ * @param channelLength Number of elements in the FMQ.
+ * @param pollingTimeWindow How much time (in microseconds) the
+ * ResultChannelReceiver is allowed to poll the FMQ before waiting on
+ * the blocking futex. Polling may result in lower latencies at the
+ * potential cost of more power usage.
+ * @return A pair of ResultChannelReceiver and the FMQ descriptor on
+ * successful creation, both nullptr otherwise.
+ */
+ static std::pair<std::unique_ptr<ResultChannelReceiver>, const FmqResultDescriptor*> create(
+ size_t channelLength, std::chrono::microseconds pollingTimeWindow);
+
+ /**
+ * Get the result from the channel.
+ *
+ * This method will block until either:
+ * 1) The packet has been retrieved, or
+ * 2) The receiver has been invalidated
+ *
+ * @return Result object if successfully received, std::nullopt if error or
+ * if the receiver object was invalidated.
+ */
+ std::optional<std::tuple<hardware::neuralnetworks::V1_0::ErrorStatus,
+ std::vector<hardware::neuralnetworks::V1_2::OutputShape>,
+ hardware::neuralnetworks::V1_2::Timing>>
+ getBlocking();
+
+ /**
+ * Method to mark the channel as invalid, unblocking any current or future
+ * calls to ResultChannelReceiver::getBlocking.
+ */
+ void invalidate();
+
+ // prefer calling ResultChannelReceiver::getBlocking
+ std::optional<std::vector<hardware::neuralnetworks::V1_2::FmqResultDatum>> getPacketBlocking();
+
+ ResultChannelReceiver(std::unique_ptr<FmqResultChannel> fmqResultChannel,
+ std::chrono::microseconds pollingTimeWindow);
+
+ private:
+ const std::unique_ptr<FmqResultChannel> mFmqResultChannel;
+ std::atomic<bool> mValid{true};
+ const std::chrono::microseconds kPollingTimeWindow;
+};
+
+} // namespace android::hardware::neuralnetworks::V1_2::utils
+
+#endif // ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_2_UTILS_EXECUTION_BURST_UTILS_H
diff --git a/neuralnetworks/1.2/utils/include/nnapi/hal/1.2/PreparedModel.h b/neuralnetworks/1.2/utils/include/nnapi/hal/1.2/PreparedModel.h
index 6a56a82..fb11130 100644
--- a/neuralnetworks/1.2/utils/include/nnapi/hal/1.2/PreparedModel.h
+++ b/neuralnetworks/1.2/utils/include/nnapi/hal/1.2/PreparedModel.h
@@ -36,7 +36,8 @@
namespace android::hardware::neuralnetworks::V1_2::utils {
// Class that adapts V1_2::IPreparedModel to nn::IPreparedModel.
-class PreparedModel final : public nn::IPreparedModel {
+class PreparedModel final : public nn::IPreparedModel,
+ public std::enable_shared_from_this<PreparedModel> {
struct PrivateConstructorTag {};
public:
@@ -57,6 +58,8 @@
const nn::OptionalDuration& loopTimeoutDuration,
const nn::OptionalDuration& timeoutDurationAfterFence) const override;
+ nn::GeneralResult<nn::SharedBurst> configureExecutionBurst() const override;
+
std::any getUnderlyingResource() const override;
private:
diff --git a/neuralnetworks/1.2/utils/src/Device.cpp b/neuralnetworks/1.2/utils/src/Device.cpp
index 9fe0de2..1954dfa 100644
--- a/neuralnetworks/1.2/utils/src/Device.cpp
+++ b/neuralnetworks/1.2/utils/src/Device.cpp
@@ -199,6 +199,10 @@
return kDeviceType;
}
+bool Device::isUpdatable() const {
+ return false;
+}
+
const std::vector<nn::Extension>& Device::getSupportedExtensions() const {
return kExtensions;
}
diff --git a/neuralnetworks/1.2/utils/src/ExecutionBurstController.cpp b/neuralnetworks/1.2/utils/src/ExecutionBurstController.cpp
new file mode 100644
index 0000000..2265861
--- /dev/null
+++ b/neuralnetworks/1.2/utils/src/ExecutionBurstController.cpp
@@ -0,0 +1,299 @@
+/*
+ * Copyright (C) 2019 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#define LOG_TAG "ExecutionBurstController"
+
+#include "ExecutionBurstController.h"
+
+#include <android-base/logging.h>
+
+#include <algorithm>
+#include <cstring>
+#include <limits>
+#include <memory>
+#include <string>
+#include <tuple>
+#include <utility>
+#include <vector>
+
+#include "ExecutionBurstUtils.h"
+#include "HalInterfaces.h"
+#include "Tracing.h"
+#include "Utils.h"
+
+namespace android::nn {
+namespace {
+
+class BurstContextDeathHandler : public hardware::hidl_death_recipient {
+ public:
+ using Callback = std::function<void()>;
+
+ BurstContextDeathHandler(const Callback& onDeathCallback) : mOnDeathCallback(onDeathCallback) {
+ CHECK(onDeathCallback != nullptr);
+ }
+
+ void serviceDied(uint64_t /*cookie*/, const wp<hidl::base::V1_0::IBase>& /*who*/) override {
+ LOG(ERROR) << "BurstContextDeathHandler::serviceDied -- service unexpectedly died!";
+ mOnDeathCallback();
+ }
+
+ private:
+ const Callback mOnDeathCallback;
+};
+
+} // anonymous namespace
+
+hardware::Return<void> ExecutionBurstController::ExecutionBurstCallback::getMemories(
+ const hardware::hidl_vec<int32_t>& slots, getMemories_cb cb) {
+ std::lock_guard<std::mutex> guard(mMutex);
+
+ // get all memories
+ hardware::hidl_vec<hardware::hidl_memory> memories(slots.size());
+ std::transform(slots.begin(), slots.end(), memories.begin(), [this](int32_t slot) {
+ return slot < mMemoryCache.size() ? mMemoryCache[slot] : hardware::hidl_memory{};
+ });
+
+ // ensure all memories are valid
+ if (!std::all_of(memories.begin(), memories.end(),
+ [](const hardware::hidl_memory& memory) { return memory.valid(); })) {
+ cb(V1_0::ErrorStatus::INVALID_ARGUMENT, {});
+ return hardware::Void();
+ }
+
+ // return successful
+ cb(V1_0::ErrorStatus::NONE, std::move(memories));
+ return hardware::Void();
+}
+
+std::vector<int32_t> ExecutionBurstController::ExecutionBurstCallback::getSlots(
+ const hardware::hidl_vec<hardware::hidl_memory>& memories,
+ const std::vector<intptr_t>& keys) {
+ std::lock_guard<std::mutex> guard(mMutex);
+
+ // retrieve (or bind) all slots corresponding to memories
+ std::vector<int32_t> slots;
+ slots.reserve(memories.size());
+ for (size_t i = 0; i < memories.size(); ++i) {
+ slots.push_back(getSlotLocked(memories[i], keys[i]));
+ }
+ return slots;
+}
+
+std::pair<bool, int32_t> ExecutionBurstController::ExecutionBurstCallback::freeMemory(
+ intptr_t key) {
+ std::lock_guard<std::mutex> guard(mMutex);
+
+ auto iter = mMemoryIdToSlot.find(key);
+ if (iter == mMemoryIdToSlot.end()) {
+ return {false, 0};
+ }
+ const int32_t slot = iter->second;
+ mMemoryIdToSlot.erase(key);
+ mMemoryCache[slot] = {};
+ mFreeSlots.push(slot);
+ return {true, slot};
+}
+
+int32_t ExecutionBurstController::ExecutionBurstCallback::getSlotLocked(
+ const hardware::hidl_memory& memory, intptr_t key) {
+ auto iter = mMemoryIdToSlot.find(key);
+ if (iter == mMemoryIdToSlot.end()) {
+ const int32_t slot = allocateSlotLocked();
+ mMemoryIdToSlot[key] = slot;
+ mMemoryCache[slot] = memory;
+ return slot;
+ } else {
+ const int32_t slot = iter->second;
+ return slot;
+ }
+}
+
+int32_t ExecutionBurstController::ExecutionBurstCallback::allocateSlotLocked() {
+ constexpr size_t kMaxNumberOfSlots = std::numeric_limits<int32_t>::max();
+
+ // if there is a free slot, use it
+ if (mFreeSlots.size() > 0) {
+ const int32_t slot = mFreeSlots.top();
+ mFreeSlots.pop();
+ return slot;
+ }
+
+ // otherwise use a slot for the first time
+ CHECK(mMemoryCache.size() < kMaxNumberOfSlots) << "Exceeded maximum number of slots!";
+ const int32_t slot = static_cast<int32_t>(mMemoryCache.size());
+ mMemoryCache.emplace_back();
+
+ return slot;
+}
+
+std::unique_ptr<ExecutionBurstController> ExecutionBurstController::create(
+ const sp<V1_2::IPreparedModel>& preparedModel,
+ std::chrono::microseconds pollingTimeWindow) {
+ // check inputs
+ if (preparedModel == nullptr) {
+ LOG(ERROR) << "ExecutionBurstController::create passed a nullptr";
+ return nullptr;
+ }
+
+ // create callback object
+ sp<ExecutionBurstCallback> callback = new ExecutionBurstCallback();
+
+ // create FMQ objects
+ auto [requestChannelSenderTemp, requestChannelDescriptor] =
+ RequestChannelSender::create(kExecutionBurstChannelLength);
+ auto [resultChannelReceiverTemp, resultChannelDescriptor] =
+ ResultChannelReceiver::create(kExecutionBurstChannelLength, pollingTimeWindow);
+ std::shared_ptr<RequestChannelSender> requestChannelSender =
+ std::move(requestChannelSenderTemp);
+ std::shared_ptr<ResultChannelReceiver> resultChannelReceiver =
+ std::move(resultChannelReceiverTemp);
+
+ // check FMQ objects
+ if (!requestChannelSender || !resultChannelReceiver || !requestChannelDescriptor ||
+ !resultChannelDescriptor) {
+ LOG(ERROR) << "ExecutionBurstController::create failed to create FastMessageQueue";
+ return nullptr;
+ }
+
+ // configure burst
+ V1_0::ErrorStatus errorStatus;
+ sp<IBurstContext> burstContext;
+ const hardware::Return<void> ret = preparedModel->configureExecutionBurst(
+ callback, *requestChannelDescriptor, *resultChannelDescriptor,
+ [&errorStatus, &burstContext](V1_0::ErrorStatus status,
+ const sp<IBurstContext>& context) {
+ errorStatus = status;
+ burstContext = context;
+ });
+
+ // check burst
+ if (!ret.isOk()) {
+ LOG(ERROR) << "IPreparedModel::configureExecutionBurst failed with description "
+ << ret.description();
+ return nullptr;
+ }
+ if (errorStatus != V1_0::ErrorStatus::NONE) {
+ LOG(ERROR) << "IPreparedModel::configureExecutionBurst failed with status "
+ << toString(errorStatus);
+ return nullptr;
+ }
+ if (burstContext == nullptr) {
+ LOG(ERROR) << "IPreparedModel::configureExecutionBurst returned nullptr for burst";
+ return nullptr;
+ }
+
+ // create death handler object
+ BurstContextDeathHandler::Callback onDeathCallback = [requestChannelSender,
+ resultChannelReceiver] {
+ requestChannelSender->invalidate();
+ resultChannelReceiver->invalidate();
+ };
+ const sp<BurstContextDeathHandler> deathHandler = new BurstContextDeathHandler(onDeathCallback);
+
+ // linkToDeath registers a callback that will be invoked on service death to
+ // proactively handle service crashes. If the linkToDeath call fails,
+ // asynchronous calls are susceptible to hangs if the service crashes before
+ // providing the response.
+ const hardware::Return<bool> deathHandlerRet = burstContext->linkToDeath(deathHandler, 0);
+ if (!deathHandlerRet.isOk() || deathHandlerRet != true) {
+ LOG(ERROR) << "ExecutionBurstController::create -- Failed to register a death recipient "
+ "for the IBurstContext object.";
+ return nullptr;
+ }
+
+ // make and return controller
+ return std::make_unique<ExecutionBurstController>(requestChannelSender, resultChannelReceiver,
+ burstContext, callback, deathHandler);
+}
+
+ExecutionBurstController::ExecutionBurstController(
+ const std::shared_ptr<RequestChannelSender>& requestChannelSender,
+ const std::shared_ptr<ResultChannelReceiver>& resultChannelReceiver,
+ const sp<IBurstContext>& burstContext, const sp<ExecutionBurstCallback>& callback,
+ const sp<hardware::hidl_death_recipient>& deathHandler)
+ : mRequestChannelSender(requestChannelSender),
+ mResultChannelReceiver(resultChannelReceiver),
+ mBurstContext(burstContext),
+ mMemoryCache(callback),
+ mDeathHandler(deathHandler) {}
+
+ExecutionBurstController::~ExecutionBurstController() {
+ // It is safe to ignore any errors resulting from this unlinkToDeath call
+ // because the ExecutionBurstController object is already being destroyed
+ // and its underlying IBurstContext object is no longer being used by the NN
+ // runtime.
+ if (mDeathHandler) {
+ mBurstContext->unlinkToDeath(mDeathHandler).isOk();
+ }
+}
+
+static std::tuple<int, std::vector<V1_2::OutputShape>, V1_2::Timing, bool> getExecutionResult(
+ V1_0::ErrorStatus status, std::vector<V1_2::OutputShape> outputShapes, V1_2::Timing timing,
+ bool fallback) {
+ auto [n, checkedOutputShapes, checkedTiming] =
+ getExecutionResult(convertToV1_3(status), std::move(outputShapes), timing);
+ return {n, convertToV1_2(checkedOutputShapes), convertToV1_2(checkedTiming), fallback};
+}
+
+std::tuple<int, std::vector<V1_2::OutputShape>, V1_2::Timing, bool>
+ExecutionBurstController::compute(const V1_0::Request& request, V1_2::MeasureTiming measure,
+ const std::vector<intptr_t>& memoryIds) {
+ // This is the first point when we know an execution is occurring, so begin
+ // to collect systraces. Note that the first point we can begin collecting
+ // systraces in ExecutionBurstServer is when the RequestChannelReceiver
+ // realizes there is data in the FMQ, so ExecutionBurstServer collects
+ // systraces at different points in the code.
+ NNTRACE_FULL(NNTRACE_LAYER_IPC, NNTRACE_PHASE_EXECUTION, "ExecutionBurstController::compute");
+
+ std::lock_guard<std::mutex> guard(mMutex);
+
+ // send request packet
+ const std::vector<int32_t> slots = mMemoryCache->getSlots(request.pools, memoryIds);
+ const bool success = mRequestChannelSender->send(request, measure, slots);
+ if (!success) {
+ LOG(ERROR) << "Error sending FMQ packet";
+ // only use fallback execution path if the packet could not be sent
+ return getExecutionResult(V1_0::ErrorStatus::GENERAL_FAILURE, {}, kNoTiming12,
+ /*fallback=*/true);
+ }
+
+ // get result packet
+ const auto result = mResultChannelReceiver->getBlocking();
+ if (!result) {
+ LOG(ERROR) << "Error retrieving FMQ packet";
+ // only use fallback execution path if the packet could not be sent
+ return getExecutionResult(V1_0::ErrorStatus::GENERAL_FAILURE, {}, kNoTiming12,
+ /*fallback=*/false);
+ }
+
+ // unpack results and return (only use fallback execution path if the
+ // packet could not be sent)
+ auto [status, outputShapes, timing] = std::move(*result);
+ return getExecutionResult(status, std::move(outputShapes), timing, /*fallback=*/false);
+}
+
+void ExecutionBurstController::freeMemory(intptr_t key) {
+ std::lock_guard<std::mutex> guard(mMutex);
+
+ bool valid;
+ int32_t slot;
+ std::tie(valid, slot) = mMemoryCache->freeMemory(key);
+ if (valid) {
+ mBurstContext->freeMemory(slot).isOk();
+ }
+}
+
+} // namespace android::nn
diff --git a/neuralnetworks/1.2/utils/src/ExecutionBurstServer.cpp b/neuralnetworks/1.2/utils/src/ExecutionBurstServer.cpp
new file mode 100644
index 0000000..022548d
--- /dev/null
+++ b/neuralnetworks/1.2/utils/src/ExecutionBurstServer.cpp
@@ -0,0 +1,260 @@
+/*
+ * Copyright (C) 2019 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#define LOG_TAG "ExecutionBurstServer"
+
+#include "ExecutionBurstServer.h"
+
+#include <android-base/logging.h>
+
+#include <algorithm>
+#include <cstring>
+#include <limits>
+#include <map>
+#include <memory>
+#include <tuple>
+#include <utility>
+#include <vector>
+
+#include "ExecutionBurstUtils.h"
+#include "HalInterfaces.h"
+#include "Tracing.h"
+
+namespace android::nn {
+namespace {
+
+// DefaultBurstExecutorWithCache adapts an IPreparedModel so that it can be
+// used as an IBurstExecutorWithCache. Specifically, the cache simply stores the
+// hidl_memory object, and the execution forwards calls to the provided
+// IPreparedModel's "executeSynchronously" method. With this class, hidl_memory
+// must be mapped and unmapped for each execution.
+class DefaultBurstExecutorWithCache : public ExecutionBurstServer::IBurstExecutorWithCache {
+ public:
+ DefaultBurstExecutorWithCache(V1_2::IPreparedModel* preparedModel)
+ : mpPreparedModel(preparedModel) {}
+
+ bool isCacheEntryPresent(int32_t slot) const override {
+ const auto it = mMemoryCache.find(slot);
+ return (it != mMemoryCache.end()) && it->second.valid();
+ }
+
+ void addCacheEntry(const hardware::hidl_memory& memory, int32_t slot) override {
+ mMemoryCache[slot] = memory;
+ }
+
+ void removeCacheEntry(int32_t slot) override { mMemoryCache.erase(slot); }
+
+ std::tuple<V1_0::ErrorStatus, hardware::hidl_vec<V1_2::OutputShape>, V1_2::Timing> execute(
+ const V1_0::Request& request, const std::vector<int32_t>& slots,
+ V1_2::MeasureTiming measure) override {
+ // convert slots to pools
+ hardware::hidl_vec<hardware::hidl_memory> pools(slots.size());
+ std::transform(slots.begin(), slots.end(), pools.begin(),
+ [this](int32_t slot) { return mMemoryCache[slot]; });
+
+ // create full request
+ V1_0::Request fullRequest = request;
+ fullRequest.pools = std::move(pools);
+
+ // setup execution
+ V1_0::ErrorStatus returnedStatus = V1_0::ErrorStatus::GENERAL_FAILURE;
+ hardware::hidl_vec<V1_2::OutputShape> returnedOutputShapes;
+ V1_2::Timing returnedTiming;
+ auto cb = [&returnedStatus, &returnedOutputShapes, &returnedTiming](
+ V1_0::ErrorStatus status,
+ const hardware::hidl_vec<V1_2::OutputShape>& outputShapes,
+ const V1_2::Timing& timing) {
+ returnedStatus = status;
+ returnedOutputShapes = outputShapes;
+ returnedTiming = timing;
+ };
+
+ // execute
+ const hardware::Return<void> ret =
+ mpPreparedModel->executeSynchronously(fullRequest, measure, cb);
+ if (!ret.isOk() || returnedStatus != V1_0::ErrorStatus::NONE) {
+ LOG(ERROR) << "IPreparedModelAdapter::execute -- Error executing";
+ return {returnedStatus, std::move(returnedOutputShapes), kNoTiming};
+ }
+
+ return std::make_tuple(returnedStatus, std::move(returnedOutputShapes), returnedTiming);
+ }
+
+ private:
+ V1_2::IPreparedModel* const mpPreparedModel;
+ std::map<int32_t, hardware::hidl_memory> mMemoryCache;
+};
+
+} // anonymous namespace
+
+// ExecutionBurstServer methods
+
+sp<ExecutionBurstServer> ExecutionBurstServer::create(
+ const sp<IBurstCallback>& callback, const MQDescriptorSync<FmqRequestDatum>& requestChannel,
+ const MQDescriptorSync<FmqResultDatum>& resultChannel,
+ std::shared_ptr<IBurstExecutorWithCache> executorWithCache,
+ std::chrono::microseconds pollingTimeWindow) {
+ // check inputs
+ if (callback == nullptr || executorWithCache == nullptr) {
+ LOG(ERROR) << "ExecutionBurstServer::create passed a nullptr";
+ return nullptr;
+ }
+
+ // create FMQ objects
+ std::unique_ptr<RequestChannelReceiver> requestChannelReceiver =
+ RequestChannelReceiver::create(requestChannel, pollingTimeWindow);
+ std::unique_ptr<ResultChannelSender> resultChannelSender =
+ ResultChannelSender::create(resultChannel);
+
+ // check FMQ objects
+ if (!requestChannelReceiver || !resultChannelSender) {
+ LOG(ERROR) << "ExecutionBurstServer::create failed to create FastMessageQueue";
+ return nullptr;
+ }
+
+ // make and return context
+ return new ExecutionBurstServer(callback, std::move(requestChannelReceiver),
+ std::move(resultChannelSender), std::move(executorWithCache));
+}
+
+sp<ExecutionBurstServer> ExecutionBurstServer::create(
+ const sp<IBurstCallback>& callback, const MQDescriptorSync<FmqRequestDatum>& requestChannel,
+ const MQDescriptorSync<FmqResultDatum>& resultChannel, V1_2::IPreparedModel* preparedModel,
+ std::chrono::microseconds pollingTimeWindow) {
+ // check relevant input
+ if (preparedModel == nullptr) {
+ LOG(ERROR) << "ExecutionBurstServer::create passed a nullptr";
+ return nullptr;
+ }
+
+ // adapt IPreparedModel to have caching
+ const std::shared_ptr<DefaultBurstExecutorWithCache> preparedModelAdapter =
+ std::make_shared<DefaultBurstExecutorWithCache>(preparedModel);
+
+ // make and return context
+ return ExecutionBurstServer::create(callback, requestChannel, resultChannel,
+ preparedModelAdapter, pollingTimeWindow);
+}
+
+ExecutionBurstServer::ExecutionBurstServer(
+ const sp<IBurstCallback>& callback, std::unique_ptr<RequestChannelReceiver> requestChannel,
+ std::unique_ptr<ResultChannelSender> resultChannel,
+ std::shared_ptr<IBurstExecutorWithCache> executorWithCache)
+ : mCallback(callback),
+ mRequestChannelReceiver(std::move(requestChannel)),
+ mResultChannelSender(std::move(resultChannel)),
+ mExecutorWithCache(std::move(executorWithCache)) {
+ // TODO: highly document the threading behavior of this class
+ mWorker = std::thread([this] { task(); });
+}
+
+ExecutionBurstServer::~ExecutionBurstServer() {
+ // set teardown flag
+ mTeardown = true;
+ mRequestChannelReceiver->invalidate();
+
+ // wait for task thread to end
+ mWorker.join();
+}
+
+hardware::Return<void> ExecutionBurstServer::freeMemory(int32_t slot) {
+ std::lock_guard<std::mutex> hold(mMutex);
+ mExecutorWithCache->removeCacheEntry(slot);
+ return hardware::Void();
+}
+
+void ExecutionBurstServer::ensureCacheEntriesArePresentLocked(const std::vector<int32_t>& slots) {
+ const auto slotIsKnown = [this](int32_t slot) {
+ return mExecutorWithCache->isCacheEntryPresent(slot);
+ };
+
+ // find unique unknown slots
+ std::vector<int32_t> unknownSlots = slots;
+ auto unknownSlotsEnd = unknownSlots.end();
+ std::sort(unknownSlots.begin(), unknownSlotsEnd);
+ unknownSlotsEnd = std::unique(unknownSlots.begin(), unknownSlotsEnd);
+ unknownSlotsEnd = std::remove_if(unknownSlots.begin(), unknownSlotsEnd, slotIsKnown);
+ unknownSlots.erase(unknownSlotsEnd, unknownSlots.end());
+
+ // quick-exit if all slots are known
+ if (unknownSlots.empty()) {
+ return;
+ }
+
+ V1_0::ErrorStatus errorStatus = V1_0::ErrorStatus::GENERAL_FAILURE;
+ std::vector<hardware::hidl_memory> returnedMemories;
+ auto cb = [&errorStatus, &returnedMemories](
+ V1_0::ErrorStatus status,
+ const hardware::hidl_vec<hardware::hidl_memory>& memories) {
+ errorStatus = status;
+ returnedMemories = memories;
+ };
+
+ const hardware::Return<void> ret = mCallback->getMemories(unknownSlots, cb);
+
+ if (!ret.isOk() || errorStatus != V1_0::ErrorStatus::NONE ||
+ returnedMemories.size() != unknownSlots.size()) {
+ LOG(ERROR) << "Error retrieving memories";
+ return;
+ }
+
+ // add memories to unknown slots
+ for (size_t i = 0; i < unknownSlots.size(); ++i) {
+ mExecutorWithCache->addCacheEntry(returnedMemories[i], unknownSlots[i]);
+ }
+}
+
+void ExecutionBurstServer::task() {
+ // loop until the burst object is being destroyed
+ while (!mTeardown) {
+ // receive request
+ auto arguments = mRequestChannelReceiver->getBlocking();
+
+ // if the request packet was not properly received, return a generic
+ // error and skip the execution
+ //
+ // if the burst is being torn down, skip the execution so the "task"
+ // function can end
+ if (!arguments) {
+ if (!mTeardown) {
+ mResultChannelSender->send(V1_0::ErrorStatus::GENERAL_FAILURE, {}, kNoTiming);
+ }
+ continue;
+ }
+
+ // otherwise begin tracing execution
+ NNTRACE_FULL(NNTRACE_LAYER_IPC, NNTRACE_PHASE_EXECUTION,
+ "ExecutionBurstServer getting memory, executing, and returning results");
+
+ // unpack the arguments; types are Request, std::vector<int32_t>, and
+ // MeasureTiming, respectively
+ const auto [requestWithoutPools, slotsOfPools, measure] = std::move(*arguments);
+
+ // ensure executor with cache has required memory
+ std::lock_guard<std::mutex> hold(mMutex);
+ ensureCacheEntriesArePresentLocked(slotsOfPools);
+
+ // perform computation; types are ErrorStatus, hidl_vec<OutputShape>,
+ // and Timing, respectively
+ const auto [errorStatus, outputShapes, returnedTiming] =
+ mExecutorWithCache->execute(requestWithoutPools, slotsOfPools, measure);
+
+ // return result
+ mResultChannelSender->send(errorStatus, outputShapes, returnedTiming);
+ }
+}
+
+} // namespace android::nn
diff --git a/neuralnetworks/1.2/utils/src/ExecutionBurstUtils.cpp b/neuralnetworks/1.2/utils/src/ExecutionBurstUtils.cpp
new file mode 100644
index 0000000..f0275f9
--- /dev/null
+++ b/neuralnetworks/1.2/utils/src/ExecutionBurstUtils.cpp
@@ -0,0 +1,749 @@
+/*
+ * Copyright (C) 2019 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#define LOG_TAG "ExecutionBurstUtils"
+
+#include "ExecutionBurstUtils.h"
+
+#include <android-base/logging.h>
+#include <android/hardware/neuralnetworks/1.0/types.h>
+#include <android/hardware/neuralnetworks/1.1/types.h>
+#include <android/hardware/neuralnetworks/1.2/types.h>
+#include <fmq/MessageQueue.h>
+#include <hidl/MQDescriptor.h>
+
+#include <atomic>
+#include <chrono>
+#include <memory>
+#include <thread>
+#include <tuple>
+#include <utility>
+#include <vector>
+
+namespace android::hardware::neuralnetworks::V1_2::utils {
+namespace {
+
+constexpr V1_2::Timing kNoTiming = {std::numeric_limits<uint64_t>::max(),
+ std::numeric_limits<uint64_t>::max()};
+
+}
+
+// serialize a request into a packet
+std::vector<FmqRequestDatum> serialize(const V1_0::Request& request, V1_2::MeasureTiming measure,
+ const std::vector<int32_t>& slots) {
+ // count how many elements need to be sent for a request
+ size_t count = 2 + request.inputs.size() + request.outputs.size() + request.pools.size();
+ for (const auto& input : request.inputs) {
+ count += input.dimensions.size();
+ }
+ for (const auto& output : request.outputs) {
+ count += output.dimensions.size();
+ }
+
+ // create buffer to temporarily store elements
+ std::vector<FmqRequestDatum> data;
+ data.reserve(count);
+
+ // package packetInfo
+ {
+ FmqRequestDatum datum;
+ datum.packetInformation(
+ {/*.packetSize=*/static_cast<uint32_t>(count),
+ /*.numberOfInputOperands=*/static_cast<uint32_t>(request.inputs.size()),
+ /*.numberOfOutputOperands=*/static_cast<uint32_t>(request.outputs.size()),
+ /*.numberOfPools=*/static_cast<uint32_t>(request.pools.size())});
+ data.push_back(datum);
+ }
+
+ // package input data
+ for (const auto& input : request.inputs) {
+ // package operand information
+ FmqRequestDatum datum;
+ datum.inputOperandInformation(
+ {/*.hasNoValue=*/input.hasNoValue,
+ /*.location=*/input.location,
+ /*.numberOfDimensions=*/static_cast<uint32_t>(input.dimensions.size())});
+ data.push_back(datum);
+
+ // package operand dimensions
+ for (uint32_t dimension : input.dimensions) {
+ FmqRequestDatum datum;
+ datum.inputOperandDimensionValue(dimension);
+ data.push_back(datum);
+ }
+ }
+
+ // package output data
+ for (const auto& output : request.outputs) {
+ // package operand information
+ FmqRequestDatum datum;
+ datum.outputOperandInformation(
+ {/*.hasNoValue=*/output.hasNoValue,
+ /*.location=*/output.location,
+ /*.numberOfDimensions=*/static_cast<uint32_t>(output.dimensions.size())});
+ data.push_back(datum);
+
+ // package operand dimensions
+ for (uint32_t dimension : output.dimensions) {
+ FmqRequestDatum datum;
+ datum.outputOperandDimensionValue(dimension);
+ data.push_back(datum);
+ }
+ }
+
+ // package pool identifier
+ for (int32_t slot : slots) {
+ FmqRequestDatum datum;
+ datum.poolIdentifier(slot);
+ data.push_back(datum);
+ }
+
+ // package measureTiming
+ {
+ FmqRequestDatum datum;
+ datum.measureTiming(measure);
+ data.push_back(datum);
+ }
+
+ // return packet
+ return data;
+}
+
+// serialize result
+std::vector<FmqResultDatum> serialize(V1_0::ErrorStatus errorStatus,
+ const std::vector<V1_2::OutputShape>& outputShapes,
+ V1_2::Timing timing) {
+ // count how many elements need to be sent for a request
+ size_t count = 2 + outputShapes.size();
+ for (const auto& outputShape : outputShapes) {
+ count += outputShape.dimensions.size();
+ }
+
+ // create buffer to temporarily store elements
+ std::vector<FmqResultDatum> data;
+ data.reserve(count);
+
+ // package packetInfo
+ {
+ FmqResultDatum datum;
+ datum.packetInformation({/*.packetSize=*/static_cast<uint32_t>(count),
+ /*.errorStatus=*/errorStatus,
+ /*.numberOfOperands=*/static_cast<uint32_t>(outputShapes.size())});
+ data.push_back(datum);
+ }
+
+ // package output shape data
+ for (const auto& operand : outputShapes) {
+ // package operand information
+ FmqResultDatum::OperandInformation info{};
+ info.isSufficient = operand.isSufficient;
+ info.numberOfDimensions = static_cast<uint32_t>(operand.dimensions.size());
+
+ FmqResultDatum datum;
+ datum.operandInformation(info);
+ data.push_back(datum);
+
+ // package operand dimensions
+ for (uint32_t dimension : operand.dimensions) {
+ FmqResultDatum datum;
+ datum.operandDimensionValue(dimension);
+ data.push_back(datum);
+ }
+ }
+
+ // package executionTiming
+ {
+ FmqResultDatum datum;
+ datum.executionTiming(timing);
+ data.push_back(datum);
+ }
+
+ // return result
+ return data;
+}
+
+// deserialize request
+std::optional<std::tuple<V1_0::Request, std::vector<int32_t>, V1_2::MeasureTiming>> deserialize(
+ const std::vector<FmqRequestDatum>& data) {
+ using discriminator = FmqRequestDatum::hidl_discriminator;
+
+ size_t index = 0;
+
+ // validate packet information
+ if (data.size() == 0 || data[index].getDiscriminator() != discriminator::packetInformation) {
+ LOG(ERROR) << "FMQ Request packet ill-formed";
+ return std::nullopt;
+ }
+
+ // unpackage packet information
+ const FmqRequestDatum::PacketInformation& packetInfo = data[index].packetInformation();
+ index++;
+ const uint32_t packetSize = packetInfo.packetSize;
+ const uint32_t numberOfInputOperands = packetInfo.numberOfInputOperands;
+ const uint32_t numberOfOutputOperands = packetInfo.numberOfOutputOperands;
+ const uint32_t numberOfPools = packetInfo.numberOfPools;
+
+ // verify packet size
+ if (data.size() != packetSize) {
+ LOG(ERROR) << "FMQ Request packet ill-formed";
+ return std::nullopt;
+ }
+
+ // unpackage input operands
+ std::vector<V1_0::RequestArgument> inputs;
+ inputs.reserve(numberOfInputOperands);
+ for (size_t operand = 0; operand < numberOfInputOperands; ++operand) {
+ // validate input operand information
+ if (data[index].getDiscriminator() != discriminator::inputOperandInformation) {
+ LOG(ERROR) << "FMQ Request packet ill-formed";
+ return std::nullopt;
+ }
+
+ // unpackage operand information
+ const FmqRequestDatum::OperandInformation& operandInfo =
+ data[index].inputOperandInformation();
+ index++;
+ const bool hasNoValue = operandInfo.hasNoValue;
+ const V1_0::DataLocation location = operandInfo.location;
+ const uint32_t numberOfDimensions = operandInfo.numberOfDimensions;
+
+ // unpackage operand dimensions
+ std::vector<uint32_t> dimensions;
+ dimensions.reserve(numberOfDimensions);
+ for (size_t i = 0; i < numberOfDimensions; ++i) {
+ // validate dimension
+ if (data[index].getDiscriminator() != discriminator::inputOperandDimensionValue) {
+ LOG(ERROR) << "FMQ Request packet ill-formed";
+ return std::nullopt;
+ }
+
+ // unpackage dimension
+ const uint32_t dimension = data[index].inputOperandDimensionValue();
+ index++;
+
+ // store result
+ dimensions.push_back(dimension);
+ }
+
+ // store result
+ inputs.push_back(
+ {/*.hasNoValue=*/hasNoValue, /*.location=*/location, /*.dimensions=*/dimensions});
+ }
+
+ // unpackage output operands
+ std::vector<V1_0::RequestArgument> outputs;
+ outputs.reserve(numberOfOutputOperands);
+ for (size_t operand = 0; operand < numberOfOutputOperands; ++operand) {
+ // validate output operand information
+ if (data[index].getDiscriminator() != discriminator::outputOperandInformation) {
+ LOG(ERROR) << "FMQ Request packet ill-formed";
+ return std::nullopt;
+ }
+
+ // unpackage operand information
+ const FmqRequestDatum::OperandInformation& operandInfo =
+ data[index].outputOperandInformation();
+ index++;
+ const bool hasNoValue = operandInfo.hasNoValue;
+ const V1_0::DataLocation location = operandInfo.location;
+ const uint32_t numberOfDimensions = operandInfo.numberOfDimensions;
+
+ // unpackage operand dimensions
+ std::vector<uint32_t> dimensions;
+ dimensions.reserve(numberOfDimensions);
+ for (size_t i = 0; i < numberOfDimensions; ++i) {
+ // validate dimension
+ if (data[index].getDiscriminator() != discriminator::outputOperandDimensionValue) {
+ LOG(ERROR) << "FMQ Request packet ill-formed";
+ return std::nullopt;
+ }
+
+ // unpackage dimension
+ const uint32_t dimension = data[index].outputOperandDimensionValue();
+ index++;
+
+ // store result
+ dimensions.push_back(dimension);
+ }
+
+ // store result
+ outputs.push_back(
+ {/*.hasNoValue=*/hasNoValue, /*.location=*/location, /*.dimensions=*/dimensions});
+ }
+
+ // unpackage pools
+ std::vector<int32_t> slots;
+ slots.reserve(numberOfPools);
+ for (size_t pool = 0; pool < numberOfPools; ++pool) {
+ // validate input operand information
+ if (data[index].getDiscriminator() != discriminator::poolIdentifier) {
+ LOG(ERROR) << "FMQ Request packet ill-formed";
+ return std::nullopt;
+ }
+
+ // unpackage operand information
+ const int32_t poolId = data[index].poolIdentifier();
+ index++;
+
+ // store result
+ slots.push_back(poolId);
+ }
+
+ // validate measureTiming
+ if (data[index].getDiscriminator() != discriminator::measureTiming) {
+ LOG(ERROR) << "FMQ Request packet ill-formed";
+ return std::nullopt;
+ }
+
+ // unpackage measureTiming
+ const V1_2::MeasureTiming measure = data[index].measureTiming();
+ index++;
+
+ // validate packet information
+ if (index != packetSize) {
+ LOG(ERROR) << "FMQ Result packet ill-formed";
+ return std::nullopt;
+ }
+
+ // return request
+ V1_0::Request request = {/*.inputs=*/inputs, /*.outputs=*/outputs, /*.pools=*/{}};
+ return std::make_tuple(std::move(request), std::move(slots), measure);
+}
+
+// deserialize a packet into the result
+std::optional<std::tuple<V1_0::ErrorStatus, std::vector<V1_2::OutputShape>, V1_2::Timing>>
+deserialize(const std::vector<FmqResultDatum>& data) {
+ using discriminator = FmqResultDatum::hidl_discriminator;
+
+ std::vector<V1_2::OutputShape> outputShapes;
+ size_t index = 0;
+
+ // validate packet information
+ if (data.size() == 0 || data[index].getDiscriminator() != discriminator::packetInformation) {
+ LOG(ERROR) << "FMQ Result packet ill-formed";
+ return std::nullopt;
+ }
+
+ // unpackage packet information
+ const FmqResultDatum::PacketInformation& packetInfo = data[index].packetInformation();
+ index++;
+ const uint32_t packetSize = packetInfo.packetSize;
+ const V1_0::ErrorStatus errorStatus = packetInfo.errorStatus;
+ const uint32_t numberOfOperands = packetInfo.numberOfOperands;
+
+ // verify packet size
+ if (data.size() != packetSize) {
+ LOG(ERROR) << "FMQ Result packet ill-formed";
+ return std::nullopt;
+ }
+
+ // unpackage operands
+ for (size_t operand = 0; operand < numberOfOperands; ++operand) {
+ // validate operand information
+ if (data[index].getDiscriminator() != discriminator::operandInformation) {
+ LOG(ERROR) << "FMQ Result packet ill-formed";
+ return std::nullopt;
+ }
+
+ // unpackage operand information
+ const FmqResultDatum::OperandInformation& operandInfo = data[index].operandInformation();
+ index++;
+ const bool isSufficient = operandInfo.isSufficient;
+ const uint32_t numberOfDimensions = operandInfo.numberOfDimensions;
+
+ // unpackage operand dimensions
+ std::vector<uint32_t> dimensions;
+ dimensions.reserve(numberOfDimensions);
+ for (size_t i = 0; i < numberOfDimensions; ++i) {
+ // validate dimension
+ if (data[index].getDiscriminator() != discriminator::operandDimensionValue) {
+ LOG(ERROR) << "FMQ Result packet ill-formed";
+ return std::nullopt;
+ }
+
+ // unpackage dimension
+ const uint32_t dimension = data[index].operandDimensionValue();
+ index++;
+
+ // store result
+ dimensions.push_back(dimension);
+ }
+
+ // store result
+ outputShapes.push_back({/*.dimensions=*/dimensions, /*.isSufficient=*/isSufficient});
+ }
+
+ // validate execution timing
+ if (data[index].getDiscriminator() != discriminator::executionTiming) {
+ LOG(ERROR) << "FMQ Result packet ill-formed";
+ return std::nullopt;
+ }
+
+ // unpackage execution timing
+ const V1_2::Timing timing = data[index].executionTiming();
+ index++;
+
+ // validate packet information
+ if (index != packetSize) {
+ LOG(ERROR) << "FMQ Result packet ill-formed";
+ return std::nullopt;
+ }
+
+ // return result
+ return std::make_tuple(errorStatus, std::move(outputShapes), timing);
+}
+
+V1_0::ErrorStatus legacyConvertResultCodeToErrorStatus(int resultCode) {
+ return convertToV1_0(convertResultCodeToErrorStatus(resultCode));
+}
+
+// RequestChannelSender methods
+
+std::pair<std::unique_ptr<RequestChannelSender>, const FmqRequestDescriptor*>
+RequestChannelSender::create(size_t channelLength) {
+ std::unique_ptr<FmqRequestChannel> fmqRequestChannel =
+ std::make_unique<FmqRequestChannel>(channelLength, /*confEventFlag=*/true);
+ if (!fmqRequestChannel->isValid()) {
+ LOG(ERROR) << "Unable to create RequestChannelSender";
+ return {nullptr, nullptr};
+ }
+
+ const FmqRequestDescriptor* descriptor = fmqRequestChannel->getDesc();
+ return std::make_pair(std::make_unique<RequestChannelSender>(std::move(fmqRequestChannel)),
+ descriptor);
+}
+
+RequestChannelSender::RequestChannelSender(std::unique_ptr<FmqRequestChannel> fmqRequestChannel)
+ : mFmqRequestChannel(std::move(fmqRequestChannel)) {}
+
+bool RequestChannelSender::send(const V1_0::Request& request, V1_2::MeasureTiming measure,
+ const std::vector<int32_t>& slots) {
+ const std::vector<FmqRequestDatum> serialized = serialize(request, measure, slots);
+ return sendPacket(serialized);
+}
+
+bool RequestChannelSender::sendPacket(const std::vector<FmqRequestDatum>& packet) {
+ if (!mValid) {
+ return false;
+ }
+
+ if (packet.size() > mFmqRequestChannel->availableToWrite()) {
+ LOG(ERROR)
+ << "RequestChannelSender::sendPacket -- packet size exceeds size available in FMQ";
+ return false;
+ }
+
+ // Always send the packet with "blocking" because this signals the futex and
+ // unblocks the consumer if it is waiting on the futex.
+ return mFmqRequestChannel->writeBlocking(packet.data(), packet.size());
+}
+
+void RequestChannelSender::invalidate() {
+ mValid = false;
+}
+
+// RequestChannelReceiver methods
+
+std::unique_ptr<RequestChannelReceiver> RequestChannelReceiver::create(
+ const FmqRequestDescriptor& requestChannel, std::chrono::microseconds pollingTimeWindow) {
+ std::unique_ptr<FmqRequestChannel> fmqRequestChannel =
+ std::make_unique<FmqRequestChannel>(requestChannel);
+
+ if (!fmqRequestChannel->isValid()) {
+ LOG(ERROR) << "Unable to create RequestChannelReceiver";
+ return nullptr;
+ }
+ if (fmqRequestChannel->getEventFlagWord() == nullptr) {
+ LOG(ERROR)
+ << "RequestChannelReceiver::create was passed an MQDescriptor without an EventFlag";
+ return nullptr;
+ }
+
+ return std::make_unique<RequestChannelReceiver>(std::move(fmqRequestChannel),
+ pollingTimeWindow);
+}
+
+RequestChannelReceiver::RequestChannelReceiver(std::unique_ptr<FmqRequestChannel> fmqRequestChannel,
+ std::chrono::microseconds pollingTimeWindow)
+ : mFmqRequestChannel(std::move(fmqRequestChannel)), kPollingTimeWindow(pollingTimeWindow) {}
+
+std::optional<std::tuple<V1_0::Request, std::vector<int32_t>, V1_2::MeasureTiming>>
+RequestChannelReceiver::getBlocking() {
+ const auto packet = getPacketBlocking();
+ if (!packet) {
+ return std::nullopt;
+ }
+
+ return deserialize(*packet);
+}
+
+void RequestChannelReceiver::invalidate() {
+ mTeardown = true;
+
+ // force unblock
+ // ExecutionBurstServer is by default waiting on a request packet. If the
+ // client process destroys its burst object, the server may still be waiting
+ // on the futex. This force unblock wakes up any thread waiting on the
+ // futex.
+ // TODO: look for a different/better way to signal/notify the futex to wake
+ // up any thread waiting on it
+ FmqRequestDatum datum;
+ datum.packetInformation({/*.packetSize=*/0, /*.numberOfInputOperands=*/0,
+ /*.numberOfOutputOperands=*/0, /*.numberOfPools=*/0});
+ mFmqRequestChannel->writeBlocking(&datum, 1);
+}
+
+std::optional<std::vector<FmqRequestDatum>> RequestChannelReceiver::getPacketBlocking() {
+ if (mTeardown) {
+ return std::nullopt;
+ }
+
+ // First spend time polling if results are available in FMQ instead of
+ // waiting on the futex. Polling is more responsive (yielding lower
+ // latencies), but can take up more power, so only poll for a limited period
+ // of time.
+
+ auto& getCurrentTime = std::chrono::high_resolution_clock::now;
+ const auto timeToStopPolling = getCurrentTime() + kPollingTimeWindow;
+
+ while (getCurrentTime() < timeToStopPolling) {
+ // if class is being torn down, immediately return
+ if (mTeardown.load(std::memory_order_relaxed)) {
+ return std::nullopt;
+ }
+
+ // Check if data is available. If it is, immediately retrieve it and
+ // return.
+ const size_t available = mFmqRequestChannel->availableToRead();
+ if (available > 0) {
+ // This is the first point when we know an execution is occurring,
+ // so begin to collect systraces. Note that a similar systrace does
+ // not exist at the corresponding point in
+ // ResultChannelReceiver::getPacketBlocking because the execution is
+ // already in flight.
+ NNTRACE_FULL(NNTRACE_LAYER_IPC, NNTRACE_PHASE_EXECUTION,
+ "ExecutionBurstServer getting packet");
+ std::vector<FmqRequestDatum> packet(available);
+ const bool success = mFmqRequestChannel->read(packet.data(), available);
+ if (!success) {
+ LOG(ERROR) << "Error receiving packet";
+ return std::nullopt;
+ }
+ return std::make_optional(std::move(packet));
+ }
+ }
+
+ // If we get to this point, we either stopped polling because it was taking
+ // too long or polling was not allowed. Instead, perform a blocking call
+ // which uses a futex to save power.
+
+ // wait for request packet and read first element of request packet
+ FmqRequestDatum datum;
+ bool success = mFmqRequestChannel->readBlocking(&datum, 1);
+
+ // This is the first point when we know an execution is occurring, so begin
+ // to collect systraces. Note that a similar systrace does not exist at the
+ // corresponding point in ResultChannelReceiver::getPacketBlocking because
+ // the execution is already in flight.
+ NNTRACE_FULL(NNTRACE_LAYER_IPC, NNTRACE_PHASE_EXECUTION, "ExecutionBurstServer getting packet");
+
+ // retrieve remaining elements
+ // NOTE: all of the data is already available at this point, so there's no
+ // need to do a blocking wait to wait for more data. This is known because
+ // in FMQ, all writes are published (made available) atomically. Currently,
+ // the producer always publishes the entire packet in one function call, so
+ // if the first element of the packet is available, the remaining elements
+ // are also available.
+ const size_t count = mFmqRequestChannel->availableToRead();
+ std::vector<FmqRequestDatum> packet(count + 1);
+ std::memcpy(&packet.front(), &datum, sizeof(datum));
+ success &= mFmqRequestChannel->read(packet.data() + 1, count);
+
+ // terminate loop
+ if (mTeardown) {
+ return std::nullopt;
+ }
+
+ // ensure packet was successfully received
+ if (!success) {
+ LOG(ERROR) << "Error receiving packet";
+ return std::nullopt;
+ }
+
+ return std::make_optional(std::move(packet));
+}
+
+// ResultChannelSender methods
+
+std::unique_ptr<ResultChannelSender> ResultChannelSender::create(
+ const FmqResultDescriptor& resultChannel) {
+ std::unique_ptr<FmqResultChannel> fmqResultChannel =
+ std::make_unique<FmqResultChannel>(resultChannel);
+
+ if (!fmqResultChannel->isValid()) {
+ LOG(ERROR) << "Unable to create RequestChannelSender";
+ return nullptr;
+ }
+ if (fmqResultChannel->getEventFlagWord() == nullptr) {
+ LOG(ERROR) << "ResultChannelSender::create was passed an MQDescriptor without an EventFlag";
+ return nullptr;
+ }
+
+ return std::make_unique<ResultChannelSender>(std::move(fmqResultChannel));
+}
+
+ResultChannelSender::ResultChannelSender(std::unique_ptr<FmqResultChannel> fmqResultChannel)
+ : mFmqResultChannel(std::move(fmqResultChannel)) {}
+
+bool ResultChannelSender::send(V1_0::ErrorStatus errorStatus,
+ const std::vector<V1_2::OutputShape>& outputShapes,
+ V1_2::Timing timing) {
+ const std::vector<FmqResultDatum> serialized = serialize(errorStatus, outputShapes, timing);
+ return sendPacket(serialized);
+}
+
+bool ResultChannelSender::sendPacket(const std::vector<FmqResultDatum>& packet) {
+ if (packet.size() > mFmqResultChannel->availableToWrite()) {
+ LOG(ERROR)
+ << "ResultChannelSender::sendPacket -- packet size exceeds size available in FMQ";
+ const std::vector<FmqResultDatum> errorPacket =
+ serialize(V1_0::ErrorStatus::GENERAL_FAILURE, {}, kNoTiming);
+
+ // Always send the packet with "blocking" because this signals the futex
+ // and unblocks the consumer if it is waiting on the futex.
+ return mFmqResultChannel->writeBlocking(errorPacket.data(), errorPacket.size());
+ }
+
+ // Always send the packet with "blocking" because this signals the futex and
+ // unblocks the consumer if it is waiting on the futex.
+ return mFmqResultChannel->writeBlocking(packet.data(), packet.size());
+}
+
+// ResultChannelReceiver methods
+
+std::pair<std::unique_ptr<ResultChannelReceiver>, const FmqResultDescriptor*>
+ResultChannelReceiver::create(size_t channelLength, std::chrono::microseconds pollingTimeWindow) {
+ std::unique_ptr<FmqResultChannel> fmqResultChannel =
+ std::make_unique<FmqResultChannel>(channelLength, /*confEventFlag=*/true);
+ if (!fmqResultChannel->isValid()) {
+ LOG(ERROR) << "Unable to create ResultChannelReceiver";
+ return {nullptr, nullptr};
+ }
+
+ const FmqResultDescriptor* descriptor = fmqResultChannel->getDesc();
+ return std::make_pair(
+ std::make_unique<ResultChannelReceiver>(std::move(fmqResultChannel), pollingTimeWindow),
+ descriptor);
+}
+
+ResultChannelReceiver::ResultChannelReceiver(std::unique_ptr<FmqResultChannel> fmqResultChannel,
+ std::chrono::microseconds pollingTimeWindow)
+ : mFmqResultChannel(std::move(fmqResultChannel)), kPollingTimeWindow(pollingTimeWindow) {}
+
+std::optional<std::tuple<V1_0::ErrorStatus, std::vector<V1_2::OutputShape>, V1_2::Timing>>
+ResultChannelReceiver::getBlocking() {
+ const auto packet = getPacketBlocking();
+ if (!packet) {
+ return std::nullopt;
+ }
+
+ return deserialize(*packet);
+}
+
+void ResultChannelReceiver::invalidate() {
+ mValid = false;
+
+ // force unblock
+ // ExecutionBurstController waits on a result packet after sending a
+ // request. If the driver containing ExecutionBurstServer crashes, the
+ // controller may be waiting on the futex. This force unblock wakes up any
+ // thread waiting on the futex.
+ // TODO: look for a different/better way to signal/notify the futex to
+ // wake up any thread waiting on it
+ FmqResultDatum datum;
+ datum.packetInformation({/*.packetSize=*/0,
+ /*.errorStatus=*/V1_0::ErrorStatus::GENERAL_FAILURE,
+ /*.numberOfOperands=*/0});
+ mFmqResultChannel->writeBlocking(&datum, 1);
+}
+
+std::optional<std::vector<FmqResultDatum>> ResultChannelReceiver::getPacketBlocking() {
+ if (!mValid) {
+ return std::nullopt;
+ }
+
+ // First spend time polling if results are available in FMQ instead of
+ // waiting on the futex. Polling is more responsive (yielding lower
+ // latencies), but can take up more power, so only poll for a limited period
+ // of time.
+
+ auto& getCurrentTime = std::chrono::high_resolution_clock::now;
+ const auto timeToStopPolling = getCurrentTime() + kPollingTimeWindow;
+
+ while (getCurrentTime() < timeToStopPolling) {
+ // if class is being torn down, immediately return
+ if (!mValid.load(std::memory_order_relaxed)) {
+ return std::nullopt;
+ }
+
+ // Check if data is available. If it is, immediately retrieve it and
+ // return.
+ const size_t available = mFmqResultChannel->availableToRead();
+ if (available > 0) {
+ std::vector<FmqResultDatum> packet(available);
+ const bool success = mFmqResultChannel->read(packet.data(), available);
+ if (!success) {
+ LOG(ERROR) << "Error receiving packet";
+ return std::nullopt;
+ }
+ return std::make_optional(std::move(packet));
+ }
+ }
+
+ // If we get to this point, we either stopped polling because it was taking
+ // too long or polling was not allowed. Instead, perform a blocking call
+ // which uses a futex to save power.
+
+ // wait for result packet and read first element of result packet
+ FmqResultDatum datum;
+ bool success = mFmqResultChannel->readBlocking(&datum, 1);
+
+ // retrieve remaining elements
+ // NOTE: all of the data is already available at this point, so there's no
+ // need to do a blocking wait to wait for more data. This is known because
+ // in FMQ, all writes are published (made available) atomically. Currently,
+ // the producer always publishes the entire packet in one function call, so
+ // if the first element of the packet is available, the remaining elements
+ // are also available.
+ const size_t count = mFmqResultChannel->availableToRead();
+ std::vector<FmqResultDatum> packet(count + 1);
+ std::memcpy(&packet.front(), &datum, sizeof(datum));
+ success &= mFmqResultChannel->read(packet.data() + 1, count);
+
+ if (!mValid) {
+ return std::nullopt;
+ }
+
+ // ensure packet was successfully received
+ if (!success) {
+ LOG(ERROR) << "Error receiving packet";
+ return std::nullopt;
+ }
+
+ return std::make_optional(std::move(packet));
+}
+
+} // namespace android::hardware::neuralnetworks::V1_2::utils
diff --git a/neuralnetworks/1.2/utils/src/PreparedModel.cpp b/neuralnetworks/1.2/utils/src/PreparedModel.cpp
index 6d00082..6841c5e 100644
--- a/neuralnetworks/1.2/utils/src/PreparedModel.cpp
+++ b/neuralnetworks/1.2/utils/src/PreparedModel.cpp
@@ -27,6 +27,7 @@
#include <nnapi/IPreparedModel.h>
#include <nnapi/Result.h>
#include <nnapi/Types.h>
+#include <nnapi/hal/1.0/Burst.h>
#include <nnapi/hal/1.0/Conversions.h>
#include <nnapi/hal/CommonUtils.h>
#include <nnapi/hal/HandleError.h>
@@ -117,6 +118,10 @@
<< "IPreparedModel::executeFenced is not supported on 1.2 HAL service";
}
+nn::GeneralResult<nn::SharedBurst> PreparedModel::configureExecutionBurst() const {
+ return V1_0::utils::Burst::create(shared_from_this());
+}
+
std::any PreparedModel::getUnderlyingResource() const {
sp<V1_2::IPreparedModel> resource = kPreparedModel;
return resource;
diff --git a/neuralnetworks/1.2/utils/test/DeviceTest.cpp b/neuralnetworks/1.2/utils/test/DeviceTest.cpp
new file mode 100644
index 0000000..9c8adde
--- /dev/null
+++ b/neuralnetworks/1.2/utils/test/DeviceTest.cpp
@@ -0,0 +1,875 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "MockDevice.h"
+#include "MockPreparedModel.h"
+
+#include <android/hardware/neuralnetworks/1.2/IDevice.h>
+#include <gmock/gmock.h>
+#include <gtest/gtest.h>
+#include <nnapi/IDevice.h>
+#include <nnapi/TypeUtils.h>
+#include <nnapi/Types.h>
+#include <nnapi/hal/1.2/Device.h>
+
+#include <functional>
+#include <memory>
+#include <string>
+
+namespace android::hardware::neuralnetworks::V1_2::utils {
+namespace {
+
+using ::testing::_;
+using ::testing::Invoke;
+using ::testing::InvokeWithoutArgs;
+
+const nn::Model kSimpleModel = {
+ .main = {.operands = {{.type = nn::OperandType::TENSOR_FLOAT32,
+ .dimensions = {1},
+ .lifetime = nn::Operand::LifeTime::SUBGRAPH_INPUT},
+ {.type = nn::OperandType::TENSOR_FLOAT32,
+ .dimensions = {1},
+ .lifetime = nn::Operand::LifeTime::SUBGRAPH_OUTPUT}},
+ .operations = {{.type = nn::OperationType::RELU, .inputs = {0}, .outputs = {1}}},
+ .inputIndexes = {0},
+ .outputIndexes = {1}}};
+
+const std::string kName = "Google-MockV1";
+const std::string kInvalidName = "";
+const sp<V1_2::IDevice> kInvalidDevice;
+constexpr V1_0::PerformanceInfo kNoPerformanceInfo = {
+ .execTime = std::numeric_limits<float>::max(),
+ .powerUsage = std::numeric_limits<float>::max()};
+
+template <typename... Args>
+auto makeCallbackReturn(Args&&... args) {
+ return [argPack = std::make_tuple(std::forward<Args>(args)...)](const auto& cb) {
+ std::apply(cb, argPack);
+ return Void();
+ };
+}
+
+sp<MockDevice> createMockDevice() {
+ const auto mockDevice = MockDevice::create();
+
+ // Setup default actions for each relevant call.
+ const auto getVersionString_ret = makeCallbackReturn(V1_0::ErrorStatus::NONE, kName);
+ const auto getType_ret = makeCallbackReturn(V1_0::ErrorStatus::NONE, V1_2::DeviceType::OTHER);
+ const auto getSupportedExtensions_ret =
+ makeCallbackReturn(V1_0::ErrorStatus::NONE, hidl_vec<V1_2::Extension>{});
+ const auto getNumberOfCacheFilesNeeded_ret = makeCallbackReturn(
+ V1_0::ErrorStatus::NONE, nn::kMaxNumberOfCacheFiles, nn::kMaxNumberOfCacheFiles);
+ const auto getCapabilities_ret = makeCallbackReturn(
+ V1_0::ErrorStatus::NONE,
+ V1_2::Capabilities{
+ .relaxedFloat32toFloat16PerformanceScalar = kNoPerformanceInfo,
+ .relaxedFloat32toFloat16PerformanceTensor = kNoPerformanceInfo,
+ });
+
+ // Setup default actions for each relevant call.
+ ON_CALL(*mockDevice, getVersionString(_)).WillByDefault(Invoke(getVersionString_ret));
+ ON_CALL(*mockDevice, getType(_)).WillByDefault(Invoke(getType_ret));
+ ON_CALL(*mockDevice, getSupportedExtensions(_))
+ .WillByDefault(Invoke(getSupportedExtensions_ret));
+ ON_CALL(*mockDevice, getNumberOfCacheFilesNeeded(_))
+ .WillByDefault(Invoke(getNumberOfCacheFilesNeeded_ret));
+ ON_CALL(*mockDevice, getCapabilities_1_2(_)).WillByDefault(Invoke(getCapabilities_ret));
+
+ // Ensure that older calls are not used.
+ EXPECT_CALL(*mockDevice, getCapabilities(_)).Times(0);
+ EXPECT_CALL(*mockDevice, getCapabilities_1_1(_)).Times(0);
+ EXPECT_CALL(*mockDevice, getSupportedOperations(_, _)).Times(0);
+ EXPECT_CALL(*mockDevice, getSupportedOperations_1_1(_, _)).Times(0);
+ EXPECT_CALL(*mockDevice, prepareModel(_, _)).Times(0);
+ EXPECT_CALL(*mockDevice, prepareModel_1_1(_, _, _)).Times(0);
+
+ // These EXPECT_CALL(...).Times(testing::AnyNumber()) calls are to suppress warnings on the
+ // uninteresting methods calls.
+ EXPECT_CALL(*mockDevice, getVersionString(_)).Times(testing::AnyNumber());
+ EXPECT_CALL(*mockDevice, getType(_)).Times(testing::AnyNumber());
+ EXPECT_CALL(*mockDevice, getSupportedExtensions(_)).Times(testing::AnyNumber());
+ EXPECT_CALL(*mockDevice, getNumberOfCacheFilesNeeded(_)).Times(testing::AnyNumber());
+ EXPECT_CALL(*mockDevice, getCapabilities_1_2(_)).Times(testing::AnyNumber());
+
+ return mockDevice;
+}
+
+auto makePreparedModelReturn(V1_0::ErrorStatus launchStatus, V1_0::ErrorStatus returnStatus,
+ const sp<MockPreparedModel>& preparedModel) {
+ return [launchStatus, returnStatus, preparedModel](
+ const V1_2::Model& /*model*/, V1_1::ExecutionPreference /*preference*/,
+ const hardware::hidl_vec<hardware::hidl_handle>& /*modelCache*/,
+ const hardware::hidl_vec<hardware::hidl_handle>& /*dataCache*/,
+ const CacheToken& /*token*/, const sp<V1_2::IPreparedModelCallback>& cb)
+ -> hardware::Return<V1_0::ErrorStatus> {
+ cb->notify_1_2(returnStatus, preparedModel).isOk();
+ return launchStatus;
+ };
+}
+auto makePreparedModelFromCacheReturn(V1_0::ErrorStatus launchStatus,
+ V1_0::ErrorStatus returnStatus,
+ const sp<MockPreparedModel>& preparedModel) {
+ return [launchStatus, returnStatus, preparedModel](
+ const hardware::hidl_vec<hardware::hidl_handle>& /*modelCache*/,
+ const hardware::hidl_vec<hardware::hidl_handle>& /*dataCache*/,
+ const CacheToken& /*token*/, const sp<V1_2::IPreparedModelCallback>& cb)
+ -> hardware::Return<V1_0::ErrorStatus> {
+ cb->notify_1_2(returnStatus, preparedModel).isOk();
+ return launchStatus;
+ };
+}
+
+std::function<hardware::Status()> makeTransportFailure(status_t status) {
+ return [status] { return hardware::Status::fromStatusT(status); };
+}
+
+const auto makeGeneralTransportFailure = makeTransportFailure(NO_MEMORY);
+const auto makeDeadObjectFailure = makeTransportFailure(DEAD_OBJECT);
+
+} // namespace
+
+TEST(DeviceTest, invalidName) {
+ // run test
+ const auto device = MockDevice::create();
+ const auto result = Device::create(kInvalidName, device);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::INVALID_ARGUMENT);
+}
+
+TEST(DeviceTest, invalidDevice) {
+ // run test
+ const auto result = Device::create(kName, kInvalidDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::INVALID_ARGUMENT);
+}
+
+TEST(DeviceTest, getVersionStringError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto ret = makeCallbackReturn(V1_0::ErrorStatus::GENERAL_FAILURE, "");
+ EXPECT_CALL(*mockDevice, getVersionString(_)).Times(1).WillOnce(Invoke(ret));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getVersionStringTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, getVersionString(_))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getVersionStringDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, getVersionString(_))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, getTypeError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto ret =
+ makeCallbackReturn(V1_0::ErrorStatus::GENERAL_FAILURE, V1_2::DeviceType::OTHER);
+ EXPECT_CALL(*mockDevice, getType(_)).Times(1).WillOnce(Invoke(ret));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getTypeTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, getType(_))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getTypeDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, getType(_))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, getSupportedExtensionsError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto ret =
+ makeCallbackReturn(V1_0::ErrorStatus::GENERAL_FAILURE, hidl_vec<V1_2::Extension>{});
+ EXPECT_CALL(*mockDevice, getSupportedExtensions(_)).Times(1).WillOnce(Invoke(ret));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getSupportedExtensionsTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, getSupportedExtensions(_))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getSupportedExtensionsDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, getSupportedExtensions(_))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, getNumberOfCacheFilesNeededError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto ret = makeCallbackReturn(V1_0::ErrorStatus::GENERAL_FAILURE,
+ nn::kMaxNumberOfCacheFiles, nn::kMaxNumberOfCacheFiles);
+ EXPECT_CALL(*mockDevice, getNumberOfCacheFilesNeeded(_)).Times(1).WillOnce(Invoke(ret));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, dataCacheFilesExceedsSpecifiedMax) {
+ // setup test
+ const auto mockDevice = createMockDevice();
+ const auto ret = makeCallbackReturn(V1_0::ErrorStatus::NONE, nn::kMaxNumberOfCacheFiles + 1,
+ nn::kMaxNumberOfCacheFiles);
+ EXPECT_CALL(*mockDevice, getNumberOfCacheFilesNeeded(_)).Times(1).WillOnce(Invoke(ret));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, modelCacheFilesExceedsSpecifiedMax) {
+ // setup test
+ const auto mockDevice = createMockDevice();
+ const auto ret = makeCallbackReturn(V1_0::ErrorStatus::NONE, nn::kMaxNumberOfCacheFiles,
+ nn::kMaxNumberOfCacheFiles + 1);
+ EXPECT_CALL(*mockDevice, getNumberOfCacheFilesNeeded(_)).Times(1).WillOnce(Invoke(ret));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getNumberOfCacheFilesNeededTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, getNumberOfCacheFilesNeeded(_))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getNumberOfCacheFilesNeededDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, getNumberOfCacheFilesNeeded(_))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, getCapabilitiesError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto ret = makeCallbackReturn(
+ V1_0::ErrorStatus::GENERAL_FAILURE,
+ V1_2::Capabilities{
+ .relaxedFloat32toFloat16PerformanceScalar = kNoPerformanceInfo,
+ .relaxedFloat32toFloat16PerformanceTensor = kNoPerformanceInfo,
+ });
+ EXPECT_CALL(*mockDevice, getCapabilities_1_2(_)).Times(1).WillOnce(Invoke(ret));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getCapabilitiesTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, getCapabilities_1_2(_))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getCapabilitiesDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, getCapabilities_1_2(_))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, linkToDeathError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto ret = []() -> Return<bool> { return false; };
+ EXPECT_CALL(*mockDevice, linkToDeathRet()).Times(1).WillOnce(InvokeWithoutArgs(ret));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, linkToDeathTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, linkToDeathRet())
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, linkToDeathDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, linkToDeathRet())
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, getName) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+
+ // run test
+ const auto& name = device->getName();
+
+ // verify result
+ EXPECT_EQ(name, kName);
+}
+
+TEST(DeviceTest, getFeatureLevel) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+
+ // run test
+ const auto featureLevel = device->getFeatureLevel();
+
+ // verify result
+ EXPECT_EQ(featureLevel, nn::Version::ANDROID_Q);
+}
+
+TEST(DeviceTest, getCachedData) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, getVersionString(_)).Times(1);
+ EXPECT_CALL(*mockDevice, getType(_)).Times(1);
+ EXPECT_CALL(*mockDevice, getSupportedExtensions(_)).Times(1);
+ EXPECT_CALL(*mockDevice, getNumberOfCacheFilesNeeded(_)).Times(1);
+ EXPECT_CALL(*mockDevice, getCapabilities_1_2(_)).Times(1);
+
+ const auto result = Device::create(kName, mockDevice);
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ const auto& device = result.value();
+
+ // run test and verify results
+ EXPECT_EQ(device->getVersionString(), device->getVersionString());
+ EXPECT_EQ(device->getType(), device->getType());
+ EXPECT_EQ(device->getSupportedExtensions(), device->getSupportedExtensions());
+ EXPECT_EQ(device->getNumberOfCacheFilesNeeded(), device->getNumberOfCacheFilesNeeded());
+ EXPECT_EQ(device->getCapabilities(), device->getCapabilities());
+}
+
+TEST(DeviceTest, wait) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto ret = []() -> Return<void> { return {}; };
+ EXPECT_CALL(*mockDevice, ping()).Times(1).WillOnce(InvokeWithoutArgs(ret));
+ const auto device = Device::create(kName, mockDevice).value();
+
+ // run test
+ const auto result = device->wait();
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(DeviceTest, waitTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, ping())
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+ const auto device = Device::create(kName, mockDevice).value();
+
+ // run test
+ const auto result = device->wait();
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, waitDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, ping()).Times(1).WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+ const auto device = Device::create(kName, mockDevice).value();
+
+ // run test
+ const auto result = device->wait();
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, getSupportedOperations) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ const auto ret = [](const auto& model, const auto& cb) {
+ cb(V1_0::ErrorStatus::NONE, std::vector<bool>(model.operations.size(), true));
+ return hardware::Void();
+ };
+ EXPECT_CALL(*mockDevice, getSupportedOperations_1_2(_, _)).Times(1).WillOnce(Invoke(ret));
+
+ // run test
+ const auto result = device->getSupportedOperations(kSimpleModel);
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ const auto& supportedOperations = result.value();
+ EXPECT_EQ(supportedOperations.size(), kSimpleModel.main.operations.size());
+ EXPECT_THAT(supportedOperations, Each(testing::IsTrue()));
+}
+
+TEST(DeviceTest, getSupportedOperationsError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ const auto ret = [](const auto& /*model*/, const auto& cb) {
+ cb(V1_0::ErrorStatus::GENERAL_FAILURE, {});
+ return hardware::Void();
+ };
+ EXPECT_CALL(*mockDevice, getSupportedOperations_1_2(_, _)).Times(1).WillOnce(Invoke(ret));
+
+ // run test
+ const auto result = device->getSupportedOperations(kSimpleModel);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getSupportedOperationsTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, getSupportedOperations_1_2(_, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = device->getSupportedOperations(kSimpleModel);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getSupportedOperationsDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, getSupportedOperations_1_2(_, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = device->getSupportedOperations(kSimpleModel);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, prepareModel) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ const auto mockPreparedModel = MockPreparedModel::create();
+ EXPECT_CALL(*mockDevice, prepareModel_1_2(_, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makePreparedModelReturn(V1_0::ErrorStatus::NONE,
+ V1_0::ErrorStatus::NONE, mockPreparedModel)));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ EXPECT_NE(result.value(), nullptr);
+}
+
+TEST(DeviceTest, prepareModelLaunchError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModel_1_2(_, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makePreparedModelReturn(V1_0::ErrorStatus::GENERAL_FAILURE,
+ V1_0::ErrorStatus::GENERAL_FAILURE, nullptr)));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, prepareModelReturnError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModel_1_2(_, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makePreparedModelReturn(V1_0::ErrorStatus::NONE,
+ V1_0::ErrorStatus::GENERAL_FAILURE, nullptr)));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, prepareModelNullptrError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModel_1_2(_, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makePreparedModelReturn(V1_0::ErrorStatus::NONE,
+ V1_0::ErrorStatus::NONE, nullptr)));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, prepareModelTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModel_1_2(_, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, prepareModelDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModel_1_2(_, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, prepareModelAsyncCrash) {
+ // setup test
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ const auto ret = [&mockDevice]() -> hardware::Return<V1_0::ErrorStatus> {
+ mockDevice->simulateCrash();
+ return V1_0::ErrorStatus::NONE;
+ };
+ EXPECT_CALL(*mockDevice, prepareModel_1_2(_, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(ret));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, prepareModelFromCache) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ const auto mockPreparedModel = MockPreparedModel::create();
+ EXPECT_CALL(*mockDevice, prepareModelFromCache(_, _, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makePreparedModelFromCacheReturn(
+ V1_0::ErrorStatus::NONE, V1_0::ErrorStatus::NONE, mockPreparedModel)));
+
+ // run test
+ const auto result = device->prepareModelFromCache({}, {}, {}, {});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ EXPECT_NE(result.value(), nullptr);
+}
+
+TEST(DeviceTest, prepareModelFromCacheError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModelFromCache(_, _, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makePreparedModelFromCacheReturn(V1_0::ErrorStatus::GENERAL_FAILURE,
+ V1_0::ErrorStatus::GENERAL_FAILURE,
+ nullptr)));
+
+ // run test
+ const auto result = device->prepareModelFromCache({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, prepareModelFromCacheNullptrError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModelFromCache(_, _, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makePreparedModelFromCacheReturn(V1_0::ErrorStatus::NONE,
+ V1_0::ErrorStatus::NONE, nullptr)));
+
+ // run test
+ const auto result = device->prepareModelFromCache({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, prepareModelFromCacheTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModelFromCache(_, _, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = device->prepareModelFromCache({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, prepareModelFromCacheDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModelFromCache(_, _, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = device->prepareModelFromCache({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, prepareModelFromCacheAsyncCrash) {
+ // setup test
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ const auto ret = [&mockDevice]() -> hardware::Return<V1_0::ErrorStatus> {
+ mockDevice->simulateCrash();
+ return V1_0::ErrorStatus::NONE;
+ };
+ EXPECT_CALL(*mockDevice, prepareModelFromCache(_, _, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(ret));
+
+ // run test
+ const auto result = device->prepareModelFromCache({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, allocateNotSupported) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+
+ // run test
+ const auto result = device->allocate({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+} // namespace android::hardware::neuralnetworks::V1_2::utils
diff --git a/neuralnetworks/1.2/utils/test/MockDevice.h b/neuralnetworks/1.2/utils/test/MockDevice.h
new file mode 100644
index 0000000..b459943
--- /dev/null
+++ b/neuralnetworks/1.2/utils/test/MockDevice.h
@@ -0,0 +1,117 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_2_UTILS_TEST_MOCK_DEVICE
+#define ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_2_UTILS_TEST_MOCK_DEVICE
+
+#include <android/hardware/neuralnetworks/1.2/IDevice.h>
+#include <gmock/gmock.h>
+#include <gtest/gtest.h>
+#include <hidl/Status.h>
+
+namespace android::hardware::neuralnetworks::V1_2::utils {
+
+using CacheToken =
+ hidl_array<uint8_t, static_cast<uint32_t>(V1_2::Constant::BYTE_SIZE_OF_CACHE_TOKEN)>;
+
+class MockDevice final : public IDevice {
+ public:
+ static sp<MockDevice> create();
+
+ // IBase methods below.
+ MOCK_METHOD(Return<void>, ping, (), (override));
+ MOCK_METHOD(Return<bool>, linkToDeathRet, ());
+ Return<bool> linkToDeath(const sp<hidl_death_recipient>& recipient, uint64_t /*cookie*/);
+
+ // V1_0 methods below.
+ MOCK_METHOD(Return<void>, getCapabilities, (getCapabilities_cb cb), (override));
+ MOCK_METHOD(Return<void>, getSupportedOperations,
+ (const V1_0::Model& model, getSupportedOperations_cb cb), (override));
+ MOCK_METHOD(Return<V1_0::ErrorStatus>, prepareModel,
+ (const V1_0::Model& model, const sp<V1_0::IPreparedModelCallback>& callback),
+ (override));
+ MOCK_METHOD(Return<V1_0::DeviceStatus>, getStatus, (), (override));
+
+ // V1_1 methods below.
+ MOCK_METHOD(Return<void>, getCapabilities_1_1, (getCapabilities_1_1_cb cb), (override));
+ MOCK_METHOD(Return<void>, getSupportedOperations_1_1,
+ (const V1_1::Model& model, getSupportedOperations_1_1_cb cb), (override));
+ MOCK_METHOD(Return<V1_0::ErrorStatus>, prepareModel_1_1,
+ (const V1_1::Model& model, V1_1::ExecutionPreference preference,
+ const sp<V1_0::IPreparedModelCallback>& callback),
+ (override));
+
+ // V1_2 methods below.
+ MOCK_METHOD(Return<void>, getVersionString, (getVersionString_cb cb), (override));
+ MOCK_METHOD(Return<void>, getType, (getType_cb cb), (override));
+ MOCK_METHOD(Return<void>, getCapabilities_1_2, (getCapabilities_1_2_cb cb), (override));
+ MOCK_METHOD(Return<void>, getSupportedExtensions, (getSupportedExtensions_cb cb), (override));
+ MOCK_METHOD(Return<void>, getSupportedOperations_1_2,
+ (const V1_2::Model& model, getSupportedOperations_1_2_cb cb), (override));
+ MOCK_METHOD(Return<void>, getNumberOfCacheFilesNeeded, (getNumberOfCacheFilesNeeded_cb cb),
+ (override));
+ MOCK_METHOD(Return<V1_0::ErrorStatus>, prepareModel_1_2,
+ (const V1_2::Model& model, V1_1::ExecutionPreference preference,
+ const hidl_vec<hidl_handle>& modelCache, const hidl_vec<hidl_handle>& dataCache,
+ const CacheToken& token, const sp<V1_2::IPreparedModelCallback>& callback),
+ (override));
+ MOCK_METHOD(Return<V1_0::ErrorStatus>, prepareModelFromCache,
+ (const hidl_vec<hidl_handle>& modelCache, const hidl_vec<hidl_handle>& dataCache,
+ const CacheToken& token, const sp<V1_2::IPreparedModelCallback>& callback),
+ (override));
+
+ // Helper methods.
+ void simulateCrash();
+
+ private:
+ sp<hidl_death_recipient> mDeathRecipient;
+};
+
+inline sp<MockDevice> MockDevice::create() {
+ auto mockDevice = sp<MockDevice>::make();
+
+ // Setup default actions for each relevant call.
+ const auto ret = []() -> Return<bool> { return true; };
+
+ // Setup default actions for each relevant call.
+ ON_CALL(*mockDevice, linkToDeathRet()).WillByDefault(testing::Invoke(ret));
+
+ // These EXPECT_CALL(...).Times(testing::AnyNumber()) calls are to suppress warnings on the
+ // uninteresting methods calls.
+ EXPECT_CALL(*mockDevice, linkToDeathRet()).Times(testing::AnyNumber());
+
+ return mockDevice;
+}
+
+inline Return<bool> MockDevice::linkToDeath(const sp<hidl_death_recipient>& recipient,
+ uint64_t /*cookie*/) {
+ mDeathRecipient = recipient;
+ return linkToDeathRet();
+}
+
+inline void MockDevice::simulateCrash() {
+ ASSERT_NE(nullptr, mDeathRecipient.get());
+
+ // Currently, the utils::Device will not use the `cookie` or `who` arguments, so we pass in 0
+ // and nullptr for these arguments instead. Normally, they are used by the hidl_death_recipient
+ // to determine which object is dead. However, the utils::Device code only pairs a single death
+ // recipient with a single HIDL interface object, so these arguments are redundant.
+ mDeathRecipient->serviceDied(0, nullptr);
+}
+
+} // namespace android::hardware::neuralnetworks::V1_2::utils
+
+#endif // ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_2_UTILS_TEST_MOCK_DEVICE
diff --git a/neuralnetworks/1.2/utils/test/MockPreparedModel.h b/neuralnetworks/1.2/utils/test/MockPreparedModel.h
new file mode 100644
index 0000000..f5fd1f3
--- /dev/null
+++ b/neuralnetworks/1.2/utils/test/MockPreparedModel.h
@@ -0,0 +1,101 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_2_UTILS_TEST_MOCK_PREPARED_MODEL
+#define ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_2_UTILS_TEST_MOCK_PREPARED_MODEL
+
+#include <android/hardware/neuralnetworks/1.2/IPreparedModel.h>
+#include <gmock/gmock.h>
+#include <gtest/gtest.h>
+#include <hidl/HidlSupport.h>
+#include <hidl/Status.h>
+
+namespace android::hardware::neuralnetworks::V1_2::utils {
+
+class MockPreparedModel final : public IPreparedModel {
+ public:
+ static sp<MockPreparedModel> create();
+
+ // IBase methods below.
+ MOCK_METHOD(Return<void>, ping, (), (override));
+ MOCK_METHOD(Return<bool>, linkToDeathRet, ());
+ Return<bool> linkToDeath(const sp<hidl_death_recipient>& recipient,
+ uint64_t /*cookie*/) override;
+
+ // V1_0 methods below.
+ MOCK_METHOD(Return<V1_0::ErrorStatus>, execute,
+ (const V1_0::Request& request, const sp<V1_0::IExecutionCallback>& callback),
+ (override));
+
+ // V1_2 methods below.
+ MOCK_METHOD(Return<V1_0::ErrorStatus>, execute_1_2,
+ (const V1_0::Request& request, V1_2::MeasureTiming measure,
+ const sp<V1_2::IExecutionCallback>& callback),
+ (override));
+ MOCK_METHOD(Return<void>, executeSynchronously,
+ (const V1_0::Request& request, V1_2::MeasureTiming measure,
+ executeSynchronously_cb cb),
+ (override));
+ MOCK_METHOD(Return<void>, configureExecutionBurst,
+ (const sp<V1_2::IBurstCallback>& callback,
+ const MQDescriptorSync<V1_2::FmqRequestDatum>& requestChannel,
+ const MQDescriptorSync<V1_2::FmqResultDatum>& resultChannel,
+ configureExecutionBurst_cb cb),
+ (override));
+
+ // Helper methods.
+ void simulateCrash();
+
+ private:
+ sp<hidl_death_recipient> mDeathRecipient;
+};
+
+inline sp<MockPreparedModel> MockPreparedModel::create() {
+ auto mockPreparedModel = sp<MockPreparedModel>::make();
+
+ // Setup default actions for each relevant call.
+ const auto ret = []() -> Return<bool> { return true; };
+
+ // Setup default actions for each relevant call.
+ ON_CALL(*mockPreparedModel, linkToDeathRet()).WillByDefault(testing::Invoke(ret));
+
+ // These EXPECT_CALL(...).Times(testing::AnyNumber()) calls are to suppress warnings on the
+ // uninteresting methods calls.
+ EXPECT_CALL(*mockPreparedModel, linkToDeathRet()).Times(testing::AnyNumber());
+
+ return mockPreparedModel;
+}
+
+inline Return<bool> MockPreparedModel::linkToDeath(const sp<hidl_death_recipient>& recipient,
+ uint64_t /*cookie*/) {
+ mDeathRecipient = recipient;
+ return linkToDeathRet();
+}
+
+inline void MockPreparedModel::simulateCrash() {
+ ASSERT_NE(nullptr, mDeathRecipient.get());
+
+ // Currently, the utils::PreparedModel will not use the `cookie` or `who` arguments, so we pass
+ // in 0 and nullptr for these arguments instead. Normally, they are used by the
+ // hidl_death_recipient to determine which object is dead. However, the utils::PreparedModel
+ // code only pairs a single death recipient with a single HIDL interface object, so these
+ // arguments are redundant.
+ mDeathRecipient->serviceDied(0, nullptr);
+}
+
+} // namespace android::hardware::neuralnetworks::V1_2::utils
+
+#endif // ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_2_UTILS_TEST_MOCK_PREPARED_MODEL
diff --git a/neuralnetworks/1.2/utils/test/PreparedModelTest.cpp b/neuralnetworks/1.2/utils/test/PreparedModelTest.cpp
new file mode 100644
index 0000000..5062ac9
--- /dev/null
+++ b/neuralnetworks/1.2/utils/test/PreparedModelTest.cpp
@@ -0,0 +1,341 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "MockPreparedModel.h"
+
+#include <android/hardware/neuralnetworks/1.2/IExecutionCallback.h>
+#include <gmock/gmock.h>
+#include <gtest/gtest.h>
+#include <nnapi/IPreparedModel.h>
+#include <nnapi/TypeUtils.h>
+#include <nnapi/Types.h>
+#include <nnapi/hal/1.2/PreparedModel.h>
+
+#include <functional>
+#include <memory>
+
+namespace android::hardware::neuralnetworks::V1_2::utils {
+namespace {
+
+using ::testing::_;
+using ::testing::Invoke;
+using ::testing::InvokeWithoutArgs;
+
+const sp<V1_2::IPreparedModel> kInvalidPreparedModel;
+constexpr auto kNoTiming = V1_2::Timing{.timeOnDevice = std::numeric_limits<uint64_t>::max(),
+ .timeInDriver = std::numeric_limits<uint64_t>::max()};
+
+sp<MockPreparedModel> createMockPreparedModel() {
+ const auto mockPreparedModel = MockPreparedModel::create();
+
+ // Ensure that older calls are not used.
+ EXPECT_CALL(*mockPreparedModel, execute(_, _)).Times(0);
+
+ return mockPreparedModel;
+}
+
+auto makeExecuteSynchronously(V1_0::ErrorStatus status,
+ const std::vector<V1_2::OutputShape>& outputShapes,
+ const V1_2::Timing& timing) {
+ return [status, outputShapes, timing](const V1_0::Request& /*request*/,
+ V1_2::MeasureTiming /*measureTiming*/,
+ const V1_2::IPreparedModel::executeSynchronously_cb& cb) {
+ cb(status, outputShapes, timing);
+ return hardware::Void();
+ };
+}
+auto makeExecuteAsynchronously(V1_0::ErrorStatus launchStatus, V1_0::ErrorStatus returnStatus,
+ const std::vector<V1_2::OutputShape>& outputShapes,
+ const V1_2::Timing& timing) {
+ return [launchStatus, returnStatus, outputShapes, timing](
+ const V1_0::Request& /*request*/, V1_2::MeasureTiming /*measureTiming*/,
+ const sp<V1_2::IExecutionCallback>& cb) -> Return<V1_0::ErrorStatus> {
+ cb->notify_1_2(returnStatus, outputShapes, timing);
+ return launchStatus;
+ };
+}
+
+std::function<hardware::Status()> makeTransportFailure(status_t status) {
+ return [status] { return hardware::Status::fromStatusT(status); };
+}
+
+const auto makeGeneralTransportFailure = makeTransportFailure(NO_MEMORY);
+const auto makeDeadObjectFailure = makeTransportFailure(DEAD_OBJECT);
+
+} // namespace
+
+TEST(PreparedModelTest, invalidPreparedModel) {
+ // run test
+ const auto result = PreparedModel::create(kInvalidPreparedModel, /*executeSynchronously=*/true);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(PreparedModelTest, linkToDeathError) {
+ // setup call
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto ret = []() -> Return<bool> { return false; };
+ EXPECT_CALL(*mockPreparedModel, linkToDeathRet()).Times(1).WillOnce(InvokeWithoutArgs(ret));
+
+ // run test
+ const auto result = PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/true);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(PreparedModelTest, linkToDeathTransportFailure) {
+ // setup call
+ const auto mockPreparedModel = createMockPreparedModel();
+ EXPECT_CALL(*mockPreparedModel, linkToDeathRet())
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/true);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(PreparedModelTest, linkToDeathDeadObject) {
+ // setup call
+ const auto mockPreparedModel = createMockPreparedModel();
+ EXPECT_CALL(*mockPreparedModel, linkToDeathRet())
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/true);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(PreparedModelTest, executeSync) {
+ // setup call
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/true).value();
+ EXPECT_CALL(*mockPreparedModel, executeSynchronously(_, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makeExecuteSynchronously(V1_0::ErrorStatus::NONE, {}, kNoTiming)));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ EXPECT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(PreparedModelTest, executeSyncError) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/true).value();
+ EXPECT_CALL(*mockPreparedModel, executeSynchronously(_, _, _))
+ .Times(1)
+ .WillOnce(Invoke(
+ makeExecuteSynchronously(V1_0::ErrorStatus::GENERAL_FAILURE, {}, kNoTiming)));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(PreparedModelTest, executeSyncTransportFailure) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/true).value();
+ EXPECT_CALL(*mockPreparedModel, executeSynchronously(_, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(PreparedModelTest, executeSyncDeadObject) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/true).value();
+ EXPECT_CALL(*mockPreparedModel, executeSynchronously(_, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(PreparedModelTest, executeAsync) {
+ // setup call
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/false).value();
+ EXPECT_CALL(*mockPreparedModel, execute_1_2(_, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makeExecuteAsynchronously(V1_0::ErrorStatus::NONE,
+ V1_0::ErrorStatus::NONE, {}, kNoTiming)));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ EXPECT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(PreparedModelTest, executeAsyncLaunchError) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/false).value();
+ EXPECT_CALL(*mockPreparedModel, execute_1_2(_, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makeExecuteAsynchronously(V1_0::ErrorStatus::GENERAL_FAILURE,
+ V1_0::ErrorStatus::GENERAL_FAILURE, {},
+ kNoTiming)));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(PreparedModelTest, executeAsyncReturnError) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/false).value();
+ EXPECT_CALL(*mockPreparedModel, execute_1_2(_, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makeExecuteAsynchronously(
+ V1_0::ErrorStatus::NONE, V1_0::ErrorStatus::GENERAL_FAILURE, {}, kNoTiming)));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(PreparedModelTest, executeAsyncTransportFailure) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/false).value();
+ EXPECT_CALL(*mockPreparedModel, execute_1_2(_, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(PreparedModelTest, executeAsyncDeadObject) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/false).value();
+ EXPECT_CALL(*mockPreparedModel, execute_1_2(_, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(PreparedModelTest, executeAsyncCrash) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/false).value();
+ const auto ret = [&mockPreparedModel]() -> hardware::Return<V1_0::ErrorStatus> {
+ mockPreparedModel->simulateCrash();
+ return V1_0::ErrorStatus::NONE;
+ };
+ EXPECT_CALL(*mockPreparedModel, execute_1_2(_, _, _)).Times(1).WillOnce(InvokeWithoutArgs(ret));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(PreparedModelTest, executeFencedNotSupported) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/true).value();
+
+ // run test
+ const auto result = preparedModel->executeFenced({}, {}, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+// TODO: test burst execution if/when it is added to nn::IPreparedModel.
+
+TEST(PreparedModelTest, getUnderlyingResource) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/true).value();
+
+ // run test
+ const auto resource = preparedModel->getUnderlyingResource();
+
+ // verify resource
+ const sp<V1_2::IPreparedModel>* maybeMock = std::any_cast<sp<V1_2::IPreparedModel>>(&resource);
+ ASSERT_NE(maybeMock, nullptr);
+ EXPECT_EQ(maybeMock->get(), mockPreparedModel.get());
+}
+
+} // namespace android::hardware::neuralnetworks::V1_2::utils
diff --git a/neuralnetworks/1.3/utils/Android.bp b/neuralnetworks/1.3/utils/Android.bp
index d5d897d..41d9521 100644
--- a/neuralnetworks/1.3/utils/Android.bp
+++ b/neuralnetworks/1.3/utils/Android.bp
@@ -38,3 +38,35 @@
"neuralnetworks_utils_hal_common",
],
}
+
+cc_test {
+ name: "neuralnetworks_utils_hal_1_3_test",
+ srcs: ["test/*.cpp"],
+ static_libs: [
+ "android.hardware.neuralnetworks@1.0",
+ "android.hardware.neuralnetworks@1.1",
+ "android.hardware.neuralnetworks@1.2",
+ "android.hardware.neuralnetworks@1.3",
+ "libgmock",
+ "libneuralnetworks_common",
+ "neuralnetworks_types",
+ "neuralnetworks_utils_hal_common",
+ "neuralnetworks_utils_hal_1_0",
+ "neuralnetworks_utils_hal_1_1",
+ "neuralnetworks_utils_hal_1_2",
+ "neuralnetworks_utils_hal_1_3",
+ ],
+ shared_libs: [
+ "android.hidl.allocator@1.0",
+ "android.hidl.memory@1.0",
+ "libbase",
+ "libcutils",
+ "libfmq",
+ "libhidlbase",
+ "libhidlmemory",
+ "liblog",
+ "libnativewindow",
+ "libutils",
+ ],
+ test_suites: ["general-tests"],
+}
diff --git a/neuralnetworks/1.3/utils/include/nnapi/hal/1.3/Device.h b/neuralnetworks/1.3/utils/include/nnapi/hal/1.3/Device.h
index 84f606a..f36b6c0 100644
--- a/neuralnetworks/1.3/utils/include/nnapi/hal/1.3/Device.h
+++ b/neuralnetworks/1.3/utils/include/nnapi/hal/1.3/Device.h
@@ -54,6 +54,7 @@
const std::string& getVersionString() const override;
nn::Version getFeatureLevel() const override;
nn::DeviceType getType() const override;
+ bool isUpdatable() const override;
const std::vector<nn::Extension>& getSupportedExtensions() const override;
const nn::Capabilities& getCapabilities() const override;
std::pair<uint32_t, uint32_t> getNumberOfCacheFilesNeeded() const override;
diff --git a/neuralnetworks/1.3/utils/include/nnapi/hal/1.3/PreparedModel.h b/neuralnetworks/1.3/utils/include/nnapi/hal/1.3/PreparedModel.h
index 664d87a..690fecc 100644
--- a/neuralnetworks/1.3/utils/include/nnapi/hal/1.3/PreparedModel.h
+++ b/neuralnetworks/1.3/utils/include/nnapi/hal/1.3/PreparedModel.h
@@ -35,7 +35,8 @@
namespace android::hardware::neuralnetworks::V1_3::utils {
// Class that adapts V1_3::IPreparedModel to nn::IPreparedModel.
-class PreparedModel final : public nn::IPreparedModel {
+class PreparedModel final : public nn::IPreparedModel,
+ public std::enable_shared_from_this<PreparedModel> {
struct PrivateConstructorTag {};
public:
@@ -56,6 +57,8 @@
const nn::OptionalDuration& loopTimeoutDuration,
const nn::OptionalDuration& timeoutDurationAfterFence) const override;
+ nn::GeneralResult<nn::SharedBurst> configureExecutionBurst() const override;
+
std::any getUnderlyingResource() const override;
private:
diff --git a/neuralnetworks/1.3/utils/src/Device.cpp b/neuralnetworks/1.3/utils/src/Device.cpp
index d710b85..87c9f32 100644
--- a/neuralnetworks/1.3/utils/src/Device.cpp
+++ b/neuralnetworks/1.3/utils/src/Device.cpp
@@ -150,6 +150,10 @@
return kDeviceType;
}
+bool Device::isUpdatable() const {
+ return false;
+}
+
const std::vector<nn::Extension>& Device::getSupportedExtensions() const {
return kExtensions;
}
diff --git a/neuralnetworks/1.3/utils/src/PreparedModel.cpp b/neuralnetworks/1.3/utils/src/PreparedModel.cpp
index 7b4b7ba..725e4f5 100644
--- a/neuralnetworks/1.3/utils/src/PreparedModel.cpp
+++ b/neuralnetworks/1.3/utils/src/PreparedModel.cpp
@@ -29,6 +29,7 @@
#include <nnapi/Result.h>
#include <nnapi/TypeUtils.h>
#include <nnapi/Types.h>
+#include <nnapi/hal/1.0/Burst.h>
#include <nnapi/hal/1.2/Conversions.h>
#include <nnapi/hal/CommonUtils.h>
#include <nnapi/hal/HandleError.h>
@@ -197,6 +198,10 @@
return std::make_pair(std::move(syncFence), std::move(callback));
}
+nn::GeneralResult<nn::SharedBurst> PreparedModel::configureExecutionBurst() const {
+ return V1_0::utils::Burst::create(shared_from_this());
+}
+
std::any PreparedModel::getUnderlyingResource() const {
sp<V1_3::IPreparedModel> resource = kPreparedModel;
return resource;
diff --git a/neuralnetworks/1.3/utils/test/BufferTest.cpp b/neuralnetworks/1.3/utils/test/BufferTest.cpp
new file mode 100644
index 0000000..d892b87
--- /dev/null
+++ b/neuralnetworks/1.3/utils/test/BufferTest.cpp
@@ -0,0 +1,208 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "MockBuffer.h"
+
+#include <android/hardware/neuralnetworks/1.3/IBuffer.h>
+#include <gmock/gmock.h>
+#include <gtest/gtest.h>
+#include <nnapi/IBuffer.h>
+#include <nnapi/SharedMemory.h>
+#include <nnapi/TypeUtils.h>
+#include <nnapi/Types.h>
+#include <nnapi/hal/1.3/Buffer.h>
+
+#include <functional>
+#include <memory>
+
+namespace android::hardware::neuralnetworks::V1_3::utils {
+namespace {
+
+using ::testing::_;
+using ::testing::Invoke;
+using ::testing::InvokeWithoutArgs;
+using ::testing::Return;
+
+const auto kMemory = nn::createSharedMemory(4).value();
+const sp<V1_3::IBuffer> kInvalidBuffer;
+constexpr auto kInvalidToken = nn::Request::MemoryDomainToken{0};
+constexpr auto kToken = nn::Request::MemoryDomainToken{1};
+
+std::function<hardware::Return<V1_3::ErrorStatus>()> makeFunctionReturn(V1_3::ErrorStatus status) {
+ return [status]() -> hardware::Return<V1_3::ErrorStatus> { return status; };
+}
+
+std::function<hardware::Status()> makeTransportFailure(status_t status) {
+ return [status] { return hardware::Status::fromStatusT(status); };
+}
+
+const auto makeSuccessful = makeFunctionReturn(V1_3::ErrorStatus::NONE);
+const auto makeGeneralError = makeFunctionReturn(V1_3::ErrorStatus::GENERAL_FAILURE);
+const auto makeGeneralTransportFailure = makeTransportFailure(NO_MEMORY);
+const auto makeDeadObjectFailure = makeTransportFailure(DEAD_OBJECT);
+
+} // namespace
+
+TEST(BufferTest, invalidBuffer) {
+ // run test
+ const auto result = Buffer::create(kInvalidBuffer, kToken);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(BufferTest, invalidToken) {
+ // setup call
+ const auto mockBuffer = MockBuffer::create();
+
+ // run test
+ const auto result = Buffer::create(mockBuffer, kInvalidToken);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(BufferTest, create) {
+ // setup call
+ const auto mockBuffer = MockBuffer::create();
+ const auto buffer = Buffer::create(mockBuffer, kToken).value();
+
+ // run test
+ const auto token = buffer->getToken();
+
+ // verify result
+ EXPECT_EQ(token, kToken);
+}
+
+TEST(BufferTest, copyTo) {
+ // setup call
+ const auto mockBuffer = MockBuffer::create();
+ const auto buffer = Buffer::create(mockBuffer, kToken).value();
+ EXPECT_CALL(*mockBuffer, copyTo(_)).Times(1).WillOnce(InvokeWithoutArgs(makeSuccessful));
+
+ // run test
+ const auto result = buffer->copyTo(kMemory);
+
+ // verify result
+ EXPECT_TRUE(result.has_value()) << result.error().message;
+}
+
+TEST(BufferTest, copyToError) {
+ // setup test
+ const auto mockBuffer = MockBuffer::create();
+ const auto buffer = Buffer::create(mockBuffer, kToken).value();
+ EXPECT_CALL(*mockBuffer, copyTo(_)).Times(1).WillOnce(InvokeWithoutArgs(makeGeneralError));
+
+ // run test
+ const auto result = buffer->copyTo(kMemory);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(BufferTest, copyToTransportFailure) {
+ // setup test
+ const auto mockBuffer = MockBuffer::create();
+ const auto buffer = Buffer::create(mockBuffer, kToken).value();
+ EXPECT_CALL(*mockBuffer, copyTo(_))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = buffer->copyTo(kMemory);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(BufferTest, copyToDeadObject) {
+ // setup test
+ const auto mockBuffer = MockBuffer::create();
+ const auto buffer = Buffer::create(mockBuffer, kToken).value();
+ EXPECT_CALL(*mockBuffer, copyTo(_)).Times(1).WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = buffer->copyTo(kMemory);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(BufferTest, copyFrom) {
+ // setup call
+ const auto mockBuffer = MockBuffer::create();
+ const auto buffer = Buffer::create(mockBuffer, kToken).value();
+ EXPECT_CALL(*mockBuffer, copyFrom(_, _)).Times(1).WillOnce(InvokeWithoutArgs(makeSuccessful));
+
+ // run test
+ const auto result = buffer->copyFrom(kMemory, {});
+
+ // verify result
+ EXPECT_TRUE(result.has_value());
+}
+
+TEST(BufferTest, copyFromError) {
+ // setup test
+ const auto mockBuffer = MockBuffer::create();
+ const auto buffer = Buffer::create(mockBuffer, kToken).value();
+ EXPECT_CALL(*mockBuffer, copyFrom(_, _)).Times(1).WillOnce(InvokeWithoutArgs(makeGeneralError));
+
+ // run test
+ const auto result = buffer->copyFrom(kMemory, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(BufferTest, copyFromTransportFailure) {
+ // setup test
+ const auto mockBuffer = MockBuffer::create();
+ const auto buffer = Buffer::create(mockBuffer, kToken).value();
+ EXPECT_CALL(*mockBuffer, copyFrom(_, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = buffer->copyFrom(kMemory, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(BufferTest, copyFromDeadObject) {
+ // setup test
+ const auto mockBuffer = MockBuffer::create();
+ const auto buffer = Buffer::create(mockBuffer, kToken).value();
+ EXPECT_CALL(*mockBuffer, copyFrom(_, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = buffer->copyFrom(kMemory, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+} // namespace android::hardware::neuralnetworks::V1_3::utils
diff --git a/neuralnetworks/1.3/utils/test/DeviceTest.cpp b/neuralnetworks/1.3/utils/test/DeviceTest.cpp
new file mode 100644
index 0000000..f260990
--- /dev/null
+++ b/neuralnetworks/1.3/utils/test/DeviceTest.cpp
@@ -0,0 +1,951 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "MockBuffer.h"
+#include "MockDevice.h"
+#include "MockPreparedModel.h"
+
+#include <android/hardware/neuralnetworks/1.3/IDevice.h>
+#include <gmock/gmock.h>
+#include <gtest/gtest.h>
+#include <nnapi/IDevice.h>
+#include <nnapi/TypeUtils.h>
+#include <nnapi/Types.h>
+#include <nnapi/hal/1.3/Device.h>
+
+#include <functional>
+#include <memory>
+#include <string>
+
+namespace android::hardware::neuralnetworks::V1_3::utils {
+namespace {
+
+using ::testing::_;
+using ::testing::Invoke;
+using ::testing::InvokeWithoutArgs;
+
+const nn::Model kSimpleModel = {
+ .main = {.operands = {{.type = nn::OperandType::TENSOR_FLOAT32,
+ .dimensions = {1},
+ .lifetime = nn::Operand::LifeTime::SUBGRAPH_INPUT},
+ {.type = nn::OperandType::TENSOR_FLOAT32,
+ .dimensions = {1},
+ .lifetime = nn::Operand::LifeTime::SUBGRAPH_OUTPUT}},
+ .operations = {{.type = nn::OperationType::RELU, .inputs = {0}, .outputs = {1}}},
+ .inputIndexes = {0},
+ .outputIndexes = {1}}};
+
+const std::string kName = "Google-MockV1";
+const std::string kInvalidName = "";
+const sp<V1_3::IDevice> kInvalidDevice;
+constexpr V1_0::PerformanceInfo kNoPerformanceInfo = {
+ .execTime = std::numeric_limits<float>::max(),
+ .powerUsage = std::numeric_limits<float>::max()};
+
+template <typename... Args>
+auto makeCallbackReturn(Args&&... args) {
+ return [argPack = std::make_tuple(std::forward<Args>(args)...)](const auto& cb) {
+ std::apply(cb, argPack);
+ return Void();
+ };
+}
+
+sp<MockDevice> createMockDevice() {
+ const auto mockDevice = MockDevice::create();
+
+ // Setup default actions for each relevant call.
+ const auto getVersionString_ret = makeCallbackReturn(V1_0::ErrorStatus::NONE, kName);
+ const auto getType_ret = makeCallbackReturn(V1_0::ErrorStatus::NONE, V1_2::DeviceType::OTHER);
+ const auto getSupportedExtensions_ret =
+ makeCallbackReturn(V1_0::ErrorStatus::NONE, hidl_vec<V1_2::Extension>{});
+ const auto getNumberOfCacheFilesNeeded_ret = makeCallbackReturn(
+ V1_0::ErrorStatus::NONE, nn::kMaxNumberOfCacheFiles, nn::kMaxNumberOfCacheFiles);
+ const auto getCapabilities_ret = makeCallbackReturn(
+ V1_3::ErrorStatus::NONE,
+ V1_3::Capabilities{
+ .relaxedFloat32toFloat16PerformanceScalar = kNoPerformanceInfo,
+ .relaxedFloat32toFloat16PerformanceTensor = kNoPerformanceInfo,
+ .ifPerformance = kNoPerformanceInfo,
+ .whilePerformance = kNoPerformanceInfo,
+ });
+
+ // Setup default actions for each relevant call.
+ ON_CALL(*mockDevice, getVersionString(_)).WillByDefault(Invoke(getVersionString_ret));
+ ON_CALL(*mockDevice, getType(_)).WillByDefault(Invoke(getType_ret));
+ ON_CALL(*mockDevice, getSupportedExtensions(_))
+ .WillByDefault(Invoke(getSupportedExtensions_ret));
+ ON_CALL(*mockDevice, getNumberOfCacheFilesNeeded(_))
+ .WillByDefault(Invoke(getNumberOfCacheFilesNeeded_ret));
+ ON_CALL(*mockDevice, getCapabilities_1_3(_)).WillByDefault(Invoke(getCapabilities_ret));
+
+ // Ensure that older calls are not used.
+ EXPECT_CALL(*mockDevice, getCapabilities(_)).Times(0);
+ EXPECT_CALL(*mockDevice, getCapabilities_1_1(_)).Times(0);
+ EXPECT_CALL(*mockDevice, getCapabilities_1_2(_)).Times(0);
+ EXPECT_CALL(*mockDevice, getSupportedOperations(_, _)).Times(0);
+ EXPECT_CALL(*mockDevice, getSupportedOperations_1_1(_, _)).Times(0);
+ EXPECT_CALL(*mockDevice, prepareModel(_, _)).Times(0);
+ EXPECT_CALL(*mockDevice, prepareModel_1_1(_, _, _)).Times(0);
+ EXPECT_CALL(*mockDevice, getSupportedOperations_1_2(_, _)).Times(0);
+ EXPECT_CALL(*mockDevice, prepareModel_1_2(_, _, _, _, _, _)).Times(0);
+ EXPECT_CALL(*mockDevice, prepareModelFromCache(_, _, _, _)).Times(0);
+
+ // These EXPECT_CALL(...).Times(testing::AnyNumber()) calls are to suppress warnings on the
+ // uninteresting methods calls.
+ EXPECT_CALL(*mockDevice, getVersionString(_)).Times(testing::AnyNumber());
+ EXPECT_CALL(*mockDevice, getType(_)).Times(testing::AnyNumber());
+ EXPECT_CALL(*mockDevice, getSupportedExtensions(_)).Times(testing::AnyNumber());
+ EXPECT_CALL(*mockDevice, getNumberOfCacheFilesNeeded(_)).Times(testing::AnyNumber());
+ EXPECT_CALL(*mockDevice, getCapabilities_1_3(_)).Times(testing::AnyNumber());
+
+ return mockDevice;
+}
+
+auto makePreparedModelReturn(V1_3::ErrorStatus launchStatus, V1_3::ErrorStatus returnStatus,
+ const sp<MockPreparedModel>& preparedModel) {
+ return [launchStatus, returnStatus, preparedModel](
+ const V1_3::Model& /*model*/, V1_1::ExecutionPreference /*preference*/,
+ V1_3::Priority /*priority*/, const V1_3::OptionalTimePoint& /*deadline*/,
+ const hardware::hidl_vec<hardware::hidl_handle>& /*modelCache*/,
+ const hardware::hidl_vec<hardware::hidl_handle>& /*dataCache*/,
+ const CacheToken& /*token*/, const sp<V1_3::IPreparedModelCallback>& cb)
+ -> hardware::Return<V1_3::ErrorStatus> {
+ cb->notify_1_3(returnStatus, preparedModel).isOk();
+ return launchStatus;
+ };
+}
+auto makePreparedModelFromCacheReturn(V1_3::ErrorStatus launchStatus,
+ V1_3::ErrorStatus returnStatus,
+ const sp<MockPreparedModel>& preparedModel) {
+ return [launchStatus, returnStatus, preparedModel](
+ const V1_3::OptionalTimePoint& /*deadline*/,
+ const hardware::hidl_vec<hardware::hidl_handle>& /*modelCache*/,
+ const hardware::hidl_vec<hardware::hidl_handle>& /*dataCache*/,
+ const CacheToken& /*token*/, const sp<V1_3::IPreparedModelCallback>& cb)
+ -> hardware::Return<V1_3::ErrorStatus> {
+ cb->notify_1_3(returnStatus, preparedModel).isOk();
+ return launchStatus;
+ };
+}
+auto makeAllocateReturn(ErrorStatus status, const sp<MockBuffer>& buffer, uint32_t token) {
+ return [status, buffer, token](
+ const V1_3::BufferDesc& /*desc*/,
+ const hardware::hidl_vec<sp<V1_3::IPreparedModel>>& /*preparedModels*/,
+ const hardware::hidl_vec<V1_3::BufferRole>& /*inputRoles*/,
+ const hardware::hidl_vec<V1_3::BufferRole>& /*outputRoles*/,
+ const V1_3::IDevice::allocate_cb& cb) -> hardware::Return<void> {
+ cb(status, buffer, token);
+ return hardware::Void();
+ };
+}
+
+std::function<hardware::Status()> makeTransportFailure(status_t status) {
+ return [status] { return hardware::Status::fromStatusT(status); };
+}
+
+const auto makeGeneralTransportFailure = makeTransportFailure(NO_MEMORY);
+const auto makeDeadObjectFailure = makeTransportFailure(DEAD_OBJECT);
+
+} // namespace
+
+TEST(DeviceTest, invalidName) {
+ // run test
+ const auto device = MockDevice::create();
+ const auto result = Device::create(kInvalidName, device);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::INVALID_ARGUMENT);
+}
+
+TEST(DeviceTest, invalidDevice) {
+ // run test
+ const auto result = Device::create(kName, kInvalidDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::INVALID_ARGUMENT);
+}
+
+TEST(DeviceTest, getVersionStringError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto ret = makeCallbackReturn(V1_0::ErrorStatus::GENERAL_FAILURE, "");
+ EXPECT_CALL(*mockDevice, getVersionString(_)).Times(1).WillOnce(Invoke(ret));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getVersionStringTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, getVersionString(_))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getVersionStringDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, getVersionString(_))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, getTypeError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto ret =
+ makeCallbackReturn(V1_0::ErrorStatus::GENERAL_FAILURE, V1_2::DeviceType::OTHER);
+ EXPECT_CALL(*mockDevice, getType(_)).Times(1).WillOnce(Invoke(ret));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getTypeTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, getType(_))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getTypeDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, getType(_))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, getSupportedExtensionsError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto ret =
+ makeCallbackReturn(V1_0::ErrorStatus::GENERAL_FAILURE, hidl_vec<V1_2::Extension>{});
+ EXPECT_CALL(*mockDevice, getSupportedExtensions(_)).Times(1).WillOnce(Invoke(ret));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getSupportedExtensionsTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, getSupportedExtensions(_))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getSupportedExtensionsDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, getSupportedExtensions(_))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, getNumberOfCacheFilesNeededError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto ret = makeCallbackReturn(V1_0::ErrorStatus::GENERAL_FAILURE,
+ nn::kMaxNumberOfCacheFiles, nn::kMaxNumberOfCacheFiles);
+ EXPECT_CALL(*mockDevice, getNumberOfCacheFilesNeeded(_)).Times(1).WillOnce(Invoke(ret));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, dataCacheFilesExceedsSpecifiedMax) {
+ // setup test
+ const auto mockDevice = createMockDevice();
+ const auto ret = makeCallbackReturn(V1_0::ErrorStatus::NONE, nn::kMaxNumberOfCacheFiles + 1,
+ nn::kMaxNumberOfCacheFiles);
+ EXPECT_CALL(*mockDevice, getNumberOfCacheFilesNeeded(_)).Times(1).WillOnce(Invoke(ret));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, modelCacheFilesExceedsSpecifiedMax) {
+ // setup test
+ const auto mockDevice = createMockDevice();
+ const auto ret = makeCallbackReturn(V1_0::ErrorStatus::NONE, nn::kMaxNumberOfCacheFiles,
+ nn::kMaxNumberOfCacheFiles + 1);
+ EXPECT_CALL(*mockDevice, getNumberOfCacheFilesNeeded(_)).Times(1).WillOnce(Invoke(ret));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getNumberOfCacheFilesNeededTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, getNumberOfCacheFilesNeeded(_))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getNumberOfCacheFilesNeededDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, getNumberOfCacheFilesNeeded(_))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, getCapabilitiesError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto ret = makeCallbackReturn(
+ V1_3::ErrorStatus::GENERAL_FAILURE,
+ V1_3::Capabilities{
+ .relaxedFloat32toFloat16PerformanceScalar = kNoPerformanceInfo,
+ .relaxedFloat32toFloat16PerformanceTensor = kNoPerformanceInfo,
+ .ifPerformance = kNoPerformanceInfo,
+ .whilePerformance = kNoPerformanceInfo,
+ });
+ EXPECT_CALL(*mockDevice, getCapabilities_1_3(_)).Times(1).WillOnce(Invoke(ret));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getCapabilitiesTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, getCapabilities_1_3(_))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getCapabilitiesDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, getCapabilities_1_3(_))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, linkToDeathError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto ret = []() -> Return<bool> { return false; };
+ EXPECT_CALL(*mockDevice, linkToDeathRet()).Times(1).WillOnce(InvokeWithoutArgs(ret));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, linkToDeathTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, linkToDeathRet())
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, linkToDeathDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, linkToDeathRet())
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = Device::create(kName, mockDevice);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, getName) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+
+ // run test
+ const auto& name = device->getName();
+
+ // verify result
+ EXPECT_EQ(name, kName);
+}
+
+TEST(DeviceTest, getFeatureLevel) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+
+ // run test
+ const auto featureLevel = device->getFeatureLevel();
+
+ // verify result
+ EXPECT_EQ(featureLevel, nn::Version::ANDROID_R);
+}
+
+TEST(DeviceTest, getCachedData) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, getVersionString(_)).Times(1);
+ EXPECT_CALL(*mockDevice, getType(_)).Times(1);
+ EXPECT_CALL(*mockDevice, getSupportedExtensions(_)).Times(1);
+ EXPECT_CALL(*mockDevice, getNumberOfCacheFilesNeeded(_)).Times(1);
+ EXPECT_CALL(*mockDevice, getCapabilities_1_3(_)).Times(1);
+
+ const auto result = Device::create(kName, mockDevice);
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ const auto& device = result.value();
+
+ // run test and verify results
+ EXPECT_EQ(device->getVersionString(), device->getVersionString());
+ EXPECT_EQ(device->getType(), device->getType());
+ EXPECT_EQ(device->getSupportedExtensions(), device->getSupportedExtensions());
+ EXPECT_EQ(device->getNumberOfCacheFilesNeeded(), device->getNumberOfCacheFilesNeeded());
+ EXPECT_EQ(device->getCapabilities(), device->getCapabilities());
+}
+
+TEST(DeviceTest, wait) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto ret = []() -> Return<void> { return {}; };
+ EXPECT_CALL(*mockDevice, ping()).Times(1).WillOnce(InvokeWithoutArgs(ret));
+ const auto device = Device::create(kName, mockDevice).value();
+
+ // run test
+ const auto result = device->wait();
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(DeviceTest, waitTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, ping())
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+ const auto device = Device::create(kName, mockDevice).value();
+
+ // run test
+ const auto result = device->wait();
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, waitDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ EXPECT_CALL(*mockDevice, ping()).Times(1).WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+ const auto device = Device::create(kName, mockDevice).value();
+
+ // run test
+ const auto result = device->wait();
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, getSupportedOperations) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ const auto ret = [](const auto& model, const auto& cb) {
+ cb(V1_3::ErrorStatus::NONE, std::vector<bool>(model.main.operations.size(), true));
+ return hardware::Void();
+ };
+ EXPECT_CALL(*mockDevice, getSupportedOperations_1_3(_, _)).Times(1).WillOnce(Invoke(ret));
+
+ // run test
+ const auto result = device->getSupportedOperations(kSimpleModel);
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ const auto& supportedOperations = result.value();
+ EXPECT_EQ(supportedOperations.size(), kSimpleModel.main.operations.size());
+ EXPECT_THAT(supportedOperations, Each(testing::IsTrue()));
+}
+
+TEST(DeviceTest, getSupportedOperationsError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ const auto ret = [](const auto& /*model*/, const auto& cb) {
+ cb(V1_3::ErrorStatus::GENERAL_FAILURE, {});
+ return hardware::Void();
+ };
+ EXPECT_CALL(*mockDevice, getSupportedOperations_1_3(_, _)).Times(1).WillOnce(Invoke(ret));
+
+ // run test
+ const auto result = device->getSupportedOperations(kSimpleModel);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getSupportedOperationsTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, getSupportedOperations_1_3(_, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = device->getSupportedOperations(kSimpleModel);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, getSupportedOperationsDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, getSupportedOperations_1_3(_, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = device->getSupportedOperations(kSimpleModel);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, prepareModel) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ const auto mockPreparedModel = MockPreparedModel::create();
+ EXPECT_CALL(*mockDevice, prepareModel_1_3(_, _, _, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makePreparedModelReturn(V1_3::ErrorStatus::NONE,
+ V1_3::ErrorStatus::NONE, mockPreparedModel)));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ EXPECT_NE(result.value(), nullptr);
+}
+
+TEST(DeviceTest, prepareModelLaunchError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModel_1_3(_, _, _, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makePreparedModelReturn(V1_3::ErrorStatus::GENERAL_FAILURE,
+ V1_3::ErrorStatus::GENERAL_FAILURE, nullptr)));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, prepareModelReturnError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModel_1_3(_, _, _, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makePreparedModelReturn(V1_3::ErrorStatus::NONE,
+ V1_3::ErrorStatus::GENERAL_FAILURE, nullptr)));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, prepareModelNullptrError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModel_1_3(_, _, _, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makePreparedModelReturn(V1_3::ErrorStatus::NONE,
+ V1_3::ErrorStatus::NONE, nullptr)));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, prepareModelTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModel_1_3(_, _, _, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, prepareModelDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModel_1_3(_, _, _, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, prepareModelAsyncCrash) {
+ // setup test
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ const auto ret = [&mockDevice]() -> hardware::Return<V1_3::ErrorStatus> {
+ mockDevice->simulateCrash();
+ return V1_3::ErrorStatus::NONE;
+ };
+ EXPECT_CALL(*mockDevice, prepareModel_1_3(_, _, _, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(ret));
+
+ // run test
+ const auto result = device->prepareModel(kSimpleModel, nn::ExecutionPreference::DEFAULT,
+ nn::Priority::DEFAULT, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, prepareModelFromCache) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ const auto mockPreparedModel = MockPreparedModel::create();
+ EXPECT_CALL(*mockDevice, prepareModelFromCache_1_3(_, _, _, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makePreparedModelFromCacheReturn(
+ V1_3::ErrorStatus::NONE, V1_3::ErrorStatus::NONE, mockPreparedModel)));
+
+ // run test
+ const auto result = device->prepareModelFromCache({}, {}, {}, {});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ EXPECT_NE(result.value(), nullptr);
+}
+
+TEST(DeviceTest, prepareModelFromCacheError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModelFromCache_1_3(_, _, _, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makePreparedModelFromCacheReturn(V1_3::ErrorStatus::GENERAL_FAILURE,
+ V1_3::ErrorStatus::GENERAL_FAILURE,
+ nullptr)));
+
+ // run test
+ const auto result = device->prepareModelFromCache({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, prepareModelFromCacheNullptrError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModelFromCache_1_3(_, _, _, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makePreparedModelFromCacheReturn(V1_3::ErrorStatus::NONE,
+ V1_3::ErrorStatus::NONE, nullptr)));
+
+ // run test
+ const auto result = device->prepareModelFromCache({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, prepareModelFromCacheTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModelFromCache_1_3(_, _, _, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = device->prepareModelFromCache({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, prepareModelFromCacheDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, prepareModelFromCache_1_3(_, _, _, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = device->prepareModelFromCache({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, prepareModelFromCacheAsyncCrash) {
+ // setup test
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ const auto ret = [&mockDevice]() -> hardware::Return<V1_3::ErrorStatus> {
+ mockDevice->simulateCrash();
+ return V1_3::ErrorStatus::NONE;
+ };
+ EXPECT_CALL(*mockDevice, prepareModelFromCache_1_3(_, _, _, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(ret));
+
+ // run test
+ const auto result = device->prepareModelFromCache({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(DeviceTest, allocate) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ const auto mockBuffer = MockBuffer::create();
+ constexpr uint32_t token = 1;
+ EXPECT_CALL(*mockDevice, allocate(_, _, _, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makeAllocateReturn(ErrorStatus::NONE, mockBuffer, token)));
+
+ // run test
+ const auto result = device->allocate({}, {}, {}, {});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ EXPECT_NE(result.value(), nullptr);
+}
+
+TEST(DeviceTest, allocateError) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, allocate(_, _, _, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makeAllocateReturn(ErrorStatus::GENERAL_FAILURE, nullptr, 0)));
+
+ // run test
+ const auto result = device->allocate({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, allocateTransportFailure) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, allocate(_, _, _, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = device->allocate({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(DeviceTest, allocateDeadObject) {
+ // setup call
+ const auto mockDevice = createMockDevice();
+ const auto device = Device::create(kName, mockDevice).value();
+ EXPECT_CALL(*mockDevice, allocate(_, _, _, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = device->allocate({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+} // namespace android::hardware::neuralnetworks::V1_3::utils
diff --git a/neuralnetworks/1.3/utils/test/MockBuffer.h b/neuralnetworks/1.3/utils/test/MockBuffer.h
new file mode 100644
index 0000000..fb31b51
--- /dev/null
+++ b/neuralnetworks/1.3/utils/test/MockBuffer.h
@@ -0,0 +1,43 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_3_UTILS_TEST_MOCK_BUFFER
+#define ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_3_UTILS_TEST_MOCK_BUFFER
+
+#include <android/hardware/neuralnetworks/1.3/IBuffer.h>
+#include <gmock/gmock.h>
+#include <gtest/gtest.h>
+#include <hidl/Status.h>
+
+namespace android::hardware::neuralnetworks::V1_3::utils {
+
+class MockBuffer final : public IBuffer {
+ public:
+ static sp<MockBuffer> create();
+
+ // V1_3 methods below.
+ MOCK_METHOD(Return<V1_3::ErrorStatus>, copyTo, (const hidl_memory& dst), (override));
+ MOCK_METHOD(Return<V1_3::ErrorStatus>, copyFrom,
+ (const hidl_memory& src, const hidl_vec<uint32_t>& dimensions), (override));
+};
+
+inline sp<MockBuffer> MockBuffer::create() {
+ return sp<MockBuffer>::make();
+}
+
+} // namespace android::hardware::neuralnetworks::V1_3::utils
+
+#endif // ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_3_UTILS_TEST_MOCK_BUFFER
diff --git a/neuralnetworks/1.3/utils/test/MockDevice.h b/neuralnetworks/1.3/utils/test/MockDevice.h
new file mode 100644
index 0000000..85d3750
--- /dev/null
+++ b/neuralnetworks/1.3/utils/test/MockDevice.h
@@ -0,0 +1,139 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_3_UTILS_TEST_MOCK_DEVICE
+#define ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_3_UTILS_TEST_MOCK_DEVICE
+
+#include <android/hardware/neuralnetworks/1.3/IDevice.h>
+#include <gmock/gmock.h>
+#include <gtest/gtest.h>
+#include <hidl/Status.h>
+
+namespace android::hardware::neuralnetworks::V1_3::utils {
+
+using CacheToken =
+ hidl_array<uint8_t, static_cast<uint32_t>(V1_2::Constant::BYTE_SIZE_OF_CACHE_TOKEN)>;
+
+class MockDevice final : public IDevice {
+ public:
+ static sp<MockDevice> create();
+
+ // IBase methods below.
+ MOCK_METHOD(Return<void>, ping, (), (override));
+ MOCK_METHOD(Return<bool>, linkToDeathRet, ());
+ Return<bool> linkToDeath(const sp<hidl_death_recipient>& recipient, uint64_t /*cookie*/);
+
+ // V1_0 methods below.
+ MOCK_METHOD(Return<void>, getCapabilities, (getCapabilities_cb cb), (override));
+ MOCK_METHOD(Return<void>, getSupportedOperations,
+ (const V1_0::Model& model, getSupportedOperations_cb cb), (override));
+ MOCK_METHOD(Return<V1_0::ErrorStatus>, prepareModel,
+ (const V1_0::Model& model, const sp<V1_0::IPreparedModelCallback>& callback),
+ (override));
+ MOCK_METHOD(Return<V1_0::DeviceStatus>, getStatus, (), (override));
+
+ // V1_1 methods below.
+ MOCK_METHOD(Return<void>, getCapabilities_1_1, (getCapabilities_1_1_cb cb), (override));
+ MOCK_METHOD(Return<void>, getSupportedOperations_1_1,
+ (const V1_1::Model& model, getSupportedOperations_1_1_cb cb), (override));
+ MOCK_METHOD(Return<V1_0::ErrorStatus>, prepareModel_1_1,
+ (const V1_1::Model& model, V1_1::ExecutionPreference preference,
+ const sp<V1_0::IPreparedModelCallback>& callback),
+ (override));
+
+ // V1_2 methods below.
+ MOCK_METHOD(Return<void>, getVersionString, (getVersionString_cb cb), (override));
+ MOCK_METHOD(Return<void>, getType, (getType_cb cb), (override));
+ MOCK_METHOD(Return<void>, getCapabilities_1_2, (getCapabilities_1_2_cb cb), (override));
+ MOCK_METHOD(Return<void>, getSupportedExtensions, (getSupportedExtensions_cb cb), (override));
+ MOCK_METHOD(Return<void>, getSupportedOperations_1_2,
+ (const V1_2::Model& model, getSupportedOperations_1_2_cb cb), (override));
+ MOCK_METHOD(Return<void>, getNumberOfCacheFilesNeeded, (getNumberOfCacheFilesNeeded_cb cb),
+ (override));
+ MOCK_METHOD(Return<V1_0::ErrorStatus>, prepareModel_1_2,
+ (const V1_2::Model& model, V1_1::ExecutionPreference preference,
+ const hidl_vec<hidl_handle>& modelCache, const hidl_vec<hidl_handle>& dataCache,
+ const CacheToken& token, const sp<V1_2::IPreparedModelCallback>& callback),
+ (override));
+ MOCK_METHOD(Return<V1_0::ErrorStatus>, prepareModelFromCache,
+ (const hidl_vec<hidl_handle>& modelCache, const hidl_vec<hidl_handle>& dataCache,
+ const CacheToken& token, const sp<V1_2::IPreparedModelCallback>& callback),
+ (override));
+
+ // V1_3 methods below.
+ MOCK_METHOD(Return<void>, getCapabilities_1_3, (getCapabilities_1_3_cb cb), (override));
+ MOCK_METHOD(Return<void>, getSupportedOperations_1_3,
+ (const V1_3::Model& model, getSupportedOperations_1_3_cb cb), (override));
+ MOCK_METHOD(Return<V1_3::ErrorStatus>, prepareModel_1_3,
+ (const V1_3::Model& model, V1_1::ExecutionPreference preference,
+ V1_3::Priority priority, const V1_3::OptionalTimePoint& deadline,
+ const hidl_vec<hidl_handle>& modelCache, const hidl_vec<hidl_handle>& dataCache,
+ const CacheToken& token, const sp<V1_3::IPreparedModelCallback>& callback),
+ (override));
+ MOCK_METHOD(Return<V1_3::ErrorStatus>, prepareModelFromCache_1_3,
+ (const V1_3::OptionalTimePoint& deadline, const hidl_vec<hidl_handle>& modelCache,
+ const hidl_vec<hidl_handle>& dataCache, const CacheToken& token,
+ const sp<V1_3::IPreparedModelCallback>& callback),
+ (override));
+ MOCK_METHOD(Return<void>, allocate,
+ (const V1_3::BufferDesc& desc,
+ const hidl_vec<sp<V1_3::IPreparedModel>>& preparedModels,
+ const hidl_vec<V1_3::BufferRole>& inputRoles,
+ const hidl_vec<V1_3::BufferRole>& outputRoles, allocate_cb cb),
+ (override));
+
+ // Helper methods.
+ void simulateCrash();
+
+ private:
+ sp<hidl_death_recipient> mDeathRecipient;
+};
+
+inline sp<MockDevice> MockDevice::create() {
+ auto mockDevice = sp<MockDevice>::make();
+
+ // Setup default actions for each relevant call.
+ const auto ret = []() -> Return<bool> { return true; };
+
+ // Setup default actions for each relevant call.
+ ON_CALL(*mockDevice, linkToDeathRet()).WillByDefault(testing::Invoke(ret));
+
+ // These EXPECT_CALL(...).Times(testing::AnyNumber()) calls are to suppress warnings on the
+ // uninteresting methods calls.
+ EXPECT_CALL(*mockDevice, linkToDeathRet()).Times(testing::AnyNumber());
+
+ return mockDevice;
+}
+
+inline Return<bool> MockDevice::linkToDeath(const sp<hidl_death_recipient>& recipient,
+ uint64_t /*cookie*/) {
+ mDeathRecipient = recipient;
+ return linkToDeathRet();
+}
+
+inline void MockDevice::simulateCrash() {
+ ASSERT_NE(nullptr, mDeathRecipient.get());
+
+ // Currently, the utils::Device will not use the `cookie` or `who` arguments, so we pass in 0
+ // and nullptr for these arguments instead. Normally, they are used by the hidl_death_recipient
+ // to determine which object is dead. However, the utils::Device code only pairs a single death
+ // recipient with a single HIDL interface object, so these arguments are redundant.
+ mDeathRecipient->serviceDied(0, nullptr);
+}
+
+} // namespace android::hardware::neuralnetworks::V1_3::utils
+
+#endif // ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_3_UTILS_TEST_MOCK_DEVICE
diff --git a/neuralnetworks/1.3/utils/test/MockFencedExecutionCallback.h b/neuralnetworks/1.3/utils/test/MockFencedExecutionCallback.h
new file mode 100644
index 0000000..fc08a7f
--- /dev/null
+++ b/neuralnetworks/1.3/utils/test/MockFencedExecutionCallback.h
@@ -0,0 +1,42 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_3_UTILS_TEST_MOCK_FENCED_EXECUTION_CALLBACK
+#define ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_3_UTILS_TEST_MOCK_FENCED_EXECUTION_CALLBACK
+
+#include <android/hardware/neuralnetworks/1.3/IFencedExecutionCallback.h>
+#include <gmock/gmock.h>
+#include <gtest/gtest.h>
+#include <hidl/Status.h>
+
+namespace android::hardware::neuralnetworks::V1_3::utils {
+
+class MockFencedExecutionCallback final : public IFencedExecutionCallback {
+ public:
+ static sp<MockFencedExecutionCallback> create();
+
+ // V1_3 methods below.
+ MOCK_METHOD(Return<void>, getExecutionInfo, (IFencedExecutionCallback::getExecutionInfo_cb cb),
+ (override));
+};
+
+inline sp<MockFencedExecutionCallback> MockFencedExecutionCallback::create() {
+ return sp<MockFencedExecutionCallback>::make();
+}
+
+} // namespace android::hardware::neuralnetworks::V1_3::utils
+
+#endif // ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_3_UTILS_TEST_MOCK_FENCED_EXECUTION_CALLBACK
diff --git a/neuralnetworks/1.3/utils/test/MockPreparedModel.h b/neuralnetworks/1.3/utils/test/MockPreparedModel.h
new file mode 100644
index 0000000..e441524
--- /dev/null
+++ b/neuralnetworks/1.3/utils/test/MockPreparedModel.h
@@ -0,0 +1,121 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_3_UTILS_TEST_MOCK_PREPARED_MODEL
+#define ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_3_UTILS_TEST_MOCK_PREPARED_MODEL
+
+#include <android/hardware/neuralnetworks/1.3/IPreparedModel.h>
+#include <gmock/gmock.h>
+#include <gtest/gtest.h>
+#include <hidl/HidlSupport.h>
+#include <hidl/Status.h>
+
+namespace android::hardware::neuralnetworks::V1_3::utils {
+
+class MockPreparedModel final : public IPreparedModel {
+ public:
+ static sp<MockPreparedModel> create();
+
+ // IBase methods below.
+ MOCK_METHOD(Return<void>, ping, (), (override));
+ MOCK_METHOD(Return<bool>, linkToDeathRet, ());
+ Return<bool> linkToDeath(const sp<hidl_death_recipient>& recipient,
+ uint64_t /*cookie*/) override;
+
+ // V1_0 methods below.
+ MOCK_METHOD(Return<V1_0::ErrorStatus>, execute,
+ (const V1_0::Request& request, const sp<V1_0::IExecutionCallback>& callback),
+ (override));
+
+ // V1_2 methods below.
+ MOCK_METHOD(Return<V1_0::ErrorStatus>, execute_1_2,
+ (const V1_0::Request& request, V1_2::MeasureTiming measure,
+ const sp<V1_2::IExecutionCallback>& callback),
+ (override));
+ MOCK_METHOD(Return<void>, executeSynchronously,
+ (const V1_0::Request& request, V1_2::MeasureTiming measure,
+ executeSynchronously_cb cb),
+ (override));
+ MOCK_METHOD(Return<void>, configureExecutionBurst,
+ (const sp<V1_2::IBurstCallback>& callback,
+ const MQDescriptorSync<V1_2::FmqRequestDatum>& requestChannel,
+ const MQDescriptorSync<V1_2::FmqResultDatum>& resultChannel,
+ configureExecutionBurst_cb cb),
+ (override));
+
+ // V1_3 methods below.
+ MOCK_METHOD(Return<V1_3::ErrorStatus>, execute_1_3,
+ (const V1_3::Request& request, V1_2::MeasureTiming measure,
+ const V1_3::OptionalTimePoint& deadline,
+ const V1_3::OptionalTimeoutDuration& loopTimeoutDuration,
+ const sp<V1_3::IExecutionCallback>& callback),
+ (override));
+ MOCK_METHOD(Return<void>, executeSynchronously_1_3,
+ (const V1_3::Request& request, V1_2::MeasureTiming measure,
+ const V1_3::OptionalTimePoint& deadline,
+ const V1_3::OptionalTimeoutDuration& loopTimeoutDuration,
+ executeSynchronously_1_3_cb cb),
+ (override));
+ MOCK_METHOD(Return<void>, executeFenced,
+ (const V1_3::Request& request, const hidl_vec<hidl_handle>& waitFor,
+ V1_2::MeasureTiming measure, const V1_3::OptionalTimePoint& deadline,
+ const V1_3::OptionalTimeoutDuration& loopTimeoutDuration,
+ const V1_3::OptionalTimeoutDuration& duration, executeFenced_cb cb),
+ (override));
+
+ // Helper methods.
+ void simulateCrash();
+
+ private:
+ sp<hidl_death_recipient> mDeathRecipient;
+};
+
+inline sp<MockPreparedModel> MockPreparedModel::create() {
+ auto mockPreparedModel = sp<MockPreparedModel>::make();
+
+ // Setup default actions for each relevant call.
+ const auto ret = []() -> Return<bool> { return true; };
+
+ // Setup default actions for each relevant call.
+ ON_CALL(*mockPreparedModel, linkToDeathRet()).WillByDefault(testing::Invoke(ret));
+
+ // These EXPECT_CALL(...).Times(testing::AnyNumber()) calls are to suppress warnings on the
+ // uninteresting methods calls.
+ EXPECT_CALL(*mockPreparedModel, linkToDeathRet()).Times(testing::AnyNumber());
+
+ return mockPreparedModel;
+}
+
+inline Return<bool> MockPreparedModel::linkToDeath(const sp<hidl_death_recipient>& recipient,
+ uint64_t /*cookie*/) {
+ mDeathRecipient = recipient;
+ return linkToDeathRet();
+}
+
+inline void MockPreparedModel::simulateCrash() {
+ ASSERT_NE(nullptr, mDeathRecipient.get());
+
+ // Currently, the utils::PreparedModel will not use the `cookie` or `who` arguments, so we pass
+ // in 0 and nullptr for these arguments instead. Normally, they are used by the
+ // hidl_death_recipient to determine which object is dead. However, the utils::PreparedModel
+ // code only pairs a single death recipient with a single HIDL interface object, so these
+ // arguments are redundant.
+ mDeathRecipient->serviceDied(0, nullptr);
+}
+
+} // namespace android::hardware::neuralnetworks::V1_3::utils
+
+#endif // ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_1_3_UTILS_TEST_MOCK_PREPARED_MODEL
diff --git a/neuralnetworks/1.3/utils/test/PreparedModelTest.cpp b/neuralnetworks/1.3/utils/test/PreparedModelTest.cpp
new file mode 100644
index 0000000..11796dd
--- /dev/null
+++ b/neuralnetworks/1.3/utils/test/PreparedModelTest.cpp
@@ -0,0 +1,470 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "MockFencedExecutionCallback.h"
+#include "MockPreparedModel.h"
+
+#include <android/hardware/neuralnetworks/1.3/IExecutionCallback.h>
+#include <android/hardware/neuralnetworks/1.3/IFencedExecutionCallback.h>
+#include <gmock/gmock.h>
+#include <gtest/gtest.h>
+#include <nnapi/IPreparedModel.h>
+#include <nnapi/TypeUtils.h>
+#include <nnapi/Types.h>
+#include <nnapi/hal/1.3/PreparedModel.h>
+
+#include <functional>
+#include <memory>
+
+namespace android::hardware::neuralnetworks::V1_3::utils {
+namespace {
+
+using ::testing::_;
+using ::testing::Invoke;
+using ::testing::InvokeWithoutArgs;
+
+const sp<V1_3::IPreparedModel> kInvalidPreparedModel;
+constexpr auto kNoTiming = V1_2::Timing{.timeOnDevice = std::numeric_limits<uint64_t>::max(),
+ .timeInDriver = std::numeric_limits<uint64_t>::max()};
+
+sp<MockPreparedModel> createMockPreparedModel() {
+ const auto mockPreparedModel = MockPreparedModel::create();
+
+ // Ensure that older calls are not used.
+ EXPECT_CALL(*mockPreparedModel, execute(_, _)).Times(0);
+ EXPECT_CALL(*mockPreparedModel, execute_1_2(_, _, _)).Times(0);
+ EXPECT_CALL(*mockPreparedModel, executeSynchronously(_, _, _)).Times(0);
+
+ return mockPreparedModel;
+}
+
+auto makeExecuteSynchronously(V1_3::ErrorStatus status,
+ const std::vector<V1_2::OutputShape>& outputShapes,
+ const V1_2::Timing& timing) {
+ return [status, outputShapes, timing](
+ const V1_3::Request& /*request*/, V1_2::MeasureTiming /*measureTiming*/,
+ const V1_3::OptionalTimePoint& /*deadline*/,
+ const V1_3::OptionalTimeoutDuration& /*loopTimeoutDuration*/,
+ const V1_3::IPreparedModel::executeSynchronously_1_3_cb& cb) {
+ cb(status, outputShapes, timing);
+ return hardware::Void();
+ };
+}
+auto makeExecuteAsynchronously(V1_3::ErrorStatus launchStatus, V1_3::ErrorStatus returnStatus,
+ const std::vector<V1_2::OutputShape>& outputShapes,
+ const V1_2::Timing& timing) {
+ return [launchStatus, returnStatus, outputShapes, timing](
+ const V1_3::Request& /*request*/, V1_2::MeasureTiming /*measureTiming*/,
+ const V1_3::OptionalTimePoint& /*deadline*/,
+ const V1_3::OptionalTimeoutDuration& /*loopTimeoutDuration*/,
+ const sp<V1_3::IExecutionCallback>& cb) -> Return<V1_3::ErrorStatus> {
+ cb->notify_1_3(returnStatus, outputShapes, timing);
+ return launchStatus;
+ };
+}
+auto makeExecuteFencedReturn(V1_3::ErrorStatus status, const hardware::hidl_handle& syncFence,
+ const sp<V1_3::IFencedExecutionCallback>& dispatchCallback) {
+ return [status, syncFence, dispatchCallback](
+ const V1_3::Request& /*request*/,
+ const hardware::hidl_vec<hardware::hidl_handle>& /*waitFor*/,
+ V1_2::MeasureTiming /*measure*/, const V1_3::OptionalTimePoint& /*deadline*/,
+ const V1_3::OptionalTimeoutDuration& /*loopTimeoutDuration*/,
+ const V1_3::OptionalTimeoutDuration& /*duration*/,
+ const V1_3::IPreparedModel::executeFenced_cb& cb) {
+ cb(status, syncFence, dispatchCallback);
+ return hardware::Void();
+ };
+}
+auto makeExecuteFencedCallbackReturn(V1_3::ErrorStatus status, const V1_2::Timing& timingA,
+ const V1_2::Timing& timingB) {
+ return [status, timingA,
+ timingB](const V1_3::IFencedExecutionCallback::getExecutionInfo_cb& cb) {
+ cb(status, timingA, timingB);
+ return hardware::Void();
+ };
+}
+
+std::function<hardware::Status()> makeTransportFailure(status_t status) {
+ return [status] { return hardware::Status::fromStatusT(status); };
+}
+
+const auto makeGeneralTransportFailure = makeTransportFailure(NO_MEMORY);
+const auto makeDeadObjectFailure = makeTransportFailure(DEAD_OBJECT);
+
+} // namespace
+
+TEST(PreparedModelTest, invalidPreparedModel) {
+ // run test
+ const auto result = PreparedModel::create(kInvalidPreparedModel, /*executeSynchronously=*/true);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(PreparedModelTest, linkToDeathError) {
+ // setup call
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto ret = []() -> Return<bool> { return false; };
+ EXPECT_CALL(*mockPreparedModel, linkToDeathRet()).Times(1).WillOnce(InvokeWithoutArgs(ret));
+
+ // run test
+ const auto result = PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/true);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(PreparedModelTest, linkToDeathTransportFailure) {
+ // setup call
+ const auto mockPreparedModel = createMockPreparedModel();
+ EXPECT_CALL(*mockPreparedModel, linkToDeathRet())
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/true);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(PreparedModelTest, linkToDeathDeadObject) {
+ // setup call
+ const auto mockPreparedModel = createMockPreparedModel();
+ EXPECT_CALL(*mockPreparedModel, linkToDeathRet())
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/true);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(PreparedModelTest, executeSync) {
+ // setup call
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/true).value();
+ EXPECT_CALL(*mockPreparedModel, executeSynchronously_1_3(_, _, _, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makeExecuteSynchronously(V1_3::ErrorStatus::NONE, {}, kNoTiming)));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ EXPECT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(PreparedModelTest, executeSyncError) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/true).value();
+ EXPECT_CALL(*mockPreparedModel, executeSynchronously_1_3(_, _, _, _, _))
+ .Times(1)
+ .WillOnce(Invoke(
+ makeExecuteSynchronously(V1_3::ErrorStatus::GENERAL_FAILURE, {}, kNoTiming)));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(PreparedModelTest, executeSyncTransportFailure) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/true).value();
+ EXPECT_CALL(*mockPreparedModel, executeSynchronously_1_3(_, _, _, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(PreparedModelTest, executeSyncDeadObject) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/true).value();
+ EXPECT_CALL(*mockPreparedModel, executeSynchronously_1_3(_, _, _, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(PreparedModelTest, executeAsync) {
+ // setup call
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/false).value();
+ EXPECT_CALL(*mockPreparedModel, execute_1_3(_, _, _, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makeExecuteAsynchronously(V1_3::ErrorStatus::NONE,
+ V1_3::ErrorStatus::NONE, {}, kNoTiming)));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ EXPECT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(PreparedModelTest, executeAsyncLaunchError) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/false).value();
+ EXPECT_CALL(*mockPreparedModel, execute_1_3(_, _, _, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makeExecuteAsynchronously(V1_3::ErrorStatus::GENERAL_FAILURE,
+ V1_3::ErrorStatus::GENERAL_FAILURE, {},
+ kNoTiming)));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(PreparedModelTest, executeAsyncReturnError) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/false).value();
+ EXPECT_CALL(*mockPreparedModel, execute_1_3(_, _, _, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makeExecuteAsynchronously(
+ V1_3::ErrorStatus::NONE, V1_3::ErrorStatus::GENERAL_FAILURE, {}, kNoTiming)));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(PreparedModelTest, executeAsyncTransportFailure) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/false).value();
+ EXPECT_CALL(*mockPreparedModel, execute_1_3(_, _, _, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(PreparedModelTest, executeAsyncDeadObject) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/false).value();
+ EXPECT_CALL(*mockPreparedModel, execute_1_3(_, _, _, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(PreparedModelTest, executeAsyncCrash) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/false).value();
+ const auto ret = [&mockPreparedModel]() -> hardware::Return<V1_3::ErrorStatus> {
+ mockPreparedModel->simulateCrash();
+ return V1_3::ErrorStatus::NONE;
+ };
+ EXPECT_CALL(*mockPreparedModel, execute_1_3(_, _, _, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(ret));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(PreparedModelTest, executeFenced) {
+ // setup call
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/true).value();
+ const auto mockCallback = MockFencedExecutionCallback::create();
+ EXPECT_CALL(*mockCallback, getExecutionInfo(_))
+ .Times(1)
+ .WillOnce(Invoke(makeExecuteFencedCallbackReturn(V1_3::ErrorStatus::NONE, kNoTiming,
+ kNoTiming)));
+ EXPECT_CALL(*mockPreparedModel, executeFenced(_, _, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makeExecuteFencedReturn(V1_3::ErrorStatus::NONE, {}, mockCallback)));
+
+ // run test
+ const auto result = preparedModel->executeFenced({}, {}, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ const auto& [syncFence, callback] = result.value();
+ EXPECT_EQ(syncFence.syncWait({}), nn::SyncFence::FenceState::SIGNALED);
+ ASSERT_NE(callback, nullptr);
+
+ // get results from callback
+ const auto callbackResult = callback();
+ ASSERT_TRUE(callbackResult.has_value()) << "Failed with " << callbackResult.error().code << ": "
+ << callbackResult.error().message;
+}
+
+TEST(PreparedModelTest, executeFencedCallbackError) {
+ // setup call
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/true).value();
+ const auto mockCallback = MockFencedExecutionCallback::create();
+ EXPECT_CALL(*mockCallback, getExecutionInfo(_))
+ .Times(1)
+ .WillOnce(Invoke(makeExecuteFencedCallbackReturn(V1_3::ErrorStatus::GENERAL_FAILURE,
+ kNoTiming, kNoTiming)));
+ EXPECT_CALL(*mockPreparedModel, executeFenced(_, _, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(Invoke(makeExecuteFencedReturn(V1_3::ErrorStatus::NONE, {}, mockCallback)));
+
+ // run test
+ const auto result = preparedModel->executeFenced({}, {}, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ const auto& [syncFence, callback] = result.value();
+ EXPECT_NE(syncFence.syncWait({}), nn::SyncFence::FenceState::ACTIVE);
+ ASSERT_NE(callback, nullptr);
+
+ // verify callback failure
+ const auto callbackResult = callback();
+ ASSERT_FALSE(callbackResult.has_value());
+ EXPECT_EQ(callbackResult.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(PreparedModelTest, executeFencedError) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/true).value();
+ EXPECT_CALL(*mockPreparedModel, executeFenced(_, _, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(Invoke(
+ makeExecuteFencedReturn(V1_3::ErrorStatus::GENERAL_FAILURE, {}, nullptr)));
+
+ // run test
+ const auto result = preparedModel->executeFenced({}, {}, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(PreparedModelTest, executeFencedTransportFailure) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/true).value();
+ EXPECT_CALL(*mockPreparedModel, executeFenced(_, _, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeGeneralTransportFailure));
+
+ // run test
+ const auto result = preparedModel->executeFenced({}, {}, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(PreparedModelTest, executeFencedDeadObject) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/true).value();
+ EXPECT_CALL(*mockPreparedModel, executeFenced(_, _, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(InvokeWithoutArgs(makeDeadObjectFailure));
+
+ // run test
+ const auto result = preparedModel->executeFenced({}, {}, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+// TODO: test burst execution if/when it is added to nn::IPreparedModel.
+
+TEST(PreparedModelTest, getUnderlyingResource) {
+ // setup test
+ const auto mockPreparedModel = createMockPreparedModel();
+ const auto preparedModel =
+ PreparedModel::create(mockPreparedModel, /*executeSynchronously=*/true).value();
+
+ // run test
+ const auto resource = preparedModel->getUnderlyingResource();
+
+ // verify resource
+ const sp<V1_3::IPreparedModel>* maybeMock = std::any_cast<sp<V1_3::IPreparedModel>>(&resource);
+ ASSERT_NE(maybeMock, nullptr);
+ EXPECT_EQ(maybeMock->get(), mockPreparedModel.get());
+}
+
+} // namespace android::hardware::neuralnetworks::V1_3::utils
diff --git a/neuralnetworks/TEST_MAPPING b/neuralnetworks/TEST_MAPPING
index ca5041d..de84624 100644
--- a/neuralnetworks/TEST_MAPPING
+++ b/neuralnetworks/TEST_MAPPING
@@ -1,6 +1,21 @@
{
"presubmit": [
{
+ "name": "neuralnetworks_utils_hal_common_test"
+ },
+ {
+ "name": "neuralnetworks_utils_hal_1_0_test"
+ },
+ {
+ "name": "neuralnetworks_utils_hal_1_1_test"
+ },
+ {
+ "name": "neuralnetworks_utils_hal_1_2_test"
+ },
+ {
+ "name": "neuralnetworks_utils_hal_1_3_test"
+ },
+ {
"name": "VtsHalNeuralnetworksV1_0TargetTest",
"options": [
{
diff --git a/neuralnetworks/utils/common/Android.bp b/neuralnetworks/utils/common/Android.bp
index 21562cf..6c491ae 100644
--- a/neuralnetworks/utils/common/Android.bp
+++ b/neuralnetworks/utils/common/Android.bp
@@ -28,3 +28,28 @@
"libhidlbase",
],
}
+
+cc_test {
+ name: "neuralnetworks_utils_hal_common_test",
+ srcs: ["test/*.cpp"],
+ static_libs: [
+ "android.hardware.neuralnetworks@1.0",
+ "libgmock",
+ "libneuralnetworks_common",
+ "neuralnetworks_types",
+ "neuralnetworks_utils_hal_common",
+ ],
+ shared_libs: [
+ "android.hidl.allocator@1.0",
+ "android.hidl.memory@1.0",
+ "libbase",
+ "libcutils",
+ "libfmq",
+ "libhidlbase",
+ "libhidlmemory",
+ "liblog",
+ "libnativewindow",
+ "libutils",
+ ],
+ test_suites: ["general-tests"],
+}
diff --git a/neuralnetworks/utils/common/include/nnapi/hal/InvalidBurst.h b/neuralnetworks/utils/common/include/nnapi/hal/InvalidBurst.h
new file mode 100644
index 0000000..83e60b6
--- /dev/null
+++ b/neuralnetworks/utils/common/include/nnapi/hal/InvalidBurst.h
@@ -0,0 +1,40 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_UTILS_COMMON_INVALID_BURST_H
+#define ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_UTILS_COMMON_INVALID_BURST_H
+
+#include <nnapi/IBurst.h>
+#include <nnapi/Result.h>
+#include <nnapi/Types.h>
+
+#include <memory>
+#include <optional>
+#include <utility>
+
+namespace android::hardware::neuralnetworks::utils {
+
+class InvalidBurst final : public nn::IBurst {
+ public:
+ OptionalCacheHold cacheMemory(const nn::Memory& memory) const override;
+
+ nn::ExecutionResult<std::pair<std::vector<nn::OutputShape>, nn::Timing>> execute(
+ const nn::Request& request, nn::MeasureTiming measure) const override;
+};
+
+} // namespace android::hardware::neuralnetworks::utils
+
+#endif // ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_UTILS_COMMON_INVALID_BURST_H
diff --git a/neuralnetworks/utils/common/include/nnapi/hal/InvalidDevice.h b/neuralnetworks/utils/common/include/nnapi/hal/InvalidDevice.h
index 5e62b9a..d843526 100644
--- a/neuralnetworks/utils/common/include/nnapi/hal/InvalidDevice.h
+++ b/neuralnetworks/utils/common/include/nnapi/hal/InvalidDevice.h
@@ -32,7 +32,7 @@
class InvalidDevice final : public nn::IDevice {
public:
InvalidDevice(std::string name, std::string versionString, nn::Version featureLevel,
- nn::DeviceType type, std::vector<nn::Extension> extensions,
+ nn::DeviceType type, bool isUpdatable, std::vector<nn::Extension> extensions,
nn::Capabilities capabilities,
std::pair<uint32_t, uint32_t> numberOfCacheFilesNeeded);
@@ -40,6 +40,7 @@
const std::string& getVersionString() const override;
nn::Version getFeatureLevel() const override;
nn::DeviceType getType() const override;
+ bool isUpdatable() const override;
const std::vector<nn::Extension>& getSupportedExtensions() const override;
const nn::Capabilities& getCapabilities() const override;
std::pair<uint32_t, uint32_t> getNumberOfCacheFilesNeeded() const override;
@@ -70,6 +71,7 @@
const std::string kVersionString;
const nn::Version kFeatureLevel;
const nn::DeviceType kType;
+ const bool kIsUpdatable;
const std::vector<nn::Extension> kExtensions;
const nn::Capabilities kCapabilities;
const std::pair<uint32_t, uint32_t> kNumberOfCacheFilesNeeded;
diff --git a/neuralnetworks/utils/common/include/nnapi/hal/InvalidPreparedModel.h b/neuralnetworks/utils/common/include/nnapi/hal/InvalidPreparedModel.h
index 985cddb..3e1dca7 100644
--- a/neuralnetworks/utils/common/include/nnapi/hal/InvalidPreparedModel.h
+++ b/neuralnetworks/utils/common/include/nnapi/hal/InvalidPreparedModel.h
@@ -40,6 +40,8 @@
const nn::OptionalDuration& loopTimeoutDuration,
const nn::OptionalDuration& timeoutDurationAfterFence) const override;
+ nn::GeneralResult<nn::SharedBurst> configureExecutionBurst() const override;
+
std::any getUnderlyingResource() const override;
};
diff --git a/neuralnetworks/utils/common/include/nnapi/hal/ResilientBuffer.h b/neuralnetworks/utils/common/include/nnapi/hal/ResilientBuffer.h
index 9d5e3e6..d2c2469 100644
--- a/neuralnetworks/utils/common/include/nnapi/hal/ResilientBuffer.h
+++ b/neuralnetworks/utils/common/include/nnapi/hal/ResilientBuffer.h
@@ -42,7 +42,7 @@
nn::SharedBuffer buffer);
nn::SharedBuffer getBuffer() const;
- nn::SharedBuffer recover(const nn::IBuffer* failingBuffer, bool blocking) const;
+ nn::GeneralResult<nn::SharedBuffer> recover(const nn::IBuffer* failingBuffer) const;
nn::Request::MemoryDomainToken getToken() const override;
diff --git a/neuralnetworks/utils/common/include/nnapi/hal/ResilientBurst.h b/neuralnetworks/utils/common/include/nnapi/hal/ResilientBurst.h
new file mode 100644
index 0000000..0df287f
--- /dev/null
+++ b/neuralnetworks/utils/common/include/nnapi/hal/ResilientBurst.h
@@ -0,0 +1,60 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_UTILS_COMMON_RESILIENT_BURST_H
+#define ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_UTILS_COMMON_RESILIENT_BURST_H
+
+#include <android-base/thread_annotations.h>
+#include <nnapi/IBurst.h>
+#include <nnapi/Result.h>
+#include <nnapi/Types.h>
+
+#include <functional>
+#include <memory>
+#include <mutex>
+#include <optional>
+#include <utility>
+
+namespace android::hardware::neuralnetworks::utils {
+
+class ResilientBurst final : public nn::IBurst,
+ public std::enable_shared_from_this<ResilientBurst> {
+ struct PrivateConstructorTag {};
+
+ public:
+ using Factory = std::function<nn::GeneralResult<nn::SharedBurst>()>;
+
+ static nn::GeneralResult<std::shared_ptr<const ResilientBurst>> create(Factory makeBurst);
+
+ ResilientBurst(PrivateConstructorTag tag, Factory makeBurst, nn::SharedBurst burst);
+
+ nn::SharedBurst getBurst() const;
+ nn::GeneralResult<nn::SharedBurst> recover(const nn::IBurst* failingBurst) const;
+
+ OptionalCacheHold cacheMemory(const nn::Memory& memory) const override;
+
+ nn::ExecutionResult<std::pair<std::vector<nn::OutputShape>, nn::Timing>> execute(
+ const nn::Request& request, nn::MeasureTiming measure) const override;
+
+ private:
+ const Factory kMakeBurst;
+ mutable std::mutex mMutex;
+ mutable nn::SharedBurst mBurst GUARDED_BY(mMutex);
+};
+
+} // namespace android::hardware::neuralnetworks::utils
+
+#endif // ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_UTILS_COMMON_RESILIENT_BURST_H
diff --git a/neuralnetworks/utils/common/include/nnapi/hal/ResilientDevice.h b/neuralnetworks/utils/common/include/nnapi/hal/ResilientDevice.h
index 84ae799..8199c52 100644
--- a/neuralnetworks/utils/common/include/nnapi/hal/ResilientDevice.h
+++ b/neuralnetworks/utils/common/include/nnapi/hal/ResilientDevice.h
@@ -53,6 +53,7 @@
const std::string& getVersionString() const override;
nn::Version getFeatureLevel() const override;
nn::DeviceType getType() const override;
+ bool isUpdatable() const override;
const std::vector<nn::Extension>& getSupportedExtensions() const override;
const nn::Capabilities& getCapabilities() const override;
std::pair<uint32_t, uint32_t> getNumberOfCacheFilesNeeded() const override;
diff --git a/neuralnetworks/utils/common/include/nnapi/hal/ResilientPreparedModel.h b/neuralnetworks/utils/common/include/nnapi/hal/ResilientPreparedModel.h
index faae673..a6c1b19 100644
--- a/neuralnetworks/utils/common/include/nnapi/hal/ResilientPreparedModel.h
+++ b/neuralnetworks/utils/common/include/nnapi/hal/ResilientPreparedModel.h
@@ -30,7 +30,8 @@
namespace android::hardware::neuralnetworks::utils {
-class ResilientPreparedModel final : public nn::IPreparedModel {
+class ResilientPreparedModel final : public nn::IPreparedModel,
+ public std::enable_shared_from_this<ResilientPreparedModel> {
struct PrivateConstructorTag {};
public:
@@ -43,8 +44,8 @@
nn::SharedPreparedModel preparedModel);
nn::SharedPreparedModel getPreparedModel() const;
- nn::SharedPreparedModel recover(const nn::IPreparedModel* failingPreparedModel,
- bool blocking) const;
+ nn::GeneralResult<nn::SharedPreparedModel> recover(
+ const nn::IPreparedModel* failingPreparedModel) const;
nn::ExecutionResult<std::pair<std::vector<nn::OutputShape>, nn::Timing>> execute(
const nn::Request& request, nn::MeasureTiming measure,
@@ -57,9 +58,14 @@
const nn::OptionalDuration& loopTimeoutDuration,
const nn::OptionalDuration& timeoutDurationAfterFence) const override;
+ nn::GeneralResult<nn::SharedBurst> configureExecutionBurst() const override;
+
std::any getUnderlyingResource() const override;
private:
+ bool isValidInternal() const EXCLUDES(mMutex);
+ nn::GeneralResult<nn::SharedBurst> configureExecutionBurstInternal() const;
+
const Factory kMakePreparedModel;
mutable std::mutex mMutex;
mutable nn::SharedPreparedModel mPreparedModel GUARDED_BY(mMutex);
diff --git a/neuralnetworks/utils/common/src/InvalidBurst.cpp b/neuralnetworks/utils/common/src/InvalidBurst.cpp
new file mode 100644
index 0000000..4ca6603
--- /dev/null
+++ b/neuralnetworks/utils/common/src/InvalidBurst.cpp
@@ -0,0 +1,38 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "InvalidBurst.h"
+
+#include <nnapi/IBurst.h>
+#include <nnapi/Result.h>
+#include <nnapi/Types.h>
+
+#include <memory>
+#include <optional>
+#include <utility>
+
+namespace android::hardware::neuralnetworks::utils {
+
+InvalidBurst::OptionalCacheHold InvalidBurst::cacheMemory(const nn::Memory& /*memory*/) const {
+ return nullptr;
+}
+
+nn::ExecutionResult<std::pair<std::vector<nn::OutputShape>, nn::Timing>> InvalidBurst::execute(
+ const nn::Request& /*request*/, nn::MeasureTiming /*measure*/) const {
+ return NN_ERROR() << "InvalidBurst";
+}
+
+} // namespace android::hardware::neuralnetworks::utils
diff --git a/neuralnetworks/utils/common/src/InvalidDevice.cpp b/neuralnetworks/utils/common/src/InvalidDevice.cpp
index 535ccb4..81bca7f 100644
--- a/neuralnetworks/utils/common/src/InvalidDevice.cpp
+++ b/neuralnetworks/utils/common/src/InvalidDevice.cpp
@@ -32,13 +32,14 @@
namespace android::hardware::neuralnetworks::utils {
InvalidDevice::InvalidDevice(std::string name, std::string versionString, nn::Version featureLevel,
- nn::DeviceType type, std::vector<nn::Extension> extensions,
- nn::Capabilities capabilities,
+ nn::DeviceType type, bool isUpdatable,
+ std::vector<nn::Extension> extensions, nn::Capabilities capabilities,
std::pair<uint32_t, uint32_t> numberOfCacheFilesNeeded)
: kName(std::move(name)),
kVersionString(std::move(versionString)),
kFeatureLevel(featureLevel),
kType(type),
+ kIsUpdatable(isUpdatable),
kExtensions(std::move(extensions)),
kCapabilities(std::move(capabilities)),
kNumberOfCacheFilesNeeded(numberOfCacheFilesNeeded) {}
@@ -59,6 +60,10 @@
return kType;
}
+bool InvalidDevice::isUpdatable() const {
+ return kIsUpdatable;
+}
+
const std::vector<nn::Extension>& InvalidDevice::getSupportedExtensions() const {
return kExtensions;
}
diff --git a/neuralnetworks/utils/common/src/InvalidPreparedModel.cpp b/neuralnetworks/utils/common/src/InvalidPreparedModel.cpp
index a46f4ac..9081e1f 100644
--- a/neuralnetworks/utils/common/src/InvalidPreparedModel.cpp
+++ b/neuralnetworks/utils/common/src/InvalidPreparedModel.cpp
@@ -42,6 +42,10 @@
return NN_ERROR() << "InvalidPreparedModel";
}
+nn::GeneralResult<nn::SharedBurst> InvalidPreparedModel::configureExecutionBurst() const {
+ return NN_ERROR() << "InvalidPreparedModel";
+}
+
std::any InvalidPreparedModel::getUnderlyingResource() const {
return {};
}
diff --git a/neuralnetworks/utils/common/src/ResilientBuffer.cpp b/neuralnetworks/utils/common/src/ResilientBuffer.cpp
index cf5496a..47abbe2 100644
--- a/neuralnetworks/utils/common/src/ResilientBuffer.cpp
+++ b/neuralnetworks/utils/common/src/ResilientBuffer.cpp
@@ -20,6 +20,7 @@
#include <android-base/thread_annotations.h>
#include <nnapi/IBuffer.h>
#include <nnapi/Result.h>
+#include <nnapi/TypeUtils.h>
#include <nnapi/Types.h>
#include <functional>
@@ -29,6 +30,34 @@
#include <vector>
namespace android::hardware::neuralnetworks::utils {
+namespace {
+
+template <typename FnType>
+auto protect(const ResilientBuffer& resilientBuffer, const FnType& fn)
+ -> decltype(fn(*resilientBuffer.getBuffer())) {
+ auto buffer = resilientBuffer.getBuffer();
+ auto result = fn(*buffer);
+
+ // Immediately return if device is not dead.
+ if (result.has_value() || result.error().code != nn::ErrorStatus::DEAD_OBJECT) {
+ return result;
+ }
+
+ // Attempt recovery and return if it fails.
+ auto maybeBuffer = resilientBuffer.recover(buffer.get());
+ if (!maybeBuffer.has_value()) {
+ const auto& [resultErrorMessage, resultErrorCode] = result.error();
+ const auto& [recoveryErrorMessage, recoveryErrorCode] = maybeBuffer.error();
+ return nn::error(resultErrorCode)
+ << resultErrorMessage << ", and failed to recover dead buffer with error "
+ << recoveryErrorCode << ": " << recoveryErrorMessage;
+ }
+ buffer = std::move(maybeBuffer).value();
+
+ return fn(*buffer);
+}
+
+} // namespace
nn::GeneralResult<std::shared_ptr<const ResilientBuffer>> ResilientBuffer::create(
Factory makeBuffer) {
@@ -53,9 +82,16 @@
std::lock_guard guard(mMutex);
return mBuffer;
}
-nn::SharedBuffer ResilientBuffer::recover(const nn::IBuffer* /*failingBuffer*/,
- bool /*blocking*/) const {
+nn::GeneralResult<nn::SharedBuffer> ResilientBuffer::recover(
+ const nn::IBuffer* failingBuffer) const {
std::lock_guard guard(mMutex);
+
+ // Another caller updated the failing prepared model.
+ if (mBuffer.get() != failingBuffer) {
+ return mBuffer;
+ }
+
+ mBuffer = NN_TRY(kMakeBuffer());
return mBuffer;
}
@@ -64,12 +100,16 @@
}
nn::GeneralResult<void> ResilientBuffer::copyTo(const nn::Memory& dst) const {
- return getBuffer()->copyTo(dst);
+ const auto fn = [&dst](const nn::IBuffer& buffer) { return buffer.copyTo(dst); };
+ return protect(*this, fn);
}
nn::GeneralResult<void> ResilientBuffer::copyFrom(const nn::Memory& src,
const nn::Dimensions& dimensions) const {
- return getBuffer()->copyFrom(src, dimensions);
+ const auto fn = [&src, &dimensions](const nn::IBuffer& buffer) {
+ return buffer.copyFrom(src, dimensions);
+ };
+ return protect(*this, fn);
}
} // namespace android::hardware::neuralnetworks::utils
diff --git a/neuralnetworks/utils/common/src/ResilientBurst.cpp b/neuralnetworks/utils/common/src/ResilientBurst.cpp
new file mode 100644
index 0000000..0d3cb33
--- /dev/null
+++ b/neuralnetworks/utils/common/src/ResilientBurst.cpp
@@ -0,0 +1,109 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "ResilientBurst.h"
+
+#include <android-base/logging.h>
+#include <android-base/thread_annotations.h>
+#include <nnapi/IBurst.h>
+#include <nnapi/Result.h>
+#include <nnapi/TypeUtils.h>
+#include <nnapi/Types.h>
+
+#include <functional>
+#include <memory>
+#include <mutex>
+#include <optional>
+#include <utility>
+
+namespace android::hardware::neuralnetworks::utils {
+namespace {
+
+template <typename FnType>
+auto protect(const ResilientBurst& resilientBurst, const FnType& fn)
+ -> decltype(fn(*resilientBurst.getBurst())) {
+ auto burst = resilientBurst.getBurst();
+ auto result = fn(*burst);
+
+ // Immediately return if burst is not dead.
+ if (result.has_value() || result.error().code != nn::ErrorStatus::DEAD_OBJECT) {
+ return result;
+ }
+
+ // Attempt recovery and return if it fails.
+ auto maybeBurst = resilientBurst.recover(burst.get());
+ if (!maybeBurst.has_value()) {
+ auto [resultErrorMessage, resultErrorCode, resultOutputShapes] = std::move(result).error();
+ const auto& [recoveryErrorMessage, recoveryErrorCode] = maybeBurst.error();
+ return nn::error(resultErrorCode, std::move(resultOutputShapes))
+ << resultErrorMessage << ", and failed to recover dead burst object with error "
+ << recoveryErrorCode << ": " << recoveryErrorMessage;
+ }
+ burst = std::move(maybeBurst).value();
+
+ return fn(*burst);
+}
+
+} // namespace
+
+nn::GeneralResult<std::shared_ptr<const ResilientBurst>> ResilientBurst::create(Factory makeBurst) {
+ if (makeBurst == nullptr) {
+ return NN_ERROR(nn::ErrorStatus::INVALID_ARGUMENT)
+ << "utils::ResilientBurst::create must have non-empty makeBurst";
+ }
+ auto burst = NN_TRY(makeBurst());
+ CHECK(burst != nullptr);
+ return std::make_shared<ResilientBurst>(PrivateConstructorTag{}, std::move(makeBurst),
+ std::move(burst));
+}
+
+ResilientBurst::ResilientBurst(PrivateConstructorTag /*tag*/, Factory makeBurst,
+ nn::SharedBurst burst)
+ : kMakeBurst(std::move(makeBurst)), mBurst(std::move(burst)) {
+ CHECK(kMakeBurst != nullptr);
+ CHECK(mBurst != nullptr);
+}
+
+nn::SharedBurst ResilientBurst::getBurst() const {
+ std::lock_guard guard(mMutex);
+ return mBurst;
+}
+
+nn::GeneralResult<nn::SharedBurst> ResilientBurst::recover(const nn::IBurst* failingBurst) const {
+ std::lock_guard guard(mMutex);
+
+ // Another caller updated the failing burst.
+ if (mBurst.get() != failingBurst) {
+ return mBurst;
+ }
+
+ mBurst = NN_TRY(kMakeBurst());
+ return mBurst;
+}
+
+ResilientBurst::OptionalCacheHold ResilientBurst::cacheMemory(const nn::Memory& memory) const {
+ return getBurst()->cacheMemory(memory);
+}
+
+nn::ExecutionResult<std::pair<std::vector<nn::OutputShape>, nn::Timing>> ResilientBurst::execute(
+ const nn::Request& request, nn::MeasureTiming measure) const {
+ const auto fn = [&request, measure](const nn::IBurst& burst) {
+ return burst.execute(request, measure);
+ };
+ return protect(*this, fn);
+}
+
+} // namespace android::hardware::neuralnetworks::utils
diff --git a/neuralnetworks/utils/common/src/ResilientDevice.cpp b/neuralnetworks/utils/common/src/ResilientDevice.cpp
index 6ad3fad..13965af 100644
--- a/neuralnetworks/utils/common/src/ResilientDevice.cpp
+++ b/neuralnetworks/utils/common/src/ResilientDevice.cpp
@@ -122,12 +122,14 @@
};
if (compare(&IDevice::getName) || compare(&IDevice::getVersionString) ||
compare(&IDevice::getFeatureLevel) || compare(&IDevice::getType) ||
- compare(&IDevice::getSupportedExtensions) || compare(&IDevice::getCapabilities)) {
+ compare(&IDevice::isUpdatable) || compare(&IDevice::getSupportedExtensions) ||
+ compare(&IDevice::getCapabilities)) {
LOG(ERROR) << "Recovered device has different metadata than what is cached. Marking "
"IDevice object as invalid.";
device = std::make_shared<const InvalidDevice>(
- kName, kVersionString, mDevice->getFeatureLevel(), mDevice->getType(), kExtensions,
- kCapabilities, mDevice->getNumberOfCacheFilesNeeded());
+ kName, kVersionString, mDevice->getFeatureLevel(), mDevice->getType(),
+ mDevice->isUpdatable(), kExtensions, kCapabilities,
+ mDevice->getNumberOfCacheFilesNeeded());
mIsValid = false;
}
@@ -151,6 +153,10 @@
return getDevice()->getType();
}
+bool ResilientDevice::isUpdatable() const {
+ return getDevice()->isUpdatable();
+}
+
const std::vector<nn::Extension>& ResilientDevice::getSupportedExtensions() const {
return kExtensions;
}
@@ -180,6 +186,7 @@
const nn::Model& model, nn::ExecutionPreference preference, nn::Priority priority,
nn::OptionalTimePoint deadline, const std::vector<nn::SharedHandle>& modelCache,
const std::vector<nn::SharedHandle>& dataCache, const nn::CacheToken& token) const {
+#if 0
auto self = shared_from_this();
ResilientPreparedModel::Factory makePreparedModel = [device = std::move(self), model,
preference, priority, deadline, modelCache,
@@ -188,29 +195,41 @@
dataCache, token);
};
return ResilientPreparedModel::create(std::move(makePreparedModel));
+#else
+ return prepareModelInternal(model, preference, priority, deadline, modelCache, dataCache,
+ token);
+#endif
}
nn::GeneralResult<nn::SharedPreparedModel> ResilientDevice::prepareModelFromCache(
nn::OptionalTimePoint deadline, const std::vector<nn::SharedHandle>& modelCache,
const std::vector<nn::SharedHandle>& dataCache, const nn::CacheToken& token) const {
+#if 0
auto self = shared_from_this();
ResilientPreparedModel::Factory makePreparedModel = [device = std::move(self), deadline,
modelCache, dataCache, token] {
return device->prepareModelFromCacheInternal(deadline, modelCache, dataCache, token);
};
return ResilientPreparedModel::create(std::move(makePreparedModel));
+#else
+ return prepareModelFromCacheInternal(deadline, modelCache, dataCache, token);
+#endif
}
nn::GeneralResult<nn::SharedBuffer> ResilientDevice::allocate(
const nn::BufferDesc& desc, const std::vector<nn::SharedPreparedModel>& preparedModels,
const std::vector<nn::BufferRole>& inputRoles,
const std::vector<nn::BufferRole>& outputRoles) const {
+#if 0
auto self = shared_from_this();
ResilientBuffer::Factory makeBuffer = [device = std::move(self), desc, preparedModels,
inputRoles, outputRoles] {
return device->allocateInternal(desc, preparedModels, inputRoles, outputRoles);
};
return ResilientBuffer::create(std::move(makeBuffer));
+#else
+ return allocateInternal(desc, preparedModels, inputRoles, outputRoles);
+#endif
}
bool ResilientDevice::isValidInternal() const {
@@ -225,8 +244,8 @@
if (!isValidInternal()) {
return std::make_shared<const InvalidPreparedModel>();
}
- const auto fn = [&model, preference, priority, deadline, &modelCache, &dataCache,
- token](const nn::IDevice& device) {
+ const auto fn = [&model, preference, priority, &deadline, &modelCache, &dataCache,
+ &token](const nn::IDevice& device) {
return device.prepareModel(model, preference, priority, deadline, modelCache, dataCache,
token);
};
@@ -239,7 +258,7 @@
if (!isValidInternal()) {
return std::make_shared<const InvalidPreparedModel>();
}
- const auto fn = [deadline, &modelCache, &dataCache, token](const nn::IDevice& device) {
+ const auto fn = [&deadline, &modelCache, &dataCache, &token](const nn::IDevice& device) {
return device.prepareModelFromCache(deadline, modelCache, dataCache, token);
};
return protect(*this, fn, /*blocking=*/false);
diff --git a/neuralnetworks/utils/common/src/ResilientPreparedModel.cpp b/neuralnetworks/utils/common/src/ResilientPreparedModel.cpp
index b8acee1..5dd5f99 100644
--- a/neuralnetworks/utils/common/src/ResilientPreparedModel.cpp
+++ b/neuralnetworks/utils/common/src/ResilientPreparedModel.cpp
@@ -16,19 +16,52 @@
#include "ResilientPreparedModel.h"
+#include "InvalidBurst.h"
+#include "ResilientBurst.h"
+
#include <android-base/logging.h>
#include <android-base/thread_annotations.h>
#include <nnapi/IPreparedModel.h>
#include <nnapi/Result.h>
+#include <nnapi/TypeUtils.h>
#include <nnapi/Types.h>
#include <functional>
#include <memory>
#include <mutex>
+#include <sstream>
#include <utility>
#include <vector>
namespace android::hardware::neuralnetworks::utils {
+namespace {
+
+template <typename FnType>
+auto protect(const ResilientPreparedModel& resilientPreparedModel, const FnType& fn)
+ -> decltype(fn(*resilientPreparedModel.getPreparedModel())) {
+ auto preparedModel = resilientPreparedModel.getPreparedModel();
+ auto result = fn(*preparedModel);
+
+ // Immediately return if prepared model is not dead.
+ if (result.has_value() || result.error().code != nn::ErrorStatus::DEAD_OBJECT) {
+ return result;
+ }
+
+ // Attempt recovery and return if it fails.
+ auto maybePreparedModel = resilientPreparedModel.recover(preparedModel.get());
+ if (!maybePreparedModel.has_value()) {
+ const auto& [message, code] = maybePreparedModel.error();
+ std::ostringstream oss;
+ oss << ", and failed to recover dead prepared model with error " << code << ": " << message;
+ result.error().message += oss.str();
+ return result;
+ }
+ preparedModel = std::move(maybePreparedModel).value();
+
+ return fn(*preparedModel);
+}
+
+} // namespace
nn::GeneralResult<std::shared_ptr<const ResilientPreparedModel>> ResilientPreparedModel::create(
Factory makePreparedModel) {
@@ -55,9 +88,16 @@
return mPreparedModel;
}
-nn::SharedPreparedModel ResilientPreparedModel::recover(
- const nn::IPreparedModel* /*failingPreparedModel*/, bool /*blocking*/) const {
+nn::GeneralResult<nn::SharedPreparedModel> ResilientPreparedModel::recover(
+ const nn::IPreparedModel* failingPreparedModel) const {
std::lock_guard guard(mMutex);
+
+ // Another caller updated the failing prepared model.
+ if (mPreparedModel.get() != failingPreparedModel) {
+ return mPreparedModel;
+ }
+
+ mPreparedModel = NN_TRY(kMakePreparedModel());
return mPreparedModel;
}
@@ -65,7 +105,11 @@
ResilientPreparedModel::execute(const nn::Request& request, nn::MeasureTiming measure,
const nn::OptionalTimePoint& deadline,
const nn::OptionalDuration& loopTimeoutDuration) const {
- return getPreparedModel()->execute(request, measure, deadline, loopTimeoutDuration);
+ const auto fn = [&request, measure, &deadline,
+ &loopTimeoutDuration](const nn::IPreparedModel& preparedModel) {
+ return preparedModel.execute(request, measure, deadline, loopTimeoutDuration);
+ };
+ return protect(*this, fn);
}
nn::GeneralResult<std::pair<nn::SyncFence, nn::ExecuteFencedInfoCallback>>
@@ -75,12 +119,43 @@
const nn::OptionalTimePoint& deadline,
const nn::OptionalDuration& loopTimeoutDuration,
const nn::OptionalDuration& timeoutDurationAfterFence) const {
- return getPreparedModel()->executeFenced(request, waitFor, measure, deadline,
- loopTimeoutDuration, timeoutDurationAfterFence);
+ const auto fn = [&request, &waitFor, measure, &deadline, &loopTimeoutDuration,
+ &timeoutDurationAfterFence](const nn::IPreparedModel& preparedModel) {
+ return preparedModel.executeFenced(request, waitFor, measure, deadline, loopTimeoutDuration,
+ timeoutDurationAfterFence);
+ };
+ return protect(*this, fn);
+}
+
+nn::GeneralResult<nn::SharedBurst> ResilientPreparedModel::configureExecutionBurst() const {
+#if 0
+ auto self = shared_from_this();
+ ResilientBurst::Factory makeBurst =
+ [preparedModel = std::move(self)]() -> nn::GeneralResult<nn::SharedBurst> {
+ return preparedModel->configureExecutionBurst();
+ };
+ return ResilientBurst::create(std::move(makeBurst));
+#else
+ return configureExecutionBurstInternal();
+#endif
}
std::any ResilientPreparedModel::getUnderlyingResource() const {
return getPreparedModel()->getUnderlyingResource();
}
+bool ResilientPreparedModel::isValidInternal() const {
+ return true;
+}
+
+nn::GeneralResult<nn::SharedBurst> ResilientPreparedModel::configureExecutionBurstInternal() const {
+ if (!isValidInternal()) {
+ return std::make_shared<const InvalidBurst>();
+ }
+ const auto fn = [](const nn::IPreparedModel& preparedModel) {
+ return preparedModel.configureExecutionBurst();
+ };
+ return protect(*this, fn);
+}
+
} // namespace android::hardware::neuralnetworks::utils
diff --git a/neuralnetworks/utils/common/test/MockBuffer.h b/neuralnetworks/utils/common/test/MockBuffer.h
new file mode 100644
index 0000000..c5405fb
--- /dev/null
+++ b/neuralnetworks/utils/common/test/MockBuffer.h
@@ -0,0 +1,37 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_UTILS_COMMON_TEST_MOCK_BUFFER
+#define ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_UTILS_COMMON_TEST_MOCK_BUFFER
+
+#include <gmock/gmock.h>
+#include <gtest/gtest.h>
+#include <nnapi/IBuffer.h>
+#include <nnapi/Types.h>
+
+namespace android::nn {
+
+class MockBuffer final : public IBuffer {
+ public:
+ MOCK_METHOD(Request::MemoryDomainToken, getToken, (), (const, override));
+ MOCK_METHOD(GeneralResult<void>, copyTo, (const Memory& dst), (const, override));
+ MOCK_METHOD(GeneralResult<void>, copyFrom, (const Memory& src, const Dimensions& dimensions),
+ (const, override));
+};
+
+} // namespace android::nn
+
+#endif // ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_UTILS_COMMON_TEST_MOCK_BUFFER
diff --git a/neuralnetworks/utils/common/test/MockDevice.h b/neuralnetworks/utils/common/test/MockDevice.h
new file mode 100644
index 0000000..5566968
--- /dev/null
+++ b/neuralnetworks/utils/common/test/MockDevice.h
@@ -0,0 +1,58 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_UTILS_COMMON_TEST_MOCK_DEVICE
+#define ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_UTILS_COMMON_TEST_MOCK_DEVICE
+
+#include <gmock/gmock.h>
+#include <gtest/gtest.h>
+#include <nnapi/IDevice.h>
+
+namespace android::nn {
+
+class MockDevice final : public IDevice {
+ public:
+ MOCK_METHOD(const std::string&, getName, (), (const, override));
+ MOCK_METHOD(const std::string&, getVersionString, (), (const, override));
+ MOCK_METHOD(Version, getFeatureLevel, (), (const, override));
+ MOCK_METHOD(DeviceType, getType, (), (const, override));
+ MOCK_METHOD(bool, isUpdatable, (), (const, override));
+ MOCK_METHOD(const std::vector<Extension>&, getSupportedExtensions, (), (const, override));
+ MOCK_METHOD(const Capabilities&, getCapabilities, (), (const, override));
+ MOCK_METHOD((std::pair<uint32_t, uint32_t>), getNumberOfCacheFilesNeeded, (),
+ (const, override));
+ MOCK_METHOD(GeneralResult<void>, wait, (), (const, override));
+ MOCK_METHOD(GeneralResult<std::vector<bool>>, getSupportedOperations, (const Model& model),
+ (const, override));
+ MOCK_METHOD(GeneralResult<SharedPreparedModel>, prepareModel,
+ (const Model& model, ExecutionPreference preference, Priority priority,
+ OptionalTimePoint deadline, const std::vector<SharedHandle>& modelCache,
+ const std::vector<SharedHandle>& dataCache, const CacheToken& token),
+ (const, override));
+ MOCK_METHOD(GeneralResult<SharedPreparedModel>, prepareModelFromCache,
+ (OptionalTimePoint deadline, const std::vector<SharedHandle>& modelCache,
+ const std::vector<SharedHandle>& dataCache, const CacheToken& token),
+ (const, override));
+ MOCK_METHOD(GeneralResult<SharedBuffer>, allocate,
+ (const BufferDesc& desc, const std::vector<SharedPreparedModel>& preparedModels,
+ const std::vector<BufferRole>& inputRoles,
+ const std::vector<BufferRole>& outputRoles),
+ (const, override));
+};
+
+} // namespace android::nn
+
+#endif // ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_UTILS_COMMON_TEST_MOCK_DEVICE
diff --git a/neuralnetworks/utils/common/test/MockPreparedModel.h b/neuralnetworks/utils/common/test/MockPreparedModel.h
new file mode 100644
index 0000000..418af61
--- /dev/null
+++ b/neuralnetworks/utils/common/test/MockPreparedModel.h
@@ -0,0 +1,44 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_UTILS_COMMON_TEST_MOCK_PREPARED_MODEL
+#define ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_UTILS_COMMON_TEST_MOCK_PREPARED_MODEL
+
+#include <gmock/gmock.h>
+#include <gtest/gtest.h>
+#include <nnapi/IPreparedModel.h>
+
+namespace android::nn {
+
+class MockPreparedModel final : public IPreparedModel {
+ public:
+ MOCK_METHOD((ExecutionResult<std::pair<std::vector<OutputShape>, Timing>>), execute,
+ (const Request& request, MeasureTiming measure, const OptionalTimePoint& deadline,
+ const OptionalDuration& loopTimeoutDuration),
+ (const, override));
+ MOCK_METHOD((GeneralResult<std::pair<SyncFence, ExecuteFencedInfoCallback>>), executeFenced,
+ (const Request& request, const std::vector<SyncFence>& waitFor,
+ MeasureTiming measure, const OptionalTimePoint& deadline,
+ const OptionalDuration& loopTimeoutDuration,
+ const OptionalDuration& timeoutDurationAfterFence),
+ (const, override));
+ MOCK_METHOD(GeneralResult<SharedBurst>, configureExecutionBurst, (), (const, override));
+ MOCK_METHOD(std::any, getUnderlyingResource, (), (const, override));
+};
+
+} // namespace android::nn
+
+#endif // ANDROID_HARDWARE_INTERFACES_NEURALNETWORKS_UTILS_COMMON_TEST_MOCK_PREPARED_MODEL
diff --git a/neuralnetworks/utils/common/test/ResilientBufferTest.cpp b/neuralnetworks/utils/common/test/ResilientBufferTest.cpp
new file mode 100644
index 0000000..deb9b7c
--- /dev/null
+++ b/neuralnetworks/utils/common/test/ResilientBufferTest.cpp
@@ -0,0 +1,266 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <gmock/gmock.h>
+#include <nnapi/TypeUtils.h>
+#include <nnapi/Types.h>
+#include <nnapi/hal/ResilientBuffer.h>
+#include <tuple>
+#include <utility>
+#include "MockBuffer.h"
+
+namespace android::hardware::neuralnetworks::utils {
+namespace {
+
+using ::testing::_;
+using ::testing::InvokeWithoutArgs;
+using ::testing::Return;
+
+constexpr auto kToken = nn::Request::MemoryDomainToken{1};
+
+using SharedMockBuffer = std::shared_ptr<const nn::MockBuffer>;
+using MockBufferFactory = ::testing::MockFunction<nn::GeneralResult<nn::SharedBuffer>()>;
+
+SharedMockBuffer createConfiguredMockBuffer() {
+ return std::make_shared<const nn::MockBuffer>();
+}
+
+std::tuple<std::shared_ptr<const nn::MockBuffer>, std::unique_ptr<MockBufferFactory>,
+ std::shared_ptr<const ResilientBuffer>>
+setup() {
+ auto mockBuffer = std::make_shared<const nn::MockBuffer>();
+
+ auto mockBufferFactory = std::make_unique<MockBufferFactory>();
+ EXPECT_CALL(*mockBufferFactory, Call()).Times(1).WillOnce(Return(mockBuffer));
+
+ auto buffer = ResilientBuffer::create(mockBufferFactory->AsStdFunction()).value();
+ return std::make_tuple(std::move(mockBuffer), std::move(mockBufferFactory), std::move(buffer));
+}
+
+constexpr auto makeError = [](nn::ErrorStatus status) {
+ return [status](const auto&... /*args*/) { return nn::error(status); };
+};
+const auto kReturnGeneralFailure = makeError(nn::ErrorStatus::GENERAL_FAILURE);
+const auto kReturnDeadObject = makeError(nn::ErrorStatus::DEAD_OBJECT);
+
+const auto kNoError = nn::GeneralResult<void>{};
+
+} // namespace
+
+TEST(ResilientBufferTest, invalidBufferFactory) {
+ // setup call
+ const auto invalidBufferFactory = ResilientBuffer::Factory{};
+
+ // run test
+ const auto result = ResilientBuffer::create(invalidBufferFactory);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::INVALID_ARGUMENT);
+}
+
+TEST(ResilientBufferTest, bufferFactoryFailure) {
+ // setup call
+ const auto invalidBufferFactory = kReturnGeneralFailure;
+
+ // run test
+ const auto result = ResilientBuffer::create(invalidBufferFactory);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(ResilientBufferTest, getBuffer) {
+ // setup call
+ const auto [mockBuffer, mockBufferFactory, buffer] = setup();
+
+ // run test
+ const auto result = buffer->getBuffer();
+
+ // verify result
+ EXPECT_TRUE(result == mockBuffer);
+}
+
+TEST(ResilientBufferTest, getToken) {
+ // setup call
+ const auto [mockBuffer, mockBufferFactory, buffer] = setup();
+ EXPECT_CALL(*mockBuffer, getToken()).Times(1).WillOnce(Return(kToken));
+
+ // run test
+ const auto token = buffer->getToken();
+
+ // verify result
+ EXPECT_EQ(token, kToken);
+}
+
+TEST(ResilientBufferTest, copyTo) {
+ // setup call
+ const auto [mockBuffer, mockBufferFactory, buffer] = setup();
+ EXPECT_CALL(*mockBuffer, copyTo(_)).Times(1).WillOnce(Return(kNoError));
+
+ // run test
+ const auto result = buffer->copyTo({});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(ResilientBufferTest, copyToError) {
+ // setup call
+ const auto [mockBuffer, mockBufferFactory, buffer] = setup();
+ EXPECT_CALL(*mockBuffer, copyTo(_)).Times(1).WillOnce(kReturnGeneralFailure);
+
+ // run test
+ const auto result = buffer->copyTo({});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(ResilientBufferTest, copyToDeadObjectFailedRecovery) {
+ // setup call
+ const auto [mockBuffer, mockBufferFactory, buffer] = setup();
+ EXPECT_CALL(*mockBuffer, copyTo(_)).Times(1).WillOnce(kReturnDeadObject);
+ EXPECT_CALL(*mockBufferFactory, Call()).Times(1).WillOnce(kReturnGeneralFailure);
+
+ // run test
+ const auto result = buffer->copyTo({});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(ResilientBufferTest, copyToDeadObjectSuccessfulRecovery) {
+ // setup call
+ const auto [mockBuffer, mockBufferFactory, buffer] = setup();
+ EXPECT_CALL(*mockBuffer, copyTo(_)).Times(1).WillOnce(kReturnDeadObject);
+ const auto recoveredMockBuffer = createConfiguredMockBuffer();
+ EXPECT_CALL(*recoveredMockBuffer, copyTo(_)).Times(1).WillOnce(Return(kNoError));
+ EXPECT_CALL(*mockBufferFactory, Call()).Times(1).WillOnce(Return(recoveredMockBuffer));
+
+ // run test
+ const auto result = buffer->copyTo({});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(ResilientBufferTest, copyFrom) {
+ // setup call
+ const auto [mockBuffer, mockBufferFactory, buffer] = setup();
+ EXPECT_CALL(*mockBuffer, copyFrom(_, _)).Times(1).WillOnce(Return(kNoError));
+
+ // run test
+ const auto result = buffer->copyFrom({}, {});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(ResilientBufferTest, copyFromError) {
+ // setup call
+ const auto [mockBuffer, mockBufferFactory, buffer] = setup();
+ EXPECT_CALL(*mockBuffer, copyFrom(_, _)).Times(1).WillOnce(kReturnGeneralFailure);
+
+ // run test
+ const auto result = buffer->copyFrom({}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(ResilientBufferTest, copyFromDeadObjectFailedRecovery) {
+ // setup call
+ const auto [mockBuffer, mockBufferFactory, buffer] = setup();
+ EXPECT_CALL(*mockBuffer, copyFrom(_, _)).Times(1).WillOnce(kReturnDeadObject);
+ EXPECT_CALL(*mockBufferFactory, Call()).Times(1).WillOnce(kReturnGeneralFailure);
+
+ // run test
+ const auto result = buffer->copyFrom({}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(ResilientBufferTest, copyFromDeadObjectSuccessfulRecovery) {
+ // setup call
+ const auto [mockBuffer, mockBufferFactory, buffer] = setup();
+ EXPECT_CALL(*mockBuffer, copyFrom(_, _)).Times(1).WillOnce(kReturnDeadObject);
+ const auto recoveredMockBuffer = createConfiguredMockBuffer();
+ EXPECT_CALL(*recoveredMockBuffer, copyFrom(_, _)).Times(1).WillOnce(Return(kNoError));
+ EXPECT_CALL(*mockBufferFactory, Call()).Times(1).WillOnce(Return(recoveredMockBuffer));
+
+ // run test
+ const auto result = buffer->copyFrom({}, {});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(ResilientBufferTest, recover) {
+ // setup call
+ const auto [mockBuffer, mockBufferFactory, buffer] = setup();
+ const auto recoveredMockBuffer = createConfiguredMockBuffer();
+ EXPECT_CALL(*mockBufferFactory, Call()).Times(1).WillOnce(Return(recoveredMockBuffer));
+
+ // run test
+ const auto result = buffer->recover(mockBuffer.get());
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ EXPECT_TRUE(result.value() == recoveredMockBuffer);
+}
+
+TEST(ResilientBufferTest, recoverFailure) {
+ // setup call
+ const auto [mockBuffer, mockBufferFactory, buffer] = setup();
+ const auto recoveredMockBuffer = createConfiguredMockBuffer();
+ EXPECT_CALL(*mockBufferFactory, Call()).Times(1).WillOnce(kReturnGeneralFailure);
+
+ // run test
+ const auto result = buffer->recover(mockBuffer.get());
+
+ // verify result
+ EXPECT_FALSE(result.has_value());
+}
+
+TEST(ResilientBufferTest, someoneElseRecovered) {
+ // setup call
+ const auto [mockBuffer, mockBufferFactory, buffer] = setup();
+ const auto recoveredMockBuffer = createConfiguredMockBuffer();
+ EXPECT_CALL(*mockBufferFactory, Call()).Times(1).WillOnce(Return(recoveredMockBuffer));
+ buffer->recover(mockBuffer.get());
+
+ // run test
+ const auto result = buffer->recover(mockBuffer.get());
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ EXPECT_TRUE(result.value() == recoveredMockBuffer);
+}
+
+} // namespace android::hardware::neuralnetworks::utils
diff --git a/neuralnetworks/utils/common/test/ResilientDeviceTest.cpp b/neuralnetworks/utils/common/test/ResilientDeviceTest.cpp
new file mode 100644
index 0000000..3abd724
--- /dev/null
+++ b/neuralnetworks/utils/common/test/ResilientDeviceTest.cpp
@@ -0,0 +1,725 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <gmock/gmock.h>
+#include <nnapi/TypeUtils.h>
+#include <nnapi/Types.h>
+#include <nnapi/hal/ResilientDevice.h>
+#include <tuple>
+#include <utility>
+#include "MockBuffer.h"
+#include "MockDevice.h"
+#include "MockPreparedModel.h"
+
+namespace android::hardware::neuralnetworks::utils {
+namespace {
+
+using ::testing::_;
+using ::testing::InvokeWithoutArgs;
+using ::testing::Return;
+
+using SharedMockDevice = std::shared_ptr<const nn::MockDevice>;
+using MockDeviceFactory = ::testing::MockFunction<nn::GeneralResult<nn::SharedDevice>(bool)>;
+
+const std::string kName = "Google-MockV1";
+const std::string kVersionString = "version1";
+const auto kExtensions = std::vector<nn::Extension>{};
+constexpr auto kNoInfo = std::numeric_limits<float>::max();
+constexpr auto kNoPerformanceInfo =
+ nn::Capabilities::PerformanceInfo{.execTime = kNoInfo, .powerUsage = kNoInfo};
+const auto kCapabilities = nn::Capabilities{
+ .relaxedFloat32toFloat16PerformanceScalar = kNoPerformanceInfo,
+ .relaxedFloat32toFloat16PerformanceTensor = kNoPerformanceInfo,
+ .operandPerformance = nn::Capabilities::OperandPerformanceTable::create({}).value(),
+ .ifPerformance = kNoPerformanceInfo,
+ .whilePerformance = kNoPerformanceInfo};
+constexpr auto kNumberOfCacheFilesNeeded = std::pair<uint32_t, uint32_t>(5, 3);
+
+SharedMockDevice createConfiguredMockDevice() {
+ auto mockDevice = std::make_shared<const nn::MockDevice>();
+
+ // Setup default actions for each relevant call.
+ constexpr auto getName_ret = []() -> const std::string& { return kName; };
+ constexpr auto getVersionString_ret = []() -> const std::string& { return kVersionString; };
+ constexpr auto kFeatureLevel = nn::Version::ANDROID_OC_MR1;
+ constexpr auto kDeviceType = nn::DeviceType::ACCELERATOR;
+ constexpr auto getSupportedExtensions_ret = []() -> const std::vector<nn::Extension>& {
+ return kExtensions;
+ };
+ constexpr auto getCapabilities_ret = []() -> const nn::Capabilities& { return kCapabilities; };
+
+ // Setup default actions for each relevant call.
+ ON_CALL(*mockDevice, getName()).WillByDefault(getName_ret);
+ ON_CALL(*mockDevice, getVersionString()).WillByDefault(getVersionString_ret);
+ ON_CALL(*mockDevice, getFeatureLevel()).WillByDefault(Return(kFeatureLevel));
+ ON_CALL(*mockDevice, getType()).WillByDefault(Return(kDeviceType));
+ ON_CALL(*mockDevice, getSupportedExtensions()).WillByDefault(getSupportedExtensions_ret);
+ ON_CALL(*mockDevice, getCapabilities()).WillByDefault(getCapabilities_ret);
+ ON_CALL(*mockDevice, getNumberOfCacheFilesNeeded())
+ .WillByDefault(Return(kNumberOfCacheFilesNeeded));
+
+ // These EXPECT_CALL(...).Times(testing::AnyNumber()) calls are to suppress warnings on the
+ // uninteresting methods calls.
+ EXPECT_CALL(*mockDevice, getName()).Times(testing::AnyNumber());
+ EXPECT_CALL(*mockDevice, getVersionString()).Times(testing::AnyNumber());
+ EXPECT_CALL(*mockDevice, getFeatureLevel()).Times(testing::AnyNumber());
+ EXPECT_CALL(*mockDevice, getType()).Times(testing::AnyNumber());
+ EXPECT_CALL(*mockDevice, getSupportedExtensions()).Times(testing::AnyNumber());
+ EXPECT_CALL(*mockDevice, getCapabilities()).Times(testing::AnyNumber());
+ EXPECT_CALL(*mockDevice, getNumberOfCacheFilesNeeded()).Times(testing::AnyNumber());
+
+ return mockDevice;
+}
+
+std::tuple<SharedMockDevice, std::unique_ptr<MockDeviceFactory>,
+ std::shared_ptr<const ResilientDevice>>
+setup() {
+ auto mockDevice = createConfiguredMockDevice();
+
+ auto mockDeviceFactory = std::make_unique<MockDeviceFactory>();
+ EXPECT_CALL(*mockDeviceFactory, Call(true)).Times(1).WillOnce(Return(mockDevice));
+
+ auto device = ResilientDevice::create(mockDeviceFactory->AsStdFunction()).value();
+ return std::make_tuple(std::move(mockDevice), std::move(mockDeviceFactory), std::move(device));
+}
+
+constexpr auto makeError = [](nn::ErrorStatus status) {
+ return [status](const auto&... /*args*/) { return nn::error(status); };
+};
+const auto kReturnGeneralFailure = makeError(nn::ErrorStatus::GENERAL_FAILURE);
+const auto kReturnDeadObject = makeError(nn::ErrorStatus::DEAD_OBJECT);
+
+} // namespace
+
+TEST(ResilientDeviceTest, invalidDeviceFactory) {
+ // setup call
+ const auto invalidDeviceFactory = ResilientDevice::Factory{};
+
+ // run test
+ const auto result = ResilientDevice::create(invalidDeviceFactory);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::INVALID_ARGUMENT);
+}
+
+TEST(ResilientDeviceTest, preparedModelFactoryFailure) {
+ // setup call
+ const auto invalidDeviceFactory = kReturnGeneralFailure;
+
+ // run test
+ const auto result = ResilientDevice::create(invalidDeviceFactory);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(ResilientDeviceTest, cachedData) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+
+ // run test and verify results
+ EXPECT_EQ(device->getName(), kName);
+ EXPECT_EQ(device->getVersionString(), kVersionString);
+ EXPECT_EQ(device->getSupportedExtensions(), kExtensions);
+ EXPECT_EQ(device->getCapabilities(), kCapabilities);
+}
+
+TEST(ResilientDeviceTest, getFeatureLevel) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ constexpr auto kFeatureLevel = nn::Version::ANDROID_OC_MR1;
+ EXPECT_CALL(*mockDevice, getFeatureLevel()).Times(1).WillOnce(Return(kFeatureLevel));
+
+ // run test
+ const auto featureLevel = device->getFeatureLevel();
+
+ // verify results
+ EXPECT_EQ(featureLevel, kFeatureLevel);
+}
+
+TEST(ResilientDeviceTest, getType) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ constexpr auto kDeviceType = nn::DeviceType::ACCELERATOR;
+ EXPECT_CALL(*mockDevice, getType()).Times(1).WillOnce(Return(kDeviceType));
+
+ // run test
+ const auto type = device->getType();
+
+ // verify results
+ EXPECT_EQ(type, kDeviceType);
+}
+
+TEST(ResilientDeviceTest, getNumberOfCacheFilesNeeded) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ EXPECT_CALL(*mockDevice, getNumberOfCacheFilesNeeded())
+ .Times(1)
+ .WillOnce(Return(kNumberOfCacheFilesNeeded));
+
+ // run test
+ const auto numberOfCacheFilesNeeded = device->getNumberOfCacheFilesNeeded();
+
+ // verify results
+ EXPECT_EQ(numberOfCacheFilesNeeded, kNumberOfCacheFilesNeeded);
+}
+
+TEST(ResilientDeviceTest, getDevice) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+
+ // run test
+ const auto result = device->getDevice();
+
+ // verify result
+ EXPECT_TRUE(result == mockDevice);
+}
+
+TEST(ResilientDeviceTest, wait) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ EXPECT_CALL(*mockDevice, wait()).Times(1).WillOnce(Return(nn::GeneralResult<void>{}));
+
+ // run test
+ const auto result = device->wait();
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(ResilientDeviceTest, waitError) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ EXPECT_CALL(*mockDevice, wait()).Times(1).WillOnce(kReturnGeneralFailure);
+
+ // run test
+ const auto result = device->wait();
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(ResilientDeviceTest, waitDeadObjectFailedRecovery) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ EXPECT_CALL(*mockDevice, wait()).Times(1).WillOnce(kReturnDeadObject);
+ EXPECT_CALL(*mockDeviceFactory, Call(true)).Times(1).WillOnce(kReturnGeneralFailure);
+
+ // run test
+ const auto result = device->wait();
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(ResilientDeviceTest, waitDeadObjectSuccessfulRecovery) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ EXPECT_CALL(*mockDevice, wait()).Times(1).WillOnce(kReturnDeadObject);
+ const auto recoveredMockDevice = createConfiguredMockDevice();
+ EXPECT_CALL(*recoveredMockDevice, wait()).Times(1).WillOnce(Return(nn::GeneralResult<void>{}));
+ EXPECT_CALL(*mockDeviceFactory, Call(true)).Times(1).WillOnce(Return(recoveredMockDevice));
+
+ // run test
+ const auto result = device->wait();
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(ResilientDeviceTest, getSupportedOperations) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ EXPECT_CALL(*mockDevice, getSupportedOperations(_))
+ .Times(1)
+ .WillOnce(Return(nn::GeneralResult<std::vector<bool>>{}));
+
+ // run test
+ const auto result = device->getSupportedOperations({});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(ResilientDeviceTest, getSupportedOperationsError) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ EXPECT_CALL(*mockDevice, getSupportedOperations(_)).Times(1).WillOnce(kReturnGeneralFailure);
+
+ // run test
+ const auto result = device->getSupportedOperations({});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(ResilientDeviceTest, getSupportedOperationsDeadObjectFailedRecovery) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ EXPECT_CALL(*mockDevice, getSupportedOperations(_)).Times(1).WillOnce(kReturnDeadObject);
+ EXPECT_CALL(*mockDeviceFactory, Call(false)).Times(1).WillOnce(kReturnGeneralFailure);
+
+ // run test
+ const auto result = device->getSupportedOperations({});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(ResilientDeviceTest, getSupportedOperationsDeadObjectSuccessfulRecovery) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ EXPECT_CALL(*mockDevice, getSupportedOperations(_)).Times(1).WillOnce(kReturnDeadObject);
+ const auto recoveredMockDevice = createConfiguredMockDevice();
+ EXPECT_CALL(*recoveredMockDevice, getSupportedOperations(_))
+ .Times(1)
+ .WillOnce(Return(nn::GeneralResult<std::vector<bool>>{}));
+ EXPECT_CALL(*mockDeviceFactory, Call(false)).Times(1).WillOnce(Return(recoveredMockDevice));
+
+ // run test
+ const auto result = device->getSupportedOperations({});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(ResilientDeviceTest, prepareModel) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ const auto mockPreparedModel = std::make_shared<const nn::MockPreparedModel>();
+ EXPECT_CALL(*mockDevice, prepareModel(_, _, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(Return(mockPreparedModel));
+
+ // run test
+ const auto result = device->prepareModel({}, {}, {}, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(ResilientDeviceTest, prepareModelError) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ EXPECT_CALL(*mockDevice, prepareModel(_, _, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(kReturnGeneralFailure);
+
+ // run test
+ const auto result = device->prepareModel({}, {}, {}, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(ResilientDeviceTest, prepareModelDeadObjectFailedRecovery) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ EXPECT_CALL(*mockDevice, prepareModel(_, _, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(kReturnDeadObject);
+ EXPECT_CALL(*mockDeviceFactory, Call(false)).Times(1).WillOnce(kReturnGeneralFailure);
+
+ // run test
+ const auto result = device->prepareModel({}, {}, {}, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(ResilientDeviceTest, prepareModelDeadObjectSuccessfulRecovery) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ EXPECT_CALL(*mockDevice, prepareModel(_, _, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(kReturnDeadObject);
+ const auto recoveredMockDevice = createConfiguredMockDevice();
+ const auto mockPreparedModel = std::make_shared<const nn::MockPreparedModel>();
+ EXPECT_CALL(*recoveredMockDevice, prepareModel(_, _, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(Return(mockPreparedModel));
+ EXPECT_CALL(*mockDeviceFactory, Call(false)).Times(1).WillOnce(Return(recoveredMockDevice));
+
+ // run test
+ const auto result = device->prepareModel({}, {}, {}, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(ResilientDeviceTest, prepareModelFromCache) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ const auto mockPreparedModel = std::make_shared<const nn::MockPreparedModel>();
+ EXPECT_CALL(*mockDevice, prepareModelFromCache(_, _, _, _))
+ .Times(1)
+ .WillOnce(Return(mockPreparedModel));
+
+ // run test
+ const auto result = device->prepareModelFromCache({}, {}, {}, {});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(ResilientDeviceTest, prepareModelFromCacheError) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ EXPECT_CALL(*mockDevice, prepareModelFromCache(_, _, _, _))
+ .Times(1)
+ .WillOnce(kReturnGeneralFailure);
+
+ // run test
+ const auto result = device->prepareModelFromCache({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(ResilientDeviceTest, prepareModelFromCacheDeadObjectFailedRecovery) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ EXPECT_CALL(*mockDevice, prepareModelFromCache(_, _, _, _))
+ .Times(1)
+ .WillOnce(kReturnDeadObject);
+ EXPECT_CALL(*mockDeviceFactory, Call(false)).Times(1).WillOnce(kReturnGeneralFailure);
+
+ // run test
+ const auto result = device->prepareModelFromCache({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(ResilientDeviceTest, prepareModelFromCacheDeadObjectSuccessfulRecovery) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ EXPECT_CALL(*mockDevice, prepareModelFromCache(_, _, _, _))
+ .Times(1)
+ .WillOnce(kReturnDeadObject);
+ const auto recoveredMockDevice = createConfiguredMockDevice();
+ const auto mockPreparedModel = std::make_shared<const nn::MockPreparedModel>();
+ EXPECT_CALL(*recoveredMockDevice, prepareModelFromCache(_, _, _, _))
+ .Times(1)
+ .WillOnce(Return(mockPreparedModel));
+ EXPECT_CALL(*mockDeviceFactory, Call(false)).Times(1).WillOnce(Return(recoveredMockDevice));
+
+ // run test
+ const auto result = device->prepareModelFromCache({}, {}, {}, {});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(ResilientDeviceTest, allocate) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ const auto mockBuffer = std::make_shared<const nn::MockBuffer>();
+ EXPECT_CALL(*mockDevice, allocate(_, _, _, _)).Times(1).WillOnce(Return(mockBuffer));
+
+ // run test
+ const auto result = device->allocate({}, {}, {}, {});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(ResilientDeviceTest, allocateError) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ EXPECT_CALL(*mockDevice, allocate(_, _, _, _)).Times(1).WillOnce(kReturnGeneralFailure);
+
+ // run test
+ const auto result = device->allocate({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(ResilientDeviceTest, allocateDeadObjectFailedRecovery) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ EXPECT_CALL(*mockDevice, allocate(_, _, _, _)).Times(1).WillOnce(kReturnDeadObject);
+ EXPECT_CALL(*mockDeviceFactory, Call(false)).Times(1).WillOnce(kReturnGeneralFailure);
+
+ // run test
+ const auto result = device->allocate({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(ResilientDeviceTest, allocateDeadObjectSuccessfulRecovery) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ EXPECT_CALL(*mockDevice, allocate(_, _, _, _)).Times(1).WillOnce(kReturnDeadObject);
+ const auto recoveredMockDevice = createConfiguredMockDevice();
+ const auto mockBuffer = std::make_shared<const nn::MockBuffer>();
+ EXPECT_CALL(*recoveredMockDevice, allocate(_, _, _, _)).Times(1).WillOnce(Return(mockBuffer));
+ EXPECT_CALL(*mockDeviceFactory, Call(false)).Times(1).WillOnce(Return(recoveredMockDevice));
+
+ // run test
+ const auto result = device->allocate({}, {}, {}, {});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(ResilientDeviceTest, recover) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ const auto recoveredMockDevice = createConfiguredMockDevice();
+ EXPECT_CALL(*mockDeviceFactory, Call(false)).Times(1).WillOnce(Return(recoveredMockDevice));
+
+ // run test
+ const auto result = device->recover(mockDevice.get(), /*blocking=*/false);
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ EXPECT_TRUE(result.value() == recoveredMockDevice);
+}
+
+TEST(ResilientDeviceTest, recoverFailure) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ const auto recoveredMockDevice = createConfiguredMockDevice();
+ EXPECT_CALL(*mockDeviceFactory, Call(_)).Times(1).WillOnce(kReturnGeneralFailure);
+
+ // run test
+ const auto result = device->recover(mockDevice.get(), /*blocking=*/false);
+
+ // verify result
+ EXPECT_FALSE(result.has_value());
+}
+
+TEST(ResilientDeviceTest, someoneElseRecovered) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ const auto recoveredMockDevice = createConfiguredMockDevice();
+ EXPECT_CALL(*mockDeviceFactory, Call(false)).Times(1).WillOnce(Return(recoveredMockDevice));
+ device->recover(mockDevice.get(), /*blocking=*/false);
+
+ // run test
+ const auto result = device->recover(mockDevice.get(), /*blocking=*/false);
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ EXPECT_TRUE(result.value() == recoveredMockDevice);
+}
+
+TEST(ResilientDeviceTest, recoverCacheMismatchGetName) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ const auto recoveredMockDevice = createConfiguredMockDevice();
+ const std::string kDifferentName = "Google-DifferentName";
+ const auto ret = [&kDifferentName]() -> const std::string& { return kDifferentName; };
+ EXPECT_CALL(*recoveredMockDevice, getName()).Times(1).WillOnce(ret);
+ EXPECT_CALL(*mockDeviceFactory, Call(false)).Times(1).WillOnce(Return(recoveredMockDevice));
+
+ // run test
+ const auto result = device->recover(mockDevice.get(), /*blocking=*/false);
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ EXPECT_TRUE(result.value() != nullptr);
+ EXPECT_TRUE(result.value() != mockDevice);
+ EXPECT_TRUE(result.value() != recoveredMockDevice);
+}
+
+TEST(ResilientDeviceTest, recoverCacheMismatchGetVersionString) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ const auto recoveredMockDevice = createConfiguredMockDevice();
+ const std::string kDifferentVersionString = "differentversion";
+ const auto ret = [&kDifferentVersionString]() -> const std::string& {
+ return kDifferentVersionString;
+ };
+ EXPECT_CALL(*recoveredMockDevice, getVersionString()).Times(1).WillOnce(ret);
+ EXPECT_CALL(*mockDeviceFactory, Call(false)).Times(1).WillOnce(Return(recoveredMockDevice));
+
+ // run test
+ const auto result = device->recover(mockDevice.get(), /*blocking=*/false);
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ EXPECT_TRUE(result.value() != nullptr);
+ EXPECT_TRUE(result.value() != mockDevice);
+ EXPECT_TRUE(result.value() != recoveredMockDevice);
+}
+
+TEST(ResilientDeviceTest, recoverCacheMismatchGetFeatureLevel) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ const auto recoveredMockDevice = createConfiguredMockDevice();
+ EXPECT_CALL(*recoveredMockDevice, getFeatureLevel())
+ .Times(1)
+ .WillOnce(Return(nn::Version::ANDROID_P));
+ EXPECT_CALL(*mockDeviceFactory, Call(false)).Times(1).WillOnce(Return(recoveredMockDevice));
+
+ // run test
+ const auto result = device->recover(mockDevice.get(), /*blocking=*/false);
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ EXPECT_TRUE(result.value() != nullptr);
+ EXPECT_TRUE(result.value() != mockDevice);
+ EXPECT_TRUE(result.value() != recoveredMockDevice);
+}
+
+TEST(ResilientDeviceTest, recoverCacheMismatchGetType) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ const auto recoveredMockDevice = createConfiguredMockDevice();
+ EXPECT_CALL(*recoveredMockDevice, getType()).Times(1).WillOnce(Return(nn::DeviceType::GPU));
+ EXPECT_CALL(*mockDeviceFactory, Call(false)).Times(1).WillOnce(Return(recoveredMockDevice));
+
+ // run test
+ const auto result = device->recover(mockDevice.get(), /*blocking=*/false);
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ EXPECT_TRUE(result.value() != nullptr);
+ EXPECT_TRUE(result.value() != mockDevice);
+ EXPECT_TRUE(result.value() != recoveredMockDevice);
+}
+
+TEST(ResilientDeviceTest, recoverCacheMismatchGetSupportedExtensions) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ const auto recoveredMockDevice = createConfiguredMockDevice();
+ const auto kDifferentExtensions =
+ std::vector<nn::Extension>{nn::Extension{.name = "", .operandTypes = {}}};
+ const auto ret = [&kDifferentExtensions]() -> const std::vector<nn::Extension>& {
+ return kDifferentExtensions;
+ };
+ EXPECT_CALL(*recoveredMockDevice, getSupportedExtensions()).Times(1).WillOnce(ret);
+ EXPECT_CALL(*mockDeviceFactory, Call(false)).Times(1).WillOnce(Return(recoveredMockDevice));
+
+ // run test
+ const auto result = device->recover(mockDevice.get(), /*blocking=*/false);
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ EXPECT_TRUE(result.value() != nullptr);
+ EXPECT_TRUE(result.value() != mockDevice);
+ EXPECT_TRUE(result.value() != recoveredMockDevice);
+}
+
+TEST(ResilientDeviceTest, recoverCacheMismatchGetCapabilities) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ const auto recoveredMockDevice = createConfiguredMockDevice();
+ const auto kDifferentCapabilities = nn::Capabilities{
+ .relaxedFloat32toFloat16PerformanceTensor = {.execTime = 0.5f, .powerUsage = 0.5f},
+ .operandPerformance = nn::Capabilities::OperandPerformanceTable::create({}).value()};
+ const auto ret = [&kDifferentCapabilities]() -> const nn::Capabilities& {
+ return kDifferentCapabilities;
+ };
+ EXPECT_CALL(*recoveredMockDevice, getCapabilities()).Times(1).WillOnce(ret);
+ EXPECT_CALL(*mockDeviceFactory, Call(false)).Times(1).WillOnce(Return(recoveredMockDevice));
+
+ // run test
+ const auto result = device->recover(mockDevice.get(), /*blocking=*/false);
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ EXPECT_TRUE(result.value() != nullptr);
+ EXPECT_TRUE(result.value() != mockDevice);
+ EXPECT_TRUE(result.value() != recoveredMockDevice);
+}
+
+TEST(ResilientDeviceTest, recoverCacheMismatchInvalidPrepareModel) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ const auto recoveredMockDevice = createConfiguredMockDevice();
+ EXPECT_CALL(*recoveredMockDevice, getType()).Times(1).WillOnce(Return(nn::DeviceType::GPU));
+ EXPECT_CALL(*mockDeviceFactory, Call(false)).Times(1).WillOnce(Return(recoveredMockDevice));
+ device->recover(mockDevice.get(), /*blocking=*/false);
+
+ // run test
+ auto result = device->prepareModel({}, {}, {}, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ EXPECT_TRUE(result.value() != nullptr);
+}
+
+TEST(ResilientDeviceTest, recoverCacheMismatchInvalidPrepareModelFromCache) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ const auto recoveredMockDevice = createConfiguredMockDevice();
+ EXPECT_CALL(*recoveredMockDevice, getType()).Times(1).WillOnce(Return(nn::DeviceType::GPU));
+ EXPECT_CALL(*mockDeviceFactory, Call(false)).Times(1).WillOnce(Return(recoveredMockDevice));
+ device->recover(mockDevice.get(), /*blocking=*/false);
+
+ // run test
+ auto result = device->prepareModelFromCache({}, {}, {}, {});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ EXPECT_TRUE(result.value() != nullptr);
+}
+
+TEST(ResilientDeviceTest, recoverCacheMismatchInvalidAllocate) {
+ // setup call
+ const auto [mockDevice, mockDeviceFactory, device] = setup();
+ const auto recoveredMockDevice = createConfiguredMockDevice();
+ EXPECT_CALL(*recoveredMockDevice, getType()).Times(1).WillOnce(Return(nn::DeviceType::GPU));
+ EXPECT_CALL(*mockDeviceFactory, Call(false)).Times(1).WillOnce(Return(recoveredMockDevice));
+ device->recover(mockDevice.get(), /*blocking=*/false);
+
+ // run test
+ auto result = device->allocate({}, {}, {}, {});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ EXPECT_TRUE(result.value() != nullptr);
+}
+
+} // namespace android::hardware::neuralnetworks::utils
diff --git a/neuralnetworks/utils/common/test/ResilientPreparedModelTest.cpp b/neuralnetworks/utils/common/test/ResilientPreparedModelTest.cpp
new file mode 100644
index 0000000..6d86e10
--- /dev/null
+++ b/neuralnetworks/utils/common/test/ResilientPreparedModelTest.cpp
@@ -0,0 +1,297 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <gmock/gmock.h>
+#include <nnapi/TypeUtils.h>
+#include <nnapi/Types.h>
+#include <nnapi/hal/ResilientPreparedModel.h>
+#include <utility>
+#include "MockPreparedModel.h"
+
+namespace android::hardware::neuralnetworks::utils {
+namespace {
+
+using ::testing::_;
+using ::testing::InvokeWithoutArgs;
+using ::testing::Return;
+
+using SharedMockPreparedModel = std::shared_ptr<const nn::MockPreparedModel>;
+using MockPreparedModelFactory =
+ ::testing::MockFunction<nn::GeneralResult<nn::SharedPreparedModel>()>;
+
+SharedMockPreparedModel createConfiguredMockPreparedModel() {
+ return std::make_shared<const nn::MockPreparedModel>();
+}
+
+std::tuple<std::shared_ptr<const nn::MockPreparedModel>, std::unique_ptr<MockPreparedModelFactory>,
+ std::shared_ptr<const ResilientPreparedModel>>
+setup() {
+ auto mockPreparedModel = std::make_shared<const nn::MockPreparedModel>();
+
+ auto mockPreparedModelFactory = std::make_unique<MockPreparedModelFactory>();
+ EXPECT_CALL(*mockPreparedModelFactory, Call()).Times(1).WillOnce(Return(mockPreparedModel));
+
+ auto buffer = ResilientPreparedModel::create(mockPreparedModelFactory->AsStdFunction()).value();
+ return std::make_tuple(std::move(mockPreparedModel), std::move(mockPreparedModelFactory),
+ std::move(buffer));
+}
+
+constexpr auto makeError = [](nn::ErrorStatus status) {
+ return [status](const auto&... /*args*/) { return nn::error(status); };
+};
+const auto kReturnGeneralFailure = makeError(nn::ErrorStatus::GENERAL_FAILURE);
+const auto kReturnDeadObject = makeError(nn::ErrorStatus::DEAD_OBJECT);
+
+const auto kNoExecutionError =
+ nn::ExecutionResult<std::pair<std::vector<nn::OutputShape>, nn::Timing>>{};
+const auto kNoFencedExecutionError =
+ nn::GeneralResult<std::pair<nn::SyncFence, nn::ExecuteFencedInfoCallback>>(
+ std::make_pair(nn::SyncFence::createAsSignaled(), nullptr));
+
+struct FakeResource {};
+
+} // namespace
+
+TEST(ResilientPreparedModelTest, invalidPreparedModelFactory) {
+ // setup call
+ const auto invalidPreparedModelFactory = ResilientPreparedModel::Factory{};
+
+ // run test
+ const auto result = ResilientPreparedModel::create(invalidPreparedModelFactory);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::INVALID_ARGUMENT);
+}
+
+TEST(ResilientPreparedModelTest, preparedModelFactoryFailure) {
+ // setup call
+ const auto invalidPreparedModelFactory = kReturnGeneralFailure;
+
+ // run test
+ const auto result = ResilientPreparedModel::create(invalidPreparedModelFactory);
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(ResilientPreparedModelTest, getPreparedModel) {
+ // setup call
+ const auto [mockPreparedModel, mockPreparedModelFactory, preparedModel] = setup();
+
+ // run test
+ const auto result = preparedModel->getPreparedModel();
+
+ // verify result
+ EXPECT_TRUE(result == mockPreparedModel);
+}
+
+TEST(ResilientPreparedModelTest, execute) {
+ // setup call
+ const auto [mockPreparedModel, mockPreparedModelFactory, preparedModel] = setup();
+ EXPECT_CALL(*mockPreparedModel, execute(_, _, _, _))
+ .Times(1)
+ .WillOnce(Return(kNoExecutionError));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(ResilientPreparedModelTest, executeError) {
+ // setup call
+ const auto [mockPreparedModel, mockPreparedModelFactory, preparedModel] = setup();
+ EXPECT_CALL(*mockPreparedModel, execute(_, _, _, _)).Times(1).WillOnce(kReturnGeneralFailure);
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(ResilientPreparedModelTest, executeDeadObjectFailedRecovery) {
+ // setup call
+ const auto [mockPreparedModel, mockPreparedModelFactory, preparedModel] = setup();
+ EXPECT_CALL(*mockPreparedModel, execute(_, _, _, _)).Times(1).WillOnce(kReturnDeadObject);
+ constexpr auto ret = [] { return nn::error(nn::ErrorStatus::GENERAL_FAILURE); };
+ EXPECT_CALL(*mockPreparedModelFactory, Call()).Times(1).WillOnce(ret);
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(ResilientPreparedModelTest, executeDeadObjectSuccessfulRecovery) {
+ // setup call
+ const auto [mockPreparedModel, mockPreparedModelFactory, preparedModel] = setup();
+ EXPECT_CALL(*mockPreparedModel, execute(_, _, _, _)).Times(1).WillOnce(kReturnDeadObject);
+ const auto recoveredMockPreparedModel = createConfiguredMockPreparedModel();
+ EXPECT_CALL(*recoveredMockPreparedModel, execute(_, _, _, _))
+ .Times(1)
+ .WillOnce(Return(kNoExecutionError));
+ EXPECT_CALL(*mockPreparedModelFactory, Call())
+ .Times(1)
+ .WillOnce(Return(recoveredMockPreparedModel));
+
+ // run test
+ const auto result = preparedModel->execute({}, {}, {}, {});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(ResilientPreparedModelTest, executeFenced) {
+ // setup call
+ const auto [mockPreparedModel, mockPreparedModelFactory, preparedModel] = setup();
+ EXPECT_CALL(*mockPreparedModel, executeFenced(_, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(Return(kNoFencedExecutionError));
+
+ // run test
+ const auto result = preparedModel->executeFenced({}, {}, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(ResilientPreparedModelTest, executeFencedError) {
+ // setup call
+ const auto [mockPreparedModel, mockPreparedModelFactory, preparedModel] = setup();
+ EXPECT_CALL(*mockPreparedModel, executeFenced(_, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(kReturnGeneralFailure);
+
+ // run test
+ const auto result = preparedModel->executeFenced({}, {}, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::GENERAL_FAILURE);
+}
+
+TEST(ResilientPreparedModelTest, executeFencedDeadObjectFailedRecovery) {
+ // setup call
+ const auto [mockPreparedModel, mockPreparedModelFactory, preparedModel] = setup();
+ EXPECT_CALL(*mockPreparedModel, executeFenced(_, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(kReturnDeadObject);
+ EXPECT_CALL(*mockPreparedModelFactory, Call()).Times(1).WillOnce(kReturnGeneralFailure);
+
+ // run test
+ const auto result = preparedModel->executeFenced({}, {}, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_FALSE(result.has_value());
+ EXPECT_EQ(result.error().code, nn::ErrorStatus::DEAD_OBJECT);
+}
+
+TEST(ResilientPreparedModelTest, executeFencedDeadObjectSuccessfulRecovery) {
+ // setup call
+ const auto [mockPreparedModel, mockPreparedModelFactory, preparedModel] = setup();
+ EXPECT_CALL(*mockPreparedModel, executeFenced(_, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(kReturnDeadObject);
+ const auto recoveredMockPreparedModel = createConfiguredMockPreparedModel();
+ EXPECT_CALL(*recoveredMockPreparedModel, executeFenced(_, _, _, _, _, _))
+ .Times(1)
+ .WillOnce(Return(kNoFencedExecutionError));
+ EXPECT_CALL(*mockPreparedModelFactory, Call())
+ .Times(1)
+ .WillOnce(Return(recoveredMockPreparedModel));
+
+ // run test
+ const auto result = preparedModel->executeFenced({}, {}, {}, {}, {}, {});
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+}
+
+TEST(ResilientPreparedModelTest, getUnderlyingResource) {
+ // setup call
+ const auto [mockPreparedModel, mockPreparedModelFactory, preparedModel] = setup();
+ EXPECT_CALL(*mockPreparedModel, getUnderlyingResource())
+ .Times(1)
+ .WillOnce(Return(FakeResource{}));
+
+ // run test
+ const auto resource = preparedModel->getUnderlyingResource();
+
+ // verify resource
+ const FakeResource* maybeFakeResource = std::any_cast<FakeResource>(&resource);
+ EXPECT_NE(maybeFakeResource, nullptr);
+}
+
+TEST(ResilientPreparedModelTest, recover) {
+ // setup call
+ const auto [mockPreparedModel, mockPreparedModelFactory, preparedModel] = setup();
+ const auto recoveredMockPreparedModel = createConfiguredMockPreparedModel();
+ EXPECT_CALL(*mockPreparedModelFactory, Call())
+ .Times(1)
+ .WillOnce(Return(recoveredMockPreparedModel));
+
+ // run test
+ const auto result = preparedModel->recover(mockPreparedModel.get());
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ EXPECT_TRUE(result.value() == recoveredMockPreparedModel);
+}
+
+TEST(ResilientPreparedModelTest, recoverFailure) {
+ // setup call
+ const auto [mockPreparedModel, mockPreparedModelFactory, preparedModel] = setup();
+ const auto recoveredMockPreparedModel = createConfiguredMockPreparedModel();
+ EXPECT_CALL(*mockPreparedModelFactory, Call()).Times(1).WillOnce(kReturnGeneralFailure);
+
+ // run test
+ const auto result = preparedModel->recover(mockPreparedModel.get());
+
+ // verify result
+ EXPECT_FALSE(result.has_value());
+}
+
+TEST(ResilientPreparedModelTest, someoneElseRecovered) {
+ // setup call
+ const auto [mockPreparedModel, mockPreparedModelFactory, preparedModel] = setup();
+ const auto recoveredMockPreparedModel = createConfiguredMockPreparedModel();
+ EXPECT_CALL(*mockPreparedModelFactory, Call())
+ .Times(1)
+ .WillOnce(Return(recoveredMockPreparedModel));
+ preparedModel->recover(mockPreparedModel.get());
+
+ // run test
+ const auto result = preparedModel->recover(mockPreparedModel.get());
+
+ // verify result
+ ASSERT_TRUE(result.has_value())
+ << "Failed with " << result.error().code << ": " << result.error().message;
+ EXPECT_TRUE(result.value() == recoveredMockPreparedModel);
+}
+
+} // namespace android::hardware::neuralnetworks::utils
diff --git a/oemlock/aidl/Android.bp b/oemlock/aidl/Android.bp
new file mode 100644
index 0000000..bfc99e7
--- /dev/null
+++ b/oemlock/aidl/Android.bp
@@ -0,0 +1,16 @@
+aidl_interface {
+ name: "android.hardware.oemlock",
+ vendor_available: true,
+ srcs: ["android/hardware/oemlock/*.aidl"],
+ stability: "vintf",
+ backend: {
+ java: {
+ platform_apis: true,
+ },
+ ndk: {
+ vndk: {
+ enabled: true,
+ },
+ },
+ },
+}
diff --git a/oemlock/aidl/aidl_api/android.hardware.oemlock/current/android/hardware/oemlock/IOemLock.aidl b/oemlock/aidl/aidl_api/android.hardware.oemlock/current/android/hardware/oemlock/IOemLock.aidl
new file mode 100644
index 0000000..e3c974d
--- /dev/null
+++ b/oemlock/aidl/aidl_api/android.hardware.oemlock/current/android/hardware/oemlock/IOemLock.aidl
@@ -0,0 +1,27 @@
+///////////////////////////////////////////////////////////////////////////////
+// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
+///////////////////////////////////////////////////////////////////////////////
+
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
+//
+// You must not make a backward incompatible change to any AIDL file built
+// with the aidl_interface module type with versions property set. The module
+// type is used to build AIDL files in a way that they can be used across
+// independently updatable components of the system. If a device is shipped
+// with such a backward incompatible change, it has a high risk of breaking
+// later when a module using the interface is updated, e.g., Mainline modules.
+
+package android.hardware.oemlock;
+@VintfStability
+interface IOemLock {
+ String getName();
+ boolean isOemUnlockAllowedByCarrier();
+ boolean isOemUnlockAllowedByDevice();
+ android.hardware.oemlock.OemLockSecureStatus setOemUnlockAllowedByCarrier(in boolean allowed, in byte[] signature);
+ void setOemUnlockAllowedByDevice(in boolean allowed);
+}
diff --git a/oemlock/aidl/aidl_api/android.hardware.oemlock/current/android/hardware/oemlock/OemLockSecureStatus.aidl b/oemlock/aidl/aidl_api/android.hardware.oemlock/current/android/hardware/oemlock/OemLockSecureStatus.aidl
new file mode 100644
index 0000000..9d1327d
--- /dev/null
+++ b/oemlock/aidl/aidl_api/android.hardware.oemlock/current/android/hardware/oemlock/OemLockSecureStatus.aidl
@@ -0,0 +1,25 @@
+///////////////////////////////////////////////////////////////////////////////
+// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
+///////////////////////////////////////////////////////////////////////////////
+
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
+//
+// You must not make a backward incompatible change to any AIDL file built
+// with the aidl_interface module type with versions property set. The module
+// type is used to build AIDL files in a way that they can be used across
+// independently updatable components of the system. If a device is shipped
+// with such a backward incompatible change, it has a high risk of breaking
+// later when a module using the interface is updated, e.g., Mainline modules.
+
+package android.hardware.oemlock;
+@Backing(type="int") @VintfStability
+enum OemLockSecureStatus {
+ OK = 0,
+ FAILED = 1,
+ INVALID_SIGNATURE = 2,
+}
diff --git a/oemlock/aidl/android/hardware/oemlock/IOemLock.aidl b/oemlock/aidl/android/hardware/oemlock/IOemLock.aidl
new file mode 100644
index 0000000..674ff85
--- /dev/null
+++ b/oemlock/aidl/android/hardware/oemlock/IOemLock.aidl
@@ -0,0 +1,81 @@
+/*
+ * Copyright 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.hardware.oemlock;
+
+import android.hardware.oemlock.OemLockSecureStatus;
+
+/*
+ * The OEM lock prevents the bootloader from allowing the device to be flashed.
+ *
+ * Both the carrier and the device itself have a say as to whether OEM unlock is
+ * allowed and both must agree that is allowed in order for unlock to be
+ * possible.
+ */
+@VintfStability
+interface IOemLock {
+ /**
+ * Returns a vendor specific identifier of the HAL.
+ *
+ * The name returned must not be interpreted by the framework but must be
+ * passed to vendor code which may use it to identify the security protocol
+ * used by setOemUnlockAllowedByCarrier. This allows the vendor to identify
+ * the protocol without having to maintain a device-to-protocol mapping.
+ *
+ * @return name of the implementation and STATUS_OK if get name successfully
+ */
+ String getName();
+
+ /**
+ * Returns whether OEM unlock is allowed by the carrier.
+ *
+ * @return the current state(allowed/not allowed) of the flag
+ * and STATUS_OK if the flag was successfully read.
+ */
+ boolean isOemUnlockAllowedByCarrier();
+
+ /**
+ * Returns whether OEM unlock ia allowed by the device.
+ *
+ * @return the current state(allowed/not allowed) of the flag
+ * and STATUS_OK if the flag was successfully read.
+ */
+ boolean isOemUnlockAllowedByDevice();
+
+ /**
+ * Updates whether OEM unlock is allowed by the carrier.
+ *
+ * The implementation may require a vendor defined signature to prove the
+ * validity of this request in order to harden its security.
+ *
+ * @param allowed is the new value of the flag.
+ * @param signature to prove validity of this request or empty if not
+ * required.
+ * @return OK if the flag was successfully updated,
+ * INVALID_SIGNATURE if a signature is required but the wrong one
+ * was provided
+ * FAILED if the update was otherwise unsuccessful.
+ */
+ OemLockSecureStatus setOemUnlockAllowedByCarrier(in boolean allowed, in byte[] signature);
+
+ /**
+ * Updates whether OEM unlock is allowed by the device.
+ *
+ * @param allowed the new value of the flag.
+ * @return STATUS_OK if the flag was successfully updated.
+ */
+ void setOemUnlockAllowedByDevice(in boolean allowed);
+}
diff --git a/oemlock/aidl/android/hardware/oemlock/OemLockSecureStatus.aidl b/oemlock/aidl/android/hardware/oemlock/OemLockSecureStatus.aidl
new file mode 100644
index 0000000..3c11377
--- /dev/null
+++ b/oemlock/aidl/android/hardware/oemlock/OemLockSecureStatus.aidl
@@ -0,0 +1,34 @@
+/*
+ * Copyright 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.hardware.oemlock;
+
+@VintfStability
+@Backing(type="int")
+enum OemLockSecureStatus {
+ /**
+ * The operation completed successfully.
+ */
+ OK,
+ /**
+ * The operation encountered a problem.
+ */
+ FAILED,
+ /**
+ * An invalid signature was provided so the operation was not performed.
+ */
+ INVALID_SIGNATURE,
+}
diff --git a/oemlock/aidl/default/Android.bp b/oemlock/aidl/default/Android.bp
new file mode 100644
index 0000000..b9872d7
--- /dev/null
+++ b/oemlock/aidl/default/Android.bp
@@ -0,0 +1,32 @@
+//
+// Copyright (C) 2020 The Android Open Source Project
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+//
+
+cc_binary {
+ name: "android.hardware.oemlock-service.example",
+ relative_install_path: "hw",
+ init_rc: ["android.hardware.oemlock-service.example.rc"],
+ vintf_fragments: ["android.hardware.oemlock-service.example.xml"],
+ vendor: true,
+ srcs: [
+ "service.cpp",
+ "OemLock.cpp",
+ ],
+ shared_libs: [
+ "android.hardware.oemlock-ndk_platform",
+ "libbase",
+ "libbinder_ndk",
+ ],
+}
diff --git a/oemlock/aidl/default/OemLock.cpp b/oemlock/aidl/default/OemLock.cpp
new file mode 100644
index 0000000..646b532
--- /dev/null
+++ b/oemlock/aidl/default/OemLock.cpp
@@ -0,0 +1,56 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "OemLock.h"
+
+namespace aidl {
+namespace android {
+namespace hardware {
+namespace oemlock {
+
+// Methods from ::android::hardware::oemlock::IOemLock follow.
+
+::ndk::ScopedAStatus OemLock::getName(std::string *out_name) {
+ (void)out_name;
+ return ::ndk::ScopedAStatus::ok();
+}
+
+::ndk::ScopedAStatus OemLock::setOemUnlockAllowedByCarrier(bool in_allowed, const std::vector<uint8_t> &in_signature, OemLockSecureStatus *_aidl_return) {
+ (void)in_allowed;
+ (void)in_signature;
+ (void)_aidl_return;
+ return ::ndk::ScopedAStatus::ok();
+}
+
+::ndk::ScopedAStatus OemLock::isOemUnlockAllowedByCarrier(bool *out_allowed) {
+ (void)out_allowed;
+ return ::ndk::ScopedAStatus::ok();
+}
+
+::ndk::ScopedAStatus OemLock::setOemUnlockAllowedByDevice(bool in_allowed) {
+ (void)in_allowed;
+ return ::ndk::ScopedAStatus::ok();
+}
+
+::ndk::ScopedAStatus OemLock::isOemUnlockAllowedByDevice(bool *out_allowed) {
+ (void)out_allowed;
+ return ::ndk::ScopedAStatus::ok();
+}
+
+} // namespace oemlock
+} // namespace hardware
+} // namespace android
+} // aidl
diff --git a/oemlock/aidl/default/OemLock.h b/oemlock/aidl/default/OemLock.h
new file mode 100644
index 0000000..b0df414
--- /dev/null
+++ b/oemlock/aidl/default/OemLock.h
@@ -0,0 +1,44 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#pragma once
+
+#include <aidl/android/hardware/oemlock/BnOemLock.h>
+
+namespace aidl {
+namespace android {
+namespace hardware {
+namespace oemlock {
+
+using ::aidl::android::hardware::oemlock::IOemLock;
+using ::aidl::android::hardware::oemlock::OemLockSecureStatus;
+
+struct OemLock : public BnOemLock {
+public:
+ OemLock() = default;
+
+ // Methods from ::android::hardware::oemlock::IOemLock follow.
+ ::ndk::ScopedAStatus getName(std::string* out_name) override;
+ ::ndk::ScopedAStatus isOemUnlockAllowedByCarrier(bool* out_allowed) override;
+ ::ndk::ScopedAStatus isOemUnlockAllowedByDevice(bool* out_allowed) override;
+ ::ndk::ScopedAStatus setOemUnlockAllowedByCarrier(bool in_allowed, const std::vector<uint8_t>& in_signature, OemLockSecureStatus* _aidl_return) override;
+ ::ndk::ScopedAStatus setOemUnlockAllowedByDevice(bool in_allowed) override;
+};
+
+} // namespace oemlock
+} // namespace hardware
+} // namespace android
+} // aidl
diff --git a/oemlock/aidl/default/android.hardware.oemlock-service.example.rc b/oemlock/aidl/default/android.hardware.oemlock-service.example.rc
new file mode 100644
index 0000000..57b79d3
--- /dev/null
+++ b/oemlock/aidl/default/android.hardware.oemlock-service.example.rc
@@ -0,0 +1,4 @@
+service vendor.oemlock_default /vendor/bin/hw/android.hardware.oemlock-service.example
+ class hal
+ user hsm
+ group hsm
diff --git a/oemlock/aidl/default/android.hardware.oemlock-service.example.xml b/oemlock/aidl/default/android.hardware.oemlock-service.example.xml
new file mode 100644
index 0000000..b9f137f
--- /dev/null
+++ b/oemlock/aidl/default/android.hardware.oemlock-service.example.xml
@@ -0,0 +1,9 @@
+<manifest version="1.0" type="device">
+ <hal format="aidl">
+ <name>android.hardware.oemlock</name>
+ <interface>
+ <name>IOemLock</name>
+ <instance>default</instance>
+ </interface>
+ </hal>
+</manifest>
diff --git a/oemlock/aidl/default/service.cpp b/oemlock/aidl/default/service.cpp
new file mode 100644
index 0000000..af828a0
--- /dev/null
+++ b/oemlock/aidl/default/service.cpp
@@ -0,0 +1,35 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <android-base/logging.h>
+#include <android/binder_manager.h>
+#include <android/binder_process.h>
+
+#include "OemLock.h"
+
+using ::aidl::android::hardware::oemlock::OemLock;
+
+int main() {
+ ABinderProcess_setThreadPoolMaxThreadCount(0);
+ std::shared_ptr<OemLock> oemlock = ndk::SharedRefBase::make<OemLock>();
+
+ const std::string instance = std::string() + OemLock::descriptor + "/default";
+ binder_status_t status = AServiceManager_addService(oemlock->asBinder().get(), instance.c_str());
+ CHECK(status == STATUS_OK);
+
+ ABinderProcess_joinThreadPool();
+ return -1; // Should never be reached
+}
diff --git a/oemlock/aidl/vts/Android.bp b/oemlock/aidl/vts/Android.bp
new file mode 100644
index 0000000..a13dbe2
--- /dev/null
+++ b/oemlock/aidl/vts/Android.bp
@@ -0,0 +1,33 @@
+//
+// Copyright (C) 2020 The Android Open Source Project
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+//
+
+cc_test {
+ name: "VtsHalOemLockTargetTest",
+ defaults: [
+ "VtsHalTargetTestDefaults",
+ "use_libaidlvintf_gtest_helper_static",
+ ],
+ srcs: ["VtsHalOemLockTargetTest.cpp"],
+ shared_libs: [
+ "libbinder_ndk",
+ "libbase",
+ ],
+ static_libs: ["android.hardware.oemlock-ndk_platform"],
+ test_suites: [
+ "general-tests",
+ "vts",
+ ],
+}
diff --git a/oemlock/aidl/vts/OWNERS b/oemlock/aidl/vts/OWNERS
new file mode 100644
index 0000000..40d95e4
--- /dev/null
+++ b/oemlock/aidl/vts/OWNERS
@@ -0,0 +1,2 @@
+chengyouho@google.com
+frankwoo@google.com
diff --git a/oemlock/aidl/vts/VtsHalOemLockTargetTest.cpp b/oemlock/aidl/vts/VtsHalOemLockTargetTest.cpp
new file mode 100644
index 0000000..6bf6298
--- /dev/null
+++ b/oemlock/aidl/vts/VtsHalOemLockTargetTest.cpp
@@ -0,0 +1,165 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include <aidl/Gtest.h>
+#include <aidl/Vintf.h>
+
+#include <aidl/android/hardware/oemlock/IOemLock.h>
+#include <android/binder_manager.h>
+#include <android/binder_process.h>
+
+using ::aidl::android::hardware::oemlock::IOemLock;
+using ::aidl::android::hardware::oemlock::OemLockSecureStatus;
+
+using ndk::SpAIBinder;
+
+struct OemLockAidlTest : public ::testing::TestWithParam<std::string> {
+ virtual void SetUp() override {
+ oemlock = IOemLock::fromBinder(
+ SpAIBinder(AServiceManager_waitForService(GetParam().c_str())));
+ ASSERT_NE(oemlock, nullptr);
+ }
+
+ virtual void TearDown() override {}
+
+ std::shared_ptr<IOemLock> oemlock;
+};
+
+/*
+ * Check the name can be retrieved
+ */
+TEST_P(OemLockAidlTest, GetName) {
+ std::string name;
+
+ const auto ret = oemlock->getName(&name);
+
+ ASSERT_TRUE(ret.isOk());
+ // Any value acceptable
+};
+
+/*
+ * Check the unlock allowed by device state can be queried
+ */
+TEST_P(OemLockAidlTest, QueryUnlockAllowedByDevice) {
+ bool allowed;
+
+ const auto ret = oemlock->isOemUnlockAllowedByDevice(&allowed);
+
+ ASSERT_TRUE(ret.isOk());
+ // Any value acceptable
+}
+
+/*
+ * Check unlock allowed by device state can be toggled
+ */
+TEST_P(OemLockAidlTest, AllowedByDeviceCanBeToggled) {
+ bool allowed;
+
+ // Get the original state so it can be restored
+ const auto get_ret = oemlock->isOemUnlockAllowedByDevice(&allowed);
+ ASSERT_TRUE(get_ret.isOk());
+ const bool originallyAllowed = allowed;
+
+ // Toggle the state
+ const auto set_ret = oemlock->setOemUnlockAllowedByDevice(!originallyAllowed);
+ ASSERT_TRUE(set_ret.isOk());
+
+ const auto check_set_ret = oemlock->isOemUnlockAllowedByDevice(&allowed);
+ ASSERT_TRUE(check_set_ret.isOk());
+ ASSERT_EQ(allowed, !originallyAllowed);
+
+ // Restore the state
+ const auto restore_ret = oemlock->setOemUnlockAllowedByDevice(originallyAllowed);
+ ASSERT_TRUE(restore_ret.isOk());
+
+ const auto check_restore_ret = oemlock->isOemUnlockAllowedByDevice(&allowed);
+ ASSERT_TRUE(check_restore_ret.isOk());
+ ASSERT_EQ(allowed, originallyAllowed);
+}
+
+/*
+ * Check the unlock allowed by device state can be queried
+ */
+TEST_P(OemLockAidlTest, QueryUnlockAllowedByCarrier) {
+ bool allowed;
+
+ const auto ret = oemlock->isOemUnlockAllowedByCarrier(&allowed);
+
+ ASSERT_TRUE(ret.isOk());
+ // Any value acceptable
+}
+
+/*
+ * Attempt to check unlock allowed by carrier can be toggled
+ *
+ * The implementation may involve a signature which cannot be tested here. That
+ * is a valid implementation so the test will pass. If there is no signature
+ * required, the test will toggle the value.
+ */
+TEST_P(OemLockAidlTest, CarrierUnlock) {
+ const std::vector<uint8_t> noSignature = {};
+ bool allowed;
+ OemLockSecureStatus secure_status;
+
+ // Get the original state so it can be restored
+ const auto get_ret = oemlock->isOemUnlockAllowedByCarrier(&allowed);
+ ASSERT_TRUE(get_ret.isOk());
+ const bool originallyAllowed = allowed;
+
+ if (originallyAllowed) {
+ // Only applied to locked devices
+ return;
+ }
+
+ // Toggle the state
+ const auto set_ret = oemlock->setOemUnlockAllowedByCarrier(!originallyAllowed, noSignature, &secure_status);
+ ASSERT_TRUE(set_ret.isOk());
+ ASSERT_NE(secure_status, OemLockSecureStatus::FAILED);
+ const auto set_status = secure_status;
+
+ const auto check_set_ret = oemlock->isOemUnlockAllowedByCarrier(&allowed);
+ ASSERT_TRUE(check_set_ret.isOk());
+
+ if (set_status == OemLockSecureStatus::INVALID_SIGNATURE) {
+ // Signature is required so we cannot toggle the value in the test, but this is allowed
+ ASSERT_EQ(allowed, originallyAllowed);
+ return;
+ }
+
+ ASSERT_EQ(set_status, OemLockSecureStatus::OK);
+ ASSERT_EQ(allowed, !originallyAllowed);
+
+ // Restore the state
+ const auto restore_ret = oemlock->setOemUnlockAllowedByCarrier(originallyAllowed, noSignature, &secure_status);
+ ASSERT_TRUE(restore_ret.isOk());
+ ASSERT_EQ(secure_status, OemLockSecureStatus::OK);
+
+ const auto check_restore_ret = oemlock->isOemUnlockAllowedByCarrier(&allowed);
+ ASSERT_TRUE(check_restore_ret.isOk());
+ ASSERT_EQ(allowed, originallyAllowed);
+}
+
+GTEST_ALLOW_UNINSTANTIATED_PARAMETERIZED_TEST(OemLockAidlTest);
+INSTANTIATE_TEST_SUITE_P(
+ PerInstance, OemLockAidlTest,
+ testing::ValuesIn(android::getAidlHalInstanceNames(IOemLock::descriptor)),
+ android::PrintInstanceNameToString);
+
+int main(int argc, char** argv) {
+ ::testing::InitGoogleTest(&argc, argv);
+ ABinderProcess_setThreadPoolMaxThreadCount(1);
+ ABinderProcess_startThreadPool();
+ return RUN_ALL_TESTS();
+}
diff --git a/radio/1.0/vts/functional/vts_test_util.h b/radio/1.0/vts/functional/vts_test_util.h
index 1625f11..218e823 100644
--- a/radio/1.0/vts/functional/vts_test_util.h
+++ b/radio/1.0/vts/functional/vts_test_util.h
@@ -35,6 +35,12 @@
static constexpr const char* FEATURE_VOICE_CALL = "android.software.connectionservice";
+static constexpr const char* FEATURE_TELEPHONY = "android.hardware.telephony";
+
+static constexpr const char* FEATURE_TELEPHONY_GSM = "android.hardware.telephony.gsm";
+
+static constexpr const char* FEATURE_TELEPHONY_CDMA = "android.hardware.telephony.cdma";
+
/*
* Generate random serial number for radio test
*/
diff --git a/radio/1.4/vts/functional/radio_hidl_hal_api.cpp b/radio/1.4/vts/functional/radio_hidl_hal_api.cpp
index 1b254a1..b0b984c 100644
--- a/radio/1.4/vts/functional/radio_hidl_hal_api.cpp
+++ b/radio/1.4/vts/functional/radio_hidl_hal_api.cpp
@@ -34,6 +34,10 @@
if (!deviceSupportsFeature(FEATURE_VOICE_CALL)) {
ALOGI("Skipping emergencyDial because voice call is not supported in device");
return;
+ } else if (!deviceSupportsFeature(FEATURE_TELEPHONY_GSM) &&
+ !deviceSupportsFeature(FEATURE_TELEPHONY_CDMA)) {
+ ALOGI("Skipping emergencyDial because gsm/cdma radio is not supported in device");
+ return;
} else {
ALOGI("Running emergencyDial because voice call is supported in device");
}
@@ -86,6 +90,10 @@
if (!deviceSupportsFeature(FEATURE_VOICE_CALL)) {
ALOGI("Skipping emergencyDial because voice call is not supported in device");
return;
+ } else if (!deviceSupportsFeature(FEATURE_TELEPHONY_GSM) &&
+ !deviceSupportsFeature(FEATURE_TELEPHONY_CDMA)) {
+ ALOGI("Skipping emergencyDial because gsm/cdma radio is not supported in device");
+ return;
} else {
ALOGI("Running emergencyDial because voice call is supported in device");
}
@@ -138,6 +146,10 @@
if (!deviceSupportsFeature(FEATURE_VOICE_CALL)) {
ALOGI("Skipping emergencyDial because voice call is not supported in device");
return;
+ } else if (!deviceSupportsFeature(FEATURE_TELEPHONY_GSM) &&
+ !deviceSupportsFeature(FEATURE_TELEPHONY_CDMA)) {
+ ALOGI("Skipping emergencyDial because gsm/cdma radio is not supported in device");
+ return;
} else {
ALOGI("Running emergencyDial because voice call is supported in device");
}
diff --git a/radio/1.5/vts/functional/radio_hidl_hal_api.cpp b/radio/1.5/vts/functional/radio_hidl_hal_api.cpp
index 7166654..0b49b36 100644
--- a/radio/1.5/vts/functional/radio_hidl_hal_api.cpp
+++ b/radio/1.5/vts/functional/radio_hidl_hal_api.cpp
@@ -236,7 +236,12 @@
ALOGI("setSignalStrengthReportingCriteria_1_5_NGRAN_SSRSRP, rspInfo.error = %s\n",
toString(radioRsp_v1_5->rspInfo.error).c_str());
- ASSERT_TRUE(CheckAnyOfErrors(radioRsp_v1_5->rspInfo.error, {RadioError::NONE}));
+
+ // Allow REQUEST_NOT_SUPPORTED because some non-5G device may not support NGRAN for
+ // setSignalStrengthReportingCriteria_1_5()
+ ASSERT_TRUE(
+ CheckAnyOfErrors(radioRsp_v1_5->rspInfo.error,
+ {RadioError::NONE, RadioError::REQUEST_NOT_SUPPORTED}));
}
/*
@@ -261,7 +266,12 @@
ALOGI("setSignalStrengthReportingCriteria_1_5_NGRAN_SSRSRQ, rspInfo.error = %s\n",
toString(radioRsp_v1_5->rspInfo.error).c_str());
- ASSERT_TRUE(CheckAnyOfErrors(radioRsp_v1_5->rspInfo.error, {RadioError::NONE}));
+
+ // Allow REQUEST_NOT_SUPPORTED because some non-5G device may not support NGRAN for
+ // setSignalStrengthReportingCriteria_1_5()
+ ASSERT_TRUE(
+ CheckAnyOfErrors(radioRsp_v1_5->rspInfo.error,
+ {RadioError::NONE, RadioError::REQUEST_NOT_SUPPORTED}));
}
/*
@@ -307,7 +317,12 @@
ALOGI("setSignalStrengthReportingCriteria_1_5_NGRAN_SSSINR, rspInfo.error = %s\n",
toString(radioRsp_v1_5->rspInfo.error).c_str());
- ASSERT_TRUE(CheckAnyOfErrors(radioRsp_v1_5->rspInfo.error, {RadioError::NONE}));
+
+ // Allow REQUEST_NOT_SUPPORTED because some non-5G device may not support NGRAN for
+ // setSignalStrengthReportingCriteria_1_5()
+ ASSERT_TRUE(
+ CheckAnyOfErrors(radioRsp_v1_5->rspInfo.error,
+ {RadioError::NONE, RadioError::REQUEST_NOT_SUPPORTED}));
}
/*
diff --git a/radio/1.6/IRadioIndication.hal b/radio/1.6/IRadioIndication.hal
index 1b56d40..a53d7c1 100644
--- a/radio/1.6/IRadioIndication.hal
+++ b/radio/1.6/IRadioIndication.hal
@@ -23,6 +23,7 @@
import @1.6::NetworkScanResult;
import @1.6::SignalStrength;
import @1.6::SetupDataCallResult;
+import @1.6::PhysicalChannelConfig;
/**
* Interface declaring unsolicited radio indications.
@@ -101,4 +102,15 @@
* CellInfo.
*/
oneway networkScanResult_1_6(RadioIndicationType type, NetworkScanResult result);
+
+ /**
+ * Indicates physical channel configurations.
+ *
+ * An empty configs list indicates that the radio is in idle mode.
+ *
+ * @param type Type of radio indication
+ * @param configs Vector of PhysicalChannelConfigs
+ */
+ oneway currentPhysicalChannelConfigs_1_6(RadioIndicationType type,
+ vec<PhysicalChannelConfig> configs);
};
diff --git a/radio/1.6/types.hal b/radio/1.6/types.hal
index f4dc0bd..6dd8315 100644
--- a/radio/1.6/types.hal
+++ b/radio/1.6/types.hal
@@ -23,7 +23,10 @@
import @1.0::RadioError;
import @1.0::RadioResponseType;
import @1.0::RegState;
+import @1.1::EutranBands;
+import @1.1::GeranBands;
import @1.1::ScanStatus;
+import @1.1::UtranBands;
import @1.2::Call;
import @1.2::CellInfoCdma;
import @1.2::CellConnectionStatus;
@@ -41,6 +44,7 @@
import @1.5::CellInfoWcdma;
import @1.5::CellInfoTdscdma;
import @1.5::LinkAddress;
+import @1.5::NgranBands;
import @1.5::RegStateResult.AccessTechnologySpecificInfo.Cdma2000RegistrationInfo;
import @1.5::RegStateResult.AccessTechnologySpecificInfo.EutranRegistrationInfo;
import @1.5::RegistrationFailCause;
@@ -281,7 +285,7 @@
* suggestion. 0 indicates retry should be performed immediately. 0x7fffffffffffffff indicates
* the device should not retry data setup anymore.
*/
- uint64_t suggestedRetryTime;
+ int64_t suggestedRetryTime;
/** Context ID, uniquely identifies this data connection. */
int32_t cid;
@@ -347,7 +351,7 @@
/**
* The allocated pdu session id for this data call.
- * A value of -1 means no pdu session id was attached to this call.
+ * A value of 0 means no pdu session id was attached to this call.
*
* Reference: 3GPP TS 24.007 section 11.2.3.1b
*/
@@ -733,3 +737,70 @@
*/
string forwardedNumber;
};
+
+struct PhysicalChannelConfig {
+ /** Connection status for cell. Valid values are PRIMARY_SERVING and SECONDARY_SERVING */
+ CellConnectionStatus status;
+
+ /** The radio technology for this physical channel */
+ RadioTechnology rat;
+
+ /** Downlink Absolute Radio Frequency Channel Number */
+ int32_t downlinkChannelNumber;
+
+ /** Uplink Absolute Radio Frequency Channel Number */
+ int32_t uplinkChannelNumber;
+
+ /** Downlink cell bandwidth, in kHz */
+ int32_t cellBandwidthDownlink;
+
+ /** Uplink cell bandwidth, in kHz */
+ int32_t cellBandwidthUplink;
+
+ /**
+ * A list of data calls mapped to this physical channel. The context id must match the cid of
+ * @1.5::SetupDataCallResult. An empty list means the physical channel has no data call mapped
+ * to it.
+ */
+ vec<int32_t> contextIds;
+
+ /**
+ * The physical cell identifier for this cell.
+ *
+ * In UTRAN, this value is primary scrambling code. The range is [0, 511].
+ * Reference: 3GPP TS 25.213 section 5.2.2.
+ *
+ * In EUTRAN, this value is physical layer cell identity. The range is [0, 503].
+ * Reference: 3GPP TS 36.211 section 6.11.
+ *
+ * In 5G RAN, this value is physical layer cell identity. The range is [0, 1007].
+ * Reference: 3GPP TS 38.211 section 7.4.2.1.
+ */
+ uint32_t physicalCellId;
+
+ /**
+ * The frequency band to scan.
+ */
+ safe_union Band {
+ /** Valid only if radioAccessNetwork = GERAN. */
+ GeranBands geranBand;
+ /** Valid only if radioAccessNetwork = UTRAN. */
+ UtranBands utranBand;
+ /** Valid only if radioAccessNetwork = EUTRAN. */
+ EutranBands eutranBand;
+ /** Valid only if radioAccessNetwork = NGRAN. */
+ NgranBands ngranBand;
+ } band;
+};
+
+/**
+ * Extended from @1.5 NgranBands
+ * IRadio 1.6 supports NGRAN bands up to V16.5.0
+ */
+enum NgranBands : @1.5::NgranBands {
+ /** 3GPP TS 38.101-1, Table 5.2-1: FR1 bands */
+ BAND_26 = 26,
+ BAND_46 = 46,
+ BAND_53 = 53,
+ BAND_96 = 96,
+};
diff --git a/radio/1.6/vts/functional/radio_hidl_hal_utils_v1_6.h b/radio/1.6/vts/functional/radio_hidl_hal_utils_v1_6.h
index fbcd7a9..5fcfa3b 100644
--- a/radio/1.6/vts/functional/radio_hidl_hal_utils_v1_6.h
+++ b/radio/1.6/vts/functional/radio_hidl_hal_utils_v1_6.h
@@ -857,6 +857,11 @@
const ::android::hardware::hidl_vec<::android::hardware::radio::V1_6::CellInfo>&
records);
+ Return<void> currentPhysicalChannelConfigs_1_6(
+ RadioIndicationType type,
+ const ::android::hardware::hidl_vec<
+ ::android::hardware::radio::V1_6::PhysicalChannelConfig>& configs);
+
/* 1.5 Api */
Return<void> uiccApplicationsEnablementChanged(RadioIndicationType type, bool enabled);
diff --git a/radio/1.6/vts/functional/radio_indication.cpp b/radio/1.6/vts/functional/radio_indication.cpp
index bfc54c0..e7a9680 100644
--- a/radio/1.6/vts/functional/radio_indication.cpp
+++ b/radio/1.6/vts/functional/radio_indication.cpp
@@ -30,6 +30,13 @@
return Void();
}
+Return<void> RadioIndication_v1_6::currentPhysicalChannelConfigs_1_6(
+ RadioIndicationType /*type*/,
+ const ::android::hardware::hidl_vec<
+ ::android::hardware::radio::V1_6::PhysicalChannelConfig>& /*configs*/) {
+ return Void();
+}
+
/* 1.5 Apis */
Return<void> RadioIndication_v1_6::uiccApplicationsEnablementChanged(RadioIndicationType /*type*/,
bool /*enabled*/) {
diff --git a/radio/config/1.3/Android.bp b/radio/config/1.3/Android.bp
new file mode 100644
index 0000000..ace0de9
--- /dev/null
+++ b/radio/config/1.3/Android.bp
@@ -0,0 +1,21 @@
+// This file is autogenerated by hidl-gen -Landroidbp.
+
+hidl_interface {
+ name: "android.hardware.radio.config@1.3",
+ root: "android.hardware",
+ srcs: [
+ "types.hal",
+ "IRadioConfig.hal",
+ "IRadioConfigResponse.hal",
+ ],
+ interfaces: [
+ "android.hardware.radio.config@1.0",
+ "android.hardware.radio.config@1.1",
+ "android.hardware.radio.config@1.2",
+ "android.hardware.radio@1.0",
+ "android.hardware.radio@1.6",
+ "android.hidl.base@1.0",
+ ],
+ gen_java: true,
+ system_ext_specific: true,
+}
diff --git a/radio/config/1.3/IRadioConfig.hal b/radio/config/1.3/IRadioConfig.hal
new file mode 100644
index 0000000..83bcf92
--- /dev/null
+++ b/radio/config/1.3/IRadioConfig.hal
@@ -0,0 +1,42 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ *
+ *
+ * This interface is used by telephony and telecom to talk to cellular radio for the purpose of
+ * radio configuration, and it is not associated with any specific modem or slot.
+ * All the functions have minimum one parameter:
+ * serial: which corresponds to serial no. of request. Serial numbers must only be memorized for the
+ * duration of a method call. If clients provide colliding serials (including passing the same
+ * serial to different methods), multiple responses (one for each method call) must still be served.
+ */
+
+package android.hardware.radio.config@1.3;
+
+import @1.1::IRadioConfig;
+import IRadioConfigResponse;
+
+interface IRadioConfig extends @1.1::IRadioConfig {
+ /**
+ * Gets the available Radio Hal capabilities on the current device.
+ *
+ * This is called once per device boot up.
+ *
+ * @param serial Serial number of request
+ *
+ * Response callback is
+ * IRadioConfigResponse.getHalDeviceCapabilitiesResponse()
+ */
+ oneway getHalDeviceCapabilities(int32_t serial);
+};
diff --git a/radio/config/1.3/IRadioConfigResponse.hal b/radio/config/1.3/IRadioConfigResponse.hal
new file mode 100644
index 0000000..863754f
--- /dev/null
+++ b/radio/config/1.3/IRadioConfigResponse.hal
@@ -0,0 +1,39 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.hardware.radio.config@1.3;
+
+import android.hardware.radio@1.6::RadioResponseInfo;
+import @1.2::IRadioConfigResponse;
+import HalDeviceCapabilities;
+
+/**
+ * Interface declaring response functions to solicited radio config requests.
+ */
+interface IRadioConfigResponse extends @1.2::IRadioConfigResponse {
+ /**
+ * @param info Response info struct containing response type, serial no. and error
+ * @param capabilities Capabilities struct containing the capabilities of the
+ * device related to the Radio HAL
+ *
+ * Valid errors returned:
+ * RadioError:NONE
+ * RadioError:RADIO_NOT_AVAILABLE
+ * RadioError:INTERNAL_ERR
+ */
+ oneway getHalDeviceCapabilitiesResponse(RadioResponseInfo info,
+ HalDeviceCapabilities capabilities);
+};
diff --git a/health/1.0/default/libhealthd/healthd_board_default.cpp b/radio/config/1.3/types.hal
similarity index 63%
copy from health/1.0/default/libhealthd/healthd_board_default.cpp
copy to radio/config/1.3/types.hal
index 127f98e..bedb709 100644
--- a/health/1.0/default/libhealthd/healthd_board_default.cpp
+++ b/radio/config/1.3/types.hal
@@ -1,5 +1,5 @@
/*
- * Copyright (C) 2013 The Android Open Source Project
+ * Copyright (C) 2020 The Android Open Source Project
*
* Licensed under the Apache License, Version 2.0 (the "License");
* you may not use this file except in compliance with the License.
@@ -14,15 +14,9 @@
* limitations under the License.
*/
-#include <healthd/healthd.h>
+package android.hardware.radio.config@1.3;
-void healthd_board_init(struct healthd_config*)
-{
- // use defaults
-}
-
-int healthd_board_battery_update(struct android::BatteryProperties*)
-{
- // return 0 to log periodic polled battery status to kernel log
- return 0;
-}
+/**
+ * Contains the device capabilities with respect to the Radio HAL.
+ */
+struct HalDeviceCapabilities {};
diff --git a/radio/config/1.3/vts/functional/Android.bp b/radio/config/1.3/vts/functional/Android.bp
new file mode 100644
index 0000000..abd081f
--- /dev/null
+++ b/radio/config/1.3/vts/functional/Android.bp
@@ -0,0 +1,39 @@
+//
+// Copyright (C) 2019 The Android Open Source Project
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+//
+
+cc_test {
+ name: "VtsHalRadioConfigV1_3TargetTest",
+ defaults: ["VtsHalTargetTestDefaults"],
+ srcs: [
+ "radio_config_hidl_hal_api.cpp",
+ "radio_config_hidl_hal_test.cpp",
+ "radio_config_response.cpp",
+ "radio_config_indication.cpp",
+ "VtsHalRadioConfigV1_3TargetTest.cpp",
+ ],
+ static_libs: [
+ "RadioVtsTestUtilBase",
+ "android.hardware.radio.config@1.0",
+ "android.hardware.radio.config@1.1",
+ "android.hardware.radio.config@1.2",
+ "android.hardware.radio.config@1.3",
+ ],
+ header_libs: ["radio.util.header@1.0"],
+ test_suites: [
+ "general-tests",
+ "vts",
+ ],
+}
diff --git a/radio/config/1.3/vts/functional/VtsHalRadioConfigV1_3TargetTest.cpp b/radio/config/1.3/vts/functional/VtsHalRadioConfigV1_3TargetTest.cpp
new file mode 100644
index 0000000..5772d08
--- /dev/null
+++ b/radio/config/1.3/vts/functional/VtsHalRadioConfigV1_3TargetTest.cpp
@@ -0,0 +1,23 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <radio_config_hidl_hal_utils.h>
+
+GTEST_ALLOW_UNINSTANTIATED_PARAMETERIZED_TEST(RadioConfigHidlTest);
+INSTANTIATE_TEST_SUITE_P(
+ PerInstance, RadioConfigHidlTest,
+ testing::ValuesIn(android::hardware::getAllHalInstanceNames(IRadioConfig::descriptor)),
+ android::hardware::PrintInstanceNameToString);
diff --git a/radio/config/1.3/vts/functional/radio_config_hidl_hal_api.cpp b/radio/config/1.3/vts/functional/radio_config_hidl_hal_api.cpp
new file mode 100644
index 0000000..8df02dd
--- /dev/null
+++ b/radio/config/1.3/vts/functional/radio_config_hidl_hal_api.cpp
@@ -0,0 +1,30 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <radio_config_hidl_hal_utils.h>
+
+#define ASSERT_OK(ret) ASSERT_TRUE(ret.isOk())
+
+/*
+ * Test IRadioConfig.getHalDeviceCapabilities()
+ */
+TEST_P(RadioConfigHidlTest, getHalDeviceCapabilities) {
+ const int serial = GetRandomSerialNumber();
+ Return<void> res = radioConfig->getHalDeviceCapabilities(serial);
+ ASSERT_OK(res);
+ ALOGI("getHalDeviceCapabilities, rspInfo.error = %s\n",
+ toString(radioConfigRsp->rspInfo.error).c_str());
+}
diff --git a/radio/config/1.3/vts/functional/radio_config_hidl_hal_test.cpp b/radio/config/1.3/vts/functional/radio_config_hidl_hal_test.cpp
new file mode 100644
index 0000000..de8365a
--- /dev/null
+++ b/radio/config/1.3/vts/functional/radio_config_hidl_hal_test.cpp
@@ -0,0 +1,62 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <radio_config_hidl_hal_utils.h>
+
+void RadioConfigHidlTest::SetUp() {
+ radioConfig = IRadioConfig::getService(GetParam());
+ if (radioConfig == NULL) {
+ sleep(60);
+ radioConfig = IRadioConfig::getService(GetParam());
+ }
+ ASSERT_NE(nullptr, radioConfig.get());
+
+ radioConfigRsp = new (std::nothrow) RadioConfigResponse(*this);
+ ASSERT_NE(nullptr, radioConfigRsp.get());
+
+ count_ = 0;
+
+ radioConfig->setResponseFunctions(radioConfigRsp, nullptr);
+}
+
+/*
+ * Notify that the response message is received.
+ */
+void RadioConfigHidlTest::notify(int receivedSerial) {
+ std::unique_lock<std::mutex> lock(mtx_);
+ if (serial == receivedSerial) {
+ count_++;
+ cv_.notify_one();
+ }
+}
+
+/*
+ * Wait till the response message is notified or till TIMEOUT_PERIOD.
+ */
+std::cv_status RadioConfigHidlTest::wait() {
+ std::unique_lock<std::mutex> lock(mtx_);
+
+ std::cv_status status = std::cv_status::no_timeout;
+ auto now = std::chrono::system_clock::now();
+ while (count_ == 0) {
+ status = cv_.wait_until(lock, now + std::chrono::seconds(TIMEOUT_PERIOD));
+ if (status == std::cv_status::timeout) {
+ return status;
+ }
+ }
+ count_--;
+ return status;
+}
diff --git a/radio/config/1.3/vts/functional/radio_config_hidl_hal_utils.h b/radio/config/1.3/vts/functional/radio_config_hidl_hal_utils.h
new file mode 100644
index 0000000..439eb70
--- /dev/null
+++ b/radio/config/1.3/vts/functional/radio_config_hidl_hal_utils.h
@@ -0,0 +1,135 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <android-base/logging.h>
+
+#include <chrono>
+#include <condition_variable>
+#include <mutex>
+
+#include <android/hardware/radio/config/1.1/IRadioConfig.h>
+#include <android/hardware/radio/config/1.1/types.h>
+#include <android/hardware/radio/config/1.2/IRadioConfigIndication.h>
+#include <android/hardware/radio/config/1.2/IRadioConfigResponse.h>
+#include <android/hardware/radio/config/1.2/types.h>
+#include <android/hardware/radio/config/1.3/IRadioConfig.h>
+#include <android/hardware/radio/config/1.3/IRadioConfigResponse.h>
+#include <android/hardware/radio/config/1.3/types.h>
+#include <gtest/gtest.h>
+#include <hidl/GtestPrinter.h>
+#include <hidl/ServiceManagement.h>
+#include <log/log.h>
+
+#include "vts_test_util.h"
+
+using namespace ::android::hardware::radio::config::V1_2;
+
+using ::android::sp;
+using ::android::hardware::hidl_string;
+using ::android::hardware::hidl_vec;
+using ::android::hardware::Return;
+using ::android::hardware::Void;
+using ::android::hardware::radio::config::V1_1::ModemsConfig;
+using ::android::hardware::radio::config::V1_1::PhoneCapability;
+using ::android::hardware::radio::config::V1_2::SimSlotStatus;
+using ::android::hardware::radio::config::V1_3::HalDeviceCapabilities;
+using ::android::hardware::radio::config::V1_3::IRadioConfig;
+using ::android::hardware::radio::V1_0::RadioResponseInfo;
+
+#define TIMEOUT_PERIOD 75
+#define RADIO_SERVICE_NAME "slot1"
+
+class RadioConfigHidlTest;
+
+/* Callback class for radio config response */
+class RadioConfigResponse : public IRadioConfigResponse {
+ protected:
+ RadioConfigHidlTest& parent;
+
+ public:
+ RadioResponseInfo rspInfo;
+ PhoneCapability phoneCap;
+
+ RadioConfigResponse(RadioConfigHidlTest& parent);
+ virtual ~RadioConfigResponse() = default;
+
+ Return<void> getSimSlotsStatusResponse(
+ const RadioResponseInfo& info,
+ const ::android::hardware::hidl_vec<
+ ::android::hardware::radio::config::V1_0::SimSlotStatus>& slotStatus);
+
+ Return<void> getSimSlotsStatusResponse_1_2(
+ const RadioResponseInfo& info,
+ const ::android::hardware::hidl_vec<SimSlotStatus>& slotStatus);
+
+ Return<void> setSimSlotsMappingResponse(const RadioResponseInfo& info);
+
+ Return<void> getPhoneCapabilityResponse(const RadioResponseInfo& info,
+ const PhoneCapability& phoneCapability);
+
+ Return<void> setPreferredDataModemResponse(const RadioResponseInfo& info);
+
+ Return<void> getModemsConfigResponse(const RadioResponseInfo& info,
+ const ModemsConfig& mConfig);
+
+ Return<void> setModemsConfigResponse(const RadioResponseInfo& info);
+
+ Return<void> getHalDeviceCapabilitiesResponse(
+ const ::android::hardware::radio::V1_6::RadioResponseInfo& info,
+ const HalDeviceCapabilities& halDeviceCapabilities);
+};
+
+/* Callback class for radio config indication */
+class RadioConfigIndication : public IRadioConfigIndication {
+ protected:
+ RadioConfigHidlTest& parent;
+
+ public:
+ RadioConfigIndication(RadioConfigHidlTest& parent);
+ virtual ~RadioConfigIndication() = default;
+
+ Return<void> simSlotsStatusChanged_1_2(
+ ::android::hardware::radio::V1_0::RadioIndicationType type,
+ const ::android::hardware::hidl_vec<SimSlotStatus>& slotStatus);
+};
+
+// The main test class for Radio config HIDL.
+class RadioConfigHidlTest : public ::testing::TestWithParam<std::string> {
+ protected:
+ std::mutex mtx_;
+ std::condition_variable cv_;
+ int count_;
+
+ public:
+ virtual void SetUp() override;
+
+ /* Used as a mechanism to inform the test about data/event callback */
+ void notify(int receivedSerial);
+
+ /* Test code calls this function to wait for response */
+ std::cv_status wait();
+
+ void updateSimCardStatus();
+
+ /* Serial number for radio request */
+ int serial;
+
+ /* radio config service handle */
+ sp<IRadioConfig> radioConfig;
+
+ /* radio config response handle */
+ sp<RadioConfigResponse> radioConfigRsp;
+};
diff --git a/radio/config/1.3/vts/functional/radio_config_indication.cpp b/radio/config/1.3/vts/functional/radio_config_indication.cpp
new file mode 100644
index 0000000..6fa443c
--- /dev/null
+++ b/radio/config/1.3/vts/functional/radio_config_indication.cpp
@@ -0,0 +1,25 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <radio_config_hidl_hal_utils.h>
+
+RadioConfigIndication::RadioConfigIndication(RadioConfigHidlTest& parent) : parent(parent) {}
+
+Return<void> RadioConfigIndication::simSlotsStatusChanged_1_2(
+ ::android::hardware::radio::V1_0::RadioIndicationType /*type*/,
+ const ::android::hardware::hidl_vec<SimSlotStatus>& /*slotStatus*/) {
+ return Void();
+}
diff --git a/radio/config/1.3/vts/functional/radio_config_response.cpp b/radio/config/1.3/vts/functional/radio_config_response.cpp
new file mode 100644
index 0000000..2a8b28b
--- /dev/null
+++ b/radio/config/1.3/vts/functional/radio_config_response.cpp
@@ -0,0 +1,70 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <radio_config_hidl_hal_utils.h>
+
+// SimSlotStatus slotStatus;
+
+RadioConfigResponse::RadioConfigResponse(RadioConfigHidlTest& parent) : parent(parent) {}
+
+Return<void> RadioConfigResponse::getSimSlotsStatusResponse(
+ const ::android::hardware::radio::V1_0::RadioResponseInfo& /* info */,
+ const ::android::hardware::hidl_vec<
+ ::android::hardware::radio::config::V1_0::SimSlotStatus>& /* slotStatus */) {
+ return Void();
+}
+
+Return<void> RadioConfigResponse::getSimSlotsStatusResponse_1_2(
+ const ::android::hardware::radio::V1_0::RadioResponseInfo& /* info */,
+ const ::android::hardware::hidl_vec<SimSlotStatus>& /* slotStatus */) {
+ return Void();
+}
+
+Return<void> RadioConfigResponse::setSimSlotsMappingResponse(
+ const ::android::hardware::radio::V1_0::RadioResponseInfo& /* info */) {
+ return Void();
+}
+
+Return<void> RadioConfigResponse::getPhoneCapabilityResponse(
+ const ::android::hardware::radio::V1_0::RadioResponseInfo& info,
+ const PhoneCapability& phoneCapability) {
+ rspInfo = info;
+ phoneCap = phoneCapability;
+ parent.notify(info.serial);
+ return Void();
+}
+
+Return<void> RadioConfigResponse::setPreferredDataModemResponse(
+ const ::android::hardware::radio::V1_0::RadioResponseInfo& /* info */) {
+ return Void();
+}
+
+Return<void> RadioConfigResponse::getModemsConfigResponse(
+ const ::android::hardware::radio::V1_0::RadioResponseInfo& /* info */,
+ const ModemsConfig& /* mConfig */) {
+ return Void();
+}
+
+Return<void> RadioConfigResponse::setModemsConfigResponse(
+ const ::android::hardware::radio::V1_0::RadioResponseInfo& /* info */) {
+ return Void();
+}
+
+Return<void> RadioConfigResponse::getHalDeviceCapabilitiesResponse(
+ const ::android::hardware::radio::V1_6::RadioResponseInfo& /* info */,
+ const ::android::hardware::radio::config::V1_3::HalDeviceCapabilities& /* capabilities */) {
+ return Void();
+}
\ No newline at end of file
diff --git a/security/keymint/aidl/Android.bp b/security/keymint/aidl/Android.bp
index b5adac9..5652827 100644
--- a/security/keymint/aidl/Android.bp
+++ b/security/keymint/aidl/Android.bp
@@ -4,6 +4,9 @@
srcs: [
"android/hardware/security/keymint/*.aidl",
],
+ imports: [
+ "android.hardware.security.secureclock",
+ ],
stability: "vintf",
backend: {
java: {
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/Algorithm.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/Algorithm.aidl
index 46e0ae0..a6c3e65 100644
--- a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/Algorithm.aidl
+++ b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/Algorithm.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/BeginResult.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/BeginResult.aidl
index ed96485..84395af 100644
--- a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/BeginResult.aidl
+++ b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/BeginResult.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/BlockMode.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/BlockMode.aidl
index dddc9d8..e914823 100644
--- a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/BlockMode.aidl
+++ b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/BlockMode.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/ByteArray.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/ByteArray.aidl
index 3d18a26..cef8eca 100644
--- a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/ByteArray.aidl
+++ b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/ByteArray.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/Certificate.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/Certificate.aidl
index 9e0f8dc..2277831 100644
--- a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/Certificate.aidl
+++ b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/Certificate.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/Digest.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/Digest.aidl
index 8fc4d42..2e583ce 100644
--- a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/Digest.aidl
+++ b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/Digest.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/EcCurve.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/EcCurve.aidl
index 7c3f2f3..b372822 100644
--- a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/EcCurve.aidl
+++ b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/EcCurve.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/ErrorCode.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/ErrorCode.aidl
index cdcb08d..aa8c071 100644
--- a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/ErrorCode.aidl
+++ b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/ErrorCode.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
@@ -94,6 +95,8 @@
ATTESTATION_IDS_NOT_PROVISIONED = -75,
INVALID_OPERATION = -76,
STORAGE_KEY_UNSUPPORTED = -77,
+ INCOMPATIBLE_MGF_DIGEST = -78,
+ UNSUPPORTED_MGF_DIGEST = -79,
UNIMPLEMENTED = -100,
VERSION_MISMATCH = -101,
UNKNOWN_ERROR = -1000,
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/HardwareAuthToken.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/HardwareAuthToken.aidl
index 9ea24f5..5858c77 100644
--- a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/HardwareAuthToken.aidl
+++ b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/HardwareAuthToken.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
@@ -16,12 +17,12 @@
// later when a module using the interface is updated, e.g., Mainline modules.
package android.hardware.security.keymint;
-@VintfStability
+@RustDerive(Clone=true, Eq=true, Hash=true, Ord=true, PartialEq=true, PartialOrd=true) @VintfStability
parcelable HardwareAuthToken {
long challenge;
long userId;
long authenticatorId;
android.hardware.security.keymint.HardwareAuthenticatorType authenticatorType;
- android.hardware.security.keymint.Timestamp timestamp;
+ android.hardware.security.secureclock.Timestamp timestamp;
byte[] mac;
}
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/HardwareAuthenticatorType.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/HardwareAuthenticatorType.aidl
index aef5ee0..9ab00c1 100644
--- a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/HardwareAuthenticatorType.aidl
+++ b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/HardwareAuthenticatorType.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/IKeyMintDevice.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/IKeyMintDevice.aidl
index 3d08cfe..c95145d 100644
--- a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/IKeyMintDevice.aidl
+++ b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/IKeyMintDevice.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
@@ -19,11 +20,10 @@
@VintfStability
interface IKeyMintDevice {
android.hardware.security.keymint.KeyMintHardwareInfo getHardwareInfo();
- android.hardware.security.keymint.VerificationToken verifyAuthorization(in long challenge, in android.hardware.security.keymint.HardwareAuthToken token);
void addRngEntropy(in byte[] data);
- void generateKey(in android.hardware.security.keymint.KeyParameter[] keyParams, out android.hardware.security.keymint.ByteArray generatedKeyBlob, out android.hardware.security.keymint.KeyCharacteristics generatedKeyCharacteristics, out android.hardware.security.keymint.Certificate[] outCertChain);
- void importKey(in android.hardware.security.keymint.KeyParameter[] inKeyParams, in android.hardware.security.keymint.KeyFormat inKeyFormat, in byte[] inKeyData, out android.hardware.security.keymint.ByteArray outImportedKeyBlob, out android.hardware.security.keymint.KeyCharacteristics outImportedKeyCharacteristics, out android.hardware.security.keymint.Certificate[] outCertChain);
- void importWrappedKey(in byte[] inWrappedKeyData, in byte[] inWrappingKeyBlob, in byte[] inMaskingKey, in android.hardware.security.keymint.KeyParameter[] inUnwrappingParams, in long inPasswordSid, in long inBiometricSid, out android.hardware.security.keymint.ByteArray outImportedKeyBlob, out android.hardware.security.keymint.KeyCharacteristics outImportedKeyCharacteristics);
+ android.hardware.security.keymint.KeyCreationResult generateKey(in android.hardware.security.keymint.KeyParameter[] keyParams);
+ android.hardware.security.keymint.KeyCreationResult importKey(in android.hardware.security.keymint.KeyParameter[] keyParams, in android.hardware.security.keymint.KeyFormat keyFormat, in byte[] keyData);
+ android.hardware.security.keymint.KeyCreationResult importWrappedKey(in byte[] wrappedKeyData, in byte[] wrappingKeyBlob, in byte[] maskingKey, in android.hardware.security.keymint.KeyParameter[] unwrappingParams, in long passwordSid, in long biometricSid);
byte[] upgradeKey(in byte[] inKeyBlobToUpgrade, in android.hardware.security.keymint.KeyParameter[] inUpgradeParams);
void deleteKey(in byte[] inKeyBlob);
void deleteAllKeys();
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/IKeyMintOperation.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/IKeyMintOperation.aidl
index 8e3b0fc..e6ab4c8 100644
--- a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/IKeyMintOperation.aidl
+++ b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/IKeyMintOperation.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
@@ -18,7 +19,7 @@
package android.hardware.security.keymint;
@VintfStability
interface IKeyMintOperation {
- int update(in @nullable android.hardware.security.keymint.KeyParameterArray inParams, in @nullable byte[] input, in @nullable android.hardware.security.keymint.HardwareAuthToken inAuthToken, in @nullable android.hardware.security.keymint.VerificationToken inVerificationToken, out @nullable android.hardware.security.keymint.KeyParameterArray outParams, out @nullable android.hardware.security.keymint.ByteArray output);
- byte[] finish(in @nullable android.hardware.security.keymint.KeyParameterArray inParams, in @nullable byte[] input, in @nullable byte[] inSignature, in @nullable android.hardware.security.keymint.HardwareAuthToken authToken, in @nullable android.hardware.security.keymint.VerificationToken inVerificationToken, out @nullable android.hardware.security.keymint.KeyParameterArray outParams);
+ int update(in @nullable android.hardware.security.keymint.KeyParameterArray inParams, in @nullable byte[] input, in @nullable android.hardware.security.keymint.HardwareAuthToken inAuthToken, in @nullable android.hardware.security.secureclock.TimeStampToken inTimeStampToken, out @nullable android.hardware.security.keymint.KeyParameterArray outParams, out @nullable android.hardware.security.keymint.ByteArray output);
+ byte[] finish(in @nullable android.hardware.security.keymint.KeyParameterArray inParams, in @nullable byte[] input, in @nullable byte[] inSignature, in @nullable android.hardware.security.keymint.HardwareAuthToken authToken, in @nullable android.hardware.security.secureclock.TimeStampToken inTimeStampToken, out @nullable android.hardware.security.keymint.KeyParameterArray outParams);
void abort();
}
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyCharacteristics.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyCharacteristics.aidl
index fb4214c..49ea8af 100644
--- a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyCharacteristics.aidl
+++ b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyCharacteristics.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
@@ -18,6 +19,6 @@
package android.hardware.security.keymint;
@VintfStability
parcelable KeyCharacteristics {
- android.hardware.security.keymint.KeyParameter[] softwareEnforced;
- android.hardware.security.keymint.KeyParameter[] hardwareEnforced;
+ android.hardware.security.keymint.SecurityLevel securityLevel;
+ android.hardware.security.keymint.KeyParameter[] authorizations;
}
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyCreationResult.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyCreationResult.aidl
new file mode 100644
index 0000000..4b9ac79
--- /dev/null
+++ b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyCreationResult.aidl
@@ -0,0 +1,25 @@
+///////////////////////////////////////////////////////////////////////////////
+// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
+///////////////////////////////////////////////////////////////////////////////
+
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
+//
+// You must not make a backward incompatible change to any AIDL file built
+// with the aidl_interface module type with versions property set. The module
+// type is used to build AIDL files in a way that they can be used across
+// independently updatable components of the system. If a device is shipped
+// with such a backward incompatible change, it has a high risk of breaking
+// later when a module using the interface is updated, e.g., Mainline modules.
+
+package android.hardware.security.keymint;
+@VintfStability
+parcelable KeyCreationResult {
+ byte[] keyBlob;
+ android.hardware.security.keymint.KeyCharacteristics[] keyCharacteristics;
+ android.hardware.security.keymint.Certificate[] certificateChain;
+}
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyFormat.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyFormat.aidl
index f701c80..4eb5a78 100644
--- a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyFormat.aidl
+++ b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyFormat.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyMintHardwareInfo.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyMintHardwareInfo.aidl
index 5e9f7ae..0390ec9 100644
--- a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyMintHardwareInfo.aidl
+++ b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyMintHardwareInfo.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyOrigin.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyOrigin.aidl
index 9728bf9..e84cf74 100644
--- a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyOrigin.aidl
+++ b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyOrigin.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyParameter.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyParameter.aidl
index 4985768..6829a2b 100644
--- a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyParameter.aidl
+++ b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyParameter.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyParameterArray.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyParameterArray.aidl
index 2c3b768..882ca89 100644
--- a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyParameterArray.aidl
+++ b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyParameterArray.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyParameterValue.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyParameterValue.aidl
index ecf20ad..6c11a92 100644
--- a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyParameterValue.aidl
+++ b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyParameterValue.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyPurpose.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyPurpose.aidl
index a6fd8c3..ff8d85a 100644
--- a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyPurpose.aidl
+++ b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/KeyPurpose.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/PaddingMode.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/PaddingMode.aidl
index 2ecfa1e..6c61312 100644
--- a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/PaddingMode.aidl
+++ b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/PaddingMode.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/SecurityLevel.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/SecurityLevel.aidl
index 601693f..c4812ed 100644
--- a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/SecurityLevel.aidl
+++ b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/SecurityLevel.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/Tag.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/Tag.aidl
index 38eb6e6..ce12fed 100644
--- a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/Tag.aidl
+++ b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/Tag.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
@@ -30,6 +31,7 @@
EC_CURVE = 268435466,
RSA_PUBLIC_EXPONENT = 1342177480,
INCLUDE_UNIQUE_ID = 1879048394,
+ RSA_OAEP_MGF_DIGEST = 536871115,
BLOB_USAGE_REQUIREMENTS = 268435757,
BOOTLOADER_ONLY = 1879048494,
ROLLBACK_RESISTANCE = 1879048495,
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/TagType.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/TagType.aidl
index bb2766c..41c8832 100644
--- a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/TagType.aidl
+++ b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/TagType.aidl
@@ -2,13 +2,14 @@
// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
///////////////////////////////////////////////////////////////////////////////
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
//
-// You must not make a backward incompatible changes to the AIDL files built
+// You must not make a backward incompatible change to any AIDL file built
// with the aidl_interface module type with versions property set. The module
// type is used to build AIDL files in a way that they can be used across
// independently updatable components of the system. If a device is shipped
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/Timestamp.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/Timestamp.aidl
deleted file mode 100644
index 4d5b659..0000000
--- a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/Timestamp.aidl
+++ /dev/null
@@ -1,22 +0,0 @@
-///////////////////////////////////////////////////////////////////////////////
-// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
-///////////////////////////////////////////////////////////////////////////////
-
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
-//
-// You must not make a backward incompatible changes to the AIDL files built
-// with the aidl_interface module type with versions property set. The module
-// type is used to build AIDL files in a way that they can be used across
-// independently updatable components of the system. If a device is shipped
-// with such a backward incompatible change, it has a high risk of breaking
-// later when a module using the interface is updated, e.g., Mainline modules.
-
-package android.hardware.security.keymint;
-@VintfStability
-parcelable Timestamp {
- long milliSeconds;
-}
diff --git a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/VerificationToken.aidl b/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/VerificationToken.aidl
deleted file mode 100644
index 5c76816..0000000
--- a/security/keymint/aidl/aidl_api/android.hardware.security.keymint/current/android/hardware/security/keymint/VerificationToken.aidl
+++ /dev/null
@@ -1,25 +0,0 @@
-///////////////////////////////////////////////////////////////////////////////
-// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
-///////////////////////////////////////////////////////////////////////////////
-
-// This file is a snapshot of an AIDL interface (or parcelable). Do not try to
-// edit this file. It looks like you are doing that because you have modified
-// an AIDL interface in a backward-incompatible way, e.g., deleting a function
-// from an interface or a field from a parcelable and it broke the build. That
-// breakage is intended.
-//
-// You must not make a backward incompatible changes to the AIDL files built
-// with the aidl_interface module type with versions property set. The module
-// type is used to build AIDL files in a way that they can be used across
-// independently updatable components of the system. If a device is shipped
-// with such a backward incompatible change, it has a high risk of breaking
-// later when a module using the interface is updated, e.g., Mainline modules.
-
-package android.hardware.security.keymint;
-@VintfStability
-parcelable VerificationToken {
- long challenge;
- android.hardware.security.keymint.Timestamp timestamp;
- android.hardware.security.keymint.SecurityLevel securityLevel;
- byte[] mac;
-}
diff --git a/security/keymint/aidl/android/hardware/security/keymint/Certificate.aidl b/security/keymint/aidl/android/hardware/security/keymint/Certificate.aidl
index a953859..0e5d898 100644
--- a/security/keymint/aidl/android/hardware/security/keymint/Certificate.aidl
+++ b/security/keymint/aidl/android/hardware/security/keymint/Certificate.aidl
@@ -17,9 +17,8 @@
package android.hardware.security.keymint;
/**
- * This encodes the IKeyMintDevice attestation generated certificate.
+ * This encodes an IKeyMintDevice certificate, generated for a KeyMint asymmetric public key.
*/
-
@VintfStability
parcelable Certificate {
/**
diff --git a/security/keymint/aidl/android/hardware/security/keymint/ErrorCode.aidl b/security/keymint/aidl/android/hardware/security/keymint/ErrorCode.aidl
index fb24ad1..b20601d 100644
--- a/security/keymint/aidl/android/hardware/security/keymint/ErrorCode.aidl
+++ b/security/keymint/aidl/android/hardware/security/keymint/ErrorCode.aidl
@@ -99,6 +99,8 @@
ATTESTATION_IDS_NOT_PROVISIONED = -75,
INVALID_OPERATION = -76,
STORAGE_KEY_UNSUPPORTED = -77,
+ INCOMPATIBLE_MGF_DIGEST = -78,
+ UNSUPPORTED_MGF_DIGEST = -79,
UNIMPLEMENTED = -100,
VERSION_MISMATCH = -101,
diff --git a/security/keymint/aidl/android/hardware/security/keymint/HardwareAuthToken.aidl b/security/keymint/aidl/android/hardware/security/keymint/HardwareAuthToken.aidl
index 12d615f..417a0b1 100644
--- a/security/keymint/aidl/android/hardware/security/keymint/HardwareAuthToken.aidl
+++ b/security/keymint/aidl/android/hardware/security/keymint/HardwareAuthToken.aidl
@@ -16,7 +16,7 @@
package android.hardware.security.keymint;
-import android.hardware.security.keymint.Timestamp;
+import android.hardware.security.secureclock.Timestamp;
import android.hardware.security.keymint.HardwareAuthenticatorType;
/**
@@ -29,6 +29,7 @@
* appropriate for a given key operation.
*/
@VintfStability
+@RustDerive(Clone=true, Eq=true, PartialEq=true, Ord=true, PartialOrd=true, Hash=true)
parcelable HardwareAuthToken {
/**
* challenge is a value that's used to enable authentication tokens to authorize specific
diff --git a/security/keymint/aidl/android/hardware/security/keymint/IKeyMintDevice.aidl b/security/keymint/aidl/android/hardware/security/keymint/IKeyMintDevice.aidl
index 4944acb..1ca7713 100644
--- a/security/keymint/aidl/android/hardware/security/keymint/IKeyMintDevice.aidl
+++ b/security/keymint/aidl/android/hardware/security/keymint/IKeyMintDevice.aidl
@@ -18,16 +18,14 @@
import android.hardware.security.keymint.BeginResult;
import android.hardware.security.keymint.ByteArray;
-import android.hardware.security.keymint.Certificate;
import android.hardware.security.keymint.HardwareAuthToken;
import android.hardware.security.keymint.IKeyMintOperation;
-import android.hardware.security.keymint.KeyCharacteristics;
+import android.hardware.security.keymint.KeyCreationResult;
import android.hardware.security.keymint.KeyFormat;
import android.hardware.security.keymint.KeyParameter;
import android.hardware.security.keymint.KeyMintHardwareInfo;
import android.hardware.security.keymint.KeyPurpose;
import android.hardware.security.keymint.SecurityLevel;
-import android.hardware.security.keymint.VerificationToken;
/**
* KeyMint device definition.
@@ -126,16 +124,22 @@
* attacker can use them at will (though they're more secure than keys which can be
* exfiltrated). Therefore, IKeyMintDevice must enforce access controls.
*
- * Access controls are defined as an "authorization list" of tag/value pairs. Authorization tags
- * are 32-bit integers from the Tag enum, and the values are a variety of types, defined in the
- * TagType enum. Some tags may be repeated to specify multiple values. Whether a tag may be
- * repeated is specified in the documentation for the tag and in the TagType. When a key is
- * created or imported, the caller specifies an authorization list. The IKeyMintDevice must divide
- * the caller-provided authorizations into two lists, those it enforces in tee secure zone and
- * those enforced in the strongBox hardware. These two lists are returned as the "teeEnforced"
- * and "strongboxEnforced" elements of the KeyCharacteristics struct. Note that software enforced
- * authorization list entries are not returned because they are not enforced by keymint. The
- * IKeyMintDevice must also add the following authorizations to the appropriate list:
+ * Access controls are defined as "authorization lists" of tag/value pairs. Authorization tags are
+ * 32-bit integers from the Tag enum, and the values are a variety of types, defined in the TagType
+ * enum. Some tags may be repeated to specify multiple values. Whether a tag may be repeated is
+ * specified in the documentation for the tag and in the TagType. When a key is created or
+ * imported, the caller specifies a `key_description` authorization list. The IKeyMintDevice must
+ * determine which tags it can and cannot enforce, and at what SecurityLevel, and return an array of
+ * `KeyCharacteristics` structures that contains everything it will enforce, associated with the
+ * appropriate security level, which is one of SOFTWARE, TRUSTED_ENVIRONMENT and STRONGBOX.
+ * Typically, implementations will only return a single KeyCharacteristics structure, because
+ * everything they enforce is enforced at the same security level. There may be cases, however, for
+ * which multiple security levels are relevant. One example is that of a StrongBox IKeyMintDevice
+ * that relies on a TEE to enforce biometric user authentication. In that case, the generate/import
+ * methods must return two KeyCharacteristics structs, one with SecurityLevel::TRUSTED_ENVIRONMENT
+ * and the biometric authentication-related tags, and another with SecurityLevel::STRONGBOX and
+ * everything else. The IKeyMintDevice must also add the following authorizations to the
+ * appropriate list:
*
* o Tag::OS_VERSION
* o Tag::OS_PATCHLEVEL
@@ -148,26 +152,27 @@
* The caller must always provide the current date time in the keyParameter CREATION_DATETIME
* tags.
*
- * All authorization tags and their values, both teeEnforced and strongboxEnforced, including
- * unknown tags, must be cryptographically bound to the private/secret key material such that any
- * modification of the portion of the key blob that contains the authorization list makes it
- * impossible for the secure environment to obtain the private/secret key material. The
- * recommended approach to meet this requirement is to use the full set of authorization tags
- * associated with a key as input to a secure key derivation function used to derive a key that
- * is used to encrypt the private/secret key material.
+ * All authorization tags and their values enforced by an IKeyMintDevice must be cryptographically
+ * bound to the private/secret key material such that any modification of the portion of the key
+ * blob that contains the authorization list makes it impossible for the secure environment to
+ * obtain the private/secret key material. The recommended approach to meet this requirement is to
+ * use the full set of authorization tags associated with a key as input to a secure key derivation
+ * function used to derive a key (the KEK) that is used to encrypt the private/secret key material.
+ * Note that it is NOT acceptable to use a static KEK to encrypt the private/secret key material
+ * with an AEAD cipher mode, using the enforced authorization tags as AAD. This is because
+ * Tag::APPLICATION_DATA must not be included in the authorization tags stored in the key blob, but
+ * must be provided by the caller for every use. Assuming the Tag::APPLICATION_DATA value has
+ * sufficient entropy, this provides a cryptographic guarantee that an attacker cannot use a key
+ * without knowing the Tag::APPLICATION_DATA value, even if they compromise the IKeyMintDevice.
*
- * IKeyMintDevice implementations ignore any tags they cannot enforce and do not return them
- * in KeyCharacteristics. For example, Tag::ORIGINATION_EXPIRE_DATETIME provides the date and
- * time after which a key may not be used to encrypt or sign new messages. Unless the
- * IKeyMintDevice has access to a secure source of current date/time information, it is not
- * possible for the IKeyMintDevice to enforce this tag. An IKeyMintDevice implementation will
- * not rely on the non-secure world's notion of time, because it could be controlled by an
- * attacker. Similarly, it cannot rely on GPSr time, even if it has exclusive control of the
- * GPSr, because that might be spoofed by attacker RF signals.
- *
- * IKeyMintDevices do not use or enforce any tags they place in the softwareEnforced
- * list. The IKeyMintDevice caller must enforce them, and it is unnecessary to enforce them
- * twice.
+ * IKeyMintDevice implementations must ignore any tags they cannot enforce and must not return them
+ * in KeyCharacteristics. For example, Tag::ORIGINATION_EXPIRE_DATETIME provides the date and time
+ * after which a key may not be used to encrypt or sign new messages. Unless the IKeyMintDevice has
+ * access to a secure source of current date/time information, it is not possible for the
+ * IKeyMintDevice to enforce this tag. An IKeyMintDevice implementation will not rely on the
+ * non-secure world's notion of time, because it could be controlled by an attacker. Similarly, it
+ * cannot rely on GPSr time, even if it has exclusive control of the GPSr, because that might be
+ * spoofed by attacker RF signals.
*
* Some tags must be enforced by the IKeyMintDevice. See the detailed documentation on each Tag
* in Tag.aidl.
@@ -217,34 +222,6 @@
KeyMintHardwareInfo getHardwareInfo();
/**
- * Verify authorizations for another IKeyMintDevice instance.
- *
- * On systems with both a StrongBox and a TEE IKeyMintDevice instance it is sometimes useful
- * to ask the TEE KeyMintDevice to verify authorizations for a key hosted in StrongBox.
- *
- * For every StrongBox operation, Keystore is required to call this method on the TEE KeyMint,
- * passing in the StrongBox key's hardwareEnforced authorization list and the challenge
- * returned by StrongBox begin(). Keystore must then pass the VerificationToken to the
- * subsequent invocations of StrongBox update() and finish().
- *
- * StrongBox implementations must return ErrorCode::UNIMPLEMENTED.
- *
- * @param the challenge returned by StrongBox's keyMint's begin().
- *
- * @param authToken A HardwareAuthToken if needed to authorize key usage.
- *
- * @return error ErrorCode::OK on success or ErrorCode::UNIMPLEMENTED if the KeyMintDevice is
- * a StrongBox. If the IKeyMintDevice cannot verify one or more elements of
- * parametersToVerify it must not return an error code, but just omit the unverified
- * parameter from the VerificationToken.
- *
- * @return token the verification token. See VerificationToken in VerificationToken.aidl for
- * details.
- */
- VerificationToken verifyAuthorization(in long challenge,
- in HardwareAuthToken token);
-
- /**
* Adds entropy to the RNG used by KeyMint. Entropy added through this method must not be the
* only source of entropy used, and a secure mixing function must be used to mix the entropy
* provided by this method with internally-generated entropy. The mixing function must be
@@ -337,38 +314,9 @@
* provided in params. See above for detailed specifications of which tags are required
* for which types of keys.
*
- * @return generatedKeyBlob Opaque descriptor of the generated key. The recommended
- * implementation strategy is to include an encrypted copy of the key material, wrapped
- * in a key unavailable outside secure hardware.
- *
- * @return generatedKeyCharacteristics Description of the generated key, divided into two sets:
- * hardware-enforced and software-enforced. The description here applies equally
- * to the key characteristics lists returned by generateKey, importKey and
- * importWrappedKey. The characteristics returned by this parameter completely
- * describe the type and usage of the specified key.
- *
- * The rule that IKeyMintDevice implementations must use for deciding whether a
- * given tag belongs in the hardware-enforced or software-enforced list is that if
- * the meaning of the tag is fully assured by secure hardware, it is hardware
- * enforced. Otherwise, it's software enforced.
- *
- * @return outCertChain If the key is an asymmetric key, and proper keyparameters for
- * attestation (such as challenge) is provided, then this parameter will return the
- * attestation certificate. If the signing of the attestation certificate is from a
- * factory key, additional certificates back to the root attestation certificate will
- * also be provided. Clients will need to check root certificate against a known-good
- * value. The certificates must be DER-encoded. Caller needs to provide
- * CREATION_DATETIME as one of the attestation parameters, otherwise the attestation
- * certificate will not contain the creation datetime. The first certificate in the
- * vector is the attestation for the generated key itself, the next certificate is
- * the key that signs the first certificate, and so forth. The last certificate in
- * the chain is the root certificate. If the key is a symmetric key, then no
- * certificate will be returned and this variable will return empty. TODO: change
- * certificate return to a single certificate and make it nullable b/163604282.
+ * @return The result of key creation. See KeyCreationResult.aidl.
*/
- void generateKey(in KeyParameter[] keyParams, out ByteArray generatedKeyBlob,
- out KeyCharacteristics generatedKeyCharacteristics,
- out Certificate[] outCertChain);
+ KeyCreationResult generateKey(in KeyParameter[] keyParams);
/**
* Imports key material into an IKeyMintDevice. Key definition parameters and return values
@@ -396,29 +344,10 @@
*
* @param inKeyData The key material to import, in the format specified in keyFormat.
*
- * @return outImportedKeyBlob descriptor of the imported key. The format of the keyblob will
- * be the google specified keyblob format.
- *
- * @return outImportedKeyCharacteristics Description of the generated key. See the
- * keyCharacteristics description in generateKey.
- *
- * @return outCertChain If the key is an asymmetric key, and proper keyparameters for
- * attestation (such as challenge) is provided, then this parameter will return the
- * attestation certificate. If the signing of the attestation certificate is from a
- * factory key, additional certificates back to the root attestation certificate will
- * also be provided. Clients will need to check root certificate against a known-good
- * value. The certificates must be DER-encoded. Caller needs to provide
- * CREATION_DATETIME as one of the attestation parameters, otherwise the attestation
- * certificate will not contain the creation datetime. The first certificate in the
- * vector is the attestation for the generated key itself, the next certificate is
- * the key that signs the first certificate, and so forth. The last certificate in
- * the chain is the root certificate. If the key is a symmetric key, then no
- * certificate will be returned and this variable will return empty.
+ * @return The result of key creation. See KeyCreationResult.aidl.
*/
- void importKey(in KeyParameter[] inKeyParams, in KeyFormat inKeyFormat,
- in byte[] inKeyData, out ByteArray outImportedKeyBlob,
- out KeyCharacteristics outImportedKeyCharacteristics,
- out Certificate[] outCertChain);
+ KeyCreationResult importKey(in KeyParameter[] keyParams, in KeyFormat keyFormat,
+ in byte[] keyData);
/**
* Securely imports a key, or key pair, returning a key blob and a description of the imported
@@ -474,45 +403,38 @@
* 5. Perform the equivalent of calling importKey(keyParams, keyFormat, keyData), except
* that the origin tag should be set to SECURELY_IMPORTED.
*
- * @param inWrappingKeyBlob The opaque key descriptor returned by generateKey() or importKey().
+ * @param wrappingKeyBlob The opaque key descriptor returned by generateKey() or importKey().
* This key must have been created with Purpose::WRAP_KEY.
*
- * @param inMaskingKey The 32-byte value XOR'd with the transport key in the SecureWrappedKey
+ * @param maskingKey The 32-byte value XOR'd with the transport key in the SecureWrappedKey
* structure.
*
- * @param inUnwrappingParams must contain any parameters needed to perform the unwrapping
- * operation. For example, if the wrapping key is an AES key the block and padding
- * modes must be specified in this argument.
+ * @param unwrappingParams must contain any parameters needed to perform the unwrapping
+ * operation. For example, if the wrapping key is an AES key the block and padding modes
+ * must be specified in this argument.
*
- * @param inPasswordSid specifies the password secure ID (SID) of the user that owns the key
- * being installed. If the authorization list in wrappedKeyData contains a
- * Tag::USER_SECURE_IDwith a value that has the HardwareAuthenticatorType::PASSWORD
- * bit set, the constructed key must be bound to the SID value provided by this
- * argument. If the wrappedKeyData does not contain such a tag and value, this argument
- * must be ignored.
+ * @param passwordSid specifies the password secure ID (SID) of the user that owns the key being
+ * installed. If the authorization list in wrappedKeyData contains a
+ * Tag::USER_SECURE_IDwith a value that has the HardwareAuthenticatorType::PASSWORD bit
+ * set, the constructed key must be bound to the SID value provided by this argument. If
+ * the wrappedKeyData does not contain such a tag and value, this argument must be
+ * ignored.
*
- * @param inBiometricSid specifies the biometric secure ID (SID) of the user that owns the key
+ * @param biometricSid specifies the biometric secure ID (SID) of the user that owns the key
* being installed. If the authorization list in wrappedKeyData contains a
* Tag::USER_SECURE_ID with a value that has the HardwareAuthenticatorType::FINGERPRINT
* bit set, the constructed key must be bound to the SID value provided by this argument.
* If the wrappedKeyData does not contain such a tag and value, this argument must be
* ignored.
*
- * @return outImportedKeyBlob Opaque descriptor of the imported key. It is recommended that
- * the keyBlob contain a copy of the key material, wrapped in a key unavailable outside
- * secure hardware.
- *
- * @return outImportedKeyCharacteristics Description of the generated key. See the description
- * of keyCharacteristics parameter in generateKey.
+ * @return The result of key creation. See KeyCreationResult.aidl.
*/
- void importWrappedKey(in byte[] inWrappedKeyData,
- in byte[] inWrappingKeyBlob,
- in byte[] inMaskingKey,
- in KeyParameter[] inUnwrappingParams,
- in long inPasswordSid,
- in long inBiometricSid,
- out ByteArray outImportedKeyBlob,
- out KeyCharacteristics outImportedKeyCharacteristics);
+ KeyCreationResult importWrappedKey(in byte[] wrappedKeyData,
+ in byte[] wrappingKeyBlob,
+ in byte[] maskingKey,
+ in KeyParameter[] unwrappingParams,
+ in long passwordSid,
+ in long biometricSid);
/**
* Upgrades an old key blob. Keys can become "old" in two ways: IKeyMintDevice can be
diff --git a/security/keymint/aidl/android/hardware/security/keymint/IKeyMintOperation.aidl b/security/keymint/aidl/android/hardware/security/keymint/IKeyMintOperation.aidl
index 24960cc..8c49602 100644
--- a/security/keymint/aidl/android/hardware/security/keymint/IKeyMintOperation.aidl
+++ b/security/keymint/aidl/android/hardware/security/keymint/IKeyMintOperation.aidl
@@ -20,7 +20,7 @@
import android.hardware.security.keymint.HardwareAuthToken;
import android.hardware.security.keymint.KeyParameter;
import android.hardware.security.keymint.KeyParameterArray;
-import android.hardware.security.keymint.VerificationToken;
+import android.hardware.security.secureclock.TimeStampToken;
@VintfStability
interface IKeyMintOperation {
@@ -119,10 +119,9 @@
* @param input Data to be processed. Note that update() may or may not consume all of the data
* provided. See return value.
*
- * @param verificationToken Verification token, used to prove that another IKeymasterDevice HAL
- * has verified some parameters, and to deliver the other HAL's current timestamp, if
- * needed. If not provided, all fields must be initialized to zero and vectors must be
- * empty.
+ * @param inTimeStampToken timestamp token, certifies the freshness of an auth token in case
+ * the security domain of this KeyMint instance has a different clock than the
+ * authenticator issuing the auth token.
*
* @return error Returns ErrorCode encountered in keymint as service specific errors. See the
* ErrorCode enum in ErrorCode.aidl.
@@ -141,7 +140,7 @@
int update(in @nullable KeyParameterArray inParams,
in @nullable byte[] input,
in @nullable HardwareAuthToken inAuthToken,
- in @nullable VerificationToken inVerificationToken,
+ in @nullable TimeStampToken inTimeStampToken,
out @nullable KeyParameterArray outParams,
out @nullable ByteArray output);
@@ -241,9 +240,9 @@
*
* @param authToken Authentication token. Can be nullable if not provided.
*
- * @param verificationToken Verification token, used to prove that another IKeyMintDevice HAL
- * has verified some parameters, and to deliver the other HAL's current timestamp, if
- * needed. Can be nullable if not needed.
+ * @param inTimeStampToken timestamp token, certifies the freshness of an auth token in case
+ * the security domain of this KeyMint instance has a different clock than the
+ * authenticator issuing the auth token.
*
* @return outParams Any output parameters generated by finish().
*
@@ -252,7 +251,7 @@
byte[] finish(in @nullable KeyParameterArray inParams, in @nullable byte[] input,
in @nullable byte[] inSignature,
in @nullable HardwareAuthToken authToken,
- in @nullable VerificationToken inVerificationToken,
+ in @nullable TimeStampToken inTimeStampToken,
out @nullable KeyParameterArray outParams);
/**
diff --git a/security/keymint/aidl/android/hardware/security/keymint/KeyCharacteristics.aidl b/security/keymint/aidl/android/hardware/security/keymint/KeyCharacteristics.aidl
index 0801868..edd4d8f 100644
--- a/security/keymint/aidl/android/hardware/security/keymint/KeyCharacteristics.aidl
+++ b/security/keymint/aidl/android/hardware/security/keymint/KeyCharacteristics.aidl
@@ -17,25 +17,20 @@
package android.hardware.security.keymint;
import android.hardware.security.keymint.KeyParameter;
+import android.hardware.security.keymint.SecurityLevel;
/**
- * KeyCharacteristics defines the attributes of a key, including cryptographic parameters, and usage
- * restrictions. It consits of two vectors of KeyParameters, one for "softwareEnforced" attributes
- * and one for "hardwareEnforced" attributes.
+ * KeyCharacteristics defines the attributes of a key that are enforced by KeyMint, and the security
+ * level (see SecurityLevel.aidl) of that enforcement.
*
- * KeyCharacteristics objects are returned by generateKey, importKey, importWrappedKey and
- * getKeyCharacteristics. The IKeyMintDevice secure environment is responsible for allocating the
- * parameters, all of which are Tags with associated values, to the correct vector. The
- * hardwareEnforced vector must contain only those attributes which are enforced by secure hardware.
- * All others should be in the softwareEnforced vector. See the definitions of individual Tag enums
- * for specification of which must be hardware-enforced, which may be software-enforced and which
- * must never appear in KeyCharacteristics.
+ * The `generateKey` `importKey` and `importWrappedKey` methods each return an array of
+ * KeyCharacteristics, specifying the security levels of enforcement and the authorizations
+ * enforced. Note that enforcement at a given security level means that the semantics of the tag
+ * and value are fully enforced. See the definition of individual tags for specifications of what
+ * must be enforced.
*/
@VintfStability
parcelable KeyCharacteristics {
- /* TODO(seleneh) get rid of the software enforced in keymint. replace hardware enforced with
- * tee enforced and strongbox enforced.
- */
- KeyParameter[] softwareEnforced;
- KeyParameter[] hardwareEnforced;
+ SecurityLevel securityLevel;
+ KeyParameter[] authorizations;
}
diff --git a/security/keymint/aidl/android/hardware/security/keymint/KeyCreationResult.aidl b/security/keymint/aidl/android/hardware/security/keymint/KeyCreationResult.aidl
new file mode 100644
index 0000000..b149ac9
--- /dev/null
+++ b/security/keymint/aidl/android/hardware/security/keymint/KeyCreationResult.aidl
@@ -0,0 +1,62 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.hardware.security.keymint;
+
+import android.hardware.security.keymint.Certificate;
+import android.hardware.security.keymint.KeyCharacteristics;
+
+/**
+ * This structure is returned when a new key is created with generateKey(), importKey() or
+ * importWrappedKey().
+ */
+@VintfStability
+parcelable KeyCreationResult {
+ /**
+ * `keyBlob` is an descriptor of the generated/imported key key.
+ */
+ byte[] keyBlob;
+
+ /**
+ * `keyCharacteristics` is a description of the generated key in the form of authorization lists
+ * associated with security levels. The rules that IKeyMintDevice implementations must use for
+ * deciding whether a given tag from `keyParams` argument to the generation/import method should
+ * be returned in `keyCharacteristics` are:
+ *
+ * - If the IKeyMintDevice cannot fully enforce the semantics of the tag, it should be omitted.
+ * - If the semantics of the tag are fully enforced by the IKeyMintDevice, without any
+ * assistance from components running at other security levels, it should be included in an
+ * entry with the SecurityLevel of the IKeyMintDevice.
+ * - If the semantics of the tag are fully enforced, but with the assistance of components
+ * running at another SecurityLevel, it should be included in an entry with the minimum
+ * SecurityLevel of the involved components. For example if a StrongBox IKeyMintDevice relies
+ * on a TEE to validate biometric authentication, biometric authentication tags go in an entry
+ * with SecurityLevel::TRUSTED_ENVIRONMENT.
+ */
+ KeyCharacteristics[] keyCharacteristics;
+
+ /**
+ * If the generated/imported key is an asymmetric key, `certificateChain` will contain a chain
+ * of one or more certificates. If the key parameters provided to the generate/import method
+ * contains Tag::ATTESTATION_CHALLENGE the first certificate will contain an attestation
+ * extension, and will be signed by a factory-installed attestation key and followed by a chain
+ * of certificates leading to an authoritative root. If there is no attestation challenge, only
+ * one certificate will be returned, and it will be self-signed or contain a fake signature,
+ * depending on whether the key has KeyPurpose::SIGN. If the generated key is symmetric,
+ * certificateChain will be empty.
+ */
+ Certificate[] certificateChain;
+}
diff --git a/security/keymint/aidl/android/hardware/security/keymint/Tag.aidl b/security/keymint/aidl/android/hardware/security/keymint/Tag.aidl
index 3bc3f16..f92bf00 100644
--- a/security/keymint/aidl/android/hardware/security/keymint/Tag.aidl
+++ b/security/keymint/aidl/android/hardware/security/keymint/Tag.aidl
@@ -187,6 +187,22 @@
*/
INCLUDE_UNIQUE_ID = (7 << 28) /* TagType:BOOL */ | 202,
+ /**
+ * Tag::RSA_OAEP_MGF_DIGEST specifies the MGF1 digest algorithms that may be used with
+ * RSA encryption/decryption with OAEP padding. If the key characteristics supports OAEP
+ * and this tag is absent then SHA1 digest is selected by default for MGF1.
+ *
+ * This tag is repeatable for key generation/import. If this tag is present in the key
+ * characteristics with one or more values from @4.0::Digest, then for RSA cipher
+ * operations with OAEP Padding, the caller must specify a digest in the additionalParams
+ * argument of begin operation. If this tag is missing or the specified digest is not in
+ * the digests associated with the key then begin operation must fail with
+ * ErrorCode::INCOMPATIBLE_MGF_DIGEST.
+ *
+ * Must be hardware-enforced.
+ */
+ RSA_OAEP_MGF_DIGEST = (2 << 28) /* TagType:ENUM_REP */ | 203,
+
/**
* TODO(seleneh) this tag needs to be deleted from all codes.
*
@@ -496,10 +512,10 @@
/**
* Tag::APPLICATION_DATA. When provided to generateKey or importKey, this tag specifies data
- * that is necessary during all uses of the key. In particular, calls to exportKey() and
- * getKeyCharacteristics() must provide the same value to the appData parameter, and calls to
- * begin must provide this tag and the same associated data as part of the inParams set. If
- * the correct data is not provided, the method must return ErrorCode::INVALID_KEY_BLOB.
+ * that is necessary during all uses of the key. In particular, calls to begin() and
+ * exportKey() must provide the same value to the appData parameter, and calls to begin must
+ * provide this tag and the same associated data as part of the inParams set. If the correct
+ * data is not provided, the method must return ErrorCode::INVALID_KEY_BLOB.
*
* The content of this tag msut be bound to the key cryptographically, meaning it must not be
* possible for an adversary who has access to all of the secure world secrets but does not have
diff --git a/security/keymint/aidl/android/hardware/security/keymint/VerificationToken.aidl b/security/keymint/aidl/android/hardware/security/keymint/VerificationToken.aidl
deleted file mode 100644
index f76e6a8..0000000
--- a/security/keymint/aidl/android/hardware/security/keymint/VerificationToken.aidl
+++ /dev/null
@@ -1,63 +0,0 @@
-/*
- * Copyright (C) 2020 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-package android.hardware.security.keymint;
-
-import android.hardware.security.keymint.SecurityLevel;
-import android.hardware.security.keymint.Timestamp;
-
-/**
- * VerificationToken instances are used for secure environments to authenticate one another.
- *
- * This version of the parcelable currently don't use the parametersVerified field since it's not
- * needed for time-based verification. This can be added in a later version, if needed.
- */
-@VintfStability
-parcelable VerificationToken {
- /**
- * The operation handle, used to ensure freshness.
- */
- long challenge;
-
- /**
- * The current time of the secure environment that generates the VerificationToken. This can be
- * checked against auth tokens generated by the same secure environment, which avoids needing to
- * synchronize clocks.
- */
- Timestamp timestamp;
-
- /**
- * SecurityLevel of the secure environment that generated the token.
- */
- SecurityLevel securityLevel;
-
- /**
- * 32-byte HMAC-SHA256 of the above values, computed as:
- *
- * HMAC(H,
- * "Auth Verification" || challenge || timestamp || securityLevel)
- *
- * where:
- *
- * ``HMAC'' is the shared HMAC key (see computeSharedHmac() in IKeyMint).
- *
- * ``||'' represents concatenation
- *
- * The representation of challenge and timestamp is as 64-bit unsigned integers in big-endian
- * order. securityLevel is represented as a 32-bit unsigned integer in big-endian order.
- */
- byte[] mac;
-}
diff --git a/security/keymint/aidl/vts/functional/Android.bp b/security/keymint/aidl/vts/functional/Android.bp
index c7cc380..17a4613 100644
--- a/security/keymint/aidl/vts/functional/Android.bp
+++ b/security/keymint/aidl/vts/functional/Android.bp
@@ -22,7 +22,6 @@
],
srcs: [
"KeyMintTest.cpp",
- "VerificationTokenTest.cpp",
],
shared_libs: [
"libbinder_ndk",
@@ -32,6 +31,7 @@
],
static_libs: [
"android.hardware.security.keymint-unstable-ndk_platform",
+ "android.hardware.security.secureclock-unstable-ndk_platform",
"libcppbor_external",
"libkeymint_vts_test_utils",
],
@@ -61,6 +61,7 @@
],
static_libs: [
"android.hardware.security.keymint-unstable-ndk_platform",
+ "android.hardware.security.secureclock-unstable-ndk_platform",
"libcppbor",
],
}
diff --git a/security/keymint/aidl/vts/functional/KeyMintAidlTestBase.cpp b/security/keymint/aidl/vts/functional/KeyMintAidlTestBase.cpp
index 94bc199..766c02d 100644
--- a/security/keymint/aidl/vts/functional/KeyMintAidlTestBase.cpp
+++ b/security/keymint/aidl/vts/functional/KeyMintAidlTestBase.cpp
@@ -17,6 +17,7 @@
#include "KeyMintAidlTestBase.h"
#include <chrono>
+#include <unordered_set>
#include <vector>
#include <android-base/logging.h>
@@ -36,13 +37,41 @@
os << "(Empty)" << ::std::endl;
else {
os << "\n";
- for (size_t i = 0; i < set.size(); ++i) os << set[i] << ::std::endl;
+ for (auto& entry : set) os << entry << ::std::endl;
}
return os;
}
namespace test {
+namespace {
+
+// Predicate for testing basic characteristics validity in generation or import.
+bool KeyCharacteristicsBasicallyValid(SecurityLevel secLevel,
+ const vector<KeyCharacteristics>& key_characteristics) {
+ if (key_characteristics.empty()) return false;
+
+ std::unordered_set<SecurityLevel> levels_seen;
+ for (auto& entry : key_characteristics) {
+ if (entry.authorizations.empty()) return false;
+
+ if (levels_seen.find(entry.securityLevel) != levels_seen.end()) return false;
+ levels_seen.insert(entry.securityLevel);
+
+ // Generally, we should only have one entry, at the same security level as the KM
+ // instance. There is an exception: StrongBox KM can have some authorizations that are
+ // enforced by the TEE.
+ bool isExpectedSecurityLevel = secLevel == entry.securityLevel ||
+ (secLevel == SecurityLevel::STRONGBOX &&
+ entry.securityLevel == SecurityLevel::TRUSTED_ENVIRONMENT);
+
+ if (!isExpectedSecurityLevel) return false;
+ }
+ return true;
+}
+
+} // namespace
+
ErrorCode KeyMintAidlTestBase::GetReturnErrorCode(const Status& result) {
if (result.isOk()) return ErrorCode::OK;
@@ -78,35 +107,41 @@
}
ErrorCode KeyMintAidlTestBase::GenerateKey(const AuthorizationSet& key_desc,
- vector<uint8_t>* keyBlob, KeyCharacteristics* keyChar) {
- EXPECT_NE(keyBlob, nullptr) << "Key blob pointer must not be null. Test bug";
- EXPECT_NE(keyChar, nullptr)
+ vector<uint8_t>* key_blob,
+ vector<KeyCharacteristics>* key_characteristics) {
+ EXPECT_NE(key_blob, nullptr) << "Key blob pointer must not be null. Test bug";
+ EXPECT_NE(key_characteristics, nullptr)
<< "Previous characteristics not deleted before generating key. Test bug.";
// Aidl does not clear these output parameters if the function returns
// error. This is different from hal where output parameter is always
// cleared due to hal returning void. So now we need to do our own clearing
// of the output variables prior to calling keyMint aidl libraries.
- keyBlob->clear();
- keyChar->softwareEnforced.clear();
- keyChar->hardwareEnforced.clear();
- certChain_.clear();
+ key_blob->clear();
+ key_characteristics->clear();
+ cert_chain_.clear();
- Status result;
- ByteArray blob;
+ KeyCreationResult creationResult;
+ Status result = keymint_->generateKey(key_desc.vector_data(), &creationResult);
- result = keymint_->generateKey(key_desc.vector_data(), &blob, keyChar, &certChain_);
-
- // On result, blob & characteristics should be empty.
if (result.isOk()) {
- if (SecLevel() != SecurityLevel::SOFTWARE) {
- EXPECT_GT(keyChar->hardwareEnforced.size(), 0);
+ EXPECT_PRED2(KeyCharacteristicsBasicallyValid, SecLevel(),
+ creationResult.keyCharacteristics);
+ EXPECT_GT(creationResult.keyBlob.size(), 0);
+ *key_blob = std::move(creationResult.keyBlob);
+ *key_characteristics = std::move(creationResult.keyCharacteristics);
+ cert_chain_ = std::move(creationResult.certificateChain);
+
+ auto algorithm = key_desc.GetTagValue(TAG_ALGORITHM);
+ EXPECT_TRUE(algorithm);
+ if (algorithm &&
+ (algorithm.value() == Algorithm::RSA || algorithm.value() == Algorithm::EC)) {
+ EXPECT_GE(cert_chain_.size(), 1);
+ if (key_desc.Contains(TAG_ATTESTATION_CHALLENGE)) EXPECT_GT(cert_chain_.size(), 1);
+ } else {
+ // For symmetric keys there should be no certificates.
+ EXPECT_EQ(cert_chain_.size(), 0);
}
- EXPECT_GT(keyChar->softwareEnforced.size(), 0);
- // TODO(seleneh) in a later version where we return @nullable
- // single Certificate, check non-null single certificate is always
- // non-empty.
- *keyBlob = blob.data;
}
return GetReturnErrorCode(result);
@@ -118,25 +153,37 @@
ErrorCode KeyMintAidlTestBase::ImportKey(const AuthorizationSet& key_desc, KeyFormat format,
const string& key_material, vector<uint8_t>* key_blob,
- KeyCharacteristics* key_characteristics) {
+ vector<KeyCharacteristics>* key_characteristics) {
Status result;
- certChain_.clear();
- key_characteristics->softwareEnforced.clear();
- key_characteristics->hardwareEnforced.clear();
+ cert_chain_.clear();
+ key_characteristics->clear();
key_blob->clear();
- ByteArray blob;
+ KeyCreationResult creationResult;
result = keymint_->importKey(key_desc.vector_data(), format,
- vector<uint8_t>(key_material.begin(), key_material.end()), &blob,
- key_characteristics, &certChain_);
+ vector<uint8_t>(key_material.begin(), key_material.end()),
+ &creationResult);
if (result.isOk()) {
- if (SecLevel() != SecurityLevel::SOFTWARE) {
- EXPECT_GT(key_characteristics->hardwareEnforced.size(), 0);
+ EXPECT_PRED2(KeyCharacteristicsBasicallyValid, SecLevel(),
+ creationResult.keyCharacteristics);
+ EXPECT_GT(creationResult.keyBlob.size(), 0);
+
+ *key_blob = std::move(creationResult.keyBlob);
+ *key_characteristics = std::move(creationResult.keyCharacteristics);
+ cert_chain_ = std::move(creationResult.certificateChain);
+
+ auto algorithm = key_desc.GetTagValue(TAG_ALGORITHM);
+ EXPECT_TRUE(algorithm);
+ if (algorithm &&
+ (algorithm.value() == Algorithm::RSA || algorithm.value() == Algorithm::EC)) {
+ EXPECT_GE(cert_chain_.size(), 1);
+ if (key_desc.Contains(TAG_ATTESTATION_CHALLENGE)) EXPECT_GT(cert_chain_.size(), 1);
+ } else {
+ // For symmetric keys there should be no certificates.
+ EXPECT_EQ(cert_chain_.size(), 0);
}
- EXPECT_GT(key_characteristics->softwareEnforced.size(), 0);
- *key_blob = blob.data;
}
return GetReturnErrorCode(result);
@@ -151,25 +198,39 @@
const AuthorizationSet& wrapping_key_desc,
string masking_key,
const AuthorizationSet& unwrapping_params) {
- Status result;
EXPECT_EQ(ErrorCode::OK, ImportKey(wrapping_key_desc, KeyFormat::PKCS8, wrapping_key));
- ByteArray outBlob;
- key_characteristics_.softwareEnforced.clear();
- key_characteristics_.hardwareEnforced.clear();
+ key_characteristics_.clear();
- result = keymint_->importWrappedKey(vector<uint8_t>(wrapped_key.begin(), wrapped_key.end()),
- key_blob_,
- vector<uint8_t>(masking_key.begin(), masking_key.end()),
- unwrapping_params.vector_data(), 0 /* passwordSid */,
- 0 /* biometricSid */, &outBlob, &key_characteristics_);
+ KeyCreationResult creationResult;
+ Status result = keymint_->importWrappedKey(
+ vector<uint8_t>(wrapped_key.begin(), wrapped_key.end()), key_blob_,
+ vector<uint8_t>(masking_key.begin(), masking_key.end()),
+ unwrapping_params.vector_data(), 0 /* passwordSid */, 0 /* biometricSid */,
+ &creationResult);
if (result.isOk()) {
- key_blob_ = outBlob.data;
- if (SecLevel() != SecurityLevel::SOFTWARE) {
- EXPECT_GT(key_characteristics_.hardwareEnforced.size(), 0);
+ EXPECT_PRED2(KeyCharacteristicsBasicallyValid, SecLevel(),
+ creationResult.keyCharacteristics);
+ EXPECT_GT(creationResult.keyBlob.size(), 0);
+
+ key_blob_ = std::move(creationResult.keyBlob);
+ key_characteristics_ = std::move(creationResult.keyCharacteristics);
+ cert_chain_ = std::move(creationResult.certificateChain);
+
+ AuthorizationSet allAuths;
+ for (auto& entry : key_characteristics_) {
+ allAuths.push_back(AuthorizationSet(entry.authorizations));
}
- EXPECT_GT(key_characteristics_.softwareEnforced.size(), 0);
+ auto algorithm = allAuths.GetTagValue(TAG_ALGORITHM);
+ EXPECT_TRUE(algorithm);
+ if (algorithm &&
+ (algorithm.value() == Algorithm::RSA || algorithm.value() == Algorithm::EC)) {
+ EXPECT_GE(cert_chain_.size(), 1);
+ } else {
+ // For symmetric keys there should be no certificates.
+ EXPECT_EQ(cert_chain_.size(), 0);
+ }
}
return GetReturnErrorCode(result);
@@ -754,6 +815,33 @@
return {};
}
+static const vector<KeyParameter> kEmptyAuthList{};
+
+const vector<KeyParameter>& KeyMintAidlTestBase::SecLevelAuthorizations(
+ const vector<KeyCharacteristics>& key_characteristics) {
+ auto found = std::find_if(key_characteristics.begin(), key_characteristics.end(),
+ [this](auto& entry) { return entry.securityLevel == SecLevel(); });
+ return (found == key_characteristics.end()) ? kEmptyAuthList : found->authorizations;
+}
+
+const vector<KeyParameter>& KeyMintAidlTestBase::HwEnforcedAuthorizations(
+ const vector<KeyCharacteristics>& key_characteristics) {
+ auto found =
+ std::find_if(key_characteristics.begin(), key_characteristics.end(), [](auto& entry) {
+ return entry.securityLevel == SecurityLevel::STRONGBOX ||
+ entry.securityLevel == SecurityLevel::TRUSTED_ENVIRONMENT;
+ });
+ return (found == key_characteristics.end()) ? kEmptyAuthList : found->authorizations;
+}
+
+const vector<KeyParameter>& KeyMintAidlTestBase::SwEnforcedAuthorizations(
+ const vector<KeyCharacteristics>& key_characteristics) {
+ auto found = std::find_if(
+ key_characteristics.begin(), key_characteristics.end(),
+ [](auto& entry) { return entry.securityLevel == SecurityLevel::SOFTWARE; });
+ return (found == key_characteristics.end()) ? kEmptyAuthList : found->authorizations;
+}
+
} // namespace test
} // namespace aidl::android::hardware::security::keymint
diff --git a/security/keymint/aidl/vts/functional/KeyMintAidlTestBase.h b/security/keymint/aidl/vts/functional/KeyMintAidlTestBase.h
index f73c26d..c1a1dd9 100644
--- a/security/keymint/aidl/vts/functional/KeyMintAidlTestBase.h
+++ b/security/keymint/aidl/vts/functional/KeyMintAidlTestBase.h
@@ -27,7 +27,11 @@
#include <keymint_support/authorization_set.h>
-namespace aidl::android::hardware::security::keymint::test {
+namespace aidl::android::hardware::security::keymint {
+
+::std::ostream& operator<<(::std::ostream& os, const AuthorizationSet& set);
+
+namespace test {
using ::android::sp;
using Status = ::ndk::ScopedAStatus;
@@ -37,8 +41,6 @@
constexpr uint64_t kOpHandleSentinel = 0xFFFFFFFFFFFFFFFF;
-::std::ostream& operator<<(::std::ostream& os, const AuthorizationSet& set);
-
class KeyMintAidlTestBase : public ::testing::TestWithParam<string> {
public:
void SetUp() override;
@@ -56,13 +58,13 @@
ErrorCode GetReturnErrorCode(const Status& result);
ErrorCode GenerateKey(const AuthorizationSet& key_desc, vector<uint8_t>* key_blob,
- KeyCharacteristics* key_characteristics);
+ vector<KeyCharacteristics>* key_characteristics);
ErrorCode GenerateKey(const AuthorizationSet& key_desc);
ErrorCode ImportKey(const AuthorizationSet& key_desc, KeyFormat format,
const string& key_material, vector<uint8_t>* key_blob,
- KeyCharacteristics* key_characteristics);
+ vector<KeyCharacteristics>* key_characteristics);
ErrorCode ImportKey(const AuthorizationSet& key_desc, KeyFormat format,
const string& key_material);
@@ -147,8 +149,8 @@
std::pair<ErrorCode, vector<uint8_t>> UpgradeKey(const vector<uint8_t>& key_blob);
- bool IsSecure() { return securityLevel_ != SecurityLevel::SOFTWARE; }
- SecurityLevel SecLevel() { return securityLevel_; }
+ bool IsSecure() const { return securityLevel_ != SecurityLevel::SOFTWARE; }
+ SecurityLevel SecLevel() const { return securityLevel_; }
vector<uint32_t> ValidKeySizes(Algorithm algorithm);
vector<uint32_t> InvalidKeySizes(Algorithm algorithm);
@@ -164,9 +166,19 @@
}
std::shared_ptr<IKeyMintOperation> op_;
- vector<Certificate> certChain_;
+ vector<Certificate> cert_chain_;
vector<uint8_t> key_blob_;
- KeyCharacteristics key_characteristics_;
+ vector<KeyCharacteristics> key_characteristics_;
+
+ const vector<KeyParameter>& SecLevelAuthorizations(
+ const vector<KeyCharacteristics>& key_characteristics);
+ inline const vector<KeyParameter>& SecLevelAuthorizations() {
+ return SecLevelAuthorizations(key_characteristics_);
+ }
+ const vector<KeyParameter>& HwEnforcedAuthorizations(
+ const vector<KeyCharacteristics>& key_characteristics);
+ const vector<KeyParameter>& SwEnforcedAuthorizations(
+ const vector<KeyCharacteristics>& key_characteristics);
private:
std::shared_ptr<IKeyMintDevice> keymint_;
@@ -184,4 +196,6 @@
testing::ValuesIn(KeyMintAidlTestBase::build_params()), \
::android::PrintInstanceNameToString)
-} // namespace aidl::android::hardware::security::keymint::test
+} // namespace test
+
+} // namespace aidl::android::hardware::security::keymint
diff --git a/security/keymint/aidl/vts/functional/KeyMintTest.cpp b/security/keymint/aidl/vts/functional/KeyMintTest.cpp
index 3060153..e7c94f3 100644
--- a/security/keymint/aidl/vts/functional/KeyMintTest.cpp
+++ b/security/keymint/aidl/vts/functional/KeyMintTest.cpp
@@ -56,18 +56,16 @@
template <>
struct std::equal_to<KeyCharacteristics> {
bool operator()(const KeyCharacteristics& a, const KeyCharacteristics& b) const {
- // This isn't very efficient. Oh, well.
- AuthorizationSet a_sw(a.softwareEnforced);
- AuthorizationSet b_sw(b.softwareEnforced);
- AuthorizationSet a_tee(b.hardwareEnforced);
- AuthorizationSet b_tee(b.hardwareEnforced);
+ if (a.securityLevel != b.securityLevel) return false;
- a_sw.Sort();
- b_sw.Sort();
- a_tee.Sort();
- b_tee.Sort();
+ // this isn't very efficient. Oh, well.
+ AuthorizationSet a_auths(a.authorizations);
+ AuthorizationSet b_auths(b.authorizations);
- return ((a_sw == b_sw) && (a_tee == b_tee));
+ a_auths.Sort();
+ b_auths.Sort();
+
+ return a_auths == b_auths;
}
};
@@ -182,9 +180,280 @@
void operator()(RSA* p) { RSA_free(p); }
};
-/* TODO(seleneh) add attestation verification codes like verify_chain() and
- * attestation tests after we decided on the keymint 1 attestation changes.
- */
+char nibble2hex[16] = {'0', '1', '2', '3', '4', '5', '6', '7',
+ '8', '9', 'a', 'b', 'c', 'd', 'e', 'f'};
+
+string bin2hex(const vector<uint8_t>& data) {
+ string retval;
+ retval.reserve(data.size() * 2 + 1);
+ for (uint8_t byte : data) {
+ retval.push_back(nibble2hex[0x0F & (byte >> 4)]);
+ retval.push_back(nibble2hex[0x0F & byte]);
+ }
+ return retval;
+}
+
+X509* parse_cert_blob(const vector<uint8_t>& blob) {
+ const uint8_t* p = blob.data();
+ return d2i_X509(nullptr, &p, blob.size());
+}
+
+bool verify_chain(const vector<Certificate>& chain) {
+ for (size_t i = 0; i < chain.size(); ++i) {
+ X509_Ptr key_cert(parse_cert_blob(chain[i].encodedCertificate));
+ X509_Ptr signing_cert;
+ if (i < chain.size() - 1) {
+ signing_cert.reset(parse_cert_blob(chain[i + 1].encodedCertificate));
+ } else {
+ signing_cert.reset(parse_cert_blob(chain[i].encodedCertificate));
+ }
+ EXPECT_TRUE(!!key_cert.get() && !!signing_cert.get());
+ if (!key_cert.get() || !signing_cert.get()) return false;
+
+ EVP_PKEY_Ptr signing_pubkey(X509_get_pubkey(signing_cert.get()));
+ EXPECT_TRUE(!!signing_pubkey.get());
+ if (!signing_pubkey.get()) return false;
+
+ EXPECT_EQ(1, X509_verify(key_cert.get(), signing_pubkey.get()))
+ << "Verification of certificate " << i << " failed "
+ << "OpenSSL error string: " << ERR_error_string(ERR_get_error(), NULL);
+
+ char* cert_issuer = //
+ X509_NAME_oneline(X509_get_issuer_name(key_cert.get()), nullptr, 0);
+ char* signer_subj =
+ X509_NAME_oneline(X509_get_subject_name(signing_cert.get()), nullptr, 0);
+ EXPECT_STREQ(cert_issuer, signer_subj) << "Cert " << i << " has wrong issuer.";
+ if (i == 0) {
+ char* cert_sub = X509_NAME_oneline(X509_get_subject_name(key_cert.get()), nullptr, 0);
+ EXPECT_STREQ("/CN=Android Keystore Key", cert_sub)
+ << "Cert " << i << " has wrong subject.";
+ OPENSSL_free(cert_sub);
+ }
+
+ OPENSSL_free(cert_issuer);
+ OPENSSL_free(signer_subj);
+
+ if (dump_Attestations) std::cout << bin2hex(chain[i].encodedCertificate) << std::endl;
+ }
+
+ return true;
+}
+
+// Extract attestation record from cert. Returned object is still part of cert; don't free it
+// separately.
+ASN1_OCTET_STRING* get_attestation_record(X509* certificate) {
+ ASN1_OBJECT_Ptr oid(OBJ_txt2obj(kAttestionRecordOid, 1 /* dotted string format */));
+ EXPECT_TRUE(!!oid.get());
+ if (!oid.get()) return nullptr;
+
+ int location = X509_get_ext_by_OBJ(certificate, oid.get(), -1 /* search from beginning */);
+ EXPECT_NE(-1, location) << "Attestation extension not found in certificate";
+ if (location == -1) return nullptr;
+
+ X509_EXTENSION* attest_rec_ext = X509_get_ext(certificate, location);
+ EXPECT_TRUE(!!attest_rec_ext)
+ << "Found attestation extension but couldn't retrieve it? Probably a BoringSSL bug.";
+ if (!attest_rec_ext) return nullptr;
+
+ ASN1_OCTET_STRING* attest_rec = X509_EXTENSION_get_data(attest_rec_ext);
+ EXPECT_TRUE(!!attest_rec) << "Attestation extension contained no data";
+ return attest_rec;
+}
+
+bool tag_in_list(const KeyParameter& entry) {
+ // Attestations don't contain everything in key authorization lists, so we need to filter
+ // the key lists to produce the lists that we expect to match the attestations.
+ auto tag_list = {
+ Tag::BLOB_USAGE_REQUIREMENTS, //
+ Tag::CREATION_DATETIME, //
+ Tag::EC_CURVE,
+ Tag::HARDWARE_TYPE,
+ Tag::INCLUDE_UNIQUE_ID,
+ };
+ return std::find(tag_list.begin(), tag_list.end(), entry.tag) != tag_list.end();
+}
+
+AuthorizationSet filtered_tags(const AuthorizationSet& set) {
+ AuthorizationSet filtered;
+ std::remove_copy_if(set.begin(), set.end(), std::back_inserter(filtered), tag_in_list);
+ return filtered;
+}
+
+bool avb_verification_enabled() {
+ char value[PROPERTY_VALUE_MAX];
+ return property_get("ro.boot.vbmeta.device_state", value, "") != 0;
+}
+
+bool verify_attestation_record(const string& challenge, //
+ const string& app_id, //
+ AuthorizationSet expected_sw_enforced, //
+ AuthorizationSet expected_hw_enforced, //
+ SecurityLevel security_level,
+ const vector<uint8_t>& attestation_cert) {
+ X509_Ptr cert(parse_cert_blob(attestation_cert));
+ EXPECT_TRUE(!!cert.get());
+ if (!cert.get()) return false;
+
+ ASN1_OCTET_STRING* attest_rec = get_attestation_record(cert.get());
+ EXPECT_TRUE(!!attest_rec);
+ if (!attest_rec) return false;
+
+ AuthorizationSet att_sw_enforced;
+ AuthorizationSet att_hw_enforced;
+ uint32_t att_attestation_version;
+ uint32_t att_keymaster_version;
+ SecurityLevel att_attestation_security_level;
+ SecurityLevel att_keymaster_security_level;
+ vector<uint8_t> att_challenge;
+ vector<uint8_t> att_unique_id;
+ vector<uint8_t> att_app_id;
+
+ auto error = parse_attestation_record(attest_rec->data, //
+ attest_rec->length, //
+ &att_attestation_version, //
+ &att_attestation_security_level, //
+ &att_keymaster_version, //
+ &att_keymaster_security_level, //
+ &att_challenge, //
+ &att_sw_enforced, //
+ &att_hw_enforced, //
+ &att_unique_id);
+ EXPECT_EQ(ErrorCode::OK, error);
+ if (error != ErrorCode::OK) return false;
+
+ EXPECT_GE(att_attestation_version, 3U);
+
+ expected_sw_enforced.push_back(TAG_ATTESTATION_APPLICATION_ID,
+ vector<uint8_t>(app_id.begin(), app_id.end()));
+
+ EXPECT_GE(att_keymaster_version, 4U);
+ EXPECT_EQ(security_level, att_keymaster_security_level);
+ EXPECT_EQ(security_level, att_attestation_security_level);
+
+ EXPECT_EQ(challenge.length(), att_challenge.size());
+ EXPECT_EQ(0, memcmp(challenge.data(), att_challenge.data(), challenge.length()));
+
+ char property_value[PROPERTY_VALUE_MAX] = {};
+ // TODO(b/136282179): When running under VTS-on-GSI the TEE-backed
+ // keymaster implementation will report YYYYMM dates instead of YYYYMMDD
+ // for the BOOT_PATCH_LEVEL.
+ if (avb_verification_enabled()) {
+ for (int i = 0; i < att_hw_enforced.size(); i++) {
+ if (att_hw_enforced[i].tag == TAG_BOOT_PATCHLEVEL ||
+ att_hw_enforced[i].tag == TAG_VENDOR_PATCHLEVEL) {
+ std::string date =
+ std::to_string(att_hw_enforced[i].value.get<KeyParameterValue::dateTime>());
+ // strptime seems to require delimiters, but the tag value will
+ // be YYYYMMDD
+ date.insert(6, "-");
+ date.insert(4, "-");
+ EXPECT_EQ(date.size(), 10);
+ struct tm time;
+ strptime(date.c_str(), "%Y-%m-%d", &time);
+
+ // Day of the month (0-31)
+ EXPECT_GE(time.tm_mday, 0);
+ EXPECT_LT(time.tm_mday, 32);
+ // Months since Jan (0-11)
+ EXPECT_GE(time.tm_mon, 0);
+ EXPECT_LT(time.tm_mon, 12);
+ // Years since 1900
+ EXPECT_GT(time.tm_year, 110);
+ EXPECT_LT(time.tm_year, 200);
+ }
+ }
+ }
+
+ // Check to make sure boolean values are properly encoded. Presence of a boolean tag indicates
+ // true. A provided boolean tag that can be pulled back out of the certificate indicates correct
+ // encoding. No need to check if it's in both lists, since the AuthorizationSet compare below
+ // will handle mismatches of tags.
+ if (security_level == SecurityLevel::SOFTWARE) {
+ EXPECT_TRUE(expected_sw_enforced.Contains(TAG_NO_AUTH_REQUIRED));
+ } else {
+ EXPECT_TRUE(expected_hw_enforced.Contains(TAG_NO_AUTH_REQUIRED));
+ }
+
+ // Alternatively this checks the opposite - a false boolean tag (one that isn't provided in
+ // the authorization list during key generation) isn't being attested to in the certificate.
+ EXPECT_FALSE(expected_sw_enforced.Contains(TAG_TRUSTED_USER_PRESENCE_REQUIRED));
+ EXPECT_FALSE(att_sw_enforced.Contains(TAG_TRUSTED_USER_PRESENCE_REQUIRED));
+ EXPECT_FALSE(expected_hw_enforced.Contains(TAG_TRUSTED_USER_PRESENCE_REQUIRED));
+ EXPECT_FALSE(att_hw_enforced.Contains(TAG_TRUSTED_USER_PRESENCE_REQUIRED));
+
+ if (att_hw_enforced.Contains(TAG_ALGORITHM, Algorithm::EC)) {
+ // For ECDSA keys, either an EC_CURVE or a KEY_SIZE can be specified, but one must be.
+ EXPECT_TRUE(att_hw_enforced.Contains(TAG_EC_CURVE) ||
+ att_hw_enforced.Contains(TAG_KEY_SIZE));
+ }
+
+ // Test root of trust elements
+ vector<uint8_t> verified_boot_key;
+ VerifiedBoot verified_boot_state;
+ bool device_locked;
+ vector<uint8_t> verified_boot_hash;
+ error = parse_root_of_trust(attest_rec->data, attest_rec->length, &verified_boot_key,
+ &verified_boot_state, &device_locked, &verified_boot_hash);
+ EXPECT_EQ(ErrorCode::OK, error);
+
+ if (avb_verification_enabled()) {
+ EXPECT_NE(property_get("ro.boot.vbmeta.digest", property_value, ""), 0);
+ string prop_string(property_value);
+ EXPECT_EQ(prop_string.size(), 64);
+ EXPECT_EQ(prop_string, bin2hex(verified_boot_hash));
+
+ EXPECT_NE(property_get("ro.boot.vbmeta.device_state", property_value, ""), 0);
+ if (!strcmp(property_value, "unlocked")) {
+ EXPECT_FALSE(device_locked);
+ } else {
+ EXPECT_TRUE(device_locked);
+ }
+
+ // Check that the device is locked if not debuggable, e.g., user build
+ // images in CTS. For VTS, debuggable images are used to allow adb root
+ // and the device is unlocked.
+ if (!property_get_bool("ro.debuggable", false)) {
+ EXPECT_TRUE(device_locked);
+ } else {
+ EXPECT_FALSE(device_locked);
+ }
+ }
+
+ // Verified boot key should be all 0's if the boot state is not verified or self signed
+ std::string empty_boot_key(32, '\0');
+ std::string verified_boot_key_str((const char*)verified_boot_key.data(),
+ verified_boot_key.size());
+ EXPECT_NE(property_get("ro.boot.verifiedbootstate", property_value, ""), 0);
+ if (!strcmp(property_value, "green")) {
+ EXPECT_EQ(verified_boot_state, VerifiedBoot::VERIFIED);
+ EXPECT_NE(0, memcmp(verified_boot_key.data(), empty_boot_key.data(),
+ verified_boot_key.size()));
+ } else if (!strcmp(property_value, "yellow")) {
+ EXPECT_EQ(verified_boot_state, VerifiedBoot::SELF_SIGNED);
+ EXPECT_NE(0, memcmp(verified_boot_key.data(), empty_boot_key.data(),
+ verified_boot_key.size()));
+ } else if (!strcmp(property_value, "orange")) {
+ EXPECT_EQ(verified_boot_state, VerifiedBoot::UNVERIFIED);
+ EXPECT_EQ(0, memcmp(verified_boot_key.data(), empty_boot_key.data(),
+ verified_boot_key.size()));
+ } else if (!strcmp(property_value, "red")) {
+ EXPECT_EQ(verified_boot_state, VerifiedBoot::FAILED);
+ } else {
+ EXPECT_EQ(verified_boot_state, VerifiedBoot::UNVERIFIED);
+ EXPECT_NE(0, memcmp(verified_boot_key.data(), empty_boot_key.data(),
+ verified_boot_key.size()));
+ }
+
+ att_sw_enforced.Sort();
+ expected_sw_enforced.Sort();
+ EXPECT_EQ(filtered_tags(expected_sw_enforced), filtered_tags(att_sw_enforced));
+
+ att_hw_enforced.Sort();
+ expected_hw_enforced.Sort();
+ EXPECT_EQ(filtered_tags(expected_hw_enforced), filtered_tags(att_hw_enforced));
+
+ return true;
+}
std::string make_string(const uint8_t* data, size_t length) {
return std::string(reinterpret_cast<const char*>(data), length);
@@ -229,19 +498,20 @@
class NewKeyGenerationTest : public KeyMintAidlTestBase {
protected:
- void CheckBaseParams(const KeyCharacteristics& keyCharacteristics) {
+ void CheckBaseParams(const vector<KeyCharacteristics>& keyCharacteristics) {
// TODO(swillden): Distinguish which params should be in which auth list.
- AuthorizationSet auths(keyCharacteristics.hardwareEnforced);
- auths.push_back(AuthorizationSet(keyCharacteristics.softwareEnforced));
+ AuthorizationSet auths;
+ for (auto& entry : keyCharacteristics) {
+ auths.push_back(AuthorizationSet(entry.authorizations));
+ }
EXPECT_TRUE(auths.Contains(TAG_ORIGIN, KeyOrigin::GENERATED));
EXPECT_TRUE(auths.Contains(TAG_PURPOSE, KeyPurpose::SIGN));
EXPECT_TRUE(auths.Contains(TAG_PURPOSE, KeyPurpose::VERIFY));
- // Verify that App ID, App data and ROT are NOT included.
+ // Verify that App data and ROT are NOT included.
EXPECT_FALSE(auths.Contains(TAG_ROOT_OF_TRUST));
- EXPECT_FALSE(auths.Contains(TAG_APPLICATION_ID));
EXPECT_FALSE(auths.Contains(TAG_APPLICATION_DATA));
// Check that some unexpected tags/values are NOT present.
@@ -249,15 +519,13 @@
EXPECT_FALSE(auths.Contains(TAG_PURPOSE, KeyPurpose::DECRYPT));
EXPECT_FALSE(auths.Contains(TAG_AUTH_TIMEOUT, 301U));
- // Now check that unspecified, defaulted tags are correct.
- EXPECT_TRUE(auths.Contains(TAG_CREATION_DATETIME));
+ auto os_ver = auths.GetTagValue(TAG_OS_VERSION);
+ ASSERT_TRUE(os_ver);
+ EXPECT_EQ(*os_ver, os_version());
- EXPECT_TRUE(auths.Contains(TAG_OS_VERSION, os_version()))
- << "OS version is " << os_version() << " key reported "
- << auths.GetTagValue(TAG_OS_VERSION)->get();
- EXPECT_TRUE(auths.Contains(TAG_OS_PATCHLEVEL, os_patch_level()))
- << "OS patch level is " << os_patch_level() << " key reported "
- << auths.GetTagValue(TAG_OS_PATCHLEVEL)->get();
+ auto os_pl = auths.GetTagValue(TAG_OS_PATCHLEVEL);
+ ASSERT_TRUE(os_pl);
+ EXPECT_EQ(*os_pl, os_patch_level());
}
};
@@ -270,7 +538,7 @@
TEST_P(NewKeyGenerationTest, Rsa) {
for (auto key_size : ValidKeySizes(Algorithm::RSA)) {
vector<uint8_t> key_blob;
- KeyCharacteristics key_characteristics;
+ vector<KeyCharacteristics> key_characteristics;
ASSERT_EQ(ErrorCode::OK, GenerateKey(AuthorizationSetBuilder()
.RsaSigningKey(key_size, 65537)
.Digest(Digest::NONE)
@@ -280,12 +548,7 @@
ASSERT_GT(key_blob.size(), 0U);
CheckBaseParams(key_characteristics);
- AuthorizationSet crypto_params;
- if (IsSecure()) {
- crypto_params = key_characteristics.hardwareEnforced;
- } else {
- crypto_params = key_characteristics.softwareEnforced;
- }
+ AuthorizationSet crypto_params = SecLevelAuthorizations(key_characteristics);
EXPECT_TRUE(crypto_params.Contains(TAG_ALGORITHM, Algorithm::RSA));
EXPECT_TRUE(crypto_params.Contains(TAG_KEY_SIZE, key_size))
@@ -297,6 +560,51 @@
}
/*
+ * NewKeyGenerationTest.Rsa
+ *
+ * Verifies that keymint can generate all required RSA key sizes, and that the resulting keys
+ * have correct characteristics.
+ */
+TEST_P(NewKeyGenerationTest, RsaWithAttestation) {
+ for (auto key_size : ValidKeySizes(Algorithm::RSA)) {
+ auto challenge = "hello";
+ auto app_id = "foo";
+
+ vector<uint8_t> key_blob;
+ vector<KeyCharacteristics> key_characteristics;
+ ASSERT_EQ(ErrorCode::OK, GenerateKey(AuthorizationSetBuilder()
+ .RsaSigningKey(key_size, 65537)
+ .Digest(Digest::NONE)
+ .Padding(PaddingMode::NONE)
+ .AttestationChallenge(challenge)
+ .AttestationApplicationId(app_id)
+ .Authorization(TAG_NO_AUTH_REQUIRED),
+ &key_blob, &key_characteristics));
+
+ ASSERT_GT(key_blob.size(), 0U);
+ CheckBaseParams(key_characteristics);
+
+ AuthorizationSet crypto_params = SecLevelAuthorizations(key_characteristics);
+
+ EXPECT_TRUE(crypto_params.Contains(TAG_ALGORITHM, Algorithm::RSA));
+ EXPECT_TRUE(crypto_params.Contains(TAG_KEY_SIZE, key_size))
+ << "Key size " << key_size << "missing";
+ EXPECT_TRUE(crypto_params.Contains(TAG_RSA_PUBLIC_EXPONENT, 65537U));
+
+ EXPECT_TRUE(verify_chain(cert_chain_));
+ ASSERT_GT(cert_chain_.size(), 0);
+
+ AuthorizationSet hw_enforced = HwEnforcedAuthorizations(key_characteristics);
+ AuthorizationSet sw_enforced = SwEnforcedAuthorizations(key_characteristics);
+ EXPECT_TRUE(verify_attestation_record(challenge, app_id, //
+ sw_enforced, hw_enforced, SecLevel(),
+ cert_chain_[0].encodedCertificate));
+
+ CheckedDeleteKey(&key_blob);
+ }
+}
+
+/*
* NewKeyGenerationTest.NoInvalidRsaSizes
*
* Verifies that keymint cannot generate any RSA key sizes that are designated as invalid.
@@ -304,7 +612,7 @@
TEST_P(NewKeyGenerationTest, NoInvalidRsaSizes) {
for (auto key_size : InvalidKeySizes(Algorithm::RSA)) {
vector<uint8_t> key_blob;
- KeyCharacteristics key_characteristics;
+ vector<KeyCharacteristics> key_characteristics;
ASSERT_EQ(ErrorCode::UNSUPPORTED_KEY_SIZE,
GenerateKey(AuthorizationSetBuilder()
.RsaSigningKey(key_size, 65537)
@@ -337,7 +645,7 @@
TEST_P(NewKeyGenerationTest, Ecdsa) {
for (auto key_size : ValidKeySizes(Algorithm::EC)) {
vector<uint8_t> key_blob;
- KeyCharacteristics key_characteristics;
+ vector<KeyCharacteristics> key_characteristics;
ASSERT_EQ(ErrorCode::OK,
GenerateKey(
AuthorizationSetBuilder().EcdsaSigningKey(key_size).Digest(Digest::NONE),
@@ -345,12 +653,7 @@
ASSERT_GT(key_blob.size(), 0U);
CheckBaseParams(key_characteristics);
- AuthorizationSet crypto_params;
- if (IsSecure()) {
- crypto_params = key_characteristics.hardwareEnforced;
- } else {
- crypto_params = key_characteristics.softwareEnforced;
- }
+ AuthorizationSet crypto_params = SecLevelAuthorizations(key_characteristics);
EXPECT_TRUE(crypto_params.Contains(TAG_ALGORITHM, Algorithm::EC));
EXPECT_TRUE(crypto_params.Contains(TAG_KEY_SIZE, key_size))
@@ -383,7 +686,7 @@
TEST_P(NewKeyGenerationTest, EcdsaInvalidSize) {
for (auto key_size : InvalidKeySizes(Algorithm::EC)) {
vector<uint8_t> key_blob;
- KeyCharacteristics key_characteristics;
+ vector<KeyCharacteristics> key_characteristics;
ASSERT_EQ(ErrorCode::UNSUPPORTED_KEY_SIZE,
GenerateKey(
AuthorizationSetBuilder().EcdsaSigningKey(key_size).Digest(Digest::NONE),
@@ -454,7 +757,7 @@
TEST_P(NewKeyGenerationTest, Hmac) {
for (auto digest : ValidDigests(false /* withNone */, true /* withMD5 */)) {
vector<uint8_t> key_blob;
- KeyCharacteristics key_characteristics;
+ vector<KeyCharacteristics> key_characteristics;
constexpr size_t key_size = 128;
ASSERT_EQ(ErrorCode::OK,
GenerateKey(
@@ -465,17 +768,10 @@
ASSERT_GT(key_blob.size(), 0U);
CheckBaseParams(key_characteristics);
- AuthorizationSet hardwareEnforced = key_characteristics.hardwareEnforced;
- AuthorizationSet softwareEnforced = key_characteristics.softwareEnforced;
- if (IsSecure()) {
- EXPECT_TRUE(hardwareEnforced.Contains(TAG_ALGORITHM, Algorithm::HMAC));
- EXPECT_TRUE(hardwareEnforced.Contains(TAG_KEY_SIZE, key_size))
- << "Key size " << key_size << "missing";
- } else {
- EXPECT_TRUE(softwareEnforced.Contains(TAG_ALGORITHM, Algorithm::HMAC));
- EXPECT_TRUE(softwareEnforced.Contains(TAG_KEY_SIZE, key_size))
- << "Key size " << key_size << "missing";
- }
+ AuthorizationSet crypto_params = SecLevelAuthorizations(key_characteristics);
+ EXPECT_TRUE(crypto_params.Contains(TAG_ALGORITHM, Algorithm::HMAC));
+ EXPECT_TRUE(crypto_params.Contains(TAG_KEY_SIZE, key_size))
+ << "Key size " << key_size << "missing";
CheckedDeleteKey(&key_blob);
}
@@ -600,7 +896,7 @@
/*
* SigningOperationsTest.RsaUseRequiresCorrectAppIdAppData
*
- * Verifies that using an RSA key requires the correct app ID/data.
+ * Verifies that using an RSA key requires the correct app data.
*/
TEST_P(SigningOperationsTest, RsaUseRequiresCorrectAppIdAppData) {
ASSERT_EQ(ErrorCode::OK, GenerateKey(AuthorizationSetBuilder()
@@ -1412,7 +1708,7 @@
string key_material = "HelloThisIsAKey";
vector<uint8_t> signing_key, verification_key;
- KeyCharacteristics signing_key_chars, verification_key_chars;
+ vector<KeyCharacteristics> signing_key_chars, verification_key_chars;
EXPECT_EQ(ErrorCode::OK,
ImportKey(AuthorizationSetBuilder()
.Authorization(TAG_NO_AUTH_REQUIRED)
@@ -1466,28 +1762,22 @@
template <TagType tag_type, Tag tag, typename ValueT>
void CheckCryptoParam(TypedTag<tag_type, tag> ttag, ValueT expected) {
SCOPED_TRACE("CheckCryptoParam");
- if (IsSecure()) {
- EXPECT_TRUE(contains(key_characteristics_.hardwareEnforced, ttag, expected))
- << "Tag " << tag << " with value " << expected << " not found";
- EXPECT_FALSE(contains(key_characteristics_.softwareEnforced, ttag))
- << "Tag " << tag << " found";
- } else {
- EXPECT_TRUE(contains(key_characteristics_.softwareEnforced, ttag, expected))
- << "Tag " << tag << " with value " << expected << " not found";
- EXPECT_FALSE(contains(key_characteristics_.hardwareEnforced, ttag))
- << "Tag " << tag << " found";
+ for (auto& entry : key_characteristics_) {
+ if (entry.securityLevel == SecLevel()) {
+ EXPECT_TRUE(contains(entry.authorizations, ttag, expected))
+ << "Tag " << tag << " with value " << expected
+ << " not found at security level" << entry.securityLevel;
+ } else {
+ EXPECT_FALSE(contains(entry.authorizations, ttag, expected))
+ << "Tag " << tag << " found at security level " << entry.securityLevel;
+ }
}
}
void CheckOrigin() {
SCOPED_TRACE("CheckOrigin");
- if (IsSecure()) {
- EXPECT_TRUE(contains(key_characteristics_.hardwareEnforced, TAG_ORIGIN,
- KeyOrigin::IMPORTED));
- } else {
- EXPECT_TRUE(contains(key_characteristics_.softwareEnforced, TAG_ORIGIN,
- KeyOrigin::IMPORTED));
- }
+ // Origin isn't a crypto param, but it always lives with them.
+ return CheckCryptoParam(TAG_ORIGIN, KeyOrigin::IMPORTED);
}
};
@@ -2056,6 +2346,107 @@
}
/*
+ * EncryptionOperationsTest.RsaOaepWithMGFDigestSuccess
+ *
+ * Verifies that RSA-OAEP encryption operations work, with all SHA 256 digests and all type of MGF1
+ * digests.
+ */
+TEST_P(EncryptionOperationsTest, RsaOaepWithMGFDigestSuccess) {
+ auto digests = ValidDigests(false /* withNone */, true /* withMD5 */);
+
+ size_t key_size = 2048; // Need largish key for SHA-512 test.
+ ASSERT_EQ(ErrorCode::OK, GenerateKey(AuthorizationSetBuilder()
+ .OaepMGFDigest(digests)
+ .Authorization(TAG_NO_AUTH_REQUIRED)
+ .RsaEncryptionKey(key_size, 65537)
+ .Padding(PaddingMode::RSA_OAEP)
+ .Digest(Digest::SHA_2_256)));
+
+ string message = "Hello";
+
+ for (auto digest : digests) {
+ auto params = AuthorizationSetBuilder()
+ .Authorization(TAG_RSA_OAEP_MGF_DIGEST, digest)
+ .Digest(Digest::SHA_2_256)
+ .Padding(PaddingMode::RSA_OAEP);
+ string ciphertext1 = EncryptMessage(message, params);
+ if (HasNonfatalFailure()) std::cout << "-->" << digest << std::endl;
+ EXPECT_EQ(key_size / 8, ciphertext1.size());
+
+ string ciphertext2 = EncryptMessage(message, params);
+ EXPECT_EQ(key_size / 8, ciphertext2.size());
+
+ // OAEP randomizes padding so every result should be different (with astronomically high
+ // probability).
+ EXPECT_NE(ciphertext1, ciphertext2);
+
+ string plaintext1 = DecryptMessage(ciphertext1, params);
+ EXPECT_EQ(message, plaintext1) << "RSA-OAEP failed with digest " << digest;
+ string plaintext2 = DecryptMessage(ciphertext2, params);
+ EXPECT_EQ(message, plaintext2) << "RSA-OAEP failed with digest " << digest;
+
+ // Decrypting corrupted ciphertext should fail.
+ size_t offset_to_corrupt = random() % ciphertext1.size();
+ char corrupt_byte;
+ do {
+ corrupt_byte = static_cast<char>(random() % 256);
+ } while (corrupt_byte == ciphertext1[offset_to_corrupt]);
+ ciphertext1[offset_to_corrupt] = corrupt_byte;
+
+ EXPECT_EQ(ErrorCode::OK, Begin(KeyPurpose::DECRYPT, params));
+ string result;
+ EXPECT_EQ(ErrorCode::UNKNOWN_ERROR, Finish(ciphertext1, &result));
+ EXPECT_EQ(0U, result.size());
+ }
+}
+
+/*
+ * EncryptionOperationsTest.RsaOaepWithMGFIncompatibleDigest
+ *
+ * Verifies that RSA-OAEP encryption operations fail in the correct way when asked to operate
+ * with incompatible MGF digest.
+ */
+TEST_P(EncryptionOperationsTest, RsaOaepWithMGFIncompatibleDigest) {
+ ASSERT_EQ(ErrorCode::OK,
+ GenerateKey(AuthorizationSetBuilder()
+ .Authorization(TAG_RSA_OAEP_MGF_DIGEST, Digest::SHA_2_256)
+ .Authorization(TAG_NO_AUTH_REQUIRED)
+ .RsaEncryptionKey(2048, 65537)
+ .Padding(PaddingMode::RSA_OAEP)
+ .Digest(Digest::SHA_2_256)));
+ string message = "Hello World!";
+
+ auto params = AuthorizationSetBuilder()
+ .Padding(PaddingMode::RSA_OAEP)
+ .Digest(Digest::SHA_2_256)
+ .Authorization(TAG_RSA_OAEP_MGF_DIGEST, Digest::SHA_2_224);
+ EXPECT_EQ(ErrorCode::INCOMPATIBLE_MGF_DIGEST, Begin(KeyPurpose::ENCRYPT, params));
+}
+
+/*
+ * EncryptionOperationsTest.RsaOaepWithMGFUnsupportedDigest
+ *
+ * Verifies that RSA-OAEP encryption operations fail in the correct way when asked to operate
+ * with unsupported MGF digest.
+ */
+TEST_P(EncryptionOperationsTest, RsaOaepWithMGFUnsupportedDigest) {
+ ASSERT_EQ(ErrorCode::OK,
+ GenerateKey(AuthorizationSetBuilder()
+ .Authorization(TAG_RSA_OAEP_MGF_DIGEST, Digest::SHA_2_256)
+ .Authorization(TAG_NO_AUTH_REQUIRED)
+ .RsaEncryptionKey(2048, 65537)
+ .Padding(PaddingMode::RSA_OAEP)
+ .Digest(Digest::SHA_2_256)));
+ string message = "Hello World!";
+
+ auto params = AuthorizationSetBuilder()
+ .Padding(PaddingMode::RSA_OAEP)
+ .Digest(Digest::SHA_2_256)
+ .Authorization(TAG_RSA_OAEP_MGF_DIGEST, Digest::NONE);
+ EXPECT_EQ(ErrorCode::UNSUPPORTED_MGF_DIGEST, Begin(KeyPurpose::ENCRYPT, params));
+}
+
+/*
* EncryptionOperationsTest.RsaPkcs1Success
*
* Verifies that RSA PKCS encryption/decrypts works.
@@ -3820,16 +4211,6 @@
INSTANTIATE_KEYMINT_AIDL_TEST(AddEntropyTest);
-typedef KeyMintAidlTestBase AttestationTest;
-
-/*
- * AttestationTest.RsaAttestation
- *
- * Verifies that attesting to RSA keys works and generates the expected output.
- */
-// TODO(seleneh) add attestation tests back after decided on the new attestation
-// behavior under generateKey and importKey
-
typedef KeyMintAidlTestBase KeyDeletionTest;
/**
@@ -3849,7 +4230,7 @@
// Delete must work if rollback protection is implemented
if (error == ErrorCode::OK) {
- AuthorizationSet hardwareEnforced(key_characteristics_.hardwareEnforced);
+ AuthorizationSet hardwareEnforced(SecLevelAuthorizations());
ASSERT_TRUE(hardwareEnforced.Contains(TAG_ROLLBACK_RESISTANCE));
ASSERT_EQ(ErrorCode::OK, DeleteKey(true /* keep key blob */));
@@ -3882,8 +4263,8 @@
// Delete must work if rollback protection is implemented
if (error == ErrorCode::OK) {
- AuthorizationSet hardwareEnforced(key_characteristics_.hardwareEnforced);
- ASSERT_TRUE(hardwareEnforced.Contains(TAG_ROLLBACK_RESISTANCE));
+ AuthorizationSet enforced(SecLevelAuthorizations());
+ ASSERT_TRUE(enforced.Contains(TAG_ROLLBACK_RESISTANCE));
// Delete the key we don't care about the result at this point.
DeleteKey();
@@ -3918,7 +4299,7 @@
// Delete must work if rollback protection is implemented
if (error == ErrorCode::OK) {
- AuthorizationSet hardwareEnforced(key_characteristics_.hardwareEnforced);
+ AuthorizationSet hardwareEnforced(SecLevelAuthorizations());
ASSERT_TRUE(hardwareEnforced.Contains(TAG_ROLLBACK_RESISTANCE));
ASSERT_EQ(ErrorCode::OK, DeleteAllKeys());
diff --git a/security/keymint/aidl/vts/functional/VerificationTokenTest.cpp b/security/keymint/aidl/vts/functional/VerificationTokenTest.cpp
deleted file mode 100644
index 0b1eccd..0000000
--- a/security/keymint/aidl/vts/functional/VerificationTokenTest.cpp
+++ /dev/null
@@ -1,168 +0,0 @@
-/*
- * Copyright (C) 2020 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#include "KeyMintAidlTestBase.h"
-
-namespace aidl::android::hardware::security::keymint::test {
-
-class VerificationTokenTest : public KeyMintAidlTestBase {
- protected:
- struct VerifyAuthorizationResult {
- ErrorCode error;
- VerificationToken token;
- };
-
- VerifyAuthorizationResult verifyAuthorization(uint64_t operationHandle,
- const HardwareAuthToken& authToken) {
- VerifyAuthorizationResult result;
-
- Status err;
- err = keyMint().verifyAuthorization(operationHandle, //
- authToken, //
- &result.token);
-
- result.error = GetReturnErrorCode(err);
- return result;
- }
-
- uint64_t getTime() {
- struct timespec timespec;
- EXPECT_EQ(0, clock_gettime(CLOCK_BOOTTIME, ×pec));
- return timespec.tv_sec * 1000 + timespec.tv_nsec / 1000000;
- }
-
- int sleep_ms(uint32_t milliseconds) {
- struct timespec sleep_time = {static_cast<time_t>(milliseconds / 1000),
- static_cast<long>(milliseconds % 1000) * 1000000};
- while (sleep_time.tv_sec || sleep_time.tv_nsec) {
- if (nanosleep(&sleep_time /* to wait */,
- &sleep_time /* remaining (on interrruption) */) == 0) {
- sleep_time = {};
- } else {
- if (errno != EINTR) return errno;
- }
- }
- return 0;
- }
-};
-
-/*
- * VerificationTokens exist to facilitate cross-KeyMint verification of requirements. As
- * such, the precise capabilities required will vary depending on the specific vendor
- * implementations. Essentially, VerificationTokens are a "hook" to enable vendor
- * implementations to communicate, so the precise usage is defined by those vendors. The only
- * thing we really can test is that tokens can be created by TEE keyMints, and that the
- * timestamps increase as expected.
- */
-TEST_P(VerificationTokenTest, TestCreation) {
- auto result1 = verifyAuthorization(1 /* operation handle */, HardwareAuthToken());
- auto result1_time = getTime();
-
- if (SecLevel() == SecurityLevel::STRONGBOX) {
- // StrongBox should not implement verifyAuthorization.
- EXPECT_EQ(ErrorCode::UNIMPLEMENTED, result1.error);
- return;
- }
-
- ASSERT_EQ(ErrorCode::OK, result1.error);
- EXPECT_EQ(1U, result1.token.challenge);
- EXPECT_EQ(SecLevel(), result1.token.securityLevel);
- EXPECT_GT(result1.token.timestamp.milliSeconds, 0U);
-
- constexpr uint32_t time_to_sleep = 200;
- sleep_ms(time_to_sleep);
-
- auto result2 = verifyAuthorization(2 /* operation handle */, HardwareAuthToken());
-
- auto result2_time = getTime();
- ASSERT_EQ(ErrorCode::OK, result2.error);
- EXPECT_EQ(2U, result2.token.challenge);
- EXPECT_EQ(SecLevel(), result2.token.securityLevel);
-
- auto host_time_delta = result2_time - result1_time;
-
- EXPECT_GE(host_time_delta, time_to_sleep)
- << "We slept for " << time_to_sleep << " ms, the clock must have advanced by that much";
- EXPECT_LE(host_time_delta, time_to_sleep + 20)
- << "The verifyAuthorization call took " << (host_time_delta - time_to_sleep)
- << " ms? That's awful!";
-
- auto km_time_delta =
- result2.token.timestamp.milliSeconds - result1.token.timestamp.milliSeconds;
-
- // If not too much else is going on on the system, the time delta should be quite close. Allow
- // 2 ms of slop just to avoid test flakiness.
- //
- // TODO(swillden): see if we can output values so they can be gathered across many runs and
- // report if times aren't nearly always <1ms apart.
- EXPECT_LE(host_time_delta, km_time_delta + 2);
- EXPECT_LE(km_time_delta, host_time_delta + 2);
- ASSERT_EQ(result1.token.mac.size(), result2.token.mac.size());
- ASSERT_NE(0,
- memcmp(result1.token.mac.data(), result2.token.mac.data(), result1.token.mac.size()));
-}
-
-/*
- * Test that the mac changes when the time stamp changes. This is does not guarantee that the time
- * stamp is included in the mac but on failure we know that it is not. Other than in the test
- * case above we call verifyAuthorization with the exact same set of parameters.
- */
-TEST_P(VerificationTokenTest, MacChangesOnChangingTimestamp) {
- auto result1 = verifyAuthorization(0 /* operation handle */, HardwareAuthToken());
- auto result1_time = getTime();
-
- if (SecLevel() == SecurityLevel::STRONGBOX) {
- // StrongBox should not implement verifyAuthorization.
- EXPECT_EQ(ErrorCode::UNIMPLEMENTED, result1.error);
- return;
- }
-
- EXPECT_EQ(ErrorCode::OK, result1.error);
- EXPECT_EQ(0U, result1.token.challenge);
- EXPECT_EQ(SecLevel(), result1.token.securityLevel);
- EXPECT_GT(result1.token.timestamp.milliSeconds, 0U);
-
- constexpr uint32_t time_to_sleep = 200;
- sleep_ms(time_to_sleep);
-
- auto result2 = verifyAuthorization(0 /* operation handle */, HardwareAuthToken());
- // ASSERT_TRUE(result2.callSuccessful);
- auto result2_time = getTime();
- EXPECT_EQ(ErrorCode::OK, result2.error);
- EXPECT_EQ(0U, result2.token.challenge);
- EXPECT_EQ(SecLevel(), result2.token.securityLevel);
-
- auto host_time_delta = result2_time - result1_time;
-
- EXPECT_GE(host_time_delta, time_to_sleep)
- << "We slept for " << time_to_sleep << " ms, the clock must have advanced by that much";
- EXPECT_LE(host_time_delta, time_to_sleep + 20)
- << "The verifyAuthorization call took " << (host_time_delta - time_to_sleep)
- << " ms? That's awful!";
-
- auto km_time_delta =
- result2.token.timestamp.milliSeconds - result1.token.timestamp.milliSeconds;
-
- EXPECT_LE(host_time_delta, km_time_delta + 2);
- EXPECT_LE(km_time_delta, host_time_delta + 2);
- ASSERT_EQ(result1.token.mac.size(), result2.token.mac.size());
- ASSERT_NE(0,
- memcmp(result1.token.mac.data(), result2.token.mac.data(), result1.token.mac.size()));
-}
-
-INSTANTIATE_KEYMINT_AIDL_TEST(VerificationTokenTest);
-
-} // namespace aidl::android::hardware::security::keymint::test
diff --git a/security/keymint/support/authorization_set.cpp b/security/keymint/support/authorization_set.cpp
index f98851c..3d44dff 100644
--- a/security/keymint/support/authorization_set.cpp
+++ b/security/keymint/support/authorization_set.cpp
@@ -227,6 +227,14 @@
return *this;
}
+AuthorizationSetBuilder& AuthorizationSetBuilder::OaepMGFDigest(
+ const std::vector<android::hardware::security::keymint::Digest>& digests) {
+ for (auto digest : digests) {
+ push_back(TAG_RSA_OAEP_MGF_DIGEST, digest);
+ }
+ return *this;
+}
+
AuthorizationSetBuilder& AuthorizationSetBuilder::Padding(
std::initializer_list<PaddingMode> paddingModes) {
for (auto paddingMode : paddingModes) {
diff --git a/security/keymint/support/include/keymint_support/authorization_set.h b/security/keymint/support/include/keymint_support/authorization_set.h
index 4ff1705..1407c5f 100644
--- a/security/keymint/support/include/keymint_support/authorization_set.h
+++ b/security/keymint/support/include/keymint_support/authorization_set.h
@@ -259,6 +259,12 @@
size - 1); // drop the terminating '\0'
}
+ template <Tag tag>
+ AuthorizationSetBuilder& Authorization(TypedTag<TagType::BYTES, tag> ttag,
+ const std::string& data) {
+ return Authorization(ttag, reinterpret_cast<const uint8_t*>(data.data()), data.size());
+ }
+
AuthorizationSetBuilder& Authorizations(const AuthorizationSet& set) {
for (const auto& entry : set) {
push_back(entry);
@@ -290,9 +296,24 @@
AuthorizationSetBuilder& GcmModeMacLen(uint32_t macLength);
AuthorizationSetBuilder& BlockMode(std::initializer_list<BlockMode> blockModes);
+ AuthorizationSetBuilder& OaepMGFDigest(const std::vector<Digest>& digests);
AuthorizationSetBuilder& Digest(std::vector<Digest> digests);
AuthorizationSetBuilder& Padding(std::initializer_list<PaddingMode> paddings);
+ AuthorizationSetBuilder& AttestationChallenge(const std::string& challenge) {
+ return Authorization(TAG_ATTESTATION_CHALLENGE, challenge);
+ }
+ AuthorizationSetBuilder& AttestationChallenge(std::vector<uint8_t> challenge) {
+ return Authorization(TAG_ATTESTATION_CHALLENGE, challenge);
+ }
+
+ AuthorizationSetBuilder& AttestationApplicationId(const std::string& id) {
+ return Authorization(TAG_ATTESTATION_APPLICATION_ID, id);
+ }
+ AuthorizationSetBuilder& AttestationApplicationId(std::vector<uint8_t> id) {
+ return Authorization(TAG_ATTESTATION_APPLICATION_ID, id);
+ }
+
template <typename... T>
AuthorizationSetBuilder& BlockMode(T&&... a) {
return BlockMode({std::forward<T>(a)...});
diff --git a/security/keymint/support/include/keymint_support/key_param_output.h b/security/keymint/support/include/keymint_support/key_param_output.h
index 5f004fe..c2b0029 100644
--- a/security/keymint/support/include/keymint_support/key_param_output.h
+++ b/security/keymint/support/include/keymint_support/key_param_output.h
@@ -84,8 +84,10 @@
::std::ostream& operator<<(::std::ostream& os, const KeyParameter& param);
inline ::std::ostream& operator<<(::std::ostream& os, const KeyCharacteristics& value) {
- return os << "SW: " << value.softwareEnforced << ::std::endl
- << "HW: " << value.hardwareEnforced << ::std::endl;
+ for (auto& entry : value.authorizations) {
+ os << value.securityLevel << ": " << entry;
+ }
+ return os;
}
inline ::std::ostream& operator<<(::std::ostream& os, KeyPurpose value) {
diff --git a/security/keymint/support/include/keymint_support/keymint_tags.h b/security/keymint/support/include/keymint_support/keymint_tags.h
index d932b40..76aecb7 100644
--- a/security/keymint/support/include/keymint_support/keymint_tags.h
+++ b/security/keymint/support/include/keymint_support/keymint_tags.h
@@ -124,6 +124,7 @@
DECLARE_TYPED_TAG(USER_ID);
DECLARE_TYPED_TAG(USER_SECURE_ID);
DECLARE_TYPED_TAG(VENDOR_PATCHLEVEL);
+DECLARE_TYPED_TAG(RSA_OAEP_MGF_DIGEST);
#undef DECLARE_TYPED_TAG
@@ -239,6 +240,7 @@
MAKE_TAG_ENUM_VALUE_ACCESSOR(TAG_PURPOSE, keyPurpose)
MAKE_TAG_ENUM_VALUE_ACCESSOR(TAG_USER_AUTH_TYPE, hardwareAuthenticatorType)
MAKE_TAG_ENUM_VALUE_ACCESSOR(TAG_HARDWARE_TYPE, securityLevel)
+MAKE_TAG_ENUM_VALUE_ACCESSOR(TAG_RSA_OAEP_MGF_DIGEST, digest)
#undef MAKE_TAG_ENUM_VALUE_ACCESSOR
diff --git a/security/secureclock/aidl/Android.bp b/security/secureclock/aidl/Android.bp
new file mode 100644
index 0000000..5a6d7ae
--- /dev/null
+++ b/security/secureclock/aidl/Android.bp
@@ -0,0 +1,21 @@
+aidl_interface {
+ name: "android.hardware.security.secureclock",
+ vendor_available: true,
+ srcs: [
+ "android/hardware/security/secureclock/*.aidl",
+ ],
+ stability: "vintf",
+ backend: {
+ java: {
+ sdk_version: "module_current",
+ },
+ ndk: {
+ vndk: {
+ enabled: true,
+ },
+ },
+ rust: {
+ enabled: true,
+ },
+ },
+}
diff --git a/security/secureclock/aidl/aidl_api/android.hardware.security.secureclock/current/android/hardware/security/secureclock/ISecureClock.aidl b/security/secureclock/aidl/aidl_api/android.hardware.security.secureclock/current/android/hardware/security/secureclock/ISecureClock.aidl
new file mode 100644
index 0000000..c16b312
--- /dev/null
+++ b/security/secureclock/aidl/aidl_api/android.hardware.security.secureclock/current/android/hardware/security/secureclock/ISecureClock.aidl
@@ -0,0 +1,24 @@
+///////////////////////////////////////////////////////////////////////////////
+// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
+///////////////////////////////////////////////////////////////////////////////
+
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
+//
+// You must not make a backward incompatible change to any AIDL file built
+// with the aidl_interface module type with versions property set. The module
+// type is used to build AIDL files in a way that they can be used across
+// independently updatable components of the system. If a device is shipped
+// with such a backward incompatible change, it has a high risk of breaking
+// later when a module using the interface is updated, e.g., Mainline modules.
+
+package android.hardware.security.secureclock;
+@VintfStability
+interface ISecureClock {
+ android.hardware.security.secureclock.TimeStampToken generateTimeStamp(in long challenge);
+ const String TIME_STAMP_MAC_LABEL = "Time Verification";
+}
diff --git a/security/secureclock/aidl/aidl_api/android.hardware.security.secureclock/current/android/hardware/security/secureclock/TimeStampToken.aidl b/security/secureclock/aidl/aidl_api/android.hardware.security.secureclock/current/android/hardware/security/secureclock/TimeStampToken.aidl
new file mode 100644
index 0000000..21eeb74
--- /dev/null
+++ b/security/secureclock/aidl/aidl_api/android.hardware.security.secureclock/current/android/hardware/security/secureclock/TimeStampToken.aidl
@@ -0,0 +1,25 @@
+///////////////////////////////////////////////////////////////////////////////
+// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
+///////////////////////////////////////////////////////////////////////////////
+
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
+//
+// You must not make a backward incompatible change to any AIDL file built
+// with the aidl_interface module type with versions property set. The module
+// type is used to build AIDL files in a way that they can be used across
+// independently updatable components of the system. If a device is shipped
+// with such a backward incompatible change, it has a high risk of breaking
+// later when a module using the interface is updated, e.g., Mainline modules.
+
+package android.hardware.security.secureclock;
+@RustDerive(Clone=true, Eq=true, Hash=true, Ord=true, PartialEq=true, PartialOrd=true) @VintfStability
+parcelable TimeStampToken {
+ long challenge;
+ android.hardware.security.secureclock.Timestamp timestamp;
+ byte[] mac;
+}
diff --git a/security/secureclock/aidl/aidl_api/android.hardware.security.secureclock/current/android/hardware/security/secureclock/Timestamp.aidl b/security/secureclock/aidl/aidl_api/android.hardware.security.secureclock/current/android/hardware/security/secureclock/Timestamp.aidl
new file mode 100644
index 0000000..f01fdc7
--- /dev/null
+++ b/security/secureclock/aidl/aidl_api/android.hardware.security.secureclock/current/android/hardware/security/secureclock/Timestamp.aidl
@@ -0,0 +1,23 @@
+///////////////////////////////////////////////////////////////////////////////
+// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
+///////////////////////////////////////////////////////////////////////////////
+
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
+//
+// You must not make a backward incompatible change to any AIDL file built
+// with the aidl_interface module type with versions property set. The module
+// type is used to build AIDL files in a way that they can be used across
+// independently updatable components of the system. If a device is shipped
+// with such a backward incompatible change, it has a high risk of breaking
+// later when a module using the interface is updated, e.g., Mainline modules.
+
+package android.hardware.security.secureclock;
+@RustDerive(Clone=true, Eq=true, Hash=true, Ord=true, PartialEq=true, PartialOrd=true) @VintfStability
+parcelable Timestamp {
+ long milliSeconds;
+}
diff --git a/security/secureclock/aidl/android/hardware/security/secureclock/ISecureClock.aidl b/security/secureclock/aidl/android/hardware/security/secureclock/ISecureClock.aidl
new file mode 100644
index 0000000..7d416dd
--- /dev/null
+++ b/security/secureclock/aidl/android/hardware/security/secureclock/ISecureClock.aidl
@@ -0,0 +1,48 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * limitations under the License.
+ */
+
+package android.hardware.security.secureclock;
+import android.hardware.security.secureclock.TimeStampToken;
+
+/**
+ * Secure Clock definition.
+ *
+ * An ISecureClock provides a keymint service to generate secure timestamp using a secure platform.
+ * The secure time stamp contains time in milliseconds. This time stamp also contains a 256-bit MAC
+ * which provides integrity protection. The MAC is generated using HMAC-SHA-256 and a shared
+ * secret. The shared secret must be available to secure clock service by implementing
+ * ISharedSecret aidl. Note: ISecureClock depends on the shared secret, without which the secure
+ * time stamp token cannot be generated.
+ */
+
+@VintfStability
+interface ISecureClock {
+ /**
+ * String used as context in the HMAC computation signing the generated time stamp.
+ * See TimeStampToken.mac for details.
+ */
+ const String TIME_STAMP_MAC_LABEL = "Time Verification";
+
+ /**
+ * Generates an authenticated timestamp.
+ *
+ * @param A challenge value provided by the relying party. It will be included in the generated
+ * TimeStampToken to ensure freshness. The relying service must ensure that the
+ * challenge cannot be specified or predicted by an attacker.
+ *
+ * @return the TimeStampToken, see the definition for details.
+ */
+ TimeStampToken generateTimeStamp(in long challenge);
+}
diff --git a/security/secureclock/aidl/android/hardware/security/secureclock/TimeStampToken.aidl b/security/secureclock/aidl/android/hardware/security/secureclock/TimeStampToken.aidl
new file mode 100644
index 0000000..3fb5860
--- /dev/null
+++ b/security/secureclock/aidl/android/hardware/security/secureclock/TimeStampToken.aidl
@@ -0,0 +1,56 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.hardware.security.secureclock;
+
+import android.hardware.security.secureclock.Timestamp;
+
+/**
+ * TimeStampToken instances are used for secure environments that requires secure time information.
+ */
+
+@VintfStability
+@RustDerive(Clone=true, Eq=true, PartialEq=true, Ord=true, PartialOrd=true, Hash=true)
+parcelable TimeStampToken {
+ /**
+ * The challenge that was provided as argument to ISecureClock.generateTimeStamp by the client.
+ */
+ long challenge;
+
+ /**
+ * The current time of the secure environment that generates the TimeStampToken.
+ */
+ Timestamp timestamp;
+
+ /**
+ * 32-byte HMAC-SHA256 of the above values, computed as:
+ *
+ * HMAC(H,
+ * ISecureClock.TIME_STAMP_MAC_LABEL || challenge || timestamp)
+ *
+ * where:
+ *
+ * ``ISecureClock.TIME_STAMP_MAC_LABEL'' is a sting constant defined in ISecureClock.aidl.
+ *
+ * ``H'' is the shared HMAC key (see computeSharedHmac() in ISharedHmacSecret).
+ *
+ * ``||'' represents concatenation
+ *
+ * The representation of challenge and timestamp is as 64-bit unsigned integers in big-endian
+ * order. securityLevel is represented as a 32-bit unsigned integer in big-endian order.
+ */
+ byte[] mac;
+}
diff --git a/security/keymint/aidl/android/hardware/security/keymint/Timestamp.aidl b/security/secureclock/aidl/android/hardware/security/secureclock/Timestamp.aidl
similarity index 88%
rename from security/keymint/aidl/android/hardware/security/keymint/Timestamp.aidl
rename to security/secureclock/aidl/android/hardware/security/secureclock/Timestamp.aidl
index ebb3684..27758e1 100644
--- a/security/keymint/aidl/android/hardware/security/keymint/Timestamp.aidl
+++ b/security/secureclock/aidl/android/hardware/security/secureclock/Timestamp.aidl
@@ -14,7 +14,7 @@
* limitations under the License.
*/
-package android.hardware.security.keymint;
+package android.hardware.security.secureclock;
/**
* Time in milliseconds since some arbitrary point in time. Time must be monotonically increasing,
@@ -23,6 +23,7 @@
* by setting the clock to zero during each boot, and then counting time accurately).
*/
@VintfStability
+@RustDerive(Clone=true, Eq=true, PartialEq=true, Ord=true, PartialOrd=true, Hash=true)
parcelable Timestamp {
long milliSeconds;
}
diff --git a/security/sharedsecret/aidl/Android.bp b/security/sharedsecret/aidl/Android.bp
new file mode 100644
index 0000000..ab44110
--- /dev/null
+++ b/security/sharedsecret/aidl/Android.bp
@@ -0,0 +1,21 @@
+aidl_interface {
+ name: "android.hardware.security.sharedsecret",
+ vendor_available: true,
+ srcs: [
+ "android/hardware/security/sharedsecret/*.aidl",
+ ],
+ stability: "vintf",
+ backend: {
+ java: {
+ sdk_version: "module_current",
+ },
+ ndk: {
+ vndk: {
+ enabled: true,
+ },
+ },
+ rust: {
+ enabled: true,
+ },
+ },
+}
diff --git a/security/sharedsecret/aidl/aidl_api/android.hardware.security.sharedsecret/current/android/hardware/security/sharedsecret/ISharedSecret.aidl b/security/sharedsecret/aidl/aidl_api/android.hardware.security.sharedsecret/current/android/hardware/security/sharedsecret/ISharedSecret.aidl
new file mode 100644
index 0000000..2509936
--- /dev/null
+++ b/security/sharedsecret/aidl/aidl_api/android.hardware.security.sharedsecret/current/android/hardware/security/sharedsecret/ISharedSecret.aidl
@@ -0,0 +1,26 @@
+///////////////////////////////////////////////////////////////////////////////
+// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
+///////////////////////////////////////////////////////////////////////////////
+
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
+//
+// You must not make a backward incompatible change to any AIDL file built
+// with the aidl_interface module type with versions property set. The module
+// type is used to build AIDL files in a way that they can be used across
+// independently updatable components of the system. If a device is shipped
+// with such a backward incompatible change, it has a high risk of breaking
+// later when a module using the interface is updated, e.g., Mainline modules.
+
+package android.hardware.security.sharedsecret;
+@VintfStability
+interface ISharedSecret {
+ android.hardware.security.sharedsecret.SharedSecretParameters getSharedSecretParameters();
+ byte[] computeSharedSecret(in android.hardware.security.sharedsecret.SharedSecretParameters[] params);
+ const String KEY_AGREEMENT_LABEL = "KeymasterSharedMac";
+ const String KEY_CHECK_LABEL = "Keymaster HMAC Verification";
+}
diff --git a/security/sharedsecret/aidl/aidl_api/android.hardware.security.sharedsecret/current/android/hardware/security/sharedsecret/SharedSecretParameters.aidl b/security/sharedsecret/aidl/aidl_api/android.hardware.security.sharedsecret/current/android/hardware/security/sharedsecret/SharedSecretParameters.aidl
new file mode 100644
index 0000000..9b65046
--- /dev/null
+++ b/security/sharedsecret/aidl/aidl_api/android.hardware.security.sharedsecret/current/android/hardware/security/sharedsecret/SharedSecretParameters.aidl
@@ -0,0 +1,24 @@
+///////////////////////////////////////////////////////////////////////////////
+// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
+///////////////////////////////////////////////////////////////////////////////
+
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
+//
+// You must not make a backward incompatible change to any AIDL file built
+// with the aidl_interface module type with versions property set. The module
+// type is used to build AIDL files in a way that they can be used across
+// independently updatable components of the system. If a device is shipped
+// with such a backward incompatible change, it has a high risk of breaking
+// later when a module using the interface is updated, e.g., Mainline modules.
+
+package android.hardware.security.sharedsecret;
+@VintfStability
+parcelable SharedSecretParameters {
+ byte[] seed;
+ byte[] nonce;
+}
diff --git a/security/sharedsecret/aidl/android/hardware/security/sharedsecret/ISharedSecret.aidl b/security/sharedsecret/aidl/android/hardware/security/sharedsecret/ISharedSecret.aidl
new file mode 100644
index 0000000..906303f
--- /dev/null
+++ b/security/sharedsecret/aidl/android/hardware/security/sharedsecret/ISharedSecret.aidl
@@ -0,0 +1,114 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * limitations under the License.
+ */
+
+package android.hardware.security.sharedsecret;
+import android.hardware.security.sharedsecret.SharedSecretParameters;
+
+/**
+ * Shared Secret definition.
+ *
+ * An ISharedSecret enables any service that implements this interface to establish a shared secret
+ * with one or more other services such as ISecureClock, TEE IKeymintDevice, StrongBox
+ * IKeymintDevice, etc. The shared secret is a 256-bit HMAC key and it is further used to generate
+ * secure tokens with integrity protection. There are two steps to establish a shared secret between
+ * the collaborating services:
+ *
+ * Step 1: During Android startup the system calls each service that implements this interface to
+ * get the shared secret parameters. This is done using getSharedSecretParameters method defined
+ * below.
+ * Step 2: The system lexicographically sorts the shared secret parameters received from each
+ * service and then sends these sorted parameter list to each service in a computeSharedSecret
+ * method defined below. The services individually computes the shared secret and returns back
+ * the 32 byte sharing check hash value generated by using the computed shared secret.
+ * Step 3: The system collects sharing check hash values from each service and evaluates them. If
+ * they are all equal, then the shared secret generation is considered to be successful else it is
+ * considered to have failed.
+ */
+
+@VintfStability
+interface ISharedSecret {
+ /**
+ * String used as label in the shared key derivation. See computeSharedSecret below.
+ */
+ const String KEY_AGREEMENT_LABEL = "KeymasterSharedMac";
+
+ /**
+ * String used as context in the computation of the sharingCheck. See computeSharedSecret
+ * below.
+ */
+ const String KEY_CHECK_LABEL = "Keymaster HMAC Verification";
+
+ /**
+ * This method is the first step in the process for agreeing on a shared key. It is called by
+ * Android during startup. The system calls it on each of the HAL instances and collects the
+ * results in preparation for the second step.
+ *
+ * @return The SharedSecretParameters to use. As specified in the SharedSecretParameters
+ * documentation, the seed must contain the same value in every invocation
+ * of the method on a given device, and the nonce must return the same value for every
+ * invocation during a boot session.
+ */
+ SharedSecretParameters getSharedSecretParameters();
+
+ /**
+ * This method is the second and final step in the process for agreeing on a shared key. It is
+ * called by Android during startup. The system calls it on each of the keymint services, and
+ * sends to it all of the SharedSecretParameters returned by all keymint services.
+ *
+ * This method computes the shared 32-byte HMAC key ``H'' as follows (all keymint services
+ * instances perform the same computation to arrive at the same result):
+ *
+ * H = CKDF(key = K,
+ * context = P1 || P2 || ... || Pn,
+ * label = KEY_AGREEMENT_LABEL)
+ *
+ * where:
+ *
+ * ``CKDF'' is the standard AES-CMAC KDF from NIST SP 800-108 in counter mode (see Section
+ * 5.1 of the referenced publication). ``key'', ``context'', and ``label'' are
+ * defined in the standard. The counter is prefixed and length L appended, as shown
+ * in the construction on page 12 of the standard. The label string is UTF-8 encoded.
+ *
+ * ``K'' is a pre-established shared secret, set up during factory reset. The mechanism for
+ * establishing this shared secret is implementation-defined.Any method of securely
+ * establishing K that ensures that an attacker cannot obtain or derive its value is
+ * acceptable.
+ *
+ * CRITICAL SECURITY REQUIREMENT: All keys created by a IKeymintDevice instance must
+ * be cryptographically bound to the value of K, such that establishing a new K
+ * permanently destroys them.
+ *
+ * ``||'' represents concatenation.
+ *
+ * ``Pi'' is the i'th SharedSecretParameters value in the params vector. Encoding of an
+ * SharedSecretParameters is the concatenation of its two fields, i.e. seed || nonce.
+ *
+ * Note that the label "KeymasterSharedMac" is the 18-byte UTF-8 encoding of the string.
+ *
+ * @param params is an array of SharedSecretParameters The lexicographically sorted
+ * SharedSecretParameters data returned by all keymint services when getSharedSecretParameters
+ * was called.
+ *
+ * @return sharingCheck A 32-byte value used to verify that all the keymint services have
+ * computed the same shared HMAC key. The sharingCheck value is computed as follows:
+ *
+ * sharingCheck = HMAC(H, KEY_CHECK_LABEL)
+ *
+ * The string is UTF-8 encoded, 27 bytes in length. If the returned values of all
+ * keymint services don't match, clients must assume that HMAC agreement
+ * failed.
+ */
+ byte[] computeSharedSecret(in SharedSecretParameters[] params);
+}
diff --git a/security/sharedsecret/aidl/android/hardware/security/sharedsecret/SharedSecretParameters.aidl b/security/sharedsecret/aidl/android/hardware/security/sharedsecret/SharedSecretParameters.aidl
new file mode 100644
index 0000000..691b3f1
--- /dev/null
+++ b/security/sharedsecret/aidl/android/hardware/security/sharedsecret/SharedSecretParameters.aidl
@@ -0,0 +1,40 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.hardware.security.sharedsecret;
+
+/**
+ * SharedSecretParameters holds the data used in the process of establishing a shared secret i.e.
+ * HMAC key between multiple keymint services. These parameters are returned in by
+ * getSharedSecretParameters() and send to computeShareSecret(). See the named methods in
+ * ISharedSecret for details of usage.
+ */
+
+@VintfStability
+parcelable SharedSecretParameters {
+ /**
+ * Either empty or contains a non zero persistent value that is associated with the pre-shared
+ * HMAC agreement key. It is either empty or 32 bytes in length.
+ */
+ byte[] seed;
+
+ /**
+ * A 32-byte value which is guaranteed to be different each time
+ * getSharedSecretParameters() is called. Probabilistic uniqueness (i.e. random) is acceptable,
+ * though a stronger uniqueness guarantee (e.g. counter) is recommended where possible.
+ */
+ byte[] nonce;
+}
diff --git a/tests/lazy/1.1/ILazy.hal b/tests/lazy/1.1/ILazy.hal
index a15e0e3..eb48fd3 100644
--- a/tests/lazy/1.1/ILazy.hal
+++ b/tests/lazy/1.1/ILazy.hal
@@ -18,4 +18,12 @@
import android.hardware.tests.lazy@1.0;
-interface ILazy extends @1.0::ILazy {};
+interface ILazy extends @1.0::ILazy {
+ /**
+ * Ask the process hosting the service to install a callback that notifies if there are
+ * services with clients.
+ * For testing purposes, this callback exercises the code to unregister/re-register
+ * the services and eventually shuts down the process.
+ */
+ setCustomActiveServicesCallback();
+};
diff --git a/tests/msgq/1.0/ITestMsgQ.hal b/tests/msgq/1.0/ITestMsgQ.hal
index bd10237..0cf9c7c 100644
--- a/tests/msgq/1.0/ITestMsgQ.hal
+++ b/tests/msgq/1.0/ITestMsgQ.hal
@@ -41,12 +41,15 @@
*
* @param configureFmq The server sets up a new unsynchronized FMQ if
* this parameter is true.
+ * @param userFd True to initialize the message queue with a user supplied
+ * file descriptor for the ring buffer.
+ * False to let the message queue use a single FD for everything.
*
* @return ret True if successful.
* @return mqDesc This structure describes the unsynchronized FMQ that was
* set up by the service. Client can use it to set up the FMQ at its end.
*/
- getFmqUnsyncWrite(bool configureFmq) generates(bool ret, fmq_unsync<int32_t> mqDesc);
+ getFmqUnsyncWrite(bool configureFmq, bool userFd) generates(bool ret, fmq_unsync<int32_t> mqDesc);
/**
* This method request the service to write into the synchronized read/write
diff --git a/tests/msgq/1.0/default/Android.bp b/tests/msgq/1.0/default/Android.bp
index 6e7cd44..a50206b 100644
--- a/tests/msgq/1.0/default/Android.bp
+++ b/tests/msgq/1.0/default/Android.bp
@@ -91,9 +91,10 @@
// These are static libs only for testing purposes and portability. Shared
// libs should be used on device.
static_libs: [
+ "android.hardware.common-unstable-ndk_platform",
+ "android.hardware.common.fmq-unstable-ndk_platform",
"android.hardware.tests.msgq@1.0",
"android.fmq.test-ndk_platform",
- "android.hardware.common.fmq-unstable-ndk_platform",
],
whole_static_libs: [
"android.hardware.tests.msgq@1.0-impl",
diff --git a/tests/msgq/1.0/default/TestMsgQ.cpp b/tests/msgq/1.0/default/TestMsgQ.cpp
index 4473737..4726ffe 100644
--- a/tests/msgq/1.0/default/TestMsgQ.cpp
+++ b/tests/msgq/1.0/default/TestMsgQ.cpp
@@ -41,10 +41,19 @@
return true;
}
-Return<void> TestMsgQ::getFmqUnsyncWrite(bool configureFmq, getFmqUnsyncWrite_cb _hidl_cb) {
+Return<void> TestMsgQ::getFmqUnsyncWrite(bool configureFmq, bool userFd,
+ getFmqUnsyncWrite_cb _hidl_cb) {
if (configureFmq) {
static constexpr size_t kNumElementsInQueue = 1024;
- mFmqUnsynchronized.reset(new (std::nothrow) MessageQueueUnsync(kNumElementsInQueue));
+ static constexpr size_t kElementSizeBytes = sizeof(int32_t);
+ android::base::unique_fd ringbufferFd;
+ if (userFd) {
+ ringbufferFd.reset(
+ ::ashmem_create_region("UnsyncWrite", kNumElementsInQueue * kElementSizeBytes));
+ }
+ mFmqUnsynchronized.reset(new (std::nothrow) MessageQueueUnsync(
+ kNumElementsInQueue, false, std::move(ringbufferFd),
+ kNumElementsInQueue * kElementSizeBytes));
}
if ((mFmqUnsynchronized == nullptr) ||
(mFmqUnsynchronized->isValid() == false)) {
diff --git a/tests/msgq/1.0/default/TestMsgQ.h b/tests/msgq/1.0/default/TestMsgQ.h
index 8a204b7..49675fe 100644
--- a/tests/msgq/1.0/default/TestMsgQ.h
+++ b/tests/msgq/1.0/default/TestMsgQ.h
@@ -56,7 +56,8 @@
// Methods from ::android::hardware::tests::msgq::V1_0::ITestMsgQ follow.
Return<bool> configureFmqSyncReadWrite(const MQDescriptorSync<int32_t>& mqDesc) override;
- Return<void> getFmqUnsyncWrite(bool configureFmq, getFmqUnsyncWrite_cb _hidl_cb) override;
+ Return<void> getFmqUnsyncWrite(bool configureFmq, bool userFd,
+ getFmqUnsyncWrite_cb _hidl_cb) override;
Return<bool> requestWriteFmqSync(int32_t count) override;
Return<bool> requestReadFmqSync(int32_t count) override;
Return<bool> requestWriteFmqUnsync(int32_t count) override;
diff --git a/tv/input/1.0/default/TvInput.cpp b/tv/input/1.0/default/TvInput.cpp
index 4ea1dec..7583a67 100644
--- a/tv/input/1.0/default/TvInput.cpp
+++ b/tv/input/1.0/default/TvInput.cpp
@@ -142,7 +142,7 @@
// static
void TvInput::notify(struct tv_input_device* __unused, tv_input_event_t* event,
- void* __unused) {
+ void* optionalStatus) {
if (mCallback != nullptr && event != nullptr) {
// Capturing is no longer supported.
if (event->type >= TV_INPUT_EVENT_CAPTURE_SUCCEEDED) {
@@ -154,7 +154,17 @@
tvInputEvent.deviceInfo.type = static_cast<TvInputType>(
event->device_info.type);
tvInputEvent.deviceInfo.portId = event->device_info.hdmi.port_id;
- tvInputEvent.deviceInfo.cableConnectionStatus = CableConnectionStatus::UNKNOWN;
+ CableConnectionStatus connectionStatus = CableConnectionStatus::UNKNOWN;
+ if (optionalStatus != nullptr &&
+ ((event->type == TV_INPUT_EVENT_STREAM_CONFIGURATIONS_CHANGED) ||
+ (event->type == TV_INPUT_EVENT_DEVICE_AVAILABLE))) {
+ int newStatus = *reinterpret_cast<int*>(optionalStatus);
+ if (newStatus <= static_cast<int>(CableConnectionStatus::DISCONNECTED) &&
+ newStatus >= static_cast<int>(CableConnectionStatus::UNKNOWN)) {
+ connectionStatus = static_cast<CableConnectionStatus>(newStatus);
+ }
+ }
+ tvInputEvent.deviceInfo.cableConnectionStatus = connectionStatus;
// TODO: Ensure the legacy audio type code is the same once audio HAL default
// implementation is ready.
tvInputEvent.deviceInfo.audioType = static_cast<AudioDevice>(
diff --git a/tv/tuner/1.0/vts/functional/DvrTests.cpp b/tv/tuner/1.0/vts/functional/DvrTests.cpp
index 0dfc032..ba21189 100644
--- a/tv/tuner/1.0/vts/functional/DvrTests.cpp
+++ b/tv/tuner/1.0/vts/functional/DvrTests.cpp
@@ -55,6 +55,7 @@
uint8_t* buffer;
ALOGW("[vts] playback thread loop start %s", mInputDataFile.c_str());
if (fd < 0) {
+ EXPECT_TRUE(fd >= 0) << "Failed to open: " + mInputDataFile;
mPlaybackThreadRunning = false;
ALOGW("[vts] Error %s", strerror(errno));
}
@@ -178,7 +179,7 @@
// Our current implementation filter the data and write it into the filter FMQ
// immediately after the DATA_READY from the VTS/framework
if (!readRecordFMQ()) {
- ALOGD("[vts] record data failed to be filtered. Ending thread");
+ ALOGW("[vts] record data failed to be filtered. Ending thread");
mRecordThreadRunning = false;
break;
}
diff --git a/tv/tuner/1.0/vts/functional/FilterTests.cpp b/tv/tuner/1.0/vts/functional/FilterTests.cpp
index 0ecdf73..a354c78 100644
--- a/tv/tuner/1.0/vts/functional/FilterTests.cpp
+++ b/tv/tuner/1.0/vts/functional/FilterTests.cpp
@@ -70,6 +70,10 @@
}
bool FilterCallback::readFilterEventData() {
+ if (mFilterMQ == NULL) {
+ ALOGW("[vts] FMQ is not configured and does not need to be tested.");
+ return true;
+ }
bool result = false;
DemuxFilterEvent filterEvent = mFilterEvent;
ALOGW("[vts] reading from filter FMQ or buffer %d", mFilterId);
@@ -218,7 +222,11 @@
return AssertionResult(status == Result::SUCCESS);
}
-AssertionResult FilterTests::getFilterMQDescriptor(uint32_t filterId) {
+AssertionResult FilterTests::getFilterMQDescriptor(uint32_t filterId, bool getMqDesc) {
+ if (!getMqDesc) {
+ ALOGE("[vts] Filter does not need FMQ.");
+ return success();
+ }
Result status;
EXPECT_TRUE(mFilters[filterId]) << "Test with getNewlyOpenedFilterId first.";
EXPECT_TRUE(mFilterCallbacks[filterId]) << "Test with getNewlyOpenedFilterId first.";
@@ -279,16 +287,14 @@
AssertionResult FilterTests::closeFilter(uint32_t filterId) {
EXPECT_TRUE(mFilters[filterId]) << "Test with getNewlyOpenedFilterId first.";
Result status = mFilters[filterId]->close();
- if (status == Result::SUCCESS) {
- for (int i = 0; i < mUsedFilterIds.size(); i++) {
- if (mUsedFilterIds[i] == filterId) {
- mUsedFilterIds.erase(mUsedFilterIds.begin() + i);
- break;
- }
+ for (int i = 0; i < mUsedFilterIds.size(); i++) {
+ if (mUsedFilterIds[i] == filterId) {
+ mUsedFilterIds.erase(mUsedFilterIds.begin() + i);
+ break;
}
- mFilterCallbacks.erase(filterId);
- mFilters.erase(filterId);
}
+ mFilterCallbacks.erase(filterId);
+ mFilters.erase(filterId);
return AssertionResult(status == Result::SUCCESS);
}
diff --git a/tv/tuner/1.0/vts/functional/FilterTests.h b/tv/tuner/1.0/vts/functional/FilterTests.h
index a76a6b9..75c59b3 100644
--- a/tv/tuner/1.0/vts/functional/FilterTests.h
+++ b/tv/tuner/1.0/vts/functional/FilterTests.h
@@ -157,7 +157,7 @@
AssertionResult getTimeStamp();
AssertionResult getNewlyOpenedFilterId(uint32_t& filterId);
AssertionResult configFilter(DemuxFilterSettings setting, uint32_t filterId);
- AssertionResult getFilterMQDescriptor(uint32_t filterId);
+ AssertionResult getFilterMQDescriptor(uint32_t filterId, bool getMqDesc);
AssertionResult setFilterDataSource(uint32_t sourceFilterId, uint32_t sinkFilterId);
AssertionResult setFilterDataSourceToDemux(uint32_t filterId);
AssertionResult startFilter(uint32_t filterId);
diff --git a/tv/tuner/1.0/vts/functional/VtsHalTvTunerV1_0TargetTest.cpp b/tv/tuner/1.0/vts/functional/VtsHalTvTunerV1_0TargetTest.cpp
index 2be68b8..22ba271 100644
--- a/tv/tuner/1.0/vts/functional/VtsHalTvTunerV1_0TargetTest.cpp
+++ b/tv/tuner/1.0/vts/functional/VtsHalTvTunerV1_0TargetTest.cpp
@@ -48,7 +48,7 @@
ASSERT_TRUE(mFilterTests.openFilterInDemux(filterConf.type, filterConf.bufferSize));
ASSERT_TRUE(mFilterTests.getNewlyOpenedFilterId(filterId));
ASSERT_TRUE(mFilterTests.configFilter(filterConf.settings, filterId));
- ASSERT_TRUE(mFilterTests.getFilterMQDescriptor(filterId));
+ ASSERT_TRUE(mFilterTests.getFilterMQDescriptor(filterId, filterConf.getMqDesc));
ASSERT_TRUE(mFilterTests.startFilter(filterId));
ASSERT_TRUE(mFilterTests.stopFilter(filterId));
ASSERT_TRUE(mFilterTests.closeFilter(filterId));
@@ -75,6 +75,9 @@
void TunerBroadcastHidlTest::broadcastSingleFilterTest(FilterConfig filterConf,
FrontendConfig frontendConf) {
+ if (!frontendConf.enable) {
+ return;
+ }
uint32_t feId;
uint32_t demuxId;
sp<IDemux> demux;
@@ -99,7 +102,7 @@
ASSERT_TRUE(mFilterTests.openFilterInDemux(filterConf.type, filterConf.bufferSize));
ASSERT_TRUE(mFilterTests.getNewlyOpenedFilterId(filterId));
ASSERT_TRUE(mFilterTests.configFilter(filterConf.settings, filterId));
- ASSERT_TRUE(mFilterTests.getFilterMQDescriptor(filterId));
+ ASSERT_TRUE(mFilterTests.getFilterMQDescriptor(filterId, filterConf.getMqDesc));
ASSERT_TRUE(mFilterTests.startFilter(filterId));
// tune test
ASSERT_TRUE(mFrontendTests.tuneFrontend(frontendConf, true /*testWithDemux*/));
@@ -145,7 +148,7 @@
ASSERT_TRUE(mFilterTests.openFilterInDemux(filterConf.type, filterConf.bufferSize));
ASSERT_TRUE(mFilterTests.getNewlyOpenedFilterId(filterId));
ASSERT_TRUE(mFilterTests.configFilter(filterConf.settings, filterId));
- ASSERT_TRUE(mFilterTests.getFilterMQDescriptor(filterId));
+ ASSERT_TRUE(mFilterTests.getFilterMQDescriptor(filterId, filterConf.getMqDesc));
mDvrTests.startPlaybackInputThread(dvrConf.playbackInputFile, dvrConf.settings.playback());
ASSERT_TRUE(mDvrTests.startDvrPlayback());
ASSERT_TRUE(mFilterTests.startFilter(filterId));
@@ -160,6 +163,9 @@
void TunerRecordHidlTest::recordSingleFilterTest(FilterConfig filterConf,
FrontendConfig frontendConf, DvrConfig dvrConf) {
+ if (!frontendConf.enable) {
+ return;
+ }
uint32_t feId;
uint32_t demuxId;
sp<IDemux> demux;
@@ -184,7 +190,7 @@
ASSERT_TRUE(mFilterTests.openFilterInDemux(filterConf.type, filterConf.bufferSize));
ASSERT_TRUE(mFilterTests.getNewlyOpenedFilterId(filterId));
ASSERT_TRUE(mFilterTests.configFilter(filterConf.settings, filterId));
- ASSERT_TRUE(mFilterTests.getFilterMQDescriptor(filterId));
+ ASSERT_TRUE(mFilterTests.getFilterMQDescriptor(filterId, filterConf.getMqDesc));
filter = mFilterTests.getFilterById(filterId);
ASSERT_TRUE(filter != nullptr);
mDvrTests.startRecordOutputThread(dvrConf.settings.record());
@@ -247,7 +253,7 @@
ASSERT_TRUE(mFilterTests.openFilterInDemux(filterConf.type, filterConf.bufferSize));
ASSERT_TRUE(mFilterTests.getNewlyOpenedFilterId(filterId));
ASSERT_TRUE(mFilterTests.configFilter(filterConf.settings, filterId));
- ASSERT_TRUE(mFilterTests.getFilterMQDescriptor(filterId));
+ ASSERT_TRUE(mFilterTests.getFilterMQDescriptor(filterId, filterConf.getMqDesc));
filter = mFilterTests.getFilterById(filterId);
ASSERT_TRUE(filter != nullptr);
ASSERT_TRUE(mDvrTests.attachFilterToDvr(filter));
@@ -265,6 +271,9 @@
void TunerDescramblerHidlTest::scrambledBroadcastTest(set<struct FilterConfig> mediaFilterConfs,
FrontendConfig frontendConf,
DescramblerConfig descConfig) {
+ if (!frontendConf.enable) {
+ return;
+ }
uint32_t feId;
uint32_t demuxId;
sp<IDemux> demux;
@@ -328,17 +337,17 @@
TEST_P(TunerFrontendHidlTest, TuneFrontend) {
description("Tune one Frontend with specific setting and check Lock event");
- mFrontendTests.tuneTest(frontendArray[DVBT]);
+ mFrontendTests.tuneTest(frontendArray[defaultFrontend]);
}
TEST_P(TunerFrontendHidlTest, AutoScanFrontend) {
description("Run an auto frontend scan with specific setting and check lock scanMessage");
- mFrontendTests.scanTest(frontendScanArray[SCAN_DVBT], FrontendScanType::SCAN_AUTO);
+ mFrontendTests.scanTest(frontendScanArray[defaultScanFrontend], FrontendScanType::SCAN_AUTO);
}
TEST_P(TunerFrontendHidlTest, BlindScanFrontend) {
description("Run an blind frontend scan with specific setting and check lock scanMessage");
- mFrontendTests.scanTest(frontendScanArray[SCAN_DVBT], FrontendScanType::SCAN_BLIND);
+ mFrontendTests.scanTest(frontendScanArray[defaultScanFrontend], FrontendScanType::SCAN_BLIND);
}
TEST_P(TunerLnbHidlTest, OpenLnbByName) {
@@ -374,7 +383,7 @@
uint32_t feId;
uint32_t demuxId;
sp<IDemux> demux;
- mFrontendTests.getFrontendIdByType(frontendArray[DVBT].type, feId);
+ mFrontendTests.getFrontendIdByType(frontendArray[defaultFrontend].type, feId);
ASSERT_TRUE(feId != INVALID_ID);
ASSERT_TRUE(mFrontendTests.openFrontendById(feId));
ASSERT_TRUE(mFrontendTests.setFrontendCallback());
@@ -394,7 +403,7 @@
uint32_t avSyncHwId;
sp<IFilter> mediaFilter;
- mFrontendTests.getFrontendIdByType(frontendArray[DVBT].type, feId);
+ mFrontendTests.getFrontendIdByType(frontendArray[defaultFrontend].type, feId);
ASSERT_TRUE(feId != INVALID_ID);
ASSERT_TRUE(mFrontendTests.openFrontendById(feId));
ASSERT_TRUE(mFrontendTests.setFrontendCallback());
@@ -422,7 +431,7 @@
TEST_P(TunerFilterHidlTest, StartFilterInDemux) {
description("Open and start a filter in Demux.");
// TODO use paramterized tests
- configSingleFilterInDemuxTest(filterArray[TS_VIDEO0], frontendArray[DVBT]);
+ configSingleFilterInDemuxTest(filterArray[TS_VIDEO0], frontendArray[defaultFrontend]);
}
TEST_P(TunerFilterHidlTest, SetFilterLinkage) {
@@ -463,22 +472,22 @@
TEST_P(TunerBroadcastHidlTest, BroadcastDataFlowVideoFilterTest) {
description("Test Video Filter functionality in Broadcast use case.");
- broadcastSingleFilterTest(filterArray[TS_VIDEO1], frontendArray[DVBT]);
+ broadcastSingleFilterTest(filterArray[TS_VIDEO1], frontendArray[defaultFrontend]);
}
TEST_P(TunerBroadcastHidlTest, BroadcastDataFlowAudioFilterTest) {
description("Test Audio Filter functionality in Broadcast use case.");
- broadcastSingleFilterTest(filterArray[TS_AUDIO0], frontendArray[DVBT]);
+ broadcastSingleFilterTest(filterArray[TS_AUDIO0], frontendArray[defaultFrontend]);
}
TEST_P(TunerBroadcastHidlTest, BroadcastDataFlowSectionFilterTest) {
description("Test Section Filter functionality in Broadcast use case.");
- broadcastSingleFilterTest(filterArray[TS_SECTION0], frontendArray[DVBT]);
+ broadcastSingleFilterTest(filterArray[TS_SECTION0], frontendArray[defaultFrontend]);
}
TEST_P(TunerBroadcastHidlTest, IonBufferTest) {
description("Test the av filter data bufferring.");
- broadcastSingleFilterTest(filterArray[TS_VIDEO0], frontendArray[DVBT]);
+ broadcastSingleFilterTest(filterArray[TS_VIDEO0], frontendArray[defaultFrontend]);
}
TEST_P(TunerBroadcastHidlTest, LnbBroadcastDataFlowVideoFilterTest) {
@@ -494,13 +503,14 @@
TEST_P(TunerRecordHidlTest, AttachFiltersToRecordTest) {
description("Attach a single filter to the record dvr test.");
// TODO use paramterized tests
- attachSingleFilterToRecordDvrTest(filterArray[TS_RECORD0], frontendArray[DVBT],
+ attachSingleFilterToRecordDvrTest(filterArray[TS_RECORD0], frontendArray[defaultFrontend],
dvrArray[DVR_RECORD0]);
}
TEST_P(TunerRecordHidlTest, RecordDataFlowWithTsRecordFilterTest) {
description("Feed ts data from frontend to recording and test with ts record filter");
- recordSingleFilterTest(filterArray[TS_RECORD0], frontendArray[DVBT], dvrArray[DVR_RECORD0]);
+ recordSingleFilterTest(filterArray[TS_RECORD0], frontendArray[defaultFrontend],
+ dvrArray[DVR_RECORD0]);
}
TEST_P(TunerRecordHidlTest, LnbRecordDataFlowWithTsRecordFilterTest) {
@@ -513,7 +523,7 @@
uint32_t feId;
uint32_t demuxId;
sp<IDemux> demux;
- mFrontendTests.getFrontendIdByType(frontendArray[DVBT].type, feId);
+ mFrontendTests.getFrontendIdByType(frontendArray[defaultFrontend].type, feId);
ASSERT_TRUE(feId != INVALID_ID);
ASSERT_TRUE(mFrontendTests.openFrontendById(feId));
ASSERT_TRUE(mFrontendTests.setFrontendCallback());
@@ -530,7 +540,7 @@
set<FilterConfig> filterConfs;
filterConfs.insert(filterArray[TS_AUDIO0]);
filterConfs.insert(filterArray[TS_VIDEO1]);
- scrambledBroadcastTest(filterConfs, frontendArray[DVBT], descramblerArray[DESC_0]);
+ scrambledBroadcastTest(filterConfs, frontendArray[defaultFrontend], descramblerArray[DESC_0]);
}
INSTANTIATE_TEST_SUITE_P(
diff --git a/tv/tuner/1.0/vts/functional/VtsHalTvTunerV1_0TestConfigurations.h b/tv/tuner/1.0/vts/functional/VtsHalTvTunerV1_0TestConfigurations.h
index 6c68e35..92a8130 100644
--- a/tv/tuner/1.0/vts/functional/VtsHalTvTunerV1_0TestConfigurations.h
+++ b/tv/tuner/1.0/vts/functional/VtsHalTvTunerV1_0TestConfigurations.h
@@ -55,6 +55,7 @@
using namespace std;
+const uint32_t FMQ_SIZE_512K = 0x80000;
const uint32_t FMQ_SIZE_1M = 0x100000;
const uint32_t FMQ_SIZE_4M = 0x400000;
const uint32_t FMQ_SIZE_16M = 0x1000000;
@@ -134,6 +135,7 @@
uint32_t bufferSize;
DemuxFilterType type;
DemuxFilterSettings settings;
+ bool getMqDesc;
bool operator<(const FilterConfig& /*c*/) const { return false; }
};
@@ -144,6 +146,7 @@
};
struct FrontendConfig {
+ bool enable;
bool isSoftwareFe;
FrontendType type;
FrontendSettings settings;
@@ -191,6 +194,8 @@
static DvrConfig dvrArray[DVR_MAX];
static DescramblerConfig descramblerArray[DESC_MAX];
static vector<string> goldenOutputFiles;
+static int defaultFrontend = DVBT;
+static int defaultScanFrontend = SCAN_DVBT;
/** Configuration array for the frontend tune test */
inline void initFrontendConfig() {
@@ -216,7 +221,9 @@
frontendArray[DVBT].tuneStatusTypes = types;
frontendArray[DVBT].expectTuneStatuses = statuses;
frontendArray[DVBT].isSoftwareFe = true;
+ frontendArray[DVBS].enable = true;
frontendArray[DVBS].type = FrontendType::DVBS;
+ frontendArray[DVBS].enable = true;
frontendArray[DVBS].isSoftwareFe = true;
};
@@ -283,6 +290,7 @@
.isRaw = false,
.streamId = 0xbd,
});
+ filterArray[TS_PES0].getMqDesc = true;
// TS PCR filter setting
filterArray[TS_PCR0].type.mainType = DemuxFilterMainType::TS;
filterArray[TS_PCR0].type.subType.tsFilterType(DemuxTsFilterType::PCR);
@@ -303,6 +311,7 @@
filterArray[TS_SECTION0].settings.ts().filterSettings.section({
.isRaw = false,
});
+ filterArray[TS_SECTION0].getMqDesc = true;
// TS RECORD filter setting
filterArray[TS_RECORD0].type.mainType = DemuxFilterMainType::TS;
filterArray[TS_RECORD0].type.subType.tsFilterType(DemuxTsFilterType::RECORD);
diff --git a/weaver/aidl/Android.bp b/weaver/aidl/Android.bp
new file mode 100644
index 0000000..5637e0a
--- /dev/null
+++ b/weaver/aidl/Android.bp
@@ -0,0 +1,16 @@
+aidl_interface {
+ name: "android.hardware.weaver",
+ vendor_available: true,
+ srcs: ["android/hardware/weaver/*.aidl"],
+ stability: "vintf",
+ backend: {
+ java: {
+ platform_apis: true,
+ },
+ ndk: {
+ vndk: {
+ enabled: true,
+ },
+ },
+ },
+}
diff --git a/weaver/aidl/aidl_api/android.hardware.weaver/current/android/hardware/weaver/IWeaver.aidl b/weaver/aidl/aidl_api/android.hardware.weaver/current/android/hardware/weaver/IWeaver.aidl
new file mode 100644
index 0000000..29bd9a9
--- /dev/null
+++ b/weaver/aidl/aidl_api/android.hardware.weaver/current/android/hardware/weaver/IWeaver.aidl
@@ -0,0 +1,42 @@
+/*
+ * Copyright 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ *////////////////////////////////////////////////////////////////////////////////
+// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
+///////////////////////////////////////////////////////////////////////////////
+
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
+//
+// You must not make a backward incompatible change to any AIDL file built
+// with the aidl_interface module type with versions property set. The module
+// type is used to build AIDL files in a way that they can be used across
+// independently updatable components of the system. If a device is shipped
+// with such a backward incompatible change, it has a high risk of breaking
+// later when a module using the interface is updated, e.g., Mainline modules.
+
+package android.hardware.weaver;
+@VintfStability
+interface IWeaver {
+ android.hardware.weaver.WeaverConfig getConfig();
+ android.hardware.weaver.WeaverReadResponse read(in int slotId, in byte[] key);
+ void write(in int slotId, in byte[] key, in byte[] value);
+ const int STATUS_FAILED = 1;
+ const int INCORRECT_KEY = 2;
+ const int THROTTLE = 3;
+}
diff --git a/weaver/aidl/aidl_api/android.hardware.weaver/current/android/hardware/weaver/WeaverConfig.aidl b/weaver/aidl/aidl_api/android.hardware.weaver/current/android/hardware/weaver/WeaverConfig.aidl
new file mode 100644
index 0000000..239cdac
--- /dev/null
+++ b/weaver/aidl/aidl_api/android.hardware.weaver/current/android/hardware/weaver/WeaverConfig.aidl
@@ -0,0 +1,39 @@
+/*
+ * Copyright 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ *////////////////////////////////////////////////////////////////////////////////
+// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
+///////////////////////////////////////////////////////////////////////////////
+
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
+//
+// You must not make a backward incompatible change to any AIDL file built
+// with the aidl_interface module type with versions property set. The module
+// type is used to build AIDL files in a way that they can be used across
+// independently updatable components of the system. If a device is shipped
+// with such a backward incompatible change, it has a high risk of breaking
+// later when a module using the interface is updated, e.g., Mainline modules.
+
+package android.hardware.weaver;
+@VintfStability
+parcelable WeaverConfig {
+ long slots;
+ long keySize;
+ long valueSize;
+}
diff --git a/weaver/aidl/aidl_api/android.hardware.weaver/current/android/hardware/weaver/WeaverReadResponse.aidl b/weaver/aidl/aidl_api/android.hardware.weaver/current/android/hardware/weaver/WeaverReadResponse.aidl
new file mode 100644
index 0000000..7e5db59
--- /dev/null
+++ b/weaver/aidl/aidl_api/android.hardware.weaver/current/android/hardware/weaver/WeaverReadResponse.aidl
@@ -0,0 +1,38 @@
+/*
+ * Copyright 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ *////////////////////////////////////////////////////////////////////////////////
+// THIS FILE IS IMMUTABLE. DO NOT EDIT IN ANY CASE. //
+///////////////////////////////////////////////////////////////////////////////
+
+// This file is a snapshot of an AIDL file. Do not edit it manually. There are
+// two cases:
+// 1). this is a frozen version file - do not edit this in any case.
+// 2). this is a 'current' file. If you make a backwards compatible change to
+// the interface (from the latest frozen version), the build system will
+// prompt you to update this file with `m <name>-update-api`.
+//
+// You must not make a backward incompatible change to any AIDL file built
+// with the aidl_interface module type with versions property set. The module
+// type is used to build AIDL files in a way that they can be used across
+// independently updatable components of the system. If a device is shipped
+// with such a backward incompatible change, it has a high risk of breaking
+// later when a module using the interface is updated, e.g., Mainline modules.
+
+package android.hardware.weaver;
+@VintfStability
+parcelable WeaverReadResponse {
+ long timeout;
+ byte[] value;
+}
diff --git a/weaver/aidl/android/hardware/weaver/IWeaver.aidl b/weaver/aidl/android/hardware/weaver/IWeaver.aidl
new file mode 100644
index 0000000..ebbfabe
--- /dev/null
+++ b/weaver/aidl/android/hardware/weaver/IWeaver.aidl
@@ -0,0 +1,94 @@
+/*
+ * Copyright 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.hardware.weaver;
+
+import android.hardware.weaver.WeaverConfig;
+import android.hardware.weaver.WeaverReadResponse;
+
+/**
+ * Weaver provides secure storage of secret values that may only be read if the
+ * corresponding key has been presented.
+ *
+ * The storage must be secure as the device's user authentication and encryption
+ * relies on the security of these values. The cardinality of the domains of the
+ * key and value must be suitably large such that they cannot be easily guessed.
+ *
+ * Weaver is structured as an array of slots, each containing a key-value pair.
+ * Slots are uniquely identified by an ID in the range [0, `getConfig().slots`).
+ */
+@VintfStability
+interface IWeaver {
+ /**
+ * Retrieves the config information for this implementation of Weaver.
+ *
+ * The config is static i.e. every invocation returns the same information.
+ *
+ * @return config data for this implementation of Weaver if status is OK,
+ * otherwise undefined.
+ */
+ WeaverConfig getConfig();
+
+ /**
+ * Read binder calls may return a ServiceSpecificException with the following error codes.
+ */
+ const int STATUS_FAILED = 1;
+ const int INCORRECT_KEY = 2;
+ const int THROTTLE = 3;
+
+ /**
+ * Attempts to retrieve the value stored in the identified slot.
+ *
+ * The value is only returned if the provided key matches the key stored in
+ * the slot. The value is never returned if the wrong key is provided.
+ *
+ * Throttling must be used to limit the frequency of failed read attempts.
+ * The value is only returned when throttling is not active, even if the
+ * correct key is provided. If called when throttling is active, the time
+ * until the next attempt can be made is returned.
+ *
+ * Service status return:
+ *
+ * OK if the value was successfully read from slot.
+ * INCORRECT_KEY if the key does not match the key in the slot.
+ * THROTTLE if throttling is active.
+ * STATUS_FAILED if the read was unsuccessful for another reason.
+ *
+ * @param slotId of the slot to read from, this must be positive to be valid.
+ * @param key that is stored in the slot.
+ * @return The WeaverReadResponse for this read request. If the status is OK,
+ * value is set to the value in the slot and timeout is 0. Otherwise, value is
+ * empty and timeout is set accordingly.
+ */
+ WeaverReadResponse read(in int slotId, in byte[] key);
+
+ /**
+ * Overwrites the identified slot with the provided key and value.
+ *
+ * The new values are written regardless of the current state of the slot in
+ * order to remain idempotent.
+ *
+ * Service status return:
+ *
+ * OK if the write was successfully completed.
+ * FAILED if the write was unsuccessful.
+ *
+ * @param slotId of the slot to write to.
+ * @param key to write to the slot.
+ * @param value to write to slot.
+ */
+ void write(in int slotId, in byte[] key, in byte[] value);
+}
diff --git a/health/1.0/default/libhealthd/healthd_board_default.cpp b/weaver/aidl/android/hardware/weaver/WeaverConfig.aidl
similarity index 61%
copy from health/1.0/default/libhealthd/healthd_board_default.cpp
copy to weaver/aidl/android/hardware/weaver/WeaverConfig.aidl
index 127f98e..75d961e 100644
--- a/health/1.0/default/libhealthd/healthd_board_default.cpp
+++ b/weaver/aidl/android/hardware/weaver/WeaverConfig.aidl
@@ -1,5 +1,5 @@
/*
- * Copyright (C) 2013 The Android Open Source Project
+ * Copyright 2020 The Android Open Source Project
*
* Licensed under the Apache License, Version 2.0 (the "License");
* you may not use this file except in compliance with the License.
@@ -14,15 +14,21 @@
* limitations under the License.
*/
-#include <healthd/healthd.h>
+package android.hardware.weaver;
-void healthd_board_init(struct healthd_config*)
-{
- // use defaults
+@VintfStability
+parcelable WeaverConfig {
+ /**
+ * The number of slots available.
+ */
+ long slots;
+ /**
+ * The number of bytes used for a key.
+ */
+ long keySize;
+ /**
+ * The number of bytes used for a value.
+ */
+ long valueSize;
}
-int healthd_board_battery_update(struct android::BatteryProperties*)
-{
- // return 0 to log periodic polled battery status to kernel log
- return 0;
-}
diff --git a/health/1.0/default/libhealthd/healthd_board_default.cpp b/weaver/aidl/android/hardware/weaver/WeaverReadResponse.aidl
similarity index 61%
copy from health/1.0/default/libhealthd/healthd_board_default.cpp
copy to weaver/aidl/android/hardware/weaver/WeaverReadResponse.aidl
index 127f98e..ec006e8 100644
--- a/health/1.0/default/libhealthd/healthd_board_default.cpp
+++ b/weaver/aidl/android/hardware/weaver/WeaverReadResponse.aidl
@@ -1,5 +1,5 @@
/*
- * Copyright (C) 2013 The Android Open Source Project
+ * Copyright 2020 The Android Open Source Project
*
* Licensed under the Apache License, Version 2.0 (the "License");
* you may not use this file except in compliance with the License.
@@ -14,15 +14,17 @@
* limitations under the License.
*/
-#include <healthd/healthd.h>
+package android.hardware.weaver;
-void healthd_board_init(struct healthd_config*)
-{
- // use defaults
+@VintfStability
+parcelable WeaverReadResponse {
+ /**
+ * The time to wait, in milliseconds, before making the next request.
+ */
+ long timeout;
+ /**
+ * The value read from the slot or empty if the value was not read.
+ */
+ byte[] value;
}
-int healthd_board_battery_update(struct android::BatteryProperties*)
-{
- // return 0 to log periodic polled battery status to kernel log
- return 0;
-}
diff --git a/weaver/aidl/default/Android.bp b/weaver/aidl/default/Android.bp
new file mode 100644
index 0000000..d936828
--- /dev/null
+++ b/weaver/aidl/default/Android.bp
@@ -0,0 +1,32 @@
+//
+// Copyright (C) 2020 The Android Open Source Project
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+//
+
+cc_binary {
+ name: "android.hardware.weaver-service.example",
+ relative_install_path: "hw",
+ init_rc: ["android.hardware.weaver-service.example.rc"],
+ vintf_fragments: ["android.hardware.weaver-service.example.xml"],
+ vendor: true,
+ srcs: [
+ "service.cpp",
+ "Weaver.cpp",
+ ],
+ shared_libs: [
+ "android.hardware.weaver-ndk_platform",
+ "libbase",
+ "libbinder_ndk",
+ ],
+}
diff --git a/weaver/aidl/default/Weaver.cpp b/weaver/aidl/default/Weaver.cpp
new file mode 100644
index 0000000..56d9c4d
--- /dev/null
+++ b/weaver/aidl/default/Weaver.cpp
@@ -0,0 +1,48 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "Weaver.h"
+
+namespace aidl {
+namespace android {
+namespace hardware {
+namespace weaver {
+
+// Methods from ::android::hardware::weaver::IWeaver follow.
+
+::ndk::ScopedAStatus Weaver::getConfig(WeaverConfig* out_config) {
+ (void)out_config;
+ return ::ndk::ScopedAStatus::ok();
+}
+
+::ndk::ScopedAStatus Weaver::read(int32_t in_slotId, const std::vector<uint8_t>& in_key, WeaverReadResponse* out_response) {
+ (void)in_slotId;
+ (void)in_key;
+ (void)out_response;
+ return ::ndk::ScopedAStatus::ok();
+}
+
+::ndk::ScopedAStatus Weaver::write(int32_t in_slotId, const std::vector<uint8_t>& in_key, const std::vector<uint8_t>& in_value) {
+ (void)in_slotId;
+ (void)in_key;
+ (void)in_value;
+ return ::ndk::ScopedAStatus::ok();
+}
+
+} //namespace weaver
+} //namespace hardware
+} //namespace android
+} //namespace aidl
diff --git a/weaver/aidl/default/Weaver.h b/weaver/aidl/default/Weaver.h
new file mode 100644
index 0000000..b50018e
--- /dev/null
+++ b/weaver/aidl/default/Weaver.h
@@ -0,0 +1,42 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#pragma once
+
+#include <aidl/android/hardware/weaver/BnWeaver.h>
+
+namespace aidl {
+namespace android {
+namespace hardware {
+namespace weaver {
+
+using ::aidl::android::hardware::weaver::WeaverConfig;
+using ::aidl::android::hardware::weaver::WeaverReadResponse;
+
+struct Weaver : public BnWeaver {
+public:
+ Weaver() = default;
+
+ // Methods from ::android::hardware::weaver::IWeaver follow.
+ ::ndk::ScopedAStatus getConfig(WeaverConfig* _aidl_return) override;
+ ::ndk::ScopedAStatus read(int32_t in_slotId, const std::vector<uint8_t>& in_key, WeaverReadResponse* _aidl_return) override;
+ ::ndk::ScopedAStatus write(int32_t in_slotId, const std::vector<uint8_t>& in_key, const std::vector<uint8_t>& in_value) override;
+};
+
+} // namespace weaver
+} // namespace hardware
+} // namespace android
+} // namespace aidl
diff --git a/weaver/aidl/default/android.hardware.weaver-service.example.rc b/weaver/aidl/default/android.hardware.weaver-service.example.rc
new file mode 100644
index 0000000..ec77774
--- /dev/null
+++ b/weaver/aidl/default/android.hardware.weaver-service.example.rc
@@ -0,0 +1,4 @@
+service vendor.weaver_default /vendor/bin/hw/android.hardware.weaver-service.example
+ class hal
+ user hsm
+ group hsm
diff --git a/weaver/aidl/default/android.hardware.weaver-service.example.xml b/weaver/aidl/default/android.hardware.weaver-service.example.xml
new file mode 100644
index 0000000..ed291cd
--- /dev/null
+++ b/weaver/aidl/default/android.hardware.weaver-service.example.xml
@@ -0,0 +1,10 @@
+<manifest version="1.0" type="device">
+ <hal format="aidl">
+ <name>android.hardware.weaver</name>
+ <version>1</version>
+ <interface>
+ <name>IWeaver</name>
+ <instance>default</instance>
+ </interface>
+ </hal>
+</manifest>
diff --git a/weaver/aidl/default/service.cpp b/weaver/aidl/default/service.cpp
new file mode 100644
index 0000000..1495bc9
--- /dev/null
+++ b/weaver/aidl/default/service.cpp
@@ -0,0 +1,35 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <android-base/logging.h>
+#include <android/binder_manager.h>
+#include <android/binder_process.h>
+
+#include "Weaver.h"
+
+using ::aidl::android::hardware::weaver::Weaver;
+
+int main() {
+ ABinderProcess_setThreadPoolMaxThreadCount(0);
+ std::shared_ptr<Weaver> weaver = ndk::SharedRefBase::make<Weaver>();
+
+ const std::string instance = std::string() + Weaver::descriptor + "/default";
+ binder_status_t status = AServiceManager_addService(weaver->asBinder().get(), instance.c_str());
+ CHECK(status == STATUS_OK);
+
+ ABinderProcess_joinThreadPool();
+ return -1; // Should never be reached
+}
diff --git a/weaver/aidl/vts/Android.bp b/weaver/aidl/vts/Android.bp
new file mode 100644
index 0000000..d7e3ab7
--- /dev/null
+++ b/weaver/aidl/vts/Android.bp
@@ -0,0 +1,33 @@
+//
+// Copyright (C) 2020 The Android Open Source Project
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+//
+
+cc_test {
+ name: "VtsHalWeaverTargetTest",
+ defaults: [
+ "VtsHalTargetTestDefaults",
+ "use_libaidlvintf_gtest_helper_static",
+ ],
+ srcs: ["VtsHalWeaverTargetTest.cpp"],
+ shared_libs: [
+ "libbinder_ndk",
+ "libbase",
+ ],
+ static_libs: ["android.hardware.weaver-ndk_platform"],
+ test_suites: [
+ "general-tests",
+ "vts",
+ ],
+}
diff --git a/weaver/aidl/vts/OWNERS b/weaver/aidl/vts/OWNERS
new file mode 100644
index 0000000..40d95e4
--- /dev/null
+++ b/weaver/aidl/vts/OWNERS
@@ -0,0 +1,2 @@
+chengyouho@google.com
+frankwoo@google.com
diff --git a/weaver/aidl/vts/VtsHalWeaverTargetTest.cpp b/weaver/aidl/vts/VtsHalWeaverTargetTest.cpp
new file mode 100644
index 0000000..7d8daa2
--- /dev/null
+++ b/weaver/aidl/vts/VtsHalWeaverTargetTest.cpp
@@ -0,0 +1,277 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include <aidl/Gtest.h>
+#include <aidl/Vintf.h>
+
+#include <aidl/android/hardware/weaver/IWeaver.h>
+#include <android/binder_manager.h>
+#include <android/binder_process.h>
+
+#include <limits>
+
+using ::aidl::android::hardware::weaver::IWeaver;
+using ::aidl::android::hardware::weaver::WeaverConfig;
+using ::aidl::android::hardware::weaver::WeaverReadResponse;
+
+using ::ndk::SpAIBinder;
+
+const std::vector<uint8_t> KEY{1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16};
+const std::vector<uint8_t> WRONG_KEY{0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0};
+const std::vector<uint8_t> VALUE{16, 15, 14, 13, 12, 11, 10, 9, 8, 7, 6, 5, 4, 3, 2, 1};
+const std::vector<uint8_t> OTHER_VALUE{0, 1, 1, 2, 3, 5, 8, 13, 21, 34, 55, 89, 144, 233, 255, 255};
+
+struct WeaverAidlTest : public ::testing::TestWithParam<std::string> {
+ virtual void SetUp() override {
+ weaver = IWeaver::fromBinder(
+ SpAIBinder(AServiceManager_waitForService(GetParam().c_str())));
+ ASSERT_NE(weaver, nullptr);
+ }
+
+ virtual void TearDown() override {}
+
+ std::shared_ptr<IWeaver> weaver;
+};
+
+/*
+ * Checks config values are suitably large
+ */
+TEST_P(WeaverAidlTest, GetConfig) {
+ WeaverConfig config;
+
+ auto ret = weaver->getConfig(&config);
+
+ ASSERT_TRUE(ret.isOk());
+
+ EXPECT_GE(config.slots, 16u);
+ EXPECT_GE(config.keySize, 16u);
+ EXPECT_GE(config.valueSize, 16u);
+}
+
+/*
+ * Gets the config twice and checks they are the same
+ */
+TEST_P(WeaverAidlTest, GettingConfigMultipleTimesGivesSameResult) {
+ WeaverConfig config1;
+ WeaverConfig config2;
+
+ auto ret = weaver->getConfig(&config1);
+ ASSERT_TRUE(ret.isOk());
+
+ ret = weaver->getConfig(&config2);
+ ASSERT_TRUE(ret.isOk());
+
+ EXPECT_EQ(config1, config2);
+}
+
+/*
+ * Gets the number of slots from the config and writes a key and value to the last one
+ */
+TEST_P(WeaverAidlTest, WriteToLastSlot) {
+ WeaverConfig config;
+ const auto configRet = weaver->getConfig(&config);
+
+ ASSERT_TRUE(configRet.isOk());
+
+ const uint32_t lastSlot = config.slots - 1;
+ const auto writeRet = weaver->write(lastSlot, KEY, VALUE);
+ ASSERT_TRUE(writeRet.isOk());
+}
+
+/*
+ * Writes a key and value to a slot
+ * Reads the slot with the same key and receives the value that was previously written
+ */
+TEST_P(WeaverAidlTest, WriteFollowedByReadGivesTheSameValue) {
+ constexpr uint32_t slotId = 0;
+ const auto ret = weaver->write(slotId, KEY, VALUE);
+ ASSERT_TRUE(ret.isOk());
+
+ WeaverReadResponse response;
+ std::vector<uint8_t> readValue;
+ uint32_t timeout;
+ const auto readRet = weaver->read(slotId, KEY, &response);
+
+ readValue = response.value;
+ timeout = response.timeout;
+
+ ASSERT_TRUE(readRet.isOk());
+ EXPECT_EQ(readValue, VALUE);
+ EXPECT_EQ(timeout, 0u);
+}
+
+/*
+ * Writes a key and value to a slot
+ * Overwrites the slot with a new key and value
+ * Reads the slot with the new key and receives the new value
+ */
+TEST_P(WeaverAidlTest, OverwritingSlotUpdatesTheValue) {
+ constexpr uint32_t slotId = 0;
+ const auto initialWriteRet = weaver->write(slotId, WRONG_KEY, VALUE);
+ ASSERT_TRUE(initialWriteRet.isOk());
+
+ const auto overwriteRet = weaver->write(slotId, KEY, OTHER_VALUE);
+ ASSERT_TRUE(overwriteRet.isOk());
+
+ WeaverReadResponse response;
+ std::vector<uint8_t> readValue;
+ uint32_t timeout;
+ const auto readRet = weaver->read(slotId, KEY, &response);
+
+ readValue = response.value;
+ timeout = response.timeout;
+
+ ASSERT_TRUE(readRet.isOk());
+ EXPECT_EQ(readValue, OTHER_VALUE);
+ EXPECT_EQ(timeout, 0u);
+}
+
+/*
+ * Writes a key and value to a slot
+ * Reads the slot with a different key so does not receive the value
+ */
+TEST_P(WeaverAidlTest, WriteFollowedByReadWithWrongKeyDoesNotGiveTheValue) {
+ constexpr uint32_t slotId = 0;
+ const auto ret = weaver->write(slotId, KEY, VALUE);
+ ASSERT_TRUE(ret.isOk());
+
+ WeaverReadResponse response;
+ std::vector<uint8_t> readValue;
+ const auto readRet =
+ weaver->read(slotId, WRONG_KEY, &response);
+
+ readValue = response.value;
+
+ ASSERT_FALSE(readRet.isOk());
+ ASSERT_EQ(EX_SERVICE_SPECIFIC, readRet.getExceptionCode());
+ ASSERT_EQ(IWeaver::INCORRECT_KEY, readRet.getServiceSpecificError());
+ EXPECT_TRUE(readValue.empty());
+}
+
+/*
+ * Writing to an invalid slot fails
+ */
+TEST_P(WeaverAidlTest, WritingToInvalidSlotFails) {
+ WeaverConfig config;
+ const auto configRet = weaver->getConfig(&config);
+ ASSERT_TRUE(configRet.isOk());
+
+ if (config.slots == std::numeric_limits<uint32_t>::max()) {
+ // If there are no invalid slots then pass
+ return;
+ }
+
+ const auto writeRet = weaver->write(config.slots, KEY, VALUE);
+ ASSERT_FALSE(writeRet.isOk());
+}
+
+/*
+ * Reading from an invalid slot fails rather than incorrect key
+ */
+TEST_P(WeaverAidlTest, ReadingFromInvalidSlotFails) {
+ WeaverConfig config;
+ const auto configRet = weaver->getConfig(&config);
+ ASSERT_TRUE(configRet.isOk());
+
+ if (config.slots == std::numeric_limits<uint32_t>::max()) {
+ // If there are no invalid slots then pass
+ return;
+ }
+
+ WeaverReadResponse response;
+ std::vector<uint8_t> readValue;
+ uint32_t timeout;
+ const auto readRet =
+ weaver->read(config.slots, KEY, &response);
+
+ readValue = response.value;
+ timeout = response.timeout;
+
+ ASSERT_FALSE(readRet.isOk());
+ ASSERT_EQ(EX_SERVICE_SPECIFIC, readRet.getExceptionCode());
+ ASSERT_EQ(IWeaver::STATUS_FAILED, readRet.getServiceSpecificError());
+ EXPECT_TRUE(readValue.empty());
+ EXPECT_EQ(timeout, 0u);
+}
+
+/*
+ * Writing a key that is too large fails
+ */
+TEST_P(WeaverAidlTest, WriteWithTooLargeKeyFails) {
+ WeaverConfig config;
+ const auto configRet = weaver->getConfig(&config);
+ ASSERT_TRUE(configRet.isOk());
+
+ std::vector<uint8_t> bigKey(config.keySize + 1);
+
+ constexpr uint32_t slotId = 0;
+ const auto writeRet = weaver->write(slotId, bigKey, VALUE);
+ ASSERT_FALSE(writeRet.isOk());
+}
+
+/*
+ * Writing a value that is too large fails
+ */
+TEST_P(WeaverAidlTest, WriteWithTooLargeValueFails) {
+ WeaverConfig config;
+ const auto configRet = weaver->getConfig(&config);
+ ASSERT_TRUE(configRet.isOk());
+
+ std::vector<uint8_t> bigValue(config.valueSize + 1);
+
+ constexpr uint32_t slotId = 0;
+ const auto writeRet = weaver->write(slotId, KEY, bigValue);
+ ASSERT_FALSE(writeRet.isOk());
+}
+
+/*
+ * Reading with a key that is loo large fails
+ */
+TEST_P(WeaverAidlTest, ReadWithTooLargeKeyFails) {
+ WeaverConfig config;
+ const auto configRet = weaver->getConfig(&config);
+ ASSERT_TRUE(configRet.isOk());
+
+ std::vector<uint8_t> bigKey(config.keySize + 1);
+
+ constexpr uint32_t slotId = 0;
+ WeaverReadResponse response;
+ std::vector<uint8_t> readValue;
+ uint32_t timeout;
+ const auto readRet =
+ weaver->read(slotId, bigKey, &response);
+
+ readValue = response.value;
+ timeout = response.timeout;
+
+ ASSERT_FALSE(readRet.isOk());
+ ASSERT_EQ(EX_SERVICE_SPECIFIC, readRet.getExceptionCode());
+ ASSERT_EQ(IWeaver::STATUS_FAILED, readRet.getServiceSpecificError());
+ EXPECT_TRUE(readValue.empty());
+ EXPECT_EQ(timeout, 0u);
+}
+
+GTEST_ALLOW_UNINSTANTIATED_PARAMETERIZED_TEST(WeaverAidlTest);
+INSTANTIATE_TEST_SUITE_P(
+ PerInstance, WeaverAidlTest,
+ testing::ValuesIn(android::getAidlHalInstanceNames(IWeaver::descriptor)),
+ android::PrintInstanceNameToString);
+
+int main(int argc, char** argv) {
+ ::testing::InitGoogleTest(&argc, argv);
+ ABinderProcess_setThreadPoolMaxThreadCount(1);
+ ABinderProcess_startThreadPool();
+ return RUN_ALL_TESTS();
+}
diff --git a/wifi/1.4/default/wifi_legacy_hal.h b/wifi/1.4/default/wifi_legacy_hal.h
index 9964460..822f83a 100644
--- a/wifi/1.4/default/wifi_legacy_hal.h
+++ b/wifi/1.4/default/wifi_legacy_hal.h
@@ -23,15 +23,9 @@
#include <thread>
#include <vector>
+#include <hardware_legacy/wifi_hal.h>
#include <wifi_system/interface_tool.h>
-// HACK: The include inside the namespace below also transitively includes a
-// bunch of libc headers into the namespace, which leads to functions like
-// socketpair being defined in
-// android::hardware::wifi::V1_1::implementation::legacy_hal. Include this one
-// particular header as a hacky workaround until that's fixed.
-#include <sys/socket.h>
-
namespace android {
namespace hardware {
namespace wifi {
@@ -40,9 +34,274 @@
// This is in a separate namespace to prevent typename conflicts between
// the legacy HAL types and the HIDL interface types.
namespace legacy_hal {
-// Wrap all the types defined inside the legacy HAL header files inside this
+// Import all the types defined inside the legacy HAL header files into this
// namespace.
-#include <hardware_legacy/wifi_hal.h>
+using ::FRAME_TYPE_80211_MGMT;
+using ::FRAME_TYPE_ETHERNET_II;
+using ::FRAME_TYPE_UNKNOWN;
+using ::NAN_CHANNEL_24G_BAND;
+using ::NAN_CHANNEL_5G_BAND_HIGH;
+using ::NAN_CHANNEL_5G_BAND_LOW;
+using ::NAN_DISABLE_RANGE_REPORT;
+using ::NAN_DO_NOT_USE_SRF;
+using ::NAN_DP_CHANNEL_NOT_REQUESTED;
+using ::NAN_DP_CONFIG_NO_SECURITY;
+using ::NAN_DP_CONFIG_SECURITY;
+using ::NAN_DP_END;
+using ::NAN_DP_FORCE_CHANNEL_SETUP;
+using ::NAN_DP_INITIATOR_RESPONSE;
+using ::NAN_DP_INTERFACE_CREATE;
+using ::NAN_DP_INTERFACE_DELETE;
+using ::NAN_DP_REQUEST_ACCEPT;
+using ::NAN_DP_REQUEST_CHANNEL_SETUP;
+using ::NAN_DP_REQUEST_REJECT;
+using ::NAN_DP_RESPONDER_RESPONSE;
+using ::NAN_GET_CAPABILITIES;
+using ::NAN_MATCH_ALG_MATCH_CONTINUOUS;
+using ::NAN_MATCH_ALG_MATCH_NEVER;
+using ::NAN_MATCH_ALG_MATCH_ONCE;
+using ::NAN_PUBLISH_TYPE_SOLICITED;
+using ::NAN_PUBLISH_TYPE_UNSOLICITED;
+using ::NAN_PUBLISH_TYPE_UNSOLICITED_SOLICITED;
+using ::NAN_RANGING_AUTO_RESPONSE_DISABLE;
+using ::NAN_RANGING_AUTO_RESPONSE_ENABLE;
+using ::NAN_RANGING_DISABLE;
+using ::NAN_RANGING_ENABLE;
+using ::NAN_RESPONSE_BEACON_SDF_PAYLOAD;
+using ::NAN_RESPONSE_CONFIG;
+using ::NAN_RESPONSE_DISABLED;
+using ::NAN_RESPONSE_ENABLED;
+using ::NAN_RESPONSE_ERROR;
+using ::NAN_RESPONSE_PUBLISH;
+using ::NAN_RESPONSE_PUBLISH_CANCEL;
+using ::NAN_RESPONSE_STATS;
+using ::NAN_RESPONSE_SUBSCRIBE;
+using ::NAN_RESPONSE_SUBSCRIBE_CANCEL;
+using ::NAN_RESPONSE_TCA;
+using ::NAN_RESPONSE_TRANSMIT_FOLLOWUP;
+using ::NAN_SECURITY_KEY_INPUT_PASSPHRASE;
+using ::NAN_SECURITY_KEY_INPUT_PASSPHRASE;
+using ::NAN_SECURITY_KEY_INPUT_PMK;
+using ::NAN_SECURITY_KEY_INPUT_PMK;
+using ::NAN_SERVICE_ACCEPT_POLICY_ALL;
+using ::NAN_SERVICE_ACCEPT_POLICY_NONE;
+using ::NAN_SRF_ATTR_BLOOM_FILTER;
+using ::NAN_SRF_ATTR_PARTIAL_MAC_ADDR;
+using ::NAN_SRF_INCLUDE_DO_NOT_RESPOND;
+using ::NAN_SRF_INCLUDE_RESPOND;
+using ::NAN_SSI_NOT_REQUIRED_IN_MATCH_IND;
+using ::NAN_SSI_REQUIRED_IN_MATCH_IND;
+using ::NAN_STATUS_ALREADY_ENABLED;
+using ::NAN_STATUS_FOLLOWUP_QUEUE_FULL;
+using ::NAN_STATUS_INTERNAL_FAILURE;
+using ::NAN_STATUS_INVALID_NDP_ID;
+using ::NAN_STATUS_INVALID_PARAM;
+using ::NAN_STATUS_INVALID_PUBLISH_SUBSCRIBE_ID;
+using ::NAN_STATUS_INVALID_REQUESTOR_INSTANCE_ID;
+using ::NAN_STATUS_NAN_NOT_ALLOWED;
+using ::NAN_STATUS_NO_OTA_ACK;
+using ::NAN_STATUS_NO_RESOURCE_AVAILABLE;
+using ::NAN_STATUS_PROTOCOL_FAILURE;
+using ::NAN_STATUS_SUCCESS;
+using ::NAN_STATUS_UNSUPPORTED_CONCURRENCY_NAN_DISABLED;
+using ::NAN_SUBSCRIBE_TYPE_ACTIVE;
+using ::NAN_SUBSCRIBE_TYPE_PASSIVE;
+using ::NAN_TRANSMIT_IN_DW;
+using ::NAN_TRANSMIT_IN_FAW;
+using ::NAN_TX_PRIORITY_HIGH;
+using ::NAN_TX_PRIORITY_NORMAL;
+using ::NAN_TX_TYPE_BROADCAST;
+using ::NAN_TX_TYPE_UNICAST;
+using ::NAN_USE_SRF;
+using ::NanBeaconSdfPayloadInd;
+using ::NanCapabilities;
+using ::NanChannelInfo;
+using ::NanConfigRequest;
+using ::NanDataPathChannelCfg;
+using ::NanDataPathConfirmInd;
+using ::NanDataPathEndInd;
+using ::NanDataPathIndicationResponse;
+using ::NanDataPathInitiatorRequest;
+using ::NanDataPathRequestInd;
+using ::NanDataPathScheduleUpdateInd;
+using ::NanDisabledInd;
+using ::NanDiscEngEventInd;
+using ::NanEnableRequest;
+using ::NanFollowupInd;
+using ::NanMatchAlg;
+using ::NanMatchExpiredInd;
+using ::NanMatchInd;
+using ::NanPublishCancelRequest;
+using ::NanPublishRequest;
+using ::NanPublishTerminatedInd;
+using ::NanPublishType;
+using ::NanRangeReportInd;
+using ::NanRangeRequestInd;
+using ::NanResponseMsg;
+using ::NanSRFType;
+using ::NanStatusType;
+using ::NanSubscribeCancelRequest;
+using ::NanSubscribeRequest;
+using ::NanSubscribeTerminatedInd;
+using ::NanSubscribeType;
+using ::NanTransmitFollowupInd;
+using ::NanTransmitFollowupRequest;
+using ::NanTxType;
+using ::ROAMING_DISABLE;
+using ::ROAMING_ENABLE;
+using ::RTT_PEER_AP;
+using ::RTT_PEER_NAN;
+using ::RTT_PEER_P2P_CLIENT;
+using ::RTT_PEER_P2P_GO;
+using ::RTT_PEER_STA;
+using ::RTT_STATUS_ABORTED;
+using ::RTT_STATUS_FAILURE;
+using ::RTT_STATUS_FAIL_AP_ON_DIFF_CHANNEL;
+using ::RTT_STATUS_FAIL_BUSY_TRY_LATER;
+using ::RTT_STATUS_FAIL_FTM_PARAM_OVERRIDE;
+using ::RTT_STATUS_FAIL_INVALID_TS;
+using ::RTT_STATUS_FAIL_NOT_SCHEDULED_YET;
+using ::RTT_STATUS_FAIL_NO_CAPABILITY;
+using ::RTT_STATUS_FAIL_NO_RSP;
+using ::RTT_STATUS_FAIL_PROTOCOL;
+using ::RTT_STATUS_FAIL_REJECTED;
+using ::RTT_STATUS_FAIL_SCHEDULE;
+using ::RTT_STATUS_FAIL_TM_TIMEOUT;
+using ::RTT_STATUS_INVALID_REQ;
+using ::RTT_STATUS_NAN_RANGING_CONCURRENCY_NOT_SUPPORTED;
+using ::RTT_STATUS_NAN_RANGING_PROTOCOL_FAILURE;
+using ::RTT_STATUS_NO_WIFI;
+using ::RTT_STATUS_SUCCESS;
+using ::RTT_TYPE_1_SIDED;
+using ::RTT_TYPE_2_SIDED;
+using ::RX_PKT_FATE_DRV_DROP_FILTER;
+using ::RX_PKT_FATE_DRV_DROP_INVALID;
+using ::RX_PKT_FATE_DRV_DROP_NOBUFS;
+using ::RX_PKT_FATE_DRV_DROP_OTHER;
+using ::RX_PKT_FATE_DRV_QUEUED;
+using ::RX_PKT_FATE_FW_DROP_FILTER;
+using ::RX_PKT_FATE_FW_DROP_INVALID;
+using ::RX_PKT_FATE_FW_DROP_NOBUFS;
+using ::RX_PKT_FATE_FW_DROP_OTHER;
+using ::RX_PKT_FATE_FW_QUEUED;
+using ::RX_PKT_FATE_SUCCESS;
+using ::TX_PKT_FATE_ACKED;
+using ::TX_PKT_FATE_DRV_DROP_INVALID;
+using ::TX_PKT_FATE_DRV_DROP_NOBUFS;
+using ::TX_PKT_FATE_DRV_DROP_OTHER;
+using ::TX_PKT_FATE_DRV_QUEUED;
+using ::TX_PKT_FATE_FW_DROP_INVALID;
+using ::TX_PKT_FATE_FW_DROP_NOBUFS;
+using ::TX_PKT_FATE_FW_DROP_OTHER;
+using ::TX_PKT_FATE_FW_QUEUED;
+using ::TX_PKT_FATE_SENT;
+using ::WIFI_AC_BE;
+using ::WIFI_AC_BK;
+using ::WIFI_AC_VI;
+using ::WIFI_AC_VO;
+using ::WIFI_BAND_A;
+using ::WIFI_BAND_ABG;
+using ::WIFI_BAND_ABG_WITH_DFS;
+using ::WIFI_BAND_A_DFS;
+using ::WIFI_BAND_A_WITH_DFS;
+using ::WIFI_BAND_BG;
+using ::WIFI_BAND_UNSPECIFIED;
+using ::WIFI_CHAN_WIDTH_10;
+using ::WIFI_CHAN_WIDTH_160;
+using ::WIFI_CHAN_WIDTH_20;
+using ::WIFI_CHAN_WIDTH_40;
+using ::WIFI_CHAN_WIDTH_5;
+using ::WIFI_CHAN_WIDTH_5;
+using ::WIFI_CHAN_WIDTH_80;
+using ::WIFI_CHAN_WIDTH_80P80;
+using ::WIFI_CHAN_WIDTH_INVALID;
+using ::WIFI_ERROR_BUSY;
+using ::WIFI_ERROR_INVALID_ARGS;
+using ::WIFI_ERROR_INVALID_REQUEST_ID;
+using ::WIFI_ERROR_NONE;
+using ::WIFI_ERROR_NOT_AVAILABLE;
+using ::WIFI_ERROR_NOT_SUPPORTED;
+using ::WIFI_ERROR_OUT_OF_MEMORY;
+using ::WIFI_ERROR_TIMED_OUT;
+using ::WIFI_ERROR_TOO_MANY_REQUESTS;
+using ::WIFI_ERROR_UNINITIALIZED;
+using ::WIFI_ERROR_UNKNOWN;
+using ::WIFI_INTERFACE_TYPE_AP;
+using ::WIFI_INTERFACE_TYPE_NAN;
+using ::WIFI_INTERFACE_TYPE_P2P;
+using ::WIFI_INTERFACE_TYPE_STA;
+using ::WIFI_LATENCY_MODE_LOW;
+using ::WIFI_LATENCY_MODE_NORMAL;
+using ::WIFI_LOGGER_CONNECT_EVENT_SUPPORTED;
+using ::WIFI_LOGGER_DRIVER_DUMP_SUPPORTED;
+using ::WIFI_LOGGER_MEMORY_DUMP_SUPPORTED;
+using ::WIFI_LOGGER_PACKET_FATE_SUPPORTED;
+using ::WIFI_LOGGER_POWER_EVENT_SUPPORTED;
+using ::WIFI_LOGGER_WAKE_LOCK_SUPPORTED;
+using ::WIFI_MOTION_EXPECTED;
+using ::WIFI_MOTION_NOT_EXPECTED;
+using ::WIFI_MOTION_UNKNOWN;
+using ::WIFI_POWER_SCENARIO_ON_BODY_CELL_OFF;
+using ::WIFI_POWER_SCENARIO_ON_BODY_CELL_ON;
+using ::WIFI_POWER_SCENARIO_ON_HEAD_CELL_OFF;
+using ::WIFI_POWER_SCENARIO_ON_HEAD_CELL_ON;
+using ::WIFI_POWER_SCENARIO_VOICE_CALL;
+using ::WIFI_RTT_BW_10;
+using ::WIFI_RTT_BW_160;
+using ::WIFI_RTT_BW_20;
+using ::WIFI_RTT_BW_40;
+using ::WIFI_RTT_BW_5;
+using ::WIFI_RTT_BW_80;
+using ::WIFI_RTT_PREAMBLE_HE;
+using ::WIFI_RTT_PREAMBLE_HT;
+using ::WIFI_RTT_PREAMBLE_LEGACY;
+using ::WIFI_RTT_PREAMBLE_VHT;
+using ::WIFI_SCAN_FLAG_INTERRUPTED;
+using ::WIFI_SUCCESS;
+using ::WLAN_MAC_2_4_BAND;
+using ::WLAN_MAC_5_0_BAND;
+using ::WLAN_MAC_6_0_BAND;
+using ::frame_info;
+using ::frame_type;
+using ::fw_roaming_state_t;
+using ::mac_addr;
+using ::rtt_peer_type;
+using ::ssid_t;
+using ::transaction_id;
+using ::wifi_band;
+using ::wifi_cached_scan_results;
+using ::wifi_channel_info;
+using ::wifi_channel_stat;
+using ::wifi_channel_width;
+using ::wifi_error;
+using ::wifi_gscan_capabilities;
+using ::wifi_information_element;
+using ::wifi_interface_type;
+using ::wifi_latency_mode;
+using ::wifi_lci_information;
+using ::wifi_lcr_information;
+using ::wifi_motion_pattern;
+using ::wifi_power_scenario;
+using ::wifi_rate;
+using ::wifi_request_id;
+using ::wifi_ring_buffer_status;
+using ::wifi_roaming_capabilities;
+using ::wifi_roaming_config;
+using ::wifi_rtt_bw;
+using ::wifi_rtt_capabilities;
+using ::wifi_rtt_config;
+using ::wifi_rtt_preamble;
+using ::wifi_rtt_responder;
+using ::wifi_rtt_result;
+using ::wifi_rtt_status;
+using ::wifi_rtt_type;
+using ::wifi_rx_packet_fate;
+using ::wifi_rx_report;
+using ::wifi_scan_bucket_spec;
+using ::wifi_scan_cmd_params;
+using ::wifi_scan_result;
+using ::wifi_tx_packet_fate;
+using ::wifi_tx_report;
// APF capabilities supported by the iface.
struct PacketFilterCapabilities {
diff --git a/wifi/1.4/default/wifi_legacy_hal_stubs.h b/wifi/1.4/default/wifi_legacy_hal_stubs.h
index 577a545..c709680 100644
--- a/wifi/1.4/default/wifi_legacy_hal_stubs.h
+++ b/wifi/1.4/default/wifi_legacy_hal_stubs.h
@@ -17,13 +17,14 @@
#ifndef WIFI_LEGACY_HAL_STUBS_H_
#define WIFI_LEGACY_HAL_STUBS_H_
+#include <hardware_legacy/wifi_hal.h>
+
namespace android {
namespace hardware {
namespace wifi {
namespace V1_4 {
namespace implementation {
namespace legacy_hal {
-#include <hardware_legacy/wifi_hal.h>
bool initHalFuncTableWithStubs(wifi_hal_fn* hal_fn);
} // namespace legacy_hal