Merge "Default divider interaction to true if transition doesn't succeed" into main
diff --git a/Android.bp b/Android.bp
index b139b7e..82b844b 100644
--- a/Android.bp
+++ b/Android.bp
@@ -218,6 +218,7 @@
         "apex_aidl_interface-java",
         "packagemanager_aidl-java",
         "framework-protos",
+        "libtombstone_proto_java",
         "updatable-driver-protos",
         "ota_metadata_proto_java",
         "android.hidl.base-V1.0-java",
diff --git a/ProtoLibraries.bp b/ProtoLibraries.bp
index e7adf20..d03bbd2 100644
--- a/ProtoLibraries.bp
+++ b/ProtoLibraries.bp
@@ -34,7 +34,6 @@
         ":ipconnectivity-proto-src",
         ":libstats_atom_enum_protos",
         ":libstats_atom_message_protos",
-        ":libtombstone_proto-src",
         "core/proto/**/*.proto",
         "libs/incident/**/*.proto",
     ],
diff --git a/STABILITY_OWNERS b/STABILITY_OWNERS
new file mode 100644
index 0000000..a7ecb4d
--- /dev/null
+++ b/STABILITY_OWNERS
@@ -0,0 +1,2 @@
+gaillard@google.com
+
diff --git a/TEST_MAPPING b/TEST_MAPPING
index 117faa2..d59775f 100644
--- a/TEST_MAPPING
+++ b/TEST_MAPPING
@@ -132,6 +132,9 @@
     },
     {
       "name": "vts_treble_vintf_vendor_test"
+    },
+    {
+      "name": "CtsStrictJavaPackagesTestCases"
     }
   ],
   "postsubmit-ravenwood": [
diff --git a/apex/jobscheduler/service/java/com/android/server/alarm/AlarmManagerService.java b/apex/jobscheduler/service/java/com/android/server/alarm/AlarmManagerService.java
index 5a32a02..abf8008 100644
--- a/apex/jobscheduler/service/java/com/android/server/alarm/AlarmManagerService.java
+++ b/apex/jobscheduler/service/java/com/android/server/alarm/AlarmManagerService.java
@@ -115,6 +115,7 @@
 import android.os.ShellCallback;
 import android.os.ShellCommand;
 import android.os.SystemClock;
+import android.os.SystemProperties;
 import android.os.ThreadLocalWorkSource;
 import android.os.Trace;
 import android.os.UserHandle;
@@ -229,6 +230,9 @@
 
     private static final long TEMPORARY_QUOTA_DURATION = INTERVAL_DAY;
 
+    // System property read on some device configurations to initialize time properly.
+    private static final String TIMEOFFSET_PROPERTY = "persist.sys.time.offset";
+
     private final Intent mBackgroundIntent
             = new Intent().addFlags(Intent.FLAG_FROM_BACKGROUND);
 
@@ -2142,6 +2146,9 @@
             // "GMT" if the ID is unrecognized). The parameter ID is used here rather than
             // newZone.getId(). It will be rejected if it is invalid.
             timeZoneWasChanged = SystemTimeZone.setTimeZoneId(tzId, confidence, logInfo);
+
+            final int gmtOffset = newZone.getOffset(mInjector.getCurrentTimeMillis());
+            SystemProperties.set(TIMEOFFSET_PROPERTY, String.valueOf(gmtOffset));
         }
 
         // Clear the default time zone in the system server process. This forces the next call
diff --git a/api/StubLibraries.bp b/api/StubLibraries.bp
index 28b2d4b..ef1fa60 100644
--- a/api/StubLibraries.bp
+++ b/api/StubLibraries.bp
@@ -900,10 +900,19 @@
     ],
     api_levels_sdk_type: "system",
     extensions_info_file: ":sdk-extensions-info",
+    dists: [
+        // Make the api-versions.xml file for the system API available in the
+        // sdk build target.
+        {
+            targets: ["sdk"],
+            dest: "api-versions_system.xml",
+            tag: ".api_versions.xml",
+        },
+    ],
 }
 
 // This module can be built with:
-// m out/soong/.intermediates/frameworks/base/api_versions_module_lib/android_common/metalava/api-versions.xml
+// m out/soong/.intermediates/frameworks/base/api/api_versions_module_lib/android_common/metalava/api-versions.xml
 droidstubs {
     name: "api_versions_module_lib",
     srcs: [":android_module_stubs_current_with_test_libs{.jar}"],
diff --git a/core/api/current.txt b/core/api/current.txt
index c7b921c..e0b224e 100644
--- a/core/api/current.txt
+++ b/core/api/current.txt
@@ -102,6 +102,7 @@
     field public static final String FOREGROUND_SERVICE_HEALTH = "android.permission.FOREGROUND_SERVICE_HEALTH";
     field public static final String FOREGROUND_SERVICE_LOCATION = "android.permission.FOREGROUND_SERVICE_LOCATION";
     field public static final String FOREGROUND_SERVICE_MEDIA_PLAYBACK = "android.permission.FOREGROUND_SERVICE_MEDIA_PLAYBACK";
+    field @FlaggedApi("android.content.pm.introduce_media_processing_type") public static final String FOREGROUND_SERVICE_MEDIA_PROCESSING = "android.permission.FOREGROUND_SERVICE_MEDIA_PROCESSING";
     field public static final String FOREGROUND_SERVICE_MEDIA_PROJECTION = "android.permission.FOREGROUND_SERVICE_MEDIA_PROJECTION";
     field public static final String FOREGROUND_SERVICE_MICROPHONE = "android.permission.FOREGROUND_SERVICE_MICROPHONE";
     field public static final String FOREGROUND_SERVICE_PHONE_CALL = "android.permission.FOREGROUND_SERVICE_PHONE_CALL";
@@ -5315,6 +5316,7 @@
     ctor @Deprecated public AutomaticZenRule(String, android.content.ComponentName, android.net.Uri, int, boolean);
     ctor public AutomaticZenRule(@NonNull String, @Nullable android.content.ComponentName, @Nullable android.content.ComponentName, @NonNull android.net.Uri, @Nullable android.service.notification.ZenPolicy, int, boolean);
     ctor public AutomaticZenRule(android.os.Parcel);
+    method @FlaggedApi("android.app.modes_api") public boolean canUpdate();
     method public int describeContents();
     method public android.net.Uri getConditionId();
     method @Nullable public android.content.ComponentName getConfigurationActivity();
@@ -12368,7 +12370,6 @@
 
   public final class ModuleInfo implements android.os.Parcelable {
     method public int describeContents();
-    method @FlaggedApi("android.content.pm.provide_info_of_apk_in_apex") @NonNull public java.util.Collection<java.lang.String> getApkInApexPackageNames();
     method @Nullable public CharSequence getName();
     method @Nullable public String getPackageName();
     method public boolean isHidden();
@@ -12817,7 +12818,7 @@
     method public boolean isPackageSuspended();
     method @CheckResult public abstract boolean isPermissionRevokedByPolicy(@NonNull String, @NonNull String);
     method public abstract boolean isSafeMode();
-    method @FlaggedApi("android.content.pm.get_package_info") @WorkerThread public <T> T parseAndroidManifest(@NonNull String, @NonNull java.util.function.Function<android.content.res.XmlResourceParser,T>) throws java.io.IOException;
+    method @FlaggedApi("android.content.pm.get_package_info") @WorkerThread public <T> T parseAndroidManifest(@NonNull java.io.File, @NonNull java.util.function.Function<android.content.res.XmlResourceParser,T>) throws java.io.IOException;
     method @NonNull public java.util.List<android.content.pm.PackageManager.Property> queryActivityProperty(@NonNull String);
     method @NonNull public java.util.List<android.content.pm.PackageManager.Property> queryApplicationProperty(@NonNull String);
     method @NonNull public abstract java.util.List<android.content.pm.ResolveInfo> queryBroadcastReceivers(@NonNull android.content.Intent, int);
@@ -13287,6 +13288,7 @@
     field @RequiresPermission(allOf={android.Manifest.permission.FOREGROUND_SERVICE_LOCATION}, anyOf={android.Manifest.permission.ACCESS_COARSE_LOCATION, android.Manifest.permission.ACCESS_FINE_LOCATION}, conditional=true) public static final int FOREGROUND_SERVICE_TYPE_LOCATION = 8; // 0x8
     field public static final int FOREGROUND_SERVICE_TYPE_MANIFEST = -1; // 0xffffffff
     field @RequiresPermission(value=android.Manifest.permission.FOREGROUND_SERVICE_MEDIA_PLAYBACK, conditional=true) public static final int FOREGROUND_SERVICE_TYPE_MEDIA_PLAYBACK = 2; // 0x2
+    field @FlaggedApi("android.content.pm.introduce_media_processing_type") @RequiresPermission(android.Manifest.permission.FOREGROUND_SERVICE_MEDIA_PROCESSING) public static final int FOREGROUND_SERVICE_TYPE_MEDIA_PROCESSING = 8192; // 0x2000
     field @RequiresPermission(value=android.Manifest.permission.FOREGROUND_SERVICE_MEDIA_PROJECTION, conditional=true) public static final int FOREGROUND_SERVICE_TYPE_MEDIA_PROJECTION = 32; // 0x20
     field @RequiresPermission(allOf={android.Manifest.permission.FOREGROUND_SERVICE_MICROPHONE}, anyOf={android.Manifest.permission.CAPTURE_AUDIO_OUTPUT, android.Manifest.permission.RECORD_AUDIO}, conditional=true) public static final int FOREGROUND_SERVICE_TYPE_MICROPHONE = 128; // 0x80
     field @Deprecated public static final int FOREGROUND_SERVICE_TYPE_NONE = 0; // 0x0
@@ -26291,6 +26293,7 @@
     field public static final int STATE_FAST_FORWARDING = 4; // 0x4
     field public static final int STATE_NONE = 0; // 0x0
     field public static final int STATE_PAUSED = 2; // 0x2
+    field @FlaggedApi("com.android.media.flags.enable_notifying_activity_manager_with_media_session_status_change") public static final int STATE_PLAYBACK_SUPPRESSED = 12; // 0xc
     field public static final int STATE_PLAYING = 3; // 0x3
     field public static final int STATE_REWINDING = 5; // 0x5
     field public static final int STATE_SKIPPING_TO_NEXT = 10; // 0xa
@@ -53974,6 +53977,7 @@
     field public static final String PROPERTY_COMPAT_ALLOW_SANDBOXING_VIEW_BOUNDS_APIS = "android.window.PROPERTY_COMPAT_ALLOW_SANDBOXING_VIEW_BOUNDS_APIS";
     field public static final String PROPERTY_COMPAT_ENABLE_FAKE_FOCUS = "android.window.PROPERTY_COMPAT_ENABLE_FAKE_FOCUS";
     field public static final String PROPERTY_COMPAT_IGNORE_REQUESTED_ORIENTATION = "android.window.PROPERTY_COMPAT_IGNORE_REQUESTED_ORIENTATION";
+    field @FlaggedApi("com.android.window.flags.supports_multi_instance_system_ui") public static final String PROPERTY_SUPPORTS_MULTI_INSTANCE_SYSTEM_UI = "android.window.PROPERTY_SUPPORTS_MULTI_INSTANCE_SYSTEM_UI";
   }
 
   public static class WindowManager.BadTokenException extends java.lang.RuntimeException {
diff --git a/core/api/system-current.txt b/core/api/system-current.txt
index 494d488..9077d02 100644
--- a/core/api/system-current.txt
+++ b/core/api/system-current.txt
@@ -473,7 +473,7 @@
     field public static final int config_defaultCallScreening = 17039398; // 0x1040026
     field public static final int config_defaultDialer = 17039395; // 0x1040023
     field public static final int config_defaultNotes = 17039429; // 0x1040045
-    field public static final int config_defaultRetailDemo;
+    field @FlaggedApi("android.permission.flags.retail_demo_role_enabled") public static final int config_defaultRetailDemo;
     field public static final int config_defaultSms = 17039396; // 0x1040024
     field public static final int config_devicePolicyManagement = 17039421; // 0x104003d
     field public static final int config_feedbackIntentExtraKey = 17039391; // 0x104001f
@@ -4141,7 +4141,7 @@
     field public static final int PROTECTION_FLAG_MODULE = 4194304; // 0x400000
     field public static final int PROTECTION_FLAG_OEM = 16384; // 0x4000
     field public static final int PROTECTION_FLAG_RECENTS = 33554432; // 0x2000000
-    field @Deprecated public static final int PROTECTION_FLAG_RETAIL_DEMO = 16777216; // 0x1000000
+    field public static final int PROTECTION_FLAG_RETAIL_DEMO = 16777216; // 0x1000000
     field public static final int PROTECTION_FLAG_ROLE = 67108864; // 0x4000000
     field public static final int PROTECTION_FLAG_SYSTEM_TEXT_CLASSIFIER = 65536; // 0x10000
     field public static final int PROTECTION_FLAG_VENDOR_PRIVILEGED = 32768; // 0x8000
@@ -10571,7 +10571,7 @@
     method @RequiresPermission(anyOf={android.Manifest.permission.RECOVERY, android.Manifest.permission.REBOOT}) public static int rebootAndApply(@NonNull android.content.Context, @NonNull String, boolean) throws java.io.IOException;
     method @RequiresPermission(allOf={android.Manifest.permission.RECOVERY, android.Manifest.permission.REBOOT}) public static void rebootWipeAb(android.content.Context, java.io.File, String) throws java.io.IOException;
     method @RequiresPermission(android.Manifest.permission.RECOVERY) public static void scheduleUpdateOnBoot(android.content.Context, java.io.File) throws java.io.IOException;
-    method public static boolean verifyPackageCompatibility(java.io.File) throws java.io.IOException;
+    method @Deprecated public static boolean verifyPackageCompatibility(java.io.File) throws java.io.IOException;
     field public static final int RESUME_ON_REBOOT_REBOOT_ERROR_INVALID_PACKAGE_NAME = 2000; // 0x7d0
     field public static final int RESUME_ON_REBOOT_REBOOT_ERROR_LSKF_NOT_CAPTURED = 3000; // 0xbb8
     field public static final int RESUME_ON_REBOOT_REBOOT_ERROR_PROVIDER_PREPARATION_FAILURE = 5000; // 0x1388
diff --git a/core/api/test-current.txt b/core/api/test-current.txt
index 572be19..d2af9db 100644
--- a/core/api/test-current.txt
+++ b/core/api/test-current.txt
@@ -284,6 +284,16 @@
     method public default void onOpActiveChanged(@NonNull String, int, @NonNull String, @Nullable String, boolean, int, int);
   }
 
+  public final class AutomaticZenRule implements android.os.Parcelable {
+    method @FlaggedApi("android.app.modes_api") public int getUserModifiedFields();
+    field @FlaggedApi("android.app.modes_api") public static final int FIELD_INTERRUPTION_FILTER = 2; // 0x2
+    field @FlaggedApi("android.app.modes_api") public static final int FIELD_NAME = 1; // 0x1
+  }
+
+  @FlaggedApi("android.app.modes_api") public static final class AutomaticZenRule.Builder {
+    method @FlaggedApi("android.app.modes_api") @NonNull public android.app.AutomaticZenRule.Builder setUserModifiedFields(int);
+  }
+
   public class BroadcastOptions extends android.app.ComponentOptions {
     ctor public BroadcastOptions();
     ctor public BroadcastOptions(@NonNull android.os.Bundle);
@@ -3007,6 +3017,49 @@
     method @Deprecated public boolean isBound();
   }
 
+  @FlaggedApi("android.app.modes_api") public final class ZenDeviceEffects implements android.os.Parcelable {
+    method public int getUserModifiedFields();
+    field public static final int FIELD_DIM_WALLPAPER = 4; // 0x4
+    field public static final int FIELD_DISABLE_AUTO_BRIGHTNESS = 16; // 0x10
+    field public static final int FIELD_DISABLE_TAP_TO_WAKE = 32; // 0x20
+    field public static final int FIELD_DISABLE_TILT_TO_WAKE = 64; // 0x40
+    field public static final int FIELD_DISABLE_TOUCH = 128; // 0x80
+    field public static final int FIELD_GRAYSCALE = 1; // 0x1
+    field public static final int FIELD_MAXIMIZE_DOZE = 512; // 0x200
+    field public static final int FIELD_MINIMIZE_RADIO_USAGE = 256; // 0x100
+    field public static final int FIELD_NIGHT_MODE = 8; // 0x8
+    field public static final int FIELD_SUPPRESS_AMBIENT_DISPLAY = 2; // 0x2
+  }
+
+  @FlaggedApi("android.app.modes_api") public static final class ZenDeviceEffects.Builder {
+    method @NonNull public android.service.notification.ZenDeviceEffects.Builder setUserModifiedFields(int);
+  }
+
+  public final class ZenPolicy implements android.os.Parcelable {
+    method @FlaggedApi("android.app.modes_api") public int getUserModifiedFields();
+    field @FlaggedApi("android.app.modes_api") public static final int FIELD_ALLOW_CHANNELS = 8; // 0x8
+    field @FlaggedApi("android.app.modes_api") public static final int FIELD_CALLS = 2; // 0x2
+    field @FlaggedApi("android.app.modes_api") public static final int FIELD_CONVERSATIONS = 4; // 0x4
+    field @FlaggedApi("android.app.modes_api") public static final int FIELD_MESSAGES = 1; // 0x1
+    field @FlaggedApi("android.app.modes_api") public static final int FIELD_PRIORITY_CATEGORY_ALARMS = 128; // 0x80
+    field @FlaggedApi("android.app.modes_api") public static final int FIELD_PRIORITY_CATEGORY_EVENTS = 32; // 0x20
+    field @FlaggedApi("android.app.modes_api") public static final int FIELD_PRIORITY_CATEGORY_MEDIA = 256; // 0x100
+    field @FlaggedApi("android.app.modes_api") public static final int FIELD_PRIORITY_CATEGORY_REPEAT_CALLERS = 64; // 0x40
+    field @FlaggedApi("android.app.modes_api") public static final int FIELD_PRIORITY_CATEGORY_SYSTEM = 512; // 0x200
+    field @FlaggedApi("android.app.modes_api") public static final int FIELD_VISUAL_EFFECT_AMBIENT = 32768; // 0x8000
+    field @FlaggedApi("android.app.modes_api") public static final int FIELD_VISUAL_EFFECT_BADGE = 16384; // 0x4000
+    field @FlaggedApi("android.app.modes_api") public static final int FIELD_VISUAL_EFFECT_FULL_SCREEN_INTENT = 1024; // 0x400
+    field @FlaggedApi("android.app.modes_api") public static final int FIELD_VISUAL_EFFECT_LIGHTS = 2048; // 0x800
+    field @FlaggedApi("android.app.modes_api") public static final int FIELD_VISUAL_EFFECT_NOTIFICATION_LIST = 65536; // 0x10000
+    field @FlaggedApi("android.app.modes_api") public static final int FIELD_VISUAL_EFFECT_PEEK = 4096; // 0x1000
+    field @FlaggedApi("android.app.modes_api") public static final int FIELD_VISUAL_EFFECT_STATUS_BAR = 8192; // 0x2000
+  }
+
+  public static final class ZenPolicy.Builder {
+    ctor public ZenPolicy.Builder(@Nullable android.service.notification.ZenPolicy);
+    method @FlaggedApi("android.app.modes_api") @NonNull public android.service.notification.ZenPolicy.Builder setUserModifiedFields(int);
+  }
+
 }
 
 package android.service.quickaccesswallet {
diff --git a/core/api/test-lint-baseline.txt b/core/api/test-lint-baseline.txt
index bf26bd0..5e904ef9 100644
--- a/core/api/test-lint-baseline.txt
+++ b/core/api/test-lint-baseline.txt
@@ -535,6 +535,10 @@
     Missing nullability on parameter `foreground` in method `isDefaultFocusHighlightNeeded`
 
 
+OptionalBuilderConstructorArgument: android.service.notification.ZenPolicy.Builder#Builder(android.service.notification.ZenPolicy) parameter #0:
+    Builder constructor arguments must be mandatory (i.e. not @Nullable): parameter policy in android.service.notification.ZenPolicy.Builder(android.service.notification.ZenPolicy policy)
+
+
 ProtectedMember: android.app.AppDetailsActivity#onCreate(android.os.Bundle):
     Protected methods not allowed; must be public: method android.app.AppDetailsActivity.onCreate(android.os.Bundle)}
 ProtectedMember: android.view.ViewGroup#resetResolvedDrawables():
@@ -2143,6 +2147,8 @@
     New API must be flagged with @FlaggedApi: field android.service.notification.NotificationRankingUpdate.PARCELABLE_WRITE_RETURN_VALUE
 UnflaggedApi: android.service.notification.NotificationRankingUpdate#isFdNotNullAndClosed():
     New API must be flagged with @FlaggedApi: method android.service.notification.NotificationRankingUpdate.isFdNotNullAndClosed()
+UnflaggedApi: android.service.notification.ZenPolicy.Builder#Builder(android.service.notification.ZenPolicy):
+    New API must be flagged with @FlaggedApi: constructor android.service.notification.ZenPolicy.Builder(android.service.notification.ZenPolicy)
 UnflaggedApi: android.telephony.TelephonyManager#HAL_SERVICE_SATELLITE:
     New API must be flagged with @FlaggedApi: field android.telephony.TelephonyManager.HAL_SERVICE_SATELLITE
 UnflaggedApi: android.telephony.ims.feature.MmTelFeature.MmTelCapabilities:
diff --git a/core/java/android/app/Activity.java b/core/java/android/app/Activity.java
index 5d4d5e2..f9583d2 100644
--- a/core/java/android/app/Activity.java
+++ b/core/java/android/app/Activity.java
@@ -24,7 +24,9 @@
 import static android.app.WindowConfiguration.WINDOWING_MODE_PINNED;
 import static android.app.WindowConfiguration.inMultiWindowMode;
 import static android.os.Process.myUid;
+
 import static com.android.sdksandbox.flags.Flags.sandboxActivitySdkBasedContext;
+
 import static java.lang.Character.MIN_VALUE;
 
 import android.annotation.AnimRes;
@@ -45,6 +47,7 @@
 import android.annotation.SystemApi;
 import android.annotation.TestApi;
 import android.annotation.UiContext;
+import android.app.ActivityOptions.SceneTransitionInfo;
 import android.app.VoiceInteractor.Request;
 import android.app.admin.DevicePolicyManager;
 import android.app.assist.AssistContent;
@@ -930,8 +933,8 @@
     @UnsupportedAppUsage
     final FragmentController mFragments = FragmentController.createController(new HostCallbacks());
 
-    /** The options for scene transition. */
-    ActivityOptions mPendingOptions;
+    /** The scene transition info. */
+    SceneTransitionInfo mSceneTransitionInfo;
 
     /** Whether this activity was launched from a bubble. **/
     boolean mLaunchedFromBubble;
@@ -5807,10 +5810,9 @@
 
     private Bundle transferSpringboardActivityOptions(@Nullable Bundle options) {
         if (options == null && (mWindow != null && !mWindow.isActive())) {
-            final ActivityOptions activityOptions = getActivityOptions();
-            if (activityOptions != null &&
-                    activityOptions.getAnimationType() == ActivityOptions.ANIM_SCENE_TRANSITION) {
-                return activityOptions.toBundle();
+            final SceneTransitionInfo info = getSceneTransitionInfo();
+            if (info != null) {
+                return ActivityOptions.makeBasic().setSceneTransitionInfo(info).toBundle();
             }
         }
         return options;
@@ -8079,8 +8081,10 @@
      *
      * @param callback the method to call when all visible activities behind this one have been
      * drawn and it is safe to make this activity translucent again.
-     * @param options activity options delivered to the activity below this one. The options
-     * are retrieved using {@link #getActivityOptions}.
+     * @param options activity options that created from
+     *             {@link ActivityOptions#makeSceneTransitionAnimation} which will be converted to
+     *             {@link SceneTransitionInfo} and delivered to the activity below this one. The
+     *              options are retrieved using {@link #getSceneTransitionInfo}.
      * @return <code>true</code> if Window was opaque and will become translucent or
      * <code>false</code> if window was translucent and no change needed to be made.
      *
@@ -8116,27 +8120,27 @@
     }
 
     /** @hide */
-    public void onNewActivityOptions(ActivityOptions options) {
-        mActivityTransitionState.setEnterActivityOptions(this, options);
+    public void onNewSceneTransitionInfo(ActivityOptions.SceneTransitionInfo info) {
+        mActivityTransitionState.setEnterSceneTransitionInfo(this, info);
         if (!mStopped) {
             mActivityTransitionState.enterReady(this);
         }
     }
 
     /**
-     * Takes the ActivityOptions passed in from the launching activity or passed back
+     * Takes the {@link SceneTransitionInfo} passed in from the launching activity or passed back
      * from an activity launched by this activity in its call to {@link
      * #convertToTranslucent(TranslucentConversionListener, ActivityOptions)}
      *
-     * @return The ActivityOptions passed to {@link #convertToTranslucent}.
+     * @return The {@link SceneTransitionInfo} which based on the ActivityOptions that originally
+     *         passed to {@link #convertToTranslucent}.
      * @hide
      */
-    @UnsupportedAppUsage
-    ActivityOptions getActivityOptions() {
-        final ActivityOptions options = mPendingOptions;
-        // The option only applies once.
-        mPendingOptions = null;
-        return options;
+    SceneTransitionInfo getSceneTransitionInfo() {
+        final SceneTransitionInfo sceneTransitionInfo = mSceneTransitionInfo;
+        // The info only applies once.
+        mSceneTransitionInfo = null;
+        return sceneTransitionInfo;
     }
 
     /**
@@ -8780,7 +8784,7 @@
         mVisibleFromClient = !mWindow.getWindowStyle().getBoolean(
                 com.android.internal.R.styleable.Window_windowNoDisplay, false);
         mFragments.dispatchActivityCreated();
-        mActivityTransitionState.setEnterActivityOptions(this, getActivityOptions());
+        mActivityTransitionState.setEnterSceneTransitionInfo(this, getSceneTransitionInfo());
         dispatchActivityPostCreated(icicle);
         Trace.traceEnd(Trace.TRACE_TAG_WINDOW_MANAGER);
     }
@@ -8798,7 +8802,7 @@
                     + mComponent.getClassName());
         }
         dispatchActivityPreStarted();
-        mActivityTransitionState.setEnterActivityOptions(this, getActivityOptions());
+        mActivityTransitionState.setEnterSceneTransitionInfo(this, getSceneTransitionInfo());
         mFragments.noteStateNotSaved();
         mCalled = false;
         mFragments.execPendingActions();
diff --git a/core/java/android/app/ActivityOptions.aidl b/core/java/android/app/ActivityOptions.aidl
new file mode 100644
index 0000000..bd5cd88
--- /dev/null
+++ b/core/java/android/app/ActivityOptions.aidl
@@ -0,0 +1,20 @@
+/**
+ * Copyright (c) 2024, The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.app;
+
+/** @hide */
+parcelable ActivityOptions.SceneTransitionInfo;
\ No newline at end of file
diff --git a/core/java/android/app/ActivityOptions.java b/core/java/android/app/ActivityOptions.java
index 9c279c3..8af7ed1 100644
--- a/core/java/android/app/ActivityOptions.java
+++ b/core/java/android/app/ActivityOptions.java
@@ -357,22 +357,7 @@
     private static final String KEY_APPLY_NO_USER_ACTION_FLAG_FOR_SHORTCUT =
             "android:activity.applyNoUserActionFlagForShortcut";
 
-    /**
-     * For Activity transitions, the calling Activity's TransitionListener used to
-     * notify the called Activity when the shared element and the exit transitions
-     * complete.
-     */
-    private static final String KEY_TRANSITION_COMPLETE_LISTENER
-            = "android:activity.transitionCompleteListener";
-
-    private static final String KEY_TRANSITION_IS_RETURNING
-            = "android:activity.transitionIsReturning";
-    private static final String KEY_TRANSITION_SHARED_ELEMENTS
-            = "android:activity.sharedElementNames";
-    private static final String KEY_RESULT_DATA = "android:activity.resultData";
-    private static final String KEY_RESULT_CODE = "android:activity.resultCode";
-    private static final String KEY_EXIT_COORDINATOR_INDEX
-            = "android:activity.exitCoordinatorIndex";
+    private static final String KEY_SCENE_TRANSITION_INFO = "android:activity.sceneTransitionInfo";
 
     /** See {@link SourceInfo}. */
     private static final String KEY_SOURCE_INFO = "android.activity.sourceInfo";
@@ -472,12 +457,7 @@
     private int mHeight;
     private IRemoteCallback mAnimationStartedListener;
     private IRemoteCallback mAnimationFinishedListener;
-    private ResultReceiver mTransitionReceiver;
-    private boolean mIsReturning;
-    private ArrayList<String> mSharedElementNames;
-    private Intent mResultData;
-    private int mResultCode;
-    private int mExitCoordinatorIndex;
+    private SceneTransitionInfo mSceneTransitionInfo;
     private PendingIntent mUsageTimeReport;
     private int mLaunchDisplayId = INVALID_DISPLAY;
     private int mCallerDisplayId = INVALID_DISPLAY;
@@ -1006,8 +986,11 @@
         ExitTransitionCoordinator exit = makeSceneTransitionAnimation(
                 new ActivityExitTransitionCallbacks(activity), activity.mExitTransitionListener,
                 activity.getWindow(), opts, sharedElements);
-        opts.mExitCoordinatorIndex =
-                activity.mActivityTransitionState.addExitTransitionCoordinator(exit);
+        final SceneTransitionInfo info = opts.getSceneTransitionInfo();
+        if (info != null) {
+            info.setExitCoordinatorKey(
+                    activity.mActivityTransitionState.addExitTransitionCoordinator(exit));
+        }
         return opts;
     }
 
@@ -1029,13 +1012,16 @@
         ActivityOptions opts = new ActivityOptions();
         ExitTransitionCoordinator exit = makeSceneTransitionAnimation(
                 exitCallbacks, callback, window, opts, sharedElements);
-        opts.mExitCoordinatorIndex = -1;
+        final SceneTransitionInfo info = opts.getSceneTransitionInfo();
+        if (info != null) {
+            info.setExitCoordinatorKey(-1);
+        }
         return Pair.create(opts, exit);
     }
 
     /**
-     * This method should be called when the
-     * {@link #startSharedElementAnimation(Window, ExitTransitionCallbacks, Pair[])}
+     * This method should be called when the {@link #startSharedElementAnimation(Window,
+     * ExitTransitionCallbacks, SharedElementCallback, Pair[])}
      * animation must be stopped and the Views reset. This can happen if there was an error
      * from startActivity or a springboard activity and the animation should stop and reset.
      *
@@ -1088,9 +1074,11 @@
 
         ExitTransitionCoordinator exit = new ExitTransitionCoordinator(exitCallbacks, window,
                 callback, names, names, views, false);
-        opts.mTransitionReceiver = exit;
-        opts.mSharedElementNames = names;
-        opts.mIsReturning = false;
+        final SceneTransitionInfo info = new SceneTransitionInfo();
+        info.setResultReceiver(exit);
+        info.setSharedElementNames(names);
+        info.setReturning(false);
+        opts.setSceneTransitionInfo(info);
         return exit;
     }
 
@@ -1111,17 +1099,20 @@
             int resultCode, Intent resultData) {
         ActivityOptions opts = new ActivityOptions();
         opts.mAnimationType = ANIM_SCENE_TRANSITION;
-        opts.mSharedElementNames = sharedElementNames;
-        opts.mTransitionReceiver = exitCoordinator;
-        opts.mIsReturning = true;
-        opts.mResultCode = resultCode;
-        opts.mResultData = resultData;
+        final SceneTransitionInfo info = new SceneTransitionInfo();
+        info.setSharedElementNames(sharedElementNames);
+        info.setResultReceiver(exitCoordinator);
+        info.setReturning(true);
+        info.setResultCode(resultCode);
+        info.setResultData(resultData);
         if (activity == null) {
-            opts.mExitCoordinatorIndex = -1;
+            info.setExitCoordinatorKey(-1);
         } else {
-            opts.mExitCoordinatorIndex =
-                    activity.mActivityTransitionState.addExitTransitionCoordinator(exitCoordinator);
+            info.setExitCoordinatorKey(
+                    activity.mActivityTransitionState.addExitTransitionCoordinator(
+                            exitCoordinator));
         }
+        opts.setSceneTransitionInfo(info);
         return opts;
     }
 
@@ -1269,12 +1260,8 @@
                 break;
 
             case ANIM_SCENE_TRANSITION:
-                mTransitionReceiver = opts.getParcelable(KEY_TRANSITION_COMPLETE_LISTENER, android.os.ResultReceiver.class);
-                mIsReturning = opts.getBoolean(KEY_TRANSITION_IS_RETURNING, false);
-                mSharedElementNames = opts.getStringArrayList(KEY_TRANSITION_SHARED_ELEMENTS);
-                mResultData = opts.getParcelable(KEY_RESULT_DATA, android.content.Intent.class);
-                mResultCode = opts.getInt(KEY_RESULT_CODE);
-                mExitCoordinatorIndex = opts.getInt(KEY_EXIT_COORDINATOR_INDEX);
+                mSceneTransitionInfo = opts.getParcelable(KEY_SCENE_TRANSITION_INFO,
+                        SceneTransitionInfo.class);
                 break;
         }
         mLockTaskMode = opts.getBoolean(KEY_LOCK_TASK_MODE, false);
@@ -1437,9 +1424,6 @@
     }
 
     /** @hide */
-    public int getExitCoordinatorKey() { return mExitCoordinatorIndex; }
-
-    /** @hide */
     public void abort() {
         if (mAnimationStartedListener != null) {
             try {
@@ -1450,35 +1434,17 @@
     }
 
     /** @hide */
-    public boolean isReturning() {
-        return mIsReturning;
-    }
-
-    /**
-     * Returns whether or not the ActivityOptions was created with
-     * {@link #startSharedElementAnimation(Window, Pair[])}.
-     *
-     * @hide
-     */
-    boolean isCrossTask() {
-        return mExitCoordinatorIndex < 0;
+    public ActivityOptions setSceneTransitionInfo(SceneTransitionInfo info) {
+        mSceneTransitionInfo = info;
+        return this;
     }
 
     /** @hide */
-    public ArrayList<String> getSharedElementNames() {
-        return mSharedElementNames;
+    public SceneTransitionInfo getSceneTransitionInfo() {
+        return mSceneTransitionInfo;
     }
 
     /** @hide */
-    public ResultReceiver getResultReceiver() { return mTransitionReceiver; }
-
-    /** @hide */
-    public int getResultCode() { return mResultCode; }
-
-    /** @hide */
-    public Intent getResultData() { return mResultData; }
-
-    /** @hide */
     public PendingIntent getUsageTimeReport() {
         return mUsageTimeReport;
     }
@@ -2102,12 +2068,7 @@
             mPackageName = otherOptions.mPackageName;
         }
         mUsageTimeReport = otherOptions.mUsageTimeReport;
-        mTransitionReceiver = null;
-        mSharedElementNames = null;
-        mIsReturning = false;
-        mResultData = null;
-        mResultCode = 0;
-        mExitCoordinatorIndex = 0;
+        mSceneTransitionInfo = null;
         mAnimationType = otherOptions.mAnimationType;
         switch (otherOptions.mAnimationType) {
             case ANIM_CUSTOM:
@@ -2157,14 +2118,9 @@
                 mAnimationStartedListener = otherOptions.mAnimationStartedListener;
                 break;
             case ANIM_SCENE_TRANSITION:
-                mTransitionReceiver = otherOptions.mTransitionReceiver;
-                mSharedElementNames = otherOptions.mSharedElementNames;
-                mIsReturning = otherOptions.mIsReturning;
+                mSceneTransitionInfo = otherOptions.mSceneTransitionInfo;
                 mThumbnail = null;
                 mAnimationStartedListener = null;
-                mResultData = otherOptions.mResultData;
-                mResultCode = otherOptions.mResultCode;
-                mExitCoordinatorIndex = otherOptions.mExitCoordinatorIndex;
                 break;
         }
         mLockTaskMode = otherOptions.mLockTaskMode;
@@ -2240,14 +2196,9 @@
                         != null ? mAnimationStartedListener.asBinder() : null);
                 break;
             case ANIM_SCENE_TRANSITION:
-                if (mTransitionReceiver != null) {
-                    b.putParcelable(KEY_TRANSITION_COMPLETE_LISTENER, mTransitionReceiver);
+                if (mSceneTransitionInfo != null) {
+                    b.putParcelable(KEY_SCENE_TRANSITION_INFO, mSceneTransitionInfo);
                 }
-                b.putBoolean(KEY_TRANSITION_IS_RETURNING, mIsReturning);
-                b.putStringArrayList(KEY_TRANSITION_SHARED_ELEMENTS, mSharedElementNames);
-                b.putParcelable(KEY_RESULT_DATA, mResultData);
-                b.putInt(KEY_RESULT_CODE, mResultCode);
-                b.putInt(KEY_EXIT_COORDINATOR_INDEX, mExitCoordinatorIndex);
                 break;
         }
         if (mLockTaskMode) {
@@ -2607,4 +2558,124 @@
             }
         };
     }
+
+    /**
+     * This class contains necessary information for Activity Scene Transition.
+     *
+     * @hide
+     */
+    public static class SceneTransitionInfo implements Parcelable {
+        private boolean mIsReturning;
+        private int mResultCode;
+        @Nullable
+        private Intent mResultData;
+        @Nullable
+        private ArrayList<String> mSharedElementNames;
+        @Nullable
+        private ResultReceiver mResultReceiver;
+        private int mExitCoordinatorIndex;
+
+        public SceneTransitionInfo() {
+        }
+
+        SceneTransitionInfo(Parcel in) {
+            mIsReturning = in.readBoolean();
+            mResultCode = in.readInt();
+            mResultData = in.readTypedObject(Intent.CREATOR);
+            mSharedElementNames = in.createStringArrayList();
+            mResultReceiver = in.readTypedObject(ResultReceiver.CREATOR);
+            mExitCoordinatorIndex = in.readInt();
+        }
+
+        public static final Creator<SceneTransitionInfo> CREATOR = new Creator<>() {
+            @Override
+            public SceneTransitionInfo createFromParcel(Parcel in) {
+                return new SceneTransitionInfo(in);
+            }
+
+            @Override
+            public SceneTransitionInfo[] newArray(int size) {
+                return new SceneTransitionInfo[size];
+            }
+        };
+
+        @Override
+        public int describeContents() {
+            return 0;
+        }
+
+        @Override
+        public void writeToParcel(Parcel dest, int flags) {
+            dest.writeBoolean(mIsReturning);
+            dest.writeInt(mResultCode);
+            dest.writeTypedObject(mResultData, flags);
+            dest.writeStringList(mSharedElementNames);
+            dest.writeTypedObject(mResultReceiver, flags);
+            dest.writeInt(mExitCoordinatorIndex);
+        }
+
+        public void setReturning(boolean isReturning) {
+            mIsReturning = isReturning;
+        }
+
+        public boolean isReturning() {
+            return mIsReturning;
+        }
+
+        public void setResultCode(int resultCode) {
+            mResultCode = resultCode;
+        }
+
+        public int getResultCode() {
+            return mResultCode;
+        }
+
+        public void setResultData(Intent resultData) {
+            mResultData = resultData;
+        }
+
+        @Nullable
+        public Intent getResultData() {
+            return mResultData;
+        }
+
+        public void setSharedElementNames(ArrayList<String> sharedElementNames) {
+            mSharedElementNames = sharedElementNames;
+        }
+
+        @Nullable
+        public ArrayList<String> getSharedElementNames() {
+            return mSharedElementNames;
+        }
+
+        public void setResultReceiver(ResultReceiver resultReceiver) {
+            mResultReceiver = resultReceiver;
+        }
+
+        @Nullable
+        public ResultReceiver getResultReceiver() {
+            return mResultReceiver;
+        }
+
+        public void setExitCoordinatorKey(int exitCoordinatorKey) {
+            mExitCoordinatorIndex = exitCoordinatorKey;
+        }
+
+        public int getExitCoordinatorKey() {
+            return mExitCoordinatorIndex;
+        }
+
+        boolean isCrossTask() {
+            return mExitCoordinatorIndex < 0;
+        }
+
+        @Override
+        public String toString() {
+            return "SceneTransitionInfo, mIsReturning=" + mIsReturning
+                    + ", mResultCode=" + mResultCode + ", mResultData=" + mResultData
+                    + ", mSharedElementNames=" + mSharedElementNames
+                    + ", mTransitionReceiver=" + mResultReceiver
+                    + ", mExitCoordinatorIndex=" + mExitCoordinatorIndex;
+        }
+    }
 }
diff --git a/core/java/android/app/ActivityThread.java b/core/java/android/app/ActivityThread.java
index 7e5326e..949e2ba 100644
--- a/core/java/android/app/ActivityThread.java
+++ b/core/java/android/app/ActivityThread.java
@@ -43,6 +43,7 @@
 
 import android.annotation.NonNull;
 import android.annotation.Nullable;
+import android.app.ActivityOptions.SceneTransitionInfo;
 import android.app.RemoteServiceException.BadForegroundServiceNotificationException;
 import android.app.RemoteServiceException.BadUserInitiatedJobNotificationException;
 import android.app.RemoteServiceException.CannotPostForegroundServiceNotificationException;
@@ -632,8 +633,8 @@
         @UnsupportedAppUsage
         boolean mPreserveWindow;
 
-        /** The options for scene transition. */
-        ActivityOptions mActivityOptions;
+        /** The scene transition info. */
+        SceneTransitionInfo mSceneTransitionInfo;
 
         /** Whether this activiy was launched from a bubble. */
         boolean mLaunchedFromBubble;
@@ -660,7 +661,7 @@
                 ActivityInfo info, Configuration overrideConfig,
                 String referrer, IVoiceInteractor voiceInteractor, Bundle state,
                 PersistableBundle persistentState, List<ResultInfo> pendingResults,
-                List<ReferrerIntent> pendingNewIntents, ActivityOptions activityOptions,
+                List<ReferrerIntent> pendingNewIntents, SceneTransitionInfo sceneTransitionInfo,
                 boolean isForward, ProfilerInfo profilerInfo, ClientTransactionHandler client,
                 IBinder assistToken, IBinder shareableActivityToken, boolean launchedFromBubble,
                 IBinder taskFragmentToken) {
@@ -680,7 +681,7 @@
             this.profilerInfo = profilerInfo;
             this.overrideConfig = overrideConfig;
             this.packageInfo = client.getPackageInfoNoCheck(activityInfo.applicationInfo);
-            mActivityOptions = activityOptions;
+            mSceneTransitionInfo = sceneTransitionInfo;
             mLaunchedFromBubble = launchedFromBubble;
             mTaskFragmentToken = taskFragmentToken;
             init();
@@ -1960,9 +1961,9 @@
             sendMessage(H.TRANSLUCENT_CONVERSION_COMPLETE, token, drawComplete ? 1 : 0);
         }
 
-        public void scheduleOnNewActivityOptions(IBinder token, Bundle options) {
-            sendMessage(H.ON_NEW_ACTIVITY_OPTIONS,
-                    new Pair<IBinder, ActivityOptions>(token, ActivityOptions.fromBundle(options)));
+        public void scheduleOnNewSceneTransitionInfo(IBinder token, SceneTransitionInfo info) {
+            sendMessage(H.ON_NEW_SCENE_TRANSITION_INFO,
+                    new Pair<IBinder, SceneTransitionInfo>(token, info));
         }
 
         public void setProcessState(int state) {
@@ -2258,7 +2259,7 @@
         public static final int TRANSLUCENT_CONVERSION_COMPLETE = 144;
         @UnsupportedAppUsage
         public static final int INSTALL_PROVIDER        = 145;
-        public static final int ON_NEW_ACTIVITY_OPTIONS = 146;
+        public static final int ON_NEW_SCENE_TRANSITION_INFO = 146;
         @UnsupportedAppUsage
         public static final int ENTER_ANIMATION_COMPLETE = 149;
         public static final int START_BINDER_TRACKING = 150;
@@ -2314,7 +2315,7 @@
                     case REQUEST_ASSIST_CONTEXT_EXTRAS: return "REQUEST_ASSIST_CONTEXT_EXTRAS";
                     case TRANSLUCENT_CONVERSION_COMPLETE: return "TRANSLUCENT_CONVERSION_COMPLETE";
                     case INSTALL_PROVIDER: return "INSTALL_PROVIDER";
-                    case ON_NEW_ACTIVITY_OPTIONS: return "ON_NEW_ACTIVITY_OPTIONS";
+                    case ON_NEW_SCENE_TRANSITION_INFO: return "ON_NEW_SCENE_TRANSITION_INFO";
                     case ENTER_ANIMATION_COMPLETE: return "ENTER_ANIMATION_COMPLETE";
                     case LOCAL_VOICE_INTERACTION_STARTED: return "LOCAL_VOICE_INTERACTION_STARTED";
                     case ATTACH_AGENT: return "ATTACH_AGENT";
@@ -2520,9 +2521,10 @@
                         Trace.traceEnd(Trace.TRACE_TAG_ACTIVITY_MANAGER);
                     }
                     break;
-                case ON_NEW_ACTIVITY_OPTIONS:
-                    Pair<IBinder, ActivityOptions> pair = (Pair<IBinder, ActivityOptions>) msg.obj;
-                    onNewActivityOptions(pair.first, pair.second);
+                case ON_NEW_SCENE_TRANSITION_INFO:
+                    Pair<IBinder, SceneTransitionInfo> pair =
+                            (Pair<IBinder, SceneTransitionInfo>) msg.obj;
+                    onNewSceneTransitionInfo(pair.first, pair.second);
                     break;
                 case ENTER_ANIMATION_COMPLETE:
                     handleEnterAnimationComplete((IBinder) msg.obj);
@@ -3921,9 +3923,9 @@
                     activity.setTheme(theme);
                 }
 
-                if (r.mActivityOptions != null) {
-                    activity.mPendingOptions = r.mActivityOptions;
-                    r.mActivityOptions = null;
+                if (r.mSceneTransitionInfo != null) {
+                    activity.mSceneTransitionInfo = r.mSceneTransitionInfo;
+                    r.mSceneTransitionInfo = null;
                 }
                 activity.mLaunchedFromBubble = r.mLaunchedFromBubble;
                 activity.mCalled = false;
@@ -3962,7 +3964,7 @@
 
     @Override
     public void handleStartActivity(ActivityClientRecord r,
-            PendingTransactionActions pendingActions, ActivityOptions activityOptions) {
+            PendingTransactionActions pendingActions, SceneTransitionInfo sceneTransitionInfo) {
         final Activity activity = r.activity;
         if (!r.stopped) {
             throw new IllegalStateException("Can't start activity that is not stopped.");
@@ -3973,8 +3975,8 @@
         }
 
         unscheduleGcIdler();
-        if (activityOptions != null) {
-            activity.mPendingOptions = activityOptions;
+        if (sceneTransitionInfo != null) {
+            activity.mSceneTransitionInfo = sceneTransitionInfo;
         }
 
         // Start
@@ -4349,10 +4351,10 @@
         }
     }
 
-    public void onNewActivityOptions(IBinder token, ActivityOptions options) {
+    public void onNewSceneTransitionInfo(IBinder token, SceneTransitionInfo info) {
         ActivityClientRecord r = mActivities.get(token);
         if (r != null) {
-            r.activity.onNewActivityOptions(options);
+            r.activity.onNewSceneTransitionInfo(info);
         }
     }
 
diff --git a/core/java/android/app/ActivityTransitionState.java b/core/java/android/app/ActivityTransitionState.java
index 6f4bb45..d947a9b 100644
--- a/core/java/android/app/ActivityTransitionState.java
+++ b/core/java/android/app/ActivityTransitionState.java
@@ -15,6 +15,7 @@
  */
 package android.app;
 
+import android.app.ActivityOptions.SceneTransitionInfo;
 import android.content.Intent;
 import android.os.Bundle;
 import android.os.ResultReceiver;
@@ -81,9 +82,9 @@
     private EnterTransitionCoordinator mEnterTransitionCoordinator;
 
     /**
-     * ActivityOptions used on entering this Activity.
+     * {@link SceneTransitionInfo} used on entering this Activity.
      */
-    private ActivityOptions mEnterActivityOptions;
+    private SceneTransitionInfo mEnterSceneTransitionInfo;
 
     /**
      * Has an exit transition been started? If so, we don't want to double-exit.
@@ -165,7 +166,7 @@
         }
     }
 
-    public void setEnterActivityOptions(Activity activity, ActivityOptions options) {
+    public void setEnterSceneTransitionInfo(Activity activity, SceneTransitionInfo info) {
         final Window window = activity.getWindow();
         if (window == null) {
             return;
@@ -173,16 +174,15 @@
         // ensure Decor View has been created so that the window features are activated
         window.getDecorView();
         if (window.hasFeature(Window.FEATURE_ACTIVITY_TRANSITIONS)
-                && options != null && mEnterActivityOptions == null
-                && mEnterTransitionCoordinator == null
-                && options.getAnimationType() == ActivityOptions.ANIM_SCENE_TRANSITION) {
-            mEnterActivityOptions = options;
+                && info != null && mEnterSceneTransitionInfo == null
+                && mEnterTransitionCoordinator == null) {
+            mEnterSceneTransitionInfo = info;
             mIsEnterTriggered = false;
-            if (mEnterActivityOptions.isReturning()) {
+            if (mEnterSceneTransitionInfo.isReturning()) {
                 restoreExitedViews();
-                int result = mEnterActivityOptions.getResultCode();
+                int result = mEnterSceneTransitionInfo.getResultCode();
                 if (result != 0) {
-                    Intent intent = mEnterActivityOptions.getResultData();
+                    Intent intent = mEnterSceneTransitionInfo.getResultData();
                     if (intent != null) {
                         intent.setExtrasClassLoader(activity.getClassLoader());
                     }
@@ -193,25 +193,26 @@
     }
 
     public void enterReady(Activity activity) {
-        if (mEnterActivityOptions == null || mIsEnterTriggered) {
+        if (mEnterSceneTransitionInfo == null || mIsEnterTriggered) {
             return;
         }
         mIsEnterTriggered = true;
         mHasExited = false;
-        ArrayList<String> sharedElementNames = mEnterActivityOptions.getSharedElementNames();
-        ResultReceiver resultReceiver = mEnterActivityOptions.getResultReceiver();
-        final boolean isReturning = mEnterActivityOptions.isReturning();
+        final ArrayList<String> sharedElementNames =
+                mEnterSceneTransitionInfo.getSharedElementNames();
+        ResultReceiver resultReceiver = mEnterSceneTransitionInfo.getResultReceiver();
+        final boolean isReturning = mEnterSceneTransitionInfo.isReturning();
         if (isReturning) {
             restoreExitedViews();
             activity.getWindow().getDecorView().setVisibility(View.VISIBLE);
         }
         getPendingExitNames(); // Set mPendingExitNames before resetting mEnterTransitionCoordinator
         mEnterTransitionCoordinator = new EnterTransitionCoordinator(activity,
-                resultReceiver, sharedElementNames, mEnterActivityOptions.isReturning(),
-                mEnterActivityOptions.isCrossTask());
-        if (mEnterActivityOptions.isCrossTask()) {
-            mExitingFrom = new ArrayList<>(mEnterActivityOptions.getSharedElementNames());
-            mExitingTo = new ArrayList<>(mEnterActivityOptions.getSharedElementNames());
+                resultReceiver, sharedElementNames, mEnterSceneTransitionInfo.isReturning(),
+                mEnterSceneTransitionInfo.isCrossTask());
+        if (mEnterSceneTransitionInfo.isCrossTask() && sharedElementNames != null) {
+            mExitingFrom = new ArrayList<>(sharedElementNames);
+            mExitingTo = new ArrayList<>(sharedElementNames);
         }
 
         if (!mIsEnterPostponed) {
@@ -248,7 +249,7 @@
         mExitingFrom = null;
         mExitingTo = null;
         mExitingToView = null;
-        mEnterActivityOptions = null;
+        mEnterSceneTransitionInfo = null;
     }
 
     public void onStop(Activity activity) {
@@ -296,7 +297,7 @@
         mExitingToView = null;
         mCalledExitCoordinator = null;
         mEnterTransitionCoordinator = null;
-        mEnterActivityOptions = null;
+        mEnterSceneTransitionInfo = null;
         mExitTransitionCoordinators = null;
     }
 
@@ -386,9 +387,10 @@
                 mExitTransitionCoordinators == null) {
             return;
         }
-        ActivityOptions activityOptions = new ActivityOptions(options);
-        if (activityOptions.getAnimationType() == ActivityOptions.ANIM_SCENE_TRANSITION) {
-            int key = activityOptions.getExitCoordinatorKey();
+        final ActivityOptions activityOptions = new ActivityOptions(options);
+        final SceneTransitionInfo info = activityOptions.getSceneTransitionInfo();
+        if (info != null) {
+            int key = info.getExitCoordinatorKey();
             int index = mExitTransitionCoordinators.indexOfKey(key);
             if (index >= 0) {
                 mCalledExitCoordinator = mExitTransitionCoordinators.valueAt(index).get();
diff --git a/core/java/android/app/ApplicationPackageManager.java b/core/java/android/app/ApplicationPackageManager.java
index 287d2bd..34c44f9 100644
--- a/core/java/android/app/ApplicationPackageManager.java
+++ b/core/java/android/app/ApplicationPackageManager.java
@@ -131,6 +131,7 @@
 
 import libcore.util.EmptyArray;
 
+import java.io.File;
 import java.io.IOException;
 import java.io.InputStream;
 import java.lang.ref.WeakReference;
@@ -4038,11 +4039,11 @@
     }
 
     @Override
-    public <T> T parseAndroidManifest(@NonNull String apkFilePath,
+    public <T> T parseAndroidManifest(@NonNull File apkFile,
             @NonNull Function<XmlResourceParser, T> parserFunction) throws IOException {
-        Objects.requireNonNull(apkFilePath, "apkFilePath cannot be null");
+        Objects.requireNonNull(apkFile, "apkFile cannot be null");
         Objects.requireNonNull(parserFunction, "parserFunction cannot be null");
-        try (XmlResourceParser xmlResourceParser = getAndroidManifestParser(apkFilePath)) {
+        try (XmlResourceParser xmlResourceParser = getAndroidManifestParser(apkFile)) {
             return parserFunction.apply(xmlResourceParser);
         } catch (IOException e) {
             Log.w(TAG, "Failed to get the android manifest parser", e);
@@ -4050,11 +4051,11 @@
         }
     }
 
-    private static XmlResourceParser getAndroidManifestParser(@NonNull String apkFilePath)
+    private static XmlResourceParser getAndroidManifestParser(@NonNull File apkFile)
             throws IOException {
         ApkAssets apkAssets = null;
         try {
-            apkAssets = ApkAssets.loadFromPath(apkFilePath);
+            apkAssets = ApkAssets.loadFromPath(apkFile.getAbsolutePath());
             return apkAssets.openXml(ApkLiteParseUtils.ANDROID_MANIFEST_FILENAME);
         } finally {
             if (apkAssets != null) {
diff --git a/core/java/android/app/AutomaticZenRule.java b/core/java/android/app/AutomaticZenRule.java
index f9ab55e..5b354fc 100644
--- a/core/java/android/app/AutomaticZenRule.java
+++ b/core/java/android/app/AutomaticZenRule.java
@@ -23,6 +23,7 @@
 import android.annotation.IntDef;
 import android.annotation.NonNull;
 import android.annotation.Nullable;
+import android.annotation.TestApi;
 import android.app.NotificationManager.InterruptionFilter;
 import android.content.ComponentName;
 import android.net.Uri;
@@ -35,6 +36,7 @@
 
 import java.lang.annotation.Retention;
 import java.lang.annotation.RetentionPolicy;
+import java.util.ArrayList;
 import java.util.Objects;
 
 /**
@@ -111,6 +113,30 @@
     @Retention(RetentionPolicy.SOURCE)
     public @interface Type {}
 
+    /** Used to track which rule variables have been modified by the user.
+     * Should be checked against the bitmask {@link #getUserModifiedFields()}.
+     * @hide
+     */
+    @IntDef(flag = true, prefix = { "FIELD_" }, value = {
+            FIELD_NAME,
+            FIELD_INTERRUPTION_FILTER,
+    })
+    @Retention(RetentionPolicy.SOURCE)
+    public @interface ModifiableField {}
+
+    /**
+     * @hide
+     */
+    @FlaggedApi(Flags.FLAG_MODES_API)
+    @TestApi
+    public static final int FIELD_NAME = 1 << 0;
+    /**
+     * @hide
+     */
+    @FlaggedApi(Flags.FLAG_MODES_API)
+    @TestApi
+    public static final int FIELD_INTERRUPTION_FILTER = 1 << 1;
+
     private boolean enabled;
     private String name;
     private @InterruptionFilter int interruptionFilter;
@@ -120,12 +146,14 @@
     private long creationTime;
     private ZenPolicy mZenPolicy;
     private ZenDeviceEffects mDeviceEffects;
+    // TODO: b/310620812 - Remove this once FLAG_MODES_API is inlined.
     private boolean mModified = false;
     private String mPkg;
-    private int mType = TYPE_UNKNOWN;
+    private int mType = Flags.modesApi() ? TYPE_UNKNOWN : 0;
     private int mIconResId;
     private String mTriggerDescription;
     private boolean mAllowManualInvocation;
+    private @ModifiableField int mUserModifiedFields; // Bitwise representation
 
     /**
      * The maximum string length for any string contained in this automatic zen rule. This pertains
@@ -228,6 +256,7 @@
             mIconResId = source.readInt();
             mTriggerDescription = getTrimmedString(source.readString(), MAX_DESC_LENGTH);
             mType = source.readInt();
+            mUserModifiedFields = source.readInt();
         }
     }
 
@@ -278,6 +307,8 @@
      * Returns whether this rule's name has been modified by the user.
      * @hide
      */
+    // TODO: b/310620812 - Replace with mUserModifiedFields & FIELD_NAME once
+    //  FLAG_MODES_API is inlined.
     public boolean isModified() {
         return mModified;
     }
@@ -475,6 +506,32 @@
         return type;
     }
 
+    /**
+     * Gets the bitmask representing which fields are user modified. Bits are set using
+     * {@link ModifiableField}.
+     * @hide
+     */
+    @FlaggedApi(Flags.FLAG_MODES_API)
+    @TestApi
+    public @ModifiableField int getUserModifiedFields() {
+        return mUserModifiedFields;
+    }
+
+    /**
+     * Returns {@code true} if the {@link AutomaticZenRule} can be updated.
+     * When this returns {@code false}, calls to
+     * {@link NotificationManager#updateAutomaticZenRule(String, AutomaticZenRule)}) with this rule
+     * will ignore changes to user-configurable fields.
+     */
+    @FlaggedApi(Flags.FLAG_MODES_API)
+    public boolean canUpdate() {
+        // The rule is considered updateable if its bitmask has no user modifications, and
+        // the bitmasks of the policy and device effects have no modification.
+        return mUserModifiedFields == 0
+                && (mZenPolicy == null || mZenPolicy.getUserModifiedFields() == 0)
+                && (mDeviceEffects == null || mDeviceEffects.getUserModifiedFields() == 0);
+    }
+
     @Override
     public int describeContents() {
         return 0;
@@ -503,6 +560,7 @@
             dest.writeInt(mIconResId);
             dest.writeString(mTriggerDescription);
             dest.writeInt(mType);
+            dest.writeInt(mUserModifiedFields);
         }
     }
 
@@ -524,12 +582,26 @@
                     .append(",allowManualInvocation=").append(mAllowManualInvocation)
                     .append(",iconResId=").append(mIconResId)
                     .append(",triggerDescription=").append(mTriggerDescription)
-                    .append(",type=").append(mType);
+                    .append(",type=").append(mType)
+                    .append(",userModifiedFields=")
+                    .append(modifiedFieldsToString(mUserModifiedFields));
         }
 
         return sb.append(']').toString();
     }
 
+    @FlaggedApi(Flags.FLAG_MODES_API)
+    private String modifiedFieldsToString(int bitmask) {
+        ArrayList<String> modified = new ArrayList<>();
+        if ((bitmask & FIELD_NAME) != 0) {
+            modified.add("FIELD_NAME");
+        }
+        if ((bitmask & FIELD_INTERRUPTION_FILTER) != 0) {
+            modified.add("FIELD_INTERRUPTION_FILTER");
+        }
+        return "{" + String.join(",", modified) + "}";
+    }
+
     @Override
     public boolean equals(@Nullable Object o) {
         if (!(o instanceof AutomaticZenRule)) return false;
@@ -551,7 +623,8 @@
                     && other.mAllowManualInvocation == mAllowManualInvocation
                     && other.mIconResId == mIconResId
                     && Objects.equals(other.mTriggerDescription, mTriggerDescription)
-                    && other.mType == mType;
+                    && other.mType == mType
+                    && other.mUserModifiedFields == mUserModifiedFields;
         }
         return finalEquals;
     }
@@ -561,7 +634,8 @@
         if (Flags.modesApi()) {
             return Objects.hash(enabled, name, interruptionFilter, conditionId, owner,
                     configurationActivity, mZenPolicy, mDeviceEffects, mModified, creationTime,
-                    mPkg, mAllowManualInvocation, mIconResId, mTriggerDescription, mType);
+                    mPkg, mAllowManualInvocation, mIconResId, mTriggerDescription, mType,
+                    mUserModifiedFields);
         }
         return Objects.hash(enabled, name, interruptionFilter, conditionId, owner,
                 configurationActivity, mZenPolicy, mModified, creationTime, mPkg);
@@ -630,6 +704,7 @@
         private boolean mAllowManualInvocation;
         private long mCreationTime;
         private String mPkg;
+        private @ModifiableField int mUserModifiedFields;
 
         public Builder(@NonNull AutomaticZenRule rule) {
             mName = rule.getName();
@@ -646,6 +721,7 @@
             mAllowManualInvocation = rule.isManualInvocationAllowed();
             mCreationTime = rule.getCreationTime();
             mPkg = rule.getPackageName();
+            mUserModifiedFields = rule.mUserModifiedFields;
         }
 
         public Builder(@NonNull String name, @NonNull Uri conditionId) {
@@ -772,6 +848,19 @@
             return this;
         }
 
+        /**
+         * Sets the bitmask representing which fields have been user-modified.
+         * This method should not be used outside of tests. The value of userModifiedFields
+         * should be set based on what values are changed when a rule is populated or updated..
+         * @hide
+         */
+        @FlaggedApi(Flags.FLAG_MODES_API)
+        @TestApi
+        public @NonNull Builder setUserModifiedFields(@ModifiableField int userModifiedFields) {
+            mUserModifiedFields = userModifiedFields;
+            return this;
+        }
+
         public @NonNull AutomaticZenRule build() {
             AutomaticZenRule rule = new AutomaticZenRule(mName, mOwner, mConfigurationActivity,
                     mConditionId, mPolicy, mInterruptionFilter, mEnabled);
@@ -782,6 +871,7 @@
             rule.mIconResId = mIconResId;
             rule.mAllowManualInvocation = mAllowManualInvocation;
             rule.setPackageName(mPkg);
+            rule.mUserModifiedFields = mUserModifiedFields;
 
             return rule;
         }
diff --git a/core/java/android/app/ClientTransactionHandler.java b/core/java/android/app/ClientTransactionHandler.java
index 25075e9..b300674 100644
--- a/core/java/android/app/ClientTransactionHandler.java
+++ b/core/java/android/app/ClientTransactionHandler.java
@@ -17,6 +17,7 @@
 
 import android.annotation.NonNull;
 import android.annotation.Nullable;
+import android.app.ActivityOptions.SceneTransitionInfo;
 import android.app.ActivityThread.ActivityClientRecord;
 import android.app.servertransaction.ClientTransaction;
 import android.app.servertransaction.DestroyActivityItem;
@@ -207,7 +208,7 @@
 
     /** Perform activity start. */
     public abstract void handleStartActivity(@NonNull ActivityClientRecord r,
-            PendingTransactionActions pendingActions, ActivityOptions activityOptions);
+            PendingTransactionActions pendingActions, SceneTransitionInfo sceneTransitionInfo);
 
     /** Get package info. */
     public abstract LoadedApk getPackageInfoNoCheck(ApplicationInfo ai);
diff --git a/core/java/android/app/ForegroundServiceTypePolicy.java b/core/java/android/app/ForegroundServiceTypePolicy.java
index ac9c497..d1e517b 100644
--- a/core/java/android/app/ForegroundServiceTypePolicy.java
+++ b/core/java/android/app/ForegroundServiceTypePolicy.java
@@ -30,6 +30,7 @@
 import static android.content.pm.ServiceInfo.FOREGROUND_SERVICE_TYPE_LOCATION;
 import static android.content.pm.ServiceInfo.FOREGROUND_SERVICE_TYPE_MANIFEST;
 import static android.content.pm.ServiceInfo.FOREGROUND_SERVICE_TYPE_MEDIA_PLAYBACK;
+import static android.content.pm.ServiceInfo.FOREGROUND_SERVICE_TYPE_MEDIA_PROCESSING;
 import static android.content.pm.ServiceInfo.FOREGROUND_SERVICE_TYPE_MEDIA_PROJECTION;
 import static android.content.pm.ServiceInfo.FOREGROUND_SERVICE_TYPE_MICROPHONE;
 import static android.content.pm.ServiceInfo.FOREGROUND_SERVICE_TYPE_NONE;
@@ -577,6 +578,26 @@
     );
 
     /**
+     * The policy for the {@link ServiceInfo#FOREGROUND_SERVICE_TYPE_MEDIA_PROCESSING}.
+     *
+     * @hide
+     */
+    public static final @NonNull ForegroundServiceTypePolicyInfo FGS_TYPE_POLICY_MEDIA_PROCESSING =
+            new ForegroundServiceTypePolicyInfo(
+                    FOREGROUND_SERVICE_TYPE_MEDIA_PROCESSING,
+                    ForegroundServiceTypePolicyInfo.INVALID_CHANGE_ID,
+                    ForegroundServiceTypePolicyInfo.INVALID_CHANGE_ID,
+                    new ForegroundServiceTypePermissions(new ForegroundServiceTypePermission[] {
+                            new RegularPermission(
+                                    Manifest.permission.FOREGROUND_SERVICE_MEDIA_PROCESSING)
+                    }, true),
+                    null /* anyOfPermissions */,
+                    null /* permissionEnforcementFlag */,
+                    true /* permissionEnforcementFlagDefaultValue */,
+                    false /* foregroundOnlyPermission */
+            );
+
+    /**
      * The policy for the {@link ServiceInfo#FOREGROUND_SERVICE_TYPE_SPECIAL_USE}.
      *
      * @hide
@@ -1331,6 +1352,8 @@
                     FGS_TYPE_POLICY_SYSTEM_EXEMPTED);
             mForegroundServiceTypePolicies.put(FOREGROUND_SERVICE_TYPE_SHORT_SERVICE,
                     FGS_TYPE_POLICY_SHORT_SERVICE);
+            mForegroundServiceTypePolicies.put(FOREGROUND_SERVICE_TYPE_MEDIA_PROCESSING,
+                    FGS_TYPE_POLICY_MEDIA_PROCESSING);
             // TODO (b/271950506): revisit it in the next release.
             // Hide the file management type for now. If anyone uses it, will default to "none".
             mForegroundServiceTypePolicies.put(FOREGROUND_SERVICE_TYPE_SPECIAL_USE,
diff --git a/core/java/android/app/IApplicationThread.aidl b/core/java/android/app/IApplicationThread.aidl
index a301c18..59e0e99 100644
--- a/core/java/android/app/IApplicationThread.aidl
+++ b/core/java/android/app/IApplicationThread.aidl
@@ -16,6 +16,7 @@
 
 package android.app;
 
+import android.app.ActivityOptions.SceneTransitionInfo;
 import android.app.ContentProviderHolder;
 import android.app.IInstrumentationWatcher;
 import android.app.IUiAutomationConnection;
@@ -114,7 +115,7 @@
     void scheduleCreateBackupAgent(in ApplicationInfo app,
             int backupMode, int userId, int operationType);
     void scheduleDestroyBackupAgent(in ApplicationInfo app, int userId);
-    void scheduleOnNewActivityOptions(IBinder token, in Bundle options);
+    void scheduleOnNewSceneTransitionInfo(IBinder token, in SceneTransitionInfo info);
     void scheduleSuicide();
     void dispatchPackageBroadcast(int cmd, in String[] packages);
     void scheduleCrash(in String msg, int typeId, in Bundle extras);
diff --git a/core/java/android/app/LocalActivityManager.java b/core/java/android/app/LocalActivityManager.java
index 6b5f19a..1b19ecd 100644
--- a/core/java/android/app/LocalActivityManager.java
+++ b/core/java/android/app/LocalActivityManager.java
@@ -179,7 +179,7 @@
             }
 
             mActivityThread.handleStartActivity(clientRecord, pendingActions,
-                    null /* activityOptions */);
+                    null /* sceneTransitionInfo */);
             r.curState = STARTED;
             
             if (desiredState == RESUMED) {
diff --git a/core/java/android/app/servertransaction/LaunchActivityItem.java b/core/java/android/app/servertransaction/LaunchActivityItem.java
index 1190bf6..4d53701 100644
--- a/core/java/android/app/servertransaction/LaunchActivityItem.java
+++ b/core/java/android/app/servertransaction/LaunchActivityItem.java
@@ -23,7 +23,7 @@
 import android.annotation.NonNull;
 import android.annotation.Nullable;
 import android.app.ActivityClient;
-import android.app.ActivityOptions;
+import android.app.ActivityOptions.SceneTransitionInfo;
 import android.app.ActivityThread;
 import android.app.ActivityThread.ActivityClientRecord;
 import android.app.ClientTransactionHandler;
@@ -73,7 +73,7 @@
     private PersistableBundle mPersistentState;
     private List<ResultInfo> mPendingResults;
     private List<ReferrerIntent> mPendingNewIntents;
-    private ActivityOptions mActivityOptions;
+    private SceneTransitionInfo mSceneTransitionInfo;
     private boolean mIsForward;
     private ProfilerInfo mProfilerInfo;
     private IBinder mAssistToken;
@@ -104,8 +104,8 @@
         Trace.traceBegin(TRACE_TAG_ACTIVITY_MANAGER, "activityStart");
         ActivityClientRecord r = new ActivityClientRecord(mActivityToken, mIntent, mIdent, mInfo,
                 mOverrideConfig, mReferrer, mVoiceInteractor, mState, mPersistentState,
-                mPendingResults, mPendingNewIntents, mActivityOptions, mIsForward, mProfilerInfo,
-                client, mAssistToken, mShareableActivityToken, mLaunchedFromBubble,
+                mPendingResults, mPendingNewIntents, mSceneTransitionInfo, mIsForward,
+                mProfilerInfo, client, mAssistToken, mShareableActivityToken, mLaunchedFromBubble,
                 mTaskFragmentToken);
         client.handleLaunchActivity(r, pendingActions, mDeviceId, null /* customIntent */);
         Trace.traceEnd(TRACE_TAG_ACTIVITY_MANAGER);
@@ -136,7 +136,7 @@
             @Nullable IVoiceInteractor voiceInteractor, int procState, @Nullable Bundle state,
             @Nullable PersistableBundle persistentState, @Nullable List<ResultInfo> pendingResults,
             @Nullable List<ReferrerIntent> pendingNewIntents,
-            @Nullable ActivityOptions activityOptions,
+            @Nullable SceneTransitionInfo sceneTransitionInfo,
             boolean isForward, @Nullable ProfilerInfo profilerInfo, @NonNull IBinder assistToken,
             @Nullable IActivityClientController activityClientController,
             @NonNull IBinder shareableActivityToken, boolean launchedFromBubble,
@@ -152,7 +152,7 @@
                 persistentState != null ? new PersistableBundle(persistentState) : null,
                 pendingResults != null ? new ArrayList<>(pendingResults) : null,
                 pendingNewIntents != null ? new ArrayList<>(pendingNewIntents) : null,
-                activityOptions, isForward,
+                sceneTransitionInfo, isForward,
                 profilerInfo != null ? new ProfilerInfo(profilerInfo) : null,
                 assistToken, activityClientController, shareableActivityToken,
                 launchedFromBubble, taskFragmentToken);
@@ -193,7 +193,7 @@
         dest.writePersistableBundle(mPersistentState);
         dest.writeTypedList(mPendingResults, flags);
         dest.writeTypedList(mPendingNewIntents, flags);
-        dest.writeBundle(mActivityOptions != null ? mActivityOptions.toBundle() : null);
+        dest.writeTypedObject(mSceneTransitionInfo, flags);
         dest.writeBoolean(mIsForward);
         dest.writeTypedObject(mProfilerInfo, flags);
         dest.writeStrongBinder(mAssistToken);
@@ -213,7 +213,8 @@
                 in.readPersistableBundle(getClass().getClassLoader()),
                 in.createTypedArrayList(ResultInfo.CREATOR),
                 in.createTypedArrayList(ReferrerIntent.CREATOR),
-                ActivityOptions.fromBundle(in.readBundle()), in.readBoolean(),
+                in.readTypedObject(SceneTransitionInfo.CREATOR),
+                in.readBoolean(),
                 in.readTypedObject(ProfilerInfo.CREATOR),
                 in.readStrongBinder(),
                 IActivityClientController.Stub.asInterface(in.readStrongBinder()),
@@ -253,7 +254,7 @@
                 && areBundlesEqualRoughly(mPersistentState, other.mPersistentState)
                 && Objects.equals(mPendingResults, other.mPendingResults)
                 && Objects.equals(mPendingNewIntents, other.mPendingNewIntents)
-                && (mActivityOptions == null) == (other.mActivityOptions == null)
+                && (mSceneTransitionInfo == null) == (other.mSceneTransitionInfo == null)
                 && mIsForward == other.mIsForward
                 && Objects.equals(mProfilerInfo, other.mProfilerInfo)
                 && Objects.equals(mAssistToken, other.mAssistToken)
@@ -276,7 +277,7 @@
         result = 31 * result + getRoughBundleHashCode(mPersistentState);
         result = 31 * result + Objects.hashCode(mPendingResults);
         result = 31 * result + Objects.hashCode(mPendingNewIntents);
-        result = 31 * result + (mActivityOptions != null ? 1 : 0);
+        result = 31 * result + (mSceneTransitionInfo != null ? 1 : 0);
         result = 31 * result + (mIsForward ? 1 : 0);
         result = 31 * result + Objects.hashCode(mProfilerInfo);
         result = 31 * result + Objects.hashCode(mAssistToken);
@@ -325,7 +326,7 @@
                 + ",persistentState=" + mPersistentState
                 + ",pendingResults=" + mPendingResults
                 + ",pendingNewIntents=" + mPendingNewIntents
-                + ",options=" + mActivityOptions
+                + ",sceneTransitionInfo=" + mSceneTransitionInfo
                 + ",profilerInfo=" + mProfilerInfo
                 + ",assistToken=" + mAssistToken
                 + ",shareableActivityToken=" + mShareableActivityToken + "}";
@@ -340,7 +341,7 @@
             int procState, @Nullable Bundle state, @Nullable PersistableBundle persistentState,
             @Nullable List<ResultInfo> pendingResults,
             @Nullable List<ReferrerIntent> pendingNewIntents,
-            @Nullable ActivityOptions activityOptions, boolean isForward,
+            @Nullable SceneTransitionInfo sceneTransitionInfo, boolean isForward,
             @Nullable ProfilerInfo profilerInfo, @Nullable IBinder assistToken,
             @Nullable IActivityClientController activityClientController,
             @Nullable IBinder shareableActivityToken, boolean launchedFromBubble,
@@ -359,7 +360,7 @@
         instance.mPersistentState = persistentState;
         instance.mPendingResults = pendingResults;
         instance.mPendingNewIntents = pendingNewIntents;
-        instance.mActivityOptions = activityOptions;
+        instance.mSceneTransitionInfo = sceneTransitionInfo;
         instance.mIsForward = isForward;
         instance.mProfilerInfo = profilerInfo;
         instance.mAssistToken = assistToken;
diff --git a/core/java/android/app/servertransaction/StartActivityItem.java b/core/java/android/app/servertransaction/StartActivityItem.java
index 8b98b21..a0f93ce 100644
--- a/core/java/android/app/servertransaction/StartActivityItem.java
+++ b/core/java/android/app/servertransaction/StartActivityItem.java
@@ -20,7 +20,7 @@
 
 import android.annotation.NonNull;
 import android.annotation.Nullable;
-import android.app.ActivityOptions;
+import android.app.ActivityOptions.SceneTransitionInfo;
 import android.app.ActivityThread.ActivityClientRecord;
 import android.app.ClientTransactionHandler;
 import android.os.IBinder;
@@ -35,13 +35,13 @@
 
     private static final String TAG = "StartActivityItem";
 
-    private ActivityOptions mActivityOptions;
+    private SceneTransitionInfo mSceneTransitionInfo;
 
     @Override
     public void execute(@NonNull ClientTransactionHandler client, @NonNull ActivityClientRecord r,
             @NonNull PendingTransactionActions pendingActions) {
         Trace.traceBegin(TRACE_TAG_ACTIVITY_MANAGER, "startActivityItem");
-        client.handleStartActivity(r, pendingActions, mActivityOptions);
+        client.handleStartActivity(r, pendingActions, mSceneTransitionInfo);
         Trace.traceEnd(TRACE_TAG_ACTIVITY_MANAGER);
     }
 
@@ -57,13 +57,13 @@
     /** Obtain an instance initialized with provided params. */
     @NonNull
     public static StartActivityItem obtain(@NonNull IBinder activityToken,
-            @Nullable ActivityOptions activityOptions) {
+            @Nullable SceneTransitionInfo sceneTransitionInfo) {
         StartActivityItem instance = ObjectPool.obtain(StartActivityItem.class);
         if (instance == null) {
             instance = new StartActivityItem();
         }
         instance.setActivityToken(activityToken);
-        instance.mActivityOptions = activityOptions;
+        instance.mSceneTransitionInfo = sceneTransitionInfo;
 
         return instance;
     }
@@ -71,7 +71,7 @@
     @Override
     public void recycle() {
         super.recycle();
-        mActivityOptions = null;
+        mSceneTransitionInfo = null;
         ObjectPool.recycle(this);
     }
 
@@ -81,13 +81,13 @@
     @Override
     public void writeToParcel(@NonNull Parcel dest, int flags) {
         super.writeToParcel(dest, flags);
-        dest.writeBundle(mActivityOptions != null ? mActivityOptions.toBundle() : null);
+        dest.writeTypedObject(mSceneTransitionInfo, flags);
     }
 
     /** Read from Parcel. */
     private StartActivityItem(@NonNull Parcel in) {
         super(in);
-        mActivityOptions = ActivityOptions.fromBundle(in.readBundle());
+        mSceneTransitionInfo = in.readTypedObject(SceneTransitionInfo.CREATOR);
     }
 
     public static final @NonNull Creator<StartActivityItem> CREATOR = new Creator<>() {
@@ -109,21 +109,21 @@
             return false;
         }
         final StartActivityItem other = (StartActivityItem) o;
-        return (mActivityOptions == null) == (other.mActivityOptions == null);
+        return (mSceneTransitionInfo == null) == (other.mSceneTransitionInfo == null);
     }
 
     @Override
     public int hashCode() {
         int result = 17;
         result = 31 * result + super.hashCode();
-        result = 31 * result + (mActivityOptions != null ? 1 : 0);
+        result = 31 * result + (mSceneTransitionInfo != null ? 1 : 0);
         return result;
     }
 
     @Override
     public String toString() {
         return "StartActivityItem{" + super.toString()
-                + ",options=" + mActivityOptions + "}";
+                + ",sceneTransitionInfo=" + mSceneTransitionInfo + "}";
     }
 }
 
diff --git a/core/java/android/app/servertransaction/TransactionExecutor.java b/core/java/android/app/servertransaction/TransactionExecutor.java
index 2e47fee..ba94077 100644
--- a/core/java/android/app/servertransaction/TransactionExecutor.java
+++ b/core/java/android/app/servertransaction/TransactionExecutor.java
@@ -324,7 +324,7 @@
                     break;
                 case ON_START:
                     mTransactionHandler.handleStartActivity(r, mPendingActions,
-                            null /* activityOptions */);
+                            null /* sceneTransitionInfo */);
                     break;
                 case ON_RESUME:
                     mTransactionHandler.handleResumeActivity(r, false /* finalStateRequest */,
diff --git a/core/java/android/companion/AssociationInfo.java b/core/java/android/companion/AssociationInfo.java
index cdb92ac..843158c 100644
--- a/core/java/android/companion/AssociationInfo.java
+++ b/core/java/android/companion/AssociationInfo.java
@@ -71,6 +71,12 @@
      * @see CompanionDeviceManager#disassociate(int)
      */
     private final boolean mRevoked;
+    /**
+     * Indicates that the association is waiting for its corresponding companion app to be installed
+     * before it can be added to CDM. This is likely because it was restored onto the device from a
+     * backup.
+     */
+    private final boolean mPending;
     private final long mTimeApprovedMs;
     /**
      * A long value indicates the last time connected reported by selfManaged devices
@@ -88,7 +94,7 @@
             @Nullable String tag, @Nullable MacAddress macAddress,
             @Nullable CharSequence displayName, @Nullable String deviceProfile,
             @Nullable AssociatedDevice associatedDevice, boolean selfManaged,
-            boolean notifyOnDeviceNearby, boolean revoked, long timeApprovedMs,
+            boolean notifyOnDeviceNearby, boolean revoked, boolean pending, long timeApprovedMs,
             long lastTimeConnectedMs, int systemDataSyncFlags) {
         if (id <= 0) {
             throw new IllegalArgumentException("Association ID should be greater than 0");
@@ -109,6 +115,7 @@
         mSelfManaged = selfManaged;
         mNotifyOnDeviceNearby = notifyOnDeviceNearby;
         mRevoked = revoked;
+        mPending = pending;
         mTimeApprovedMs = timeApprovedMs;
         mLastTimeConnectedMs = lastTimeConnectedMs;
         mSystemDataSyncFlags = systemDataSyncFlags;
@@ -236,6 +243,15 @@
     }
 
     /**
+     * @return true if the association is waiting for its corresponding app to be installed
+     * before it can be added to CDM.
+     * @hide
+     */
+    public boolean isPending() {
+        return mPending;
+    }
+
+    /**
      * @return the last time self reported disconnected for selfManaged only.
      * @hide
      */
@@ -318,6 +334,7 @@
                 + ", mAssociatedDevice=" + mAssociatedDevice
                 + ", mNotifyOnDeviceNearby=" + mNotifyOnDeviceNearby
                 + ", mRevoked=" + mRevoked
+                + ", mPending=" + mPending
                 + ", mTimeApprovedMs=" + new Date(mTimeApprovedMs)
                 + ", mLastTimeConnectedMs=" + (
                     mLastTimeConnectedMs == Long.MAX_VALUE
@@ -336,6 +353,7 @@
                 && mSelfManaged == that.mSelfManaged
                 && mNotifyOnDeviceNearby == that.mNotifyOnDeviceNearby
                 && mRevoked == that.mRevoked
+                && mPending == that.mPending
                 && mTimeApprovedMs == that.mTimeApprovedMs
                 && mLastTimeConnectedMs == that.mLastTimeConnectedMs
                 && Objects.equals(mPackageName, that.mPackageName)
@@ -351,7 +369,7 @@
     public int hashCode() {
         return Objects.hash(mId, mUserId, mPackageName, mTag, mDeviceMacAddress, mDisplayName,
                 mDeviceProfile, mAssociatedDevice, mSelfManaged, mNotifyOnDeviceNearby, mRevoked,
-                mTimeApprovedMs, mLastTimeConnectedMs, mSystemDataSyncFlags);
+                mPending, mTimeApprovedMs, mLastTimeConnectedMs, mSystemDataSyncFlags);
     }
 
     @Override
@@ -372,6 +390,7 @@
         dest.writeBoolean(mSelfManaged);
         dest.writeBoolean(mNotifyOnDeviceNearby);
         dest.writeBoolean(mRevoked);
+        dest.writeBoolean(mPending);
         dest.writeLong(mTimeApprovedMs);
         dest.writeLong(mLastTimeConnectedMs);
         dest.writeInt(mSystemDataSyncFlags);
@@ -389,6 +408,7 @@
         mSelfManaged = in.readBoolean();
         mNotifyOnDeviceNearby = in.readBoolean();
         mRevoked = in.readBoolean();
+        mPending = in.readBoolean();
         mTimeApprovedMs = in.readLong();
         mLastTimeConnectedMs = in.readLong();
         mSystemDataSyncFlags = in.readInt();
@@ -427,6 +447,7 @@
         private boolean mSelfManaged;
         private boolean mNotifyOnDeviceNearby;
         private boolean mRevoked;
+        private boolean mPending;
         private long mTimeApprovedMs;
         private long mLastTimeConnectedMs;
         private int mSystemDataSyncFlags;
@@ -453,6 +474,7 @@
             mSelfManaged = info.mSelfManaged;
             mNotifyOnDeviceNearby = info.mNotifyOnDeviceNearby;
             mRevoked = info.mRevoked;
+            mPending = info.mPending;
             mTimeApprovedMs = info.mTimeApprovedMs;
             mLastTimeConnectedMs = info.mLastTimeConnectedMs;
             mSystemDataSyncFlags = info.mSystemDataSyncFlags;
@@ -476,6 +498,7 @@
             mSelfManaged = info.mSelfManaged;
             mNotifyOnDeviceNearby = info.mNotifyOnDeviceNearby;
             mRevoked = info.mRevoked;
+            mPending = info.mPending;
             mTimeApprovedMs = info.mTimeApprovedMs;
             mLastTimeConnectedMs = info.mLastTimeConnectedMs;
             mSystemDataSyncFlags = info.mSystemDataSyncFlags;
@@ -549,6 +572,14 @@
         }
 
         /** @hide */
+        @NonNull
+        @SuppressLint("MissingGetterMatchingBuilder")
+        public Builder setPending(boolean pending) {
+            mPending = pending;
+            return this;
+        }
+
+        /** @hide */
         @TestApi
         @NonNull
         @SuppressLint("MissingGetterMatchingBuilder")
@@ -606,6 +637,7 @@
                     mSelfManaged,
                     mNotifyOnDeviceNearby,
                     mRevoked,
+                    mPending,
                     mTimeApprovedMs,
                     mLastTimeConnectedMs,
                     mSystemDataSyncFlags
diff --git a/core/java/android/content/Intent.java b/core/java/android/content/Intent.java
index ee1d117b..d5eee63f 100644
--- a/core/java/android/content/Intent.java
+++ b/core/java/android/content/Intent.java
@@ -8099,7 +8099,7 @@
                         int end = data.indexOf('/', 14);
                         if (end < 0) {
                             // All we have is a package name.
-                            intent.mPackage = data.substring(14);
+                            intent.mPackage = Uri.decodeIfNeeded(data.substring(14));
                             if (!explicitAction) {
                                 intent.setAction(ACTION_MAIN);
                             }
@@ -8107,21 +8107,22 @@
                         } else {
                             // Target the Intent at the given package name always.
                             String authority = null;
-                            intent.mPackage = data.substring(14, end);
+                            intent.mPackage = Uri.decodeIfNeeded(data.substring(14, end));
                             int newEnd;
                             if ((end+1) < data.length()) {
                                 if ((newEnd=data.indexOf('/', end+1)) >= 0) {
                                     // Found a scheme, remember it.
-                                    scheme = data.substring(end+1, newEnd);
+                                    scheme = Uri.decodeIfNeeded(data.substring(end + 1, newEnd));
                                     end = newEnd;
                                     if (end < data.length() && (newEnd=data.indexOf('/', end+1)) >= 0) {
                                         // Found a authority, remember it.
-                                        authority = data.substring(end+1, newEnd);
+                                        authority = Uri.decodeIfNeeded(
+                                                data.substring(end + 1, newEnd));
                                         end = newEnd;
                                     }
                                 } else {
                                     // All we have is a scheme.
-                                    scheme = data.substring(end+1);
+                                    scheme = Uri.decodeIfNeeded(data.substring(end + 1));
                                 }
                             }
                             if (scheme == null) {
@@ -11762,27 +11763,33 @@
                         + this);
             }
             uri.append("android-app://");
-            uri.append(mPackage);
+            uri.append(Uri.encode(mPackage));
             String scheme = null;
             if (mData != null) {
-                scheme = mData.getScheme();
+                // All values here must be wrapped with Uri#encodeIfNotEncoded because it is
+                // possible to exploit the Uri API to return a raw unencoded value, which will
+                // not deserialize properly and may cause the resulting Intent to be transformed
+                // to a malicious value.
+                scheme = Uri.encodeIfNotEncoded(mData.getScheme(), null);
                 if (scheme != null) {
                     uri.append('/');
                     uri.append(scheme);
-                    String authority = mData.getEncodedAuthority();
+                    String authority = Uri.encodeIfNotEncoded(mData.getEncodedAuthority(), null);
                     if (authority != null) {
                         uri.append('/');
                         uri.append(authority);
-                        String path = mData.getEncodedPath();
+
+                        // Multiple path segments are allowed, don't encode the path / separator
+                        String path = Uri.encodeIfNotEncoded(mData.getEncodedPath(), "/");
                         if (path != null) {
                             uri.append(path);
                         }
-                        String queryParams = mData.getEncodedQuery();
+                        String queryParams = Uri.encodeIfNotEncoded(mData.getEncodedQuery(), null);
                         if (queryParams != null) {
                             uri.append('?');
                             uri.append(queryParams);
                         }
-                        String fragment = mData.getEncodedFragment();
+                        String fragment = Uri.encodeIfNotEncoded(mData.getEncodedFragment(), null);
                         if (fragment != null) {
                             uri.append('#');
                             uri.append(fragment);
diff --git a/core/java/android/content/pm/ActivityInfo.java b/core/java/android/content/pm/ActivityInfo.java
index 30871e9..9fe8af5 100644
--- a/core/java/android/content/pm/ActivityInfo.java
+++ b/core/java/android/content/pm/ActivityInfo.java
@@ -23,7 +23,6 @@
 import android.annotation.Nullable;
 import android.annotation.TestApi;
 import android.app.Activity;
-import android.app.compat.CompatChanges;
 import android.compat.annotation.ChangeId;
 import android.compat.annotation.Disabled;
 import android.compat.annotation.EnabledSince;
@@ -37,7 +36,6 @@
 import android.os.Build;
 import android.os.Parcel;
 import android.os.Parcelable;
-import android.os.UserHandle;
 import android.util.ArraySet;
 import android.util.Printer;
 import android.window.OnBackInvokedCallback;
@@ -1790,8 +1788,7 @@
      * @hide
      */
     public boolean isChangeEnabled(long changeId) {
-        return CompatChanges.isChangeEnabled(changeId, applicationInfo.packageName,
-                UserHandle.getUserHandleForUid(applicationInfo.uid));
+        return applicationInfo.isChangeEnabled(changeId);
     }
 
     /** @hide */
diff --git a/core/java/android/content/pm/ApplicationInfo.java b/core/java/android/content/pm/ApplicationInfo.java
index 869c621..f0a8996 100644
--- a/core/java/android/content/pm/ApplicationInfo.java
+++ b/core/java/android/content/pm/ApplicationInfo.java
@@ -26,6 +26,7 @@
 import android.annotation.RequiresPermission;
 import android.annotation.SystemApi;
 import android.annotation.TestApi;
+import android.app.compat.CompatChanges;
 import android.compat.annotation.UnsupportedAppUsage;
 import android.content.Context;
 import android.content.pm.PackageManager.NameNotFoundException;
@@ -2645,6 +2646,17 @@
     }
 
     /**
+     * Checks if a changeId is enabled for the current user
+     * @param changeId The changeId to verify
+     * @return True of the changeId is enabled
+     * @hide
+     */
+    public boolean isChangeEnabled(long changeId) {
+        return CompatChanges.isChangeEnabled(changeId, packageName,
+                UserHandle.getUserHandleForUid(uid));
+    }
+
+    /**
      * @return whether the app has requested exemption from the foreground service restrictions.
      * This does not take any affect for now.
      * @hide
diff --git a/core/java/android/content/pm/ModuleInfo.java b/core/java/android/content/pm/ModuleInfo.java
index a1c8747..c6e93bb 100644
--- a/core/java/android/content/pm/ModuleInfo.java
+++ b/core/java/android/content/pm/ModuleInfo.java
@@ -16,7 +16,6 @@
 
 package android.content.pm;
 
-import android.annotation.FlaggedApi;
 import android.annotation.NonNull;
 import android.annotation.Nullable;
 import android.os.Parcel;
@@ -122,18 +121,15 @@
         return mApexModuleName;
     }
 
-    /** @hide Sets the list of the package name of APK-in-APEX apps in this module. */
+    /** @hide Set the list of the package names of all APK-in-APEX apps in this module. */
     public ModuleInfo setApkInApexPackageNames(@NonNull Collection<String> apkInApexPackageNames) {
         Objects.requireNonNull(apkInApexPackageNames);
         mApkInApexPackageNames = List.copyOf(apkInApexPackageNames);
         return this;
     }
 
-    /**
-     * Gets the list of the package name of all APK-in-APEX apps in the module.
-     */
+    /** @hide Get the list of the package names of all APK-in-APEX apps in the module. */
     @NonNull
-    @FlaggedApi(android.content.pm.Flags.FLAG_PROVIDE_INFO_OF_APK_IN_APEX)
     public Collection<String> getApkInApexPackageNames() {
         if (mApkInApexPackageNames == null) {
             return Collections.emptyList();
diff --git a/core/java/android/content/pm/PackageInstaller.java b/core/java/android/content/pm/PackageInstaller.java
index 0e131b4..43322641 100644
--- a/core/java/android/content/pm/PackageInstaller.java
+++ b/core/java/android/content/pm/PackageInstaller.java
@@ -672,6 +672,13 @@
     public @interface UserActionReason {}
 
     /**
+     * The unarchival status is not set.
+     *
+     * @hide
+     */
+    public static final int UNARCHIVAL_STATUS_UNSET = -1;
+
+    /**
      * The unarchival is possible and will commence.
      *
      * <p> Note that this does not mean that the unarchival has completed. This status should be
@@ -736,6 +743,7 @@
      * @hide
      */
     @IntDef(value = {
+            UNARCHIVAL_STATUS_UNSET,
             UNARCHIVAL_OK,
             UNARCHIVAL_ERROR_USER_ACTION_NEEDED,
             UNARCHIVAL_ERROR_INSUFFICIENT_STORAGE,
@@ -2696,8 +2704,6 @@
         public int developmentInstallFlags = 0;
         /** {@hide} */
         public int unarchiveId = -1;
-        /** {@hide} */
-        public IntentSender unarchiveIntentSender;
 
         private final ArrayMap<String, Integer> mPermissionStates;
 
@@ -2750,7 +2756,6 @@
             applicationEnabledSettingPersistent = source.readBoolean();
             developmentInstallFlags = source.readInt();
             unarchiveId = source.readInt();
-            unarchiveIntentSender = source.readParcelable(null, IntentSender.class);
         }
 
         /** {@hide} */
@@ -2785,7 +2790,6 @@
             ret.applicationEnabledSettingPersistent = applicationEnabledSettingPersistent;
             ret.developmentInstallFlags = developmentInstallFlags;
             ret.unarchiveId = unarchiveId;
-            ret.unarchiveIntentSender = unarchiveIntentSender;
             return ret;
         }
 
@@ -3495,7 +3499,6 @@
                     applicationEnabledSettingPersistent);
             pw.printHexPair("developmentInstallFlags", developmentInstallFlags);
             pw.printPair("unarchiveId", unarchiveId);
-            pw.printPair("unarchiveIntentSender", unarchiveIntentSender);
             pw.println();
         }
 
@@ -3540,7 +3543,6 @@
             dest.writeBoolean(applicationEnabledSettingPersistent);
             dest.writeInt(developmentInstallFlags);
             dest.writeInt(unarchiveId);
-            dest.writeParcelable(unarchiveIntentSender, flags);
         }
 
         public static final Parcelable.Creator<SessionParams>
diff --git a/core/java/android/content/pm/PackageManager.java b/core/java/android/content/pm/PackageManager.java
index 0fb0993..8e5e825 100644
--- a/core/java/android/content/pm/PackageManager.java
+++ b/core/java/android/content/pm/PackageManager.java
@@ -11534,14 +11534,14 @@
     }
 
     /**
-     * Retrieve AndroidManifest.xml information for the given application apk path.
+     * Retrieve AndroidManifest.xml information for the given application apk file.
      *
      * <p>Example:
      *
      * <pre><code>
      * Bundle result;
      * try {
-     *     result = getContext().getPackageManager().parseAndroidManifest(apkFilePath,
+     *     result = getContext().getPackageManager().parseAndroidManifest(apkFile,
      *             xmlResourceParser -> {
      *                 Bundle bundle = new Bundle();
      *                 // Search the start tag
@@ -11570,9 +11570,10 @@
      *
      * Note: When the parserFunction is invoked, the client can read the AndroidManifest.xml
      * information by the XmlResourceParser object. After leaving the parserFunction, the
-     * XmlResourceParser object will be closed.
+     * XmlResourceParser object will be closed. The caller should also handle the exception for
+     * calling this method.
      *
-     * @param apkFilePath The path of an application apk file.
+     * @param apkFile The file of an application apk.
      * @param parserFunction The parserFunction will be invoked with the XmlResourceParser object
      *        after getting the AndroidManifest.xml of an application package.
      *
@@ -11583,7 +11584,7 @@
      */
     @FlaggedApi(android.content.pm.Flags.FLAG_GET_PACKAGE_INFO)
     @WorkerThread
-    public <T> T parseAndroidManifest(@NonNull String apkFilePath,
+    public <T> T parseAndroidManifest(@NonNull File apkFile,
             @NonNull Function<XmlResourceParser, T> parserFunction) throws IOException {
         throw new UnsupportedOperationException(
                 "parseAndroidManifest not implemented in subclass");
diff --git a/core/java/android/content/pm/PermissionInfo.java b/core/java/android/content/pm/PermissionInfo.java
index 012b6c4..cdda12e 100644
--- a/core/java/android/content/pm/PermissionInfo.java
+++ b/core/java/android/content/pm/PermissionInfo.java
@@ -273,9 +273,6 @@
      * to the <code>retailDemo</code> value of
      * {@link android.R.attr#protectionLevel}.
      *
-     * @deprecated This flag has been replaced by the retail demo role and is a no-op since Android
-     *             V.
-     *
      * @hide
      */
     @SystemApi
diff --git a/core/java/android/content/pm/ServiceInfo.java b/core/java/android/content/pm/ServiceInfo.java
index 4d704c3..ae46c027 100644
--- a/core/java/android/content/pm/ServiceInfo.java
+++ b/core/java/android/content/pm/ServiceInfo.java
@@ -17,6 +17,7 @@
 package android.content.pm;
 
 import android.Manifest;
+import android.annotation.FlaggedApi;
 import android.annotation.IntDef;
 import android.annotation.RequiresPermission;
 import android.os.Parcel;
@@ -471,6 +472,17 @@
     public static final int FOREGROUND_SERVICE_TYPE_FILE_MANAGEMENT = 1 << 12;
 
     /**
+     * Constant corresponding to {@code mediaProcessing} in
+     * the {@link android.R.attr#foregroundServiceType} attribute.
+     * Media processing use cases such as video or photo editing and processing.
+     */
+    @RequiresPermission(
+            value = Manifest.permission.FOREGROUND_SERVICE_MEDIA_PROCESSING
+    )
+    @FlaggedApi(Flags.FLAG_INTRODUCE_MEDIA_PROCESSING_TYPE)
+    public static final int FOREGROUND_SERVICE_TYPE_MEDIA_PROCESSING = 1 << 13;
+
+    /**
      * Constant corresponding to {@code specialUse} in
      * the {@link android.R.attr#foregroundServiceType} attribute.
      * Use cases that can't be categorized into any other foreground service types, but also
@@ -554,6 +566,7 @@
             FOREGROUND_SERVICE_TYPE_SYSTEM_EXEMPTED,
             FOREGROUND_SERVICE_TYPE_SHORT_SERVICE,
             FOREGROUND_SERVICE_TYPE_FILE_MANAGEMENT,
+            FOREGROUND_SERVICE_TYPE_MEDIA_PROCESSING,
             FOREGROUND_SERVICE_TYPE_SPECIAL_USE,
     })
     @Retention(RetentionPolicy.SOURCE)
@@ -640,6 +653,8 @@
                 return "shortService";
             case FOREGROUND_SERVICE_TYPE_FILE_MANAGEMENT:
                 return "fileManagement";
+            case FOREGROUND_SERVICE_TYPE_MEDIA_PROCESSING:
+                return "mediaProcessing";
             case FOREGROUND_SERVICE_TYPE_SPECIAL_USE:
                 return "specialUse";
             default:
diff --git a/core/java/android/content/pm/flags.aconfig b/core/java/android/content/pm/flags.aconfig
index 94bec35..a2cd3e1 100644
--- a/core/java/android/content/pm/flags.aconfig
+++ b/core/java/android/content/pm/flags.aconfig
@@ -131,3 +131,18 @@
     bug: "310801107"
     is_fixed_read_only: true
 }
+
+flag {
+    name: "introduce_media_processing_type"
+    namespace: "backstage_power"
+    description: "Add a new FGS type for media processing use cases."
+    bug: "317788011"
+}
+
+flag {
+    name: "encode_app_intent"
+    namespace: "package_manager_service"
+    description: "Feature flag to encode app intent."
+    bug: "281848623"
+}
+
diff --git a/core/java/android/content/res/Element.java b/core/java/android/content/res/Element.java
index e511469..89f4985 100644
--- a/core/java/android/content/res/Element.java
+++ b/core/java/android/content/res/Element.java
@@ -26,6 +26,8 @@
 
 import com.android.internal.R;
 
+import java.util.Set;
+
 /**
  * Defines the string attribute length and child tag count restrictions for a xml element.
  *
@@ -37,7 +39,11 @@
     private static final int MAX_ATTR_LEN_URL_COMPONENT = 256;
     private static final int MAX_ATTR_LEN_PERMISSION_GROUP = 256;
     private static final int MAX_ATTR_LEN_PACKAGE = 256;
-    private static final int MAX_ATTR_LEN_MIMETYPE = 512;
+    /**
+     * The mime type max length restriction here should match the restriction that is also
+     * placed in {@link android.content.pm.PackageManager#setMimeGroup(String, Set)}
+     */
+    private static final int MAX_ATTR_LEN_MIMETYPE = 255;
     private static final int MAX_ATTR_LEN_NAME = 1024;
     private static final int MAX_ATTR_LEN_PATH = 4000;
     private static final int MAX_ATTR_LEN_VALUE = 32_768;
@@ -103,6 +109,7 @@
     protected static final String TAG_ATTR_HOST = "host";
     protected static final String TAG_ATTR_MANAGE_SPACE_ACTIVITY = "manageSpaceActivity";
     protected static final String TAG_ATTR_MIMETYPE = "mimeType";
+    protected static final String TAG_ATTR_MIMEGROUP = "mimeGroup";
     protected static final String TAG_ATTR_NAME = "name";
     protected static final String TAG_ATTR_PACKAGE = "package";
     protected static final String TAG_ATTR_PATH = "path";
@@ -367,6 +374,7 @@
             case TAG_ATTR_BACKUP_AGENT:
             case TAG_ATTR_CATEGORY:
             case TAG_ATTR_MANAGE_SPACE_ACTIVITY:
+            case TAG_ATTR_MIMEGROUP:
             case TAG_ATTR_NAME:
             case TAG_ATTR_PARENT_ACTIVITY_NAME:
             case TAG_ATTR_PERMISSION:
@@ -520,6 +528,8 @@
                 return MAX_ATTR_LEN_URL_COMPONENT;
             case R.styleable.AndroidManifestData_mimeType:
                 return MAX_ATTR_LEN_MIMETYPE;
+            case R.styleable.AndroidManifestData_mimeGroup:
+                return MAX_ATTR_LEN_NAME;
             case R.styleable.AndroidManifestData_path:
             case R.styleable.AndroidManifestData_pathPattern:
             case R.styleable.AndroidManifestData_pathPrefix:
diff --git a/core/java/android/credentials/CredentialManager.java b/core/java/android/credentials/CredentialManager.java
index 3fcb3da..47ee76e 100644
--- a/core/java/android/credentials/CredentialManager.java
+++ b/core/java/android/credentials/CredentialManager.java
@@ -26,6 +26,7 @@
 import android.annotation.RequiresPermission;
 import android.annotation.SystemService;
 import android.annotation.TestApi;
+import android.app.ActivityOptions;
 import android.app.PendingIntent;
 import android.content.ComponentName;
 import android.content.Context;
@@ -755,7 +756,10 @@
         @Override
         public void onPendingIntent(PendingIntent pendingIntent) {
             try {
-                mContext.startIntentSender(pendingIntent.getIntentSender(), null, 0, 0, 0);
+                mContext.startIntentSender(pendingIntent.getIntentSender(), null, 0, 0, 0,
+                        ActivityOptions.makeBasic()
+                            .setPendingIntentBackgroundActivityStartMode(
+                                ActivityOptions.MODE_BACKGROUND_ACTIVITY_START_ALLOWED).toBundle());
             } catch (IntentSender.SendIntentException e) {
                 Log.e(
                         TAG,
diff --git a/core/java/android/database/sqlite/SQLiteConnection.java b/core/java/android/database/sqlite/SQLiteConnection.java
index b96d832..ecffe9e 100644
--- a/core/java/android/database/sqlite/SQLiteConnection.java
+++ b/core/java/android/database/sqlite/SQLiteConnection.java
@@ -121,8 +121,12 @@
     // The native SQLiteConnection pointer.  (FOR INTERNAL USE ONLY)
     private long mConnectionPtr;
 
+    // Restrict this connection to read-only operations.
     private boolean mOnlyAllowReadOnlyOperations;
 
+    // Allow this connection to treat updates to temporary tables as read-only operations.
+    private boolean mAllowTempTableRetry = Flags.sqliteAllowTempTables();
+
     // The number of times attachCancellationSignal has been called.
     // Because SQLite statement execution can be reentrant, we keep track of how many
     // times we have attempted to attach a cancellation signal to the connection so that
@@ -142,6 +146,7 @@
     private static native void nativeFinalizeStatement(long connectionPtr, long statementPtr);
     private static native int nativeGetParameterCount(long connectionPtr, long statementPtr);
     private static native boolean nativeIsReadOnly(long connectionPtr, long statementPtr);
+    private static native boolean nativeUpdatesTempOnly(long connectionPtr, long statementPtr);
     private static native int nativeGetColumnCount(long connectionPtr, long statementPtr);
     private static native String nativeGetColumnName(long connectionPtr, long statementPtr,
             int index);
@@ -1097,7 +1102,7 @@
         try {
             final int numParameters = nativeGetParameterCount(mConnectionPtr, statementPtr);
             final int type = DatabaseUtils.getSqlStatementTypeExtended(sql);
-            final boolean readOnly = nativeIsReadOnly(mConnectionPtr, statementPtr);
+            boolean readOnly = nativeIsReadOnly(mConnectionPtr, statementPtr);
             statement = obtainPreparedStatement(sql, statementPtr, numParameters, type, readOnly,
                     seqNum);
             if (!skipCache && isCacheable(type)) {
@@ -1265,13 +1270,20 @@
 
     /**
      * Verify that the statement is read-only, if the connection only allows read-only
-     * operations.
+     * operations.  If the connection allows updates to temporary tables, then the statement is
+     * read-only if the only updates are to temporary tables.
      * @param statement The statement to check.
      * @throws SQLiteException if the statement could update the database inside a read-only
      * transaction.
      */
     void throwIfStatementForbidden(PreparedStatement statement) {
         if (mOnlyAllowReadOnlyOperations && !statement.mReadOnly) {
+            if (mAllowTempTableRetry) {
+                statement.mReadOnly =
+                        nativeUpdatesTempOnly(mConnectionPtr, statement.mStatementPtr);
+                if (statement.mReadOnly) return;
+            }
+
             throw new SQLiteException("Cannot execute this statement because it "
                     + "might modify the database but the connection is read-only.");
         }
diff --git a/core/java/android/database/sqlite/flags.aconfig b/core/java/android/database/sqlite/flags.aconfig
index 62a5123..92ef9c2 100644
--- a/core/java/android/database/sqlite/flags.aconfig
+++ b/core/java/android/database/sqlite/flags.aconfig
@@ -7,3 +7,11 @@
      description: "SQLite APIs held back for Android 15"
      bug: "279043253"
 }
+
+flag {
+     name: "sqlite_allow_temp_tables"
+     namespace: "system_performance"
+     is_fixed_read_only: true
+     description: "Permit updates to TEMP tables in read-only transactions"
+     bug: "317993835"
+}
diff --git a/core/java/android/hardware/display/VirtualDisplayConfig.java b/core/java/android/hardware/display/VirtualDisplayConfig.java
index 9e09759..56f69a6 100644
--- a/core/java/android/hardware/display/VirtualDisplayConfig.java
+++ b/core/java/android/hardware/display/VirtualDisplayConfig.java
@@ -450,11 +450,14 @@
          * automatically launched upon the display creation. If unset or set to {@code false}, the
          * display will not host any activities upon creation.</p>
          *
-         * <p>Note: setting to {@code true} requires the display to be trusted. If the display is
-         * not trusted, this property is ignored.</p>
+         * <p>Note: setting to {@code true} requires the display to be trusted and to not mirror
+         * content of other displays. If the display is not trusted, or if it mirrors content of
+         * other displays, this property is ignored.</p>
          *
          * @param isHomeSupported whether home activities are supported on the display
          * @see DisplayManager#VIRTUAL_DISPLAY_FLAG_TRUSTED
+         * @see DisplayManager#VIRTUAL_DISPLAY_FLAG_AUTO_MIRROR
+         * @see DisplayManager#VIRTUAL_DISPLAY_FLAG_OWN_CONTENT_ONLY
          * @hide
          */
         @FlaggedApi(android.companion.virtual.flags.Flags.FLAG_VDM_CUSTOM_HOME)
diff --git a/core/java/android/net/Uri.java b/core/java/android/net/Uri.java
index 70de477..05a3e18 100644
--- a/core/java/android/net/Uri.java
+++ b/core/java/android/net/Uri.java
@@ -21,6 +21,7 @@
 import android.annotation.SystemApi;
 import android.compat.annotation.UnsupportedAppUsage;
 import android.content.Intent;
+import android.content.pm.Flags;
 import android.os.Environment;
 import android.os.Parcel;
 import android.os.Parcelable;
@@ -1971,6 +1972,42 @@
     }
 
     /**
+     * Encodes a value it wasn't already encoded.
+     *
+     * @param value string to encode
+     * @param allow characters to allow
+     * @return encoded value
+     * @hide
+     */
+    public static String encodeIfNotEncoded(@Nullable String value, @Nullable String allow) {
+        if (value == null) return null;
+        if (!Flags.encodeAppIntent() || isEncoded(value, allow)) return value;
+        return encode(value, allow);
+    }
+
+    /**
+     * Returns true if the given string is already encoded to safe characters.
+     *
+     * @param value string to check
+     * @param allow characters to allow
+     * @return true if the string is already encoded or false if it should be encoded
+     */
+    private static boolean isEncoded(@Nullable String value, @Nullable String allow) {
+        if (value == null) return true;
+        for (int index = 0; index < value.length(); index++) {
+            char c = value.charAt(index);
+
+            // Allow % because that's the prefix for an encoded character. This method will fail
+            // for decoded strings whose onlyinvalid character is %, but it's assumed that % alone
+            // cannot cause malicious behavior in the framework.
+            if (!isAllowed(c, allow) && c != '%') {
+                return false;
+            }
+        }
+        return true;
+    }
+
+    /**
      * Decodes '%'-escaped octets in the given string using the UTF-8 scheme.
      * Replaces invalid octets with the unicode replacement character
      * ("\\uFFFD").
@@ -1988,6 +2025,18 @@
     }
 
     /**
+     * Decodes a string if it was encoded, indicated by containing a %.
+     * @param value encoded string to decode
+     * @return decoded value
+     * @hide
+     */
+    public static String decodeIfNeeded(@Nullable String value) {
+        if (value == null) return null;
+        if (Flags.encodeAppIntent() && value.contains("%")) return decode(value);
+        return value;
+    }
+
+    /**
      * Support for part implementations.
      */
     static abstract class AbstractPart {
diff --git a/core/java/android/os/Build.java b/core/java/android/os/Build.java
index a9b7257..5871717 100755
--- a/core/java/android/os/Build.java
+++ b/core/java/android/os/Build.java
@@ -1315,9 +1315,7 @@
         if (IS_ENG) return true;
 
         if (IS_TREBLE_ENABLED) {
-            // If we can run this code, the device should already pass AVB.
-            // So, we don't need to check AVB here.
-            int result = VintfObject.verifyWithoutAvb();
+            int result = VintfObject.verifyBuildAtBoot();
 
             if (result != 0) {
                 Slog.e(TAG, "Vendor interface is incompatible, error="
diff --git a/core/java/android/os/ISystemConfig.aidl b/core/java/android/os/ISystemConfig.aidl
index 61b24aa..b7649ba 100644
--- a/core/java/android/os/ISystemConfig.aidl
+++ b/core/java/android/os/ISystemConfig.aidl
@@ -52,4 +52,9 @@
      * @see SystemConfigManager#getDefaultVrComponents
      */
     List<ComponentName> getDefaultVrComponents();
+
+    /**
+     * @see SystemConfigManager#getPreventUserDisablePackages
+     */
+    List<String> getPreventUserDisablePackages();
 }
diff --git a/core/java/android/os/OWNERS b/core/java/android/os/OWNERS
index d3f2c7a..eb5b511 100644
--- a/core/java/android/os/OWNERS
+++ b/core/java/android/os/OWNERS
@@ -94,4 +94,8 @@
 per-file Temperature.java = file:/THERMAL_OWNERS
 
 # SecurityStateManager
-per-file *SecurityStateManager* = file:/SECURITY_STATE_OWNERS
\ No newline at end of file
+per-file *SecurityStateManager* = file:/SECURITY_STATE_OWNERS
+
+# SystemConfig
+per-file ISystemConfig.aidl = file:/PACKAGE_MANAGER_OWNERS
+per-file SystemConfigManager.java = file:/PACKAGE_MANAGER_OWNERS
diff --git a/core/java/android/os/RecoverySystem.java b/core/java/android/os/RecoverySystem.java
index f71c269..07f7690 100644
--- a/core/java/android/os/RecoverySystem.java
+++ b/core/java/android/os/RecoverySystem.java
@@ -18,8 +18,6 @@
 
 import static android.view.Display.DEFAULT_DISPLAY;
 
-import static java.nio.charset.StandardCharsets.UTF_8;
-
 import android.annotation.IntDef;
 import android.annotation.NonNull;
 import android.annotation.Nullable;
@@ -47,11 +45,8 @@
 import android.util.Log;
 import android.view.Display;
 
-import libcore.io.Streams;
-
 import java.io.ByteArrayInputStream;
 import java.io.File;
-import java.io.FileInputStream;
 import java.io.FileNotFoundException;
 import java.io.FileWriter;
 import java.io.IOException;
@@ -75,7 +70,6 @@
 import java.util.concurrent.atomic.AtomicInteger;
 import java.util.zip.ZipEntry;
 import java.util.zip.ZipFile;
-import java.util.zip.ZipInputStream;
 
 import sun.security.pkcs.PKCS7;
 import sun.security.pkcs.SignerInfo;
@@ -426,72 +420,43 @@
         } finally {
             raf.close();
         }
-
-        // Additionally verify the package compatibility.
-        if (!readAndVerifyPackageCompatibilityEntry(packageFile)) {
-            throw new SignatureException("package compatibility verification failed");
-        }
     }
 
     /**
      * Verifies the compatibility entry from an {@link InputStream}.
      *
-     * @return the verification result.
+     * @param inputStream The stream that contains the package compatibility info.
+     * @throws IOException Never.
+     * @return {@code true}.
+     * @deprecated This function no longer checks {@code inputStream} and
+     *   unconditionally returns true. Instead, check compatibility when the
+     *   OTA package is generated.
      */
-    @UnsupportedAppUsage
+    @Deprecated
+    @UnsupportedAppUsage(
+            publicAlternatives = "Use {@code true} directly",
+            maxTargetSdk = Build.VERSION_CODES.VANILLA_ICE_CREAM)
     private static boolean verifyPackageCompatibility(InputStream inputStream) throws IOException {
-        ArrayList<String> list = new ArrayList<>();
-        ZipInputStream zis = new ZipInputStream(inputStream);
-        ZipEntry entry;
-        while ((entry = zis.getNextEntry()) != null) {
-            long entrySize = entry.getSize();
-            if (entrySize > Integer.MAX_VALUE || entrySize < 0) {
-                throw new IOException(
-                        "invalid entry size (" + entrySize + ") in the compatibility file");
-            }
-            byte[] bytes = new byte[(int) entrySize];
-            Streams.readFully(zis, bytes);
-            list.add(new String(bytes, UTF_8));
-        }
-        if (list.isEmpty()) {
-            throw new IOException("no entries found in the compatibility file");
-        }
-        return (VintfObject.verify(list.toArray(new String[list.size()])) == 0);
-    }
-
-    /**
-     * Reads and verifies the compatibility entry in an OTA zip package. The compatibility entry is
-     * a zip file (inside the OTA package zip).
-     *
-     * @return {@code true} if the entry doesn't exist or verification passes.
-     */
-    private static boolean readAndVerifyPackageCompatibilityEntry(File packageFile)
-            throws IOException {
-        try (ZipFile zip = new ZipFile(packageFile)) {
-            ZipEntry entry = zip.getEntry("compatibility.zip");
-            if (entry == null) {
-                return true;
-            }
-            InputStream inputStream = zip.getInputStream(entry);
-            return verifyPackageCompatibility(inputStream);
-        }
+        return true;
     }
 
     /**
      * Verifies the package compatibility info against the current system.
      *
      * @param compatibilityFile the {@link File} that contains the package compatibility info.
-     * @throws IOException if there were any errors reading the compatibility file.
-     * @return the compatibility verification result.
+     * @throws IOException Never.
+     * @return {@code true}
+     * @deprecated This function no longer checks {@code compatibilityFile} and
+     *   unconditionally returns true. Instead, check compatibility when the
+     *   OTA package is generated.
      *
      * {@hide}
      */
+    @Deprecated
     @SystemApi
     @SuppressLint("RequiresPermission")
     public static boolean verifyPackageCompatibility(File compatibilityFile) throws IOException {
-        try (InputStream inputStream = new FileInputStream(compatibilityFile)) {
-            return verifyPackageCompatibility(inputStream);
-        }
+        return true;
     }
 
     /**
diff --git a/core/java/android/os/SystemConfigManager.java b/core/java/android/os/SystemConfigManager.java
index 77843d9..21ffbf1 100644
--- a/core/java/android/os/SystemConfigManager.java
+++ b/core/java/android/os/SystemConfigManager.java
@@ -161,4 +161,18 @@
         }
         return Collections.emptyList();
     }
+
+    /**
+     * Return the packages that are prevented from being disabled, where if
+     * disabled it would result in a non-functioning system or similar.
+     * @hide
+     */
+    @NonNull
+    public List<String> getPreventUserDisablePackages() {
+        try {
+            return mInterface.getPreventUserDisablePackages();
+        } catch (RemoteException e) {
+            throw e.rethrowFromSystemServer();
+        }
+    }
 }
diff --git a/core/java/android/os/VintfObject.java b/core/java/android/os/VintfObject.java
index 1f11197..4fc5131 100644
--- a/core/java/android/os/VintfObject.java
+++ b/core/java/android/os/VintfObject.java
@@ -18,7 +18,6 @@
 
 import android.annotation.NonNull;
 import android.annotation.TestApi;
-import android.util.Slog;
 
 import java.util.Map;
 
@@ -44,44 +43,8 @@
     public static native String[] report();
 
     /**
-     * Verify that the given metadata for an OTA package is compatible with
-     * this device.
-     *
-     * @param packageInfo a list of serialized form of HalManifest's /
-     * CompatibilityMatri'ces (XML).
-     * @return = 0 if success (compatible)
-     *         &gt; 0 if incompatible
-     *         &lt; 0 if any error (mount partition fails, illformed XML, etc.)
-     *
-     * @deprecated Checking compatibility against an OTA package is no longer
-     * supported because the format of VINTF metadata in the OTA package may not
-     * be recognized by the current system.
-     *
-     * <p>
-     * <ul>
-     * <li>This function always returns 0 for non-empty {@code packageInfo}.
-     * </li>
-     * <li>This function returns the result of {@link #verifyWithoutAvb} for
-     * null or empty {@code packageInfo}.</li>
-     * </ul>
-     *
-     * @hide
-     */
-    @Deprecated
-    public static int verify(String[] packageInfo) {
-        if (packageInfo != null && packageInfo.length > 0) {
-            Slog.w(LOG_TAG, "VintfObject.verify() with non-empty packageInfo is deprecated. "
-                    + "Skipping compatibility checks for update package.");
-            return 0;
-        }
-        Slog.w(LOG_TAG, "VintfObject.verify() is deprecated. Call verifyWithoutAvb() instead.");
-        return verifyWithoutAvb();
-    }
-
-    /**
-     * Verify Vintf compatibility on the device without checking AVB
-     * (Android Verified Boot). It is useful to verify a running system
-     * image where AVB check is irrelevant.
+     * Verify Vintf compatibility on the device at boot time. Certain checks
+     * like kernel checks, AVB checks are disabled.
      *
      * @return = 0 if success (compatible)
      *         > 0 if incompatible
@@ -89,7 +52,7 @@
      *
      * @hide
      */
-    public static native int verifyWithoutAvb();
+    public static native int verifyBuildAtBoot();
 
     /**
      * @return a list of HAL names and versions that is supported by this
diff --git a/core/java/android/permission/flags.aconfig b/core/java/android/permission/flags.aconfig
index d09c229..fae7cb3 100644
--- a/core/java/android/permission/flags.aconfig
+++ b/core/java/android/permission/flags.aconfig
@@ -64,3 +64,10 @@
   description: "enable Permission PREPARE_FACTORY_RESET."
   bug: "302016478"
 }
+
+flag {
+    name: "retail_demo_role_enabled"
+    namespace: "permissions"
+    description: "default retail demo role holder"
+    bug: "274132354"
+}
diff --git a/core/java/android/provider/Settings.java b/core/java/android/provider/Settings.java
index 84fddcb..e8da0d9 100644
--- a/core/java/android/provider/Settings.java
+++ b/core/java/android/provider/Settings.java
@@ -108,10 +108,10 @@
 import java.lang.annotation.Target;
 import java.lang.reflect.Field;
 import java.net.URISyntaxException;
-import java.util.ArrayList;
 import java.util.HashMap;
 import java.util.HashSet;
 import java.util.List;
+import java.util.Locale;
 import java.util.Map;
 import java.util.Objects;
 import java.util.Set;
@@ -3585,10 +3585,12 @@
                     || applicationInfo.isSignedWithPlatformKey();
         }
 
-        public ArrayMap<String, String> getStringsForPrefix(ContentResolver cr, String prefix,
-                List<String> names) {
+        private ArrayMap<String, String> getStringsForPrefixStripPrefix(
+                ContentResolver cr, String prefix, String[] names) {
             String namespace = prefix.substring(0, prefix.length() - 1);
             ArrayMap<String, String> keyValues = new ArrayMap<>();
+            int substringLength = prefix.length();
+
             int currentGeneration = -1;
             boolean needsGenerationTracker = false;
 
@@ -3601,22 +3603,30 @@
                                     + " type:" + mUri.getPath()
                                     + " in package:" + cr.getPackageName());
                         }
+                        // When a generation number changes, remove cached values, remove the old
+                        // generation tracker and request a new one
+                        generationTracker.destroy();
+                        mGenerationTrackers.remove(prefix);
                         for (int i = mValues.size() - 1; i >= 0; i--) {
                             String key = mValues.keyAt(i);
                             if (key.startsWith(prefix)) {
                                 mValues.remove(key);
                             }
                         }
+                        needsGenerationTracker = true;
                     } else {
                         boolean prefixCached = mValues.containsKey(prefix);
                         if (prefixCached) {
                             if (DEBUG) {
                                 Log.i(TAG, "Cache hit for prefix:" + prefix);
                             }
-                            if (!names.isEmpty()) {
+                            if (names.length > 0) {
                                 for (String name : names) {
-                                    if (mValues.containsKey(name)) {
-                                        keyValues.put(name, mValues.get(name));
+                                    String value = mValues.get(name);
+                                    if (value != null) {
+                                        keyValues.put(
+                                                name.substring(substringLength),
+                                                value);
                                     }
                                 }
                             } else {
@@ -3625,7 +3635,10 @@
                                     // Explicitly exclude the prefix as it is only there to
                                     // signal that the prefix has been cached.
                                     if (key.startsWith(prefix) && !key.equals(prefix)) {
-                                        keyValues.put(key, mValues.get(key));
+                                        String value = mValues.valueAt(i);
+                                        keyValues.put(
+                                                key.substring(substringLength),
+                                                value);
                                     }
                                 }
                             }
@@ -3685,14 +3698,22 @@
                 Map<String, String> flagsToValues =
                         (HashMap) b.getSerializable(Settings.NameValueTable.VALUE, java.util.HashMap.class);
                 // Only the flags requested by the caller
-                if (!names.isEmpty()) {
-                    for (Map.Entry<String, String> flag : flagsToValues.entrySet()) {
-                        if (names.contains(flag.getKey())) {
-                            keyValues.put(flag.getKey(), flag.getValue());
+                if (names.length > 0) {
+                    for (String name : names) {
+                        String value = flagsToValues.get(name);
+                        if (value != null) {
+                            keyValues.put(
+                                    name.substring(substringLength),
+                                    value);
                         }
                     }
                 } else {
-                    keyValues.putAll(flagsToValues);
+                    keyValues.ensureCapacity(keyValues.size() + flagsToValues.size());
+                    for (Map.Entry<String, String> flag : flagsToValues.entrySet()) {
+                        keyValues.put(
+                                flag.getKey().substring(substringLength),
+                                flag.getValue());
+                    }
                 }
 
                 synchronized (NameValueCache.this) {
@@ -12172,6 +12193,7 @@
             CLONE_TO_MANAGED_PROFILE.add(SHOW_IME_WITH_HARD_KEYBOARD);
             CLONE_TO_MANAGED_PROFILE.add(ACCESSIBILITY_BOUNCE_KEYS);
             CLONE_TO_MANAGED_PROFILE.add(NOTIFICATION_BUBBLES);
+            CLONE_TO_MANAGED_PROFILE.add(NOTIFICATION_HISTORY_ENABLED);
         }
 
         /** @hide */
@@ -19674,6 +19696,15 @@
             @Readable
             public static final String WRIST_DETECTION_AUTO_LOCKING_ENABLED =
                     "wear_wrist_detection_auto_locking_enabled";
+
+            /**
+             * Whether consistent notification blocking experience is enabled.
+             *
+             * @hide
+             */
+            @Readable
+            public static final String CONSISTENT_NOTIFICATION_BLOCKING_ENABLED =
+                    "consistent_notification_blocking_enabled";
         }
     }
 
@@ -19834,21 +19865,15 @@
         @RequiresPermission(Manifest.permission.READ_DEVICE_CONFIG)
         public static Map<String, String> getStrings(@NonNull ContentResolver resolver,
                 @NonNull String namespace, @NonNull List<String> names) {
-            List<String> compositeNames = new ArrayList<>(names.size());
-            for (String name : names) {
-                compositeNames.add(createCompositeName(namespace, name));
+            String[] compositeNames = new String[names.size()];
+            for (int i = 0, size = names.size(); i < size; ++i) {
+                compositeNames[i] = createCompositeName(namespace, names.get(i));
             }
 
             String prefix = createPrefix(namespace);
-            ArrayMap<String, String> rawKeyValues = sNameValueCache.getStringsForPrefix(
+
+            ArrayMap<String, String> keyValues = sNameValueCache.getStringsForPrefixStripPrefix(
                     resolver, prefix, compositeNames);
-            int size = rawKeyValues.size();
-            int substringLength = prefix.length();
-            ArrayMap<String, String> keyValues = new ArrayMap<>(size);
-            for (int i = 0; i < size; ++i) {
-                keyValues.put(rawKeyValues.keyAt(i).substring(substringLength),
-                        rawKeyValues.valueAt(i));
-            }
             return keyValues;
         }
 
@@ -20174,12 +20199,13 @@
         private static String createCompositeName(@NonNull String namespace, @NonNull String name) {
             Preconditions.checkNotNull(namespace);
             Preconditions.checkNotNull(name);
-            return createPrefix(namespace) + name;
+            var sb = new StringBuilder(namespace.length() + 1 + name.length());
+            return sb.append(namespace).append('/').append(name).toString();
         }
 
         private static String createPrefix(@NonNull String namespace) {
             Preconditions.checkNotNull(namespace);
-            return namespace + "/";
+            return namespace + '/';
         }
 
         private static Uri createNamespaceUri(@NonNull String namespace) {
diff --git a/core/java/android/service/notification/ZenDeviceEffects.java b/core/java/android/service/notification/ZenDeviceEffects.java
index 0e82b6c..03ebae5 100644
--- a/core/java/android/service/notification/ZenDeviceEffects.java
+++ b/core/java/android/service/notification/ZenDeviceEffects.java
@@ -17,12 +17,16 @@
 package android.service.notification;
 
 import android.annotation.FlaggedApi;
+import android.annotation.IntDef;
 import android.annotation.NonNull;
 import android.annotation.Nullable;
+import android.annotation.TestApi;
 import android.app.Flags;
 import android.os.Parcel;
 import android.os.Parcelable;
 
+import java.lang.annotation.Retention;
+import java.lang.annotation.RetentionPolicy;
 import java.util.ArrayList;
 import java.util.Objects;
 
@@ -33,6 +37,76 @@
 @FlaggedApi(Flags.FLAG_MODES_API)
 public final class ZenDeviceEffects implements Parcelable {
 
+    /** Used to track which rule variables have been modified by the user.
+     * Should be checked against the bitmask {@link #getUserModifiedFields()}.
+     * @hide
+     */
+    @IntDef(flag = true, prefix = { "FIELD_" }, value = {
+            FIELD_GRAYSCALE,
+            FIELD_SUPPRESS_AMBIENT_DISPLAY,
+            FIELD_DIM_WALLPAPER,
+            FIELD_NIGHT_MODE,
+            FIELD_DISABLE_AUTO_BRIGHTNESS,
+            FIELD_DISABLE_TAP_TO_WAKE,
+            FIELD_DISABLE_TILT_TO_WAKE,
+            FIELD_DISABLE_TOUCH,
+            FIELD_MINIMIZE_RADIO_USAGE,
+            FIELD_MAXIMIZE_DOZE,
+    })
+    @Retention(RetentionPolicy.SOURCE)
+    public @interface ModifiableField {}
+
+    /**
+     * @hide
+     */
+    @TestApi
+    public static final int FIELD_GRAYSCALE = 1 << 0;
+    /**
+     * @hide
+     */
+    @TestApi
+    public static final int FIELD_SUPPRESS_AMBIENT_DISPLAY = 1 << 1;
+    /**
+     * @hide
+     */
+    @TestApi
+    public static final int FIELD_DIM_WALLPAPER = 1 << 2;
+    /**
+     * @hide
+     */
+    @TestApi
+    public static final int FIELD_NIGHT_MODE = 1 << 3;
+    /**
+     * @hide
+     */
+    @TestApi
+    public static final int FIELD_DISABLE_AUTO_BRIGHTNESS = 1 << 4;
+    /**
+     * @hide
+     */
+    @TestApi
+    public static final int FIELD_DISABLE_TAP_TO_WAKE = 1 << 5;
+    /**
+     * @hide
+     */
+    @TestApi
+    public static final int FIELD_DISABLE_TILT_TO_WAKE = 1 << 6;
+    /**
+     * @hide
+     */
+    @TestApi
+    public static final int FIELD_DISABLE_TOUCH = 1 << 7;
+    /**
+     * @hide
+     */
+    @TestApi
+    public static final int FIELD_MINIMIZE_RADIO_USAGE = 1 << 8;
+    /**
+     * @hide
+     */
+    @TestApi
+    public static final int FIELD_MAXIMIZE_DOZE = 1 << 9;
+
     private final boolean mGrayscale;
     private final boolean mSuppressAmbientDisplay;
     private final boolean mDimWallpaper;
@@ -45,10 +119,13 @@
     private final boolean mMinimizeRadioUsage;
     private final boolean mMaximizeDoze;
 
+    private final @ModifiableField int mUserModifiedFields; // Bitwise representation
+
     private ZenDeviceEffects(boolean grayscale, boolean suppressAmbientDisplay,
             boolean dimWallpaper, boolean nightMode, boolean disableAutoBrightness,
             boolean disableTapToWake, boolean disableTiltToWake, boolean disableTouch,
-            boolean minimizeRadioUsage, boolean maximizeDoze) {
+            boolean minimizeRadioUsage, boolean maximizeDoze,
+            @ModifiableField int userModifiedFields) {
         mGrayscale = grayscale;
         mSuppressAmbientDisplay = suppressAmbientDisplay;
         mDimWallpaper = dimWallpaper;
@@ -59,6 +136,7 @@
         mDisableTouch = disableTouch;
         mMinimizeRadioUsage = minimizeRadioUsage;
         mMaximizeDoze = maximizeDoze;
+        mUserModifiedFields = userModifiedFields;
     }
 
     @Override
@@ -75,14 +153,15 @@
                 && this.mDisableTiltToWake == that.mDisableTiltToWake
                 && this.mDisableTouch == that.mDisableTouch
                 && this.mMinimizeRadioUsage == that.mMinimizeRadioUsage
-                && this.mMaximizeDoze == that.mMaximizeDoze;
+                && this.mMaximizeDoze == that.mMaximizeDoze
+                && this.mUserModifiedFields == that.mUserModifiedFields;
     }
 
     @Override
     public int hashCode() {
         return Objects.hash(mGrayscale, mSuppressAmbientDisplay, mDimWallpaper, mNightMode,
                 mDisableAutoBrightness, mDisableTapToWake, mDisableTiltToWake, mDisableTouch,
-                mMinimizeRadioUsage, mMaximizeDoze);
+                mMinimizeRadioUsage, mMaximizeDoze, mUserModifiedFields);
     }
 
     @Override
@@ -98,7 +177,43 @@
         if (mDisableTouch) effects.add("disableTouch");
         if (mMinimizeRadioUsage) effects.add("minimizeRadioUsage");
         if (mMaximizeDoze) effects.add("maximizeDoze");
-        return "[" + String.join(", ", effects) + "]";
+        return "[" + String.join(", ", effects) + "]"
+                + " userModifiedFields: " + modifiedFieldsToString(mUserModifiedFields);
+    }
+
+    private String modifiedFieldsToString(int bitmask) {
+        ArrayList<String> modified = new ArrayList<>();
+        if ((bitmask & FIELD_GRAYSCALE) != 0) {
+            modified.add("FIELD_GRAYSCALE");
+        }
+        if ((bitmask & FIELD_SUPPRESS_AMBIENT_DISPLAY) != 0) {
+            modified.add("FIELD_SUPPRESS_AMBIENT_DISPLAY");
+        }
+        if ((bitmask & FIELD_DIM_WALLPAPER) != 0) {
+            modified.add("FIELD_DIM_WALLPAPER");
+        }
+        if ((bitmask & FIELD_NIGHT_MODE) != 0) {
+            modified.add("FIELD_NIGHT_MODE");
+        }
+        if ((bitmask & FIELD_DISABLE_AUTO_BRIGHTNESS) != 0) {
+            modified.add("FIELD_DISABLE_AUTO_BRIGHTNESS");
+        }
+        if ((bitmask & FIELD_DISABLE_TAP_TO_WAKE) != 0) {
+            modified.add("FIELD_DISABLE_TAP_TO_WAKE");
+        }
+        if ((bitmask & FIELD_DISABLE_TILT_TO_WAKE) != 0) {
+            modified.add("FIELD_DISABLE_TILT_TO_WAKE");
+        }
+        if ((bitmask & FIELD_DISABLE_TOUCH) != 0) {
+            modified.add("FIELD_DISABLE_TOUCH");
+        }
+        if ((bitmask & FIELD_MINIMIZE_RADIO_USAGE) != 0) {
+            modified.add("FIELD_MINIMIZE_RADIO_USAGE");
+        }
+        if ((bitmask & FIELD_MAXIMIZE_DOZE) != 0) {
+            modified.add("FIELD_MAXIMIZE_DOZE");
+        }
+        return "{" + String.join(",", modified) + "}";
     }
 
     /**
@@ -194,9 +309,10 @@
     public static final Creator<ZenDeviceEffects> CREATOR = new Creator<ZenDeviceEffects>() {
         @Override
         public ZenDeviceEffects createFromParcel(Parcel in) {
-            return new ZenDeviceEffects(in.readBoolean(), in.readBoolean(), in.readBoolean(),
+            return new ZenDeviceEffects(in.readBoolean(),
                     in.readBoolean(), in.readBoolean(), in.readBoolean(), in.readBoolean(),
-                    in.readBoolean(), in.readBoolean(), in.readBoolean());
+                    in.readBoolean(), in.readBoolean(), in.readBoolean(), in.readBoolean(),
+                    in.readBoolean(), in.readInt());
         }
 
         @Override
@@ -205,6 +321,16 @@
         }
     };
 
+    /**
+     * Gets the bitmask representing which fields are user modified. Bits are set using
+     * {@link ModifiableField}.
+     * @hide
+     */
+    @TestApi
+    public @ModifiableField int getUserModifiedFields() {
+        return mUserModifiedFields;
+    }
+
     @Override
     public int describeContents() {
         return 0;
@@ -222,6 +348,7 @@
         dest.writeBoolean(mDisableTouch);
         dest.writeBoolean(mMinimizeRadioUsage);
         dest.writeBoolean(mMaximizeDoze);
+        dest.writeInt(mUserModifiedFields);
     }
 
     /** Builder class for {@link ZenDeviceEffects} objects. */
@@ -238,6 +365,7 @@
         private boolean mDisableTouch;
         private boolean mMinimizeRadioUsage;
         private boolean mMaximizeDoze;
+        private @ModifiableField int mUserModifiedFields;
 
         /**
          * Instantiates a new {@link ZenPolicy.Builder} with all effects set to default (disabled).
@@ -260,6 +388,7 @@
             mDisableTouch = zenDeviceEffects.shouldDisableTouch();
             mMinimizeRadioUsage = zenDeviceEffects.shouldMinimizeRadioUsage();
             mMaximizeDoze = zenDeviceEffects.shouldMaximizeDoze();
+            mUserModifiedFields = zenDeviceEffects.mUserModifiedFields;
         }
 
         /**
@@ -381,12 +510,24 @@
             return this;
         }
 
+        /**
+         * Sets the bitmask representing which fields are user modified. See the FIELD_ constants.
+         * @hide
+         */
+        @TestApi
+        @NonNull
+        public Builder setUserModifiedFields(@ModifiableField int userModifiedFields) {
+            mUserModifiedFields = userModifiedFields;
+            return this;
+        }
+
         /** Builds a {@link ZenDeviceEffects} object based on the builder's state. */
         @NonNull
         public ZenDeviceEffects build() {
-            return new ZenDeviceEffects(mGrayscale, mSuppressAmbientDisplay, mDimWallpaper,
-                    mNightMode, mDisableAutoBrightness, mDisableTapToWake, mDisableTiltToWake,
-                    mDisableTouch, mMinimizeRadioUsage, mMaximizeDoze);
+            return new ZenDeviceEffects(mGrayscale,
+                    mSuppressAmbientDisplay, mDimWallpaper, mNightMode, mDisableAutoBrightness,
+                    mDisableTapToWake, mDisableTiltToWake, mDisableTouch, mMinimizeRadioUsage,
+                    mMaximizeDoze, mUserModifiedFields);
         }
     }
 }
diff --git a/core/java/android/service/notification/ZenModeConfig.java b/core/java/android/service/notification/ZenModeConfig.java
index fcdc5fe..45a0c20 100644
--- a/core/java/android/service/notification/ZenModeConfig.java
+++ b/core/java/android/service/notification/ZenModeConfig.java
@@ -205,6 +205,7 @@
     private static final String ALLOW_ATT_CONV = "convos";
     private static final String ALLOW_ATT_CONV_FROM = "convosFrom";
     private static final String ALLOW_ATT_CHANNELS = "channels";
+    private static final String USER_MODIFIED_FIELDS = "policyUserModifiedFields";
     private static final String DISALLOW_TAG = "disallow";
     private static final String DISALLOW_ATT_VISUAL_EFFECTS = "visualEffects";
     private static final String STATE_TAG = "state";
@@ -247,6 +248,7 @@
     private static final String RULE_ATT_MODIFIED = "modified";
     private static final String RULE_ATT_ALLOW_MANUAL = "userInvokable";
     private static final String RULE_ATT_TYPE = "type";
+    private static final String RULE_ATT_USER_MODIFIED_FIELDS = "userModifiedFields";
     private static final String RULE_ATT_ICON = "rule_icon";
     private static final String RULE_ATT_TRIGGER_DESC = "triggerDesc";
 
@@ -261,6 +263,7 @@
     private static final String DEVICE_EFFECT_DISABLE_TOUCH = "zdeDisableTouch";
     private static final String DEVICE_EFFECT_MINIMIZE_RADIO_USAGE = "zdeMinimizeRadioUsage";
     private static final String DEVICE_EFFECT_MAXIMIZE_DOZE = "zdeMaximizeDoze";
+    private static final String DEVICE_EFFECT_USER_MODIFIED_FIELDS = "zdeUserModifiedFields";
 
     @UnsupportedAppUsage
     public boolean allowAlarms = DEFAULT_ALLOW_ALARMS;
@@ -748,6 +751,7 @@
             rt.iconResName = parser.getAttributeValue(null, RULE_ATT_ICON);
             rt.triggerDescription = parser.getAttributeValue(null, RULE_ATT_TRIGGER_DESC);
             rt.type = safeInt(parser, RULE_ATT_TYPE, AutomaticZenRule.TYPE_UNKNOWN);
+            rt.userModifiedFields = safeInt(parser, RULE_ATT_USER_MODIFIED_FIELDS, 0);
         }
         return rt;
     }
@@ -794,6 +798,7 @@
                 out.attribute(null, RULE_ATT_TRIGGER_DESC, rule.triggerDescription);
             }
             out.attributeInt(null, RULE_ATT_TYPE, rule.type);
+            out.attributeInt(null, RULE_ATT_USER_MODIFIED_FIELDS, rule.userModifiedFields);
         }
     }
 
@@ -856,6 +861,7 @@
                 builder.allowChannels(channels);
                 policySet = true;
             }
+            builder.setUserModifiedFields(safeInt(parser, USER_MODIFIED_FIELDS, 0));
         }
 
         if (calls != ZenPolicy.PEOPLE_TYPE_UNSET) {
@@ -968,6 +974,7 @@
 
         if (Flags.modesApi()) {
             writeZenPolicyState(ALLOW_ATT_CHANNELS, policy.getAllowedChannels(), out);
+            out.attributeInt(null, USER_MODIFIED_FIELDS, policy.getUserModifiedFields());
         }
     }
 
@@ -993,6 +1000,7 @@
         }
     }
 
+    @FlaggedApi(Flags.FLAG_MODES_API)
     @Nullable
     private static ZenDeviceEffects readZenDeviceEffectsXml(TypedXmlPullParser parser) {
         ZenDeviceEffects deviceEffects = new ZenDeviceEffects.Builder()
@@ -1012,11 +1020,13 @@
                 .setShouldMinimizeRadioUsage(
                         safeBoolean(parser, DEVICE_EFFECT_MINIMIZE_RADIO_USAGE, false))
                 .setShouldMaximizeDoze(safeBoolean(parser, DEVICE_EFFECT_MAXIMIZE_DOZE, false))
+                .setUserModifiedFields(safeInt(parser, DEVICE_EFFECT_USER_MODIFIED_FIELDS, 0))
                 .build();
 
         return deviceEffects.hasEffects() ? deviceEffects : null;
     }
 
+    @FlaggedApi(Flags.FLAG_MODES_API)
     private static void writeZenDeviceEffectsXml(ZenDeviceEffects deviceEffects,
             TypedXmlSerializer out) throws IOException {
         writeBooleanIfTrue(out, DEVICE_EFFECT_DISPLAY_GRAYSCALE,
@@ -1035,6 +1045,8 @@
         writeBooleanIfTrue(out, DEVICE_EFFECT_MINIMIZE_RADIO_USAGE,
                 deviceEffects.shouldMinimizeRadioUsage());
         writeBooleanIfTrue(out, DEVICE_EFFECT_MAXIMIZE_DOZE, deviceEffects.shouldMaximizeDoze());
+        out.attributeInt(null, DEVICE_EFFECT_USER_MODIFIED_FIELDS,
+                deviceEffects.getUserModifiedFields());
     }
 
     private static void writeBooleanIfTrue(TypedXmlSerializer out, String att, boolean value)
@@ -1985,6 +1997,7 @@
         public String triggerDescription;
         public String iconResName;
         public boolean allowManualInvocation;
+        public int userModifiedFields;
 
         public ZenRule() { }
 
@@ -2017,9 +2030,22 @@
                 iconResName = source.readString();
                 triggerDescription = source.readString();
                 type = source.readInt();
+                userModifiedFields = source.readInt();
             }
         }
 
+        /**
+         * @see AutomaticZenRule#canUpdate()
+         */
+        @FlaggedApi(Flags.FLAG_MODES_API)
+        public boolean canBeUpdatedByApp() {
+            // The rule is considered updateable if its bitmask has no user modifications, and
+            // the bitmasks of the policy and device effects have no modification.
+            return userModifiedFields == 0
+                    && (zenPolicy == null || zenPolicy.getUserModifiedFields() == 0)
+                    && (zenDeviceEffects == null || zenDeviceEffects.getUserModifiedFields() == 0);
+        }
+
         @Override
         public int describeContents() {
             return 0;
@@ -2064,6 +2090,7 @@
                 dest.writeString(iconResName);
                 dest.writeString(triggerDescription);
                 dest.writeInt(type);
+                dest.writeInt(userModifiedFields);
             }
         }
 
@@ -2092,7 +2119,8 @@
                         .append(",allowManualInvocation=").append(allowManualInvocation)
                         .append(",iconResName=").append(iconResName)
                         .append(",triggerDescription=").append(triggerDescription)
-                        .append(",type=").append(type);
+                        .append(",type=").append(type)
+                        .append(",userModifiedFields=").append(userModifiedFields);
             }
 
             return sb.append(']').toString();
@@ -2151,7 +2179,8 @@
                         && other.allowManualInvocation == allowManualInvocation
                         && Objects.equals(other.iconResName, iconResName)
                         && Objects.equals(other.triggerDescription, triggerDescription)
-                        && other.type == type;
+                        && other.type == type
+                        && other.userModifiedFields == userModifiedFields;
             }
 
             return finalEquals;
@@ -2163,7 +2192,7 @@
                 return Objects.hash(enabled, snoozing, name, zenMode, conditionId, condition,
                         component, configurationActivity, pkg, id, enabler, zenPolicy,
                         zenDeviceEffects, modified, allowManualInvocation, iconResName,
-                        triggerDescription, type);
+                        triggerDescription, type, userModifiedFields);
             }
             return Objects.hash(enabled, snoozing, name, zenMode, conditionId, condition,
                     component, configurationActivity, pkg, id, enabler, zenPolicy, modified);
diff --git a/core/java/android/service/notification/ZenModeDiff.java b/core/java/android/service/notification/ZenModeDiff.java
index d87e758..8902368 100644
--- a/core/java/android/service/notification/ZenModeDiff.java
+++ b/core/java/android/service/notification/ZenModeDiff.java
@@ -467,6 +467,7 @@
         public static final String FIELD_ICON_RES = "iconResName";
         public static final String FIELD_TRIGGER_DESCRIPTION = "triggerDescription";
         public static final String FIELD_TYPE = "type";
+        public static final String FIELD_USER_MODIFIED_FIELDS = "userModifiedFields";
         // NOTE: new field strings must match the variable names in ZenModeConfig.ZenRule
 
         // Special field to track whether this rule became active or inactive
@@ -562,6 +563,10 @@
                 if (!Objects.equals(from.iconResName, to.iconResName)) {
                     addField(FIELD_ICON_RES, new FieldDiff<>(from.iconResName, to.iconResName));
                 }
+                if (from.userModifiedFields != to.userModifiedFields) {
+                    addField(FIELD_USER_MODIFIED_FIELDS,
+                            new FieldDiff<>(from.userModifiedFields, to.userModifiedFields));
+                }
             }
         }
 
diff --git a/core/java/android/service/notification/ZenPolicy.java b/core/java/android/service/notification/ZenPolicy.java
index 3c1a279..8477eb7 100644
--- a/core/java/android/service/notification/ZenPolicy.java
+++ b/core/java/android/service/notification/ZenPolicy.java
@@ -20,6 +20,8 @@
 import android.annotation.IntDef;
 import android.annotation.NonNull;
 import android.annotation.Nullable;
+import android.annotation.SuppressLint;
+import android.annotation.TestApi;
 import android.app.Flags;
 import android.app.Notification;
 import android.app.NotificationChannel;
@@ -32,6 +34,7 @@
 import java.lang.annotation.RetentionPolicy;
 import java.util.ArrayList;
 import java.util.Collections;
+import java.util.List;
 import java.util.Objects;
 
 /**
@@ -41,12 +44,148 @@
  * a device is in Do Not Disturb mode.
  */
 public final class ZenPolicy implements Parcelable {
-    private ArrayList<Integer> mPriorityCategories;
-    private ArrayList<Integer> mVisualEffects;
+
+    /** Used to track which rule variables have been modified by the user.
+     * Should be checked against the bitmask {@link #getUserModifiedFields()}.
+     * @hide
+     */
+    @IntDef(flag = true, prefix = { "FIELD_" }, value = {
+            FIELD_MESSAGES,
+            FIELD_CALLS,
+            FIELD_CONVERSATIONS,
+            FIELD_ALLOW_CHANNELS,
+            FIELD_PRIORITY_CATEGORY_REMINDERS,
+            FIELD_PRIORITY_CATEGORY_EVENTS,
+            FIELD_PRIORITY_CATEGORY_REPEAT_CALLERS,
+            FIELD_PRIORITY_CATEGORY_ALARMS,
+            FIELD_PRIORITY_CATEGORY_MEDIA,
+            FIELD_PRIORITY_CATEGORY_SYSTEM,
+            FIELD_VISUAL_EFFECT_FULL_SCREEN_INTENT,
+            FIELD_VISUAL_EFFECT_LIGHTS,
+            FIELD_VISUAL_EFFECT_PEEK,
+            FIELD_VISUAL_EFFECT_STATUS_BAR,
+            FIELD_VISUAL_EFFECT_BADGE,
+            FIELD_VISUAL_EFFECT_AMBIENT,
+            FIELD_VISUAL_EFFECT_NOTIFICATION_LIST,
+    })
+    @Retention(RetentionPolicy.SOURCE)
+    public @interface ModifiableField {}
+
+    /**
+     * Covers modifications to MESSAGE_SENDERS and PRIORITY_CATEGORY_MESSAGES, which are set at
+     * the same time.
+     * @hide
+     */
+    @TestApi
+    @FlaggedApi(Flags.FLAG_MODES_API)
+    public static final int FIELD_MESSAGES = 1 << 0;
+    /**
+     * Covers modifications to CALL_SENDERS and PRIORITY_CATEGORY_CALLS, which are set at
+     * the same time.
+     * @hide
+     */
+    @TestApi
+    @FlaggedApi(Flags.FLAG_MODES_API)
+    public static final int FIELD_CALLS = 1 << 1;
+    /**
+     * Covers modifications to CONVERSATION_SENDERS and PRIORITY_CATEGORY_CONVERSATIONS, which are
+     * set at the same time.
+     * @hide
+     */
+    @TestApi
+    @FlaggedApi(Flags.FLAG_MODES_API)
+    public static final int FIELD_CONVERSATIONS = 1 << 2;
+    /**
+     * @hide
+     */
+    @TestApi
+    @FlaggedApi(Flags.FLAG_MODES_API)
+    public static final int FIELD_ALLOW_CHANNELS = 1 << 3;
+    /**
+     * @hide
+     */
+    @FlaggedApi(Flags.FLAG_MODES_API)
+    public static final int FIELD_PRIORITY_CATEGORY_REMINDERS = 1 << 4;
+    /**
+     * @hide
+     */
+    @TestApi
+    @FlaggedApi(Flags.FLAG_MODES_API)
+    public static final int FIELD_PRIORITY_CATEGORY_EVENTS = 1 << 5;
+    /**
+     * @hide
+     */
+    @TestApi
+    @FlaggedApi(Flags.FLAG_MODES_API)
+    public static final int FIELD_PRIORITY_CATEGORY_REPEAT_CALLERS = 1 << 6;
+    /**
+     * @hide
+     */
+    @TestApi
+    @FlaggedApi(Flags.FLAG_MODES_API)
+    public static final int FIELD_PRIORITY_CATEGORY_ALARMS = 1 << 7;
+    /**
+     * @hide
+     */
+    @TestApi
+    @FlaggedApi(Flags.FLAG_MODES_API)
+    public static final int FIELD_PRIORITY_CATEGORY_MEDIA = 1 << 8;
+    /**
+     * @hide
+     */
+    @TestApi
+    @FlaggedApi(Flags.FLAG_MODES_API)
+    public static final int FIELD_PRIORITY_CATEGORY_SYSTEM = 1 << 9;
+    /**
+     * @hide
+     */
+    @TestApi
+    @FlaggedApi(Flags.FLAG_MODES_API)
+    public static final int FIELD_VISUAL_EFFECT_FULL_SCREEN_INTENT = 1 << 10;
+    /**
+     * @hide
+     */
+    @TestApi
+    @FlaggedApi(Flags.FLAG_MODES_API)
+    public static final int FIELD_VISUAL_EFFECT_LIGHTS = 1 << 11;
+    /**
+     * @hide
+     */
+    @TestApi
+    @FlaggedApi(Flags.FLAG_MODES_API)
+    public static final int FIELD_VISUAL_EFFECT_PEEK = 1 << 12;
+    /**
+     * @hide
+     */
+    @TestApi
+    @FlaggedApi(Flags.FLAG_MODES_API)
+    public static final int FIELD_VISUAL_EFFECT_STATUS_BAR = 1 << 13;
+    /**
+     * @hide
+     */
+    @TestApi
+    @FlaggedApi(Flags.FLAG_MODES_API)
+    public static final int FIELD_VISUAL_EFFECT_BADGE = 1 << 14;
+    /**
+     * @hide
+     */
+    @TestApi
+    @FlaggedApi(Flags.FLAG_MODES_API)
+    public static final int FIELD_VISUAL_EFFECT_AMBIENT = 1 << 15;
+    /**
+     * @hide
+     */
+    @TestApi
+    @FlaggedApi(Flags.FLAG_MODES_API)
+    public static final int FIELD_VISUAL_EFFECT_NOTIFICATION_LIST = 1 << 16;
+
+    private List<Integer> mPriorityCategories;
+    private List<Integer> mVisualEffects;
     private @PeopleType int mPriorityMessages = PEOPLE_TYPE_UNSET;
     private @PeopleType int mPriorityCalls = PEOPLE_TYPE_UNSET;
     private @ConversationSenders int mConversationSenders = CONVERSATION_SENDERS_UNSET;
     private @ChannelType int mAllowChannels = CHANNEL_TYPE_UNSET;
+    private final @ModifiableField int mUserModifiedFields; // Bitwise representation
 
     /** @hide */
     @IntDef(prefix = { "PRIORITY_CATEGORY_" }, value = {
@@ -249,6 +388,22 @@
     public ZenPolicy() {
         mPriorityCategories = new ArrayList<>(Collections.nCopies(NUM_PRIORITY_CATEGORIES, 0));
         mVisualEffects = new ArrayList<>(Collections.nCopies(NUM_VISUAL_EFFECTS, 0));
+        mUserModifiedFields = 0;
+    }
+
+    /** @hide */
+    @FlaggedApi(Flags.FLAG_MODES_API)
+    public ZenPolicy(List<Integer> priorityCategories, List<Integer> visualEffects,
+                     @PeopleType int priorityMessages, @PeopleType int priorityCalls,
+                     @ConversationSenders int conversationSenders, @ChannelType int allowChannels,
+                     @ModifiableField int userModifiedFields) {
+        mPriorityCategories = priorityCategories;
+        mVisualEffects = visualEffects;
+        mPriorityMessages = priorityMessages;
+        mPriorityCalls = priorityCalls;
+        mConversationSenders = conversationSenders;
+        mAllowChannels = allowChannels;
+        mUserModifiedFields = userModifiedFields;
     }
 
     /**
@@ -473,6 +628,8 @@
      * is not set, it is (@link STATE_UNSET} and will not change the current set policy.
      */
     public static final class Builder {
+        private @ModifiableField int mUserModifiedFields;
+
         private ZenPolicy mZenPolicy;
 
         public Builder() {
@@ -482,9 +639,14 @@
         /**
          * @hide
          */
-        public Builder(ZenPolicy policy) {
+        @SuppressLint("UnflaggedApi")
+        @TestApi
+        public Builder(@Nullable ZenPolicy policy) {
             if (policy != null) {
                 mZenPolicy = policy.copy();
+                if (Flags.modesApi()) {
+                    mUserModifiedFields = policy.mUserModifiedFields;
+                }
             } else {
                 mZenPolicy = new ZenPolicy();
             }
@@ -494,7 +656,15 @@
          * Builds the current ZenPolicy.
          */
         public @NonNull ZenPolicy build() {
-            return mZenPolicy.copy();
+            if (Flags.modesApi()) {
+                return new ZenPolicy(new ArrayList<Integer>(mZenPolicy.mPriorityCategories),
+                        new ArrayList<Integer>(mZenPolicy.mVisualEffects),
+                        mZenPolicy.mPriorityMessages, mZenPolicy.mPriorityCalls,
+                        mZenPolicy.mConversationSenders, mZenPolicy.mAllowChannels,
+                        mUserModifiedFields);
+            } else {
+                return mZenPolicy.copy();
+            }
         }
 
         /**
@@ -850,6 +1020,28 @@
             mZenPolicy.mAllowChannels = channelType;
             return this;
         }
+
+        /**
+         * Sets the user modified fields bitmask.
+         * @hide
+         */
+        @TestApi
+        @FlaggedApi(Flags.FLAG_MODES_API)
+        public @NonNull Builder setUserModifiedFields(@ModifiableField int userModifiedFields) {
+            mUserModifiedFields = userModifiedFields;
+            return this;
+        }
+    }
+
+    /**
+     Gets the bitmask representing which fields are user modified. Bits are set using
+     * {@link ModifiableField}.
+     * @hide
+     */
+    @TestApi
+    @FlaggedApi(Flags.FLAG_MODES_API)
+    public @ModifiableField int getUserModifiedFields() {
+        return mUserModifiedFields;
     }
 
     @Override
@@ -861,39 +1053,49 @@
     public void writeToParcel(Parcel dest, int flags) {
         dest.writeList(mPriorityCategories);
         dest.writeList(mVisualEffects);
-        dest.writeInt(mPriorityCalls);
         dest.writeInt(mPriorityMessages);
+        dest.writeInt(mPriorityCalls);
         dest.writeInt(mConversationSenders);
         if (Flags.modesApi()) {
             dest.writeInt(mAllowChannels);
+            dest.writeInt(mUserModifiedFields);
         }
     }
 
-    public static final @android.annotation.NonNull Parcelable.Creator<ZenPolicy> CREATOR =
-            new Parcelable.Creator<ZenPolicy>() {
-        @Override
-        public ZenPolicy createFromParcel(Parcel source) {
-            ZenPolicy policy = new ZenPolicy();
-            policy.mPriorityCategories = trimList(
-                    source.readArrayList(Integer.class.getClassLoader(), java.lang.Integer.class),
-                    NUM_PRIORITY_CATEGORIES);
-            policy.mVisualEffects = trimList(
-                    source.readArrayList(Integer.class.getClassLoader(), java.lang.Integer.class),
-                    NUM_VISUAL_EFFECTS);
-            policy.mPriorityCalls = source.readInt();
-            policy.mPriorityMessages = source.readInt();
-            policy.mConversationSenders = source.readInt();
-            if (Flags.modesApi()) {
-                policy.mAllowChannels = source.readInt();
-            }
-            return policy;
-        }
+    public static final @NonNull Creator<ZenPolicy> CREATOR =
+            new Creator<ZenPolicy>() {
+                @Override
+                public ZenPolicy createFromParcel(Parcel source) {
+                    ZenPolicy policy;
+                    if (Flags.modesApi()) {
+                        policy = new ZenPolicy(
+                                trimList(source.readArrayList(Integer.class.getClassLoader(),
+                                        Integer.class), NUM_PRIORITY_CATEGORIES),
+                                trimList(source.readArrayList(Integer.class.getClassLoader(),
+                                        Integer.class), NUM_VISUAL_EFFECTS),
+                                source.readInt(), source.readInt(), source.readInt(),
+                                source.readInt(), source.readInt()
+                        );
+                    } else {
+                        policy = new ZenPolicy();
+                        policy.mPriorityCategories =
+                                trimList(source.readArrayList(Integer.class.getClassLoader(),
+                                        Integer.class), NUM_PRIORITY_CATEGORIES);
+                        policy.mVisualEffects =
+                                trimList(source.readArrayList(Integer.class.getClassLoader(),
+                                        Integer.class), NUM_VISUAL_EFFECTS);
+                        policy.mPriorityMessages = source.readInt();
+                        policy.mPriorityCalls = source.readInt();
+                        policy.mConversationSenders = source.readInt();
+                    }
+                    return policy;
+                }
 
-        @Override
-        public ZenPolicy[] newArray(int size) {
-            return new ZenPolicy[size];
-        }
-    };
+                @Override
+                public ZenPolicy[] newArray(int size) {
+                    return new ZenPolicy[size];
+                }
+            };
 
     @Override
     public String toString() {
@@ -907,10 +1109,69 @@
                         conversationTypeToString(mConversationSenders));
         if (Flags.modesApi()) {
             sb.append(", allowChannels=").append(channelTypeToString(mAllowChannels));
+            sb.append(", userModifiedFields=")
+                    .append(modifiedFieldsToString(mUserModifiedFields));
         }
         return sb.append('}').toString();
     }
 
+    @FlaggedApi(Flags.FLAG_MODES_API)
+    private String modifiedFieldsToString(@ModifiableField int bitmask) {
+        ArrayList<String> modified = new ArrayList<>();
+        if ((bitmask & FIELD_MESSAGES) != 0) {
+            modified.add("FIELD_MESSAGES");
+        }
+        if ((bitmask & FIELD_CALLS) != 0) {
+            modified.add("FIELD_CALLS");
+        }
+        if ((bitmask & FIELD_CONVERSATIONS) != 0) {
+            modified.add("FIELD_CONVERSATIONS");
+        }
+        if ((bitmask & FIELD_ALLOW_CHANNELS) != 0) {
+            modified.add("FIELD_ALLOW_CHANNELS");
+        }
+        if ((bitmask & FIELD_PRIORITY_CATEGORY_REMINDERS) != 0) {
+            modified.add("FIELD_PRIORITY_CATEGORY_REMINDERS");
+        }
+        if ((bitmask & FIELD_PRIORITY_CATEGORY_EVENTS) != 0) {
+            modified.add("FIELD_PRIORITY_CATEGORY_EVENTS");
+        }
+        if ((bitmask & FIELD_PRIORITY_CATEGORY_REPEAT_CALLERS) != 0) {
+            modified.add("FIELD_PRIORITY_CATEGORY_REPEAT_CALLERS");
+        }
+        if ((bitmask & FIELD_PRIORITY_CATEGORY_ALARMS) != 0) {
+            modified.add("FIELD_PRIORITY_CATEGORY_ALARMS");
+        }
+        if ((bitmask & FIELD_PRIORITY_CATEGORY_MEDIA) != 0) {
+            modified.add("FIELD_PRIORITY_CATEGORY_MEDIA");
+        }
+        if ((bitmask & FIELD_PRIORITY_CATEGORY_SYSTEM) != 0) {
+            modified.add("FIELD_PRIORITY_CATEGORY_SYSTEM");
+        }
+        if ((bitmask & FIELD_VISUAL_EFFECT_FULL_SCREEN_INTENT) != 0) {
+            modified.add("FIELD_VISUAL_EFFECT_FULL_SCREEN_INTENT");
+        }
+        if ((bitmask & FIELD_VISUAL_EFFECT_LIGHTS) != 0) {
+            modified.add("FIELD_VISUAL_EFFECT_LIGHTS");
+        }
+        if ((bitmask & FIELD_VISUAL_EFFECT_PEEK) != 0) {
+            modified.add("FIELD_VISUAL_EFFECT_PEEK");
+        }
+        if ((bitmask & FIELD_VISUAL_EFFECT_STATUS_BAR) != 0) {
+            modified.add("FIELD_VISUAL_EFFECT_STATUS_BAR");
+        }
+        if ((bitmask & FIELD_VISUAL_EFFECT_BADGE) != 0) {
+            modified.add("FIELD_VISUAL_EFFECT_BADGE");
+        }
+        if ((bitmask & FIELD_VISUAL_EFFECT_AMBIENT) != 0) {
+            modified.add("FIELD_VISUAL_EFFECT_AMBIENT");
+        }
+        if ((bitmask & FIELD_VISUAL_EFFECT_NOTIFICATION_LIST) != 0) {
+            modified.add("FIELD_VISUAL_EFFECT_NOTIFICATION_LIST");
+        }
+        return "{" + String.join(",", modified) + "}";
+    }
+
     // Returns a list containing the first maxLength elements of the input list if the list is
     // longer than that size. For the lists in ZenPolicy, this should not happen unless the input
     // is corrupt.
@@ -1066,7 +1327,8 @@
                 && other.mPriorityMessages == mPriorityMessages
                 && other.mConversationSenders == mConversationSenders;
         if (Flags.modesApi()) {
-            return eq && other.mAllowChannels == mAllowChannels;
+            return eq && other.mAllowChannels == mAllowChannels
+                    && other.mUserModifiedFields == mUserModifiedFields;
         }
         return eq;
     }
@@ -1075,13 +1337,13 @@
     public int hashCode() {
         if (Flags.modesApi()) {
             return Objects.hash(mPriorityCategories, mVisualEffects, mPriorityCalls,
-                    mPriorityMessages, mConversationSenders, mAllowChannels);
+                    mPriorityMessages, mConversationSenders, mAllowChannels, mUserModifiedFields);
         }
         return Objects.hash(mPriorityCategories, mVisualEffects, mPriorityCalls, mPriorityMessages,
                 mConversationSenders);
     }
 
-    private @ZenPolicy.State int getZenPolicyPriorityCategoryState(@PriorityCategory int
+    private @State int getZenPolicyPriorityCategoryState(@PriorityCategory int
             category) {
         switch (category) {
             case PRIORITY_CATEGORY_REMINDERS:
@@ -1106,7 +1368,7 @@
         return -1;
     }
 
-    private @ZenPolicy.State int getZenPolicyVisualEffectState(@VisualEffect int effect) {
+    private @State int getZenPolicyVisualEffectState(@VisualEffect int effect) {
         switch (effect) {
             case VISUAL_EFFECT_FULL_SCREEN_INTENT:
                 return getVisualEffectFullScreenIntent();
diff --git a/core/java/android/view/DisplayAddress.java b/core/java/android/view/DisplayAddress.java
index 99e811a..c3c4ab5 100644
--- a/core/java/android/view/DisplayAddress.java
+++ b/core/java/android/view/DisplayAddress.java
@@ -138,6 +138,30 @@
             out.writeLong(mPhysicalDisplayId);
         }
 
+        /**
+         * This method is meant to check to see if the ports match
+         * @param a1 Address to compare
+         * @param a2 Address to compare
+         *
+         * @return true if the arguments have the same port, and at least one does not specify
+         *         a model.
+         */
+        public static boolean isPortMatch(DisplayAddress a1, DisplayAddress a2) {
+            // Both displays must be of type Physical
+            if (!(a1 instanceof Physical && a2 instanceof Physical)) {
+                return false;
+            }
+            Physical p1 = (Physical) a1;
+            Physical p2 = (Physical) a2;
+
+            // If both addresses specify a model, fallback to a basic match check (which
+            // also checks the port).
+            if (p1.getModel() != null && p2.getModel() != null) {
+                return p1.equals(p2);
+            }
+            return p1.getPort() == p2.getPort();
+        }
+
         private Physical(long physicalDisplayId) {
             mPhysicalDisplayId = physicalDisplayId;
         }
diff --git a/core/java/android/view/ViewRootImpl.java b/core/java/android/view/ViewRootImpl.java
index 8529b4e..350876c 100644
--- a/core/java/android/view/ViewRootImpl.java
+++ b/core/java/android/view/ViewRootImpl.java
@@ -6943,7 +6943,11 @@
         }
 
         private int doOnBackKeyEvent(KeyEvent keyEvent) {
-            OnBackInvokedCallback topCallback = getOnBackInvokedDispatcher().getTopCallback();
+            WindowOnBackInvokedDispatcher dispatcher = getOnBackInvokedDispatcher();
+            OnBackInvokedCallback topCallback = dispatcher.getTopCallback();
+            if (dispatcher.isDispatching()) {
+                return FINISH_NOT_HANDLED;
+            }
             if (topCallback instanceof OnBackAnimationCallback) {
                 final OnBackAnimationCallback animationCallback =
                         (OnBackAnimationCallback) topCallback;
diff --git a/core/java/android/view/WindowManager.java b/core/java/android/view/WindowManager.java
index 61cf126..b4ac9a2 100644
--- a/core/java/android/view/WindowManager.java
+++ b/core/java/android/view/WindowManager.java
@@ -1494,6 +1494,30 @@
             "android.window.PROPERTY_ACTIVITY_EMBEDDING_SPLITS_ENABLED";
 
     /**
+     * Activity or Application level {@link android.content.pm.PackageManager.Property
+     * PackageManager.Property} for an app to declare that System UI should be shown for this
+     * app/component to allow it to be launched as multiple instances.  This property only affects
+     * SystemUI behavior and does _not_ affect whether a component can actually be launched into
+     * multiple instances, which is determined by the Activity's {@code launchMode} or the launching
+     * Intent's flags.  If the property is set on the Application, then all components within that
+     * application will use that value unless specified per component.
+     *
+     * The value must be a boolean string.
+     *
+     * <p><b>Syntax:</b>
+     * <pre>
+     * &lt;activity&gt;
+     *   &lt;property
+     *     android:name="android.window.PROPERTY_SUPPORTS_MULTI_INSTANCE_SYSTEM_UI"
+     *     android:value="true|false"/&gt;
+     * &lt;/activity&gt;
+     * </pre>
+     */
+    @FlaggedApi(Flags.FLAG_SUPPORTS_MULTI_INSTANCE_SYSTEM_UI)
+    public static final String PROPERTY_SUPPORTS_MULTI_INSTANCE_SYSTEM_UI =
+            "android.window.PROPERTY_SUPPORTS_MULTI_INSTANCE_SYSTEM_UI";
+
+    /**
      * Request for app's keyboard shortcuts to be retrieved asynchronously.
      *
      * @param receiver The callback to be triggered when the result is ready.
@@ -3163,6 +3187,12 @@
         public static final int PRIVATE_FLAG_DISABLE_WALLPAPER_TOUCH_EVENTS = 1 << 10;
 
         /**
+         * Flag to indicate that the window is forcibly to go edge-to-edge.
+         * @hide
+         */
+        public static final int PRIVATE_FLAG_EDGE_TO_EDGE_ENFORCED = 1 << 11;
+
+        /**
          * Flag to indicate that the window frame should be the requested frame adding the display
          * cutout frame. This will only be applied if a specific size smaller than the parent frame
          * is given, and the window is covering the display cutout. The extended frame will not be
@@ -3338,6 +3368,7 @@
                 PRIVATE_FLAG_SYSTEM_ERROR,
                 PRIVATE_FLAG_OPTIMIZE_MEASURE,
                 PRIVATE_FLAG_DISABLE_WALLPAPER_TOUCH_EVENTS,
+                PRIVATE_FLAG_EDGE_TO_EDGE_ENFORCED,
                 PRIVATE_FLAG_LAYOUT_SIZE_EXTENDED_BY_CUTOUT,
                 PRIVATE_FLAG_FORCE_DECOR_VIEW_VISIBILITY,
                 PRIVATE_FLAG_LAYOUT_CHILD_WINDOW_IN_PARENT_FRAME,
@@ -3400,6 +3431,10 @@
                         equals = PRIVATE_FLAG_DISABLE_WALLPAPER_TOUCH_EVENTS,
                         name = "DISABLE_WALLPAPER_TOUCH_EVENTS"),
                 @ViewDebug.FlagToString(
+                        mask = PRIVATE_FLAG_EDGE_TO_EDGE_ENFORCED,
+                        equals = PRIVATE_FLAG_EDGE_TO_EDGE_ENFORCED,
+                        name = "EDGE_TO_EDGE_ENFORCED"),
+                @ViewDebug.FlagToString(
                         mask = PRIVATE_FLAG_LAYOUT_SIZE_EXTENDED_BY_CUTOUT,
                         equals = PRIVATE_FLAG_LAYOUT_SIZE_EXTENDED_BY_CUTOUT,
                         name = "LAYOUT_SIZE_EXTENDED_BY_CUTOUT"),
diff --git a/core/java/android/view/inputmethod/InputMethodManager.java b/core/java/android/view/inputmethod/InputMethodManager.java
index feccc6b..3bc02a6 100644
--- a/core/java/android/view/inputmethod/InputMethodManager.java
+++ b/core/java/android/view/inputmethod/InputMethodManager.java
@@ -354,7 +354,11 @@
      * @hide
      */
     public static void ensureDefaultInstanceForDefaultDisplayIfNecessary() {
-        forContextInternal(Display.DEFAULT_DISPLAY, Looper.getMainLooper());
+        // Skip this call if we are in system_server, as the system code should not use this
+        // deprecated instance.
+        if (!ActivityThread.isSystem()) {
+            forContextInternal(Display.DEFAULT_DISPLAY, Looper.getMainLooper());
+        }
     }
 
     private static final Object sLock = new Object();
diff --git a/core/java/android/window/WindowOnBackInvokedDispatcher.java b/core/java/android/window/WindowOnBackInvokedDispatcher.java
index 6a8ca33..86804c6 100644
--- a/core/java/android/window/WindowOnBackInvokedDispatcher.java
+++ b/core/java/android/window/WindowOnBackInvokedDispatcher.java
@@ -174,6 +174,21 @@
         }
     }
 
+    /**
+     * Indicates if the dispatcher is actively dispatching to a callback.
+     */
+    public boolean isDispatching() {
+        return mIsDispatching;
+    }
+
+    private void onStartDispatching() {
+        mIsDispatching = true;
+    }
+
+    private void onStopDispatching() {
+        mIsDispatching = false;
+    }
+
     private void sendCancelledIfInProgress(@NonNull OnBackInvokedCallback callback) {
         boolean isInProgress = mProgressAnimator.isBackAnimationInProgress();
         if (isInProgress && callback instanceof OnBackAnimationCallback) {
@@ -231,7 +246,7 @@
                                     .ImeOnBackInvokedCallback
                                 ? ((ImeOnBackInvokedDispatcher.ImeOnBackInvokedCallback)
                                         callback).getIOnBackInvokedCallback()
-                                : new OnBackInvokedCallbackWrapper(callback);
+                                : new OnBackInvokedCallbackWrapper(callback, this);
                 callbackInfo = new OnBackInvokedCallbackInfo(
                         iCallback,
                         priority,
@@ -258,6 +273,7 @@
 
     @NonNull
     private static final BackProgressAnimator mProgressAnimator = new BackProgressAnimator();
+    private boolean mIsDispatching = false;
 
     /**
      * The {@link Context} in ViewRootImp and Activity could be different, this will make sure it
@@ -317,18 +333,33 @@
             }
         }
         final CallbackRef mCallbackRef;
+        /**
+         * The dispatcher this callback is registered with.
+         * This can be null for callbacks on {@link ImeOnBackInvokedDispatcher} because they are
+         * forwarded and registered on the app's {@link WindowOnBackInvokedDispatcher}. */
+        @Nullable
+        private final WindowOnBackInvokedDispatcher mDispatcher;
 
-        OnBackInvokedCallbackWrapper(@NonNull OnBackInvokedCallback callback) {
+        OnBackInvokedCallbackWrapper(
+                @NonNull OnBackInvokedCallback callback,
+                WindowOnBackInvokedDispatcher dispatcher) {
             mCallbackRef = new CallbackRef(callback, true /* useWeakRef */);
+            mDispatcher = dispatcher;
         }
 
-        OnBackInvokedCallbackWrapper(@NonNull OnBackInvokedCallback callback, boolean useWeakRef) {
+        OnBackInvokedCallbackWrapper(
+                @NonNull OnBackInvokedCallback callback,
+                boolean useWeakRef) {
             mCallbackRef = new CallbackRef(callback, useWeakRef);
+            mDispatcher = null;
         }
 
         @Override
         public void onBackStarted(BackMotionEvent backEvent) {
             Handler.getMain().post(() -> {
+                if (mDispatcher != null) {
+                    mDispatcher.onStartDispatching();
+                }
                 final OnBackAnimationCallback callback = getBackAnimationCallback();
                 if (callback != null) {
                     mProgressAnimator.onBackStarted(backEvent, event ->
@@ -353,6 +384,9 @@
         @Override
         public void onBackCancelled() {
             Handler.getMain().post(() -> {
+                if (mDispatcher != null) {
+                    mDispatcher.onStopDispatching();
+                }
                 mProgressAnimator.onBackCancelled(() -> {
                     final OnBackAnimationCallback callback = getBackAnimationCallback();
                     if (callback != null) {
@@ -365,6 +399,9 @@
         @Override
         public void onBackInvoked() throws RemoteException {
             Handler.getMain().post(() -> {
+                if (mDispatcher != null) {
+                    mDispatcher.onStopDispatching();
+                }
                 boolean isInProgress = mProgressAnimator.isBackAnimationInProgress();
                 mProgressAnimator.reset();
                 final OnBackInvokedCallback callback = mCallbackRef.get();
diff --git a/core/java/android/window/flags/windowing_frontend.aconfig b/core/java/android/window/flags/windowing_frontend.aconfig
index 3366a7e..f2bce9c 100644
--- a/core/java/android/window/flags/windowing_frontend.aconfig
+++ b/core/java/android/window/flags/windowing_frontend.aconfig
@@ -82,4 +82,12 @@
     description: "Enable record activity snapshot by default"
     bug: "259497289"
     is_fixed_read_only: true
+}
+
+flag {
+    name: "supports_multi_instance_system_ui"
+    namespace: "multitasking"
+    description: "Feature flag to enable a multi-instance system ui component property."
+    bug: "262864589"
+    is_fixed_read_only: true
 }
\ No newline at end of file
diff --git a/core/java/com/android/internal/config/sysui/SystemUiSystemPropertiesFlags.java b/core/java/com/android/internal/config/sysui/SystemUiSystemPropertiesFlags.java
index 1bd0982..eeea17b 100644
--- a/core/java/com/android/internal/config/sysui/SystemUiSystemPropertiesFlags.java
+++ b/core/java/com/android/internal/config/sysui/SystemUiSystemPropertiesFlags.java
@@ -68,10 +68,10 @@
         // TODO b/291899544: for released flags, use resource config values
         /** Value used by polite notif. feature */
         public static final Flag NOTIF_COOLDOWN_T1 = devFlag(
-                "persist.debug.sysui.notification.notif_cooldown_t1", 5000);
+                "persist.debug.sysui.notification.notif_cooldown_t1", 60000);
         /** Value used by polite notif. feature */
         public static final Flag NOTIF_COOLDOWN_T2 = devFlag(
-                "persist.debug.sysui.notification.notif_cooldown_t2", 3000);
+                "persist.debug.sysui.notification.notif_cooldown_t2", 5000);
         /** Value used by polite notif. feature */
         public static final Flag NOTIF_VOLUME1 = devFlag(
                 "persist.debug.sysui.notification.notif_volume1", 30);
@@ -80,12 +80,6 @@
         /** Value used by polite notif. feature. -1 to ignore the counter */
         public static final Flag NOTIF_COOLDOWN_COUNTER_RESET = devFlag(
                 "persist.debug.sysui.notification.notif_cooldown_counter_reset", 10);
-        /**
-         * Value used by polite notif. feature: cooldown behavior/strategy. Valid values: rule1,
-         * rule2
-         */
-        public static final Flag NOTIF_COOLDOWN_RULE = devFlag(
-                "persist.debug.sysui.notification.notif_cooldown_rule", "rule1");
 
         /** b/303716154: For debugging only: use short bitmap duration. */
         public static final Flag DEBUG_SHORT_BITMAP_DURATION = devFlag(
diff --git a/core/java/com/android/internal/policy/PhoneWindow.java b/core/java/com/android/internal/policy/PhoneWindow.java
index 31910ac..4e3b64c 100644
--- a/core/java/com/android/internal/policy/PhoneWindow.java
+++ b/core/java/com/android/internal/policy/PhoneWindow.java
@@ -31,6 +31,7 @@
 import static android.view.WindowManager.LayoutParams.FLAG_TRANSLUCENT_STATUS;
 import static android.view.WindowManager.LayoutParams.LAYOUT_IN_DISPLAY_CUTOUT_MODE_ALWAYS;
 import static android.view.WindowManager.LayoutParams.LAYOUT_IN_DISPLAY_CUTOUT_MODE_DEFAULT;
+import static android.view.WindowManager.LayoutParams.PRIVATE_FLAG_EDGE_TO_EDGE_ENFORCED;
 import static android.view.WindowManager.LayoutParams.PRIVATE_FLAG_FORCE_DRAW_BAR_BACKGROUNDS;
 import static android.view.WindowManager.LayoutParams.PRIVATE_FLAG_NO_MOVE_ANIMATION;
 
@@ -46,6 +47,7 @@
 import android.compat.annotation.UnsupportedAppUsage;
 import android.content.Context;
 import android.content.Intent;
+import android.content.pm.ApplicationInfo;
 import android.content.pm.PackageManager;
 import android.content.res.Configuration;
 import android.content.res.Resources.Theme;
@@ -294,9 +296,9 @@
     private int mFrameResource = 0;
 
     private int mTextColor = 0;
-    int mStatusBarColor = 0;
-    int mNavigationBarColor = 0;
-    int mNavigationBarDividerColor = 0;
+    int mStatusBarColor = Color.TRANSPARENT;
+    int mNavigationBarColor = Color.TRANSPARENT;
+    int mNavigationBarDividerColor = Color.TRANSPARENT;
     private boolean mForcedStatusBarColor = false;
     private boolean mForcedNavigationBarColor = false;
 
@@ -388,11 +390,9 @@
         mProxyOnBackInvokedDispatcher = new ProxyOnBackInvokedDispatcher(context);
         mAllowFloatingWindowsFillScreen = context.getResources().getBoolean(
                 com.android.internal.R.bool.config_allowFloatingWindowsFillScreen);
-        mEdgeToEdgeEnforced =
-                context.getApplicationInfo().targetSdkVersion >= ENFORCE_EDGE_TO_EDGE_SDK_VERSION
-                        || (CompatChanges.isChangeEnabled(ENFORCE_EDGE_TO_EDGE)
-                                && Flags.enforceEdgeToEdge());
+        mEdgeToEdgeEnforced = isEdgeToEdgeEnforced(context.getApplicationInfo(), true /* local */);
         if (mEdgeToEdgeEnforced) {
+            getAttributes().privateFlags |= PRIVATE_FLAG_EDGE_TO_EDGE_ENFORCED;
             mDecorFitsSystemWindows = false;
         }
     }
@@ -431,6 +431,22 @@
         mActivityConfigCallback = activityConfigCallback;
     }
 
+    /**
+     * Returns whether the given application is enforced to go edge-to-edge.
+     *
+     * @param info The application to query.
+     * @param local Whether this is called from the process of the given application.
+     * @return {@code true} if edge-to-edge is enforced. Otherwise, {@code false}.
+     */
+    public static boolean isEdgeToEdgeEnforced(ApplicationInfo info, boolean local) {
+        return info.targetSdkVersion >= ENFORCE_EDGE_TO_EDGE_SDK_VERSION
+                || (Flags.enforceEdgeToEdge() && (local
+                        // Calling this doesn't require a permission.
+                        ? CompatChanges.isChangeEnabled(ENFORCE_EDGE_TO_EDGE)
+                        // Calling this requires permissions.
+                        : info.isChangeEnabled(ENFORCE_EDGE_TO_EDGE)));
+    }
+
     @Override
     public final void setContainer(Window container) {
         super.setContainer(container);
@@ -2548,17 +2564,10 @@
         final boolean targetPreL = targetSdk < android.os.Build.VERSION_CODES.LOLLIPOP;
         final boolean targetPreQ = targetSdk < Build.VERSION_CODES.Q;
 
-        if (!mForcedStatusBarColor) {
-            final int statusBarCompatibleColor = context.getColor(R.color.status_bar_compatible);
-            final int statusBarDefaultColor = context.getColor(R.color.status_bar_default);
-            final int statusBarColor = a.getColor(R.styleable.Window_statusBarColor,
-                    statusBarDefaultColor);
-
-            mStatusBarColor = statusBarColor == statusBarDefaultColor && !mEdgeToEdgeEnforced
-                    ? statusBarCompatibleColor
-                    : statusBarColor;
+        if (!mForcedStatusBarColor && !mEdgeToEdgeEnforced) {
+            mStatusBarColor = a.getColor(R.styleable.Window_statusBarColor, Color.BLACK);
         }
-        if (!mForcedNavigationBarColor) {
+        if (!mForcedNavigationBarColor && !mEdgeToEdgeEnforced) {
             final int navBarCompatibleColor = context.getColor(R.color.navigation_bar_compatible);
             final int navBarDefaultColor = context.getColor(R.color.navigation_bar_default);
             final int navBarColor = a.getColor(R.styleable.Window_navigationBarColor,
@@ -2566,7 +2575,6 @@
 
             mNavigationBarColor =
                     navBarColor == navBarDefaultColor
-                            && !mEdgeToEdgeEnforced
                             && !context.getResources().getBoolean(
                                     R.bool.config_navBarDefaultTransparent)
                     ? navBarCompatibleColor
@@ -2575,7 +2583,7 @@
             mNavigationBarDividerColor = a.getColor(R.styleable.Window_navigationBarDividerColor,
                     Color.TRANSPARENT);
         }
-        if (!targetPreQ) {
+        if (!targetPreQ && !mEdgeToEdgeEnforced) {
             mEnsureStatusBarContrastWhenTransparent = a.getBoolean(
                     R.styleable.Window_enforceStatusBarContrast, false);
             mEnsureNavigationBarContrastWhenTransparent = a.getBoolean(
@@ -3899,6 +3907,9 @@
 
     @Override
     public void setStatusBarColor(int color) {
+        if (mEdgeToEdgeEnforced) {
+            return;
+        }
         if (mStatusBarColor == color && mForcedStatusBarColor) {
             return;
         }
@@ -3920,6 +3931,9 @@
 
     @Override
     public void setNavigationBarColor(int color) {
+        if (mEdgeToEdgeEnforced) {
+            return;
+        }
         if (mNavigationBarColor == color && mForcedNavigationBarColor) {
             return;
         }
@@ -3936,6 +3950,9 @@
 
     @Override
     public void setNavigationBarDividerColor(int navigationBarDividerColor) {
+        if (mEdgeToEdgeEnforced) {
+            return;
+        }
         mNavigationBarDividerColor = navigationBarDividerColor;
         if (mDecor != null) {
             mDecor.updateColorViews(null, false /* animate */);
@@ -3949,6 +3966,9 @@
 
     @Override
     public void setStatusBarContrastEnforced(boolean ensureContrast) {
+        if (mEdgeToEdgeEnforced) {
+            return;
+        }
         mEnsureStatusBarContrastWhenTransparent = ensureContrast;
         if (mDecor != null) {
             mDecor.updateColorViews(null, false /* animate */);
@@ -3962,6 +3982,9 @@
 
     @Override
     public void setNavigationBarContrastEnforced(boolean enforceContrast) {
+        if (mEdgeToEdgeEnforced) {
+            return;
+        }
         mEnsureNavigationBarContrastWhenTransparent = enforceContrast;
         if (mDecor != null) {
             mDecor.updateColorViews(null, false /* animate */);
@@ -4031,6 +4054,9 @@
 
     @Override
     public void setDecorFitsSystemWindows(boolean decorFitsSystemWindows) {
+        if (mEdgeToEdgeEnforced) {
+            return;
+        }
         mDecorFitsSystemWindows = decorFitsSystemWindows;
         applyDecorFitsSystemWindows();
     }
diff --git a/core/java/com/android/server/OWNERS b/core/java/com/android/server/OWNERS
deleted file mode 100644
index 1c2d19d..0000000
--- a/core/java/com/android/server/OWNERS
+++ /dev/null
@@ -1 +0,0 @@
-per-file SystemConfig.java = file:/PACKAGE_MANAGER_OWNERS
diff --git a/core/jni/android_database_SQLiteConnection.cpp b/core/jni/android_database_SQLiteConnection.cpp
index 893cc98..6f1c763 100644
--- a/core/jni/android_database_SQLiteConnection.cpp
+++ b/core/jni/android_database_SQLiteConnection.cpp
@@ -82,10 +82,16 @@
     const String8 path;
     const String8 label;
 
+    // The prepared statement used to determine which tables are updated by a statement.  This
+    // is is initially null.  It is set non-null on first use.
+    sqlite3_stmt* tableQuery;
+
     volatile bool canceled;
 
     SQLiteConnection(sqlite3* db, int openFlags, const String8& path, const String8& label) :
-        db(db), openFlags(openFlags), path(path), label(label), canceled(false) { }
+            db(db), openFlags(openFlags), path(path), label(label), tableQuery(nullptr),
+            canceled(false) { }
+
 };
 
 // Called each time a statement begins execution, when tracing is enabled.
@@ -188,6 +194,9 @@
 
     if (connection) {
         ALOGV("Closing connection %p", connection->db);
+        if (connection->tableQuery != nullptr) {
+            sqlite3_finalize(connection->tableQuery);
+        }
         int err = sqlite3_close(connection->db);
         if (err != SQLITE_OK) {
             // This can happen if sub-objects aren't closed first.  Make sure the caller knows.
@@ -419,6 +428,46 @@
     return sqlite3_stmt_readonly(statement) != 0;
 }
 
+static jboolean nativeUpdatesTempOnly(JNIEnv* env, jclass,
+        jlong connectionPtr, jlong statementPtr) {
+    sqlite3_stmt* statement = reinterpret_cast<sqlite3_stmt*>(statementPtr);
+    SQLiteConnection* connection = reinterpret_cast<SQLiteConnection*>(connectionPtr);
+
+    int result = SQLITE_OK;
+    if (connection->tableQuery == nullptr) {
+        static char const* sql =
+                "SELECT COUNT(*) FROM tables_used(?) WHERE schema != 'temp' AND wr != 0";
+        result = sqlite3_prepare_v2(connection->db, sql, -1, &connection->tableQuery, nullptr);
+        if (result != SQLITE_OK) {
+            ALOGE("failed to compile query table: %s",
+                  sqlite3_errstr(sqlite3_extended_errcode(connection->db)));
+            return false;
+        }
+    }
+
+    // A temporary, to simplify the code.
+    sqlite3_stmt* query = connection->tableQuery;
+    sqlite3_reset(query);
+    sqlite3_clear_bindings(query);
+    result = sqlite3_bind_text(query, 1, sqlite3_sql(statement), -1, SQLITE_STATIC);
+    if (result != SQLITE_OK) {
+        ALOGE("tables bind pointer returns %s", sqlite3_errstr(result));
+        return false;
+    }
+    result = sqlite3_step(query);
+    if (result != SQLITE_ROW) {
+        ALOGE("tables query error: %d/%s", result, sqlite3_errstr(result));
+        // Make sure the query is no longer bound to the statement.
+        sqlite3_clear_bindings(query);
+        return false;
+    }
+
+    int count = sqlite3_column_int(query, 0);
+    // Make sure the query is no longer bound to the statement SQL string.
+    sqlite3_clear_bindings(query);
+    return count == 0;
+}
+
 static jint nativeGetColumnCount(JNIEnv* env, jclass clazz, jlong connectionPtr,
         jlong statementPtr) {
     sqlite3_stmt* statement = reinterpret_cast<sqlite3_stmt*>(statementPtr);
@@ -915,6 +964,8 @@
             (void*)nativeGetParameterCount },
     { "nativeIsReadOnly", "(JJ)Z",
             (void*)nativeIsReadOnly },
+    { "nativeUpdatesTempOnly", "(JJ)Z",
+            (void*)nativeUpdatesTempOnly },
     { "nativeGetColumnCount", "(JJ)I",
             (void*)nativeGetColumnCount },
     { "nativeGetColumnName", "(JJI)Ljava/lang/String;",
diff --git a/core/jni/android_os_VintfObject.cpp b/core/jni/android_os_VintfObject.cpp
index 1baea2a..b651711 100644
--- a/core/jni/android_os_VintfObject.cpp
+++ b/core/jni/android_os_VintfObject.cpp
@@ -46,6 +46,7 @@
 using vintf::Version;
 using vintf::VintfObject;
 using vintf::Vndk;
+using vintf::CheckFlags::ENABLE_ALL_CHECKS;
 
 template<typename V>
 static inline jobjectArray toJavaStringArray(JNIEnv* env, const V& v) {
@@ -93,12 +94,13 @@
     return toJavaStringArray(env, cStrings);
 }
 
-static jint android_os_VintfObject_verifyWithoutAvb(JNIEnv* env, jclass) {
+static jint android_os_VintfObject_verifyBuildAtBoot(JNIEnv* env, jclass) {
     std::string error;
-    int32_t status = VintfObject::GetInstance()->checkCompatibility(&error,
-            ::android::vintf::CheckFlags::DISABLE_AVB_CHECK);
+    int32_t status =
+            VintfObject::GetInstance()
+                    ->checkCompatibility(&error, ENABLE_ALL_CHECKS.disableAvb().disableKernel());
     if (status)
-        LOG(WARNING) << "VintfObject.verifyWithoutAvb() returns " << status << ": " << error;
+        LOG(WARNING) << "VintfObject.verifyBuildAtBoot() returns " << status << ": " << error;
     return status;
 }
 
@@ -170,7 +172,7 @@
 
 static const JNINativeMethod gVintfObjectMethods[] = {
         {"report", "()[Ljava/lang/String;", (void*)android_os_VintfObject_report},
-        {"verifyWithoutAvb", "()I", (void*)android_os_VintfObject_verifyWithoutAvb},
+        {"verifyBuildAtBoot", "()I", (void*)android_os_VintfObject_verifyBuildAtBoot},
         {"getHalNamesAndVersions", "()[Ljava/lang/String;",
          (void*)android_os_VintfObject_getHalNamesAndVersions},
         {"getSepolicyVersion", "()Ljava/lang/String;",
diff --git a/core/jni/hwbinder/EphemeralStorage.cpp b/core/jni/hwbinder/EphemeralStorage.cpp
index 95bb42e..ef0750c 100644
--- a/core/jni/hwbinder/EphemeralStorage.cpp
+++ b/core/jni/hwbinder/EphemeralStorage.cpp
@@ -164,7 +164,7 @@
             }
 
             default:
-                CHECK(!"Should not be here");
+                CHECK(!"Should not be here") << "Item type: " << item.mType;
         }
     }
 
diff --git a/core/res/AndroidManifest.xml b/core/res/AndroidManifest.xml
index 1eeffb9..ef6caef 100644
--- a/core/res/AndroidManifest.xml
+++ b/core/res/AndroidManifest.xml
@@ -7147,6 +7147,16 @@
         android:label="@string/permlab_foregroundServiceFileManagement"
         android:protectionLevel="normal|instant" />
 
+    <!-- @FlaggedApi("android.content.pm.introduce_media_processing_type")
+         Allows a regular application to use {@link android.app.Service#startForeground
+         Service.startForeground} with the type "mediaProcessing".
+         <p>Protection level: normal|instant
+    -->
+    <permission android:name="android.permission.FOREGROUND_SERVICE_MEDIA_PROCESSING"
+                android:description="@string/permdesc_foregroundServiceMediaProcessing"
+                android:label="@string/permlab_foregroundServiceMediaProcessing"
+                android:protectionLevel="normal|instant" />
+
     <!-- Allows a regular application to use {@link android.app.Service#startForeground
          Service.startForeground} with the type "specialUse".
          <p>Protection level: normal|appop|instant
diff --git a/core/res/res/values/attrs_manifest.xml b/core/res/res/values/attrs_manifest.xml
index d1143c4..8fae6db 100644
--- a/core/res/res/values/attrs_manifest.xml
+++ b/core/res/res/values/attrs_manifest.xml
@@ -301,9 +301,7 @@
             granted to the system companion device manager service -->
         <flag name="companion" value="0x800000" />
         <!-- Additional flag from base permission type: this permission will be granted to the
-             retail demo app, as defined by the OEM.
-             This flag has been replaced by the retail demo role and is a no-op since Android V.
-          -->
+             retail demo app, as defined by the OEM. -->
         <flag name="retailDemo" value="0x1000000" />
         <!-- Additional flag from base permission type: this permission will be granted to the
              recents app. -->
@@ -1746,6 +1744,12 @@
             TODO: b/258855262 mark this field as {@code hide} once this bug is fixed.
             <flag name="fileManagement" value="0x1000" />
         -->
+        <!-- Media processing use cases such as video or photo editing and processing.
+            <p>Requires the app to hold the permission
+            {@link android.Manifest.permission#FOREGROUND_SERVICE_MEDIA_PROCESSING} in order to use
+            this type.
+        -->
+        <flag name="mediaProcessing" value="0x2000" />
         <!-- Use cases that can't be categorized into any other foreground service types, but also
             can't use @link android.app.job.JobInfo.Builder} APIs.
             See {@link android.content.pm.ServiceInfo#FOREGROUND_SERVICE_TYPE_SPECIAL_USE} for the
diff --git a/core/res/res/values/colors.xml b/core/res/res/values/colors.xml
index eddd81e..53a6270 100644
--- a/core/res/res/values/colors.xml
+++ b/core/res/res/values/colors.xml
@@ -568,10 +568,6 @@
     <color name="side_fps_button_color">#00677E</color>
 
     <!-- Color for system bars -->
-    <color name="status_bar_compatible">@android:color/black</color>
-    <!-- This uses non-regular transparent intentionally. It is used to tell if the transparent
-         color is set by the framework or not. -->
-    <color name="status_bar_default">#00808080</color>
     <color name="navigation_bar_compatible">@android:color/black</color>
     <!-- This uses non-regular transparent intentionally. It is used to tell if the transparent
          color is set by the framework or not. -->
diff --git a/core/res/res/values/config_telephony.xml b/core/res/res/values/config_telephony.xml
index 8d80af4..5346454 100644
--- a/core/res/res/values/config_telephony.xml
+++ b/core/res/res/values/config_telephony.xml
@@ -212,6 +212,36 @@
     <bool name="config_send_satellite_datagram_to_modem_in_demo_mode">false</bool>
     <java-symbol type="bool" name="config_send_satellite_datagram_to_modem_in_demo_mode" />
 
+    <!-- List of country codes where oem-enabled satellite services are either allowed or disallowed
+         by the device. Each country code is a lowercase 2 character ISO-3166-1 alpha-2.
+         -->
+    <string-array name="config_oem_enabled_satellite_country_codes">
+    </string-array>
+    <java-symbol type="array" name="config_oem_enabled_satellite_country_codes" />
+
+    <!-- The file storing S2-cell-based satellite access restriction of the countries defined by
+         config_oem_enabled_satellite_countries. -->
+    <string name="config_oem_enabled_satellite_s2cell_file"></string>
+    <java-symbol type="string" name="config_oem_enabled_satellite_s2cell_file" />
+
+    <!-- Whether to treat the countries defined by the config_oem_enabled_satellite_countries
+         as satellite-allowed areas. The default true value means the countries defined by
+         config_oem_enabled_satellite_countries will be treated as satellite-allowed areas.
+         -->
+    <bool name="config_oem_enabled_satellite_access_allow">true</bool>
+    <java-symbol type="bool" name="config_oem_enabled_satellite_access_allow" />
+
+    <!-- The time duration in seconds which is used to decide whether the Location returned from
+         LocationManager#getLastKnownLocation is fresh.
+
+         The Location is considered fresh if the duration from the Location's elapsed real time to
+         the current elapsed real time is less than this config. If the Location is considered
+         fresh, it will be used as the current location by Telephony to decide whether satellite
+         services should be allowed.
+         -->
+    <integer name="config_oem_enabled_satellite_location_fresh_duration">600</integer>
+    <java-symbol type="integer" name="config_oem_enabled_satellite_location_fresh_duration" />
+
     <!-- Whether enhanced IWLAN handover check is enabled. If enabled, telephony frameworks
          will not perform handover if the target transport is out of service, or VoPS not
          supported. The network will be torn down on the source transport, and will be
diff --git a/core/res/res/values/public-staging.xml b/core/res/res/values/public-staging.xml
index 540967d..17bb86a 100644
--- a/core/res/res/values/public-staging.xml
+++ b/core/res/res/values/public-staging.xml
@@ -128,7 +128,7 @@
   </staging-public-group>
 
   <staging-public-group type="string" first-id="0x01ba0000">
-    <!-- @hide @SystemApi -->
+    <!-- @hide @SystemApi @FlaggedApi("android.permission.flags.retail_demo_role_enabled") -->
     <public name="config_defaultRetailDemo" />
   </staging-public-group>
 
diff --git a/core/res/res/values/strings.xml b/core/res/res/values/strings.xml
index d2fb9e1..542e9d6 100644
--- a/core/res/res/values/strings.xml
+++ b/core/res/res/values/strings.xml
@@ -1248,6 +1248,11 @@
     <string name="permdesc_foregroundServiceFileManagement">Allows the app to make use of foreground services with the type \"fileManagement\"</string>
 
     <!-- Title of an application permission, listed so the user can choose whether they want to allow the application to do this. -->
+    <string name="permlab_foregroundServiceMediaProcessing">run foreground service with the type \"mediaProcessing\"</string>
+    <!-- Description of an application permission, listed so the user can choose whether they want to allow the application to do this. -->
+    <string name="permdesc_foregroundServiceMediaProcessing">Allows the app to make use of foreground services with the type \"mediaProcessing\"</string>
+
+    <!-- Title of an application permission, listed so the user can choose whether they want to allow the application to do this. -->
     <string name="permlab_foregroundServiceSpecialUse">run foreground service with the type \"specialUse\"</string>
     <!-- Description of an application permission, listed so the user can choose whether they want to allow the application to do this. -->
     <string name="permdesc_foregroundServiceSpecialUse">Allows the app to make use of foreground services with the type \"specialUse\"</string>
diff --git a/core/res/res/values/symbols.xml b/core/res/res/values/symbols.xml
index b0a4c16..d12ef2b 100644
--- a/core/res/res/values/symbols.xml
+++ b/core/res/res/values/symbols.xml
@@ -3095,8 +3095,6 @@
   <java-symbol type="bool" name="config_navBarDefaultTransparent" />
   <java-symbol type="color" name="navigation_bar_default"/>
   <java-symbol type="color" name="navigation_bar_compatible"/>
-  <java-symbol type="color" name="status_bar_default"/>
-  <java-symbol type="color" name="status_bar_compatible"/>
 
   <!-- EditText suggestion popup. -->
   <java-symbol type="id" name="suggestionWindowContainer" />
diff --git a/core/res/res/values/themes.xml b/core/res/res/values/themes.xml
index d5d67ab..bdbf96b 100644
--- a/core/res/res/values/themes.xml
+++ b/core/res/res/values/themes.xml
@@ -190,7 +190,7 @@
         <item name="windowTranslucentStatus">false</item>
         <item name="windowTranslucentNavigation">false</item>
         <item name="windowDrawsSystemBarBackgrounds">false</item>
-        <item name="statusBarColor">@color/status_bar_default</item>
+        <item name="statusBarColor">@color/black</item>
         <item name="navigationBarColor">@color/navigation_bar_default</item>
         <item name="windowActionBarFullscreenDecorLayout">@layout/screen_action_bar</item>
         <item name="windowContentTransitions">false</item>
diff --git a/core/tests/coretests/src/android/app/AutomaticZenRuleTest.java b/core/tests/coretests/src/android/app/AutomaticZenRuleTest.java
index 1925588..9d85b65 100644
--- a/core/tests/coretests/src/android/app/AutomaticZenRuleTest.java
+++ b/core/tests/coretests/src/android/app/AutomaticZenRuleTest.java
@@ -16,6 +16,8 @@
 
 package android.app;
 
+import static com.google.common.truth.Truth.assertThat;
+
 import static junit.framework.Assert.assertEquals;
 import static junit.framework.Assert.fail;
 
@@ -26,6 +28,8 @@
 import android.os.Parcel;
 import android.platform.test.annotations.EnableFlags;
 import android.platform.test.flag.junit.SetFlagsRule;
+import android.service.notification.ZenDeviceEffects;
+import android.service.notification.ZenPolicy;
 
 import androidx.test.ext.junit.runners.AndroidJUnit4;
 import androidx.test.filters.SmallTest;
@@ -226,4 +230,66 @@
 
         assertThrows(IllegalArgumentException.class, () -> builder.setType(100));
     }
+
+    @Test
+    @EnableFlags(Flags.FLAG_MODES_API)
+    public void testCanUpdate_nullPolicyAndDeviceEffects() {
+        AutomaticZenRule.Builder builder = new AutomaticZenRule.Builder("name",
+                Uri.parse("uri://short"));
+
+        AutomaticZenRule rule = builder.setUserModifiedFields(0)
+                .setZenPolicy(null)
+                .setDeviceEffects(null)
+                .build();
+
+        assertThat(rule.canUpdate()).isTrue();
+
+        rule = builder.setUserModifiedFields(1).build();
+        assertThat(rule.canUpdate()).isFalse();
+    }
+
+    @Test
+    @EnableFlags(Flags.FLAG_MODES_API)
+    public void testCanUpdate_policyModified() {
+        ZenPolicy.Builder policyBuilder = new ZenPolicy.Builder().setUserModifiedFields(0);
+        ZenPolicy policy = policyBuilder.build();
+
+        AutomaticZenRule.Builder builder = new AutomaticZenRule.Builder("name",
+                Uri.parse("uri://short"));
+        AutomaticZenRule rule = builder.setUserModifiedFields(0)
+                .setZenPolicy(policy)
+                .setDeviceEffects(null).build();
+
+        // Newly created ZenPolicy is not user modified.
+        assertThat(policy.getUserModifiedFields()).isEqualTo(0);
+        assertThat(rule.canUpdate()).isTrue();
+
+        policy = policyBuilder.setUserModifiedFields(1).build();
+        assertThat(policy.getUserModifiedFields()).isEqualTo(1);
+        rule = builder.setZenPolicy(policy).build();
+        assertThat(rule.canUpdate()).isFalse();
+    }
+
+    @Test
+    @EnableFlags(Flags.FLAG_MODES_API)
+    public void testCanUpdate_deviceEffectsModified() {
+        ZenDeviceEffects.Builder deviceEffectsBuilder =
+                new ZenDeviceEffects.Builder().setUserModifiedFields(0);
+        ZenDeviceEffects deviceEffects = deviceEffectsBuilder.build();
+
+        AutomaticZenRule.Builder builder = new AutomaticZenRule.Builder("name",
+                Uri.parse("uri://short"));
+        AutomaticZenRule rule = builder.setUserModifiedFields(0)
+                .setZenPolicy(null)
+                .setDeviceEffects(deviceEffects).build();
+
+        // Newly created ZenDeviceEffects is not user modified.
+        assertThat(deviceEffects.getUserModifiedFields()).isEqualTo(0);
+        assertThat(rule.canUpdate()).isTrue();
+
+        deviceEffects = deviceEffectsBuilder.setUserModifiedFields(1).build();
+        assertThat(deviceEffects.getUserModifiedFields()).isEqualTo(1);
+        rule = builder.setDeviceEffects(deviceEffects).build();
+        assertThat(rule.canUpdate()).isFalse();
+    }
 }
diff --git a/core/tests/coretests/src/android/app/servertransaction/ObjectPoolTests.java b/core/tests/coretests/src/android/app/servertransaction/ObjectPoolTests.java
index 723c081..a796a0f 100644
--- a/core/tests/coretests/src/android/app/servertransaction/ObjectPoolTests.java
+++ b/core/tests/coretests/src/android/app/servertransaction/ObjectPoolTests.java
@@ -171,7 +171,8 @@
 
     @Test
     public void testRecycleStartActivityItem() {
-        testRecycle(() -> StartActivityItem.obtain(mActivityToken, ActivityOptions.makeBasic()));
+        testRecycle(() -> StartActivityItem.obtain(mActivityToken,
+                new ActivityOptions.SceneTransitionInfo()));
     }
 
     @Test
diff --git a/core/tests/coretests/src/android/app/servertransaction/TestUtils.java b/core/tests/coretests/src/android/app/servertransaction/TestUtils.java
index c0e2a49..3823033 100644
--- a/core/tests/coretests/src/android/app/servertransaction/TestUtils.java
+++ b/core/tests/coretests/src/android/app/servertransaction/TestUtils.java
@@ -255,9 +255,9 @@
             return LaunchActivityItem.obtain(mActivityToken, mIntent, mIdent, mInfo,
                     mCurConfig, mOverrideConfig, mDeviceId, mReferrer, mVoiceInteractor,
                     mProcState, mState, mPersistentState, mPendingResults, mPendingNewIntents,
-                    mActivityOptions, mIsForward, mProfilerInfo, mAssistToken,
-                    null /* activityClientController */, mShareableActivityToken,
-                    mLaunchedFromBubble, mTaskFragmentToken);
+                    mActivityOptions != null ? mActivityOptions.getSceneTransitionInfo() : null,
+                    mIsForward, mProfilerInfo, mAssistToken, null /* activityClientController */,
+                    mShareableActivityToken, mLaunchedFromBubble, mTaskFragmentToken);
         }
     }
 }
diff --git a/core/tests/coretests/src/android/app/servertransaction/TransactionParcelTests.java b/core/tests/coretests/src/android/app/servertransaction/TransactionParcelTests.java
index 07921bf..952cdd9 100644
--- a/core/tests/coretests/src/android/app/servertransaction/TransactionParcelTests.java
+++ b/core/tests/coretests/src/android/app/servertransaction/TransactionParcelTests.java
@@ -262,7 +262,7 @@
     public void testStart() {
         // Write to parcel
         StartActivityItem item = StartActivityItem.obtain(mActivityToken,
-                ActivityOptions.makeBasic());
+                new ActivityOptions.SceneTransitionInfo());
         writeAndPrepareForReading(item);
 
         // Read from parcel and assert
diff --git a/core/tests/coretests/src/android/database/sqlite/SQLiteDatabaseTest.java b/core/tests/coretests/src/android/database/sqlite/SQLiteDatabaseTest.java
index 3fc08ee..bd5f809 100644
--- a/core/tests/coretests/src/android/database/sqlite/SQLiteDatabaseTest.java
+++ b/core/tests/coretests/src/android/database/sqlite/SQLiteDatabaseTest.java
@@ -26,6 +26,9 @@
 import android.database.Cursor;
 import android.database.DatabaseUtils;
 import android.os.SystemClock;
+import android.platform.test.annotations.RequiresFlagsEnabled;
+import android.platform.test.flag.junit.CheckFlagsRule;
+import android.platform.test.flag.junit.DeviceFlagsValueProvider;
 import android.test.AndroidTestCase;
 import android.util.Log;
 
@@ -35,6 +38,7 @@
 
 import org.junit.After;
 import org.junit.Before;
+import org.junit.Rule;
 import org.junit.Test;
 import org.junit.runner.RunWith;
 
@@ -53,6 +57,10 @@
 @SmallTest
 public class SQLiteDatabaseTest {
 
+    @Rule
+    public final CheckFlagsRule mCheckFlagsRule =
+            DeviceFlagsValueProvider.createCheckFlagsRule();
+
     private static final String TAG = "SQLiteDatabaseTest";
 
     private final Context mContext = InstrumentationRegistry.getInstrumentation().getContext();
@@ -347,4 +355,50 @@
 
         assertTrue("ReadThread failed with errors: " + errors, errors.isEmpty());
     }
+
+    @RequiresFlagsEnabled(Flags.FLAG_SQLITE_ALLOW_TEMP_TABLES)
+    @Test
+    public void testTempTable() {
+        boolean allowed;
+        allowed = true;
+        mDatabase.beginTransactionReadOnly();
+        try {
+            mDatabase.execSQL("CREATE TEMP TABLE t1 (i int, j int);");
+            mDatabase.execSQL("INSERT INTO t1 (i, j) VALUES (2, 20)");
+            mDatabase.execSQL("INSERT INTO t1 (i, j) VALUES (3, 30)");
+
+            final String sql = "SELECT i FROM t1 WHERE j = 30";
+            try (SQLiteRawStatement s = mDatabase.createRawStatement(sql)) {
+                assertTrue(s.step());
+                assertEquals(3, s.getColumnInt(0));
+            }
+
+        } catch (SQLiteException e) {
+            allowed = false;
+        } finally {
+            mDatabase.endTransaction();
+        }
+        assertTrue(allowed);
+
+        // Repeat the test on the main schema.
+        allowed = true;
+        mDatabase.beginTransactionReadOnly();
+        try {
+            mDatabase.execSQL("CREATE TABLE t2 (i int, j int);");
+            mDatabase.execSQL("INSERT INTO t2 (i, j) VALUES (2, 20)");
+            mDatabase.execSQL("INSERT INTO t2 (i, j) VALUES (3, 30)");
+
+            final String sql = "SELECT i FROM t2 WHERE j = 30";
+            try (SQLiteRawStatement s = mDatabase.createRawStatement(sql)) {
+                assertTrue(s.step());
+                assertEquals(3, s.getColumnInt(0));
+            }
+
+        } catch (SQLiteException e) {
+            allowed = false;
+        } finally {
+            mDatabase.endTransaction();
+        }
+        assertFalse(allowed);
+    }
 }
diff --git a/data/etc/com.android.systemui.xml b/data/etc/com.android.systemui.xml
index 43683ff..ce2543a 100644
--- a/data/etc/com.android.systemui.xml
+++ b/data/etc/com.android.systemui.xml
@@ -56,6 +56,7 @@
         <permission name="android.permission.REAL_GET_TASKS"/>
         <permission name="android.permission.REQUEST_NETWORK_SCORES"/>
         <permission name="android.permission.RECEIVE_MEDIA_RESOURCE_USAGE"/>
+        <permission name="android.permission.SATELLITE_COMMUNICATION"/>
         <permission name="android.permission.SET_WALLPAPER_DIM_AMOUNT"/>
         <permission name="android.permission.START_ACTIVITIES_FROM_BACKGROUND" />
         <permission name="android.permission.START_ACTIVITY_AS_CALLER"/>
diff --git a/data/etc/privapp-permissions-platform.xml b/data/etc/privapp-permissions-platform.xml
index b9efe65..a1ea2b8 100644
--- a/data/etc/privapp-permissions-platform.xml
+++ b/data/etc/privapp-permissions-platform.xml
@@ -134,6 +134,7 @@
         <permission name="android.permission.CONTROL_INCALL_EXPERIENCE"/>
         <permission name="android.permission.DUMP"/>
         <permission name="android.permission.INTERACT_ACROSS_USERS"/>
+        <permission name="android.permission.LOCATION_BYPASS"/>
         <permission name="android.permission.LOCAL_MAC_ADDRESS"/>
         <permission name="android.permission.MANAGE_USERS"/>
         <permission name="android.permission.MANAGE_SUBSCRIPTION_PLANS" />
@@ -149,6 +150,7 @@
         <permission name="android.permission.REGISTER_CALL_PROVIDER"/>
         <permission name="android.permission.REGISTER_SIM_SUBSCRIPTION"/>
         <permission name="android.permission.REGISTER_STATS_PULL_ATOM"/>
+        <permission name="android.permission.SATELLITE_COMMUNICATION"/>
         <permission name="android.permission.SEND_RESPOND_VIA_MESSAGE"/>
         <permission name="android.permission.SHUTDOWN"/>
         <permission name="android.permission.START_ACTIVITIES_FROM_BACKGROUND"/>
diff --git a/data/keyboards/Android.bp b/data/keyboards/Android.bp
new file mode 100644
index 0000000..f15c153
--- /dev/null
+++ b/data/keyboards/Android.bp
@@ -0,0 +1,29 @@
+// Copyright 2010 The Android Open Source Project
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+genrule {
+    name: "validate_framework_keymaps",
+    srcs: [
+        "*.kl",
+        "*.kcm",
+        "*.idc",
+    ],
+    tools: ["validatekeymaps"],
+    out: ["stamp"],
+    cmd: "$(location validatekeymaps) -q $(in) " +
+        "&& touch $(out)",
+    dist: {
+        targets: ["droidcore"],
+    },
+}
diff --git a/data/keyboards/Android.mk b/data/keyboards/Android.mk
deleted file mode 100644
index 6ae8800..0000000
--- a/data/keyboards/Android.mk
+++ /dev/null
@@ -1,44 +0,0 @@
-# Copyright (C) 2010 The Android Open Source Project
-#
-# Licensed under the Apache License, Version 2.0 (the "License");
-# you may not use this file except in compliance with the License.
-# You may obtain a copy of the License at
-#
-#      http://www.apache.org/licenses/LICENSE-2.0
-#
-# Unless required by applicable law or agreed to in writing, software
-# distributed under the License is distributed on an "AS IS" BASIS,
-# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-# See the License for the specific language governing permissions and
-# limitations under the License.
-
-# This makefile performs build time validation of framework keymap files.
-
-LOCAL_PATH := $(call my-dir)
-
-include $(LOCAL_PATH)/common.mk
-
-# Validate all key maps.
-include $(CLEAR_VARS)
-
-LOCAL_MODULE := validate_framework_keymaps
-LOCAL_LICENSE_KINDS := SPDX-license-identifier-Apache-2.0
-LOCAL_LICENSE_CONDITIONS := notice
-LOCAL_NOTICE_FILE := $(LOCAL_PATH)/../../NOTICE
-intermediates := $(call intermediates-dir-for,ETC,$(LOCAL_MODULE),,COMMON)
-LOCAL_BUILT_MODULE := $(intermediates)/stamp
-
-validatekeymaps := $(HOST_OUT_EXECUTABLES)/validatekeymaps$(HOST_EXECUTABLE_SUFFIX)
-$(LOCAL_BUILT_MODULE): PRIVATE_VALIDATEKEYMAPS := $(validatekeymaps)
-$(LOCAL_BUILT_MODULE) : $(framework_keylayouts) $(framework_keycharmaps) $(framework_keyconfigs) | $(validatekeymaps)
-	$(hide) $(PRIVATE_VALIDATEKEYMAPS) -q $^
-	$(hide) mkdir -p $(dir $@) && touch $@
-
-# Run validatekeymaps uncondionally for platform build.
-droidcore : $(LOCAL_BUILT_MODULE)
-
-# Reset temp vars.
-validatekeymaps :=
-framework_keylayouts :=
-framework_keycharmaps :=
-framework_keyconfigs :=
diff --git a/data/keyboards/Vendor_0957_Product_0031.kl b/data/keyboards/Vendor_0957_Product_0031.kl
new file mode 100644
index 0000000..b47ee58
--- /dev/null
+++ b/data/keyboards/Vendor_0957_Product_0031.kl
@@ -0,0 +1,82 @@
+# Copyright 2024 The Android Open Source Project
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#      http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+# Key Layout file for Google Reference RCU Remote with customizable button.
+#
+
+key 116   TV_POWER      WAKE
+key 217   ASSIST        WAKE
+key 423   MACRO_1       WAKE
+
+key 103   DPAD_UP
+key 108   DPAD_DOWN
+key 105   DPAD_LEFT
+key 106   DPAD_RIGHT
+key 353   DPAD_CENTER
+
+key 158   BACK
+key 172   HOME          WAKE
+
+key 113   VOLUME_MUTE
+key 114   VOLUME_DOWN
+key 115   VOLUME_UP
+
+key 2     1
+key 3     2
+key 4     3
+key 5     4
+key 6     5
+key 7     6
+key 8     7
+key 9     8
+key 10    9
+key 11    0
+
+# custom keys
+key usage 0x000c01BB    TV_INPUT
+
+key usage 0x000c0185    TV_TELETEXT
+key usage 0x000c0061    CAPTIONS
+
+key usage 0x000c01BD    INFO
+key usage 0x000c0037    PERIOD
+
+key usage 0x000c0069    PROG_RED
+key usage 0x000c006A    PROG_GREEN
+key usage 0x000c006C    PROG_YELLOW
+key usage 0x000c006B    PROG_BLUE
+key usage 0x000c00B4    MEDIA_SKIP_BACKWARD
+key usage 0x000c00CD    MEDIA_PLAY_PAUSE
+key usage 0x000c00B2    MEDIA_RECORD
+key usage 0x000c00B3    MEDIA_SKIP_FORWARD
+
+key usage 0x000c022A    BOOKMARK
+key usage 0x000c01A2    ALL_APPS
+key usage 0x000c019C    PROFILE_SWITCH
+
+key usage 0x000c0096    SETTINGS
+key usage 0x000c009F    NOTIFICATION
+
+key usage 0x000c008D    GUIDE
+key usage 0x000c0089    TV
+
+key usage 0x000c0187    FEATURED_APP_1    WAKE #FreeTv
+
+key usage 0x000c009C    CHANNEL_UP
+key usage 0x000c009D    CHANNEL_DOWN
+
+key usage 0x000c0077    BUTTON_3     WAKE #YouTube
+key usage 0x000c0078    BUTTON_4     WAKE #Netflix
+key usage 0x000c0079    BUTTON_6     WAKE
+key usage 0x000c007A    BUTTON_7     WAKE
\ No newline at end of file
diff --git a/data/keyboards/common.mk b/data/keyboards/common.mk
deleted file mode 100644
index d75b691..0000000
--- a/data/keyboards/common.mk
+++ /dev/null
@@ -1,22 +0,0 @@
-# Copyright (C) 2010 The Android Open Source Project
-#
-# Licensed under the Apache License, Version 2.0 (the "License");
-# you may not use this file except in compliance with the License.
-# You may obtain a copy of the License at
-#
-#      http://www.apache.org/licenses/LICENSE-2.0
-#
-# Unless required by applicable law or agreed to in writing, software
-# distributed under the License is distributed on an "AS IS" BASIS,
-# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-# See the License for the specific language governing permissions and
-# limitations under the License.
-
-# This is the list of framework provided keylayouts and key character maps to include.
-# Used by Android.mk and keyboards.mk.
-
-framework_keylayouts := $(wildcard $(LOCAL_PATH)/*.kl)
-
-framework_keycharmaps := $(wildcard $(LOCAL_PATH)/*.kcm)
-
-framework_keyconfigs := $(wildcard $(LOCAL_PATH)/*.idc)
diff --git a/libs/WindowManager/Jetpack/src/androidx/window/extensions/embedding/JetpackTaskFragmentOrganizer.java b/libs/WindowManager/Jetpack/src/androidx/window/extensions/embedding/JetpackTaskFragmentOrganizer.java
index 592f9a5..80afb16d 100644
--- a/libs/WindowManager/Jetpack/src/androidx/window/extensions/embedding/JetpackTaskFragmentOrganizer.java
+++ b/libs/WindowManager/Jetpack/src/androidx/window/extensions/embedding/JetpackTaskFragmentOrganizer.java
@@ -382,9 +382,13 @@
         if (splitAttributes == null) {
             return TaskFragmentAnimationParams.DEFAULT;
         }
-        return new TaskFragmentAnimationParams.Builder()
-                // TODO(b/263047900): Update extensions API.
-                // .setAnimationBackgroundColor(splitAttributes.getAnimationBackgroundColor())
-                .build();
+        final AnimationBackground animationBackground = splitAttributes.getAnimationBackground();
+        if (animationBackground instanceof AnimationBackground.ColorBackground colorBackground) {
+            return new TaskFragmentAnimationParams.Builder()
+                    .setAnimationBackgroundColor(colorBackground.getColor())
+                    .build();
+        } else {
+            return TaskFragmentAnimationParams.DEFAULT;
+        }
     }
 }
diff --git a/libs/WindowManager/Jetpack/src/androidx/window/extensions/embedding/SplitPresenter.java b/libs/WindowManager/Jetpack/src/androidx/window/extensions/embedding/SplitPresenter.java
index 6f356fa..8b7fd10 100644
--- a/libs/WindowManager/Jetpack/src/androidx/window/extensions/embedding/SplitPresenter.java
+++ b/libs/WindowManager/Jetpack/src/androidx/window/extensions/embedding/SplitPresenter.java
@@ -893,8 +893,7 @@
         return new SplitAttributes.Builder()
                 .setSplitType(splitTypeToUpdate)
                 .setLayoutDirection(splitAttributes.getLayoutDirection())
-                // TODO(b/263047900): Update extensions API.
-                // .setAnimationBackgroundColor(splitAttributes.getAnimationBackgroundColor())
+                .setAnimationBackground(splitAttributes.getAnimationBackground())
                 .build();
     }
 
diff --git a/libs/WindowManager/Jetpack/tests/unittest/src/androidx/window/extensions/WindowExtensionsTest.java b/libs/WindowManager/Jetpack/tests/unittest/src/androidx/window/extensions/WindowExtensionsTest.java
index 60beb0b..f471af0 100644
--- a/libs/WindowManager/Jetpack/tests/unittest/src/androidx/window/extensions/WindowExtensionsTest.java
+++ b/libs/WindowManager/Jetpack/tests/unittest/src/androidx/window/extensions/WindowExtensionsTest.java
@@ -25,6 +25,7 @@
 
 import androidx.test.ext.junit.runners.AndroidJUnit4;
 import androidx.test.filters.SmallTest;
+import androidx.window.extensions.embedding.AnimationBackground;
 import androidx.window.extensions.embedding.SplitAttributes;
 
 import org.junit.Before;
@@ -70,7 +71,7 @@
                 .isEqualTo(SplitAttributes.LayoutDirection.LOCALE);
         assertThat(splitAttributes.getSplitType())
                 .isEqualTo(new SplitAttributes.SplitType.RatioSplitType(0.5f));
-        // TODO(b/263047900): Update extensions API.
-        // assertThat(splitAttributes.getAnimationBackgroundColor()).isEqualTo(0);
+        assertThat(splitAttributes.getAnimationBackground())
+                .isEqualTo(AnimationBackground.ANIMATION_BACKGROUND_DEFAULT);
     }
 }
diff --git a/libs/WindowManager/Shell/src/com/android/wm/shell/activityembedding/ActivityEmbeddingAnimationRunner.java b/libs/WindowManager/Shell/src/com/android/wm/shell/activityembedding/ActivityEmbeddingAnimationRunner.java
index ac75c73..06210ff 100644
--- a/libs/WindowManager/Shell/src/com/android/wm/shell/activityembedding/ActivityEmbeddingAnimationRunner.java
+++ b/libs/WindowManager/Shell/src/com/android/wm/shell/activityembedding/ActivityEmbeddingAnimationRunner.java
@@ -20,6 +20,7 @@
 import static android.view.WindowManager.TRANSIT_CLOSE;
 import static android.view.WindowManagerPolicyConstants.TYPE_LAYER_OFFSET;
 import static android.window.TransitionInfo.FLAG_IS_BEHIND_STARTING_WINDOW;
+import static android.window.TransitionInfo.FLAG_TRANSLUCENT;
 
 import static com.android.wm.shell.activityembedding.ActivityEmbeddingAnimationSpec.createShowSnapshotForClosingAnimation;
 import static com.android.wm.shell.transition.TransitionAnimationHelper.addBackgroundToTransition;
@@ -330,6 +331,9 @@
             if (!animation.hasExtension()) {
                 continue;
             }
+            if (adapter.mChange.hasFlags(FLAG_TRANSLUCENT)) {
+                continue;
+            }
             final TransitionInfo.Change change = adapter.mChange;
             if (TransitionUtil.isOpeningType(adapter.mChange.getMode())) {
                 // Need to screenshot after startTransaction is applied otherwise activity
diff --git a/libs/WindowManager/Shell/src/com/android/wm/shell/back/BackAnimationController.java b/libs/WindowManager/Shell/src/com/android/wm/shell/back/BackAnimationController.java
index a498236..81d9638 100644
--- a/libs/WindowManager/Shell/src/com/android/wm/shell/back/BackAnimationController.java
+++ b/libs/WindowManager/Shell/src/com/android/wm/shell/back/BackAnimationController.java
@@ -403,8 +403,8 @@
         mCurrentTracker.updateStartLocation();
         // Dispatch onBackStarted, only to app callbacks.
         // System callbacks will receive onBackStarted when the remote animation starts.
-        if (!shouldDispatchToAnimator()) {
-            tryDispatchOnBackStarted(mActiveCallback, mCurrentTracker.createStartEvent(null));
+        if (!shouldDispatchToAnimator() && mActiveCallback != null) {
+            tryDispatchAppOnBackStarted(mActiveCallback, mCurrentTracker.createStartEvent(null));
         }
     }
 
@@ -507,7 +507,7 @@
             mActiveCallback = mBackNavigationInfo.getOnBackInvokedCallback();
             // App is handling back animation. Cancel system animation latency tracking.
             cancelLatencyTracking();
-            tryDispatchOnBackStarted(mActiveCallback, touchTracker.createStartEvent(null));
+            tryDispatchAppOnBackStarted(mActiveCallback, touchTracker.createStartEvent(null));
         }
     }
 
@@ -551,14 +551,24 @@
                 && mBackNavigationInfo.isPrepareRemoteAnimation();
     }
 
-    private void tryDispatchOnBackStarted(IOnBackInvokedCallback callback,
+    private void tryDispatchAppOnBackStarted(
+            IOnBackInvokedCallback callback,
             BackMotionEvent backEvent) {
-        if (callback == null || mOnBackStartDispatched) {
+        if (mOnBackStartDispatched && callback != null) {
+            return;
+        }
+        dispatchOnBackStarted(callback, backEvent);
+        mOnBackStartDispatched = true;
+    }
+
+    private void dispatchOnBackStarted(
+            IOnBackInvokedCallback callback,
+            BackMotionEvent backEvent) {
+        if (callback == null) {
             return;
         }
         try {
             callback.onBackStarted(backEvent);
-            mOnBackStartDispatched = true;
         } catch (RemoteException e) {
             Log.e(TAG, "dispatchOnBackStarted error: ", e);
         }
@@ -940,9 +950,17 @@
 
                                     if (apps.length >= 1) {
                                         mCurrentTracker.updateStartLocation();
-                                        tryDispatchOnBackStarted(
-                                                mActiveCallback,
-                                                mCurrentTracker.createStartEvent(apps[0]));
+                                        BackMotionEvent startEvent =
+                                                mCurrentTracker.createStartEvent(apps[0]);
+                                        // {@code mActiveCallback} is the callback from
+                                        // the BackAnimationRunners and not a real app-side
+                                        // callback. We also dispatch to the app-side callback
+                                        // (which should be a system callback with PRIORITY_SYSTEM)
+                                        // to keep consistent with app registered callbacks.
+                                        dispatchOnBackStarted(mActiveCallback, startEvent);
+                                        tryDispatchAppOnBackStarted(
+                                                mBackNavigationInfo.getOnBackInvokedCallback(),
+                                                startEvent);
                                     }
 
                                     // Dispatch the first progress after animation start for
diff --git a/libs/WindowManager/Shell/src/com/android/wm/shell/common/split/SplitScreenUtils.java b/libs/WindowManager/Shell/src/com/android/wm/shell/common/split/SplitScreenUtils.java
index 0693543..662f325 100644
--- a/libs/WindowManager/Shell/src/com/android/wm/shell/common/split/SplitScreenUtils.java
+++ b/libs/WindowManager/Shell/src/com/android/wm/shell/common/split/SplitScreenUtils.java
@@ -16,7 +16,7 @@
 
 package com.android.wm.shell.common.split;
 
-import static android.content.res.Configuration.ORIENTATION_LANDSCAPE;
+import static android.content.pm.LauncherApps.ShortcutQuery.FLAG_MATCH_ALL_KINDS_WITH_ALL_PINNED;
 
 import static com.android.wm.shell.common.split.SplitScreenConstants.CONTROLLED_ACTIVITY_TYPES;
 import static com.android.wm.shell.common.split.SplitScreenConstants.CONTROLLED_WINDOWING_MODES;
@@ -24,19 +24,27 @@
 import static com.android.wm.shell.common.split.SplitScreenConstants.SPLIT_POSITION_TOP_OR_LEFT;
 import static com.android.wm.shell.common.split.SplitScreenConstants.SPLIT_POSITION_UNDEFINED;
 
-import android.annotation.Nullable;
 import android.app.ActivityManager;
 import android.app.PendingIntent;
-import android.content.Context;
+import android.content.ComponentName;
 import android.content.Intent;
+import android.content.pm.LauncherApps;
+import android.content.pm.ShortcutInfo;
 import android.content.res.Configuration;
 import android.content.res.Resources;
 import android.graphics.Rect;
+import android.os.UserHandle;
+
+import androidx.annotation.NonNull;
+import androidx.annotation.Nullable;
 
 import com.android.internal.util.ArrayUtils;
 import com.android.wm.shell.Flags;
 import com.android.wm.shell.ShellTaskOrganizer;
 
+import java.util.Arrays;
+import java.util.List;
+
 /** Helper utility class for split screen components to use. */
 public class SplitScreenUtils {
     /** Reverse the split position. */
@@ -135,4 +143,28 @@
             return isLandscape;
         }
     }
+
+    /** Returns the component from a PendingIntent */
+    @Nullable
+    public static ComponentName getComponent(@Nullable PendingIntent pendingIntent) {
+        if (pendingIntent == null || pendingIntent.getIntent() == null) {
+            return null;
+        }
+        return pendingIntent.getIntent().getComponent();
+    }
+
+    /** Returns the component from a shortcut */
+    @Nullable
+    public static ComponentName getShortcutComponent(@NonNull String packageName, String shortcutId,
+            @NonNull UserHandle user, @NonNull LauncherApps launcherApps) {
+        LauncherApps.ShortcutQuery query = new LauncherApps.ShortcutQuery();
+        query.setPackage(packageName);
+        query.setShortcutIds(Arrays.asList(shortcutId));
+        query.setQueryFlags(FLAG_MATCH_ALL_KINDS_WITH_ALL_PINNED);
+        List<ShortcutInfo> shortcuts = launcherApps.getShortcuts(query, user);
+        ShortcutInfo info = shortcuts != null && shortcuts.size() > 0
+                ? shortcuts.get(0)
+                : null;
+        return info != null ? info.getActivity() : null;
+    }
 }
diff --git a/libs/WindowManager/Shell/src/com/android/wm/shell/dagger/WMShellModule.java b/libs/WindowManager/Shell/src/com/android/wm/shell/dagger/WMShellModule.java
index 0ef047f..36f06e8 100644
--- a/libs/WindowManager/Shell/src/com/android/wm/shell/dagger/WMShellModule.java
+++ b/libs/WindowManager/Shell/src/com/android/wm/shell/dagger/WMShellModule.java
@@ -210,7 +210,6 @@
             SyncTransactionQueue syncQueue,
             Transitions transitions,
             Optional<DesktopTasksController> desktopTasksController,
-            RecentsTransitionHandler recentsTransitionHandler,
             RootTaskDisplayAreaOrganizer rootTaskDisplayAreaOrganizer) {
         if (DesktopModeStatus.isEnabled()) {
             return new DesktopModeWindowDecorViewModel(
@@ -226,7 +225,6 @@
                     syncQueue,
                     transitions,
                     desktopTasksController,
-                    recentsTransitionHandler,
                     rootTaskDisplayAreaOrganizer);
         }
         return new CaptionWindowDecorViewModel(
diff --git a/libs/WindowManager/Shell/src/com/android/wm/shell/desktopmode/DesktopTasksController.kt b/libs/WindowManager/Shell/src/com/android/wm/shell/desktopmode/DesktopTasksController.kt
index 4a1bcaa..b1c43c1 100644
--- a/libs/WindowManager/Shell/src/com/android/wm/shell/desktopmode/DesktopTasksController.kt
+++ b/libs/WindowManager/Shell/src/com/android/wm/shell/desktopmode/DesktopTasksController.kt
@@ -320,9 +320,8 @@
     }
 
     /** Move a task with given `taskId` to fullscreen */
-    fun moveToFullscreen(taskId: Int, windowDecor: DesktopModeWindowDecoration) {
+    fun moveToFullscreen(taskId: Int) {
         shellTaskOrganizer.getRunningTaskInfo(taskId)?.let { task ->
-            windowDecor.incrementRelayoutBlock()
             moveToFullscreenWithAnimation(task, task.positionInParent)
         }
     }
@@ -906,20 +905,17 @@
      * @param position position of surface when drag ends.
      * @param inputCoordinate the coordinates of the motion event
      * @param taskBounds the updated bounds of the task being dragged.
-     * @param windowDecor the window decoration for the task being dragged
      */
     fun onDragPositioningEnd(
         taskInfo: RunningTaskInfo,
         position: Point,
         inputCoordinate: PointF,
-        taskBounds: Rect,
-        windowDecor: DesktopModeWindowDecoration
+        taskBounds: Rect
     ) {
         if (taskInfo.configuration.windowConfiguration.windowingMode != WINDOWING_MODE_FREEFORM) {
             return
         }
         if (taskBounds.top <= transitionAreaHeight) {
-            windowDecor.incrementRelayoutBlock()
             moveToFullscreenWithAnimation(taskInfo, position)
         }
         if (inputCoordinate.x <= transitionAreaWidth) {
diff --git a/libs/WindowManager/Shell/src/com/android/wm/shell/desktopmode/ToggleResizeDesktopTaskTransitionHandler.kt b/libs/WindowManager/Shell/src/com/android/wm/shell/desktopmode/ToggleResizeDesktopTaskTransitionHandler.kt
index 9debb25..0218493 100644
--- a/libs/WindowManager/Shell/src/com/android/wm/shell/desktopmode/ToggleResizeDesktopTaskTransitionHandler.kt
+++ b/libs/WindowManager/Shell/src/com/android/wm/shell/desktopmode/ToggleResizeDesktopTaskTransitionHandler.kt
@@ -54,8 +54,6 @@
         taskId: Int,
         windowDecoration: DesktopModeWindowDecoration
     ) {
-        // Pause relayout until the transition animation finishes.
-        windowDecoration.incrementRelayoutBlock()
         transitions.startTransition(TRANSIT_DESKTOP_MODE_TOGGLE_RESIZE, wct, this)
         taskToDecorationMap.put(taskId, windowDecoration)
     }
diff --git a/libs/WindowManager/Shell/src/com/android/wm/shell/freeform/FreeformTaskTransitionObserver.java b/libs/WindowManager/Shell/src/com/android/wm/shell/freeform/FreeformTaskTransitionObserver.java
index 6b6a7bc..ffcc526 100644
--- a/libs/WindowManager/Shell/src/com/android/wm/shell/freeform/FreeformTaskTransitionObserver.java
+++ b/libs/WindowManager/Shell/src/com/android/wm/shell/freeform/FreeformTaskTransitionObserver.java
@@ -112,7 +112,6 @@
                     onChangeTransitionReady(change, startT, finishT);
                     break;
             }
-            mWindowDecorViewModel.onTransitionReady(transition, info, change);
         }
         mTransitionToTaskInfo.put(transition, taskInfoList);
     }
@@ -153,8 +152,6 @@
 
     @Override
     public void onTransitionMerged(@NonNull IBinder merged, @NonNull IBinder playing) {
-        mWindowDecorViewModel.onTransitionMerged(merged, playing);
-
         final List<ActivityManager.RunningTaskInfo> infoOfMerged =
                 mTransitionToTaskInfo.get(merged);
         if (infoOfMerged == null) {
@@ -178,7 +175,6 @@
         final List<ActivityManager.RunningTaskInfo> taskInfo =
                 mTransitionToTaskInfo.getOrDefault(transition, Collections.emptyList());
         mTransitionToTaskInfo.remove(transition);
-        mWindowDecorViewModel.onTransitionFinished(transition);
         for (int i = 0; i < taskInfo.size(); ++i) {
             mWindowDecorViewModel.destroyWindowDecoration(taskInfo.get(i));
         }
diff --git a/libs/WindowManager/Shell/src/com/android/wm/shell/pip/IPip.aidl b/libs/WindowManager/Shell/src/com/android/wm/shell/pip/IPip.aidl
index 3906599..8b3de62 100644
--- a/libs/WindowManager/Shell/src/com/android/wm/shell/pip/IPip.aidl
+++ b/libs/WindowManager/Shell/src/com/android/wm/shell/pip/IPip.aidl
@@ -52,9 +52,10 @@
      * @param componentName ComponentName represents the Activity
      * @param destinationBounds the destination bounds the PiP window lands into
      * @param overlay an optional overlay to fade out after entering PiP
+     * @param appBounds the bounds used to set the buffer size of the optional content overlay
      */
     oneway void stopSwipePipToHome(int taskId, in ComponentName componentName,
-            in Rect destinationBounds, in SurfaceControl overlay) = 2;
+            in Rect destinationBounds, in SurfaceControl overlay, in Rect appBounds) = 2;
 
     /**
      * Notifies the swiping Activity to PiP onto home transition is aborted
diff --git a/libs/WindowManager/Shell/src/com/android/wm/shell/pip/PipTaskOrganizer.java b/libs/WindowManager/Shell/src/com/android/wm/shell/pip/PipTaskOrganizer.java
index 3635165..a9a3f78 100644
--- a/libs/WindowManager/Shell/src/com/android/wm/shell/pip/PipTaskOrganizer.java
+++ b/libs/WindowManager/Shell/src/com/android/wm/shell/pip/PipTaskOrganizer.java
@@ -334,6 +334,16 @@
     @Nullable
     SurfaceControl mPipOverlay;
 
+    /**
+     * The app bounds used for the buffer size of the
+     * {@link com.android.wm.shell.pip.PipContentOverlay.PipAppIconOverlay}.
+     *
+     * Note that this is empty if the overlay is removed or if it's some other type of overlay
+     * defined in {@link PipContentOverlay}.
+     */
+    @NonNull
+    final Rect mAppBounds = new Rect();
+
     public PipTaskOrganizer(Context context,
             @NonNull SyncTransactionQueue syncTransactionQueue,
             @NonNull PipTransitionState pipTransitionState,
@@ -464,15 +474,15 @@
      * Expect {@link #onTaskAppeared(ActivityManager.RunningTaskInfo, SurfaceControl)} afterwards.
      */
     public void stopSwipePipToHome(int taskId, ComponentName componentName, Rect destinationBounds,
-            SurfaceControl overlay) {
+            SurfaceControl overlay, Rect appBounds) {
         ProtoLog.d(ShellProtoLogGroup.WM_SHELL_PICTURE_IN_PICTURE,
-                "stopSwipePipToHome: %s, state=%s", componentName, mPipTransitionState);
+                "stopSwipePipToHome: %s, stat=%s", componentName, mPipTransitionState);
         // do nothing if there is no startSwipePipToHome being called before
         if (!mPipTransitionState.getInSwipePipToHomeTransition()) {
             return;
         }
         mPipBoundsState.setBounds(destinationBounds);
-        mPipOverlay = overlay;
+        setContentOverlay(overlay, appBounds);
         if (ENABLE_SHELL_TRANSITIONS && overlay != null) {
             // With Shell transition, the overlay was attached to the remote transition leash, which
             // will be removed when the current transition is finished, so we need to reparent it
@@ -1888,7 +1898,7 @@
                         "%s: trying to remove overlay (%s) which is not local reference (%s)",
                         TAG, surface, mPipOverlay);
             }
-            mPipOverlay = null;
+            clearContentOverlay();
         }
         if (mPipTransitionState.getTransitionState() == PipTransitionState.UNDEFINED) {
             // Avoid double removal, which is fatal.
@@ -1905,6 +1915,20 @@
         if (callback != null) callback.run();
     }
 
+    void clearContentOverlay() {
+        mPipOverlay = null;
+        mAppBounds.setEmpty();
+    }
+
+    void setContentOverlay(@Nullable SurfaceControl leash, @NonNull Rect appBounds) {
+        mPipOverlay = leash;
+        if (mPipOverlay != null) {
+            mAppBounds.set(appBounds);
+        } else {
+            mAppBounds.setEmpty();
+        }
+    }
+
     private void resetShadowRadius() {
         if (mPipTransitionState.getTransitionState() == PipTransitionState.UNDEFINED) {
             // mLeash is undefined when in PipTransitionState.UNDEFINED
diff --git a/libs/WindowManager/Shell/src/com/android/wm/shell/pip/PipTransition.java b/libs/WindowManager/Shell/src/com/android/wm/shell/pip/PipTransition.java
index f5f15d8..89dcc4c 100644
--- a/libs/WindowManager/Shell/src/com/android/wm/shell/pip/PipTransition.java
+++ b/libs/WindowManager/Shell/src/com/android/wm/shell/pip/PipTransition.java
@@ -141,8 +141,6 @@
     /** Whether the PIP window has fade out for fixed rotation. */
     private boolean mHasFadeOut;
 
-    private Rect mInitBounds = new Rect();
-
     /** Used for setting transform to a transaction from animator. */
     private final PipAnimationController.PipTransactionHandler mTransactionConsumer =
             new PipAnimationController.PipTransactionHandler() {
@@ -465,12 +463,13 @@
                     mSurfaceTransactionHelper.crop(tx, leash, destinationBounds)
                             .resetScale(tx, leash, destinationBounds)
                             .round(tx, leash, true /* applyCornerRadius */);
-                    if (mPipOrganizer.mPipOverlay != null && !mInitBounds.isEmpty()) {
+                    final Rect appBounds = mPipOrganizer.mAppBounds;
+                    if (mPipOrganizer.mPipOverlay != null && !appBounds.isEmpty()) {
                         // Resetting the scale for pinned task while re-adjusting its crop,
                         // also scales the overlay. So we need to update the overlay leash too.
                         Rect overlayBounds = new Rect(destinationBounds);
                         final int overlaySize = PipContentOverlay.PipAppIconOverlay
-                                .getOverlaySize(mInitBounds, destinationBounds);
+                                .getOverlaySize(appBounds, destinationBounds);
 
                         overlayBounds.offsetTo(
                                 (destinationBounds.width() - overlaySize) / 2,
@@ -479,7 +478,6 @@
                                 mPipOrganizer.mPipOverlay, overlayBounds);
                     }
                 }
-                mInitBounds.setEmpty();
                 wct.setBoundsChangeTransaction(taskInfo.token, tx);
             }
             final int displayRotation = taskInfo.getConfiguration().windowConfiguration
@@ -617,7 +615,7 @@
         // if overlay is present remove it immediately, as exit transition came before it faded out
         if (mPipOrganizer.mPipOverlay != null) {
             startTransaction.remove(mPipOrganizer.mPipOverlay);
-            clearPipOverlay();
+            mPipOrganizer.clearContentOverlay();
         }
         if (pipChange == null) {
             ProtoLog.w(ShellProtoLogGroup.WM_SHELL_PICTURE_IN_PICTURE,
@@ -951,9 +949,6 @@
         final Rect destinationBounds = mPipBoundsAlgorithm.getEntryDestinationBounds();
         final Rect currentBounds = pipChange.getStartAbsBounds();
 
-        // Cache the start bounds for overlay manipulations as a part of finishCallback.
-        mInitBounds.set(currentBounds);
-
         int rotationDelta = deltaRotation(startRotation, endRotation);
         Rect sourceHintRect = PipBoundsAlgorithm.getValidSourceHintRect(
                 taskInfo.pictureInPictureParams, currentBounds, destinationBounds);
@@ -1022,7 +1017,7 @@
         } else {
             throw new RuntimeException("Unrecognized animation type: " + enterAnimationType);
         }
-        mPipOrganizer.mPipOverlay = animator.getContentOverlayLeash();
+        mPipOrganizer.setContentOverlay(animator.getContentOverlayLeash(), currentBounds);
         animator.setTransitionDirection(TRANSITION_DIRECTION_TO_PIP)
                 .setPipAnimationCallback(mPipAnimationCallback)
                 .setDuration(mEnterExitAnimationDuration);
@@ -1073,10 +1068,6 @@
             ProtoLog.w(ShellProtoLogGroup.WM_SHELL_TRANSITIONS,
                     "%s: SwipePipToHome should not use fixed rotation %d", TAG, mEndFixedRotation);
         }
-        Rect appBounds = pipTaskInfo.configuration.windowConfiguration.getAppBounds();
-        if (mFixedRotationState == FIXED_ROTATION_CALLBACK && appBounds != null) {
-            mInitBounds.set(appBounds);
-        }
         final SurfaceControl swipePipToHomeOverlay = mPipOrganizer.mPipOverlay;
         if (swipePipToHomeOverlay != null) {
             // Launcher fade in the overlay on top of the fullscreen Task. It is possible we
@@ -1106,7 +1097,7 @@
         sendOnPipTransitionFinished(TRANSITION_DIRECTION_TO_PIP);
         if (swipePipToHomeOverlay != null) {
             mPipOrganizer.fadeOutAndRemoveOverlay(swipePipToHomeOverlay,
-                    this::clearPipOverlay /* callback */, false /* withStartDelay */);
+                    null /* callback */, false /* withStartDelay */);
         }
         mPipTransitionState.setInSwipePipToHomeTransition(false);
     }
@@ -1250,10 +1241,6 @@
         mPipMenuController.updateMenuBounds(destinationBounds);
     }
 
-    private void clearPipOverlay() {
-        mPipOrganizer.mPipOverlay = null;
-    }
-
     @Override
     public void dump(PrintWriter pw, String prefix) {
         final String innerPrefix = prefix + "  ";
diff --git a/libs/WindowManager/Shell/src/com/android/wm/shell/pip/phone/PipController.java b/libs/WindowManager/Shell/src/com/android/wm/shell/pip/phone/PipController.java
index 63f20fd..238e6b5 100644
--- a/libs/WindowManager/Shell/src/com/android/wm/shell/pip/phone/PipController.java
+++ b/libs/WindowManager/Shell/src/com/android/wm/shell/pip/phone/PipController.java
@@ -982,8 +982,9 @@
     }
 
     private void stopSwipePipToHome(int taskId, ComponentName componentName, Rect destinationBounds,
-            SurfaceControl overlay) {
-        mPipTaskOrganizer.stopSwipePipToHome(taskId, componentName, destinationBounds, overlay);
+            SurfaceControl overlay, Rect appBounds) {
+        mPipTaskOrganizer.stopSwipePipToHome(taskId, componentName, destinationBounds, overlay,
+                appBounds);
     }
 
     private void abortSwipePipToHome(int taskId, ComponentName componentName) {
@@ -1280,13 +1281,13 @@
 
         @Override
         public void stopSwipePipToHome(int taskId, ComponentName componentName,
-                Rect destinationBounds, SurfaceControl overlay) {
+                Rect destinationBounds, SurfaceControl overlay, Rect appBounds) {
             if (overlay != null) {
                 overlay.setUnreleasedWarningCallSite("PipController.stopSwipePipToHome");
             }
             executeRemoteCallWithTaskPermission(mController, "stopSwipePipToHome",
                     (controller) -> controller.stopSwipePipToHome(
-                            taskId, componentName, destinationBounds, overlay));
+                            taskId, componentName, destinationBounds, overlay, appBounds));
         }
 
         @Override
diff --git a/libs/WindowManager/Shell/src/com/android/wm/shell/splitscreen/SplitScreenController.java b/libs/WindowManager/Shell/src/com/android/wm/shell/splitscreen/SplitScreenController.java
index 7b57097..880d952 100644
--- a/libs/WindowManager/Shell/src/com/android/wm/shell/splitscreen/SplitScreenController.java
+++ b/libs/WindowManager/Shell/src/com/android/wm/shell/splitscreen/SplitScreenController.java
@@ -23,12 +23,15 @@
 import static android.content.Intent.FLAG_ACTIVITY_NO_USER_ACTION;
 import static android.view.Display.DEFAULT_DISPLAY;
 import static android.view.RemoteAnimationTarget.MODE_OPENING;
+import static android.view.WindowManager.PROPERTY_SUPPORTS_MULTI_INSTANCE_SYSTEM_UI;
 
 import static com.android.wm.shell.common.ExecutorUtils.executeRemoteCallWithTaskPermission;
 import static com.android.wm.shell.common.split.SplitScreenConstants.KEY_EXTRA_WIDGET_INTENT;
 import static com.android.wm.shell.common.split.SplitScreenConstants.SPLIT_POSITION_BOTTOM_OR_RIGHT;
 import static com.android.wm.shell.common.split.SplitScreenConstants.SPLIT_POSITION_TOP_OR_LEFT;
 import static com.android.wm.shell.common.split.SplitScreenConstants.SPLIT_POSITION_UNDEFINED;
+import static com.android.wm.shell.common.split.SplitScreenUtils.getComponent;
+import static com.android.wm.shell.common.split.SplitScreenUtils.getShortcutComponent;
 import static com.android.wm.shell.common.split.SplitScreenUtils.isValidToSplit;
 import static com.android.wm.shell.common.split.SplitScreenUtils.reverseSplitPosition;
 import static com.android.wm.shell.common.split.SplitScreenUtils.samePackage;
@@ -47,6 +50,8 @@
 import android.content.ComponentName;
 import android.content.Context;
 import android.content.Intent;
+import android.content.pm.LauncherApps;
+import android.content.pm.PackageManager;
 import android.content.pm.ShortcutInfo;
 import android.graphics.Rect;
 import android.os.Bundle;
@@ -171,6 +176,8 @@
     private final ShellTaskOrganizer mTaskOrganizer;
     private final SyncTransactionQueue mSyncQueue;
     private final Context mContext;
+    private final PackageManager mPackageManager;
+    private final LauncherApps mLauncherApps;
     private final RootTaskDisplayAreaOrganizer mRootTDAOrganizer;
     private final ShellExecutor mMainExecutor;
     private final SplitScreenImpl mImpl = new SplitScreenImpl();
@@ -186,7 +193,8 @@
     private final Optional<WindowDecorViewModel> mWindowDecorViewModel;
     private final Optional<DesktopTasksController> mDesktopTasksController;
     private final SplitScreenShellCommandHandler mSplitScreenShellCommandHandler;
-    private final String[] mAppsSupportMultiInstances;
+    // A static allow list of apps which support multi-instance
+    private final String[] mAppsSupportingMultiInstance;
 
     @VisibleForTesting
     StageCoordinator mStageCoordinator;
@@ -220,6 +228,8 @@
         mTaskOrganizer = shellTaskOrganizer;
         mSyncQueue = syncQueue;
         mContext = context;
+        mPackageManager = context.getPackageManager();
+        mLauncherApps = context.getSystemService(LauncherApps.class);
         mRootTDAOrganizer = rootTDAOrganizer;
         mMainExecutor = mainExecutor;
         mDisplayController = displayController;
@@ -242,7 +252,7 @@
 
         // TODO(255224696): Remove the config once having a way for client apps to opt-in
         //                  multi-instances split.
-        mAppsSupportMultiInstances = mContext.getResources()
+        mAppsSupportingMultiInstance = mContext.getResources()
                 .getStringArray(R.array.config_appsSupportMultiInstancesSplit);
     }
 
@@ -266,12 +276,15 @@
             WindowDecorViewModel windowDecorViewModel,
             DesktopTasksController desktopTasksController,
             ShellExecutor mainExecutor,
-            StageCoordinator stageCoordinator) {
+            StageCoordinator stageCoordinator,
+            String[] appsSupportingMultiInstance) {
         mShellCommandHandler = shellCommandHandler;
         mShellController = shellController;
         mTaskOrganizer = shellTaskOrganizer;
         mSyncQueue = syncQueue;
         mContext = context;
+        mPackageManager = context.getPackageManager();
+        mLauncherApps = context.getSystemService(LauncherApps.class);
         mRootTDAOrganizer = rootTDAOrganizer;
         mMainExecutor = mainExecutor;
         mDisplayController = displayController;
@@ -288,8 +301,7 @@
         mStageCoordinator = stageCoordinator;
         mSplitScreenShellCommandHandler = new SplitScreenShellCommandHandler(this);
         shellInit.addInitCallback(this::onInit, this);
-        mAppsSupportMultiInstances = mContext.getResources()
-                .getStringArray(R.array.config_appsSupportMultiInstancesSplit);
+        mAppsSupportingMultiInstance = appsSupportingMultiInstance;
     }
 
     public SplitScreen asSplitScreen() {
@@ -588,7 +600,8 @@
 
         if (samePackage(packageName, getPackageName(reverseSplitPosition(position)),
                 user.getIdentifier(), getUserId(reverseSplitPosition(position)))) {
-            if (supportMultiInstancesSplit(packageName)) {
+            if (supportsMultiInstanceSplit(getShortcutComponent(packageName, shortcutId, user,
+                    mLauncherApps))) {
                 activityOptions.setApplyMultipleTaskFlagForShortcut(true);
                 ProtoLog.v(ShellProtoLogGroup.WM_SHELL_SPLIT_SCREEN, "Adding MULTIPLE_TASK");
             } else if (isSplitScreenVisible()) {
@@ -609,7 +622,7 @@
                 activityOptions.toBundle(), user);
     }
 
-    void startShortcutAndTaskWithLegacyTransition(ShortcutInfo shortcutInfo,
+    void startShortcutAndTaskWithLegacyTransition(@NonNull ShortcutInfo shortcutInfo,
             @Nullable Bundle options1, int taskId, @Nullable Bundle options2,
             @SplitPosition int splitPosition, @PersistentSnapPosition int snapPosition,
             RemoteAnimationAdapter adapter, InstanceId instanceId) {
@@ -621,7 +634,7 @@
         final int userId1 = shortcutInfo.getUserId();
         final int userId2 = SplitScreenUtils.getUserId(taskId, mTaskOrganizer);
         if (samePackage(packageName1, packageName2, userId1, userId2)) {
-            if (supportMultiInstancesSplit(shortcutInfo.getPackage())) {
+            if (supportsMultiInstanceSplit(shortcutInfo.getActivity())) {
                 activityOptions.setApplyMultipleTaskFlagForShortcut(true);
                 ProtoLog.v(ShellProtoLogGroup.WM_SHELL_SPLIT_SCREEN, "Adding MULTIPLE_TASK");
             } else {
@@ -640,7 +653,7 @@
                 instanceId);
     }
 
-    void startShortcutAndTask(ShortcutInfo shortcutInfo, @Nullable Bundle options1,
+    void startShortcutAndTask(@NonNull ShortcutInfo shortcutInfo, @Nullable Bundle options1,
             int taskId, @Nullable Bundle options2, @SplitPosition int splitPosition,
             @PersistentSnapPosition int snapPosition, @Nullable RemoteTransition remoteTransition,
             InstanceId instanceId) {
@@ -653,7 +666,7 @@
         final int userId1 = shortcutInfo.getUserId();
         final int userId2 = SplitScreenUtils.getUserId(taskId, mTaskOrganizer);
         if (samePackage(packageName1, packageName2, userId1, userId2)) {
-            if (supportMultiInstancesSplit(packageName1)) {
+            if (supportsMultiInstanceSplit(shortcutInfo.getActivity())) {
                 activityOptions.setApplyMultipleTaskFlagForShortcut(true);
                 ProtoLog.v(ShellProtoLogGroup.WM_SHELL_SPLIT_SCREEN, "Adding MULTIPLE_TASK");
             } else {
@@ -692,7 +705,7 @@
         final String packageName2 = SplitScreenUtils.getPackageName(taskId, mTaskOrganizer);
         final int userId2 = SplitScreenUtils.getUserId(taskId, mTaskOrganizer);
         if (samePackage(packageName1, packageName2, userId1, userId2)) {
-            if (supportMultiInstancesSplit(packageName1)) {
+            if (supportsMultiInstanceSplit(getComponent(pendingIntent))) {
                 fillInIntent = new Intent();
                 fillInIntent.addFlags(FLAG_ACTIVITY_MULTIPLE_TASK);
                 ProtoLog.v(ShellProtoLogGroup.WM_SHELL_SPLIT_SCREEN, "Adding MULTIPLE_TASK");
@@ -722,7 +735,7 @@
         final int userId2 = SplitScreenUtils.getUserId(taskId, mTaskOrganizer);
         boolean setSecondIntentMultipleTask = false;
         if (samePackage(packageName1, packageName2, userId1, userId2)) {
-            if (supportMultiInstancesSplit(packageName1)) {
+            if (supportsMultiInstanceSplit(getComponent(pendingIntent))) {
                 setSecondIntentMultipleTask = true;
                 ProtoLog.v(ShellProtoLogGroup.WM_SHELL_SPLIT_SCREEN, "Adding MULTIPLE_TASK");
             } else {
@@ -757,7 +770,7 @@
         final String packageName1 = SplitScreenUtils.getPackageName(pendingIntent1);
         final String packageName2 = SplitScreenUtils.getPackageName(pendingIntent2);
         if (samePackage(packageName1, packageName2, userId1, userId2)) {
-            if (supportMultiInstancesSplit(packageName1)) {
+            if (supportsMultiInstanceSplit(getComponent(pendingIntent1))) {
                 fillInIntent1 = new Intent();
                 fillInIntent1.addFlags(FLAG_ACTIVITY_MULTIPLE_TASK);
                 fillInIntent2 = new Intent();
@@ -794,7 +807,7 @@
                 ? ActivityOptions.fromBundle(options2) : ActivityOptions.makeBasic();
         boolean setSecondIntentMultipleTask = false;
         if (samePackage(packageName1, packageName2, userId1, userId2)) {
-            if (supportMultiInstancesSplit(packageName1)) {
+            if (supportsMultiInstanceSplit(getComponent(pendingIntent1))) {
                 fillInIntent1 = new Intent();
                 fillInIntent1.addFlags(FLAG_ACTIVITY_MULTIPLE_TASK);
                 setSecondIntentMultipleTask = true;
@@ -856,7 +869,7 @@
             return;
         }
         if (samePackage(packageName1, packageName2, userId1, userId2)) {
-            if (supportMultiInstancesSplit(packageName1)) {
+            if (supportsMultiInstanceSplit(getComponent(intent))) {
                 // Flag with MULTIPLE_TASK if this is launching the same activity into both sides of
                 // the split and there is no reusable background task.
                 fillInIntent.addFlags(FLAG_ACTIVITY_MULTIPLE_TASK);
@@ -915,16 +928,63 @@
         return taskInfo != null ? taskInfo.userId : -1;
     }
 
+    /**
+     * Returns whether a specific component desires to be launched in multiple instances for
+     * split screen.
+     */
     @VisibleForTesting
-    boolean supportMultiInstancesSplit(String packageName) {
-        if (packageName != null) {
-            for (int i = 0; i < mAppsSupportMultiInstances.length; i++) {
-                if (mAppsSupportMultiInstances[i].equals(packageName)) {
-                    return true;
-                }
+    boolean supportsMultiInstanceSplit(@Nullable ComponentName componentName) {
+        if (componentName == null || componentName.getPackageName() == null) {
+            // TODO(b/262864589): Handle empty component case
+            return false;
+        }
+
+        // Check the pre-defined allow list
+        final String packageName = componentName.getPackageName();
+        for (int i = 0; i < mAppsSupportingMultiInstance.length; i++) {
+            if (mAppsSupportingMultiInstance[i].equals(packageName)) {
+                ProtoLog.v(ShellProtoLogGroup.WM_SHELL_SPLIT_SCREEN,
+                        "application=%s in allowlist supports multi-instance", packageName);
+                return true;
             }
         }
 
+        // Check the activity property first
+        try {
+            final PackageManager.Property activityProp = mPackageManager.getProperty(
+                    PROPERTY_SUPPORTS_MULTI_INSTANCE_SYSTEM_UI, componentName);
+            // If the above call doesn't throw a NameNotFoundException, then the activity property
+            // should override the application property value
+            if (activityProp.isBoolean()) {
+                ProtoLog.v(ShellProtoLogGroup.WM_SHELL_SPLIT_SCREEN,
+                        "activity=%s supports multi-instance", componentName);
+                return activityProp.getBoolean();
+            } else {
+                ProtoLog.w(ShellProtoLogGroup.WM_SHELL_SPLIT_SCREEN,
+                        "Warning: property=%s for activity=%s has non-bool type=%d",
+                        PROPERTY_SUPPORTS_MULTI_INSTANCE_SYSTEM_UI, packageName,
+                        activityProp.getType());
+            }
+        } catch (PackageManager.NameNotFoundException nnfe) {
+            // Not specified in the activity, fall through
+        }
+
+        // Check the application property otherwise
+        try {
+            final PackageManager.Property appProp = mPackageManager.getProperty(
+                    PROPERTY_SUPPORTS_MULTI_INSTANCE_SYSTEM_UI, packageName);
+            if (appProp.isBoolean()) {
+                ProtoLog.v(ShellProtoLogGroup.WM_SHELL_SPLIT_SCREEN,
+                        "application=%s supports multi-instance", packageName);
+                return appProp.getBoolean();
+            } else {
+                ProtoLog.w(ShellProtoLogGroup.WM_SHELL_SPLIT_SCREEN,
+                        "Warning: property=%s for application=%s has non-bool type=%d",
+                        PROPERTY_SUPPORTS_MULTI_INSTANCE_SYSTEM_UI, packageName, appProp.getType());
+            }
+        } catch (PackageManager.NameNotFoundException nnfe) {
+            // Not specified in either application or activity
+        }
         return false;
     }
 
diff --git a/libs/WindowManager/Shell/src/com/android/wm/shell/startingsurface/SplashscreenContentDrawer.java b/libs/WindowManager/Shell/src/com/android/wm/shell/startingsurface/SplashscreenContentDrawer.java
index f58aeac..a666e20 100644
--- a/libs/WindowManager/Shell/src/com/android/wm/shell/startingsurface/SplashscreenContentDrawer.java
+++ b/libs/WindowManager/Shell/src/com/android/wm/shell/startingsurface/SplashscreenContentDrawer.java
@@ -73,6 +73,7 @@
 import com.android.internal.graphics.palette.Palette;
 import com.android.internal.graphics.palette.Quantizer;
 import com.android.internal.graphics.palette.VariationalKMeansQuantizer;
+import com.android.internal.policy.PhoneWindow;
 import com.android.internal.protolog.common.ProtoLog;
 import com.android.launcher3.icons.BaseIconFactory;
 import com.android.launcher3.icons.IconProvider;
@@ -245,16 +246,19 @@
         } else {
             windowFlags |= WindowManager.LayoutParams.FLAG_DRAWS_SYSTEM_BAR_BACKGROUNDS;
         }
-        params.layoutInDisplayCutoutMode = a.getInt(
-                R.styleable.Window_windowLayoutInDisplayCutoutMode,
-                WindowManager.LayoutParams.LAYOUT_IN_DISPLAY_CUTOUT_MODE_ALWAYS);
-        params.windowAnimations = a.getResourceId(R.styleable.Window_windowAnimationStyle, 0);
-        a.recycle();
 
         final ActivityManager.RunningTaskInfo taskInfo = windowInfo.taskInfo;
         final ActivityInfo activityInfo = windowInfo.targetActivityInfo != null
                 ? windowInfo.targetActivityInfo
                 : taskInfo.topActivityInfo;
+        params.layoutInDisplayCutoutMode = a.getInt(
+                R.styleable.Window_windowLayoutInDisplayCutoutMode,
+                PhoneWindow.isEdgeToEdgeEnforced(activityInfo.applicationInfo, false /* local */)
+                        ? WindowManager.LayoutParams.LAYOUT_IN_DISPLAY_CUTOUT_MODE_ALWAYS
+                        : params.layoutInDisplayCutoutMode);
+        params.windowAnimations = a.getResourceId(R.styleable.Window_windowAnimationStyle, 0);
+        a.recycle();
+
         final int displayId = taskInfo.displayId;
         // Assumes it's safe to show starting windows of launched apps while
         // the keyguard is being hidden. This is okay because starting windows never show
diff --git a/libs/WindowManager/Shell/src/com/android/wm/shell/transition/DefaultMixedHandler.java b/libs/WindowManager/Shell/src/com/android/wm/shell/transition/DefaultMixedHandler.java
index 9f20f49..db84513 100644
--- a/libs/WindowManager/Shell/src/com/android/wm/shell/transition/DefaultMixedHandler.java
+++ b/libs/WindowManager/Shell/src/com/android/wm/shell/transition/DefaultMixedHandler.java
@@ -21,9 +21,9 @@
 import static android.app.WindowConfiguration.WINDOWING_MODE_FULLSCREEN;
 import static android.view.Display.DEFAULT_DISPLAY;
 import static android.view.WindowManager.TRANSIT_CHANGE;
+import static android.view.WindowManager.TRANSIT_FLAG_KEYGUARD_UNOCCLUDING;
 import static android.view.WindowManager.TRANSIT_PIP;
 import static android.view.WindowManager.TRANSIT_TO_BACK;
-import static android.view.WindowManager.TRANSIT_FLAG_KEYGUARD_UNOCCLUDING;
 import static android.window.TransitionInfo.FLAG_IN_TASK_WITH_EMBEDDED_ACTIVITY;
 import static android.window.TransitionInfo.FLAG_IS_WALLPAPER;
 
@@ -84,7 +84,7 @@
     private UnfoldTransitionHandler mUnfoldHandler;
     private ActivityEmbeddingController mActivityEmbeddingController;
 
-    private class MixedTransition {
+    private static class MixedTransition {
         static final int TYPE_ENTER_PIP_FROM_SPLIT = 1;
 
         /** Both the display and split-state (enter/exit) is changing */
@@ -175,7 +175,6 @@
             joinFinishArgs(wct);
 
             if (mInFlightSubAnimations == 0) {
-                mActiveTransitions.remove(MixedTransition.this);
                 mFinishCB.onTransitionFinished(mFinishWCT);
             }
         }
@@ -401,8 +400,12 @@
                 final MixedTransition keyguardMixed =
                         new MixedTransition(MixedTransition.TYPE_KEYGUARD, transition);
                 mActiveTransitions.add(keyguardMixed);
-                final boolean hasAnimateKeyguard = animateKeyguard(keyguardMixed, info,
-                        startTransaction, finishTransaction, finishCallback);
+                Transitions.TransitionFinishCallback callback = wct -> {
+                    mActiveTransitions.remove(keyguardMixed);
+                    finishCallback.onTransitionFinished(wct);
+                };
+                final boolean hasAnimateKeyguard = animateKeyguard(
+                        keyguardMixed, info, startTransaction, finishTransaction, callback);
                 if (hasAnimateKeyguard) {
                     ProtoLog.w(ShellProtoLogGroup.WM_SHELL_TRANSITIONS,
                             "Converting mixed transition into a keyguard transition");
@@ -420,27 +423,34 @@
 
         if (mixed == null) return false;
 
-        if (mixed.mType == MixedTransition.TYPE_ENTER_PIP_FROM_SPLIT) {
-            return animateEnterPipFromSplit(mixed, info, startTransaction, finishTransaction,
-                    finishCallback);
-        } else if (mixed.mType == MixedTransition.TYPE_ENTER_PIP_FROM_ACTIVITY_EMBEDDING) {
-            return animateEnterPipFromActivityEmbedding(mixed, info, startTransaction,
-                    finishTransaction, finishCallback);
-        } else if (mixed.mType == MixedTransition.TYPE_DISPLAY_AND_SPLIT_CHANGE) {
+        final MixedTransition chosenTransition = mixed;
+        Transitions.TransitionFinishCallback callback = wct -> {
+            mActiveTransitions.remove(chosenTransition);
+            finishCallback.onTransitionFinished(wct);
+        };
+
+        if (chosenTransition.mType == MixedTransition.TYPE_ENTER_PIP_FROM_SPLIT) {
+            return animateEnterPipFromSplit(
+                    chosenTransition, info, startTransaction, finishTransaction, callback);
+        } else if (chosenTransition.mType
+                == MixedTransition.TYPE_ENTER_PIP_FROM_ACTIVITY_EMBEDDING) {
+            return animateEnterPipFromActivityEmbedding(
+                    chosenTransition, info, startTransaction, finishTransaction, callback);
+        } else if (chosenTransition.mType == MixedTransition.TYPE_DISPLAY_AND_SPLIT_CHANGE) {
             return false;
-        } else if (mixed.mType == MixedTransition.TYPE_OPTIONS_REMOTE_AND_PIP_CHANGE) {
-            final boolean handledToPip = animateOpenIntentWithRemoteAndPip(mixed, info,
-                    startTransaction, finishTransaction, finishCallback);
+        } else if (chosenTransition.mType == MixedTransition.TYPE_OPTIONS_REMOTE_AND_PIP_CHANGE) {
+            final boolean handledToPip = animateOpenIntentWithRemoteAndPip(
+                    chosenTransition, info, startTransaction, finishTransaction, callback);
             // Consume the transition on remote handler if the leftover handler already handle this
             // transition. And if it cannot, the transition will be handled by remote handler, so
             // don't consume here.
             // Need to check leftOverHandler as it may change in #animateOpenIntentWithRemoteAndPip
-            if (handledToPip && mixed.mHasRequestToRemote
-                    && mixed.mLeftoversHandler != mPlayer.getRemoteTransitionHandler()) {
+            if (handledToPip && chosenTransition.mHasRequestToRemote
+                    && chosenTransition.mLeftoversHandler != mPlayer.getRemoteTransitionHandler()) {
                 mPlayer.getRemoteTransitionHandler().onTransitionConsumed(transition, false, null);
             }
             return handledToPip;
-        } else if (mixed.mType == MixedTransition.TYPE_RECENTS_DURING_SPLIT) {
+        } else if (chosenTransition.mType == MixedTransition.TYPE_RECENTS_DURING_SPLIT) {
             for (int i = info.getChanges().size() - 1; i >= 0; --i) {
                 final TransitionInfo.Change change = info.getChanges().get(i);
                 // Pip auto-entering info might be appended to recent transition like pressing
@@ -449,28 +459,29 @@
                 if (mPipHandler.isEnteringPip(change, info.getType())
                         && mSplitHandler.getSplitItemPosition(change.getLastParent())
                         != SPLIT_POSITION_UNDEFINED) {
-                    return animateEnterPipFromSplit(mixed, info, startTransaction,
-                            finishTransaction, finishCallback);
+                    return animateEnterPipFromSplit(
+                            chosenTransition, info, startTransaction, finishTransaction, callback);
                 }
             }
 
-            return animateRecentsDuringSplit(mixed, info, startTransaction, finishTransaction,
-                    finishCallback);
-        } else if (mixed.mType == MixedTransition.TYPE_KEYGUARD) {
-            return animateKeyguard(mixed, info, startTransaction, finishTransaction,
-                    finishCallback);
-        } else if (mixed.mType == MixedTransition.TYPE_RECENTS_DURING_KEYGUARD) {
-            return animateRecentsDuringKeyguard(mixed, info, startTransaction, finishTransaction,
-                    finishCallback);
-        } else if (mixed.mType == MixedTransition.TYPE_RECENTS_DURING_DESKTOP) {
-            return animateRecentsDuringDesktop(mixed, info, startTransaction, finishTransaction,
-                    finishCallback);
-        } else if (mixed.mType == MixedTransition.TYPE_UNFOLD) {
-            return animateUnfold(mixed, info, startTransaction, finishTransaction, finishCallback);
+            return animateRecentsDuringSplit(
+                    chosenTransition, info, startTransaction, finishTransaction, callback);
+        } else if (chosenTransition.mType == MixedTransition.TYPE_KEYGUARD) {
+            return animateKeyguard(
+                    chosenTransition, info, startTransaction, finishTransaction, callback);
+        } else if (chosenTransition.mType == MixedTransition.TYPE_RECENTS_DURING_KEYGUARD) {
+            return animateRecentsDuringKeyguard(
+                    chosenTransition, info, startTransaction, finishTransaction, callback);
+        } else if (chosenTransition.mType == MixedTransition.TYPE_RECENTS_DURING_DESKTOP) {
+            return animateRecentsDuringDesktop(
+                    chosenTransition, info, startTransaction, finishTransaction, callback);
+        } else if (chosenTransition.mType == MixedTransition.TYPE_UNFOLD) {
+            return animateUnfold(
+                    chosenTransition, info, startTransaction, finishTransaction, callback);
         } else {
-            mActiveTransitions.remove(mixed);
+            mActiveTransitions.remove(chosenTransition);
             throw new IllegalStateException("Starting mixed animation without a known mixed type? "
-                    + mixed.mType);
+                    + chosenTransition.mType);
         }
     }
 
@@ -727,7 +738,11 @@
         final MixedTransition mixed = new MixedTransition(
                 MixedTransition.TYPE_ENTER_PIP_FROM_SPLIT, transition);
         mActiveTransitions.add(mixed);
-        return animateEnterPipFromSplit(mixed, info, startT, finishT, finishCallback);
+        Transitions.TransitionFinishCallback callback = wct -> {
+            mActiveTransitions.remove(mixed);
+            finishCallback.onTransitionFinished(wct);
+        };
+        return animateEnterPipFromSplit(mixed, info, startT, finishT, callback);
     }
 
     /**
diff --git a/libs/WindowManager/Shell/src/com/android/wm/shell/windowdecor/CaptionWindowDecorViewModel.java b/libs/WindowManager/Shell/src/com/android/wm/shell/windowdecor/CaptionWindowDecorViewModel.java
index cebc400..1a793a1 100644
--- a/libs/WindowManager/Shell/src/com/android/wm/shell/windowdecor/CaptionWindowDecorViewModel.java
+++ b/libs/WindowManager/Shell/src/com/android/wm/shell/windowdecor/CaptionWindowDecorViewModel.java
@@ -23,13 +23,11 @@
 import android.app.ActivityManager.RunningTaskInfo;
 import android.content.Context;
 import android.os.Handler;
-import android.os.IBinder;
 import android.util.SparseArray;
 import android.view.Choreographer;
 import android.view.MotionEvent;
 import android.view.SurfaceControl;
 import android.view.View;
-import android.window.TransitionInfo;
 import android.window.WindowContainerToken;
 import android.window.WindowContainerTransaction;
 
@@ -80,16 +78,6 @@
     }
 
     @Override
-    public void onTransitionReady(IBinder transition, TransitionInfo info,
-            TransitionInfo.Change change) {}
-
-    @Override
-    public void onTransitionMerged(IBinder merged, IBinder playing) {}
-
-    @Override
-    public void onTransitionFinished(IBinder transition) {}
-
-    @Override
     public void setFreeformTaskTransitionStarter(FreeformTaskTransitionStarter transitionStarter) {
         mTaskOperations = new TaskOperations(transitionStarter, mContext, mSyncQueue);
     }
diff --git a/libs/WindowManager/Shell/src/com/android/wm/shell/windowdecor/DesktopModeWindowDecorViewModel.java b/libs/WindowManager/Shell/src/com/android/wm/shell/windowdecor/DesktopModeWindowDecorViewModel.java
index 61a8e9b..d07c646 100644
--- a/libs/WindowManager/Shell/src/com/android/wm/shell/windowdecor/DesktopModeWindowDecorViewModel.java
+++ b/libs/WindowManager/Shell/src/com/android/wm/shell/windowdecor/DesktopModeWindowDecorViewModel.java
@@ -22,7 +22,6 @@
 import static android.app.WindowConfiguration.WINDOWING_MODE_MULTI_WINDOW;
 import static android.app.WindowConfiguration.WINDOWING_MODE_PINNED;
 import static android.view.WindowInsets.Type.statusBars;
-import static android.view.WindowManager.TRANSIT_FLAG_KEYGUARD_GOING_AWAY;
 
 import static com.android.wm.shell.common.split.SplitScreenConstants.SPLIT_POSITION_BOTTOM_OR_RIGHT;
 import static com.android.wm.shell.common.split.SplitScreenConstants.SPLIT_POSITION_TOP_OR_LEFT;
@@ -43,7 +42,6 @@
 import android.graphics.Region;
 import android.hardware.input.InputManager;
 import android.os.Handler;
-import android.os.IBinder;
 import android.os.Looper;
 import android.util.SparseArray;
 import android.view.Choreographer;
@@ -59,8 +57,6 @@
 import android.view.SurfaceControl.Transaction;
 import android.view.View;
 import android.view.ViewConfiguration;
-import android.view.WindowManager;
-import android.window.TransitionInfo;
 import android.window.WindowContainerToken;
 import android.window.WindowContainerTransaction;
 
@@ -80,8 +76,6 @@
 import com.android.wm.shell.desktopmode.DesktopTasksController;
 import com.android.wm.shell.desktopmode.DesktopTasksController.SnapPosition;
 import com.android.wm.shell.freeform.FreeformTaskTransitionStarter;
-import com.android.wm.shell.recents.RecentsTransitionHandler;
-import com.android.wm.shell.recents.RecentsTransitionStateListener;
 import com.android.wm.shell.splitscreen.SplitScreen;
 import com.android.wm.shell.splitscreen.SplitScreen.StageType;
 import com.android.wm.shell.splitscreen.SplitScreenController;
@@ -115,7 +109,6 @@
     private final DisplayController mDisplayController;
     private final SyncTransactionQueue mSyncQueue;
     private final Optional<DesktopTasksController> mDesktopTasksController;
-    private final RecentsTransitionHandler mRecentsTransitionHandler;
     private boolean mTransitionDragActive;
 
     private SparseArray<EventReceiver> mEventReceiversByDisplay = new SparseArray<>();
@@ -154,7 +147,6 @@
             SyncTransactionQueue syncQueue,
             Transitions transitions,
             Optional<DesktopTasksController> desktopTasksController,
-            RecentsTransitionHandler recentsTransitionHandler,
             RootTaskDisplayAreaOrganizer rootTaskDisplayAreaOrganizer
     ) {
         this(
@@ -170,7 +162,6 @@
                 syncQueue,
                 transitions,
                 desktopTasksController,
-                recentsTransitionHandler,
                 new DesktopModeWindowDecoration.Factory(),
                 new InputMonitorFactory(),
                 SurfaceControl.Transaction::new,
@@ -191,7 +182,6 @@
             SyncTransactionQueue syncQueue,
             Transitions transitions,
             Optional<DesktopTasksController> desktopTasksController,
-            RecentsTransitionHandler recentsTransitionHandler,
             DesktopModeWindowDecoration.Factory desktopModeWindowDecorFactory,
             InputMonitorFactory inputMonitorFactory,
             Supplier<SurfaceControl.Transaction> transactionFactory,
@@ -207,7 +197,6 @@
         mSyncQueue = syncQueue;
         mTransitions = transitions;
         mDesktopTasksController = desktopTasksController;
-        mRecentsTransitionHandler = recentsTransitionHandler;
         mShellCommandHandler = shellCommandHandler;
         mDesktopModeWindowDecorFactory = desktopModeWindowDecorFactory;
         mInputMonitorFactory = inputMonitorFactory;
@@ -219,12 +208,6 @@
 
     private void onInit() {
         mShellController.addKeyguardChangeListener(mDesktopModeKeyguardChangeListener);
-        mRecentsTransitionHandler.addTransitionStateListener(new RecentsTransitionStateListener() {
-            @Override
-            public void onTransitionStarted(IBinder transition) {
-                blockRelayoutOnTransitionStarted(transition);
-            }
-        });
         mShellCommandHandler.addDumpCallback(this::dump, this);
         mDisplayInsetsController.addInsetsChangedListener(mContext.getDisplayId(),
                 new DesktopModeOnInsetsChangedListener());
@@ -264,48 +247,6 @@
     }
 
     @Override
-    public void onTransitionReady(
-            @NonNull IBinder transition,
-            @NonNull TransitionInfo info,
-            @NonNull TransitionInfo.Change change) {
-        if (change.getMode() == WindowManager.TRANSIT_CHANGE
-                && (info.getType() == Transitions.TRANSIT_EXIT_DESKTOP_MODE
-                || info.getType() == Transitions.TRANSIT_DESKTOP_MODE_TOGGLE_RESIZE
-                || info.getType() == Transitions.TRANSIT_MOVE_TO_DESKTOP)) {
-            mWindowDecorByTaskId.get(change.getTaskInfo().taskId)
-                    .addTransitionPausingRelayout(transition);
-        } else if (change.getMode() == WindowManager.TRANSIT_TO_BACK
-                && info.getType() == Transitions.TRANSIT_DESKTOP_MODE_START_DRAG_TO_DESKTOP
-                && change.getTaskInfo() != null) {
-            final DesktopModeWindowDecoration decor =
-                    mWindowDecorByTaskId.get(change.getTaskInfo().taskId);
-            if (decor != null) {
-                decor.addTransitionPausingRelayout(transition);
-            }
-        } else if (change.getMode() == WindowManager.TRANSIT_TO_FRONT
-                && ((info.getFlags() & TRANSIT_FLAG_KEYGUARD_GOING_AWAY) != 0)
-                && change.getTaskInfo() != null) {
-            blockRelayoutOnTransitionStarted(transition);
-        }
-    }
-
-    @Override
-    public void onTransitionMerged(@NonNull IBinder merged, @NonNull IBinder playing) {
-        for (int i = 0; i < mWindowDecorByTaskId.size(); i++) {
-            final DesktopModeWindowDecoration decor = mWindowDecorByTaskId.valueAt(i);
-            decor.mergeTransitionPausingRelayout(merged, playing);
-        }
-    }
-
-    @Override
-    public void onTransitionFinished(@NonNull IBinder transition) {
-        for (int i = 0; i < mWindowDecorByTaskId.size(); i++) {
-            final DesktopModeWindowDecoration decor = mWindowDecorByTaskId.valueAt(i);
-            decor.removeTransitionPausingRelayout(transition);
-        }
-    }
-
-    @Override
     public void onTaskInfoChanged(RunningTaskInfo taskInfo) {
         final DesktopModeWindowDecoration decoration = mWindowDecorByTaskId.get(taskInfo.taskId);
         if (decoration == null) return;
@@ -365,16 +306,6 @@
         }
     }
 
-    private void blockRelayoutOnTransitionStarted(IBinder transition) {
-        // Block relayout on window decorations originating from #onTaskInfoChanges until the
-        // animation completes to avoid interfering with the transition animation.
-        for (int i = 0; i < mWindowDecorByTaskId.size(); i++) {
-            final DesktopModeWindowDecoration decor = mWindowDecorByTaskId.valueAt(i);
-            decor.incrementRelayoutBlock();
-            decor.addTransitionPausingRelayout(transition);
-        }
-    }
-
     private class DesktopModeTouchEventListener extends GestureDetector.SimpleOnGestureListener
             implements View.OnClickListener, View.OnTouchListener, View.OnLongClickListener,
             DragDetector.MotionEventHandler {
@@ -425,7 +356,6 @@
                     // App sometimes draws before the insets from WindowDecoration#relayout have
                     // been added, so they must be added here
                     mWindowDecorByTaskId.get(mTaskId).addCaptionInset(wct);
-                    decoration.incrementRelayoutBlock();
                     mDesktopTasksController.get().moveToDesktop(decoration, mTaskId, wct);
                     closeOtherSplitTask(mTaskId);
                 }
@@ -436,7 +366,7 @@
                     mSplitScreenController.moveTaskToFullscreen(mTaskId);
                 } else {
                     mDesktopTasksController.ifPresent(c ->
-                            c.moveToFullscreen(mTaskId, mWindowDecorByTaskId.get(mTaskId)));
+                            c.moveToFullscreen(mTaskId));
                 }
             } else if (id == R.id.split_screen_button) {
                 decoration.closeHandleMenu();
@@ -604,7 +534,7 @@
                     mDesktopTasksController.ifPresent(c -> c.onDragPositioningEnd(taskInfo,
                             position,
                             new PointF(e.getRawX(dragPointerIdx), e.getRawY(dragPointerIdx)),
-                            newTaskBounds, mWindowDecorByTaskId.get(mTaskId)));
+                            newTaskBounds));
                     mIsDragging = false;
                     return true;
                 }
@@ -812,20 +742,8 @@
                                     mContext, mDragToDesktopAnimationStartBounds,
                                     relevantDecor.mTaskInfo, relevantDecor.mTaskSurface);
                             mDesktopTasksController.ifPresent(
-                                    c -> {
-                                        final int taskId = relevantDecor.mTaskInfo.taskId;
-                                        relevantDecor.incrementRelayoutBlock();
-                                        if (isTaskInSplitScreen(taskId)) {
-                                            final DesktopModeWindowDecoration otherDecor =
-                                                    mWindowDecorByTaskId.get(
-                                                            getOtherSplitTask(taskId).taskId);
-                                            if (otherDecor != null) {
-                                                otherDecor.incrementRelayoutBlock();
-                                            }
-                                        }
-                                        c.startDragToDesktop(relevantDecor.mTaskInfo,
-                                                mMoveToDesktopAnimator, relevantDecor);
-                                    });
+                                    c -> c.startDragToDesktop(relevantDecor.mTaskInfo,
+                                            mMoveToDesktopAnimator, relevantDecor));
                         }
                     }
                     if (mMoveToDesktopAnimator != null) {
diff --git a/libs/WindowManager/Shell/src/com/android/wm/shell/windowdecor/DesktopModeWindowDecoration.java b/libs/WindowManager/Shell/src/com/android/wm/shell/windowdecor/DesktopModeWindowDecoration.java
index d08b655..5f77192 100644
--- a/libs/WindowManager/Shell/src/com/android/wm/shell/windowdecor/DesktopModeWindowDecoration.java
+++ b/libs/WindowManager/Shell/src/com/android/wm/shell/windowdecor/DesktopModeWindowDecoration.java
@@ -36,7 +36,6 @@
 import android.graphics.Region;
 import android.graphics.drawable.Drawable;
 import android.os.Handler;
-import android.os.IBinder;
 import android.util.Log;
 import android.view.Choreographer;
 import android.view.MotionEvent;
@@ -62,8 +61,6 @@
 import com.android.wm.shell.windowdecor.viewholder.DesktopModeFocusedWindowDecorationViewHolder;
 import com.android.wm.shell.windowdecor.viewholder.DesktopModeWindowDecorationViewHolder;
 
-import java.util.HashSet;
-import java.util.Set;
 import java.util.function.Supplier;
 
 /**
@@ -104,8 +101,6 @@
 
     private ExclusionRegionListener mExclusionRegionListener;
 
-    private final Set<IBinder> mTransitionsPausingRelayout = new HashSet<>();
-    private int mRelayoutBlock;
     private final RootTaskDisplayAreaOrganizer mRootTaskDisplayAreaOrganizer;
 
     DesktopModeWindowDecoration(
@@ -179,13 +174,6 @@
 
     @Override
     void relayout(ActivityManager.RunningTaskInfo taskInfo) {
-        // TaskListener callbacks and shell transitions aren't synchronized, so starting a shell
-        // transition can trigger an onTaskInfoChanged call that updates the task's SurfaceControl
-        // and interferes with the transition animation that is playing at the same time.
-        if (mRelayoutBlock > 0) {
-            return;
-        }
-
         final SurfaceControl.Transaction t = mSurfaceControlTransactionSupplier.get();
         // The crop and position of the task should only be set when a task is fluid resizing. In
         // all other cases, it is expected that the transition handler positions and crops the task
@@ -737,16 +725,6 @@
         return exclusionRegion;
     }
 
-    /**
-     * If transition exists in mTransitionsPausingRelayout, remove the transition and decrement
-     * mRelayoutBlock
-     */
-    void removeTransitionPausingRelayout(IBinder transition) {
-        if (mTransitionsPausingRelayout.remove(transition)) {
-            mRelayoutBlock--;
-        }
-    }
-
     @Override
     int getCaptionHeightId(@WindowingMode int windowingMode) {
         return getCaptionHeightIdStatic(windowingMode);
@@ -767,35 +745,10 @@
         return R.id.desktop_mode_caption;
     }
 
-    /**
-     * Add transition to mTransitionsPausingRelayout
-     */
-    void addTransitionPausingRelayout(IBinder transition) {
-        mTransitionsPausingRelayout.add(transition);
-    }
-
-    /**
-     * If two transitions merge and the merged transition is in mTransitionsPausingRelayout,
-     * remove the merged transition from the set and add the transition it was merged into.
-     */
-    public void mergeTransitionPausingRelayout(IBinder merged, IBinder playing) {
-        if (mTransitionsPausingRelayout.remove(merged)) {
-            mTransitionsPausingRelayout.add(playing);
-        }
-    }
-
-    /**
-     * Increase mRelayoutBlock, stopping relayout if mRelayoutBlock is now greater than 0.
-     */
-    public void incrementRelayoutBlock() {
-        mRelayoutBlock++;
-    }
-
     @Override
     public String toString() {
         return "{"
                 + "mPositionInParent=" + mPositionInParent + ", "
-                + "mRelayoutBlock=" + mRelayoutBlock + ", "
                 + "taskId=" + mTaskInfo.taskId + ", "
                 + "windowingMode=" + windowingModeToString(mTaskInfo.getWindowingMode()) + ", "
                 + "isFocused=" + isFocused()
diff --git a/libs/WindowManager/Shell/src/com/android/wm/shell/windowdecor/WindowDecorViewModel.java b/libs/WindowManager/Shell/src/com/android/wm/shell/windowdecor/WindowDecorViewModel.java
index ae1a3d9..01a6012 100644
--- a/libs/WindowManager/Shell/src/com/android/wm/shell/windowdecor/WindowDecorViewModel.java
+++ b/libs/WindowManager/Shell/src/com/android/wm/shell/windowdecor/WindowDecorViewModel.java
@@ -17,9 +17,7 @@
 package com.android.wm.shell.windowdecor;
 
 import android.app.ActivityManager;
-import android.os.IBinder;
 import android.view.SurfaceControl;
-import android.window.TransitionInfo;
 
 import com.android.wm.shell.freeform.FreeformTaskTransitionStarter;
 import com.android.wm.shell.splitscreen.SplitScreenController;
@@ -103,34 +101,4 @@
      * @param taskInfo the info of the task
      */
     void destroyWindowDecoration(ActivityManager.RunningTaskInfo taskInfo);
-
-    /**
-     * Notifies that a shell transition is about to start. If the transition is of type
-     * TRANSIT_ENTER_DESKTOP, it will save that transition to unpause relayout for the transitioning
-     * task after the transition has ended.
-     *
-     * @param transition the ready transaction
-     * @param info of Transition to check if relayout needs to be paused for a task
-     * @param change a change in the given transition
-     */
-    default void onTransitionReady(IBinder transition, TransitionInfo info,
-            TransitionInfo.Change change) {}
-
-    /**
-     * Notifies that a shell transition is about to merge with another to give the window
-     * decoration a chance to prepare for this merge.
-     *
-     * @param merged the transaction being merged
-     * @param playing the transaction being merged into
-     */
-    default void onTransitionMerged(IBinder merged, IBinder playing) {}
-
-    /**
-     * Notifies that a shell transition is about to finish  to give the window decoration a chance
-     * to clean up.
-     *
-     * @param transaction
-     */
-    default void onTransitionFinished(IBinder transaction) {}
-
 }
\ No newline at end of file
diff --git a/libs/WindowManager/Shell/tests/unittest/src/com/android/wm/shell/common/split/SplitScreenUtilsTests.kt b/libs/WindowManager/Shell/tests/unittest/src/com/android/wm/shell/common/split/SplitScreenUtilsTests.kt
new file mode 100644
index 0000000..955660c
--- /dev/null
+++ b/libs/WindowManager/Shell/tests/unittest/src/com/android/wm/shell/common/split/SplitScreenUtilsTests.kt
@@ -0,0 +1,69 @@
+/*
+ * Copyright (C) 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.wm.shell.common.split
+
+import android.content.ComponentName
+import android.content.pm.LauncherApps
+import android.content.pm.ShortcutInfo
+import android.os.UserHandle
+import androidx.test.ext.junit.runners.AndroidJUnit4
+import com.android.wm.shell.ShellTestCase
+import org.junit.Assert.assertEquals
+import org.junit.Test
+import org.junit.runner.RunWith
+import org.mockito.ArgumentMatchers.any
+import org.mockito.Mockito.mock
+import org.mockito.Mockito.`when`
+
+@RunWith(AndroidJUnit4::class)
+class SplitScreenUtilsTests : ShellTestCase() {
+
+    @Test
+    fun getShortcutComponent_nullShortcuts() {
+        val launcherApps = mock(LauncherApps::class.java).also {
+            `when`(it.getShortcuts(any(), any())).thenReturn(null)
+        }
+        assertEquals(null, SplitScreenUtils.getShortcutComponent(TEST_PACKAGE,
+                TEST_SHORTCUT_ID, UserHandle.CURRENT, launcherApps))
+    }
+
+    @Test
+    fun getShortcutComponent_noShortcuts() {
+        val launcherApps = mock(LauncherApps::class.java).also {
+            `when`(it.getShortcuts(any(), any())).thenReturn(ArrayList<ShortcutInfo>())
+        }
+        assertEquals(null, SplitScreenUtils.getShortcutComponent(TEST_PACKAGE,
+                TEST_SHORTCUT_ID, UserHandle.CURRENT, launcherApps))
+    }
+
+    @Test
+    fun getShortcutComponent_validShortcut() {
+        val component = ComponentName(TEST_PACKAGE, TEST_ACTIVITY)
+        val shortcutInfo = ShortcutInfo.Builder(context, "id").setActivity(component).build()
+        val launcherApps = mock(LauncherApps::class.java).also {
+            `when`(it.getShortcuts(any(), any())).thenReturn(arrayListOf(shortcutInfo))
+        }
+        assertEquals(component, SplitScreenUtils.getShortcutComponent(TEST_PACKAGE,
+                TEST_SHORTCUT_ID, UserHandle.CURRENT, launcherApps))
+    }
+
+    companion object {
+        val TEST_PACKAGE = "com.android.wm.shell.common.split"
+        val TEST_ACTIVITY = "TestActivity";
+        val TEST_SHORTCUT_ID = "test_shortcut_1"
+    }
+}
\ No newline at end of file
diff --git a/libs/WindowManager/Shell/tests/unittest/src/com/android/wm/shell/desktopmode/DesktopTasksControllerTest.kt b/libs/WindowManager/Shell/tests/unittest/src/com/android/wm/shell/desktopmode/DesktopTasksControllerTest.kt
index 94c862b..9249b0a 100644
--- a/libs/WindowManager/Shell/tests/unittest/src/com/android/wm/shell/desktopmode/DesktopTasksControllerTest.kt
+++ b/libs/WindowManager/Shell/tests/unittest/src/com/android/wm/shell/desktopmode/DesktopTasksControllerTest.kt
@@ -393,7 +393,7 @@
     fun moveToFullscreen_displayFullscreen_windowingModeSetToUndefined() {
         val task = setUpFreeformTask()
         task.configuration.windowConfiguration.displayWindowingMode = WINDOWING_MODE_FULLSCREEN
-        controller.moveToFullscreen(task.taskId, desktopModeWindowDecoration)
+        controller.moveToFullscreen(task.taskId)
         val wct = getLatestExitDesktopWct()
         assertThat(wct.changes[task.token.asBinder()]?.windowingMode)
             .isEqualTo(WINDOWING_MODE_UNDEFINED)
@@ -403,7 +403,7 @@
     fun moveToFullscreen_displayFreeform_windowingModeSetToFullscreen() {
         val task = setUpFreeformTask()
         task.configuration.windowConfiguration.displayWindowingMode = WINDOWING_MODE_FREEFORM
-        controller.moveToFullscreen(task.taskId, desktopModeWindowDecoration)
+        controller.moveToFullscreen(task.taskId)
         val wct = getLatestExitDesktopWct()
         assertThat(wct.changes[task.token.asBinder()]?.windowingMode)
                 .isEqualTo(WINDOWING_MODE_FULLSCREEN)
@@ -411,7 +411,7 @@
 
     @Test
     fun moveToFullscreen_nonExistentTask_doesNothing() {
-        controller.moveToFullscreen(999, desktopModeWindowDecoration)
+        controller.moveToFullscreen(999)
         verifyWCTNotExecuted()
     }
 
@@ -420,7 +420,7 @@
         val taskDefaultDisplay = setUpFreeformTask(displayId = DEFAULT_DISPLAY)
         val taskSecondDisplay = setUpFreeformTask(displayId = SECOND_DISPLAY)
 
-        controller.moveToFullscreen(taskDefaultDisplay.taskId, desktopModeWindowDecoration)
+        controller.moveToFullscreen(taskDefaultDisplay.taskId)
 
         with(getLatestExitDesktopWct()) {
             assertThat(changes.keys).contains(taskDefaultDisplay.token.asBinder())
diff --git a/libs/WindowManager/Shell/tests/unittest/src/com/android/wm/shell/splitscreen/SplitScreenControllerTests.java b/libs/WindowManager/Shell/tests/unittest/src/com/android/wm/shell/splitscreen/SplitScreenControllerTests.java
index 855b7ee..12a5594 100644
--- a/libs/WindowManager/Shell/tests/unittest/src/com/android/wm/shell/splitscreen/SplitScreenControllerTests.java
+++ b/libs/WindowManager/Shell/tests/unittest/src/com/android/wm/shell/splitscreen/SplitScreenControllerTests.java
@@ -22,6 +22,7 @@
 import static android.app.WindowConfiguration.WINDOWING_MODE_MULTI_WINDOW;
 import static android.content.Intent.FLAG_ACTIVITY_MULTIPLE_TASK;
 import static android.content.Intent.FLAG_ACTIVITY_NO_USER_ACTION;
+import static android.view.WindowManager.PROPERTY_SUPPORTS_MULTI_INSTANCE_SYSTEM_UI;
 
 import static com.android.wm.shell.common.split.SplitScreenConstants.SPLIT_POSITION_BOTTOM_OR_RIGHT;
 import static com.android.wm.shell.common.split.SplitScreenConstants.SPLIT_POSITION_TOP_OR_LEFT;
@@ -36,6 +37,8 @@
 import static org.mockito.ArgumentMatchers.isNull;
 import static org.mockito.Mockito.doNothing;
 import static org.mockito.Mockito.doReturn;
+import static org.mockito.Mockito.doThrow;
+import static org.mockito.Mockito.mock;
 import static org.mockito.Mockito.never;
 import static org.mockito.Mockito.spy;
 import static org.mockito.Mockito.times;
@@ -46,8 +49,10 @@
 import android.app.ActivityTaskManager;
 import android.app.PendingIntent;
 import android.content.ComponentName;
+import android.content.Context;
 import android.content.Intent;
 import android.content.pm.ActivityInfo;
+import android.content.pm.PackageManager;
 import android.os.Bundle;
 
 import androidx.test.annotation.UiThreadTest;
@@ -55,6 +60,7 @@
 import androidx.test.filters.SmallTest;
 
 import com.android.launcher3.icons.IconProvider;
+import com.android.wm.shell.R;
 import com.android.wm.shell.RootTaskDisplayAreaOrganizer;
 import com.android.wm.shell.ShellTaskOrganizer;
 import com.android.wm.shell.ShellTestCase;
@@ -91,6 +97,10 @@
 @RunWith(AndroidJUnit4.class)
 public class SplitScreenControllerTests extends ShellTestCase {
 
+    private static final String TEST_PACKAGE = "com.android.wm.shell.splitscreen";
+    private static final String TEST_NOT_ALLOWED_PACKAGE = "com.android.wm.shell.splitscreen.fake";
+    private static final String TEST_ACTIVITY = "TestActivity";
+
     @Mock ShellInit mShellInit;
     @Mock ShellCommandHandler mShellCommandHandler;
     @Mock ShellTaskOrganizer mTaskOrganizer;
@@ -118,6 +128,8 @@
     public void setup() {
         assumeTrue(ActivityTaskManager.supportsSplitScreenMultiWindow(mContext));
         MockitoAnnotations.initMocks(this);
+        String[] appsSupportingMultiInstance = mContext.getResources()
+                .getStringArray(R.array.config_appsSupportMultiInstancesSplit);
         mShellController = spy(new ShellController(mContext, mShellInit, mShellCommandHandler,
                 mMainExecutor));
         mSplitScreenController = spy(new SplitScreenController(mContext, mShellInit,
@@ -125,7 +137,8 @@
                 mRootTDAOrganizer, mDisplayController, mDisplayImeController,
                 mDisplayInsetsController, mDragAndDropController, mTransitions, mTransactionPool,
                 mIconProvider, mRecentTasks, mLaunchAdjacentController, mWindowDecorViewModel,
-                mDesktopTasksController, mMainExecutor, mStageCoordinator));
+                mDesktopTasksController, mMainExecutor, mStageCoordinator,
+                appsSupportingMultiInstance));
     }
 
     @Test
@@ -200,7 +213,7 @@
 
     @Test
     public void startIntent_multiInstancesSupported_appendsMultipleTaskFag() {
-        doReturn(true).when(mSplitScreenController).supportMultiInstancesSplit(any());
+        doReturn(true).when(mSplitScreenController).supportsMultiInstanceSplit(any());
         Intent startIntent = createStartIntent("startActivity");
         PendingIntent pendingIntent =
                 PendingIntent.getActivity(mContext, 0, startIntent, FLAG_IMMUTABLE);
@@ -237,12 +250,13 @@
 
         verify(mStageCoordinator).startTask(anyInt(), eq(SPLIT_POSITION_TOP_OR_LEFT),
                 isNull());
-        verify(mSplitScreenController, never()).supportMultiInstancesSplit(any());
+        verify(mSplitScreenController, never()).supportsMultiInstanceSplit(any());
         verify(mStageCoordinator, never()).switchSplitPosition(any());
     }
 
     @Test
     public void startIntent_multiInstancesSupported_startTaskInBackgroundAfterSplitActivated() {
+        doReturn(true).when(mSplitScreenController).supportsMultiInstanceSplit(any());
         doNothing().when(mSplitScreenController).startTask(anyInt(), anyInt(), any());
         Intent startIntent = createStartIntent("startActivity");
         PendingIntent pendingIntent =
@@ -259,14 +273,14 @@
 
         mSplitScreenController.startIntent(pendingIntent, mContext.getUserId(), null,
                 SPLIT_POSITION_TOP_OR_LEFT, null);
-        verify(mSplitScreenController, never()).supportMultiInstancesSplit(any());
+        verify(mSplitScreenController, never()).supportsMultiInstanceSplit(any());
         verify(mStageCoordinator).startTask(anyInt(), eq(SPLIT_POSITION_TOP_OR_LEFT),
                 isNull());
     }
 
     @Test
     public void startIntent_multiInstancesNotSupported_switchesPositionAfterSplitActivated() {
-        doReturn(false).when(mSplitScreenController).supportMultiInstancesSplit(any());
+        doReturn(false).when(mSplitScreenController).supportsMultiInstanceSplit(any());
         Intent startIntent = createStartIntent("startActivity");
         PendingIntent pendingIntent =
                 PendingIntent.getActivity(mContext, 0, startIntent, FLAG_IMMUTABLE);
@@ -283,6 +297,130 @@
         verify(mStageCoordinator).switchSplitPosition(anyString());
     }
 
+    @Test
+    public void supportsMultiInstanceSplit_inStaticAllowList() {
+        String[] allowList = { TEST_PACKAGE };
+        SplitScreenController controller = new SplitScreenController(mContext, mShellInit,
+                mShellCommandHandler, mShellController, mTaskOrganizer, mSyncQueue,
+                mRootTDAOrganizer, mDisplayController, mDisplayImeController,
+                mDisplayInsetsController, mDragAndDropController, mTransitions, mTransactionPool,
+                mIconProvider, mRecentTasks, mLaunchAdjacentController, mWindowDecorViewModel,
+                mDesktopTasksController, mMainExecutor, mStageCoordinator,
+                allowList);
+        ComponentName component = new ComponentName(TEST_PACKAGE, TEST_ACTIVITY);
+        assertEquals(true, controller.supportsMultiInstanceSplit(component));
+    }
+
+    @Test
+    public void supportsMultiInstanceSplit_notInStaticAllowList() {
+        String[] allowList = { TEST_PACKAGE };
+        SplitScreenController controller = new SplitScreenController(mContext, mShellInit,
+                mShellCommandHandler, mShellController, mTaskOrganizer, mSyncQueue,
+                mRootTDAOrganizer, mDisplayController, mDisplayImeController,
+                mDisplayInsetsController, mDragAndDropController, mTransitions, mTransactionPool,
+                mIconProvider, mRecentTasks, mLaunchAdjacentController, mWindowDecorViewModel,
+                mDesktopTasksController, mMainExecutor, mStageCoordinator,
+                allowList);
+        ComponentName component = new ComponentName(TEST_NOT_ALLOWED_PACKAGE, TEST_ACTIVITY);
+        assertEquals(false, controller.supportsMultiInstanceSplit(component));
+    }
+
+    @Test
+    public void supportsMultiInstanceSplit_activityPropertyTrue()
+            throws PackageManager.NameNotFoundException {
+        Context context = spy(mContext);
+        ComponentName component = new ComponentName(TEST_PACKAGE, TEST_ACTIVITY);
+        PackageManager pm = mock(PackageManager.class);
+        doReturn(pm).when(context).getPackageManager();
+        PackageManager.Property activityProp = new PackageManager.Property("", true, "", "");
+        doReturn(activityProp).when(pm).getProperty(eq(PROPERTY_SUPPORTS_MULTI_INSTANCE_SYSTEM_UI),
+                eq(component));
+        PackageManager.Property appProp = new PackageManager.Property("", false, "", "");
+        doReturn(appProp).when(pm).getProperty(eq(PROPERTY_SUPPORTS_MULTI_INSTANCE_SYSTEM_UI),
+                eq(component.getPackageName()));
+
+        SplitScreenController controller = new SplitScreenController(context, mShellInit,
+                mShellCommandHandler, mShellController, mTaskOrganizer, mSyncQueue,
+                mRootTDAOrganizer, mDisplayController, mDisplayImeController,
+                mDisplayInsetsController, mDragAndDropController, mTransitions, mTransactionPool,
+                mIconProvider, mRecentTasks, mLaunchAdjacentController, mWindowDecorViewModel,
+                mDesktopTasksController, mMainExecutor, mStageCoordinator,
+                new String[0]);
+        // Expect activity property to override application property
+        assertEquals(true, controller.supportsMultiInstanceSplit(component));
+    }
+
+    @Test
+    public void supportsMultiInstanceSplit_activityPropertyFalseApplicationPropertyTrue()
+            throws PackageManager.NameNotFoundException {
+        Context context = spy(mContext);
+        ComponentName component = new ComponentName(TEST_PACKAGE, TEST_ACTIVITY);
+        PackageManager pm = mock(PackageManager.class);
+        doReturn(pm).when(context).getPackageManager();
+        PackageManager.Property activityProp = new PackageManager.Property("", false, "", "");
+        doReturn(activityProp).when(pm).getProperty(eq(PROPERTY_SUPPORTS_MULTI_INSTANCE_SYSTEM_UI),
+                eq(component));
+        PackageManager.Property appProp = new PackageManager.Property("", true, "", "");
+        doReturn(appProp).when(pm).getProperty(eq(PROPERTY_SUPPORTS_MULTI_INSTANCE_SYSTEM_UI),
+                eq(component.getPackageName()));
+
+        SplitScreenController controller = new SplitScreenController(context, mShellInit,
+                mShellCommandHandler, mShellController, mTaskOrganizer, mSyncQueue,
+                mRootTDAOrganizer, mDisplayController, mDisplayImeController,
+                mDisplayInsetsController, mDragAndDropController, mTransitions, mTransactionPool,
+                mIconProvider, mRecentTasks, mLaunchAdjacentController, mWindowDecorViewModel,
+                mDesktopTasksController, mMainExecutor, mStageCoordinator,
+                new String[0]);
+        // Expect activity property to override application property
+        assertEquals(false, controller.supportsMultiInstanceSplit(component));
+    }
+
+    @Test
+    public void supportsMultiInstanceSplit_noActivityPropertyApplicationPropertyTrue()
+            throws PackageManager.NameNotFoundException {
+        Context context = spy(mContext);
+        ComponentName component = new ComponentName(TEST_PACKAGE, TEST_ACTIVITY);
+        PackageManager pm = mock(PackageManager.class);
+        doReturn(pm).when(context).getPackageManager();
+        doThrow(PackageManager.NameNotFoundException.class).when(pm).getProperty(
+                eq(PROPERTY_SUPPORTS_MULTI_INSTANCE_SYSTEM_UI), eq(component));
+        PackageManager.Property appProp = new PackageManager.Property("", true, "", "");
+        doReturn(appProp).when(pm).getProperty(eq(PROPERTY_SUPPORTS_MULTI_INSTANCE_SYSTEM_UI),
+                eq(component.getPackageName()));
+
+        SplitScreenController controller = new SplitScreenController(context, mShellInit,
+                mShellCommandHandler, mShellController, mTaskOrganizer, mSyncQueue,
+                mRootTDAOrganizer, mDisplayController, mDisplayImeController,
+                mDisplayInsetsController, mDragAndDropController, mTransitions, mTransactionPool,
+                mIconProvider, mRecentTasks, mLaunchAdjacentController, mWindowDecorViewModel,
+                mDesktopTasksController, mMainExecutor, mStageCoordinator,
+                new String[0]);
+        // Expect fall through to app property
+        assertEquals(true, controller.supportsMultiInstanceSplit(component));
+    }
+
+    @Test
+    public void supportsMultiInstanceSplit_noActivityOrAppProperty()
+            throws PackageManager.NameNotFoundException {
+        Context context = spy(mContext);
+        ComponentName component = new ComponentName(TEST_PACKAGE, TEST_ACTIVITY);
+        PackageManager pm = mock(PackageManager.class);
+        doReturn(pm).when(context).getPackageManager();
+        doThrow(PackageManager.NameNotFoundException.class).when(pm).getProperty(
+                eq(PROPERTY_SUPPORTS_MULTI_INSTANCE_SYSTEM_UI), eq(component));
+        doThrow(PackageManager.NameNotFoundException.class).when(pm).getProperty(
+                eq(PROPERTY_SUPPORTS_MULTI_INSTANCE_SYSTEM_UI), eq(component.getPackageName()));
+
+        SplitScreenController controller = new SplitScreenController(context, mShellInit,
+                mShellCommandHandler, mShellController, mTaskOrganizer, mSyncQueue,
+                mRootTDAOrganizer, mDisplayController, mDisplayImeController,
+                mDisplayInsetsController, mDragAndDropController, mTransitions, mTransactionPool,
+                mIconProvider, mRecentTasks, mLaunchAdjacentController, mWindowDecorViewModel,
+                mDesktopTasksController, mMainExecutor, mStageCoordinator,
+                new String[0]);
+        assertEquals(false, controller.supportsMultiInstanceSplit(component));
+    }
+
     private Intent createStartIntent(String activityName) {
         Intent intent = new Intent();
         intent.setComponent(new ComponentName(mContext, activityName));
diff --git a/libs/WindowManager/Shell/tests/unittest/src/com/android/wm/shell/windowdecor/DesktopModeWindowDecorViewModelTests.kt b/libs/WindowManager/Shell/tests/unittest/src/com/android/wm/shell/windowdecor/DesktopModeWindowDecorViewModelTests.kt
index 883c24e..f84685a 100644
--- a/libs/WindowManager/Shell/tests/unittest/src/com/android/wm/shell/windowdecor/DesktopModeWindowDecorViewModelTests.kt
+++ b/libs/WindowManager/Shell/tests/unittest/src/com/android/wm/shell/windowdecor/DesktopModeWindowDecorViewModelTests.kt
@@ -27,7 +27,6 @@
 import android.hardware.display.DisplayManager
 import android.hardware.display.VirtualDisplay
 import android.os.Handler
-import android.os.IBinder
 import android.testing.AndroidTestingRunner
 import android.testing.TestableLooper.RunWithLooper
 import android.view.Choreographer
@@ -40,8 +39,6 @@
 import android.view.SurfaceView
 import android.view.WindowInsets.Type.navigationBars
 import android.view.WindowInsets.Type.statusBars
-import android.view.WindowManager
-import android.window.TransitionInfo
 import androidx.test.filters.SmallTest
 import com.android.wm.shell.RootTaskDisplayAreaOrganizer
 import com.android.wm.shell.ShellTaskOrganizer
@@ -53,8 +50,6 @@
 import com.android.wm.shell.common.ShellExecutor
 import com.android.wm.shell.common.SyncTransactionQueue
 import com.android.wm.shell.desktopmode.DesktopTasksController
-import com.android.wm.shell.recents.RecentsTransitionHandler
-import com.android.wm.shell.recents.RecentsTransitionStateListener
 import com.android.wm.shell.sysui.KeyguardChangeListener
 import com.android.wm.shell.sysui.ShellCommandHandler
 import com.android.wm.shell.sysui.ShellController
@@ -100,7 +95,6 @@
     @Mock private lateinit var mockShellController: ShellController
     @Mock private lateinit var mockShellExecutor: ShellExecutor
     @Mock private lateinit var mockRootTaskDisplayAreaOrganizer: RootTaskDisplayAreaOrganizer
-    @Mock private lateinit var mockRecentsTransitionHandler: RecentsTransitionHandler
     @Mock private lateinit var mockShellCommandHandler: ShellCommandHandler
 
     private val transactionFactory = Supplier<SurfaceControl.Transaction> {
@@ -127,7 +121,6 @@
                 mockSyncQueue,
                 mockTransitions,
                 Optional.of(mockDesktopTasksController),
-                mockRecentsTransitionHandler,
                 mockDesktopModeWindowDecorFactory,
                 mockInputMonitorFactory,
                 transactionFactory,
@@ -275,48 +268,6 @@
     }
 
     @Test
-    fun testRelayoutBlockedDuringRecentsTransition() {
-        val recentsCaptor = argumentCaptor<RecentsTransitionStateListener>()
-        verify(mockRecentsTransitionHandler).addTransitionStateListener(recentsCaptor.capture())
-
-        val transition = mock(IBinder::class.java)
-        val task = createTask(windowingMode = WINDOWING_MODE_FREEFORM)
-        val decoration = setUpMockDecorationForTask(task)
-
-        // Make sure a window decorations exists first by launching a freeform task.
-        onTaskOpening(task)
-        // Now call back when a Recents transition starts.
-        recentsCaptor.firstValue.onTransitionStarted(transition)
-
-        verify(decoration).incrementRelayoutBlock()
-        verify(decoration).addTransitionPausingRelayout(transition)
-    }
-
-    @Test
-    fun testRelayoutBlockedDuringKeyguardTransition() {
-        val transition = mock(IBinder::class.java)
-        val task = createTask(windowingMode = WINDOWING_MODE_FREEFORM)
-        val decoration = setUpMockDecorationForTask(task)
-        val transitionInfo = mock(TransitionInfo::class.java)
-        val transitionChange = mock(TransitionInfo.Change::class.java)
-        val taskInfo = mock(RunningTaskInfo()::class.java)
-
-        // Replicate a keyguard going away transition for a task
-        whenever(transitionInfo.getFlags())
-                .thenReturn(WindowManager.TRANSIT_FLAG_KEYGUARD_GOING_AWAY)
-        whenever(transitionChange.getMode()).thenReturn(WindowManager.TRANSIT_TO_FRONT)
-        whenever(transitionChange.getTaskInfo()).thenReturn(taskInfo)
-
-        // Make sure a window decorations exists first by launching a freeform task.
-        onTaskOpening(task)
-        // OnTransition ready is called when a keyguard going away transition happens
-        desktopModeWindowDecorViewModel
-                .onTransitionReady(transition, transitionInfo, transitionChange)
-
-        verify(decoration).incrementRelayoutBlock()
-        verify(decoration).addTransitionPausingRelayout(transition)
-    }
-    @Test
     fun testRelayoutRunsWhenStatusBarsInsetsSourceVisibilityChanges() {
         val task = createTask(windowingMode = WINDOWING_MODE_FREEFORM, focused = true)
         val decoration = setUpMockDecorationForTask(task)
diff --git a/location/api/current.txt b/location/api/current.txt
index 0c23d8c..c55676b 100644
--- a/location/api/current.txt
+++ b/location/api/current.txt
@@ -414,7 +414,7 @@
     field public static final int TYPE_GPS_L5CNAV = 259; // 0x103
     field @FlaggedApi(Flags.FLAG_GNSS_API_NAVIC_L1) public static final int TYPE_IRN_L1 = 1795; // 0x703
     field @FlaggedApi(Flags.FLAG_GNSS_API_NAVIC_L1) public static final int TYPE_IRN_L5 = 1794; // 0x702
-    field @Deprecated public static final int TYPE_IRN_L5CA = 1793; // 0x701
+    field public static final int TYPE_IRN_L5CA = 1793; // 0x701
     field public static final int TYPE_QZS_L1CA = 1025; // 0x401
     field public static final int TYPE_SBS = 513; // 0x201
     field public static final int TYPE_UNKNOWN = 0; // 0x0
diff --git a/location/java/android/location/GnssNavigationMessage.java b/location/java/android/location/GnssNavigationMessage.java
index 5e3f803..7a667ae 100644
--- a/location/java/android/location/GnssNavigationMessage.java
+++ b/location/java/android/location/GnssNavigationMessage.java
@@ -78,9 +78,7 @@
     public static final int TYPE_GAL_F = 0x0602;
     /**
      * NavIC L5 C/A message contained in the structure.
-     * @deprecated deprecated.
      */
-    @Deprecated
     public static final int TYPE_IRN_L5CA = 0x0701;
     /** NavIC L5 message contained in the structure. */
     @FlaggedApi(Flags.FLAG_GNSS_API_NAVIC_L1)
diff --git a/media/java/android/media/MediaRoute2Info.java b/media/java/android/media/MediaRoute2Info.java
index 0eabe66..838630f 100644
--- a/media/java/android/media/MediaRoute2Info.java
+++ b/media/java/android/media/MediaRoute2Info.java
@@ -943,6 +943,10 @@
                         .append(getId())
                         .append(", name=")
                         .append(getName())
+                        .append(", type=")
+                        .append(getDeviceTypeString(getType()))
+                        .append(", isSystem=")
+                        .append(isSystemRoute())
                         .append(", features=")
                         .append(getFeatures())
                         .append(", iconUri=")
diff --git a/media/java/android/media/session/PlaybackState.java b/media/java/android/media/session/PlaybackState.java
index 60497fe..47637b8 100644
--- a/media/java/android/media/session/PlaybackState.java
+++ b/media/java/android/media/session/PlaybackState.java
@@ -15,7 +15,10 @@
  */
 package android.media.session;
 
+import static com.android.media.flags.Flags.FLAG_ENABLE_NOTIFYING_ACTIVITY_MANAGER_WITH_MEDIA_SESSION_STATUS_CHANGE;
+
 import android.annotation.DrawableRes;
+import android.annotation.FlaggedApi;
 import android.annotation.IntDef;
 import android.annotation.LongDef;
 import android.annotation.Nullable;
@@ -189,7 +192,8 @@
      */
     @IntDef({STATE_NONE, STATE_STOPPED, STATE_PAUSED, STATE_PLAYING, STATE_FAST_FORWARDING,
             STATE_REWINDING, STATE_BUFFERING, STATE_ERROR, STATE_CONNECTING,
-            STATE_SKIPPING_TO_PREVIOUS, STATE_SKIPPING_TO_NEXT, STATE_SKIPPING_TO_QUEUE_ITEM})
+            STATE_SKIPPING_TO_PREVIOUS, STATE_SKIPPING_TO_NEXT, STATE_SKIPPING_TO_QUEUE_ITEM,
+            STATE_PLAYBACK_SUPPRESSED})
     @Retention(RetentionPolicy.SOURCE)
     public @interface State {}
 
@@ -286,6 +290,19 @@
     public static final int STATE_SKIPPING_TO_QUEUE_ITEM = 11;
 
     /**
+     * State indicating that playback is paused due to an external transient interruption, like a
+     * phone call.
+     *
+     * <p>This state is different from {@link #STATE_PAUSED} in that it is deemed transitory,
+     * possibly allowing the service associated to the session in this state to run in the
+     * foreground.
+     *
+     * @see Builder#setState
+     */
+    @FlaggedApi(FLAG_ENABLE_NOTIFYING_ACTIVITY_MANAGER_WITH_MEDIA_SESSION_STATUS_CHANGE)
+    public static final int STATE_PLAYBACK_SUPPRESSED = 12;
+
+    /**
      * Use this value for the position to indicate the position is not known.
      */
     public static final long PLAYBACK_POSITION_UNKNOWN = -1;
@@ -384,6 +401,7 @@
      * <li> {@link PlaybackState#STATE_SKIPPING_TO_PREVIOUS}</li>
      * <li> {@link PlaybackState#STATE_SKIPPING_TO_NEXT}</li>
      * <li> {@link PlaybackState#STATE_SKIPPING_TO_QUEUE_ITEM}</li>
+     * <li> {@link PlaybackState#STATE_PLAYBACK_SUPPRESSED}</li>
      * </ul>
      */
     @State
@@ -507,6 +525,7 @@
      * <li>{@link #STATE_SKIPPING_TO_NEXT}</li>
      * <li>{@link #STATE_SKIPPING_TO_PREVIOUS}</li>
      * <li>{@link #STATE_SKIPPING_TO_QUEUE_ITEM}</li>
+     * <li>{@link #STATE_PLAYBACK_SUPPRESSED}</li>
      * </ul>
      */
     public boolean isActive() {
@@ -519,33 +538,12 @@
             case PlaybackState.STATE_BUFFERING:
             case PlaybackState.STATE_CONNECTING:
             case PlaybackState.STATE_PLAYING:
+            case PlaybackState.STATE_PLAYBACK_SUPPRESSED:
                 return true;
         }
         return false;
     }
 
-    /**
-     * Returns whether the service holding the media session should run in the foreground when the
-     * media session has this playback state or not.
-     *
-     * @hide
-     */
-    public boolean shouldAllowServiceToRunInForeground() {
-        switch (mState) {
-            case PlaybackState.STATE_PLAYING:
-            case PlaybackState.STATE_FAST_FORWARDING:
-            case PlaybackState.STATE_REWINDING:
-            case PlaybackState.STATE_BUFFERING:
-            case PlaybackState.STATE_CONNECTING:
-            case PlaybackState.STATE_SKIPPING_TO_PREVIOUS:
-            case PlaybackState.STATE_SKIPPING_TO_NEXT:
-            case PlaybackState.STATE_SKIPPING_TO_QUEUE_ITEM:
-                return true;
-            default:
-                return false;
-        }
-    }
-
     public static final @android.annotation.NonNull Parcelable.Creator<PlaybackState> CREATOR =
             new Parcelable.Creator<PlaybackState>() {
         @Override
@@ -586,6 +584,8 @@
                 return "SKIPPING_TO_NEXT";
             case STATE_SKIPPING_TO_QUEUE_ITEM:
                 return "SKIPPING_TO_QUEUE_ITEM";
+            case STATE_PLAYBACK_SUPPRESSED:
+                return "STATE_PLAYBACK_SUPPRESSED";
             default:
                 return "UNKNOWN";
         }
@@ -823,6 +823,7 @@
          * <li> {@link PlaybackState#STATE_SKIPPING_TO_PREVIOUS}</li>
          * <li> {@link PlaybackState#STATE_SKIPPING_TO_NEXT}</li>
          * <li> {@link PlaybackState#STATE_SKIPPING_TO_QUEUE_ITEM}</li>
+         * <li> {@link PlaybackState#STATE_PLAYBACK_SUPPRESSED}</li>
          * </ul>
          *
          * @param state The current state of playback.
@@ -867,6 +868,7 @@
          * <li> {@link PlaybackState#STATE_SKIPPING_TO_PREVIOUS}</li>
          * <li> {@link PlaybackState#STATE_SKIPPING_TO_NEXT}</li>
          * <li> {@link PlaybackState#STATE_SKIPPING_TO_QUEUE_ITEM}</li>
+         * <li> {@link PlaybackState#STATE_PLAYBACK_SUPPRESSED}</li>
          * </ul>
          *
          * @param state The current state of playback.
diff --git a/packages/PackageInstaller/src/com/android/packageinstaller/v2/model/InstallRepository.kt b/packages/PackageInstaller/src/com/android/packageinstaller/v2/model/InstallRepository.kt
index 326e533..aeabbd5 100644
--- a/packages/PackageInstaller/src/com/android/packageinstaller/v2/model/InstallRepository.kt
+++ b/packages/PackageInstaller/src/com/android/packageinstaller/v2/model/InstallRepository.kt
@@ -46,6 +46,7 @@
 import com.android.packageinstaller.v2.model.InstallAborted.Companion.ABORT_REASON_DONE
 import com.android.packageinstaller.v2.model.InstallAborted.Companion.ABORT_REASON_INTERNAL_ERROR
 import com.android.packageinstaller.v2.model.InstallAborted.Companion.ABORT_REASON_POLICY
+import com.android.packageinstaller.v2.model.InstallAborted.Companion.DLG_NONE
 import com.android.packageinstaller.v2.model.InstallAborted.Companion.DLG_PACKAGE_ERROR
 import com.android.packageinstaller.v2.model.InstallUserActionRequired.Companion.USER_ACTION_REASON_ANONYMOUS_SOURCE
 import com.android.packageinstaller.v2.model.InstallUserActionRequired.Companion.USER_ACTION_REASON_INSTALL_CONFIRMATION
@@ -283,14 +284,15 @@
                             createSessionParams(intent, pfd, uri.toString())
                         stagedSessionId = packageInstaller.createSession(params)
                     }
-                } catch (e: IOException) {
+                } catch (e: Exception) {
                     Log.w(LOG_TAG, "Failed to create a staging session", e)
                     _stagingResult.value = InstallAborted(
                         ABORT_REASON_INTERNAL_ERROR,
                         resultIntent = Intent().putExtra(
                             Intent.EXTRA_INSTALL_RESULT, PackageManager.INSTALL_FAILED_INVALID_APK
                         ),
-                        activityResultCode = Activity.RESULT_FIRST_USER
+                        activityResultCode = Activity.RESULT_FIRST_USER,
+                        errorDialogType =  if (e is IOException) DLG_PACKAGE_ERROR else DLG_NONE
                     )
                     return
                 }
@@ -313,6 +315,14 @@
                     )
                 }
             }
+        } else {
+            _stagingResult.value = InstallAborted(
+                ABORT_REASON_INTERNAL_ERROR,
+                resultIntent = Intent().putExtra(
+                    Intent.EXTRA_INSTALL_RESULT, PackageManager.INSTALL_FAILED_INVALID_URI
+                ),
+                activityResultCode = Activity.RESULT_FIRST_USER
+            )
         }
     }
 
diff --git a/packages/PackageInstaller/src/com/android/packageinstaller/v2/model/InstallStages.kt b/packages/PackageInstaller/src/com/android/packageinstaller/v2/model/InstallStages.kt
index be49b39..bbb9bca 100644
--- a/packages/PackageInstaller/src/com/android/packageinstaller/v2/model/InstallStages.kt
+++ b/packages/PackageInstaller/src/com/android/packageinstaller/v2/model/InstallStages.kt
@@ -122,13 +122,14 @@
      */
     val resultIntent: Intent? = null,
     val activityResultCode: Int = Activity.RESULT_CANCELED,
-    val errorDialogType: Int? = 0,
+    val errorDialogType: Int? = DLG_NONE,
 ) : InstallStage(STAGE_ABORTED) {
 
     companion object {
         const val ABORT_REASON_INTERNAL_ERROR = 0
         const val ABORT_REASON_POLICY = 1
         const val ABORT_REASON_DONE = 2
+        const val DLG_NONE = 0
         const val DLG_PACKAGE_ERROR = 1
     }
 }
diff --git a/packages/PackageInstaller/src/com/android/packageinstaller/v2/ui/InstallActionListener.kt b/packages/PackageInstaller/src/com/android/packageinstaller/v2/ui/InstallActionListener.kt
index c109fc6..1d4d178 100644
--- a/packages/PackageInstaller/src/com/android/packageinstaller/v2/ui/InstallActionListener.kt
+++ b/packages/PackageInstaller/src/com/android/packageinstaller/v2/ui/InstallActionListener.kt
@@ -34,6 +34,8 @@
      */
     fun onNegativeResponse(stageCode: Int)
 
+    fun onNegativeResponse(resultCode: Int, data: Intent?)
+
     /**
      * Launch the intent to open the newly installed / updated app.
      */
diff --git a/packages/PackageInstaller/src/com/android/packageinstaller/v2/ui/InstallLaunch.kt b/packages/PackageInstaller/src/com/android/packageinstaller/v2/ui/InstallLaunch.kt
index 2b610d7..6f8eca3 100644
--- a/packages/PackageInstaller/src/com/android/packageinstaller/v2/ui/InstallLaunch.kt
+++ b/packages/PackageInstaller/src/com/android/packageinstaller/v2/ui/InstallLaunch.kt
@@ -36,10 +36,10 @@
 import androidx.fragment.app.FragmentManager
 import androidx.lifecycle.ViewModelProvider
 import com.android.packageinstaller.R
-import com.android.packageinstaller.v2.model.InstallRepository
 import com.android.packageinstaller.v2.model.InstallAborted
 import com.android.packageinstaller.v2.model.InstallFailed
 import com.android.packageinstaller.v2.model.InstallInstalling
+import com.android.packageinstaller.v2.model.InstallRepository
 import com.android.packageinstaller.v2.model.InstallStage
 import com.android.packageinstaller.v2.model.InstallSuccess
 import com.android.packageinstaller.v2.model.InstallUserActionRequired
@@ -50,6 +50,7 @@
 import com.android.packageinstaller.v2.ui.fragments.InstallInstallingFragment
 import com.android.packageinstaller.v2.ui.fragments.InstallStagingFragment
 import com.android.packageinstaller.v2.ui.fragments.InstallSuccessFragment
+import com.android.packageinstaller.v2.ui.fragments.ParseErrorFragment
 import com.android.packageinstaller.v2.ui.fragments.SimpleErrorFragment
 import com.android.packageinstaller.v2.viewmodel.InstallViewModel
 import com.android.packageinstaller.v2.viewmodel.InstallViewModelFactory
@@ -124,8 +125,15 @@
             InstallStage.STAGE_ABORTED -> {
                 val aborted = installStage as InstallAborted
                 when (aborted.abortReason) {
-                    InstallAborted.ABORT_REASON_DONE, InstallAborted.ABORT_REASON_INTERNAL_ERROR ->
-                        setResult(aborted.activityResultCode, aborted.resultIntent, true)
+                    InstallAborted.ABORT_REASON_DONE,
+                    InstallAborted.ABORT_REASON_INTERNAL_ERROR -> {
+                        if (aborted.errorDialogType == InstallAborted.DLG_PACKAGE_ERROR) {
+                            val parseErrorDialog = ParseErrorFragment(aborted)
+                            showDialogInner(parseErrorDialog)
+                        } else {
+                            setResult(aborted.activityResultCode, aborted.resultIntent, true)
+                        }
+                    }
 
                     InstallAborted.ABORT_REASON_POLICY -> showPolicyRestrictionDialog(aborted)
                     else -> setResult(Activity.RESULT_CANCELED, null, true)
@@ -204,7 +212,7 @@
             val blockedByPolicyDialog = createDevicePolicyRestrictionDialog(restriction)
             // Don't finish the package installer app since the next dialog
             // will be shown by this app
-            shouldFinish = blockedByPolicyDialog != null
+            shouldFinish = blockedByPolicyDialog == null
             showDialogInner(blockedByPolicyDialog)
         }
         setResult(Activity.RESULT_CANCELED, null, shouldFinish)
@@ -267,6 +275,10 @@
         setResult(Activity.RESULT_CANCELED, null, true)
     }
 
+    override fun onNegativeResponse(resultCode: Int, data: Intent?) {
+        setResult(resultCode, data, true)
+    }
+
     override fun sendUnknownAppsIntent(sourcePackageName: String) {
         val settingsIntent = Intent()
         settingsIntent.setAction(Settings.ACTION_MANAGE_UNKNOWN_APP_SOURCES)
diff --git a/packages/PackageInstaller/src/com/android/packageinstaller/v2/ui/fragments/ParseErrorFragment.java b/packages/PackageInstaller/src/com/android/packageinstaller/v2/ui/fragments/ParseErrorFragment.java
new file mode 100644
index 0000000..68d48d6
--- /dev/null
+++ b/packages/PackageInstaller/src/com/android/packageinstaller/v2/ui/fragments/ParseErrorFragment.java
@@ -0,0 +1,64 @@
+/*
+ * Copyright (C) 2024 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.packageinstaller.v2.ui.fragments;
+
+import android.app.AlertDialog;
+import android.app.Dialog;
+import android.content.Context;
+import android.content.DialogInterface;
+import android.os.Bundle;
+import androidx.annotation.NonNull;
+import androidx.fragment.app.DialogFragment;
+import com.android.packageinstaller.R;
+import com.android.packageinstaller.v2.model.InstallAborted;
+import com.android.packageinstaller.v2.ui.InstallActionListener;
+
+public class ParseErrorFragment extends DialogFragment {
+
+    private static final String TAG = ParseErrorFragment.class.getSimpleName();
+    private final InstallAborted mDialogData;
+    private InstallActionListener mInstallActionListener;
+
+    public ParseErrorFragment(InstallAborted dialogData) {
+        mDialogData = dialogData;
+    }
+
+    @Override
+    public void onAttach(@NonNull Context context) {
+        super.onAttach(context);
+        mInstallActionListener = (InstallActionListener) context;
+    }
+
+    @NonNull
+    @Override
+    public Dialog onCreateDialog(Bundle savedInstanceState) {
+        return new AlertDialog.Builder(getActivity())
+            .setMessage(R.string.Parse_error_dlg_text)
+            .setPositiveButton(R.string.ok,
+                (dialog, which) ->
+                    mInstallActionListener.onNegativeResponse(
+                        mDialogData.getActivityResultCode(), mDialogData.getResultIntent()))
+            .create();
+    }
+
+    @Override
+    public void onCancel(DialogInterface dialog) {
+        super.onCancel(dialog);
+        mInstallActionListener.onNegativeResponse(
+            mDialogData.getActivityResultCode(), mDialogData.getResultIntent());
+    }
+}
diff --git a/packages/SettingsLib/LintChecker/Android.bp b/packages/SettingsLib/LintChecker/Android.bp
new file mode 100644
index 0000000..eb489b1
--- /dev/null
+++ b/packages/SettingsLib/LintChecker/Android.bp
@@ -0,0 +1,33 @@
+// Copyright (C) 2023 The Android Open Source Project
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+package {
+    // See: http://go/android-license-faq
+    // A large-scale-change added 'default_applicable_licenses' to import
+    // all of the 'license_kinds' from "frameworks_base_license"
+    // to get the below license kinds:
+    //   SPDX-license-identifier-Apache-2.0
+    default_applicable_licenses: ["frameworks_base_license"],
+}
+
+java_library_host {
+    name: "SettingsLibLintChecker",
+    srcs: ["src/**/*.kt"],
+    plugins: ["auto_service_plugin"],
+    libs: [
+        "auto_service_annotations",
+        "lint_api",
+    ],
+    kotlincflags: ["-Xjvm-default=all"],
+}
diff --git a/packages/SettingsLib/LintChecker/src/com/android/settingslib/tools/lint/NullabilityAnnotationsDetector.kt b/packages/SettingsLib/LintChecker/src/com/android/settingslib/tools/lint/NullabilityAnnotationsDetector.kt
new file mode 100644
index 0000000..1f06261
--- /dev/null
+++ b/packages/SettingsLib/LintChecker/src/com/android/settingslib/tools/lint/NullabilityAnnotationsDetector.kt
@@ -0,0 +1,146 @@
+/*
+ * Copyright (C) 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.settingslib.tools.lint
+
+import com.android.tools.lint.client.api.UElementHandler
+import com.android.tools.lint.detector.api.Category
+import com.android.tools.lint.detector.api.Detector
+import com.android.tools.lint.detector.api.Implementation
+import com.android.tools.lint.detector.api.Issue
+import com.android.tools.lint.detector.api.JavaContext
+import com.android.tools.lint.detector.api.LintFix
+import com.android.tools.lint.detector.api.Scope
+import com.android.tools.lint.detector.api.Severity
+import com.intellij.psi.PsiModifier
+import com.intellij.psi.PsiPrimitiveType
+import com.intellij.psi.PsiType
+import org.jetbrains.uast.UAnnotated
+import org.jetbrains.uast.UElement
+import org.jetbrains.uast.UMethod
+
+class NullabilityAnnotationsDetector : Detector(), Detector.UastScanner {
+    override fun getApplicableUastTypes(): List<Class<out UElement>> = listOf(UMethod::class.java)
+
+    override fun createUastHandler(context: JavaContext): UElementHandler? {
+        if (!context.isJavaFile()) return null
+
+        return object : UElementHandler() {
+            override fun visitMethod(node: UMethod) {
+                if (node.isPublic() && node.name != ANONYMOUS_CONSTRUCTOR) {
+                    node.verifyMethod()
+                    node.verifyMethodParameters()
+                }
+            }
+
+            private fun UMethod.isPublic() = modifierList.hasModifierProperty(PsiModifier.PUBLIC)
+
+            private fun UMethod.verifyMethod() {
+                if (isConstructor) return
+                if (returnType.isPrimitive()) return
+                checkAnnotation(METHOD_MSG)
+            }
+
+            private fun UMethod.verifyMethodParameters() {
+                for (parameter in uastParameters) {
+                    if (parameter.type.isPrimitive()) continue
+                    parameter.checkAnnotation(PARAMETER_MSG)
+                }
+            }
+
+            private fun PsiType?.isPrimitive() = this is PsiPrimitiveType
+
+            private fun UAnnotated.checkAnnotation(message: String) {
+                val oldAnnotation = findOldNullabilityAnnotation()
+                val oldAnnotationName = oldAnnotation?.qualifiedName?.substringAfterLast('.')
+
+                if (oldAnnotationName != null) {
+                    val annotation = "androidx.annotation.$oldAnnotationName"
+                    reportIssue(
+                        REQUIRE_NULLABILITY_ISSUE,
+                        "Prefer $annotation",
+                        LintFix.create()
+                                .replace()
+                                .range(context.getLocation(oldAnnotation))
+                                .with("@$annotation")
+                                .autoFix()
+                                .build()
+                    )
+                } else if (!hasNullabilityAnnotation()) {
+                    reportIssue(REQUIRE_NULLABILITY_ISSUE, message)
+                }
+            }
+
+            private fun UElement.reportIssue(
+                issue: Issue,
+                message: String,
+                quickfixData: LintFix? = null,
+            ) {
+                context.report(
+                    issue = issue,
+                    scope = this,
+                    location = context.getNameLocation(this),
+                    message = message,
+                    quickfixData = quickfixData,
+                )
+            }
+
+            private fun UAnnotated.findOldNullabilityAnnotation() =
+                uAnnotations.find { it.qualifiedName in oldAnnotations }
+
+            private fun UAnnotated.hasNullabilityAnnotation() =
+                uAnnotations.any { it.qualifiedName in validAnnotations }
+        }
+    }
+
+    private fun JavaContext.isJavaFile() = psiFile?.fileElementType.toString().startsWith("java")
+
+    companion object {
+        private val validAnnotations = arrayOf("androidx.annotation.NonNull",
+            "androidx.annotation.Nullable")
+
+        private val oldAnnotations = arrayOf("android.annotation.NonNull",
+            "android.annotation.Nullable",
+        )
+
+        private const val ANONYMOUS_CONSTRUCTOR = "<anon-init>"
+
+        private const val METHOD_MSG =
+                "Java public method return with non-primitive type must add androidx annotation. " +
+                        "Example: @NonNull | @Nullable Object functionName() {}"
+
+        private const val PARAMETER_MSG =
+                "Java public method parameter with non-primitive type must add androidx " +
+                        "annotation. Example: functionName(@NonNull Context context, " +
+                        "@Nullable Object obj) {}"
+
+        internal val REQUIRE_NULLABILITY_ISSUE = Issue
+            .create(
+                id = "RequiresNullabilityAnnotation",
+                briefDescription = "Requires nullability annotation for function",
+                explanation = "All public java APIs should specify nullability annotations for " +
+                        "methods and parameters.",
+                category = Category.CUSTOM_LINT_CHECKS,
+                priority = 3,
+                severity = Severity.WARNING,
+                androidSpecific = true,
+                implementation = Implementation(
+                  NullabilityAnnotationsDetector::class.java,
+                  Scope.JAVA_FILE_SCOPE,
+                ),
+            )
+    }
+}
\ No newline at end of file
diff --git a/packages/SettingsLib/LintChecker/src/com/android/settingslib/tools/lint/SettingsLintIssueRegistry.kt b/packages/SettingsLib/LintChecker/src/com/android/settingslib/tools/lint/SettingsLintIssueRegistry.kt
new file mode 100644
index 0000000..e0ab24a
--- /dev/null
+++ b/packages/SettingsLib/LintChecker/src/com/android/settingslib/tools/lint/SettingsLintIssueRegistry.kt
@@ -0,0 +1,28 @@
+/*
+ * Copyright (C) 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.settingslib.tools.lint
+
+import com.android.tools.lint.client.api.IssueRegistry
+import com.android.tools.lint.detector.api.CURRENT_API
+import com.google.auto.service.AutoService
+
+@AutoService(IssueRegistry::class)
+class SettingsLintIssueRegistry : IssueRegistry() {
+    override val issues = listOf(NullabilityAnnotationsDetector.REQUIRE_NULLABILITY_ISSUE)
+
+    override val api: Int = CURRENT_API
+}
\ No newline at end of file
diff --git a/packages/SettingsLib/SettingsTheme/res/values-v31/styles.xml b/packages/SettingsLib/SettingsTheme/res/values-v31/styles.xml
index f44b161..0e40db2 100644
--- a/packages/SettingsLib/SettingsTheme/res/values-v31/styles.xml
+++ b/packages/SettingsLib/SettingsTheme/res/values-v31/styles.xml
@@ -14,10 +14,11 @@
   See the License for the specific language governing permissions and
   limitations under the License.
   -->
-<resources>
+<resources
+    xmlns:androidprv="http://schemas.android.com/apk/prv/res/android">
     <style name="TextAppearance.PreferenceTitle.SettingsLib"
            parent="@android:style/TextAppearance.Material.Subhead">
-        <item name="android:textColor">@color/settingslib_text_color_primary</item>
+        <item name="android:textColor">?androidprv:attr/materialColorOnSurface</item>
         <item name="android:fontFamily">@string/settingslib_config_headlineFontFamily</item>
         <item name="android:textSize">20sp</item>
     </style>
diff --git a/packages/SettingsLib/Spa/spa/src/com/android/settingslib/spa/framework/theme/SettingsDimension.kt b/packages/SettingsLib/Spa/spa/src/com/android/settingslib/spa/framework/theme/SettingsDimension.kt
index c143390..b7f2c1e 100644
--- a/packages/SettingsLib/Spa/spa/src/com/android/settingslib/spa/framework/theme/SettingsDimension.kt
+++ b/packages/SettingsLib/Spa/spa/src/com/android/settingslib/spa/framework/theme/SettingsDimension.kt
@@ -34,6 +34,15 @@
         end = itemPaddingEnd,
         bottom = itemPaddingVertical,
     )
+    val textFieldPadding = PaddingValues(
+        start = itemPaddingStart,
+        end = itemPaddingEnd,
+    )
+    val menuFieldPadding = PaddingValues(
+        start = itemPaddingStart,
+        end = itemPaddingEnd,
+        bottom = itemPaddingVertical,
+    )
     val itemPaddingAround = 8.dp
     val itemDividerHeight = 32.dp
 
diff --git a/packages/SettingsLib/Spa/spa/src/com/android/settingslib/spa/widget/editor/SettingsExposedDropdownMenuBox.kt b/packages/SettingsLib/Spa/spa/src/com/android/settingslib/spa/widget/editor/SettingsExposedDropdownMenuBox.kt
index 0d6c064..f6692a3 100644
--- a/packages/SettingsLib/Spa/spa/src/com/android/settingslib/spa/widget/editor/SettingsExposedDropdownMenuBox.kt
+++ b/packages/SettingsLib/Spa/spa/src/com/android/settingslib/spa/widget/editor/SettingsExposedDropdownMenuBox.kt
@@ -51,7 +51,7 @@
         onExpandedChange = { expanded = it },
         modifier = Modifier
             .width(350.dp)
-            .padding(SettingsDimension.itemPadding),
+            .padding(SettingsDimension.menuFieldPadding),
     ) {
         OutlinedTextField(
             // The `menuAnchor` modifier must be passed to the text field for correctness.
diff --git a/packages/SettingsLib/Spa/spa/src/com/android/settingslib/spa/widget/editor/SettingsExposedDropdownMenuCheckBox.kt b/packages/SettingsLib/Spa/spa/src/com/android/settingslib/spa/widget/editor/SettingsExposedDropdownMenuCheckBox.kt
index 5d248e1..ba8e354 100644
--- a/packages/SettingsLib/Spa/spa/src/com/android/settingslib/spa/widget/editor/SettingsExposedDropdownMenuCheckBox.kt
+++ b/packages/SettingsLib/Spa/spa/src/com/android/settingslib/spa/widget/editor/SettingsExposedDropdownMenuCheckBox.kt
@@ -63,7 +63,7 @@
         onExpandedChange = { expanded = it },
         modifier = Modifier
             .width(350.dp)
-            .padding(SettingsDimension.itemPadding)
+            .padding(SettingsDimension.menuFieldPadding)
             .onSizeChanged { dropDownWidth = it.width },
     ) {
         OutlinedTextField(
diff --git a/packages/SettingsLib/Spa/spa/src/com/android/settingslib/spa/widget/editor/SettingsOutlinedTextField.kt b/packages/SettingsLib/Spa/spa/src/com/android/settingslib/spa/widget/editor/SettingsOutlinedTextField.kt
index e0dd4e1..2ce3c66 100644
--- a/packages/SettingsLib/Spa/spa/src/com/android/settingslib/spa/widget/editor/SettingsOutlinedTextField.kt
+++ b/packages/SettingsLib/Spa/spa/src/com/android/settingslib/spa/widget/editor/SettingsOutlinedTextField.kt
@@ -42,7 +42,7 @@
     OutlinedTextField(
         modifier = Modifier
             .fillMaxWidth()
-            .padding(SettingsDimension.itemPadding),
+            .padding(SettingsDimension.textFieldPadding),
         value = value,
         onValueChange = onTextChange,
         label = {
diff --git a/packages/SettingsLib/Spa/spa/src/com/android/settingslib/spa/widget/editor/SettingsTextFieldPassword.kt b/packages/SettingsLib/Spa/spa/src/com/android/settingslib/spa/widget/editor/SettingsTextFieldPassword.kt
index 0757df3..3102a00 100644
--- a/packages/SettingsLib/Spa/spa/src/com/android/settingslib/spa/widget/editor/SettingsTextFieldPassword.kt
+++ b/packages/SettingsLib/Spa/spa/src/com/android/settingslib/spa/widget/editor/SettingsTextFieldPassword.kt
@@ -52,7 +52,7 @@
     var visibility by remember { mutableStateOf(false) }
     OutlinedTextField(
         modifier = Modifier
-            .padding(SettingsDimension.itemPadding)
+            .padding(SettingsDimension.menuFieldPadding)
             .fillMaxWidth(),
         value = value,
         onValueChange = onTextChange,
diff --git a/packages/SettingsLib/src/com/android/settingslib/media/LocalMediaManager.java b/packages/SettingsLib/src/com/android/settingslib/media/LocalMediaManager.java
index ebcca42..5925492 100644
--- a/packages/SettingsLib/src/com/android/settingslib/media/LocalMediaManager.java
+++ b/packages/SettingsLib/src/com/android/settingslib/media/LocalMediaManager.java
@@ -184,10 +184,6 @@
             return false;
         }
 
-        if (mCurrentConnectedDevice != null) {
-            mCurrentConnectedDevice.disconnect();
-        }
-
         device.setState(MediaDeviceState.STATE_CONNECTING);
         mInfoMediaManager.connectToDevice(device);
         return true;
diff --git a/packages/SettingsLib/src/com/android/settingslib/media/MediaDevice.java b/packages/SettingsLib/src/com/android/settingslib/media/MediaDevice.java
index f2d9d14..0c4cf76 100644
--- a/packages/SettingsLib/src/com/android/settingslib/media/MediaDevice.java
+++ b/packages/SettingsLib/src/com/android/settingslib/media/MediaDevice.java
@@ -396,12 +396,6 @@
     }
 
     /**
-     * Stop transfer MediaDevice
-     */
-    public void disconnect() {
-    }
-
-    /**
      * Set current device's state
      */
     public void setState(@LocalMediaManager.MediaDeviceState int state) {
diff --git a/packages/SettingsLib/tests/robotests/src/com/android/settingslib/media/LocalMediaManagerTest.java b/packages/SettingsLib/tests/robotests/src/com/android/settingslib/media/LocalMediaManagerTest.java
index 999e8d5..9a7d4f1 100644
--- a/packages/SettingsLib/tests/robotests/src/com/android/settingslib/media/LocalMediaManagerTest.java
+++ b/packages/SettingsLib/tests/robotests/src/com/android/settingslib/media/LocalMediaManagerTest.java
@@ -147,7 +147,6 @@
         mLocalMediaManager.registerCallback(mCallback);
         assertThat(mLocalMediaManager.connectDevice(device)).isTrue();
 
-        verify(currentDevice).disconnect();
         verify(mInfoMediaManager).connectToDevice(device);
     }
 
diff --git a/packages/SettingsProvider/src/android/provider/settings/backup/GlobalSettings.java b/packages/SettingsProvider/src/android/provider/settings/backup/GlobalSettings.java
index 2e39adc..add3134 100644
--- a/packages/SettingsProvider/src/android/provider/settings/backup/GlobalSettings.java
+++ b/packages/SettingsProvider/src/android/provider/settings/backup/GlobalSettings.java
@@ -93,6 +93,7 @@
         Settings.Global.Wearable.CLOCKWORK_AUTO_TIME,
         Settings.Global.Wearable.CLOCKWORK_AUTO_TIME_ZONE,
         Settings.Global.Wearable.CLOCKWORK_24HR_TIME,
+        Settings.Global.Wearable.CONSISTENT_NOTIFICATION_BLOCKING_ENABLED,
         Settings.Global.Wearable.MUTE_WHEN_OFF_BODY_ENABLED,
         Settings.Global.Wearable.AMBIENT_ENABLED,
         Settings.Global.Wearable.AMBIENT_TILT_TO_WAKE,
diff --git a/packages/SettingsProvider/src/android/provider/settings/validators/GlobalSettingsValidators.java b/packages/SettingsProvider/src/android/provider/settings/validators/GlobalSettingsValidators.java
index 5022395..c0a0760 100644
--- a/packages/SettingsProvider/src/android/provider/settings/validators/GlobalSettingsValidators.java
+++ b/packages/SettingsProvider/src/android/provider/settings/validators/GlobalSettingsValidators.java
@@ -450,6 +450,8 @@
         VALIDATORS.put(Global.Wearable.WEAR_POWER_ANOMALY_SERVICE_ENABLED, BOOLEAN_VALIDATOR);
         VALIDATORS.put(Global.Wearable.CONNECTIVITY_KEEP_DATA_ON, BOOLEAN_VALIDATOR);
         VALIDATORS.put(Global.Wearable.WRIST_DETECTION_AUTO_LOCKING_ENABLED, BOOLEAN_VALIDATOR);
+        VALIDATORS.put(
+                Global.Wearable.CONSISTENT_NOTIFICATION_BLOCKING_ENABLED, ANY_INTEGER_VALIDATOR);
         VALIDATORS.put(Global.FORCE_ENABLE_PSS_PROFILING, BOOLEAN_VALIDATOR);
     }
 }
diff --git a/packages/SettingsProvider/src/com/android/providers/settings/WritableNamespacePrefixes.java b/packages/SettingsProvider/src/com/android/providers/settings/WritableNamespacePrefixes.java
index bd99a8b..74fd828 100644
--- a/packages/SettingsProvider/src/com/android/providers/settings/WritableNamespacePrefixes.java
+++ b/packages/SettingsProvider/src/com/android/providers/settings/WritableNamespacePrefixes.java
@@ -99,7 +99,6 @@
                 "kiwi",
                 "latency_tracker",
                 "launcher",
-                "launcher_lily",
                 "leaked_animator",
                 "lmkd_native",
                 "location",
diff --git a/packages/Shell/AndroidManifest.xml b/packages/Shell/AndroidManifest.xml
index 477c42e..507d9c4 100644
--- a/packages/Shell/AndroidManifest.xml
+++ b/packages/Shell/AndroidManifest.xml
@@ -810,6 +810,9 @@
     <uses-permission android:name="android.permission.FOREGROUND_SERVICE_FILE_MANAGEMENT" />
 
     <!-- Permission required for CTS test - CtsAppFgsTestCases -->
+    <uses-permission android:name="android.permission.FOREGROUND_SERVICE_MEDIA_PROCESSING" />
+
+    <!-- Permission required for CTS test - CtsAppFgsTestCases -->
     <uses-permission android:name="android.permission.FOREGROUND_SERVICE_SPECIAL_USE" />
 
     <!-- Permissions required for CTS test - CtsAppFgsTestCases -->
diff --git a/packages/SystemUI/Android.bp b/packages/SystemUI/Android.bp
index 42107b7..d3a89f4 100644
--- a/packages/SystemUI/Android.bp
+++ b/packages/SystemUI/Android.bp
@@ -157,7 +157,7 @@
         "SystemUI-res",
         "WifiTrackerLib",
         "WindowManager-Shell",
-        "SystemUIAnimationLib",
+        "PlatformAnimationLib",
         "SystemUICommon",
         "SystemUICustomizationLib",
         "SystemUILogLib",
@@ -274,7 +274,7 @@
     static_libs: [
         "SystemUI-res",
         "WifiTrackerLib",
-        "SystemUIAnimationLib",
+        "PlatformAnimationLib",
         "SystemUIPluginLib",
         "SystemUISharedLib",
         "SystemUICustomizationLib",
diff --git a/packages/SystemUI/AndroidManifest.xml b/packages/SystemUI/AndroidManifest.xml
index a03fa9b..7443e4c 100644
--- a/packages/SystemUI/AndroidManifest.xml
+++ b/packages/SystemUI/AndroidManifest.xml
@@ -84,6 +84,7 @@
     <uses-permission android:name="android.permission.READ_WIFI_CREDENTIAL"/>
     <uses-permission android:name="android.permission.LOCATION_HARDWARE" />
     <uses-permission android:name="android.permission.NETWORK_FACTORY" />
+    <uses-permission android:name="android.permission.SATELLITE_COMMUNICATION" />
     <!-- Physical hardware -->
     <uses-permission android:name="android.permission.MANAGE_USB" />
     <uses-permission android:name="android.permission.CONTROL_DISPLAY_BRIGHTNESS" />
diff --git a/packages/SystemUI/aconfig/predictive_back.aconfig b/packages/SystemUI/aconfig/predictive_back.aconfig
index 1ad1666..d0e6b28 100644
--- a/packages/SystemUI/aconfig/predictive_back.aconfig
+++ b/packages/SystemUI/aconfig/predictive_back.aconfig
@@ -19,4 +19,11 @@
     namespace: "systemui"
     description: "Enable Predictive Back Animation in Bouncer"
     bug: "309545085"
+}
+
+flag {
+    name: "predictive_back_animate_dialogs"
+    namespace: "systemui"
+    description: "Enable Predictive Back Animation for SysUI dialogs"
+    bug: "309545085"
 }
\ No newline at end of file
diff --git a/packages/SystemUI/animation/Android.bp b/packages/SystemUI/animation/Android.bp
index 8438051..872187a 100644
--- a/packages/SystemUI/animation/Android.bp
+++ b/packages/SystemUI/animation/Android.bp
@@ -23,7 +23,7 @@
 
 android_library {
 
-    name: "SystemUIAnimationLib",
+    name: "PlatformAnimationLib",
     use_resource_processor: true,
 
     srcs: [
diff --git a/packages/SystemUI/animation/src/com/android/systemui/animation/GhostedViewLaunchAnimatorController.kt b/packages/SystemUI/animation/src/com/android/systemui/animation/GhostedViewLaunchAnimatorController.kt
index b738e2b..efdbfdb 100644
--- a/packages/SystemUI/animation/src/com/android/systemui/animation/GhostedViewLaunchAnimatorController.kt
+++ b/packages/SystemUI/animation/src/com/android/systemui/animation/GhostedViewLaunchAnimatorController.kt
@@ -494,7 +494,7 @@
             }
 
             for (i in 0 until drawable.numberOfLayers) {
-                (drawable.getDrawable(i) as? GradientDrawable)?.cornerRadii = radii
+                applyBackgroundRadii(drawable.getDrawable(i), radii)
             }
         }
 
diff --git a/packages/SystemUI/compose/core/Android.bp b/packages/SystemUI/compose/core/Android.bp
index 42d088f..9a4347d 100644
--- a/packages/SystemUI/compose/core/Android.bp
+++ b/packages/SystemUI/compose/core/Android.bp
@@ -30,7 +30,7 @@
     ],
 
     static_libs: [
-        "SystemUIAnimationLib",
+        "PlatformAnimationLib",
 
         "androidx.compose.runtime_runtime",
         "androidx.compose.material3_material3",
diff --git a/packages/SystemUI/compose/features/src/com/android/systemui/communal/ui/compose/CommunalHub.kt b/packages/SystemUI/compose/features/src/com/android/systemui/communal/ui/compose/CommunalHub.kt
index 8bd5ddb..d201544 100644
--- a/packages/SystemUI/compose/features/src/com/android/systemui/communal/ui/compose/CommunalHub.kt
+++ b/packages/SystemUI/compose/features/src/com/android/systemui/communal/ui/compose/CommunalHub.kt
@@ -20,13 +20,13 @@
 import android.os.Bundle
 import android.util.SizeF
 import android.widget.FrameLayout
-import androidx.compose.animation.core.animateDpAsState
 import androidx.compose.foundation.BorderStroke
 import androidx.compose.foundation.ExperimentalFoundationApi
 import androidx.compose.foundation.background
 import androidx.compose.foundation.layout.Arrangement
 import androidx.compose.foundation.layout.Box
 import androidx.compose.foundation.layout.BoxScope
+import androidx.compose.foundation.layout.Column
 import androidx.compose.foundation.layout.PaddingValues
 import androidx.compose.foundation.layout.Row
 import androidx.compose.foundation.layout.Spacer
@@ -45,6 +45,7 @@
 import androidx.compose.material.icons.filled.Add
 import androidx.compose.material.icons.filled.Edit
 import androidx.compose.material.icons.outlined.Delete
+import androidx.compose.material.icons.outlined.Widgets
 import androidx.compose.material3.Button
 import androidx.compose.material3.ButtonColors
 import androidx.compose.material3.ButtonDefaults
@@ -52,6 +53,7 @@
 import androidx.compose.material3.CardDefaults
 import androidx.compose.material3.Icon
 import androidx.compose.material3.IconButton
+import androidx.compose.material3.MaterialTheme
 import androidx.compose.material3.OutlinedButton
 import androidx.compose.material3.Text
 import androidx.compose.runtime.Composable
@@ -72,6 +74,7 @@
 import androidx.compose.ui.platform.LocalConfiguration
 import androidx.compose.ui.platform.LocalDensity
 import androidx.compose.ui.res.stringResource
+import androidx.compose.ui.text.style.TextAlign
 import androidx.compose.ui.unit.Dp
 import androidx.compose.ui.unit.IntSize
 import androidx.compose.ui.unit.LayoutDirection
@@ -100,7 +103,8 @@
     var isDraggingToRemove by remember { mutableStateOf(false) }
 
     Box(
-        modifier = modifier.fillMaxSize().background(Color.White),
+        modifier =
+            modifier.fillMaxSize().background(LocalAndroidColorScheme.current.outlineVariant),
     ) {
         CommunalHubLazyGrid(
             communalContent = communalContent,
@@ -111,7 +115,8 @@
                 isDraggingToRemove =
                     checkForDraggingToRemove(it, removeButtonCoordinates, gridCoordinates)
                 isDraggingToRemove
-            }
+            },
+            onOpenWidgetPicker = onOpenWidgetPicker,
         )
 
         if (viewModel.isEditMode && onOpenWidgetPicker != null && onEditDone != null) {
@@ -148,13 +153,14 @@
     contentPadding: PaddingValues,
     setGridCoordinates: (coordinates: LayoutCoordinates) -> Unit,
     updateDragPositionForRemove: (offset: Offset) -> Boolean,
+    onOpenWidgetPicker: (() -> Unit)? = null,
 ) {
     var gridModifier = Modifier.align(Alignment.CenterStart)
     val gridState = rememberLazyGridState()
     var list = communalContent
     var dragDropState: GridDragDropState? = null
     if (viewModel.isEditMode && viewModel is CommunalEditModeViewModel) {
-        val contentListState = rememberContentListState(communalContent, viewModel)
+        val contentListState = rememberContentListState(list, viewModel)
         list = contentListState.list
         // for drag & drop operations within the communal hub grid
         dragDropState =
@@ -207,17 +213,16 @@
             if (viewModel.isEditMode && dragDropState != null) {
                 DraggableItem(
                     dragDropState = dragDropState,
-                    enabled = true,
+                    enabled = list[index] is CommunalContentModel.Widget,
                     index = index,
                     size = size
-                ) { isDragging ->
-                    val elevation by animateDpAsState(if (isDragging) 4.dp else 1.dp)
+                ) { _ ->
                     CommunalContent(
                         modifier = cardModifier,
-                        elevation = elevation,
                         model = list[index],
                         viewModel = viewModel,
                         size = size,
+                        onOpenWidgetPicker = onOpenWidgetPicker,
                     )
                 }
             } else {
@@ -258,16 +263,11 @@
         horizontalArrangement = Arrangement.SpaceBetween,
         verticalAlignment = Alignment.CenterVertically
     ) {
-        val buttonContentPadding =
-            PaddingValues(
-                vertical = Dimensions.ToolbarButtonPaddingVertical,
-                horizontal = Dimensions.ToolbarButtonPaddingHorizontal,
-            )
         val spacerModifier = Modifier.width(Dimensions.ToolbarButtonSpaceBetween)
         Button(
             onClick = onOpenWidgetPicker,
-            colors = filledSecondaryButtonColors(),
-            contentPadding = buttonContentPadding
+            colors = filledButtonColors(),
+            contentPadding = Dimensions.ButtonPadding
         ) {
             Icon(Icons.Default.Add, stringResource(R.string.button_to_open_widget_editor))
             Spacer(spacerModifier)
@@ -276,25 +276,40 @@
             )
         }
 
-        val buttonColors =
-            if (isDraggingToRemove) filledButtonColors() else ButtonDefaults.outlinedButtonColors()
-        OutlinedButton(
-            onClick = {},
-            colors = buttonColors,
-            contentPadding = buttonContentPadding,
-            modifier = Modifier.onGloballyPositioned { setRemoveButtonCoordinates(it) },
-        ) {
-            Icon(Icons.Outlined.Delete, stringResource(R.string.button_to_open_widget_editor))
-            Spacer(spacerModifier)
-            Text(
-                text = stringResource(R.string.button_to_remove_widget),
-            )
+        val colors = LocalAndroidColorScheme.current
+        if (isDraggingToRemove) {
+            Button(
+                // Button is disabled to make it non-clickable
+                enabled = false,
+                onClick = {},
+                colors =
+                    ButtonDefaults.buttonColors(
+                        disabledContainerColor = colors.primary,
+                        disabledContentColor = colors.onPrimary,
+                    ),
+                contentPadding = Dimensions.ButtonPadding,
+                modifier = Modifier.onGloballyPositioned { setRemoveButtonCoordinates(it) }
+            ) {
+                RemoveButtonContent(spacerModifier)
+            }
+        } else {
+            OutlinedButton(
+                // Button is disabled to make it non-clickable
+                enabled = false,
+                onClick = {},
+                colors = ButtonDefaults.outlinedButtonColors(disabledContentColor = colors.primary),
+                border = BorderStroke(width = 1.0.dp, color = colors.primary),
+                contentPadding = Dimensions.ButtonPadding,
+                modifier = Modifier.onGloballyPositioned { setRemoveButtonCoordinates(it) }
+            ) {
+                RemoveButtonContent(spacerModifier)
+            }
         }
 
         Button(
             onClick = onEditDone,
             colors = filledButtonColors(),
-            contentPadding = buttonContentPadding
+            contentPadding = Dimensions.ButtonPadding
         ) {
             Text(
                 text = stringResource(R.string.hub_mode_editing_exit_button_text),
@@ -304,6 +319,15 @@
 }
 
 @Composable
+private fun RemoveButtonContent(spacerModifier: Modifier) {
+    Icon(Icons.Outlined.Delete, stringResource(R.string.button_to_open_widget_editor))
+    Spacer(spacerModifier)
+    Text(
+        text = stringResource(R.string.button_to_remove_widget),
+    )
+}
+
+@Composable
 private fun filledButtonColors(): ButtonColors {
     val colors = LocalAndroidColorScheme.current
     return ButtonDefaults.buttonColors(
@@ -313,25 +337,20 @@
 }
 
 @Composable
-private fun filledSecondaryButtonColors(): ButtonColors {
-    val colors = LocalAndroidColorScheme.current
-    return ButtonDefaults.buttonColors(
-        containerColor = colors.secondary,
-        contentColor = colors.onSecondary,
-    )
-}
-
-@Composable
 private fun CommunalContent(
     model: CommunalContentModel,
     viewModel: BaseCommunalViewModel,
     size: SizeF,
     modifier: Modifier = Modifier,
-    elevation: Dp = 0.dp,
+    onOpenWidgetPicker: (() -> Unit)? = null,
 ) {
     when (model) {
-        is CommunalContentModel.Widget -> WidgetContent(viewModel, model, size, elevation, modifier)
+        is CommunalContentModel.Widget -> WidgetContent(viewModel, model, size, modifier)
         is CommunalContentModel.WidgetPlaceholder -> WidgetPlaceholderContent(size)
+        is CommunalContentModel.CtaTileInViewMode ->
+            CtaTileInViewModeContent(viewModel, size, modifier)
+        is CommunalContentModel.CtaTileInEditMode ->
+            CtaTileInEditModeContent(size, modifier, onOpenWidgetPicker)
         is CommunalContentModel.Smartspace -> SmartspaceContent(model, modifier)
         is CommunalContentModel.Tutorial -> TutorialContent(modifier)
         is CommunalContentModel.Umo -> Umo(viewModel, modifier)
@@ -349,17 +368,125 @@
     ) {}
 }
 
+/** Presents a CTA tile at the end of the grid, to customize the hub. */
+@Composable
+private fun CtaTileInViewModeContent(
+    viewModel: BaseCommunalViewModel,
+    size: SizeF,
+    modifier: Modifier = Modifier,
+) {
+    val colors = LocalAndroidColorScheme.current
+    Card(
+        modifier = modifier.height(size.height.dp),
+        colors =
+            CardDefaults.cardColors(
+                containerColor = colors.primary,
+                contentColor = colors.onPrimary,
+            ),
+        shape = RoundedCornerShape(80.dp, 40.dp, 80.dp, 40.dp)
+    ) {
+        Column(
+            modifier = Modifier.fillMaxSize().padding(horizontal = 82.dp),
+            verticalArrangement =
+                Arrangement.spacedBy(Dimensions.Spacing, Alignment.CenterVertically),
+            horizontalAlignment = Alignment.CenterHorizontally,
+        ) {
+            Icon(
+                imageVector = Icons.Outlined.Widgets,
+                contentDescription = stringResource(R.string.cta_label_to_open_widget_picker),
+                modifier = Modifier.size(Dimensions.IconSize),
+            )
+            Text(
+                text = stringResource(R.string.cta_label_to_edit_widget),
+                style = MaterialTheme.typography.titleLarge,
+                textAlign = TextAlign.Center,
+            )
+            Row(
+                modifier = Modifier.fillMaxWidth(),
+                horizontalArrangement = Arrangement.Center,
+            ) {
+                OutlinedButton(
+                    colors =
+                        ButtonDefaults.buttonColors(
+                            contentColor = colors.onPrimary,
+                        ),
+                    border = BorderStroke(width = 1.0.dp, color = colors.primaryContainer),
+                    contentPadding = Dimensions.ButtonPadding,
+                    onClick = viewModel::onDismissCtaTile,
+                ) {
+                    Text(
+                        text = stringResource(R.string.cta_tile_button_to_dismiss),
+                    )
+                }
+                Spacer(modifier = Modifier.size(Dimensions.Spacing))
+                Button(
+                    colors =
+                        ButtonDefaults.buttonColors(
+                            containerColor = colors.primaryContainer,
+                            contentColor = colors.onPrimaryContainer,
+                        ),
+                    contentPadding = Dimensions.ButtonPadding,
+                    onClick = viewModel::onOpenWidgetEditor
+                ) {
+                    Text(
+                        text = stringResource(R.string.cta_tile_button_to_open_widget_editor),
+                    )
+                }
+            }
+        }
+    }
+}
+
+/** Presents a CTA tile at the end of the hub in edit mode, to add more widgets. */
+@Composable
+private fun CtaTileInEditModeContent(
+    size: SizeF,
+    modifier: Modifier = Modifier,
+    onOpenWidgetPicker: (() -> Unit)? = null,
+) {
+    if (onOpenWidgetPicker == null) {
+        throw IllegalArgumentException("onOpenWidgetPicker should not be null.")
+    }
+    val colors = LocalAndroidColorScheme.current
+    Card(
+        modifier = modifier.height(size.height.dp),
+        colors = CardDefaults.cardColors(containerColor = Color.Transparent),
+        border = BorderStroke(1.dp, colors.primary),
+        shape = RoundedCornerShape(200.dp),
+        onClick = onOpenWidgetPicker,
+    ) {
+        Column(
+            modifier = Modifier.fillMaxSize(),
+            verticalArrangement =
+                Arrangement.spacedBy(Dimensions.Spacing, Alignment.CenterVertically),
+            horizontalAlignment = Alignment.CenterHorizontally,
+        ) {
+            Icon(
+                imageVector = Icons.Outlined.Widgets,
+                contentDescription = stringResource(R.string.cta_label_to_open_widget_picker),
+                tint = colors.primary,
+                modifier = Modifier.size(Dimensions.IconSize),
+            )
+            Text(
+                text = stringResource(R.string.cta_label_to_open_widget_picker),
+                style = MaterialTheme.typography.titleLarge,
+                color = colors.primary,
+                textAlign = TextAlign.Center,
+            )
+        }
+    }
+}
+
 @Composable
 private fun WidgetContent(
     viewModel: BaseCommunalViewModel,
     model: CommunalContentModel.Widget,
     size: SizeF,
-    elevation: Dp,
     modifier: Modifier = Modifier,
 ) {
-    Card(
+    Box(
         modifier = modifier.height(size.height.dp),
-        elevation = CardDefaults.cardElevation(draggedElevation = elevation),
+        contentAlignment = Alignment.Center,
     ) {
         AndroidView(
             modifier = modifier,
@@ -502,4 +629,10 @@
     val ToolbarButtonPaddingHorizontal = 24.dp
     val ToolbarButtonPaddingVertical = 16.dp
     val ToolbarButtonSpaceBetween = 8.dp
+    val ButtonPadding =
+        PaddingValues(
+            vertical = ToolbarButtonPaddingVertical,
+            horizontal = ToolbarButtonPaddingHorizontal,
+        )
+    val IconSize = 48.dp
 }
diff --git a/packages/SystemUI/compose/scene/tests/src/com/android/compose/animation/scene/ElementTest.kt b/packages/SystemUI/compose/scene/tests/src/com/android/compose/animation/scene/ElementTest.kt
index 54c5de7..35a5054 100644
--- a/packages/SystemUI/compose/scene/tests/src/com/android/compose/animation/scene/ElementTest.kt
+++ b/packages/SystemUI/compose/scene/tests/src/com/android/compose/animation/scene/ElementTest.kt
@@ -487,7 +487,7 @@
                     // page should be composed.
                     HorizontalPager(
                         pagerState,
-                        beyondBoundsPageCount = 0,
+                        outOfBoundsPageCount = 0,
                     ) { page ->
                         when (page) {
                             0 -> Box(Modifier.element(TestElements.Foo).fillMaxSize())
diff --git a/packages/SystemUI/customization/Android.bp b/packages/SystemUI/customization/Android.bp
index 927fd8e..1d18496 100644
--- a/packages/SystemUI/customization/Android.bp
+++ b/packages/SystemUI/customization/Android.bp
@@ -30,8 +30,8 @@
         "src/**/*.aidl",
     ],
     static_libs: [
+        "PlatformAnimationLib",
         "PluginCoreLib",
-        "SystemUIAnimationLib",
         "SystemUIPluginLib",
         "SystemUIUnfoldLib",
         "androidx.dynamicanimation_dynamicanimation",
diff --git a/packages/SystemUI/multivalentTests/src/com/android/systemui/biometrics/UdfpsControllerTest.java b/packages/SystemUI/multivalentTests/src/com/android/systemui/biometrics/UdfpsControllerTest.java
index 36aa441..cec2d74 100644
--- a/packages/SystemUI/multivalentTests/src/com/android/systemui/biometrics/UdfpsControllerTest.java
+++ b/packages/SystemUI/multivalentTests/src/com/android/systemui/biometrics/UdfpsControllerTest.java
@@ -496,7 +496,8 @@
         final float[] scaleFactor = new float[]{1f, displayHeight[1] / (float) displayHeight[0]};
         final int[] rotation = new int[]{Surface.ROTATION_0, Surface.ROTATION_90};
         final UdfpsOverlayParams oldParams = new UdfpsOverlayParams(sensorBounds[0],
-                sensorBounds[0], displayWidth[0], displayHeight[0], scaleFactor[0], rotation[0]);
+                sensorBounds[0], displayWidth[0], displayHeight[0], scaleFactor[0], rotation[0],
+                FingerprintSensorProperties.TYPE_UDFPS_OPTICAL);
 
         for (int i1 = 0; i1 <= 1; ++i1) {
             for (int i2 = 0; i2 <= 1; ++i2) {
@@ -505,7 +506,8 @@
                         for (int i5 = 0; i5 <= 1; ++i5) {
                             final UdfpsOverlayParams newParams = new UdfpsOverlayParams(
                                     sensorBounds[i1], sensorBounds[i1], displayWidth[i2],
-                                    displayHeight[i3], scaleFactor[i4], rotation[i5]);
+                                    displayHeight[i3], scaleFactor[i4], rotation[i5],
+                                    FingerprintSensorProperties.TYPE_UDFPS_OPTICAL);
 
                             if (newParams.equals(oldParams)) {
                                 continue;
@@ -549,7 +551,7 @@
         // Initialize the overlay.
         mUdfpsController.updateOverlayParams(mOpticalProps,
                 new UdfpsOverlayParams(sensorBounds, sensorBounds, displayWidth, displayHeight,
-                        scaleFactor, rotation));
+                        scaleFactor, rotation, FingerprintSensorProperties.TYPE_UDFPS_OPTICAL));
 
         // Show the overlay.
         mOverlayController.showUdfpsOverlay(TEST_REQUEST_ID, mOpticalProps.sensorId,
@@ -560,7 +562,7 @@
         // Update overlay with the same parameters.
         mUdfpsController.updateOverlayParams(mOpticalProps,
                 new UdfpsOverlayParams(sensorBounds, sensorBounds, displayWidth, displayHeight,
-                        scaleFactor, rotation));
+                        scaleFactor, rotation, FingerprintSensorProperties.TYPE_UDFPS_OPTICAL));
         mFgExecutor.runAllReady();
 
         // Ensure the overlay was not recreated.
@@ -642,7 +644,8 @@
         // Test ROTATION_0
         mUdfpsController.updateOverlayParams(testParams.sensorProps,
                 new UdfpsOverlayParams(sensorBounds, sensorBounds, displayWidth, displayHeight,
-                        scaleFactor, Surface.ROTATION_0));
+                        scaleFactor, Surface.ROTATION_0,
+                        FingerprintSensorProperties.TYPE_UDFPS_OPTICAL));
         MotionEvent event = obtainMotionEvent(ACTION_DOWN, displayWidth, displayHeight, touchMinor,
                 touchMajor);
         mTouchListenerCaptor.getValue().onTouch(mUdfpsView, event);
@@ -657,7 +660,8 @@
         reset(mFingerprintManager);
         mUdfpsController.updateOverlayParams(testParams.sensorProps,
                 new UdfpsOverlayParams(sensorBounds, sensorBounds, displayWidth, displayHeight,
-                        scaleFactor, Surface.ROTATION_90));
+                        scaleFactor, Surface.ROTATION_90,
+                        FingerprintSensorProperties.TYPE_UDFPS_OPTICAL));
         event = obtainMotionEvent(ACTION_DOWN, displayHeight, 0, touchMinor, touchMajor);
         mTouchListenerCaptor.getValue().onTouch(mUdfpsView, event);
         mBiometricExecutor.runAllReady();
@@ -671,7 +675,8 @@
         reset(mFingerprintManager);
         mUdfpsController.updateOverlayParams(testParams.sensorProps,
                 new UdfpsOverlayParams(sensorBounds, sensorBounds, displayWidth, displayHeight,
-                        scaleFactor, Surface.ROTATION_270));
+                        scaleFactor, Surface.ROTATION_270,
+                        FingerprintSensorProperties.TYPE_UDFPS_OPTICAL));
         event = obtainMotionEvent(ACTION_DOWN, 0, displayWidth, touchMinor, touchMajor);
         mTouchListenerCaptor.getValue().onTouch(mUdfpsView, event);
         mBiometricExecutor.runAllReady();
@@ -685,7 +690,8 @@
         reset(mFingerprintManager);
         mUdfpsController.updateOverlayParams(testParams.sensorProps,
                 new UdfpsOverlayParams(sensorBounds, sensorBounds, displayWidth, displayHeight,
-                        scaleFactor, Surface.ROTATION_180));
+                        scaleFactor, Surface.ROTATION_180,
+                        FingerprintSensorProperties.TYPE_UDFPS_OPTICAL));
         // ROTATION_180 is not supported. It should be treated like ROTATION_0.
         event = obtainMotionEvent(ACTION_DOWN, displayWidth, displayHeight, touchMinor, touchMajor);
         mTouchListenerCaptor.getValue().onTouch(mUdfpsView, event);
diff --git a/packages/SystemUI/tests/src/com/android/systemui/communal/data/repository/CommunalMediaRepositoryImplTest.kt b/packages/SystemUI/multivalentTests/src/com/android/systemui/communal/data/repository/CommunalMediaRepositoryImplTest.kt
similarity index 69%
rename from packages/SystemUI/tests/src/com/android/systemui/communal/data/repository/CommunalMediaRepositoryImplTest.kt
rename to packages/SystemUI/multivalentTests/src/com/android/systemui/communal/data/repository/CommunalMediaRepositoryImplTest.kt
index 455f986..92b75cb 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/communal/data/repository/CommunalMediaRepositoryImplTest.kt
+++ b/packages/SystemUI/multivalentTests/src/com/android/systemui/communal/data/repository/CommunalMediaRepositoryImplTest.kt
@@ -1,5 +1,5 @@
 /*
- * Copyright (C) 2023 The Android Open Source Project
+ * Copyright (C) 2024 The Android Open Source Project
  *
  * Licensed under the Apache License, Version 2.0 (the "License");
  * you may not use this file except in compliance with the License.
@@ -25,13 +25,13 @@
 import com.android.systemui.util.mockito.KotlinArgumentCaptor
 import com.android.systemui.util.mockito.whenever
 import com.google.common.truth.Truth.assertThat
-import kotlin.test.Test
 import kotlinx.coroutines.ExperimentalCoroutinesApi
 import kotlinx.coroutines.test.StandardTestDispatcher
 import kotlinx.coroutines.test.TestScope
 import kotlinx.coroutines.test.runCurrent
 import kotlinx.coroutines.test.runTest
 import org.junit.Before
+import org.junit.Test
 import org.junit.runner.RunWith
 import org.mockito.Mock
 import org.mockito.Mockito.verify
@@ -59,37 +59,43 @@
     }
 
     @Test
-    fun mediaPlaying_defaultsToFalse() =
+    fun hasAnyMediaOrRecommendation_defaultsToFalse() =
         testScope.runTest {
             mediaRepository = CommunalMediaRepositoryImpl(mediaDataManager)
 
-            val isMediaPlaying = collectLastValue(mediaRepository.mediaPlaying)
+            val mediaModel = collectLastValue(mediaRepository.mediaModel)
             runCurrent()
-            assertThat(isMediaPlaying()).isFalse()
+            assertThat(mediaModel()?.hasAnyMediaOrRecommendation).isFalse()
         }
 
     @Test
-    fun mediaPlaying_emitsInitialValue() =
-        testScope.runTest {
-            // Start with media available.
-            whenever(mediaDataManager.hasAnyMediaOrRecommendation()).thenReturn(true)
-
-            mediaRepository = CommunalMediaRepositoryImpl(mediaDataManager)
-
-            val isMediaPlaying = collectLastValue(mediaRepository.mediaPlaying)
-            runCurrent()
-            assertThat(isMediaPlaying()).isTrue()
-        }
-
-    @Test
-    fun mediaPlaying_updatesWhenMediaDataLoaded() =
+    fun mediaModel_updatesWhenMediaDataLoaded() =
         testScope.runTest {
             mediaRepository = CommunalMediaRepositoryImpl(mediaDataManager)
 
+            // Listener is added
+            verify(mediaDataManager).addListener(mediaDataListenerCaptor.capture())
+
             // Initial value is false.
-            var isMediaPlaying = collectLastValue(mediaRepository.mediaPlaying)
+            val mediaModel = collectLastValue(mediaRepository.mediaModel)
             runCurrent()
-            assertThat(isMediaPlaying()).isFalse()
+            assertThat(mediaModel()?.hasAnyMediaOrRecommendation).isFalse()
+
+            // Change to media available and notify the listener.
+            whenever(mediaDataManager.hasAnyMediaOrRecommendation()).thenReturn(true)
+            whenever(mediaData.createdTimestampMillis).thenReturn(1234L)
+            mediaDataListenerCaptor.value.onMediaDataLoaded("key", null, mediaData)
+            runCurrent()
+
+            // Media active now returns true.
+            assertThat(mediaModel()?.hasAnyMediaOrRecommendation).isTrue()
+            assertThat(mediaModel()?.createdTimestampMillis).isEqualTo(1234L)
+        }
+
+    @Test
+    fun mediaModel_updatesWhenMediaDataRemoved() =
+        testScope.runTest {
+            mediaRepository = CommunalMediaRepositoryImpl(mediaDataManager)
 
             // Listener is added
             verify(mediaDataManager).addListener(mediaDataListenerCaptor.capture())
@@ -97,36 +103,18 @@
             // Change to media available and notify the listener.
             whenever(mediaDataManager.hasAnyMediaOrRecommendation()).thenReturn(true)
             mediaDataListenerCaptor.value.onMediaDataLoaded("key", null, mediaData)
-
-            // mediaPlaying now returns true.
-            isMediaPlaying = collectLastValue(mediaRepository.mediaPlaying)
             runCurrent()
-            assertThat(isMediaPlaying()).isTrue()
-        }
 
-    @Test
-    fun mediaPlaying_updatesWhenMediaDataRemoved() =
-        testScope.runTest {
-            // Start with media available.
-            whenever(mediaDataManager.hasAnyMediaOrRecommendation()).thenReturn(true)
-
-            mediaRepository = CommunalMediaRepositoryImpl(mediaDataManager)
-
-            // Initial value is true.
-            var isMediaPlaying = collectLastValue(mediaRepository.mediaPlaying)
-            runCurrent()
-            assertThat(isMediaPlaying()).isTrue()
-
-            // Listener is added.
-            verify(mediaDataManager).addListener(mediaDataListenerCaptor.capture())
+            // Media active now returns true.
+            val mediaModel = collectLastValue(mediaRepository.mediaModel)
+            assertThat(mediaModel()?.hasAnyMediaOrRecommendation).isTrue()
 
             // Change to media unavailable and notify the listener.
             whenever(mediaDataManager.hasAnyMediaOrRecommendation()).thenReturn(false)
-            mediaDataListenerCaptor.value.onMediaDataLoaded("key", null, mediaData)
-
-            // mediaPlaying now returns false.
-            isMediaPlaying = collectLastValue(mediaRepository.mediaPlaying)
+            mediaDataListenerCaptor.value.onMediaDataRemoved("key")
             runCurrent()
-            assertThat(isMediaPlaying()).isFalse()
+
+            // Media active now returns false.
+            assertThat(mediaModel()?.hasAnyMediaOrRecommendation).isFalse()
         }
 }
diff --git a/packages/SystemUI/multivalentTests/src/com/android/systemui/communal/data/repository/CommunalWidgetRepositoryImplTest.kt b/packages/SystemUI/multivalentTests/src/com/android/systemui/communal/data/repository/CommunalWidgetRepositoryImplTest.kt
index 449ee6f..4079f12 100644
--- a/packages/SystemUI/multivalentTests/src/com/android/systemui/communal/data/repository/CommunalWidgetRepositoryImplTest.kt
+++ b/packages/SystemUI/multivalentTests/src/com/android/systemui/communal/data/repository/CommunalWidgetRepositoryImplTest.kt
@@ -19,14 +19,14 @@
 import android.appwidget.AppWidgetHost
 import android.appwidget.AppWidgetManager
 import android.appwidget.AppWidgetProviderInfo
-import android.content.BroadcastReceiver
 import android.content.ComponentName
+import android.content.Intent
+import android.content.Intent.ACTION_USER_UNLOCKED
 import android.os.UserHandle
 import android.os.UserManager
 import androidx.test.ext.junit.runners.AndroidJUnit4
 import androidx.test.filters.SmallTest
 import com.android.systemui.SysuiTestCase
-import com.android.systemui.broadcast.BroadcastDispatcher
 import com.android.systemui.communal.data.db.CommunalItemRank
 import com.android.systemui.communal.data.db.CommunalWidgetDao
 import com.android.systemui.communal.data.db.CommunalWidgetItem
@@ -38,15 +38,12 @@
 import com.android.systemui.res.R
 import com.android.systemui.settings.UserTracker
 import com.android.systemui.util.mockito.any
-import com.android.systemui.util.mockito.kotlinArgumentCaptor
-import com.android.systemui.util.mockito.nullable
 import com.android.systemui.util.mockito.whenever
 import com.google.common.truth.Truth.assertThat
 import java.util.Optional
 import kotlinx.coroutines.ExperimentalCoroutinesApi
-import kotlinx.coroutines.flow.collect
 import kotlinx.coroutines.flow.flowOf
-import kotlinx.coroutines.launch
+import kotlinx.coroutines.flow.launchIn
 import kotlinx.coroutines.test.StandardTestDispatcher
 import kotlinx.coroutines.test.TestScope
 import kotlinx.coroutines.test.runCurrent
@@ -55,8 +52,8 @@
 import org.junit.Test
 import org.junit.runner.RunWith
 import org.mockito.Mock
-import org.mockito.Mockito
 import org.mockito.Mockito.anyInt
+import org.mockito.Mockito.never
 import org.mockito.Mockito.verify
 import org.mockito.MockitoAnnotations
 
@@ -70,8 +67,6 @@
 
     @Mock private lateinit var appWidgetHost: AppWidgetHost
 
-    @Mock private lateinit var broadcastDispatcher: BroadcastDispatcher
-
     @Mock private lateinit var userManager: UserManager
 
     @Mock private lateinit var userHandle: UserHandle
@@ -125,10 +120,10 @@
         testScope.runTest {
             communalEnabled(false)
             val repository = initCommunalWidgetRepository()
-            collectLastValue(repository.communalWidgets)()
+            repository.communalWidgets.launchIn(backgroundScope)
             runCurrent()
 
-            verify(communalWidgetDao, Mockito.never()).getWidgets()
+            verify(communalWidgetDao, never()).getWidgets()
         }
 
     @Test
@@ -136,10 +131,10 @@
         testScope.runTest {
             userUnlocked(false)
             val repository = initCommunalWidgetRepository()
-            collectLastValue(repository.communalWidgets)()
+            repository.communalWidgets.launchIn(backgroundScope)
             runCurrent()
 
-            verify(communalWidgetDao, Mockito.never()).getWidgets()
+            verify(communalWidgetDao, never()).getWidgets()
         }
 
     @Test
@@ -147,8 +142,7 @@
         testScope.runTest {
             userUnlocked(false)
             val repository = initCommunalWidgetRepository()
-            val communalWidgets = collectLastValue(repository.communalWidgets)
-            communalWidgets()
+            val communalWidgets by collectLastValue(repository.communalWidgets)
             runCurrent()
             val communalItemRankEntry = CommunalItemRank(uid = 1L, rank = 1)
             val communalWidgetItemEntry = CommunalWidgetItem(uid = 1L, 1, "pk_name/cls_name", 1L)
@@ -158,11 +152,14 @@
 
             userUnlocked(true)
             installedProviders(listOf(stopwatchProviderInfo))
-            broadcastReceiverUpdate()
+            fakeBroadcastDispatcher.sendIntentToMatchingReceiversOnly(
+                context,
+                Intent(ACTION_USER_UNLOCKED)
+            )
             runCurrent()
 
             verify(communalWidgetDao).getWidgets()
-            assertThat(communalWidgets())
+            assertThat(communalWidgets)
                 .containsExactly(
                     CommunalWidgetContentModel(
                         appWidgetId = communalWidgetItemEntry.widgetId,
@@ -182,9 +179,10 @@
             val provider = ComponentName("pkg_name", "cls_name")
             val id = 1
             val priority = 1
+            whenever(communalWidgetHost.requiresConfiguration(id)).thenReturn(true)
             whenever(communalWidgetHost.allocateIdAndBindWidget(any<ComponentName>()))
                 .thenReturn(id)
-            repository.addWidget(provider, priority)
+            repository.addWidget(provider, priority) { true }
             runCurrent()
 
             verify(communalWidgetHost).allocateIdAndBindWidget(provider)
@@ -192,6 +190,71 @@
         }
 
     @Test
+    fun addWidget_configurationFails_doNotAddWidgetToDb() =
+        testScope.runTest {
+            userUnlocked(true)
+            val repository = initCommunalWidgetRepository()
+            runCurrent()
+
+            val provider = ComponentName("pkg_name", "cls_name")
+            val id = 1
+            val priority = 1
+            whenever(communalWidgetHost.requiresConfiguration(id)).thenReturn(true)
+            whenever(communalWidgetHost.allocateIdAndBindWidget(provider)).thenReturn(id)
+            repository.addWidget(provider, priority) { false }
+            runCurrent()
+
+            verify(communalWidgetHost).allocateIdAndBindWidget(provider)
+            verify(communalWidgetDao, never()).addWidget(id, provider, priority)
+            verify(appWidgetHost).deleteAppWidgetId(id)
+        }
+
+    @Test
+    fun addWidget_configurationThrowsError_doNotAddWidgetToDb() =
+        testScope.runTest {
+            userUnlocked(true)
+            val repository = initCommunalWidgetRepository()
+            runCurrent()
+
+            val provider = ComponentName("pkg_name", "cls_name")
+            val id = 1
+            val priority = 1
+            whenever(communalWidgetHost.requiresConfiguration(id)).thenReturn(true)
+            whenever(communalWidgetHost.allocateIdAndBindWidget(provider)).thenReturn(id)
+            repository.addWidget(provider, priority) { throw IllegalStateException("some error") }
+            runCurrent()
+
+            verify(communalWidgetHost).allocateIdAndBindWidget(provider)
+            verify(communalWidgetDao, never()).addWidget(id, provider, priority)
+            verify(appWidgetHost).deleteAppWidgetId(id)
+        }
+
+    @Test
+    fun addWidget_configurationNotRequired_doesNotConfigure_addWidgetToDb() =
+        testScope.runTest {
+            userUnlocked(true)
+            val repository = initCommunalWidgetRepository()
+            runCurrent()
+
+            val provider = ComponentName("pkg_name", "cls_name")
+            val id = 1
+            val priority = 1
+            whenever(communalWidgetHost.requiresConfiguration(id)).thenReturn(false)
+            whenever(communalWidgetHost.allocateIdAndBindWidget(any<ComponentName>()))
+                .thenReturn(id)
+            var configured = false
+            repository.addWidget(provider, priority) {
+                configured = true
+                true
+            }
+            runCurrent()
+
+            verify(communalWidgetHost).allocateIdAndBindWidget(provider)
+            verify(communalWidgetDao).addWidget(id, provider, priority)
+            assertThat(configured).isFalse()
+        }
+
+    @Test
     fun deleteWidget_removeWidgetId_andDeleteFromDb() =
         testScope.runTest {
             userUnlocked(true)
@@ -225,17 +288,9 @@
         testScope.runTest {
             communalEnabled(false)
             val repository = initCommunalWidgetRepository()
-            collectLastValue(repository.communalWidgets)()
-            verifyBroadcastReceiverNeverRegistered()
-        }
-
-    @Test
-    fun broadcastReceiver_featureEnabledAndUserUnlocked_doNotRegisterBroadcastReceiver() =
-        testScope.runTest {
-            userUnlocked(true)
-            val repository = initCommunalWidgetRepository()
-            collectLastValue(repository.communalWidgets)()
-            verifyBroadcastReceiverNeverRegistered()
+            repository.communalWidgets.launchIn(backgroundScope)
+            runCurrent()
+            assertThat(fakeBroadcastDispatcher.numReceiversRegistered).isEqualTo(0)
         }
 
     @Test
@@ -243,24 +298,9 @@
         testScope.runTest {
             userUnlocked(false)
             val repository = initCommunalWidgetRepository()
-            collectLastValue(repository.communalWidgets)()
-            verifyBroadcastReceiverRegistered()
-        }
-
-    @Test
-    fun broadcastReceiver_whenFlowFinishes_unregisterBroadcastReceiver() =
-        testScope.runTest {
-            userUnlocked(false)
-            val repository = initCommunalWidgetRepository()
-
-            val job = launch { repository.communalWidgets.collect() }
+            repository.communalWidgets.launchIn(backgroundScope)
             runCurrent()
-            val receiver = broadcastReceiverUpdate()
-
-            job.cancel()
-            runCurrent()
-
-            verify(broadcastDispatcher).unregisterReceiver(receiver)
+            assertThat(fakeBroadcastDispatcher.numReceiversRegistered).isEqualTo(1)
         }
 
     @Test
@@ -268,12 +308,16 @@
         testScope.runTest {
             userUnlocked(false)
             val repository = initCommunalWidgetRepository()
-            collectLastValue(repository.communalWidgets)()
-            verify(appWidgetHost, Mockito.never()).startListening()
+            repository.communalWidgets.launchIn(backgroundScope)
+            runCurrent()
+            verify(appWidgetHost, never()).startListening()
 
             userUnlocked(true)
-            broadcastReceiverUpdate()
-            collectLastValue(repository.communalWidgets)()
+            fakeBroadcastDispatcher.sendIntentToMatchingReceiversOnly(
+                context,
+                Intent(ACTION_USER_UNLOCKED)
+            )
+            runCurrent()
 
             verify(appWidgetHost).startListening()
         }
@@ -283,18 +327,25 @@
         testScope.runTest {
             userUnlocked(false)
             val repository = initCommunalWidgetRepository()
-            collectLastValue(repository.communalWidgets)()
+            repository.communalWidgets.launchIn(backgroundScope)
+            runCurrent()
 
             userUnlocked(true)
-            broadcastReceiverUpdate()
-            collectLastValue(repository.communalWidgets)()
+            fakeBroadcastDispatcher.sendIntentToMatchingReceiversOnly(
+                context,
+                Intent(ACTION_USER_UNLOCKED)
+            )
+            runCurrent()
 
             verify(appWidgetHost).startListening()
-            verify(appWidgetHost, Mockito.never()).stopListening()
+            verify(appWidgetHost, never()).stopListening()
 
             userUnlocked(false)
-            broadcastReceiverUpdate()
-            collectLastValue(repository.communalWidgets)()
+            fakeBroadcastDispatcher.sendIntentToMatchingReceiversOnly(
+                context,
+                Intent(ACTION_USER_UNLOCKED)
+            )
+            runCurrent()
 
             verify(appWidgetHost).stopListening()
         }
@@ -305,7 +356,7 @@
             appWidgetHost,
             testScope.backgroundScope,
             testDispatcher,
-            broadcastDispatcher,
+            fakeBroadcastDispatcher,
             communalRepository,
             communalWidgetHost,
             communalWidgetDao,
@@ -315,45 +366,6 @@
         )
     }
 
-    private fun verifyBroadcastReceiverRegistered() {
-        verify(broadcastDispatcher)
-            .registerReceiver(
-                any(),
-                any(),
-                nullable(),
-                nullable(),
-                anyInt(),
-                nullable(),
-            )
-    }
-
-    private fun verifyBroadcastReceiverNeverRegistered() {
-        verify(broadcastDispatcher, Mockito.never())
-            .registerReceiver(
-                any(),
-                any(),
-                nullable(),
-                nullable(),
-                anyInt(),
-                nullable(),
-            )
-    }
-
-    private fun broadcastReceiverUpdate(): BroadcastReceiver {
-        val broadcastReceiverCaptor = kotlinArgumentCaptor<BroadcastReceiver>()
-        verify(broadcastDispatcher)
-            .registerReceiver(
-                broadcastReceiverCaptor.capture(),
-                any(),
-                nullable(),
-                nullable(),
-                anyInt(),
-                nullable(),
-            )
-        broadcastReceiverCaptor.value.onReceive(null, null)
-        return broadcastReceiverCaptor.value
-    }
-
     private fun communalEnabled(enabled: Boolean) {
         communalRepository.setIsCommunalEnabled(enabled)
     }
diff --git a/packages/SystemUI/multivalentTests/src/com/android/systemui/communal/domain/interactor/CommunalInteractorTest.kt b/packages/SystemUI/multivalentTests/src/com/android/systemui/communal/domain/interactor/CommunalInteractorTest.kt
index 62084aa..744b65f 100644
--- a/packages/SystemUI/multivalentTests/src/com/android/systemui/communal/domain/interactor/CommunalInteractorTest.kt
+++ b/packages/SystemUI/multivalentTests/src/com/android/systemui/communal/domain/interactor/CommunalInteractorTest.kt
@@ -148,25 +148,29 @@
             whenever(target1.smartspaceTargetId).thenReturn("target1")
             whenever(target1.featureType).thenReturn(SmartspaceTarget.FEATURE_WEATHER)
             whenever(target1.remoteViews).thenReturn(mock(RemoteViews::class.java))
+            whenever(target1.creationTimeMillis).thenReturn(0L)
 
             // Does not have RemoteViews
             val target2 = mock(SmartspaceTarget::class.java)
-            whenever(target1.smartspaceTargetId).thenReturn("target2")
-            whenever(target1.featureType).thenReturn(SmartspaceTarget.FEATURE_TIMER)
-            whenever(target1.remoteViews).thenReturn(null)
+            whenever(target2.smartspaceTargetId).thenReturn("target2")
+            whenever(target2.featureType).thenReturn(SmartspaceTarget.FEATURE_TIMER)
+            whenever(target2.remoteViews).thenReturn(null)
+            whenever(target2.creationTimeMillis).thenReturn(0L)
 
             // Timer and has RemoteViews
             val target3 = mock(SmartspaceTarget::class.java)
-            whenever(target1.smartspaceTargetId).thenReturn("target3")
-            whenever(target1.featureType).thenReturn(SmartspaceTarget.FEATURE_TIMER)
-            whenever(target1.remoteViews).thenReturn(mock(RemoteViews::class.java))
+            whenever(target3.smartspaceTargetId).thenReturn("target3")
+            whenever(target3.featureType).thenReturn(SmartspaceTarget.FEATURE_TIMER)
+            whenever(target3.remoteViews).thenReturn(mock(RemoteViews::class.java))
+            whenever(target3.creationTimeMillis).thenReturn(0L)
 
             val targets = listOf(target1, target2, target3)
             smartspaceRepository.setCommunalSmartspaceTargets(targets)
 
-            val smartspaceContent by collectLastValue(underTest.smartspaceContent)
+            val smartspaceContent by collectLastValue(underTest.ongoingContent)
             assertThat(smartspaceContent?.size).isEqualTo(1)
-            assertThat(smartspaceContent?.get(0)?.key).isEqualTo("smartspace_target3")
+            assertThat(smartspaceContent?.get(0)?.key)
+                .isEqualTo(CommunalContentModel.KEY.smartspace("target3"))
         }
 
     @Test
@@ -256,16 +260,12 @@
 
             val targets = mutableListOf<SmartspaceTarget>()
             for (index in 0 until totalTargets) {
-                val target = mock(SmartspaceTarget::class.java)
-                whenever(target.smartspaceTargetId).thenReturn("target$index")
-                whenever(target.featureType).thenReturn(SmartspaceTarget.FEATURE_TIMER)
-                whenever(target.remoteViews).thenReturn(mock(RemoteViews::class.java))
-                targets.add(target)
+                targets.add(smartspaceTimer(index.toString()))
             }
 
             smartspaceRepository.setCommunalSmartspaceTargets(targets)
 
-            val smartspaceContent by collectLastValue(underTest.smartspaceContent)
+            val smartspaceContent by collectLastValue(underTest.ongoingContent)
             assertThat(smartspaceContent?.size).isEqualTo(totalTargets)
             for (index in 0 until totalTargets) {
                 assertThat(smartspaceContent?.get(index)?.size).isEqualTo(expectedSizes[index])
@@ -279,13 +279,77 @@
             tutorialRepository.setTutorialSettingState(HUB_MODE_TUTORIAL_COMPLETED)
 
             // Media is playing.
-            mediaRepository.mediaPlaying.value = true
+            mediaRepository.mediaActive()
 
-            val umoContent by collectLastValue(underTest.umoContent)
+            val umoContent by collectLastValue(underTest.ongoingContent)
 
             assertThat(umoContent?.size).isEqualTo(1)
             assertThat(umoContent?.get(0)).isInstanceOf(CommunalContentModel.Umo::class.java)
-            assertThat(umoContent?.get(0)?.key).isEqualTo(CommunalContentModel.UMO_KEY)
+            assertThat(umoContent?.get(0)?.key).isEqualTo(CommunalContentModel.KEY.umo())
+        }
+
+    @Test
+    fun ongoing_shouldOrderAndSizeByTimestamp() =
+        testScope.runTest {
+            // Keyguard showing, and tutorial completed.
+            keyguardRepository.setKeyguardShowing(true)
+            keyguardRepository.setKeyguardOccluded(false)
+            tutorialRepository.setTutorialSettingState(HUB_MODE_TUTORIAL_COMPLETED)
+
+            // Timer1 started
+            val timer1 = smartspaceTimer("timer1", timestamp = 1L)
+            smartspaceRepository.setCommunalSmartspaceTargets(listOf(timer1))
+
+            // Umo started
+            mediaRepository.mediaActive(timestamp = 2L)
+
+            // Timer2 started
+            val timer2 = smartspaceTimer("timer2", timestamp = 3L)
+            smartspaceRepository.setCommunalSmartspaceTargets(listOf(timer1, timer2))
+
+            // Timer3 started
+            val timer3 = smartspaceTimer("timer3", timestamp = 4L)
+            smartspaceRepository.setCommunalSmartspaceTargets(listOf(timer1, timer2, timer3))
+
+            val ongoingContent by collectLastValue(underTest.ongoingContent)
+            assertThat(ongoingContent?.size).isEqualTo(4)
+            assertThat(ongoingContent?.get(0)?.key)
+                .isEqualTo(CommunalContentModel.KEY.smartspace("timer3"))
+            assertThat(ongoingContent?.get(0)?.size).isEqualTo(CommunalContentSize.FULL)
+            assertThat(ongoingContent?.get(1)?.key)
+                .isEqualTo(CommunalContentModel.KEY.smartspace("timer2"))
+            assertThat(ongoingContent?.get(1)?.size).isEqualTo(CommunalContentSize.THIRD)
+            assertThat(ongoingContent?.get(2)?.key).isEqualTo(CommunalContentModel.KEY.umo())
+            assertThat(ongoingContent?.get(2)?.size).isEqualTo(CommunalContentSize.THIRD)
+            assertThat(ongoingContent?.get(3)?.key)
+                .isEqualTo(CommunalContentModel.KEY.smartspace("timer1"))
+            assertThat(ongoingContent?.get(3)?.size).isEqualTo(CommunalContentSize.THIRD)
+        }
+
+    @Test
+    fun cta_visibilityTrue_shows() =
+        testScope.runTest {
+            tutorialRepository.setTutorialSettingState(HUB_MODE_TUTORIAL_COMPLETED)
+            communalRepository.setCtaTileInViewModeVisibility(true)
+
+            val ctaTileContent by collectLastValue(underTest.ctaTileContent)
+
+            assertThat(ctaTileContent?.size).isEqualTo(1)
+            assertThat(ctaTileContent?.get(0))
+                .isInstanceOf(CommunalContentModel.CtaTileInViewMode::class.java)
+            assertThat(ctaTileContent?.get(0)?.key)
+                .isEqualTo(CommunalContentModel.KEY.CTA_TILE_IN_VIEW_MODE_KEY)
+        }
+
+    @Test
+    fun ctaTile_visibilityFalse_doesNotShow() =
+        testScope.runTest {
+            tutorialRepository.setTutorialSettingState(HUB_MODE_TUTORIAL_COMPLETED)
+            communalRepository.setCtaTileInViewModeVisibility(false)
+
+            val ctaTileContent by collectLastValue(underTest.ctaTileContent)
+
+            assertThat(ctaTileContent).isEmpty()
         }
 
     @Test
@@ -334,4 +398,13 @@
             underTest.showWidgetEditor()
             verify(editWidgetsActivityStarter).startActivity()
         }
+
+    private fun smartspaceTimer(id: String, timestamp: Long = 0L): SmartspaceTarget {
+        val timer = mock(SmartspaceTarget::class.java)
+        whenever(timer.smartspaceTargetId).thenReturn(id)
+        whenever(timer.featureType).thenReturn(SmartspaceTarget.FEATURE_TIMER)
+        whenever(timer.remoteViews).thenReturn(mock(RemoteViews::class.java))
+        whenever(timer.creationTimeMillis).thenReturn(timestamp)
+        return timer
+    }
 }
diff --git a/packages/SystemUI/multivalentTests/src/com/android/systemui/communal/view/viewmodel/CommunalEditModeViewModelTest.kt b/packages/SystemUI/multivalentTests/src/com/android/systemui/communal/view/viewmodel/CommunalEditModeViewModelTest.kt
index f2f9705..c638e1e 100644
--- a/packages/SystemUI/multivalentTests/src/com/android/systemui/communal/view/viewmodel/CommunalEditModeViewModelTest.kt
+++ b/packages/SystemUI/multivalentTests/src/com/android/systemui/communal/view/viewmodel/CommunalEditModeViewModelTest.kt
@@ -16,7 +16,11 @@
 
 package com.android.systemui.communal.view.viewmodel
 
+import android.app.Activity.RESULT_CANCELED
+import android.app.Activity.RESULT_OK
 import android.app.smartspace.SmartspaceTarget
+import android.appwidget.AppWidgetHost
+import android.content.ComponentName
 import android.os.PowerManager
 import android.provider.Settings
 import android.widget.RemoteViews
@@ -42,6 +46,8 @@
 import com.android.systemui.util.mockito.whenever
 import com.google.common.truth.Truth.assertThat
 import javax.inject.Provider
+import kotlinx.coroutines.ExperimentalCoroutinesApi
+import kotlinx.coroutines.test.runCurrent
 import kotlinx.coroutines.test.runTest
 import org.junit.Before
 import org.junit.Test
@@ -50,12 +56,14 @@
 import org.mockito.Mockito
 import org.mockito.MockitoAnnotations
 
+@OptIn(ExperimentalCoroutinesApi::class)
 @SmallTest
 @RunWith(AndroidJUnit4::class)
 class CommunalEditModeViewModelTest : SysuiTestCase() {
     @Mock private lateinit var mediaHost: MediaHost
     @Mock private lateinit var shadeViewController: ShadeViewController
     @Mock private lateinit var powerManager: PowerManager
+    @Mock private lateinit var appWidgetHost: AppWidgetHost
 
     private val kosmos = testKosmos()
     private val testScope = kosmos.testScope
@@ -73,7 +81,7 @@
     fun setUp() {
         MockitoAnnotations.initMocks(this)
 
-        val withDeps = CommunalInteractorFactory.create()
+        val withDeps = CommunalInteractorFactory.create(testScope)
         keyguardRepository = withDeps.keyguardRepository
         communalRepository = withDeps.communalRepository
         tutorialRepository = withDeps.tutorialRepository
@@ -84,6 +92,7 @@
         underTest =
             CommunalEditModeViewModel(
                 withDeps.communalInteractor,
+                appWidgetHost,
                 Provider { shadeViewController },
                 powerManager,
                 mediaHost,
@@ -91,7 +100,7 @@
     }
 
     @Test
-    fun communalContent_onlyWidgetsAreShownInEditMode() =
+    fun communalContent_onlyWidgetsAndCtaTileAreShownInEditMode() =
         testScope.runTest {
             tutorialRepository.setTutorialSettingState(Settings.Secure.HUB_MODE_TUTORIAL_COMPLETED)
 
@@ -119,16 +128,18 @@
             smartspaceRepository.setCommunalSmartspaceTargets(listOf(target))
 
             // Media playing.
-            mediaRepository.mediaPlaying.value = true
+            mediaRepository.mediaActive()
 
             val communalContent by collectLastValue(underTest.communalContent)
 
-            // Only Widgets are shown.
-            assertThat(communalContent?.size).isEqualTo(2)
+            // Only Widgets and CTA tile are shown.
+            assertThat(communalContent?.size).isEqualTo(3)
             assertThat(communalContent?.get(0))
                 .isInstanceOf(CommunalContentModel.Widget::class.java)
             assertThat(communalContent?.get(1))
                 .isInstanceOf(CommunalContentModel.Widget::class.java)
+            assertThat(communalContent?.get(2))
+                .isInstanceOf(CommunalContentModel.CtaTileInEditMode::class.java)
         }
 
     @Test
@@ -143,4 +154,53 @@
             )
             .isEqualTo(false)
     }
+
+    @Test
+    fun addingWidgetTriggersConfiguration() =
+        testScope.runTest {
+            val provider = ComponentName("pkg.test", "testWidget")
+            val widgetToConfigure by collectLastValue(underTest.widgetsToConfigure)
+            assertThat(widgetToConfigure).isNull()
+            underTest.onAddWidget(componentName = provider, priority = 0)
+            assertThat(widgetToConfigure).isEqualTo(1)
+        }
+
+    @Test
+    fun settingResultOkAddsWidget() =
+        testScope.runTest {
+            val provider = ComponentName("pkg.test", "testWidget")
+            val widgetAdded by collectLastValue(widgetRepository.widgetAdded)
+            assertThat(widgetAdded).isNull()
+            underTest.onAddWidget(componentName = provider, priority = 0)
+            assertThat(widgetAdded).isNull()
+            underTest.setConfigurationResult(RESULT_OK)
+            assertThat(widgetAdded).isEqualTo(1)
+        }
+
+    @Test
+    fun settingResultCancelledDoesNotAddWidget() =
+        testScope.runTest {
+            val provider = ComponentName("pkg.test", "testWidget")
+            val widgetAdded by collectLastValue(widgetRepository.widgetAdded)
+            assertThat(widgetAdded).isNull()
+            underTest.onAddWidget(componentName = provider, priority = 0)
+            assertThat(widgetAdded).isNull()
+            underTest.setConfigurationResult(RESULT_CANCELED)
+            assertThat(widgetAdded).isNull()
+        }
+
+    @Test(expected = IllegalStateException::class)
+    fun settingResultBeforeWidgetAddedThrowsException() {
+        underTest.setConfigurationResult(RESULT_OK)
+    }
+
+    @Test(expected = IllegalStateException::class)
+    fun addingWidgetWhileConfigurationActiveFails() =
+        testScope.runTest {
+            val providerOne = ComponentName("pkg.test", "testWidget")
+            underTest.onAddWidget(componentName = providerOne, priority = 0)
+            runCurrent()
+            val providerTwo = ComponentName("pkg.test", "testWidget2")
+            underTest.onAddWidget(componentName = providerTwo, priority = 0)
+        }
 }
diff --git a/packages/SystemUI/multivalentTests/src/com/android/systemui/communal/view/viewmodel/CommunalViewModelTest.kt b/packages/SystemUI/multivalentTests/src/com/android/systemui/communal/view/viewmodel/CommunalViewModelTest.kt
index 182cc5d..16e0bc0 100644
--- a/packages/SystemUI/multivalentTests/src/com/android/systemui/communal/view/viewmodel/CommunalViewModelTest.kt
+++ b/packages/SystemUI/multivalentTests/src/com/android/systemui/communal/view/viewmodel/CommunalViewModelTest.kt
@@ -112,7 +112,7 @@
         }
 
     @Test
-    fun ordering_smartspaceBeforeUmoBeforeWidgets() =
+    fun ordering_smartspaceBeforeUmoBeforeWidgetsBeforeCtaTile() =
         testScope.runTest {
             tutorialRepository.setTutorialSettingState(Settings.Secure.HUB_MODE_TUTORIAL_COMPLETED)
 
@@ -140,12 +140,15 @@
             smartspaceRepository.setCommunalSmartspaceTargets(listOf(target))
 
             // Media playing.
-            mediaRepository.mediaPlaying.value = true
+            mediaRepository.mediaActive()
+
+            // CTA Tile not dismissed.
+            communalRepository.setCtaTileInViewModeVisibility(true)
 
             val communalContent by collectLastValue(underTest.communalContent)
 
-            // Order is smart space, then UMO, then widget content.
-            assertThat(communalContent?.size).isEqualTo(4)
+            // Order is smart space, then UMO, widget content and cta tile.
+            assertThat(communalContent?.size).isEqualTo(5)
             assertThat(communalContent?.get(0))
                 .isInstanceOf(CommunalContentModel.Smartspace::class.java)
             assertThat(communalContent?.get(1)).isInstanceOf(CommunalContentModel.Umo::class.java)
@@ -153,5 +156,7 @@
                 .isInstanceOf(CommunalContentModel.Widget::class.java)
             assertThat(communalContent?.get(3))
                 .isInstanceOf(CommunalContentModel.Widget::class.java)
+            assertThat(communalContent?.get(4))
+                .isInstanceOf(CommunalContentModel.CtaTileInViewMode::class.java)
         }
 }
diff --git a/packages/SystemUI/multivalentTests/src/com/android/systemui/keyguard/data/repository/KeyguardRepositoryImplTest.kt b/packages/SystemUI/multivalentTests/src/com/android/systemui/keyguard/data/repository/KeyguardRepositoryImplTest.kt
index 6c4bb37..c4ebbdc 100644
--- a/packages/SystemUI/multivalentTests/src/com/android/systemui/keyguard/data/repository/KeyguardRepositoryImplTest.kt
+++ b/packages/SystemUI/multivalentTests/src/com/android/systemui/keyguard/data/repository/KeyguardRepositoryImplTest.kt
@@ -24,6 +24,7 @@
 import com.android.keyguard.KeyguardUpdateMonitorCallback
 import com.android.systemui.SysuiTestCase
 import com.android.systemui.biometrics.AuthController
+import com.android.systemui.biometrics.data.repository.FakeFacePropertyRepository
 import com.android.systemui.common.shared.model.Position
 import com.android.systemui.coroutines.collectLastValue
 import com.android.systemui.doze.DozeMachine
@@ -71,6 +72,7 @@
     private val testDispatcher = StandardTestDispatcher()
     private val testScope = TestScope(testDispatcher)
     private lateinit var systemClock: FakeSystemClock
+    private lateinit var facePropertyRepository: FakeFacePropertyRepository
 
     private lateinit var underTest: KeyguardRepositoryImpl
 
@@ -78,6 +80,7 @@
     fun setUp() {
         MockitoAnnotations.initMocks(this)
         systemClock = FakeSystemClock()
+        facePropertyRepository = FakeFacePropertyRepository()
         underTest =
             KeyguardRepositoryImpl(
                 statusBarStateController,
@@ -89,6 +92,7 @@
                 mainDispatcher,
                 testScope.backgroundScope,
                 systemClock,
+                facePropertyRepository,
             )
     }
 
@@ -482,10 +486,7 @@
         testScope.runTest {
             val values = mutableListOf<Point?>()
             val job = underTest.faceSensorLocation.onEach(values::add).launchIn(this)
-
-            val captor = argumentCaptor<AuthController.Callback>()
             runCurrent()
-            verify(authController).addCallback(captor.capture())
 
             // An initial, null value should be initially emitted so that flows combined with this
             // one
@@ -500,8 +501,7 @@
                     Point(250, 250),
                 )
                 .onEach {
-                    whenever(authController.faceSensorLocation).thenReturn(it)
-                    captor.value.onFaceSensorLocationChanged()
+                    facePropertyRepository.setSensorLocation(it)
                     runCurrent()
                 }
                 .also { dispatchedSensorLocations ->
diff --git a/packages/SystemUI/multivalentTests/src/com/android/systemui/keyguard/ui/viewmodel/KeyguardRootViewModelTest.kt b/packages/SystemUI/multivalentTests/src/com/android/systemui/keyguard/ui/viewmodel/KeyguardRootViewModelTest.kt
index 7c3dc97..5b88ebe6 100644
--- a/packages/SystemUI/multivalentTests/src/com/android/systemui/keyguard/ui/viewmodel/KeyguardRootViewModelTest.kt
+++ b/packages/SystemUI/multivalentTests/src/com/android/systemui/keyguard/ui/viewmodel/KeyguardRootViewModelTest.kt
@@ -32,7 +32,7 @@
 import com.android.systemui.keyguard.shared.model.TransitionState
 import com.android.systemui.keyguard.shared.model.TransitionStep
 import com.android.systemui.kosmos.testScope
-import com.android.systemui.statusbar.notification.data.repository.fakeNotificationsKeyguardViewStateRepository
+import com.android.systemui.statusbar.notification.stack.domain.interactor.notificationsKeyguardInteractor
 import com.android.systemui.statusbar.phone.dozeParameters
 import com.android.systemui.statusbar.phone.screenOffAnimationController
 import com.android.systemui.testKosmos
@@ -56,8 +56,7 @@
     private val keyguardTransitionRepository = kosmos.fakeKeyguardTransitionRepository
     private val screenOffAnimationController = kosmos.screenOffAnimationController
     private val deviceEntryRepository = kosmos.fakeDeviceEntryRepository
-    private val fakeNotificationsKeyguardViewStateRepository =
-        kosmos.fakeNotificationsKeyguardViewStateRepository
+    private val notificationsKeyguardInteractor = kosmos.notificationsKeyguardInteractor
     private val dozeParameters = kosmos.dozeParameters
     private val underTest = kosmos.keyguardRootViewModel
 
@@ -118,7 +117,7 @@
         testScope.runTest {
             val isVisible by collectLastValue(underTest.isNotifIconContainerVisible)
             runCurrent()
-            fakeNotificationsKeyguardViewStateRepository.setPulseExpanding(true)
+            notificationsKeyguardInteractor.setPulseExpanding(true)
             deviceEntryRepository.setBypassEnabled(false)
             runCurrent()
 
@@ -130,9 +129,9 @@
         testScope.runTest {
             val isVisible by collectLastValue(underTest.isNotifIconContainerVisible)
             runCurrent()
-            fakeNotificationsKeyguardViewStateRepository.setPulseExpanding(false)
+            notificationsKeyguardInteractor.setPulseExpanding(false)
             deviceEntryRepository.setBypassEnabled(true)
-            fakeNotificationsKeyguardViewStateRepository.setNotificationsFullyHidden(true)
+            notificationsKeyguardInteractor.setNotificationsFullyHidden(true)
             runCurrent()
 
             assertThat(isVisible?.value).isTrue()
@@ -144,10 +143,10 @@
         testScope.runTest {
             val isVisible by collectLastValue(underTest.isNotifIconContainerVisible)
             runCurrent()
-            fakeNotificationsKeyguardViewStateRepository.setPulseExpanding(false)
+            notificationsKeyguardInteractor.setPulseExpanding(false)
             deviceEntryRepository.setBypassEnabled(false)
             whenever(dozeParameters.alwaysOn).thenReturn(false)
-            fakeNotificationsKeyguardViewStateRepository.setNotificationsFullyHidden(true)
+            notificationsKeyguardInteractor.setNotificationsFullyHidden(true)
             runCurrent()
 
             assertThat(isVisible?.value).isTrue()
@@ -159,11 +158,11 @@
         testScope.runTest {
             val isVisible by collectLastValue(underTest.isNotifIconContainerVisible)
             runCurrent()
-            fakeNotificationsKeyguardViewStateRepository.setPulseExpanding(false)
+            notificationsKeyguardInteractor.setPulseExpanding(false)
             deviceEntryRepository.setBypassEnabled(false)
             whenever(dozeParameters.alwaysOn).thenReturn(true)
             whenever(dozeParameters.displayNeedsBlanking).thenReturn(true)
-            fakeNotificationsKeyguardViewStateRepository.setNotificationsFullyHidden(true)
+            notificationsKeyguardInteractor.setNotificationsFullyHidden(true)
             runCurrent()
 
             assertThat(isVisible?.value).isTrue()
@@ -175,11 +174,11 @@
         testScope.runTest {
             val isVisible by collectLastValue(underTest.isNotifIconContainerVisible)
             runCurrent()
-            fakeNotificationsKeyguardViewStateRepository.setPulseExpanding(false)
+            notificationsKeyguardInteractor.setPulseExpanding(false)
             deviceEntryRepository.setBypassEnabled(false)
             whenever(dozeParameters.alwaysOn).thenReturn(true)
             whenever(dozeParameters.displayNeedsBlanking).thenReturn(false)
-            fakeNotificationsKeyguardViewStateRepository.setNotificationsFullyHidden(true)
+            notificationsKeyguardInteractor.setNotificationsFullyHidden(true)
             runCurrent()
 
             assertThat(isVisible?.value).isTrue()
@@ -191,11 +190,11 @@
         testScope.runTest {
             val isVisible by collectLastValue(underTest.isNotifIconContainerVisible)
             runCurrent()
-            fakeNotificationsKeyguardViewStateRepository.setPulseExpanding(false)
+            notificationsKeyguardInteractor.setPulseExpanding(false)
             deviceEntryRepository.setBypassEnabled(false)
             whenever(dozeParameters.alwaysOn).thenReturn(true)
             whenever(dozeParameters.displayNeedsBlanking).thenReturn(false)
-            fakeNotificationsKeyguardViewStateRepository.setNotificationsFullyHidden(true)
+            notificationsKeyguardInteractor.setNotificationsFullyHidden(true)
             runCurrent()
 
             assertThat(isVisible?.isAnimating).isEqualTo(true)
diff --git a/packages/SystemUI/multivalentTests/src/com/android/systemui/qs/tiles/impl/alarm/domain/AlarmTileMapperTest.kt b/packages/SystemUI/multivalentTests/src/com/android/systemui/qs/tiles/impl/alarm/domain/AlarmTileMapperTest.kt
index 00405d0..c2ce392 100644
--- a/packages/SystemUI/multivalentTests/src/com/android/systemui/qs/tiles/impl/alarm/domain/AlarmTileMapperTest.kt
+++ b/packages/SystemUI/multivalentTests/src/com/android/systemui/qs/tiles/impl/alarm/domain/AlarmTileMapperTest.kt
@@ -29,27 +29,37 @@
 import com.android.systemui.qs.tiles.impl.custom.QSTileStateSubject
 import com.android.systemui.qs.tiles.viewmodel.QSTileState
 import com.android.systemui.res.R
+import com.android.systemui.util.time.FakeSystemClock
 import java.time.Instant
 import java.time.LocalDateTime
 import java.util.TimeZone
+import org.junit.Before
 import org.junit.Test
 import org.junit.runner.RunWith
 
 @SmallTest
 @RunWith(AndroidJUnit4::class)
 class AlarmTileMapperTest : SysuiTestCase() {
+    private val oneMinute = 60000L
     private val kosmos = Kosmos()
     private val alarmTileConfig = kosmos.qsAlarmTileConfig
+    private val fakeClock = FakeSystemClock()
     // Using lazy (versus =) to make sure we override the right context -- see b/311612168
     private val mapper by lazy {
         AlarmTileMapper(
             context.orCreateTestableResources
                 .apply { addOverride(R.drawable.ic_alarm, TestStubDrawable()) }
                 .resources,
-            context.theme
+            context.theme,
+            fakeClock
         )
     }
 
+    @Before
+    fun setup() {
+        fakeClock.setCurrentTimeMillis(0) // same time both in test & map()
+    }
+
     @Test
     fun notAlarmSet() {
         val inputModel = AlarmTileModel.NoAlarmSet
@@ -66,7 +76,7 @@
 
     @Test
     fun nextAlarmSet24HourFormat() {
-        val triggerTime = 1L
+        val triggerTime = fakeClock.currentTimeMillis() + oneMinute
         val inputModel =
             AlarmTileModel.NextAlarmSet(true, AlarmManager.AlarmClockInfo(triggerTime, null))
 
@@ -85,7 +95,7 @@
 
     @Test
     fun nextAlarmSet12HourFormat() {
-        val triggerTime = 1L
+        val triggerTime = fakeClock.currentTimeMillis() + oneMinute
         val inputModel =
             AlarmTileModel.NextAlarmSet(false, AlarmManager.AlarmClockInfo(triggerTime, null))
 
@@ -102,6 +112,66 @@
         QSTileStateSubject.assertThat(outputState).isEqualTo(expectedState)
     }
 
+    @Test
+    fun nextAlarmSetMoreThanAWeekLater_mapsSecondaryLabelToDisplayDateOnly() {
+        val oneWeekAndOneMinute = 7 * 24 * 60 * 60 * 1000L + oneMinute
+        val triggerTime = fakeClock.currentTimeMillis() + oneWeekAndOneMinute
+        val inputModel =
+            AlarmTileModel.NextAlarmSet(false, AlarmManager.AlarmClockInfo(triggerTime, null))
+
+        val outputState = mapper.map(alarmTileConfig, inputModel)
+
+        val localDateTime =
+            LocalDateTime.ofInstant(
+                Instant.ofEpochMilli(triggerTime),
+                TimeZone.getDefault().toZoneId()
+            )
+        val expectedSecondaryLabel = AlarmTileMapper.formatterDateOnly.format(localDateTime)
+        val expectedState =
+            createAlarmTileState(QSTileState.ActivationState.ACTIVE, expectedSecondaryLabel)
+        QSTileStateSubject.assertThat(outputState).isEqualTo(expectedState)
+    }
+
+    @Test
+    fun nextAlarmSetOneMinuteLessThanAWeekLater_mapsSecondaryLabelToDisplayTime() {
+        val oneWeekMinusOneMinute = 7 * 24 * 60 * 60 * 1000L - oneMinute
+        val triggerTime = fakeClock.currentTimeMillis() + oneWeekMinusOneMinute
+        val inputModel =
+            AlarmTileModel.NextAlarmSet(false, AlarmManager.AlarmClockInfo(triggerTime, null))
+
+        val outputState = mapper.map(alarmTileConfig, inputModel)
+
+        val localDateTime =
+            LocalDateTime.ofInstant(
+                Instant.ofEpochMilli(triggerTime),
+                TimeZone.getDefault().toZoneId()
+            )
+        val expectedSecondaryLabel = AlarmTileMapper.formatter12Hour.format(localDateTime)
+        val expectedState =
+            createAlarmTileState(QSTileState.ActivationState.ACTIVE, expectedSecondaryLabel)
+        QSTileStateSubject.assertThat(outputState).isEqualTo(expectedState)
+    }
+
+    @Test
+    fun nextAlarmSetExactlyAWeekLater_mapsSecondaryLabelToDisplayDateOnly() {
+        val oneWeek = 7 * 24 * 60 * 60 * 1000L
+        val triggerTime = fakeClock.currentTimeMillis() + oneWeek
+        val inputModel =
+            AlarmTileModel.NextAlarmSet(false, AlarmManager.AlarmClockInfo(triggerTime, null))
+
+        val outputState = mapper.map(alarmTileConfig, inputModel)
+
+        val localDateTime =
+            LocalDateTime.ofInstant(
+                Instant.ofEpochMilli(triggerTime),
+                TimeZone.getDefault().toZoneId()
+            )
+        val expectedSecondaryLabel = AlarmTileMapper.formatterDateOnly.format(localDateTime)
+        val expectedState =
+            createAlarmTileState(QSTileState.ActivationState.ACTIVE, expectedSecondaryLabel)
+        QSTileStateSubject.assertThat(outputState).isEqualTo(expectedState)
+    }
+
     private fun createAlarmTileState(
         activationState: QSTileState.ActivationState,
         secondaryLabel: String
diff --git a/packages/SystemUI/multivalentTests/src/com/android/systemui/statusbar/phone/SystemUIDialogTest.java b/packages/SystemUI/multivalentTests/src/com/android/systemui/statusbar/phone/SystemUIDialogTest.java
index de767e3..7274c0c 100644
--- a/packages/SystemUI/multivalentTests/src/com/android/systemui/statusbar/phone/SystemUIDialogTest.java
+++ b/packages/SystemUI/multivalentTests/src/com/android/systemui/statusbar/phone/SystemUIDialogTest.java
@@ -21,29 +21,30 @@
 import static junit.framework.Assert.assertFalse;
 import static junit.framework.Assert.assertTrue;
 
-import static org.mockito.Mockito.atLeast;
 import static org.mockito.Mockito.never;
 import static org.mockito.Mockito.verify;
-import static org.mockito.Mockito.when;
 
 import android.content.BroadcastReceiver;
 import android.content.Intent;
 import android.content.IntentFilter;
 import android.content.res.Configuration;
+import android.platform.test.annotations.RequiresFlagsEnabled;
+import android.platform.test.flag.junit.CheckFlagsRule;
+import android.platform.test.flag.junit.DeviceFlagsValueProvider;
 import android.testing.TestableLooper.RunWithLooper;
 
 import androidx.test.ext.junit.runners.AndroidJUnit4;
 import androidx.test.filters.SmallTest;
 
 import com.android.systemui.Dependency;
+import com.android.systemui.Flags;
 import com.android.systemui.SysuiTestCase;
 import com.android.systemui.animation.DialogLaunchAnimator;
 import com.android.systemui.broadcast.BroadcastDispatcher;
-import com.android.systemui.flags.FeatureFlags;
-import com.android.systemui.flags.Flags;
 import com.android.systemui.model.SysUiState;
 
 import org.junit.Before;
+import org.junit.Rule;
 import org.junit.Test;
 import org.junit.runner.RunWith;
 import org.mockito.ArgumentCaptor;
@@ -61,17 +62,17 @@
 public class SystemUIDialogTest extends SysuiTestCase {
 
     @Mock
-    private FeatureFlags mFeatureFlags;
-    @Mock
     private BroadcastDispatcher mBroadcastDispatcher;
     @Mock
     private SystemUIDialog.Delegate mDelegate;
 
+    @Rule
+    public final CheckFlagsRule mCheckFlagsRule = DeviceFlagsValueProvider.createCheckFlagsRule();
+
     @Before
     public void setup() {
         MockitoAnnotations.initMocks(this);
 
-        mDependency.injectTestDependency(FeatureFlags.class, mFeatureFlags);
         mDependency.injectTestDependency(BroadcastDispatcher.class, mBroadcastDispatcher);
     }
 
@@ -110,16 +111,13 @@
     }
 
     @Test
+    @RequiresFlagsEnabled(Flags.FLAG_PREDICTIVE_BACK_ANIMATE_DIALOGS)
     public void usePredictiveBackAnimFlag() {
-        when(mFeatureFlags.isEnabled(Flags.WM_ENABLE_PREDICTIVE_BACK_QS_DIALOG_ANIM))
-                .thenReturn(true);
         final SystemUIDialog dialog = new SystemUIDialog(mContext);
 
         dialog.show();
 
         assertTrue(dialog.isShowing());
-        verify(mFeatureFlags, atLeast(1))
-                .isEnabled(Flags.WM_ENABLE_PREDICTIVE_BACK_QS_DIALOG_ANIM);
 
         dialog.dismiss();
         assertFalse(dialog.isShowing());
@@ -174,7 +172,6 @@
     private SystemUIDialog createDialogWithDelegate() {
         SystemUIDialog.Factory factory = new SystemUIDialog.Factory(
                 getContext(),
-                mFeatureFlags,
                 Dependency.get(SystemUIDialogManager.class),
                 Dependency.get(SysUiState.class),
                 Dependency.get(BroadcastDispatcher.class),
diff --git a/packages/SystemUI/multivalentTests/src/com/android/systemui/statusbar/pipeline/mobile/domain/interactor/FakeMobileIconsInteractor.kt b/packages/SystemUI/multivalentTests/src/com/android/systemui/statusbar/pipeline/mobile/domain/interactor/FakeMobileIconsInteractor.kt
index 75d1869..a9ee405 100644
--- a/packages/SystemUI/multivalentTests/src/com/android/systemui/statusbar/pipeline/mobile/domain/interactor/FakeMobileIconsInteractor.kt
+++ b/packages/SystemUI/multivalentTests/src/com/android/systemui/statusbar/pipeline/mobile/domain/interactor/FakeMobileIconsInteractor.kt
@@ -68,6 +68,8 @@
 
     override val isSingleCarrier = MutableStateFlow(true)
 
+    override val icons: MutableStateFlow<List<MobileIconInteractor>> = MutableStateFlow(emptyList())
+
     private val _defaultMobileIconMapping = MutableStateFlow(TEST_MAPPING)
     override val defaultMobileIconMapping = _defaultMobileIconMapping
 
@@ -80,8 +82,12 @@
     override val isForceHidden = MutableStateFlow(false)
 
     /** Always returns a new fake interactor */
-    override fun getMobileConnectionInteractorForSubId(subId: Int): MobileIconInteractor {
-        return FakeMobileIconInteractor(tableLogBuffer).also { interactorCache[subId] = it }
+    override fun getMobileConnectionInteractorForSubId(subId: Int): FakeMobileIconInteractor {
+        return FakeMobileIconInteractor(tableLogBuffer).also {
+            interactorCache[subId] = it
+            // Also update the icons
+            icons.value = interactorCache.values.toList()
+        }
     }
 
     /**
diff --git a/packages/SystemUI/plugin/Android.bp b/packages/SystemUI/plugin/Android.bp
index 0537f17..9063a02 100644
--- a/packages/SystemUI/plugin/Android.bp
+++ b/packages/SystemUI/plugin/Android.bp
@@ -46,8 +46,8 @@
     static_libs: [
         "androidx.annotation_annotation",
         "androidx-constraintlayout_constraintlayout",
+        "PlatformAnimationLib",
         "PluginCoreLib",
-        "SystemUIAnimationLib",
         "SystemUICommon",
         "SystemUILogLib",
         "androidx.annotation_annotation",
diff --git a/packages/SystemUI/res/layout/qs_footer_impl.xml b/packages/SystemUI/res/layout/qs_footer_impl.xml
index 7ab44e7..73874a0 100644
--- a/packages/SystemUI/res/layout/qs_footer_impl.xml
+++ b/packages/SystemUI/res/layout/qs_footer_impl.xml
@@ -44,6 +44,8 @@
                 android:ellipsize="marquee"
                 android:focusable="true"
                 android:gravity="center_vertical"
+                android:textDirection="locale"
+                android:textAlignment="viewStart"
                 android:singleLine="true"
                 android:textAppearance="@style/TextAppearance.QS.Status.Build"
                 android:visibility="gone" />
diff --git a/packages/SystemUI/res/layout/remote_input.xml b/packages/SystemUI/res/layout/remote_input.xml
index f4b0a45..84681d34 100644
--- a/packages/SystemUI/res/layout/remote_input.xml
+++ b/packages/SystemUI/res/layout/remote_input.xml
@@ -89,7 +89,6 @@
                 android:textColorHint="@color/remote_input_hint"
                 android:textSize="16sp"
                 android:background="@null"
-                android:maxLines="4"
                 android:ellipsize="start"
                 android:inputType="textShortMessage|textMultiLine|textAutoCorrect|textCapSentences"
                 android:imeOptions="actionSend|flagNoExtractUi|flagNoFullscreen" />
diff --git a/packages/SystemUI/res/values/config.xml b/packages/SystemUI/res/values/config.xml
index 10f7c4d..64a1d24 100644
--- a/packages/SystemUI/res/values/config.xml
+++ b/packages/SystemUI/res/values/config.xml
@@ -538,15 +538,15 @@
        -->
     <string translatable="false" name="config_frontBuiltInDisplayCutoutProtection"></string>
 
-    <!--  ID for the camera of outer display that needs extra protection -->
+    <!-- ID for the camera of outer display that needs extra protection -->
     <string translatable="false" name="config_protectedCameraId"></string>
-    <!--  Physical ID for the camera of outer display that needs extra protection -->
+    <!-- Physical ID for the camera of outer display that needs extra protection -->
     <string translatable="false" name="config_protectedPhysicalCameraId"></string>
 
     <!-- Similar to config_frontBuiltInDisplayCutoutProtection but for inner display. -->
     <string translatable="false" name="config_innerBuiltInDisplayCutoutProtection"></string>
 
-    <!-- ID for the camera of inner display that needs extra protection -->
+    <!-- ID for the camera of inner display that needs extra protection. -->
     <string translatable="false" name="config_protectedInnerCameraId"></string>
     <!-- Physical ID for the camera of inner display that needs extra protection -->
     <string translatable="false" name="config_protectedInnerPhysicalCameraId"></string>
@@ -650,13 +650,20 @@
     <!-- Whether to use window background blur for the volume dialog. -->
     <bool name="config_volumeDialogUseBackgroundBlur">false</bool>
 
-    <!-- The properties of the face auth camera in pixels -->
+    <!-- The properties of the face auth front camera for outer display in pixels -->
     <integer-array name="config_face_auth_props">
         <!-- sensorLocationX -->
         <!-- sensorLocationY -->
         <!--sensorRadius -->
     </integer-array>
 
+    <!-- The properties of the face auth front camera for inner display in pixels -->
+    <integer-array name="config_inner_face_auth_props">
+        <!-- sensorLocationX -->
+        <!-- sensorLocationY -->
+        <!--sensorRadius -->
+    </integer-array>
+
     <!-- Overrides the behavior of the face unlock keyguard bypass setting:
          0 - Don't override the setting (default)
          1 - Override the setting to always bypass keyguard
diff --git a/packages/SystemUI/res/values/strings.xml b/packages/SystemUI/res/values/strings.xml
index 854bb0f..3f11fae 100644
--- a/packages/SystemUI/res/values/strings.xml
+++ b/packages/SystemUI/res/values/strings.xml
@@ -1079,6 +1079,14 @@
 
     <!-- Description for the button that opens the widget editor on click. [CHAR LIMIT=50] -->
     <string name="button_to_open_widget_editor">Open the widget editor</string>
+    <!-- Text for CTA button that launches the hub mode widget editor on click. [CHAR LIMIT=50] -->
+    <string name="cta_tile_button_to_open_widget_editor">Customize</string>
+    <!-- Text for CTA button that dismisses the tile on click. [CHAR LIMIT=50] -->
+    <string name="cta_tile_button_to_dismiss">Dismiss</string>
+    <!-- Label for CTA tile to edit the glanceable hub [CHAR LIMIT=100] -->
+    <string name="cta_label_to_edit_widget">Add, remove, and reorder your widgets in this space</string>
+    <!-- Label for CTA tile that opens widget picker on click in edit mode [CHAR LIMIT=50] -->
+    <string name="cta_label_to_open_widget_picker">Add more widgets</string>
     <!-- Description for the button that removes a widget on click. [CHAR LIMIT=50] -->
     <string name="button_to_remove_widget">Remove</string>
     <!-- Text for the button that launches the hub mode widget picker. [CHAR LIMIT=50] -->
diff --git a/packages/SystemUI/shared/Android.bp b/packages/SystemUI/shared/Android.bp
index 3a26ebf..05106c9 100644
--- a/packages/SystemUI/shared/Android.bp
+++ b/packages/SystemUI/shared/Android.bp
@@ -51,8 +51,8 @@
     ],
     static_libs: [
         "BiometricsSharedLib",
+        "PlatformAnimationLib",
         "PluginCoreLib",
-        "SystemUIAnimationLib",
         "SystemUIPluginLib",
         "SystemUIUnfoldLib",
         "SystemUISharedLib-Keyguard",
diff --git a/packages/SystemUI/shared/biometrics/src/com/android/systemui/biometrics/shared/model/UdfpsOverlayParams.kt b/packages/SystemUI/shared/biometrics/src/com/android/systemui/biometrics/shared/model/UdfpsOverlayParams.kt
index 65c5a49..e31fb89 100644
--- a/packages/SystemUI/shared/biometrics/src/com/android/systemui/biometrics/shared/model/UdfpsOverlayParams.kt
+++ b/packages/SystemUI/shared/biometrics/src/com/android/systemui/biometrics/shared/model/UdfpsOverlayParams.kt
@@ -17,6 +17,8 @@
 package com.android.systemui.biometrics.shared.model
 
 import android.graphics.Rect
+import android.hardware.fingerprint.FingerprintSensorProperties.SensorType
+import android.hardware.fingerprint.FingerprintSensorProperties.TYPE_UDFPS_OPTICAL
 import android.view.Surface
 import android.view.Surface.Rotation
 
@@ -39,6 +41,8 @@
  * the native resolution.
  *
  * [rotation] current rotation of the display.
+ *
+ * [sensorType] fingerprint sensor type
  */
 data class UdfpsOverlayParams(
     val sensorBounds: Rect = Rect(),
@@ -46,7 +50,8 @@
     val naturalDisplayWidth: Int = 0,
     val naturalDisplayHeight: Int = 0,
     val scaleFactor: Float = 1f,
-    @Rotation val rotation: Int = Surface.ROTATION_0
+    @Rotation val rotation: Int = Surface.ROTATION_0,
+    @SensorType val sensorType: Int = TYPE_UDFPS_OPTICAL
 ) {
 
     /** Same as [sensorBounds], but in native resolution. */
diff --git a/packages/SystemUI/shared/src/com/android/systemui/navigationbar/buttons/KeyButtonRipple.java b/packages/SystemUI/shared/src/com/android/systemui/shared/navigationbar/KeyButtonRipple.java
similarity index 98%
rename from packages/SystemUI/shared/src/com/android/systemui/navigationbar/buttons/KeyButtonRipple.java
rename to packages/SystemUI/shared/src/com/android/systemui/shared/navigationbar/KeyButtonRipple.java
index f005af3..92473e8 100644
--- a/packages/SystemUI/shared/src/com/android/systemui/navigationbar/buttons/KeyButtonRipple.java
+++ b/packages/SystemUI/shared/src/com/android/systemui/shared/navigationbar/KeyButtonRipple.java
@@ -1,5 +1,5 @@
 /*
- * Copyright (C) 2020 The Android Open Source Project
+ * Copyright (C) 2024 The Android Open Source Project
  *
  * Licensed under the Apache License, Version 2.0 (the "License");
  * you may not use this file except in compliance with the License.
@@ -14,7 +14,7 @@
  * limitations under the License.
  */
 
-package com.android.systemui.navigationbar.buttons;
+package com.android.systemui.shared.navigationbar;
 
 import android.animation.Animator;
 import android.animation.AnimatorListenerAdapter;
@@ -125,7 +125,7 @@
     /**
      *  @param onInvisibleRunnable run after we are next drawn invisibly. Only used once.
      */
-    void setOnInvisibleRunnable(Runnable onInvisibleRunnable) {
+    public void setOnInvisibleRunnable(Runnable onInvisibleRunnable) {
         mOnInvisibleRunnable = onInvisibleRunnable;
     }
 
diff --git a/packages/SystemUI/shared/src/com/android/systemui/shared/rotation/FloatingRotationButtonView.java b/packages/SystemUI/shared/src/com/android/systemui/shared/rotation/FloatingRotationButtonView.java
index a4b6451..2145166 100644
--- a/packages/SystemUI/shared/src/com/android/systemui/shared/rotation/FloatingRotationButtonView.java
+++ b/packages/SystemUI/shared/src/com/android/systemui/shared/rotation/FloatingRotationButtonView.java
@@ -30,7 +30,7 @@
 
 import androidx.annotation.DimenRes;
 
-import com.android.systemui.navigationbar.buttons.KeyButtonRipple;
+import com.android.systemui.shared.navigationbar.KeyButtonRipple;
 
 public class FloatingRotationButtonView extends ImageView {
 
diff --git a/packages/SystemUI/shared/src/com/android/systemui/statusbar/policy/CallbackController.java b/packages/SystemUI/shared/src/com/android/systemui/statusbar/policy/CallbackController.java
index 047ff75..9f82201 100644
--- a/packages/SystemUI/shared/src/com/android/systemui/statusbar/policy/CallbackController.java
+++ b/packages/SystemUI/shared/src/com/android/systemui/statusbar/policy/CallbackController.java
@@ -21,6 +21,11 @@
 import androidx.lifecycle.LifecycleEventObserver;
 import androidx.lifecycle.LifecycleOwner;
 
+/**
+ * Implementation of the collection used and thread guarantees are left to the discretion of the
+ * client. Consider using {@link com.android.systemui.util.ListenerSet} to prevent concurrent
+ * modification exceptions.
+ */
 public interface CallbackController<T> {
 
     /** Add a callback */
diff --git a/packages/SystemUI/src/com/android/systemui/ScreenDecorations.java b/packages/SystemUI/src/com/android/systemui/ScreenDecorations.java
index e03c627..d6d5c26 100644
--- a/packages/SystemUI/src/com/android/systemui/ScreenDecorations.java
+++ b/packages/SystemUI/src/com/android/systemui/ScreenDecorations.java
@@ -68,7 +68,7 @@
 
 import com.android.internal.util.Preconditions;
 import com.android.settingslib.Utils;
-import com.android.systemui.biometrics.AuthController;
+import com.android.systemui.biometrics.data.repository.FacePropertyRepository;
 import com.android.systemui.dagger.SysUISingleton;
 import com.android.systemui.decor.CutoutDecorProviderFactory;
 import com.android.systemui.decor.DebugRoundedCornerDelegate;
@@ -92,6 +92,7 @@
 import com.android.systemui.statusbar.policy.ConfigurationController;
 import com.android.systemui.util.concurrency.DelayableExecutor;
 import com.android.systemui.util.concurrency.ThreadFactory;
+import com.android.systemui.util.kotlin.JavaAdapter;
 import com.android.systemui.util.settings.SecureSettings;
 
 import dalvik.annotation.optimization.NeverCompile;
@@ -131,8 +132,6 @@
     };
     private final ScreenDecorationsLogger mLogger;
 
-    private final AuthController mAuthController;
-
     private DisplayTracker mDisplayTracker;
     @VisibleForTesting
     protected boolean mIsRegistered;
@@ -183,6 +182,9 @@
     private DisplayCutout mDisplayCutout;
     private boolean mPendingManualConfigUpdate;
 
+    private FacePropertyRepository mFacePropertyRepository;
+    private JavaAdapter mJavaAdapter;
+
     @VisibleForTesting
     protected void showCameraProtection(@NonNull Path protectionPath, @NonNull Rect bounds) {
         if (mFaceScanningFactory.shouldShowFaceScanningAnim()) {
@@ -330,7 +332,8 @@
             PrivacyDotDecorProviderFactory dotFactory,
             FaceScanningProviderFactory faceScanningFactory,
             ScreenDecorationsLogger logger,
-            AuthController authController) {
+            FacePropertyRepository facePropertyRepository,
+            JavaAdapter javaAdapter) {
         mContext = context;
         mSecureSettings = secureSettings;
         mCommandRegistry = commandRegistry;
@@ -342,22 +345,10 @@
         mFaceScanningFactory = faceScanningFactory;
         mFaceScanningViewId = com.android.systemui.res.R.id.face_scanning_anim;
         mLogger = logger;
-        mAuthController = authController;
+        mFacePropertyRepository = facePropertyRepository;
+        mJavaAdapter = javaAdapter;
     }
 
-
-    private final AuthController.Callback mAuthControllerCallback = new AuthController.Callback() {
-        @Override
-        public void onFaceSensorLocationChanged() {
-            mLogger.onSensorLocationChanged();
-            if (mExecutor != null) {
-                mExecutor.execute(
-                        () -> updateOverlayProviderViews(
-                                new Integer[]{mFaceScanningViewId}));
-            }
-        }
-    };
-
     private final ScreenDecorCommand.Callback mScreenDecorCommandCallback = (cmd, pw) -> {
         // If we are exiting debug mode, we can set it (false) and bail, otherwise we will
         // ensure that debug mode is set
@@ -407,7 +398,8 @@
         mExecutor = mThreadFactory.buildDelayableExecutorOnHandler(mHandler);
         mExecutor.execute(this::startOnScreenDecorationsThread);
         mDotViewController.setUiExecutor(mExecutor);
-        mAuthController.addCallback(mAuthControllerCallback);
+        mJavaAdapter.alwaysCollectFlow(mFacePropertyRepository.getSensorLocation(),
+                this::onFaceSensorLocationChanged);
         mCommandRegistry.registerCommand(ScreenDecorCommand.SCREEN_DECOR_CMD_NAME,
                 () -> new ScreenDecorCommand(mScreenDecorCommandCallback));
     }
@@ -1320,6 +1312,16 @@
         view.setLayoutParams(params);
     }
 
+    @VisibleForTesting
+    void onFaceSensorLocationChanged(Point location) {
+        mLogger.onSensorLocationChanged();
+        if (mExecutor != null) {
+            mExecutor.execute(
+                    () -> updateOverlayProviderViews(
+                            new Integer[]{mFaceScanningViewId}));
+        }
+    }
+
     public static class DisplayCutoutView extends DisplayCutoutBaseView {
         final List<Rect> mBounds = new ArrayList();
         final Rect mBoundingRect = new Rect();
diff --git a/packages/SystemUI/src/com/android/systemui/biometrics/AuthController.java b/packages/SystemUI/src/com/android/systemui/biometrics/AuthController.java
index a4f90eb..093a1ff 100644
--- a/packages/SystemUI/src/com/android/systemui/biometrics/AuthController.java
+++ b/packages/SystemUI/src/com/android/systemui/biometrics/AuthController.java
@@ -148,10 +148,6 @@
 
     private final Display mDisplay;
     private float mScaleFactor = 1f;
-    // sensor locations without any resolution scaling nor rotation adjustments:
-    @Nullable private final Point mFaceSensorLocationDefault;
-    // cached sensor locations:
-    @Nullable private Point mFaceSensorLocation;
     @Nullable private Point mFingerprintSensorLocation;
     @Nullable private Rect mUdfpsBounds;
     private final Set<Callback> mCallbacks = new HashSet<>();
@@ -622,7 +618,6 @@
         mScaleFactor = mUdfpsUtils.getScaleFactor(mCachedDisplayInfo);
         updateUdfpsLocation();
         updateFingerprintLocation();
-        updateFaceLocation();
     }
     /**
      * @return where the fingerprint sensor exists in pixels in its natural orientation.
@@ -682,31 +677,6 @@
     }
 
     /**
-     * @return where the face sensor exists in pixels in the current device orientation. Returns
-     * null if no face sensor exists.
-     */
-    @Nullable public Point getFaceSensorLocation() {
-        return mFaceSensorLocation;
-    }
-
-    private void updateFaceLocation() {
-        if (mFaceProps == null || mFaceSensorLocationDefault == null) {
-            mFaceSensorLocation = null;
-        } else {
-            mFaceSensorLocation = rotateToCurrentOrientation(
-                    new Point(
-                            (int) (mFaceSensorLocationDefault.x * mScaleFactor),
-                            (int) (mFaceSensorLocationDefault.y * mScaleFactor)),
-                    mCachedDisplayInfo
-            );
-        }
-
-        for (final Callback cb : mCallbacks) {
-            cb.onFaceSensorLocationChanged();
-        }
-    }
-
-    /**
      * @param inOutPoint point on the display in pixels. Going in, represents the point
      *                   in the device's natural orientation. Going out, represents
      *                   the point in the display's current orientation.
@@ -821,17 +791,7 @@
         mWakefulnessLifecycle = wakefulnessLifecycle;
         mPanelInteractionDetector = panelInteractionDetector;
 
-
         mFaceProps = mFaceManager != null ? mFaceManager.getSensorPropertiesInternal() : null;
-        int[] faceAuthLocation = context.getResources().getIntArray(
-                com.android.systemui.res.R.array.config_face_auth_props);
-        if (faceAuthLocation == null || faceAuthLocation.length < 2) {
-            mFaceSensorLocationDefault = null;
-        } else {
-            mFaceSensorLocationDefault = new Point(
-                    faceAuthLocation[0],
-                    faceAuthLocation[1]);
-        }
 
         mDisplay = mContext.getDisplay();
         updateSensorLocations();
@@ -868,7 +828,8 @@
                     mCachedDisplayInfo.getNaturalWidth(),
                     mCachedDisplayInfo.getNaturalHeight(),
                     mScaleFactor,
-                    mCachedDisplayInfo.rotation);
+                    mCachedDisplayInfo.rotation,
+                    udfpsProp.sensorType);
 
             mUdfpsController.updateOverlayParams(udfpsProp, mUdfpsOverlayParams);
             if (!Objects.equals(previousUdfpsBounds, mUdfpsBounds) || !Objects.equals(
@@ -1358,8 +1319,6 @@
         final AuthDialog dialog = mCurrentDialog;
         pw.println("  mCachedDisplayInfo=" + mCachedDisplayInfo);
         pw.println("  mScaleFactor=" + mScaleFactor);
-        pw.println("  faceAuthSensorLocationDefault=" + mFaceSensorLocationDefault);
-        pw.println("  faceAuthSensorLocation=" + getFaceSensorLocation());
         pw.println("  fingerprintSensorLocationInNaturalOrientation="
                 + getFingerprintSensorLocationInNaturalOrientation());
         pw.println("  fingerprintSensorLocation=" + getFingerprintSensorLocation());
@@ -1433,11 +1392,5 @@
          * {@link #onFingerprintLocationChanged}.
          */
         default void onUdfpsLocationChanged(UdfpsOverlayParams udfpsOverlayParams) {}
-
-        /**
-         * Called when the location of the face unlock sensor (typically the front facing camera)
-         * changes. The location in pixels can change due to resolution changes.
-         */
-        default void onFaceSensorLocationChanged() {}
     }
 }
diff --git a/packages/SystemUI/src/com/android/systemui/biometrics/AuthRippleController.kt b/packages/SystemUI/src/com/android/systemui/biometrics/AuthRippleController.kt
index 45967c6..86f372a 100644
--- a/packages/SystemUI/src/com/android/systemui/biometrics/AuthRippleController.kt
+++ b/packages/SystemUI/src/com/android/systemui/biometrics/AuthRippleController.kt
@@ -32,6 +32,7 @@
 import com.android.settingslib.Utils
 import com.android.systemui.CoreStartable
 import com.android.systemui.Flags.lightRevealMigration
+import com.android.systemui.biometrics.data.repository.FacePropertyRepository
 import com.android.systemui.biometrics.shared.model.UdfpsOverlayParams
 import com.android.systemui.dagger.SysUISingleton
 import com.android.systemui.deviceentry.shared.DeviceEntryUdfpsRefactor
@@ -80,6 +81,7 @@
     private val logger: KeyguardLogger,
     private val biometricUnlockController: BiometricUnlockController,
     private val lightRevealScrim: LightRevealScrim,
+    private val facePropertyRepository: FacePropertyRepository,
     rippleView: AuthRippleView?
 ) :
     ViewController<AuthRippleView>(rippleView),
@@ -263,7 +265,7 @@
 
     fun updateSensorLocation() {
         fingerprintSensorLocation = authController.fingerprintSensorLocation
-        faceSensorLocation = authController.faceSensorLocation
+        faceSensorLocation = facePropertyRepository.sensorLocation.value
     }
 
     private fun updateRippleColor() {
diff --git a/packages/SystemUI/src/com/android/systemui/biometrics/data/repository/DisplayStateRepository.kt b/packages/SystemUI/src/com/android/systemui/biometrics/data/repository/DisplayStateRepository.kt
index b0143f5..aaccbc1 100644
--- a/packages/SystemUI/src/com/android/systemui/biometrics/data/repository/DisplayStateRepository.kt
+++ b/packages/SystemUI/src/com/android/systemui/biometrics/data/repository/DisplayStateRepository.kt
@@ -22,6 +22,7 @@
 import android.hardware.display.DisplayManager.DisplayListener
 import android.hardware.display.DisplayManager.EVENT_FLAG_DISPLAY_CHANGED
 import android.os.Handler
+import android.util.Size
 import android.view.DisplayInfo
 import com.android.internal.util.ArrayUtils
 import com.android.systemui.biometrics.shared.model.DisplayRotation
@@ -40,6 +41,7 @@
 import kotlinx.coroutines.flow.SharingStarted
 import kotlinx.coroutines.flow.StateFlow
 import kotlinx.coroutines.flow.flowOn
+import kotlinx.coroutines.flow.map
 import kotlinx.coroutines.flow.stateIn
 
 /** Repository for the current state of the display */
@@ -58,6 +60,9 @@
 
     /** Provides the current display rotation */
     val currentRotation: StateFlow<DisplayRotation>
+
+    /** Provides the current display size */
+    val currentDisplaySize: StateFlow<Size>
 }
 
 // TODO(b/296211844): This class could directly use DeviceStateRepository and DisplayRepository
@@ -110,17 +115,13 @@
                 initialValue = false,
             )
 
-    private fun getDisplayRotation(): DisplayRotation {
+    private fun getDisplayInfo(): DisplayInfo {
         val cachedDisplayInfo = DisplayInfo()
         context.display?.getDisplayInfo(cachedDisplayInfo)
-        var rotation = cachedDisplayInfo.rotation
-        if (isReverseDefaultRotation) {
-            rotation = (rotation + 1) % 4
-        }
-        return rotation.toDisplayRotation()
+        return cachedDisplayInfo
     }
 
-    override val currentRotation: StateFlow<DisplayRotation> =
+    private val currentDisplayInfo: StateFlow<DisplayInfo> =
         conflatedCallbackFlow {
                 val callback =
                     object : DisplayListener {
@@ -129,11 +130,11 @@
                         override fun onDisplayAdded(displayId: Int) {}
 
                         override fun onDisplayChanged(displayId: Int) {
-                            val rotation = getDisplayRotation()
+                            val displayInfo = getDisplayInfo()
                             trySendWithFailureLogging(
-                                rotation,
+                                displayInfo,
                                 TAG,
-                                "Error sending display rotation to $rotation"
+                                "Error sending displayInfo to $displayInfo"
                             )
                         }
                     }
@@ -148,7 +149,37 @@
             .stateIn(
                 applicationScope,
                 started = SharingStarted.Eagerly,
-                initialValue = getDisplayRotation(),
+                initialValue = getDisplayInfo(),
+            )
+
+    private fun rotationToDisplayRotation(rotation: Int): DisplayRotation {
+        var adjustedRotation = rotation
+        if (isReverseDefaultRotation) {
+            adjustedRotation = (rotation + 1) % 4
+        }
+        return adjustedRotation.toDisplayRotation()
+    }
+
+    override val currentRotation: StateFlow<DisplayRotation> =
+        currentDisplayInfo
+            .map { rotationToDisplayRotation(it.rotation) }
+            .stateIn(
+                applicationScope,
+                started = SharingStarted.WhileSubscribed(),
+                initialValue = rotationToDisplayRotation(currentDisplayInfo.value.rotation)
+            )
+
+    override val currentDisplaySize: StateFlow<Size> =
+        currentDisplayInfo
+            .map { Size(it.naturalWidth, it.naturalHeight) }
+            .stateIn(
+                applicationScope,
+                started = SharingStarted.WhileSubscribed(),
+                initialValue =
+                    Size(
+                        currentDisplayInfo.value.naturalWidth,
+                        currentDisplayInfo.value.naturalHeight
+                    ),
             )
 
     companion object {
diff --git a/packages/SystemUI/src/com/android/systemui/biometrics/data/repository/FacePropertyRepository.kt b/packages/SystemUI/src/com/android/systemui/biometrics/data/repository/FacePropertyRepository.kt
index 0ae2e16..ae1539e 100644
--- a/packages/SystemUI/src/com/android/systemui/biometrics/data/repository/FacePropertyRepository.kt
+++ b/packages/SystemUI/src/com/android/systemui/biometrics/data/repository/FacePropertyRepository.kt
@@ -17,25 +17,39 @@
 
 package com.android.systemui.biometrics.data.repository
 
+import android.content.Context
+import android.graphics.Point
+import android.hardware.camera2.CameraManager
 import android.hardware.face.FaceManager
 import android.hardware.face.FaceSensorPropertiesInternal
 import android.hardware.face.IFaceAuthenticatorsRegisteredCallback
 import android.util.Log
+import android.util.RotationUtils
+import android.util.Size
+import com.android.systemui.biometrics.shared.model.DisplayRotation
 import com.android.systemui.biometrics.shared.model.LockoutMode
 import com.android.systemui.biometrics.shared.model.SensorStrength
 import com.android.systemui.biometrics.shared.model.toLockoutMode
+import com.android.systemui.biometrics.shared.model.toRotation
 import com.android.systemui.biometrics.shared.model.toSensorStrength
 import com.android.systemui.common.coroutine.ChannelExt.trySendWithFailureLogging
 import com.android.systemui.common.coroutine.ConflatedCallbackFlow
+import com.android.systemui.common.ui.data.repository.ConfigurationRepository
 import com.android.systemui.dagger.SysUISingleton
 import com.android.systemui.dagger.qualifiers.Application
 import com.android.systemui.dagger.qualifiers.Background
+import com.android.systemui.dagger.qualifiers.Main
+import com.android.systemui.res.R
+import java.util.concurrent.Executor
 import javax.inject.Inject
 import kotlinx.coroutines.CoroutineDispatcher
 import kotlinx.coroutines.CoroutineScope
 import kotlinx.coroutines.channels.awaitClose
 import kotlinx.coroutines.flow.SharingStarted
 import kotlinx.coroutines.flow.StateFlow
+import kotlinx.coroutines.flow.combine
+import kotlinx.coroutines.flow.flatMapLatest
+import kotlinx.coroutines.flow.flowOf
 import kotlinx.coroutines.flow.onEach
 import kotlinx.coroutines.flow.stateIn
 import kotlinx.coroutines.withContext
@@ -47,20 +61,38 @@
 
     /** Get the current lockout mode for the user. This makes a binder based service call. */
     suspend fun getLockoutMode(userId: Int): LockoutMode
+
+    /** The current face sensor location in current device rotation */
+    val sensorLocation: StateFlow<Point?>
 }
 
 /** Describes a biometric sensor */
 data class FaceSensorInfo(val id: Int, val strength: SensorStrength)
 
+/** Data class for camera info */
+private data class CameraInfo(
+    /** The logical id of the camera */
+    val cameraId: String,
+    /** The physical id of the camera */
+    val cameraPhysicalId: String?,
+    /** The center point of the camera in natural orientation */
+    val cameraLocation: Point?,
+)
+
 private const val TAG = "FaceSensorPropertyRepositoryImpl"
 
 @SysUISingleton
 class FacePropertyRepositoryImpl
 @Inject
 constructor(
+    @Application val applicationContext: Context,
+    @Main mainExecutor: Executor,
     @Application private val applicationScope: CoroutineScope,
     @Background private val backgroundDispatcher: CoroutineDispatcher,
     private val faceManager: FaceManager?,
+    private val cameraManager: CameraManager,
+    displayStateRepository: DisplayStateRepository,
+    configurationRepository: ConfigurationRepository,
 ) : FacePropertyRepository {
 
     override val sensorInfo: StateFlow<FaceSensorInfo?> =
@@ -89,10 +121,179 @@
             .onEach { Log.d(TAG, "sensorProps changed: $it") }
             .stateIn(applicationScope, SharingStarted.Eagerly, null)
 
+    private val cameraInfoList: List<CameraInfo> = loadCameraInfoList()
+    private var currentPhysicalCameraId: String? = null
+
+    private val defaultSensorLocation: StateFlow<Point?> =
+        ConflatedCallbackFlow.conflatedCallbackFlow {
+                val callback =
+                    object : CameraManager.AvailabilityCallback() {
+
+                        // This callback will only be called when there is more than one front
+                        // camera on the device (e.g. foldable device with cameras on both outer &
+                        // inner display).
+                        override fun onPhysicalCameraAvailable(
+                            cameraId: String,
+                            physicalCameraId: String
+                        ) {
+                            currentPhysicalCameraId = physicalCameraId
+                            val cameraInfo =
+                                cameraInfoList.firstOrNull {
+                                    physicalCameraId == it.cameraPhysicalId
+                                }
+                            trySendWithFailureLogging(
+                                cameraInfo?.cameraLocation,
+                                TAG,
+                                "Update face sensor location to $cameraInfo."
+                            )
+                        }
+
+                        // This callback will only be called when there is more than one front
+                        // camera on the device (e.g. foldable device with cameras on both outer &
+                        // inner display).
+                        //
+                        // By default, all cameras are available which means there will be no
+                        // onPhysicalCameraAvailable() invoked and depending on the device state
+                        // (Fold or unfold), only the onPhysicalCameraUnavailable() for another
+                        // camera will be invoke. So we need to use this method to decide the
+                        // initial physical ID for foldable devices.
+                        override fun onPhysicalCameraUnavailable(
+                            cameraId: String,
+                            physicalCameraId: String
+                        ) {
+                            if (currentPhysicalCameraId == null) {
+                                val cameraInfo =
+                                    cameraInfoList.firstOrNull {
+                                        physicalCameraId != it.cameraPhysicalId
+                                    }
+                                currentPhysicalCameraId = cameraInfo?.cameraPhysicalId
+                                trySendWithFailureLogging(
+                                    cameraInfo?.cameraLocation,
+                                    TAG,
+                                    "Update face sensor location to $cameraInfo."
+                                )
+                            }
+                        }
+                    }
+                cameraManager.registerAvailabilityCallback(mainExecutor, callback)
+                awaitClose { cameraManager.unregisterAvailabilityCallback(callback) }
+            }
+            .stateIn(
+                applicationScope,
+                started = SharingStarted.WhileSubscribed(),
+                initialValue =
+                    if (cameraInfoList.isNotEmpty()) cameraInfoList[0].cameraLocation else null
+            )
+
+    override val sensorLocation: StateFlow<Point?> =
+        sensorInfo
+            .flatMapLatest { info ->
+                if (info == null) {
+                    flowOf(null)
+                } else {
+                    combine(
+                        defaultSensorLocation,
+                        displayStateRepository.currentRotation,
+                        displayStateRepository.currentDisplaySize,
+                        configurationRepository.scaleForResolution
+                    ) { defaultLocation, displayRotation, displaySize, scaleForResolution ->
+                        computeCurrentFaceLocation(
+                            defaultLocation,
+                            displayRotation,
+                            displaySize,
+                            scaleForResolution
+                        )
+                    }
+                }
+            }
+            .stateIn(
+                applicationScope,
+                started = SharingStarted.WhileSubscribed(),
+                initialValue = null
+            )
+
+    private fun computeCurrentFaceLocation(
+        defaultLocation: Point?,
+        rotation: DisplayRotation,
+        displaySize: Size,
+        scaleForResolution: Float,
+    ): Point? {
+        if (defaultLocation == null) {
+            return null
+        }
+
+        return rotateToCurrentOrientation(
+            Point(
+                (defaultLocation.x * scaleForResolution).toInt(),
+                (defaultLocation.y * scaleForResolution).toInt()
+            ),
+            rotation,
+            displaySize
+        )
+    }
+
+    private fun rotateToCurrentOrientation(
+        inOutPoint: Point,
+        rotation: DisplayRotation,
+        displaySize: Size
+    ): Point {
+        RotationUtils.rotatePoint(
+            inOutPoint,
+            rotation.toRotation(),
+            displaySize.width,
+            displaySize.height
+        )
+        return inOutPoint
+    }
     override suspend fun getLockoutMode(userId: Int): LockoutMode {
         if (sensorInfo.value == null || faceManager == null) {
             return LockoutMode.NONE
         }
         return faceManager.getLockoutModeForUser(sensorInfo.value!!.id, userId).toLockoutMode()
     }
+
+    private fun loadCameraInfoList(): List<CameraInfo> {
+        val list = mutableListOf<CameraInfo>()
+
+        val outer =
+            loadCameraInfo(
+                R.string.config_protectedCameraId,
+                R.string.config_protectedPhysicalCameraId,
+                R.array.config_face_auth_props
+            )
+        if (outer != null) {
+            list.add(outer)
+        }
+
+        val inner =
+            loadCameraInfo(
+                R.string.config_protectedInnerCameraId,
+                R.string.config_protectedInnerPhysicalCameraId,
+                R.array.config_inner_face_auth_props
+            )
+        if (inner != null) {
+            list.add(inner)
+        }
+        return list
+    }
+
+    private fun loadCameraInfo(
+        cameraIdRes: Int,
+        cameraPhysicalIdRes: Int,
+        cameraLocationRes: Int
+    ): CameraInfo? {
+        val cameraId = applicationContext.getString(cameraIdRes)
+        if (cameraId.isNullOrEmpty()) {
+            return null
+        }
+        val physicalCameraId = applicationContext.getString(cameraPhysicalIdRes)
+        val cameraLocation: IntArray = applicationContext.resources.getIntArray(cameraLocationRes)
+        val location: Point?
+        if (cameraLocation.size < 2) {
+            location = null
+        } else {
+            location = Point(cameraLocation[0], cameraLocation[1])
+        }
+        return CameraInfo(cameraId, physicalCameraId, location)
+    }
 }
diff --git a/packages/SystemUI/src/com/android/systemui/communal/data/model/CommunalMediaModel.kt b/packages/SystemUI/src/com/android/systemui/communal/data/model/CommunalMediaModel.kt
new file mode 100644
index 0000000..cf2e33c
--- /dev/null
+++ b/packages/SystemUI/src/com/android/systemui/communal/data/model/CommunalMediaModel.kt
@@ -0,0 +1,30 @@
+/*
+ * Copyright (C) 2024 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.systemui.communal.data.model
+
+/** Data model of media on the communal hub. */
+data class CommunalMediaModel(
+    val hasAnyMediaOrRecommendation: Boolean,
+    val createdTimestampMillis: Long = 0L,
+) {
+    companion object {
+        val INACTIVE =
+            CommunalMediaModel(
+                hasAnyMediaOrRecommendation = false,
+            )
+    }
+}
diff --git a/packages/SystemUI/src/com/android/systemui/communal/data/repository/CommunalMediaRepository.kt b/packages/SystemUI/src/com/android/systemui/communal/data/repository/CommunalMediaRepository.kt
index e41c322..e8a561b 100644
--- a/packages/SystemUI/src/com/android/systemui/communal/data/repository/CommunalMediaRepository.kt
+++ b/packages/SystemUI/src/com/android/systemui/communal/data/repository/CommunalMediaRepository.kt
@@ -16,18 +16,17 @@
 
 package com.android.systemui.communal.data.repository
 
+import com.android.systemui.communal.data.model.CommunalMediaModel
 import com.android.systemui.dagger.SysUISingleton
 import com.android.systemui.media.controls.models.player.MediaData
 import com.android.systemui.media.controls.pipeline.MediaDataManager
 import javax.inject.Inject
 import kotlinx.coroutines.flow.Flow
 import kotlinx.coroutines.flow.MutableStateFlow
-import kotlinx.coroutines.flow.onCompletion
-import kotlinx.coroutines.flow.onStart
 
 /** Encapsulates the state of smartspace in communal. */
 interface CommunalMediaRepository {
-    val mediaPlaying: Flow<Boolean>
+    val mediaModel: Flow<CommunalMediaModel>
 }
 
 @SysUISingleton
@@ -47,27 +46,32 @@
                 receivedSmartspaceCardLatency: Int,
                 isSsReactivated: Boolean
             ) {
-                if (!mediaDataManager.hasAnyMediaOrRecommendation()) {
-                    return
-                }
-                _mediaPlaying.value = true
+                updateMediaModel(data)
             }
 
             override fun onMediaDataRemoved(key: String) {
-                if (mediaDataManager.hasAnyMediaOrRecommendation()) {
-                    return
-                }
-                _mediaPlaying.value = false
+                updateMediaModel()
             }
         }
 
-    private val _mediaPlaying: MutableStateFlow<Boolean> = MutableStateFlow(false)
+    init {
+        mediaDataManager.addListener(mediaDataListener)
+    }
 
-    override val mediaPlaying: Flow<Boolean> =
-        _mediaPlaying
-            .onStart {
-                mediaDataManager.addListener(mediaDataListener)
-                _mediaPlaying.value = mediaDataManager.hasAnyMediaOrRecommendation()
-            }
-            .onCompletion { mediaDataManager.removeListener(mediaDataListener) }
+    private val _mediaModel: MutableStateFlow<CommunalMediaModel> =
+        MutableStateFlow(CommunalMediaModel.INACTIVE)
+
+    override val mediaModel: Flow<CommunalMediaModel> = _mediaModel
+
+    private fun updateMediaModel(data: MediaData? = null) {
+        if (mediaDataManager.hasAnyMediaOrRecommendation()) {
+            _mediaModel.value =
+                CommunalMediaModel(
+                    hasAnyMediaOrRecommendation = true,
+                    createdTimestampMillis = data?.createdTimestampMillis ?: 0L,
+                )
+        } else {
+            _mediaModel.value = CommunalMediaModel.INACTIVE
+        }
+    }
 }
diff --git a/packages/SystemUI/src/com/android/systemui/communal/data/repository/CommunalRepository.kt b/packages/SystemUI/src/com/android/systemui/communal/data/repository/CommunalRepository.kt
index 1f4be40..553b3eb 100644
--- a/packages/SystemUI/src/com/android/systemui/communal/data/repository/CommunalRepository.kt
+++ b/packages/SystemUI/src/com/android/systemui/communal/data/repository/CommunalRepository.kt
@@ -56,6 +56,9 @@
     /** Exposes the transition state of the communal [SceneTransitionLayout]. */
     val transitionState: StateFlow<ObservableCommunalTransitionState>
 
+    /** Whether the CTA tile is visible in the hub under view mode. */
+    val isCtaTileInViewModeVisible: Flow<Boolean>
+
     /** Updates the requested scene. */
     fun setDesiredScene(desiredScene: CommunalSceneKey)
 
@@ -65,6 +68,9 @@
      * Note that you must call is with `null` when the UI is done or risk a memory leak.
      */
     fun setTransitionState(transitionState: Flow<ObservableCommunalTransitionState>?)
+
+    /** Updates whether to display the CTA tile in the hub under view mode. */
+    fun setCtaTileInViewModeVisibility(isVisible: Boolean)
 }
 
 @OptIn(ExperimentalCoroutinesApi::class)
@@ -96,6 +102,16 @@
                 initialValue = defaultTransitionState,
             )
 
+    // TODO(b/313462210) - persist the value in local storage, so the tile won't show up again
+    //  once dismissed.
+    private val _isCtaTileInViewModeVisible: MutableStateFlow<Boolean> = MutableStateFlow(true)
+    override val isCtaTileInViewModeVisible: Flow<Boolean> =
+        _isCtaTileInViewModeVisible.asStateFlow()
+
+    override fun setCtaTileInViewModeVisibility(isVisible: Boolean) {
+        _isCtaTileInViewModeVisible.value = isVisible
+    }
+
     override fun setDesiredScene(desiredScene: CommunalSceneKey) {
         _desiredScene.value = desiredScene
     }
diff --git a/packages/SystemUI/src/com/android/systemui/communal/data/repository/CommunalWidgetRepository.kt b/packages/SystemUI/src/com/android/systemui/communal/data/repository/CommunalWidgetRepository.kt
index cab8adf..e6816e9 100644
--- a/packages/SystemUI/src/com/android/systemui/communal/data/repository/CommunalWidgetRepository.kt
+++ b/packages/SystemUI/src/com/android/systemui/communal/data/repository/CommunalWidgetRepository.kt
@@ -18,14 +18,12 @@
 
 import android.appwidget.AppWidgetHost
 import android.appwidget.AppWidgetManager
-import android.content.BroadcastReceiver
 import android.content.ComponentName
-import android.content.Context
 import android.content.Intent
 import android.content.IntentFilter
 import android.os.UserManager
+import androidx.annotation.WorkerThread
 import com.android.systemui.broadcast.BroadcastDispatcher
-import com.android.systemui.common.coroutine.ChannelExt.trySendWithFailureLogging
 import com.android.systemui.communal.data.db.CommunalItemRank
 import com.android.systemui.communal.data.db.CommunalWidgetDao
 import com.android.systemui.communal.data.db.CommunalWidgetItem
@@ -40,17 +38,21 @@
 import com.android.systemui.settings.UserTracker
 import java.util.Optional
 import javax.inject.Inject
+import kotlin.coroutines.cancellation.CancellationException
 import kotlinx.coroutines.CoroutineDispatcher
 import kotlinx.coroutines.CoroutineScope
 import kotlinx.coroutines.ExperimentalCoroutinesApi
-import kotlinx.coroutines.channels.awaitClose
 import kotlinx.coroutines.flow.Flow
-import kotlinx.coroutines.flow.callbackFlow
 import kotlinx.coroutines.flow.distinctUntilChanged
+import kotlinx.coroutines.flow.emptyFlow
 import kotlinx.coroutines.flow.flatMapLatest
 import kotlinx.coroutines.flow.flowOf
+import kotlinx.coroutines.flow.flowOn
 import kotlinx.coroutines.flow.map
+import kotlinx.coroutines.flow.mapLatest
+import kotlinx.coroutines.flow.onStart
 import kotlinx.coroutines.launch
+import kotlinx.coroutines.withContext
 
 /** Encapsulates the state of widgets for communal mode. */
 interface CommunalWidgetRepository {
@@ -58,7 +60,11 @@
     val communalWidgets: Flow<List<CommunalWidgetContentModel>>
 
     /** Add a widget at the specified position in the app widget service and the database. */
-    fun addWidget(provider: ComponentName, priority: Int) {}
+    fun addWidget(
+        provider: ComponentName,
+        priority: Int,
+        configureWidget: suspend (id: Int) -> Boolean
+    ) {}
 
     /** Delete a widget by id from app widget service and the database. */
     fun deleteWidget(widgetId: Int) {}
@@ -97,37 +103,22 @@
     // Whether the [AppWidgetHost] is listening for updates.
     private var isHostListening = false
 
+    private suspend fun isUserUnlockingOrUnlocked(): Boolean =
+        withContext(bgDispatcher) { userManager.isUserUnlockingOrUnlocked(userTracker.userHandle) }
+
     private val isUserUnlocked: Flow<Boolean> =
-        callbackFlow {
-                if (!communalRepository.isCommunalEnabled) {
-                    awaitClose()
-                }
-
-                fun isUserUnlockingOrUnlocked(): Boolean {
-                    return userManager.isUserUnlockingOrUnlocked(userTracker.userHandle)
-                }
-
-                fun send() {
-                    trySendWithFailureLogging(isUserUnlockingOrUnlocked(), TAG)
-                }
-
-                if (isUserUnlockingOrUnlocked()) {
-                    send()
-                    awaitClose()
+        flowOf(communalRepository.isCommunalEnabled)
+            .flatMapLatest { enabled ->
+                if (enabled) {
+                    broadcastDispatcher
+                        .broadcastFlow(
+                            filter = IntentFilter(Intent.ACTION_USER_UNLOCKED),
+                            user = userTracker.userHandle
+                        )
+                        .onStart { emit(Unit) }
+                        .mapLatest { isUserUnlockingOrUnlocked() }
                 } else {
-                    val receiver =
-                        object : BroadcastReceiver() {
-                            override fun onReceive(context: Context?, intent: Intent?) {
-                                send()
-                            }
-                        }
-
-                    broadcastDispatcher.registerReceiver(
-                        receiver,
-                        IntentFilter(Intent.ACTION_USER_UNLOCKED),
-                    )
-
-                    awaitClose { broadcastDispatcher.unregisterReceiver(receiver) }
+                    emptyFlow()
                 }
             }
             .distinctUntilChanged()
@@ -148,18 +139,52 @@
             if (!isHostActive || !appWidgetManager.isPresent) {
                 return@flatMapLatest flowOf(emptyList())
             }
-            communalWidgetDao.getWidgets().map { it.map(::mapToContentModel) }
+            communalWidgetDao
+                .getWidgets()
+                .map { it.map(::mapToContentModel) }
+                // As this reads from a database and triggers IPCs to AppWidgetManager,
+                // it should be executed in the background.
+                .flowOn(bgDispatcher)
         }
 
-    override fun addWidget(provider: ComponentName, priority: Int) {
+    override fun addWidget(
+        provider: ComponentName,
+        priority: Int,
+        configureWidget: suspend (id: Int) -> Boolean
+    ) {
         applicationScope.launch(bgDispatcher) {
             val id = communalWidgetHost.allocateIdAndBindWidget(provider)
-            id?.let {
-                communalWidgetDao.addWidget(
-                    widgetId = it,
-                    provider = provider,
-                    priority = priority,
-                )
+            if (id != null) {
+                val configured =
+                    if (communalWidgetHost.requiresConfiguration(id)) {
+                        logger.i("Widget ${provider.flattenToString()} requires configuration.")
+                        try {
+                            configureWidget.invoke(id)
+                        } catch (ex: Exception) {
+                            // Cleanup the app widget id if an error happens during configuration.
+                            logger.e("Error during widget configuration, cleaning up id $id", ex)
+                            if (ex is CancellationException) {
+                                appWidgetHost.deleteAppWidgetId(id)
+                                // Re-throw cancellation to ensure the parent coroutine also gets
+                                // cancelled.
+                                throw ex
+                            } else {
+                                false
+                            }
+                        }
+                    } else {
+                        logger.i("Skipping configuration for ${provider.flattenToString()}")
+                        true
+                    }
+                if (configured) {
+                    communalWidgetDao.addWidget(
+                        widgetId = id,
+                        provider = provider,
+                        priority = priority,
+                    )
+                } else {
+                    appWidgetHost.deleteAppWidgetId(id)
+                }
             }
             logger.i("Added widget ${provider.flattenToString()} at position $priority.")
         }
@@ -182,6 +207,7 @@
         }
     }
 
+    @WorkerThread
     private fun mapToContentModel(
         entry: Map.Entry<CommunalItemRank, CommunalWidgetItem>
     ): CommunalWidgetContentModel {
diff --git a/packages/SystemUI/src/com/android/systemui/communal/domain/interactor/CommunalInteractor.kt b/packages/SystemUI/src/com/android/systemui/communal/domain/interactor/CommunalInteractor.kt
index 18fb895..24d4c6c 100644
--- a/packages/SystemUI/src/com/android/systemui/communal/domain/interactor/CommunalInteractor.kt
+++ b/packages/SystemUI/src/com/android/systemui/communal/domain/interactor/CommunalInteractor.kt
@@ -34,15 +34,13 @@
 import com.android.systemui.keyguard.domain.interactor.KeyguardInteractor
 import com.android.systemui.smartspace.data.repository.SmartspaceRepository
 import javax.inject.Inject
-import kotlinx.coroutines.ExperimentalCoroutinesApi
 import kotlinx.coroutines.flow.Flow
 import kotlinx.coroutines.flow.StateFlow
-import kotlinx.coroutines.flow.flatMapLatest
+import kotlinx.coroutines.flow.combine
 import kotlinx.coroutines.flow.flowOf
 import kotlinx.coroutines.flow.map
 
 /** Encapsulates business-logic related to communal mode. */
-@OptIn(ExperimentalCoroutinesApi::class)
 @SysUISingleton
 class CommunalInteractor
 @Inject
@@ -98,9 +96,20 @@
         editWidgetsActivityStarter.startActivity()
     }
 
-    /** Add a widget at the specified position. */
-    fun addWidget(componentName: ComponentName, priority: Int) =
-        widgetRepository.addWidget(componentName, priority)
+    /** Dismiss the CTA tile from the hub in view mode. */
+    fun dismissCtaTile() = communalRepository.setCtaTileInViewModeVisibility(isVisible = false)
+
+    /**
+     * Add a widget at the specified position.
+     *
+     * @param configureWidget The callback to trigger if widget configuration is needed. Should
+     *   return whether configuration was successful.
+     */
+    fun addWidget(
+        componentName: ComponentName,
+        priority: Int,
+        configureWidget: suspend (id: Int) -> Boolean
+    ) = widgetRepository.addWidget(componentName, priority, configureWidget)
 
     /** Delete a widget by id. */
     fun deleteWidget(id: Int) = widgetRepository.deleteWidget(id)
@@ -125,27 +134,25 @@
             }
         }
 
-    /** A flow of available smartspace content. Currently only showing timer targets. */
-    val smartspaceContent: Flow<List<CommunalContentModel.Smartspace>> =
+    /** A flow of available smartspace targets. Currently only showing timers. */
+    private val smartspaceTargets: Flow<List<SmartspaceTarget>> =
         if (!smartspaceRepository.isSmartspaceRemoteViewsEnabled) {
             flowOf(emptyList())
         } else {
             smartspaceRepository.communalSmartspaceTargets.map { targets ->
-                targets
-                    .filter { target ->
-                        target.featureType == SmartspaceTarget.FEATURE_TIMER &&
-                            target.remoteViews != null
-                    }
-                    .mapIndexed Target@{ index, target ->
-                        return@Target CommunalContentModel.Smartspace(
-                            smartspaceTargetId = target.smartspaceTargetId,
-                            remoteViews = target.remoteViews!!,
-                            size = dynamicContentSize(targets.size, index),
-                        )
-                    }
+                targets.filter { target ->
+                    target.featureType == SmartspaceTarget.FEATURE_TIMER &&
+                        target.remoteViews != null
+                }
             }
         }
 
+    /** CTA tile to be displayed in the glanceable hub (view mode). */
+    val ctaTileContent: Flow<List<CommunalContentModel.CtaTileInViewMode>> =
+        communalRepository.isCtaTileInViewModeVisible.map { visible ->
+            if (visible) listOf(CommunalContentModel.CtaTileInViewMode()) else emptyList()
+        }
+
     /** A list of tutorial content to be displayed in the communal hub in tutorial mode. */
     val tutorialContent: List<CommunalContentModel.Tutorial> =
         listOf(
@@ -159,14 +166,43 @@
             CommunalContentModel.Tutorial(id = 7, HALF),
         )
 
-    val umoContent: Flow<List<CommunalContentModel.Umo>> =
-        mediaRepository.mediaPlaying.flatMapLatest { mediaPlaying ->
-            if (mediaPlaying) {
-                // TODO(b/310254801): support HALF and FULL layouts
-                flowOf(listOf(CommunalContentModel.Umo(THIRD)))
-            } else {
-                flowOf(emptyList())
+    /**
+     * A flow of ongoing content, including smartspace timers and umo, ordered by creation time and
+     * sized dynamically.
+     */
+    val ongoingContent: Flow<List<CommunalContentModel.Ongoing>> =
+        combine(smartspaceTargets, mediaRepository.mediaModel) { smartspace, media ->
+            val ongoingContent = mutableListOf<CommunalContentModel.Ongoing>()
+
+            // Add smartspace
+            ongoingContent.addAll(
+                smartspace.map { target ->
+                    CommunalContentModel.Smartspace(
+                        smartspaceTargetId = target.smartspaceTargetId,
+                        remoteViews = target.remoteViews!!,
+                        createdTimestampMillis = target.creationTimeMillis,
+                    )
+                }
+            )
+
+            // Add UMO
+            if (media.hasAnyMediaOrRecommendation) {
+                ongoingContent.add(
+                    CommunalContentModel.Umo(
+                        createdTimestampMillis = media.createdTimestampMillis,
+                    )
+                )
             }
+
+            // Order by creation time descending
+            ongoingContent.sortByDescending { it.createdTimestampMillis }
+
+            // Dynamic sizing
+            ongoingContent.forEachIndexed { index, model ->
+                model.size = dynamicContentSize(ongoingContent.size, index)
+            }
+
+            return@combine ongoingContent
         }
 
     companion object {
diff --git a/packages/SystemUI/src/com/android/systemui/communal/domain/model/CommunalContentModel.kt b/packages/SystemUI/src/com/android/systemui/communal/domain/model/CommunalContentModel.kt
index 3ae5229..46f957f 100644
--- a/packages/SystemUI/src/com/android/systemui/communal/domain/model/CommunalContentModel.kt
+++ b/packages/SystemUI/src/com/android/systemui/communal/domain/model/CommunalContentModel.kt
@@ -30,46 +30,95 @@
     /** Size to be rendered in the grid. */
     val size: CommunalContentSize
 
+    /**
+     * A type of communal content is ongoing / live / ephemeral, and can be sized and ordered
+     * dynamically.
+     */
+    sealed interface Ongoing : CommunalContentModel {
+        override var size: CommunalContentSize
+
+        /** Timestamp in milliseconds of when the content was created. */
+        val createdTimestampMillis: Long
+    }
+
     class Widget(
         val appWidgetId: Int,
         val providerInfo: AppWidgetProviderInfo,
         val appWidgetHost: AppWidgetHost,
     ) : CommunalContentModel {
-        override val key = "widget_$appWidgetId"
+        override val key = KEY.widget(appWidgetId)
         // Widget size is always half.
         override val size = CommunalContentSize.HALF
     }
 
     /** A placeholder item representing a new widget being added */
     class WidgetPlaceholder : CommunalContentModel {
-        override val key: String = "widget_placeholder_${UUID.randomUUID()}"
+        override val key: String = KEY.widgetPlaceholder()
+        // Same as widget size.
+        override val size = CommunalContentSize.HALF
+    }
+
+    /** A CTA tile in the glanceable hub view mode which can be dismissed. */
+    class CtaTileInViewMode : CommunalContentModel {
+        override val key: String = KEY.CTA_TILE_IN_VIEW_MODE_KEY
+        // Same as widget size.
+        override val size = CommunalContentSize.HALF
+    }
+
+    /** A CTA tile in the glanceable hub edit model which remains visible in the grid. */
+    class CtaTileInEditMode : CommunalContentModel {
+        override val key: String = KEY.CTA_TILE_IN_EDIT_MODE_KEY
         // Same as widget size.
         override val size = CommunalContentSize.HALF
     }
 
     class Tutorial(
         id: Int,
-        override val size: CommunalContentSize,
+        override var size: CommunalContentSize,
     ) : CommunalContentModel {
-        override val key = "tutorial_$id"
+        override val key = KEY.tutorial(id)
     }
 
     class Smartspace(
         smartspaceTargetId: String,
         val remoteViews: RemoteViews,
-        override val size: CommunalContentSize,
-    ) : CommunalContentModel {
-        override val key = "smartspace_$smartspaceTargetId"
+        override val createdTimestampMillis: Long,
+        override var size: CommunalContentSize = CommunalContentSize.HALF,
+    ) : Ongoing {
+        override val key = KEY.smartspace(smartspaceTargetId)
     }
 
     class Umo(
-        override val size: CommunalContentSize,
-    ) : CommunalContentModel {
-        override val key = UMO_KEY
+        override val createdTimestampMillis: Long,
+        override var size: CommunalContentSize = CommunalContentSize.HALF,
+    ) : Ongoing {
+        override val key = KEY.umo()
     }
 
-    companion object {
-        /** Key for the [Umo] in CommunalContentModel. There should only ever be one UMO. */
-        const val UMO_KEY = "umo"
+    class KEY {
+        companion object {
+            const val CTA_TILE_IN_VIEW_MODE_KEY = "cta_tile_in_view_mode"
+            const val CTA_TILE_IN_EDIT_MODE_KEY = "cta_tile_in_edit_mode"
+
+            fun widget(id: Int): String {
+                return "widget_$id"
+            }
+
+            fun widgetPlaceholder(): String {
+                return "widget_placeholder_${UUID.randomUUID()}"
+            }
+
+            fun tutorial(id: Int): String {
+                return "tutorial_$id"
+            }
+
+            fun smartspace(id: String): String {
+                return "smartspace_$id"
+            }
+
+            fun umo(): String {
+                return "umo"
+            }
+        }
     }
 }
diff --git a/packages/SystemUI/src/com/android/systemui/communal/shared/CommunalWidgetHost.kt b/packages/SystemUI/src/com/android/systemui/communal/shared/CommunalWidgetHost.kt
index 155de32..41f9cb4 100644
--- a/packages/SystemUI/src/com/android/systemui/communal/shared/CommunalWidgetHost.kt
+++ b/packages/SystemUI/src/com/android/systemui/communal/shared/CommunalWidgetHost.kt
@@ -18,6 +18,8 @@
 
 import android.appwidget.AppWidgetHost
 import android.appwidget.AppWidgetManager
+import android.appwidget.AppWidgetProviderInfo.WIDGET_FEATURE_CONFIGURATION_OPTIONAL
+import android.appwidget.AppWidgetProviderInfo.WIDGET_FEATURE_RECONFIGURABLE
 import android.content.ComponentName
 import com.android.systemui.log.LogBuffer
 import com.android.systemui.log.core.Logger
@@ -63,4 +65,23 @@
         }
         return false
     }
+
+    /**
+     * Returns whether a particular widget requires configuration when it is first added.
+     *
+     * Must be called after the widget id has been bound.
+     */
+    fun requiresConfiguration(widgetId: Int): Boolean {
+        if (appWidgetManager.isPresent) {
+            val widgetInfo = appWidgetManager.get().getAppWidgetInfo(widgetId)
+            val featureFlags: Int = widgetInfo.widgetFeatures
+            // A widget's configuration is optional only if it's configuration is marked as optional
+            // AND it can be reconfigured later.
+            val configurationOptional =
+                (featureFlags and WIDGET_FEATURE_CONFIGURATION_OPTIONAL != 0 &&
+                    featureFlags and WIDGET_FEATURE_RECONFIGURABLE != 0)
+            return widgetInfo.configure != null && !configurationOptional
+        }
+        return false
+    }
 }
diff --git a/packages/SystemUI/src/com/android/systemui/communal/shared/log/CommunalUiEvent.kt b/packages/SystemUI/src/com/android/systemui/communal/shared/log/CommunalUiEvent.kt
new file mode 100644
index 0000000..e167f3e
--- /dev/null
+++ b/packages/SystemUI/src/com/android/systemui/communal/shared/log/CommunalUiEvent.kt
@@ -0,0 +1,63 @@
+/*
+ * Copyright (C) 2024 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.systemui.communal.shared.log
+
+import com.android.internal.logging.UiEvent
+import com.android.internal.logging.UiEventLogger.UiEventEnum
+
+/** UI events for the Communal Hub. */
+enum class CommunalUiEvent(private val id: Int) : UiEventEnum {
+    @UiEvent(doc = "Communal Hub is fully shown") COMMUNAL_HUB_SHOWN(1566),
+    @UiEvent(doc = "Communal Hub starts entering") COMMUNAL_HUB_ENTERING(1575),
+    @UiEvent(doc = "Communal Hub starts exiting") COMMUNAL_HUB_EXITING(1576),
+    @UiEvent(doc = "Communal Hub is fully gone") COMMUNAL_HUB_GONE(1577),
+    @UiEvent(doc = "Communal Hub times out") COMMUNAL_HUB_TIMEOUT(1578),
+    @UiEvent(doc = "The visible content in the Communal Hub is fully loaded and rendered")
+    COMMUNAL_HUB_LOADED(1579),
+    @UiEvent(doc = "User starts the swipe gesture to enter the Communal Hub")
+    COMMUNAL_HUB_SWIPE_TO_ENTER_START(1580),
+    @UiEvent(doc = "User finishes the swipe gesture to enter the Communal Hub")
+    COMMUNAL_HUB_SWIPE_TO_ENTER_FINISH(1581),
+    @UiEvent(doc = "User cancels the swipe gesture to enter the Communal Hub")
+    COMMUNAL_HUB_SWIPE_TO_ENTER_CANCEL(1582),
+    @UiEvent(doc = "User starts the swipe gesture to exit the Communal Hub")
+    COMMUNAL_HUB_SWIPE_TO_EXIT_START(1583),
+    @UiEvent(doc = "User finishes the swipe gesture to exit the Communal Hub")
+    COMMUNAL_HUB_SWIPE_TO_EXIT_FINISH(1584),
+    @UiEvent(doc = "User cancels the swipe gesture to exit the Communal Hub")
+    COMMUNAL_HUB_SWIPE_TO_EXIT_CANCEL(1585),
+    @UiEvent(doc = "User starts the drag gesture to reorder a widget")
+    COMMUNAL_HUB_REORDER_WIDGET_START(1586),
+    @UiEvent(doc = "User finishes the drag gesture to reorder a widget")
+    COMMUNAL_HUB_REORDER_WIDGET_FINISH(1587),
+    @UiEvent(doc = "User cancels the drag gesture to reorder a widget")
+    COMMUNAL_HUB_REORDER_WIDGET_CANCEL(1588),
+    @UiEvent(doc = "Edit mode for the Communal Hub is shown") COMMUNAL_HUB_EDIT_MODE_SHOWN(1569),
+    @UiEvent(doc = "Edit mode for the Communal Hub is gone") COMMUNAL_HUB_EDIT_MODE_GONE(1589),
+    @UiEvent(doc = "Widget picker for the Communal Hub is shown")
+    COMMUNAL_HUB_WIDGET_PICKER_SHOWN(1590),
+    @UiEvent(doc = "Widget picker for the Communal Hub is gone")
+    COMMUNAL_HUB_WIDGET_PICKER_GONE(1591),
+    @UiEvent(doc = "User performs a swipe up gesture from bottom to enter bouncer")
+    COMMUNAL_HUB_SWIPE_UP_TO_BOUNCER(1573),
+    @UiEvent(doc = "User performs a swipe down gesture from top to enter shade")
+    COMMUNAL_HUB_SWIPE_DOWN_TO_SHADE(1574);
+
+    override fun getId(): Int {
+        return id
+    }
+}
diff --git a/packages/SystemUI/src/com/android/systemui/communal/ui/viewmodel/BaseCommunalViewModel.kt b/packages/SystemUI/src/com/android/systemui/communal/ui/viewmodel/BaseCommunalViewModel.kt
index c34a8df..97e530a 100644
--- a/packages/SystemUI/src/com/android/systemui/communal/ui/viewmodel/BaseCommunalViewModel.kt
+++ b/packages/SystemUI/src/com/android/systemui/communal/ui/viewmodel/BaseCommunalViewModel.kt
@@ -58,8 +58,16 @@
     /**
      * Called when a widget is added via drag and drop from the widget picker into the communal hub.
      */
-    fun onAddWidget(componentName: ComponentName, priority: Int) {
-        communalInteractor.addWidget(componentName, priority)
+    open fun onAddWidget(componentName: ComponentName, priority: Int) {
+        communalInteractor.addWidget(componentName, priority, ::configureWidget)
+    }
+
+    /**
+     * Called when a widget needs to be configured, with the id of the widget. The return value
+     * should represent whether configuring the widget was successful.
+     */
+    protected open suspend fun configureWidget(widgetId: Int): Boolean {
+        return true
     }
 
     // TODO(b/308813166): remove once CommunalContainer is moved lower in z-order and doesn't block
@@ -103,6 +111,9 @@
     /** Called as the UI requests opening the widget editor. */
     open fun onOpenWidgetEditor() {}
 
+    /** Called as the UI requests to dismiss the CTA tile. */
+    open fun onDismissCtaTile() {}
+
     /** Gets the interaction handler used to handle taps on a remote view */
     abstract fun getInteractionHandler(): RemoteViews.InteractionHandler
 }
diff --git a/packages/SystemUI/src/com/android/systemui/communal/ui/viewmodel/CommunalEditModeViewModel.kt b/packages/SystemUI/src/com/android/systemui/communal/ui/viewmodel/CommunalEditModeViewModel.kt
index da7bd34..a03e6c1 100644
--- a/packages/SystemUI/src/com/android/systemui/communal/ui/viewmodel/CommunalEditModeViewModel.kt
+++ b/packages/SystemUI/src/com/android/systemui/communal/ui/viewmodel/CommunalEditModeViewModel.kt
@@ -16,6 +16,13 @@
 
 package com.android.systemui.communal.ui.viewmodel
 
+import android.app.Activity
+import android.app.Activity.RESULT_CANCELED
+import android.app.Activity.RESULT_OK
+import android.app.ActivityOptions
+import android.appwidget.AppWidgetHost
+import android.content.ActivityNotFoundException
+import android.content.ComponentName
 import android.os.PowerManager
 import android.widget.RemoteViews
 import com.android.systemui.communal.domain.interactor.CommunalInteractor
@@ -24,10 +31,14 @@
 import com.android.systemui.media.controls.ui.MediaHost
 import com.android.systemui.media.dagger.MediaModule
 import com.android.systemui.shade.ShadeViewController
+import com.android.systemui.util.nullableAtomicReference
 import javax.inject.Inject
 import javax.inject.Named
 import javax.inject.Provider
+import kotlinx.coroutines.CompletableDeferred
 import kotlinx.coroutines.flow.Flow
+import kotlinx.coroutines.flow.MutableSharedFlow
+import kotlinx.coroutines.flow.map
 
 /** The view model for communal hub in edit mode. */
 @SysUISingleton
@@ -35,16 +46,34 @@
 @Inject
 constructor(
     private val communalInteractor: CommunalInteractor,
+    private val appWidgetHost: AppWidgetHost,
     shadeViewController: Provider<ShadeViewController>,
     powerManager: PowerManager,
     @Named(MediaModule.COMMUNAL_HUB) mediaHost: MediaHost,
 ) : BaseCommunalViewModel(communalInteractor, shadeViewController, powerManager, mediaHost) {
 
+    private companion object {
+        private const val KEY_SPLASH_SCREEN_STYLE = "android.activity.splashScreenStyle"
+        private const val SPLASH_SCREEN_STYLE_EMPTY = 0
+    }
+
+    private val _widgetsToConfigure = MutableSharedFlow<Int>()
+
+    /**
+     * Flow emitting ids of widgets which need to be configured. The consumer of this flow should
+     * trigger [startConfigurationActivity] to initiate configuration.
+     */
+    val widgetsToConfigure: Flow<Int> = _widgetsToConfigure
+
+    private var pendingConfiguration: CompletableDeferred<Int>? by nullableAtomicReference()
+
     override val isEditMode = true
 
-    // Only widgets are editable.
+    // Only widgets are editable. The CTA tile comes last in the list and remains visible.
     override val communalContent: Flow<List<CommunalContentModel>> =
-        communalInteractor.widgetContent
+        communalInteractor.widgetContent.map { widgets ->
+            widgets + listOf(CommunalContentModel.CtaTileInEditMode())
+        }
 
     override fun onDeleteWidget(id: Int) = communalInteractor.deleteWidget(id)
 
@@ -55,4 +84,55 @@
         // Ignore all interactions in edit mode.
         return RemoteViews.InteractionHandler { _, _, _ -> false }
     }
+
+    override fun onAddWidget(componentName: ComponentName, priority: Int) {
+        if (pendingConfiguration != null) {
+            throw IllegalStateException(
+                "Cannot add $componentName widget while widget configuration is pending"
+            )
+        }
+        super.onAddWidget(componentName, priority)
+    }
+
+    fun startConfigurationActivity(activity: Activity, widgetId: Int, requestCode: Int) {
+        val options =
+            ActivityOptions.makeBasic().apply {
+                setPendingIntentBackgroundActivityStartMode(
+                    ActivityOptions.MODE_BACKGROUND_ACTIVITY_START_ALLOWED
+                )
+            }
+        val bundle = options.toBundle()
+        bundle.putInt(KEY_SPLASH_SCREEN_STYLE, SPLASH_SCREEN_STYLE_EMPTY)
+        try {
+            appWidgetHost.startAppWidgetConfigureActivityForResult(
+                activity,
+                widgetId,
+                0,
+                // Use the widget id as the request code.
+                requestCode,
+                bundle
+            )
+        } catch (e: ActivityNotFoundException) {
+            setConfigurationResult(RESULT_CANCELED)
+        }
+    }
+
+    override suspend fun configureWidget(widgetId: Int): Boolean {
+        if (pendingConfiguration != null) {
+            throw IllegalStateException(
+                "Attempting to configure $widgetId while another configuration is already active"
+            )
+        }
+        pendingConfiguration = CompletableDeferred()
+        _widgetsToConfigure.emit(widgetId)
+        val resultCode = pendingConfiguration?.await() ?: RESULT_CANCELED
+        pendingConfiguration = null
+        return resultCode == RESULT_OK
+    }
+
+    /** Sets the result of widget configuration. */
+    fun setConfigurationResult(resultCode: Int) {
+        pendingConfiguration?.complete(resultCode)
+            ?: throw IllegalStateException("No widget pending configuration")
+    }
 }
diff --git a/packages/SystemUI/src/com/android/systemui/communal/ui/viewmodel/CommunalViewModel.kt b/packages/SystemUI/src/com/android/systemui/communal/ui/viewmodel/CommunalViewModel.kt
index 2fae8b5..066e897 100644
--- a/packages/SystemUI/src/com/android/systemui/communal/ui/viewmodel/CommunalViewModel.kt
+++ b/packages/SystemUI/src/com/android/systemui/communal/ui/viewmodel/CommunalViewModel.kt
@@ -54,15 +54,18 @@
                 return@flatMapLatest flowOf(communalInteractor.tutorialContent)
             }
             combine(
-                communalInteractor.smartspaceContent,
-                communalInteractor.umoContent,
+                communalInteractor.ongoingContent,
                 communalInteractor.widgetContent,
-            ) { smartspace, umo, widgets ->
-                smartspace + umo + widgets
+                communalInteractor.ctaTileContent,
+            ) { ongoing, widgets, ctaTile,
+                ->
+                ongoing + widgets + ctaTile
             }
         }
 
     override fun onOpenWidgetEditor() = communalInteractor.showWidgetEditor()
 
+    override fun onDismissCtaTile() = communalInteractor.dismissCtaTile()
+
     override fun getInteractionHandler(): RemoteViews.InteractionHandler = interactionHandler
 }
diff --git a/packages/SystemUI/src/com/android/systemui/communal/widgets/EditWidgetsActivity.kt b/packages/SystemUI/src/com/android/systemui/communal/widgets/EditWidgetsActivity.kt
index 0f94a92..bfc6f2b 100644
--- a/packages/SystemUI/src/com/android/systemui/communal/widgets/EditWidgetsActivity.kt
+++ b/packages/SystemUI/src/com/android/systemui/communal/widgets/EditWidgetsActivity.kt
@@ -27,23 +27,26 @@
 import androidx.activity.ComponentActivity
 import androidx.activity.result.ActivityResultLauncher
 import androidx.activity.result.contract.ActivityResultContracts.StartActivityForResult
-import com.android.systemui.communal.domain.interactor.CommunalInteractor
+import androidx.lifecycle.Lifecycle
+import androidx.lifecycle.lifecycleScope
+import androidx.lifecycle.repeatOnLifecycle
 import com.android.systemui.communal.ui.viewmodel.CommunalEditModeViewModel
 import com.android.systemui.compose.ComposeFacade.setCommunalEditWidgetActivityContent
 import javax.inject.Inject
+import kotlinx.coroutines.launch
 
 /** An Activity for editing the widgets that appear in hub mode. */
 class EditWidgetsActivity
 @Inject
 constructor(
     private val communalViewModel: CommunalEditModeViewModel,
-    private val communalInteractor: CommunalInteractor,
     private var windowManagerService: IWindowManager? = null,
 ) : ComponentActivity() {
     companion object {
         private const val EXTRA_IS_PENDING_WIDGET_DRAG = "is_pending_widget_drag"
         private const val EXTRA_FILTER_STRATEGY = "filter_strategy"
         private const val FILTER_STRATEGY_GLANCEABLE_HUB = 1
+        private const val REQUEST_CODE_CONFIGURE_WIDGET = 1
         private const val TAG = "EditWidgetsActivity"
     }
 
@@ -63,7 +66,7 @@
                                     Intent.EXTRA_COMPONENT_NAME,
                                     ComponentName::class.java
                                 )
-                                ?.let { communalInteractor.addWidget(it, 0) }
+                                ?.let { communalViewModel.onAddWidget(it, 0) }
                                 ?: run { Log.w(TAG, "No AppWidgetProviderInfo found in result.") }
                         }
                     }
@@ -84,14 +87,26 @@
         windowInsetsController?.hide(WindowInsets.Type.systemBars())
         window.setDecorFitsSystemWindows(false)
 
+        lifecycleScope.launch {
+            repeatOnLifecycle(Lifecycle.State.STARTED) {
+                // Start the configuration activity when new widgets are added.
+                communalViewModel.widgetsToConfigure.collect { widgetId ->
+                    communalViewModel.startConfigurationActivity(
+                        activity = this@EditWidgetsActivity,
+                        widgetId = widgetId,
+                        requestCode = REQUEST_CODE_CONFIGURE_WIDGET
+                    )
+                }
+            }
+        }
+
         setCommunalEditWidgetActivityContent(
             activity = this,
             viewModel = communalViewModel,
             onOpenWidgetPicker = {
-                val localPackageManager: PackageManager = getPackageManager()
                 val intent =
                     Intent(Intent.ACTION_MAIN).also { it.addCategory(Intent.CATEGORY_HOME) }
-                localPackageManager
+                packageManager
                     .resolveActivity(intent, PackageManager.MATCH_DEFAULT_ONLY)
                     ?.activityInfo
                     ?.packageName
@@ -122,4 +137,11 @@
             }
         )
     }
+
+    override fun onActivityResult(requestCode: Int, resultCode: Int, data: Intent?) {
+        super.onActivityResult(requestCode, resultCode, data)
+        if (requestCode == REQUEST_CODE_CONFIGURE_WIDGET) {
+            communalViewModel.setConfigurationResult(resultCode)
+        }
+    }
 }
diff --git a/packages/SystemUI/src/com/android/systemui/dagger/FrameworkServicesModule.java b/packages/SystemUI/src/com/android/systemui/dagger/FrameworkServicesModule.java
index 8b992fc..b2d7052 100644
--- a/packages/SystemUI/src/com/android/systemui/dagger/FrameworkServicesModule.java
+++ b/packages/SystemUI/src/com/android/systemui/dagger/FrameworkServicesModule.java
@@ -91,6 +91,7 @@
 import android.telephony.CarrierConfigManager;
 import android.telephony.SubscriptionManager;
 import android.telephony.TelephonyManager;
+import android.telephony.satellite.SatelliteManager;
 import android.view.Choreographer;
 import android.view.CrossWindowBlurListeners;
 import android.view.IWindowManager;
@@ -712,4 +713,10 @@
                 ServiceManager.getService(Context.URI_GRANTS_SERVICE)
         );
     }
+
+    @Provides
+    @Singleton
+    static Optional<SatelliteManager> provideSatelliteManager(Context context) {
+        return Optional.ofNullable(context.getSystemService(SatelliteManager.class));
+    }
 }
diff --git a/packages/SystemUI/src/com/android/systemui/decor/FaceScanningProviderFactory.kt b/packages/SystemUI/src/com/android/systemui/decor/FaceScanningProviderFactory.kt
index 615b503..3bc4f34 100644
--- a/packages/SystemUI/src/com/android/systemui/decor/FaceScanningProviderFactory.kt
+++ b/packages/SystemUI/src/com/android/systemui/decor/FaceScanningProviderFactory.kt
@@ -32,6 +32,7 @@
 import com.android.keyguard.KeyguardUpdateMonitor
 import com.android.systemui.FaceScanningOverlay
 import com.android.systemui.biometrics.AuthController
+import com.android.systemui.biometrics.data.repository.FacePropertyRepository
 import com.android.systemui.dagger.SysUISingleton
 import com.android.systemui.dagger.qualifiers.Main
 import com.android.systemui.log.ScreenDecorationsLogger
@@ -41,19 +42,20 @@
 
 @SysUISingleton
 class FaceScanningProviderFactory @Inject constructor(
-    private val authController: AuthController,
-    private val context: Context,
-    private val statusBarStateController: StatusBarStateController,
-    private val keyguardUpdateMonitor: KeyguardUpdateMonitor,
-    @Main private val mainExecutor: Executor,
-    private val logger: ScreenDecorationsLogger,
+        private val authController: AuthController,
+        private val context: Context,
+        private val statusBarStateController: StatusBarStateController,
+        private val keyguardUpdateMonitor: KeyguardUpdateMonitor,
+        @Main private val mainExecutor: Executor,
+        private val logger: ScreenDecorationsLogger,
+        private val facePropertyRepository: FacePropertyRepository,
 ) : DecorProviderFactory() {
     private val display = context.display
     private val displayInfo = DisplayInfo()
 
     override val hasProviders: Boolean
         get() {
-            if (authController.faceSensorLocation == null) {
+            if (facePropertyRepository.sensorLocation.value == null) {
                 return false
             }
 
@@ -86,6 +88,7 @@
                                         keyguardUpdateMonitor,
                                         mainExecutor,
                                         logger,
+                                        facePropertyRepository,
                                 )
                         )
                     }
@@ -104,12 +107,13 @@
 }
 
 class FaceScanningOverlayProviderImpl(
-    override val alignedBound: Int,
-    private val authController: AuthController,
-    private val statusBarStateController: StatusBarStateController,
-    private val keyguardUpdateMonitor: KeyguardUpdateMonitor,
-    private val mainExecutor: Executor,
-    private val logger: ScreenDecorationsLogger,
+        override val alignedBound: Int,
+        private val authController: AuthController,
+        private val statusBarStateController: StatusBarStateController,
+        private val keyguardUpdateMonitor: KeyguardUpdateMonitor,
+        private val mainExecutor: Executor,
+        private val logger: ScreenDecorationsLogger,
+        private val facePropertyRepository: FacePropertyRepository,
 ) : BoundDecorProvider() {
     override val viewId: Int = com.android.systemui.res.R.id.face_scanning_anim
 
@@ -162,8 +166,9 @@
         layoutParams.let { lp ->
             lp.width = ViewGroup.LayoutParams.MATCH_PARENT
             lp.height = ViewGroup.LayoutParams.MATCH_PARENT
-            logger.faceSensorLocation(authController.faceSensorLocation)
-            authController.faceSensorLocation?.y?.let { faceAuthSensorHeight ->
+            logger.faceSensorLocation(facePropertyRepository.sensorLocation.value)
+            facePropertyRepository.sensorLocation.value?.y?.let {
+                faceAuthSensorHeight ->
                 val faceScanningHeight = (faceAuthSensorHeight * 2)
                 when (rotation) {
                     Surface.ROTATION_0, Surface.ROTATION_180 ->
diff --git a/packages/SystemUI/src/com/android/systemui/flags/Flags.kt b/packages/SystemUI/src/com/android/systemui/flags/Flags.kt
index 38c7c6a..699532c 100644
--- a/packages/SystemUI/src/com/android/systemui/flags/Flags.kt
+++ b/packages/SystemUI/src/com/android/systemui/flags/Flags.kt
@@ -448,11 +448,6 @@
     // TODO(b/270987164): Tracking Bug
     @JvmField val TRACKPAD_GESTURE_FEATURES = releasedFlag("trackpad_gesture_features")
 
-    // TODO(b/265639042): Tracking Bug
-    @JvmField
-    val WM_ENABLE_PREDICTIVE_BACK_QS_DIALOG_ANIM =
-        unreleasedFlag("persist.wm.debug.predictive_back_qs_dialog_anim", teamfood = true)
-
     // TODO(b/273800936): Tracking Bug
     @JvmField val TRACKPAD_GESTURE_COMMON = releasedFlag("trackpad_gesture_common")
 
diff --git a/packages/SystemUI/src/com/android/systemui/keyguard/data/repository/KeyguardRepository.kt b/packages/SystemUI/src/com/android/systemui/keyguard/data/repository/KeyguardRepository.kt
index 2f937bc..704ebdd 100644
--- a/packages/SystemUI/src/com/android/systemui/keyguard/data/repository/KeyguardRepository.kt
+++ b/packages/SystemUI/src/com/android/systemui/keyguard/data/repository/KeyguardRepository.kt
@@ -21,6 +21,7 @@
 import com.android.keyguard.KeyguardUpdateMonitor
 import com.android.keyguard.KeyguardUpdateMonitorCallback
 import com.android.systemui.biometrics.AuthController
+import com.android.systemui.biometrics.data.repository.FacePropertyRepository
 import com.android.systemui.common.coroutine.ChannelExt.trySendWithFailureLogging
 import com.android.systemui.common.coroutine.ConflatedCallbackFlow.conflatedCallbackFlow
 import com.android.systemui.common.shared.model.Position
@@ -277,6 +278,7 @@
     @Main private val mainDispatcher: CoroutineDispatcher,
     @Application private val scope: CoroutineScope,
     private val systemClock: SystemClock,
+    facePropertyRepository: FacePropertyRepository,
 ) : KeyguardRepository {
     private val _dismissAction: MutableStateFlow<DismissAction> =
         MutableStateFlow(DismissAction.None)
@@ -599,27 +601,7 @@
         awaitClose { authController.removeCallback(callback) }
     }
 
-    override val faceSensorLocation: Flow<Point?> = conflatedCallbackFlow {
-        fun sendSensorLocation() {
-            trySendWithFailureLogging(
-                authController.faceSensorLocation,
-                TAG,
-                "AuthController.Callback#onFingerprintLocationChanged"
-            )
-        }
-
-        val callback =
-            object : AuthController.Callback {
-                override fun onFaceSensorLocationChanged() {
-                    sendSensorLocation()
-                }
-            }
-
-        authController.addCallback(callback)
-        sendSensorLocation()
-
-        awaitClose { authController.removeCallback(callback) }
-    }
+    override val faceSensorLocation: Flow<Point?> = facePropertyRepository.sensorLocation
 
     override val biometricUnlockSource: Flow<BiometricUnlockSource?> = conflatedCallbackFlow {
         val callback =
diff --git a/packages/SystemUI/src/com/android/systemui/media/controls/models/player/MediaData.kt b/packages/SystemUI/src/com/android/systemui/media/controls/models/player/MediaData.kt
index b98e9c2..5caa27f 100644
--- a/packages/SystemUI/src/com/android/systemui/media/controls/models/player/MediaData.kt
+++ b/packages/SystemUI/src/com/android/systemui/media/controls/models/player/MediaData.kt
@@ -81,9 +81,12 @@
     /** Set from the notification and used as fallback when PlaybackState cannot be determined */
     val isClearable: Boolean = true,
 
-    /** Timestamp when this player was last active. */
+    /** Milliseconds since boot when this player was last active. */
     var lastActive: Long = 0L,
 
+    /** Timestamp in milliseconds when this player was created. */
+    var createdTimestampMillis: Long = 0L,
+
     /** Instance ID for logging purposes */
     val instanceId: InstanceId,
 
diff --git a/packages/SystemUI/src/com/android/systemui/media/controls/pipeline/MediaDataManager.kt b/packages/SystemUI/src/com/android/systemui/media/controls/pipeline/MediaDataManager.kt
index 3e8b49d..47df3b7 100644
--- a/packages/SystemUI/src/com/android/systemui/media/controls/pipeline/MediaDataManager.kt
+++ b/packages/SystemUI/src/com/android/systemui/media/controls/pipeline/MediaDataManager.kt
@@ -400,7 +400,12 @@
             val oldKey = findExistingEntry(key, sbn.packageName)
             if (oldKey == null) {
                 val instanceId = logger.getNewInstanceId()
-                val temp = LOADING.copy(packageName = sbn.packageName, instanceId = instanceId)
+                val temp =
+                    LOADING.copy(
+                        packageName = sbn.packageName,
+                        instanceId = instanceId,
+                        createdTimestampMillis = systemClock.currentTimeMillis(),
+                    )
                 mediaEntries.put(key, temp)
                 isNewlyActiveEntry = true
             } else if (oldKey != key) {
@@ -454,7 +459,8 @@
                     resumeAction = action,
                     hasCheckedForResume = true,
                     instanceId = instanceId,
-                    appUid = appUid
+                    appUid = appUid,
+                    createdTimestampMillis = systemClock.currentTimeMillis(),
                 )
             mediaEntries.put(packageName, resumeData)
             logSingleVsMultipleMediaAdded(appUid, packageName, instanceId)
@@ -732,6 +738,7 @@
 
         val mediaAction = getResumeMediaAction(resumeAction)
         val lastActive = systemClock.elapsedRealtime()
+        val createdTimestampMillis = currentEntry?.createdTimestampMillis ?: 0L
         foregroundExecutor.execute {
             onMediaDataLoaded(
                 packageName,
@@ -757,6 +764,7 @@
                     notificationKey = packageName,
                     hasCheckedForResume = true,
                     lastActive = lastActive,
+                    createdTimestampMillis = createdTimestampMillis,
                     instanceId = instanceId,
                     appUid = appUid,
                     isExplicit = isExplicit,
@@ -907,6 +915,7 @@
         }
 
         val lastActive = systemClock.elapsedRealtime()
+        val createdTimestampMillis = currentEntry?.createdTimestampMillis ?: 0L
         foregroundExecutor.execute {
             val resumeAction: Runnable? = mediaEntries[key]?.resumeAction
             val hasCheckedForResume = mediaEntries[key]?.hasCheckedForResume == true
@@ -937,6 +946,7 @@
                     isPlaying = isPlaying,
                     isClearable = !sbn.isOngoing,
                     lastActive = lastActive,
+                    createdTimestampMillis = createdTimestampMillis,
                     instanceId = instanceId,
                     appUid = appUid,
                     isExplicit = isExplicit,
diff --git a/packages/SystemUI/src/com/android/systemui/navigationbar/buttons/KeyButtonView.java b/packages/SystemUI/src/com/android/systemui/navigationbar/buttons/KeyButtonView.java
index 6ec46f6..df6843d 100644
--- a/packages/SystemUI/src/com/android/systemui/navigationbar/buttons/KeyButtonView.java
+++ b/packages/SystemUI/src/com/android/systemui/navigationbar/buttons/KeyButtonView.java
@@ -61,6 +61,7 @@
 import com.android.systemui.assist.AssistManager;
 import com.android.systemui.recents.OverviewProxyService;
 import com.android.systemui.res.R;
+import com.android.systemui.shared.navigationbar.KeyButtonRipple;
 import com.android.systemui.shared.system.QuickStepContract;
 
 public class KeyButtonView extends ImageView implements ButtonInterface {
diff --git a/packages/SystemUI/src/com/android/systemui/qs/QSPanel.java b/packages/SystemUI/src/com/android/systemui/qs/QSPanel.java
index ddd7d67..51b94dd 100644
--- a/packages/SystemUI/src/com/android/systemui/qs/QSPanel.java
+++ b/packages/SystemUI/src/com/android/systemui/qs/QSPanel.java
@@ -189,6 +189,7 @@
     public void setBrightnessView(@NonNull View view) {
         if (mBrightnessView != null) {
             removeView(mBrightnessView);
+            mChildrenLayoutTop.remove(mBrightnessView);
             mMovableContentStartIndex--;
         }
         addView(view, 0);
diff --git a/packages/SystemUI/src/com/android/systemui/qs/QSPanelController.java b/packages/SystemUI/src/com/android/systemui/qs/QSPanelController.java
index 5eb9620..ef58a60 100644
--- a/packages/SystemUI/src/com/android/systemui/qs/QSPanelController.java
+++ b/packages/SystemUI/src/com/android/systemui/qs/QSPanelController.java
@@ -56,14 +56,18 @@
     private final QSCustomizerController mQsCustomizerController;
     private final QSTileRevealController.Factory mQsTileRevealControllerFactory;
     private final FalsingManager mFalsingManager;
-    private final BrightnessController mBrightnessController;
-    private final BrightnessSliderController mBrightnessSliderController;
-    private final BrightnessMirrorHandler mBrightnessMirrorHandler;
+    private BrightnessController mBrightnessController;
+    private BrightnessSliderController mBrightnessSliderController;
+    private BrightnessMirrorHandler mBrightnessMirrorHandler;
     private final StatusBarKeyguardViewManager mStatusBarKeyguardViewManager;
     private boolean mListening;
 
     private final boolean mSceneContainerEnabled;
 
+    private int mLastDensity;
+    private final BrightnessSliderController.Factory mBrightnessSliderControllerFactory;
+    private final BrightnessController.Factory mBrightnessControllerFactory;
+
     private View.OnTouchListener mTileLayoutTouchListener = new View.OnTouchListener() {
         @Override
         public boolean onTouch(View v, MotionEvent event) {
@@ -93,6 +97,8 @@
         mQsCustomizerController = qsCustomizerController;
         mQsTileRevealControllerFactory = qsTileRevealControllerFactory;
         mFalsingManager = falsingManager;
+        mBrightnessSliderControllerFactory = brightnessSliderFactory;
+        mBrightnessControllerFactory = brightnessControllerFactory;
 
         mBrightnessSliderController = brightnessSliderFactory.create(getContext(), mView);
         mView.setBrightnessView(mBrightnessSliderController.getRootView());
@@ -100,6 +106,7 @@
         mBrightnessController = brightnessControllerFactory.create(mBrightnessSliderController);
         mBrightnessMirrorHandler = new BrightnessMirrorHandler(mBrightnessController);
         mStatusBarKeyguardViewManager = statusBarKeyguardViewManager;
+        mLastDensity = view.getResources().getConfiguration().densityDpi;
         mSceneContainerEnabled = sceneContainerFlags.isEnabled();
     }
 
@@ -147,11 +154,31 @@
     @Override
     protected void onConfigurationChanged() {
         mView.updateResources();
+        int newDensity = mView.getResources().getConfiguration().densityDpi;
+        if (newDensity != mLastDensity) {
+            mLastDensity = newDensity;
+            reinflateBrightnessSlider();
+        }
+
         if (mView.isListening()) {
             refreshAllTiles();
         }
     }
 
+    private void reinflateBrightnessSlider() {
+        mBrightnessController.unregisterCallbacks();
+        mBrightnessSliderController =
+                mBrightnessSliderControllerFactory.create(getContext(), mView);
+        mView.setBrightnessView(mBrightnessSliderController.getRootView());
+        mBrightnessController = mBrightnessControllerFactory.create(mBrightnessSliderController);
+        mBrightnessMirrorHandler.setBrightnessController(mBrightnessController);
+        mBrightnessSliderController.init();
+        if (mListening) {
+            mBrightnessController.registerCallbacks();
+        }
+    }
+
+
     @Override
     protected void onSplitShadeChanged(boolean shouldUseSplitNotificationShade) {
         ((PagedTileLayout) mView.getOrCreateTileLayout())
diff --git a/packages/SystemUI/src/com/android/systemui/qs/ReduceBrightColorsController.java b/packages/SystemUI/src/com/android/systemui/qs/ReduceBrightColorsController.java
index 36dc743..a01d658 100644
--- a/packages/SystemUI/src/com/android/systemui/qs/ReduceBrightColorsController.java
+++ b/packages/SystemUI/src/com/android/systemui/qs/ReduceBrightColorsController.java
@@ -67,9 +67,7 @@
                 synchronized (mListeners) {
                     if (setting != null && mListeners.size() != 0) {
                         if (setting.equals(Settings.Secure.REDUCE_BRIGHT_COLORS_ACTIVATED)) {
-                            for (Listener listener : mListeners) {
-                                listener.onActivated(mManager.isReduceBrightColorsActivated());
-                            }
+                            dispatchOnActivated(mManager.isReduceBrightColorsActivated());
                         }
                     }
                 }
@@ -125,6 +123,13 @@
         mManager.setReduceBrightColorsActivated(activated);
     }
 
+    private void dispatchOnActivated(boolean activated) {
+        ArrayList<Listener> copy = new ArrayList<>(mListeners);
+        for (Listener l : copy) {
+            l.onActivated(activated);
+        }
+    }
+
     /**
      * Listener invoked whenever the Reduce Bright Colors settings are changed.
      */
diff --git a/packages/SystemUI/src/com/android/systemui/qs/tiles/impl/alarm/domain/AlarmTileMapper.kt b/packages/SystemUI/src/com/android/systemui/qs/tiles/impl/alarm/domain/AlarmTileMapper.kt
index e075e76..2b8c335 100644
--- a/packages/SystemUI/src/com/android/systemui/qs/tiles/impl/alarm/domain/AlarmTileMapper.kt
+++ b/packages/SystemUI/src/com/android/systemui/qs/tiles/impl/alarm/domain/AlarmTileMapper.kt
@@ -24,6 +24,7 @@
 import com.android.systemui.qs.tiles.viewmodel.QSTileConfig
 import com.android.systemui.qs.tiles.viewmodel.QSTileState
 import com.android.systemui.res.R
+import com.android.systemui.util.time.SystemClock
 import java.time.Instant
 import java.time.LocalDateTime
 import java.time.format.DateTimeFormatter
@@ -36,10 +37,12 @@
 constructor(
     @Main private val resources: Resources,
     private val theme: Theme,
+    private val clock: SystemClock,
 ) : QSTileDataToStateMapper<AlarmTileModel> {
     companion object {
         val formatter12Hour: DateTimeFormatter = DateTimeFormatter.ofPattern("E hh:mm a")
         val formatter24Hour: DateTimeFormatter = DateTimeFormatter.ofPattern("E HH:mm")
+        val formatterDateOnly: DateTimeFormatter = DateTimeFormatter.ofPattern("E MMM d")
     }
     override fun map(config: QSTileConfig, data: AlarmTileModel): QSTileState =
         QSTileState.build(resources, theme, config.uiConfig) {
@@ -47,14 +50,32 @@
                 is AlarmTileModel.NextAlarmSet -> {
                     activationState = QSTileState.ActivationState.ACTIVE
 
-                    val localDateTime =
+                    val alarmDateTime =
                         LocalDateTime.ofInstant(
                             Instant.ofEpochMilli(data.alarmClockInfo.triggerTime),
                             TimeZone.getDefault().toZoneId()
                         )
-                    secondaryLabel =
-                        if (data.is24HourFormat) formatter24Hour.format(localDateTime)
-                        else formatter12Hour.format(localDateTime)
+
+                    val nowDateTime =
+                        LocalDateTime.ofInstant(
+                            Instant.ofEpochMilli(clock.currentTimeMillis()),
+                            TimeZone.getDefault().toZoneId()
+                        )
+
+                    // Edge case: If it's 8:00:30 right now and alarm is requested for next week at
+                    // 8:00:29, we still want to show the date. Same at nanosecond level.
+                    val nextWeekThisTime = nowDateTime.plusWeeks(1).withSecond(0).withNano(0)
+
+                    // is the alarm over a week away?
+                    val shouldShowDateAndHideTime = alarmDateTime >= nextWeekThisTime
+
+                    if (shouldShowDateAndHideTime) {
+                        secondaryLabel = formatterDateOnly.format(alarmDateTime)
+                    } else {
+                        secondaryLabel =
+                            if (data.is24HourFormat) formatter24Hour.format(alarmDateTime)
+                            else formatter12Hour.format(alarmDateTime)
+                    }
                 }
                 is AlarmTileModel.NoAlarmSet -> {
                     activationState = QSTileState.ActivationState.INACTIVE
diff --git a/packages/SystemUI/src/com/android/systemui/settings/brightness/BrightnessMirrorHandler.kt b/packages/SystemUI/src/com/android/systemui/settings/brightness/BrightnessMirrorHandler.kt
index 51aa339..701d814 100644
--- a/packages/SystemUI/src/com/android/systemui/settings/brightness/BrightnessMirrorHandler.kt
+++ b/packages/SystemUI/src/com/android/systemui/settings/brightness/BrightnessMirrorHandler.kt
@@ -19,9 +19,16 @@
 import com.android.systemui.statusbar.policy.BrightnessMirrorController
 import com.android.systemui.statusbar.policy.BrightnessMirrorController.BrightnessMirrorListener
 
-class BrightnessMirrorHandler(private val brightnessController: MirroredBrightnessController) {
+class BrightnessMirrorHandler(brightnessController: MirroredBrightnessController) {
 
-    private var mirrorController: BrightnessMirrorController? = null
+    var mirrorController: BrightnessMirrorController? = null
+        private set
+
+    var brightnessController: MirroredBrightnessController = brightnessController
+        set(value) {
+            field = value
+            updateBrightnessMirror()
+        }
 
     private val brightnessMirrorListener = BrightnessMirrorListener { updateBrightnessMirror() }
 
@@ -33,7 +40,7 @@
         mirrorController?.removeCallback(brightnessMirrorListener)
     }
 
-    fun setController(controller: BrightnessMirrorController) {
+    fun setController(controller: BrightnessMirrorController?) {
         mirrorController?.removeCallback(brightnessMirrorListener)
         mirrorController = controller
         mirrorController?.addCallback(brightnessMirrorListener)
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/dagger/CentralSurfacesDependenciesModule.java b/packages/SystemUI/src/com/android/systemui/statusbar/dagger/CentralSurfacesDependenciesModule.java
index a957095..32cd56c 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/dagger/CentralSurfacesDependenciesModule.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/dagger/CentralSurfacesDependenciesModule.java
@@ -16,6 +16,8 @@
 
 package com.android.systemui.statusbar.dagger;
 
+import static com.android.systemui.Flags.predictiveBackAnimateDialogs;
+
 import android.content.Context;
 import android.os.RemoteException;
 import android.service.dreams.IDreamManager;
@@ -31,8 +33,6 @@
 import com.android.systemui.dagger.SysUISingleton;
 import com.android.systemui.dump.DumpHandler;
 import com.android.systemui.dump.DumpManager;
-import com.android.systemui.flags.FeatureFlags;
-import com.android.systemui.flags.Flags;
 import com.android.systemui.media.controls.pipeline.MediaDataManager;
 import com.android.systemui.power.domain.interactor.PowerInteractor;
 import com.android.systemui.settings.DisplayTracker;
@@ -230,11 +230,11 @@
     /** */
     @Provides
     @SysUISingleton
-    static AnimationFeatureFlags provideAnimationFeatureFlags(FeatureFlags featureFlags) {
+    static AnimationFeatureFlags provideAnimationFeatureFlags() {
         return new AnimationFeatureFlags() {
             @Override
             public boolean isPredictiveBackQsDialogAnim() {
-                return featureFlags.isEnabled(Flags.WM_ENABLE_PREDICTIVE_BACK_QS_DIALOG_ANIM);
+                return predictiveBackAnimateDialogs();
             }
         };
     }
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/notification/NotificationWakeUpCoordinator.kt b/packages/SystemUI/src/com/android/systemui/statusbar/notification/NotificationWakeUpCoordinator.kt
index 0c67279..3f2c818 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/notification/NotificationWakeUpCoordinator.kt
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/notification/NotificationWakeUpCoordinator.kt
@@ -31,6 +31,7 @@
 import com.android.systemui.shade.ShadeViewController
 import com.android.systemui.statusbar.StatusBarState
 import com.android.systemui.statusbar.notification.collection.NotificationEntry
+import com.android.systemui.statusbar.notification.domain.interactor.NotificationsKeyguardInteractor
 import com.android.systemui.statusbar.notification.shared.NotificationIconContainerRefactor
 import com.android.systemui.statusbar.notification.stack.NotificationStackScrollLayoutController
 import com.android.systemui.statusbar.notification.stack.StackStateAnimator
@@ -58,6 +59,7 @@
     private val dozeParameters: DozeParameters,
     private val screenOffAnimationController: ScreenOffAnimationController,
     private val logger: NotificationWakeUpCoordinatorLogger,
+    private val notifsKeyguardInteractor: NotificationsKeyguardInteractor,
 ) :
     OnHeadsUpChangedListener,
     StatusBarStateController.StateListener,
@@ -144,6 +146,7 @@
                 for (listener in wakeUpListeners) {
                     listener.onFullyHiddenChanged(value)
                 }
+                notifsKeyguardInteractor.setNotificationsFullyHidden(value)
             }
         }
 
@@ -216,6 +219,7 @@
                 for (listener in wakeUpListeners) {
                     listener.onPulseExpandingChanged(pulseExpanding)
                 }
+                notifsKeyguardInteractor.setPulseExpanding(pulseExpanding)
             }
         }
     }
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/notification/data/NotificationDataLayerModule.kt b/packages/SystemUI/src/com/android/systemui/statusbar/notification/data/NotificationDataLayerModule.kt
index 5435fb5..2cac000 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/notification/data/NotificationDataLayerModule.kt
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/notification/data/NotificationDataLayerModule.kt
@@ -15,8 +15,6 @@
  */
 package com.android.systemui.statusbar.notification.data
 
-import com.android.systemui.statusbar.notification.data.repository.NotificationsKeyguardStateRepositoryModule
 import dagger.Module
 
-@Module(includes = [NotificationsKeyguardStateRepositoryModule::class])
-interface NotificationDataLayerModule
+@Module(includes = []) interface NotificationDataLayerModule
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/notification/data/repository/NotificationsKeyguardViewStateRepository.kt b/packages/SystemUI/src/com/android/systemui/statusbar/notification/data/repository/NotificationsKeyguardViewStateRepository.kt
index 2cc1403..bd6ea30 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/notification/data/repository/NotificationsKeyguardViewStateRepository.kt
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/notification/data/repository/NotificationsKeyguardViewStateRepository.kt
@@ -15,59 +15,16 @@
  */
 package com.android.systemui.statusbar.notification.data.repository
 
-import com.android.systemui.common.coroutine.ConflatedCallbackFlow.conflatedCallbackFlow
 import com.android.systemui.dagger.SysUISingleton
-import com.android.systemui.statusbar.notification.NotificationWakeUpCoordinator
-import dagger.Binds
-import dagger.Module
 import javax.inject.Inject
-import kotlinx.coroutines.channels.awaitClose
-import kotlinx.coroutines.flow.Flow
+import kotlinx.coroutines.flow.MutableStateFlow
 
 /** View-states pertaining to notifications on the keyguard. */
-interface NotificationsKeyguardViewStateRepository {
+@SysUISingleton
+class NotificationsKeyguardViewStateRepository @Inject constructor() {
     /** Are notifications fully hidden from view? */
-    val areNotificationsFullyHidden: Flow<Boolean>
+    val areNotificationsFullyHidden = MutableStateFlow(false)
 
     /** Is a pulse expansion occurring? */
-    val isPulseExpanding: Flow<Boolean>
-}
-
-@Module
-interface NotificationsKeyguardStateRepositoryModule {
-    @Binds
-    fun bindImpl(
-        impl: NotificationsKeyguardViewStateRepositoryImpl
-    ): NotificationsKeyguardViewStateRepository
-}
-
-@SysUISingleton
-class NotificationsKeyguardViewStateRepositoryImpl
-@Inject
-constructor(
-    wakeUpCoordinator: NotificationWakeUpCoordinator,
-) : NotificationsKeyguardViewStateRepository {
-    override val areNotificationsFullyHidden: Flow<Boolean> = conflatedCallbackFlow {
-        val listener =
-            object : NotificationWakeUpCoordinator.WakeUpListener {
-                override fun onFullyHiddenChanged(isFullyHidden: Boolean) {
-                    trySend(isFullyHidden)
-                }
-            }
-        trySend(wakeUpCoordinator.notificationsFullyHidden)
-        wakeUpCoordinator.addListener(listener)
-        awaitClose { wakeUpCoordinator.removeListener(listener) }
-    }
-
-    override val isPulseExpanding: Flow<Boolean> = conflatedCallbackFlow {
-        val listener =
-            object : NotificationWakeUpCoordinator.WakeUpListener {
-                override fun onPulseExpandingChanged(isPulseExpanding: Boolean) {
-                    trySend(isPulseExpanding)
-                }
-            }
-        trySend(wakeUpCoordinator.isPulseExpanding())
-        wakeUpCoordinator.addListener(listener)
-        awaitClose { wakeUpCoordinator.removeListener(listener) }
-    }
+    val isPulseExpanding = MutableStateFlow(false)
 }
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/notification/domain/interactor/NotificationsKeyguardInteractor.kt b/packages/SystemUI/src/com/android/systemui/statusbar/notification/domain/interactor/NotificationsKeyguardInteractor.kt
index 73341db..a6361cb 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/notification/domain/interactor/NotificationsKeyguardInteractor.kt
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/notification/domain/interactor/NotificationsKeyguardInteractor.kt
@@ -15,24 +15,29 @@
  */
 package com.android.systemui.statusbar.notification.domain.interactor
 
-import com.android.systemui.dagger.qualifiers.Background
 import com.android.systemui.statusbar.notification.data.repository.NotificationsKeyguardViewStateRepository
 import javax.inject.Inject
-import kotlinx.coroutines.CoroutineDispatcher
 import kotlinx.coroutines.flow.Flow
-import kotlinx.coroutines.flow.flowOn
 
 /** Domain logic pertaining to notifications on the keyguard. */
 class NotificationsKeyguardInteractor
 @Inject
 constructor(
-    repository: NotificationsKeyguardViewStateRepository,
-    @Background backgroundDispatcher: CoroutineDispatcher,
+    private val repository: NotificationsKeyguardViewStateRepository,
 ) {
     /** Is a pulse expansion occurring? */
-    val isPulseExpanding: Flow<Boolean> = repository.isPulseExpanding.flowOn(backgroundDispatcher)
+    val isPulseExpanding: Flow<Boolean> = repository.isPulseExpanding
 
     /** Are notifications fully hidden from view? */
-    val areNotificationsFullyHidden: Flow<Boolean> =
-        repository.areNotificationsFullyHidden.flowOn(backgroundDispatcher)
+    val areNotificationsFullyHidden: Flow<Boolean> = repository.areNotificationsFullyHidden
+
+    /** Updates whether notifications are fully hidden from view. */
+    fun setNotificationsFullyHidden(fullyHidden: Boolean) {
+        repository.areNotificationsFullyHidden.value = fullyHidden
+    }
+
+    /** Updates whether a pulse expansion is occurring. */
+    fun setPulseExpanding(pulseExpanding: Boolean) {
+        repository.isPulseExpanding.value = pulseExpanding
+    }
 }
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/notification/stack/NotificationStackScrollLayoutController.java b/packages/SystemUI/src/com/android/systemui/statusbar/notification/stack/NotificationStackScrollLayoutController.java
index 6f5058c..2e54512 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/notification/stack/NotificationStackScrollLayoutController.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/notification/stack/NotificationStackScrollLayoutController.java
@@ -366,8 +366,7 @@
 
                 @Override
                 public void onStatePostChange() {
-                    mView.updateSensitiveness(mStatusBarStateController.goingToFullShade(),
-                            mLockscreenUserManager.isAnyProfilePublicMode());
+                    updateSensitivenessWithAnimation(mStatusBarStateController.goingToFullShade());
                     mView.onStatePostChange(mStatusBarStateController.fromShadeLocked());
                     if (!FooterViewRefactor.isEnabled()) {
                         updateImportantForAccessibility();
@@ -378,7 +377,7 @@
     private final UserChangedListener mLockscreenUserChangeListener = new UserChangedListener() {
         @Override
         public void onUserChanged(int userId) {
-            mView.updateSensitiveness(false, mLockscreenUserManager.isAnyProfilePublicMode());
+            updateSensitivenessWithAnimation(false);
             mHistoryEnabled = null;
             updateFooter();
         }
@@ -388,7 +387,11 @@
      * Recalculate sensitiveness without animation; called when waking up while keyguard occluded.
      */
     public void updateSensitivenessForOccludedWakeup() {
-        mView.updateSensitiveness(false, mLockscreenUserManager.isAnyProfilePublicMode());
+        updateSensitivenessWithAnimation(false);
+    }
+
+    private void updateSensitivenessWithAnimation(boolean animate) {
+        mView.updateSensitiveness(animate, mLockscreenUserManager.isAnyProfilePublicMode());
     }
 
     /**
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/ComponentSystemUIDialog.kt b/packages/SystemUI/src/com/android/systemui/statusbar/phone/ComponentSystemUIDialog.kt
index 38a6d39..13d7924 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/ComponentSystemUIDialog.kt
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/ComponentSystemUIDialog.kt
@@ -34,7 +34,6 @@
 import androidx.savedstate.setViewTreeSavedStateRegistryOwner
 import com.android.systemui.animation.DialogLaunchAnimator
 import com.android.systemui.broadcast.BroadcastDispatcher
-import com.android.systemui.flags.FeatureFlags
 import com.android.systemui.model.SysUiState
 
 /**
@@ -53,7 +52,6 @@
     context: Context,
     theme: Int,
     dismissOnDeviceLock: Boolean,
-    featureFlags: FeatureFlags,
     dialogManager: SystemUIDialogManager,
     sysUiState: SysUiState,
     broadcastDispatcher: BroadcastDispatcher,
@@ -63,7 +61,6 @@
         context,
         theme,
         dismissOnDeviceLock,
-        featureFlags,
         dialogManager,
         sysUiState,
         broadcastDispatcher,
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/ManagedProfileControllerImpl.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/ManagedProfileControllerImpl.java
index abdf827..56ea00c 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/ManagedProfileControllerImpl.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/ManagedProfileControllerImpl.java
@@ -104,7 +104,8 @@
     }
 
     private void notifyManagedProfileRemoved() {
-        for (Callback callback : mCallbacks) {
+        ArrayList<Callback> copy = new ArrayList<>(mCallbacks);
+        for (Callback callback : copy) {
             callback.onManagedProfileRemoved();
         }
     }
@@ -148,7 +149,8 @@
         @Override
         public void onUserChanged(int newUser, @NonNull Context userContext) {
             reloadManagedProfiles();
-            for (Callback callback : mCallbacks) {
+            ArrayList<Callback> copy = new ArrayList<>(mCallbacks);
+            for (Callback callback : copy) {
                 callback.onManagedProfileChanged();
             }
         }
@@ -156,7 +158,8 @@
         @Override
         public void onProfilesChanged(@NonNull List<UserInfo> profiles) {
             reloadManagedProfiles();
-            for (Callback callback : mCallbacks) {
+            ArrayList<Callback> copy = new ArrayList<>(mCallbacks);
+            for (Callback callback : copy) {
                 callback.onManagedProfileChanged();
             }
         }
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/StatusBarIconController.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/StatusBarIconController.java
index 9ae4195..d7cbe5d 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/StatusBarIconController.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/StatusBarIconController.java
@@ -14,6 +14,7 @@
 
 package com.android.systemui.statusbar.phone;
 
+import static com.android.systemui.statusbar.phone.StatusBarIconHolder.TYPE_BINDABLE;
 import static com.android.systemui.statusbar.phone.StatusBarIconHolder.TYPE_ICON;
 import static com.android.systemui.statusbar.phone.StatusBarIconHolder.TYPE_MOBILE_NEW;
 import static com.android.systemui.statusbar.phone.StatusBarIconHolder.TYPE_WIFI_NEW;
@@ -40,11 +41,13 @@
 import com.android.systemui.statusbar.StatusBarIconView;
 import com.android.systemui.statusbar.StatusIconDisplayable;
 import com.android.systemui.statusbar.connectivity.ui.MobileContextProvider;
+import com.android.systemui.statusbar.phone.StatusBarIconHolder.BindableIconHolder;
 import com.android.systemui.statusbar.phone.StatusBarSignalPolicy.CallIndicatorIconState;
 import com.android.systemui.statusbar.pipeline.mobile.ui.MobileUiAdapter;
 import com.android.systemui.statusbar.pipeline.mobile.ui.binder.MobileIconsBinder;
 import com.android.systemui.statusbar.pipeline.mobile.ui.view.ModernStatusBarMobileView;
 import com.android.systemui.statusbar.pipeline.mobile.ui.viewmodel.MobileIconsViewModel;
+import com.android.systemui.statusbar.pipeline.shared.ui.view.ModernStatusBarView;
 import com.android.systemui.statusbar.pipeline.wifi.ui.WifiUiAdapter;
 import com.android.systemui.statusbar.pipeline.wifi.ui.view.ModernStatusBarWifiView;
 import com.android.systemui.statusbar.pipeline.wifi.ui.viewmodel.LocationBasedWifiViewModel;
@@ -432,6 +435,10 @@
 
                 case TYPE_MOBILE_NEW:
                     return addNewMobileIcon(index, slot, holder.getTag());
+
+                case TYPE_BINDABLE:
+                    // Safe cast, since only BindableIconHolders can set this tag on themselves
+                    return addBindableIcon((BindableIconHolder) holder, index);
             }
 
             return null;
@@ -446,6 +453,18 @@
             return view;
         }
 
+        /**
+         * ModernStatusBarViews can be created and bound, and thus do not need to update their
+         *  drawable by sending multiple calls to setIcon. Instead, by using a bindable
+         * icon view, we can simply create the icon when requested and allow the
+         * ViewBinder to control its visual state.
+         */
+        protected StatusIconDisplayable addBindableIcon(BindableIconHolder holder, int index) {
+            ModernStatusBarView view = holder.getInitializer().createAndBind(mContext);
+            mGroup.addView(view, index, onCreateLayoutParams());
+            return view;
+        }
+
         protected StatusIconDisplayable addNewWifiIcon(int index, String slot) {
             ModernStatusBarWifiView view = onCreateModernStatusBarWifiView(slot);
             mGroup.addView(view, index, onCreateLayoutParams());
@@ -530,6 +549,7 @@
                     return;
                 case TYPE_MOBILE_NEW:
                 case TYPE_WIFI_NEW:
+                case TYPE_BINDABLE:
                     // Nothing, the new icons update themselves
                     return;
                 default:
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/StatusBarIconControllerImpl.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/StatusBarIconControllerImpl.java
index 0f4d68c..4f148f1 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/StatusBarIconControllerImpl.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/StatusBarIconControllerImpl.java
@@ -38,8 +38,11 @@
 import com.android.systemui.dump.DumpManager;
 import com.android.systemui.statusbar.CommandQueue;
 import com.android.systemui.statusbar.StatusIconDisplayable;
+import com.android.systemui.statusbar.phone.StatusBarIconHolder.BindableIconHolder;
 import com.android.systemui.statusbar.phone.StatusBarSignalPolicy.CallIndicatorIconState;
 import com.android.systemui.statusbar.pipeline.StatusBarPipelineFlags;
+import com.android.systemui.statusbar.pipeline.icons.shared.BindableIconsRegistry;
+import com.android.systemui.statusbar.pipeline.icons.shared.model.BindableIcon;
 import com.android.systemui.statusbar.policy.ConfigurationController;
 import com.android.systemui.statusbar.policy.ConfigurationController.ConfigurationListener;
 import com.android.systemui.tuner.TunerService;
@@ -83,7 +86,8 @@
             TunerService tunerService,
             DumpManager dumpManager,
             StatusBarIconList statusBarIconList,
-            StatusBarPipelineFlags statusBarPipelineFlags
+            StatusBarPipelineFlags statusBarPipelineFlags,
+            BindableIconsRegistry modernIconsRegistry
     ) {
         mStatusBarIconList = statusBarIconList;
         mContext = context;
@@ -94,6 +98,28 @@
         tunerService.addTunable(this, ICON_HIDE_LIST);
         demoModeController.addCallback(this);
         dumpManager.registerDumpable(getClass().getSimpleName(), this);
+
+        addModernBindableIcons(modernIconsRegistry);
+    }
+
+    /**
+     * BindableIcons will always produce ModernStatusBarViews, which will be initialized and bound
+     * upon being added to any icon group. Because their view policy does not require subsequent
+     * calls to setIcon(), we can simply register them all statically here and not have to build
+     * CoreStartables for each modern icon.
+     *
+     * @param registry a statically defined provider of the modern icons
+     */
+    private void addModernBindableIcons(BindableIconsRegistry registry) {
+        List<BindableIcon> icons = registry.getBindableIcons();
+
+        // Initialization point for the bindable (modern) icons. These icons get their own slot
+        // allocated immediately, and are required to control their own display properties
+        for (BindableIcon i : icons) {
+            if (i.getShouldBindIcon()) {
+                addBindableIcon(i);
+            }
+        }
     }
 
     /** */
@@ -182,6 +208,17 @@
         mIconGroups.forEach(l -> l.onIconAdded(viewIndex, slot, hidden, holder));
     }
 
+    void addBindableIcon(BindableIcon icon) {
+        StatusBarIconHolder existingHolder = mStatusBarIconList.getIconHolder(icon.getSlot(), 0);
+        // Expected to be null
+        if (existingHolder == null) {
+            BindableIconHolder bindableIcon = new BindableIconHolder(icon.getInitializer());
+            setIcon(icon.getSlot(), bindableIcon);
+        } else {
+            Log.e(TAG, "addBindableIcon called, but icon has already been added. Ignoring");
+        }
+    }
+
     /** */
     @Override
     public void setIcon(String slot, int resourceId, CharSequence contentDescription) {
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/StatusBarIconHolder.kt b/packages/SystemUI/src/com/android/systemui/statusbar/phone/StatusBarIconHolder.kt
index 5b55a1e..bef0b28 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/StatusBarIconHolder.kt
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/StatusBarIconHolder.kt
@@ -21,23 +21,24 @@
 import android.os.UserHandle
 import com.android.internal.statusbar.StatusBarIcon
 import com.android.systemui.statusbar.phone.StatusBarSignalPolicy.CallIndicatorIconState
+import com.android.systemui.statusbar.pipeline.icons.shared.model.ModernStatusBarViewCreator
 
 /** Wraps [com.android.internal.statusbar.StatusBarIcon] so we can still have a uniform list */
-class StatusBarIconHolder private constructor() {
-    @IntDef(TYPE_ICON, TYPE_MOBILE_NEW, TYPE_WIFI_NEW)
+open class StatusBarIconHolder private constructor() {
+    @IntDef(TYPE_ICON, TYPE_MOBILE_NEW, TYPE_WIFI_NEW, TYPE_BINDABLE)
     @Retention(AnnotationRetention.SOURCE)
     internal annotation class IconType
 
     var icon: StatusBarIcon? = null
 
     @IconType
-    var type = TYPE_ICON
-        private set
+    open var type = TYPE_ICON
+        internal set
 
     var tag = 0
         private set
 
-    var isVisible: Boolean
+    open var isVisible: Boolean
         get() =
             when (type) {
                 TYPE_ICON -> icon!!.visible
@@ -45,6 +46,7 @@
                 // The new pipeline controls visibilities via the view model and
                 // view binder, so
                 // this is effectively an unused return value.
+                TYPE_BINDABLE,
                 TYPE_MOBILE_NEW,
                 TYPE_WIFI_NEW -> true
                 else -> true
@@ -55,6 +57,7 @@
             }
             when (type) {
                 TYPE_ICON -> icon!!.visible = visible
+                TYPE_BINDABLE,
                 TYPE_MOBILE_NEW,
                 TYPE_WIFI_NEW -> {}
             }
@@ -94,6 +97,9 @@
         )
         const val TYPE_WIFI_NEW = 4
 
+        /** Only applicable to [BindableIconHolder] */
+        const val TYPE_BINDABLE = 5
+
         /** Returns a human-readable string representing the given type. */
         fun getTypeString(@IconType type: Int): String {
             return when (type) {
@@ -154,4 +160,25 @@
             return holder
         }
     }
+
+    /**
+     * Subclass of StatusBarIconHolder that is responsible only for the registration of an icon into
+     * the [StatusBarIconList]. A bindable icon takes care of its own display, including hiding
+     * itself under the correct conditions.
+     *
+     * StatusBarIconController will register all available bindable icons on init (see
+     * [BindableIconsRepository]), and will ignore any call to setIcon for these.
+     *
+     * [initializer] a view creator that can bind the relevant view models to the created view.
+     */
+    class BindableIconHolder(val initializer: ModernStatusBarViewCreator) : StatusBarIconHolder() {
+        override var type: Int = TYPE_BINDABLE
+
+        /** This is unused, as bindable icons use their own view binders to control visibility */
+        override var isVisible: Boolean = true
+
+        override fun toString(): String {
+            return ("StatusBarIconHolder(type=BINDABLE)")
+        }
+    }
 }
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/SystemUIDialog.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/SystemUIDialog.java
index 3394eac..390d2c9 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/SystemUIDialog.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/SystemUIDialog.java
@@ -16,6 +16,8 @@
 
 package com.android.systemui.statusbar.phone;
 
+import static com.android.systemui.Flags.predictiveBackAnimateDialogs;
+
 import android.app.AlertDialog;
 import android.app.Dialog;
 import android.content.BroadcastReceiver;
@@ -45,8 +47,6 @@
 import com.android.systemui.animation.DialogLaunchAnimator;
 import com.android.systemui.broadcast.BroadcastDispatcher;
 import com.android.systemui.dagger.qualifiers.Application;
-import com.android.systemui.flags.FeatureFlags;
-import com.android.systemui.flags.Flags;
 import com.android.systemui.model.SysUiState;
 import com.android.systemui.res.R;
 import com.android.systemui.shared.system.QuickStepContract;
@@ -78,7 +78,6 @@
     public static final boolean DEFAULT_DISMISS_ON_DEVICE_LOCK = true;
 
     private final Context mContext;
-    private final FeatureFlags mFeatureFlags;
     private final DialogDelegate<SystemUIDialog> mDelegate;
     @Nullable private final DismissReceiver mDismissReceiver;
     private final Handler mHandler = new Handler();
@@ -110,7 +109,6 @@
         // SystemUIDialogFactory and make all other dialogs create a SystemUIDialog to which we set
         // the content and attach listeners.
         this(context, theme, dismissOnDeviceLock,
-                Dependency.get(FeatureFlags.class),
                 Dependency.get(SystemUIDialogManager.class),
                 Dependency.get(SysUiState.class),
                 Dependency.get(BroadcastDispatcher.class),
@@ -119,7 +117,6 @@
 
     public static class Factory {
         private final Context mContext;
-        private final FeatureFlags mFeatureFlags;
         private final SystemUIDialogManager mSystemUIDialogManager;
         private final SysUiState mSysUiState;
         private final BroadcastDispatcher mBroadcastDispatcher;
@@ -128,13 +125,11 @@
         @Inject
         public Factory(
                 @Application Context context,
-                FeatureFlags featureFlags,
                 SystemUIDialogManager systemUIDialogManager,
                 SysUiState sysUiState,
                 BroadcastDispatcher broadcastDispatcher,
                 DialogLaunchAnimator dialogLaunchAnimator) {
             mContext = context;
-            mFeatureFlags = featureFlags;
             mSystemUIDialogManager = systemUIDialogManager;
             mSysUiState = sysUiState;
             mBroadcastDispatcher = broadcastDispatcher;
@@ -177,7 +172,6 @@
                     context,
                     DEFAULT_THEME,
                     DEFAULT_DISMISS_ON_DEVICE_LOCK,
-                    mFeatureFlags,
                     mSystemUIDialogManager,
                     mSysUiState,
                     mBroadcastDispatcher,
@@ -190,7 +184,6 @@
             Context context,
             int theme,
             boolean dismissOnDeviceLock,
-            FeatureFlags featureFlags,
             SystemUIDialogManager dialogManager,
             SysUiState sysUiState,
             BroadcastDispatcher broadcastDispatcher,
@@ -199,7 +192,6 @@
                 context,
                 theme,
                 dismissOnDeviceLock,
-                featureFlags,
                 dialogManager,
                 sysUiState,
                 broadcastDispatcher,
@@ -211,7 +203,6 @@
             Context context,
             int theme,
             boolean dismissOnDeviceLock,
-            FeatureFlags featureFlags,
             SystemUIDialogManager dialogManager,
             SysUiState sysUiState,
             BroadcastDispatcher broadcastDispatcher,
@@ -221,7 +212,6 @@
                 context,
                 theme,
                 dismissOnDeviceLock,
-                featureFlags,
                 dialogManager,
                 sysUiState,
                 broadcastDispatcher,
@@ -233,7 +223,6 @@
             Context context,
             int theme,
             boolean dismissOnDeviceLock,
-            FeatureFlags featureFlags,
             SystemUIDialogManager dialogManager,
             SysUiState sysUiState,
             BroadcastDispatcher broadcastDispatcher,
@@ -241,7 +230,6 @@
             DialogDelegate<SystemUIDialog> delegate) {
         super(context, theme);
         mContext = context;
-        mFeatureFlags = featureFlags;
         mDelegate = delegate;
 
         applyFlags(this);
@@ -269,7 +257,7 @@
         for (int i = 0; i < mOnCreateRunnables.size(); i++) {
             mOnCreateRunnables.get(i).run();
         }
-        if (mFeatureFlags.isEnabled(Flags.WM_ENABLE_PREDICTIVE_BACK_QS_DIALOG_ANIM)) {
+        if (predictiveBackAnimateDialogs()) {
             DialogKt.registerAnimationOnBackInvoked(
                     /* dialog = */ this,
                     /* targetView = */ getWindow().getDecorView()
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/SystemUIDialogFactory.kt b/packages/SystemUI/src/com/android/systemui/statusbar/phone/SystemUIDialogFactory.kt
index d91ca92..f3e8f62d 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/SystemUIDialogFactory.kt
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/SystemUIDialogFactory.kt
@@ -20,7 +20,6 @@
 import com.android.systemui.animation.DialogLaunchAnimator
 import com.android.systemui.broadcast.BroadcastDispatcher
 import com.android.systemui.dagger.qualifiers.Application
-import com.android.systemui.flags.FeatureFlagsClassic
 import com.android.systemui.model.SysUiState
 import com.android.systemui.util.Assert
 import javax.inject.Inject
@@ -30,7 +29,6 @@
 @Inject
 constructor(
     @Application val applicationContext: Context,
-    private val featureFlags: FeatureFlagsClassic,
     private val dialogManager: SystemUIDialogManager,
     private val sysUiState: SysUiState,
     private val broadcastDispatcher: BroadcastDispatcher,
@@ -57,7 +55,6 @@
             context,
             theme,
             dismissOnDeviceLock,
-            featureFlags,
             dialogManager,
             sysUiState,
             broadcastDispatcher,
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/dagger/StatusBarPipelineModule.kt b/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/dagger/StatusBarPipelineModule.kt
index e1fd37f..89a2fb7 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/dagger/StatusBarPipelineModule.kt
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/dagger/StatusBarPipelineModule.kt
@@ -29,6 +29,8 @@
 import com.android.systemui.statusbar.pipeline.airplane.data.repository.AirplaneModeRepositoryImpl
 import com.android.systemui.statusbar.pipeline.airplane.ui.viewmodel.AirplaneModeViewModel
 import com.android.systemui.statusbar.pipeline.airplane.ui.viewmodel.AirplaneModeViewModelImpl
+import com.android.systemui.statusbar.pipeline.icons.shared.BindableIconsRegistry
+import com.android.systemui.statusbar.pipeline.icons.shared.BindableIconsRegistryImpl
 import com.android.systemui.statusbar.pipeline.mobile.data.repository.CarrierConfigCoreStartable
 import com.android.systemui.statusbar.pipeline.mobile.data.repository.MobileConnectionsRepository
 import com.android.systemui.statusbar.pipeline.mobile.data.repository.MobileRepositorySwitcher
@@ -42,6 +44,8 @@
 import com.android.systemui.statusbar.pipeline.mobile.util.MobileMappingsProxyImpl
 import com.android.systemui.statusbar.pipeline.mobile.util.SubscriptionManagerProxy
 import com.android.systemui.statusbar.pipeline.mobile.util.SubscriptionManagerProxyImpl
+import com.android.systemui.statusbar.pipeline.satellite.data.DeviceBasedSatelliteRepository
+import com.android.systemui.statusbar.pipeline.satellite.data.prod.DeviceBasedSatelliteRepositoryImpl
 import com.android.systemui.statusbar.pipeline.shared.data.repository.ConnectivityRepository
 import com.android.systemui.statusbar.pipeline.shared.data.repository.ConnectivityRepositoryImpl
 import com.android.systemui.statusbar.pipeline.shared.ui.binder.CollapsedStatusBarViewBinder
@@ -76,8 +80,16 @@
     abstract fun airplaneModeViewModel(impl: AirplaneModeViewModelImpl): AirplaneModeViewModel
 
     @Binds
+    abstract fun bindableIconsRepository(impl: BindableIconsRegistryImpl): BindableIconsRegistry
+
+    @Binds
     abstract fun connectivityRepository(impl: ConnectivityRepositoryImpl): ConnectivityRepository
 
+    @Binds
+    abstract fun deviceBasedSatelliteRepository(
+        impl: DeviceBasedSatelliteRepositoryImpl
+    ): DeviceBasedSatelliteRepository
+
     @Binds abstract fun wifiRepository(impl: WifiRepositorySwitcher): WifiRepository
 
     @Binds abstract fun wifiInteractor(impl: WifiInteractorImpl): WifiInteractor
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/icons/shared/BindableIconsRegistry.kt b/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/icons/shared/BindableIconsRegistry.kt
new file mode 100644
index 0000000..e3c3139
--- /dev/null
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/icons/shared/BindableIconsRegistry.kt
@@ -0,0 +1,48 @@
+/*
+ * Copyright (C) 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.systemui.statusbar.pipeline.icons.shared
+
+import com.android.systemui.dagger.SysUISingleton
+import com.android.systemui.statusbar.pipeline.icons.shared.model.BindableIcon
+import javax.inject.Inject
+
+/**
+ * Bindable status bar icons represent icon descriptions which can be registered with
+ * StatusBarIconController and can also create their own bindings. A bound icon is responsible for
+ * its own updates via the [repeatWhenAttached] view lifecycle utility. Thus,
+ * StatusBarIconController can (and will) ignore any call to setIcon.
+ *
+ * In other words, these icons are bound once (at controller init) and they will control their
+ * visibility on their own (while their overall appearance remains at the discretion of
+ * StatusBarIconController, via the ModernStatusBarViewBinding interface).
+ */
+interface BindableIconsRegistry {
+    val bindableIcons: List<BindableIcon>
+}
+
+@SysUISingleton
+class BindableIconsRegistryImpl
+@Inject
+constructor(
+/** Bindables go here */
+) : BindableIconsRegistry {
+    /**
+     * Adding the injected bindables to this list will get them registered with
+     * StatusBarIconController
+     */
+    override val bindableIcons: List<BindableIcon> = listOf()
+}
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/icons/shared/model/BindableIcon.kt b/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/icons/shared/model/BindableIcon.kt
new file mode 100644
index 0000000..9d0d838
--- /dev/null
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/icons/shared/model/BindableIcon.kt
@@ -0,0 +1,55 @@
+/*
+ * Copyright (C) 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.systemui.statusbar.pipeline.icons.shared.model
+
+/**
+ * A BindableIcon describes a status bar icon that can be housed in the [ModernStatusBarView]
+ * created by [initializer]. They can be registered statically for [BindableIconsRepositoryImpl].
+ *
+ * Typical usage would be to create an (@SysUISingleton) adapter class that implements the
+ * interface. For example:
+ * ```
+ * @SysuUISingleton
+ * class MyBindableIconAdapter
+ * @Inject constructor(
+ *     // deps
+ *     val viewModel: MyViewModel
+ * ) : BindableIcon {
+ *     override val slot = "icon_slot_name"
+ *
+ *     override val initializer = ModernStatusBarViewCreator() {
+ *         SingleBindableStatusBarIconView.createView(context).also { iconView ->
+ *             MyIconViewBinder.bind(iconView, viewModel)
+ *         }
+ *     }
+ *
+ *     override fun shouldBind() = Flags.myFlag()
+ * }
+ * ```
+ *
+ * By defining this adapter (and injecting it into the repository), we get our icon registered with
+ * the legacy StatusBarIconController while proxying all updates to the view binder that is created
+ * elsewhere.
+ *
+ * Note that the initializer block defines a closure that can pull in the viewModel dependency
+ * without us having to store it directly in the icon controller.
+ */
+interface BindableIcon {
+    val slot: String
+    val initializer: ModernStatusBarViewCreator
+    val shouldBindIcon: Boolean
+}
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/icons/shared/model/ModernStatusBarViewCreator.kt b/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/icons/shared/model/ModernStatusBarViewCreator.kt
new file mode 100644
index 0000000..dbd5c1d
--- /dev/null
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/icons/shared/model/ModernStatusBarViewCreator.kt
@@ -0,0 +1,29 @@
+/*
+ * Copyright (C) 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.systemui.statusbar.pipeline.icons.shared.model
+
+import android.content.Context
+import com.android.systemui.statusbar.pipeline.shared.ui.view.ModernStatusBarView
+
+/**
+ * Defined as an interface (as opposed to a typealias) to simplify calling from java.
+ * [ModernStatusBarViewCreator.createAndBind] should return a constructed and bound
+ * [ModernStatusBarView].
+ */
+fun interface ModernStatusBarViewCreator {
+    fun createAndBind(context: Context): ModernStatusBarView
+}
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/mobile/domain/interactor/MobileIconsInteractor.kt b/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/mobile/domain/interactor/MobileIconsInteractor.kt
index dad4093..39135c7 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/mobile/domain/interactor/MobileIconsInteractor.kt
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/mobile/domain/interactor/MobileIconsInteractor.kt
@@ -71,6 +71,12 @@
     /** List of subscriptions, potentially filtered for CBRS */
     val filteredSubscriptions: Flow<List<SubscriptionModel>>
 
+    /**
+     * The current list of [MobileIconInteractor]s associated with the current list of
+     * [filteredSubscriptions]
+     */
+    val icons: StateFlow<List<MobileIconInteractor>>
+
     /** True if the active mobile data subscription has data enabled */
     val activeDataConnectionHasDataEnabled: StateFlow<Boolean>
 
@@ -259,6 +265,13 @@
         }
     }
 
+    override val icons =
+        filteredSubscriptions
+            .mapLatest { subs ->
+                subs.map { getMobileConnectionInteractorForSubId(it.subscriptionId) }
+            }
+            .stateIn(scope, SharingStarted.WhileSubscribed(), emptyList())
+
     /**
      * Copied from the old pipeline. We maintain a 2s period of time where we will keep the
      * validated bit from the old active network (A) while data is changing to the new one (B).
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/satellite/data/DeviceBasedSatelliteRepository.kt b/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/satellite/data/DeviceBasedSatelliteRepository.kt
new file mode 100644
index 0000000..ad8b810
--- /dev/null
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/satellite/data/DeviceBasedSatelliteRepository.kt
@@ -0,0 +1,37 @@
+/*
+ * Copyright (C) 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.systemui.statusbar.pipeline.satellite.data
+
+import com.android.systemui.statusbar.pipeline.satellite.shared.model.SatelliteConnectionState
+import kotlinx.coroutines.flow.Flow
+
+/**
+ * Device-based satellite refers to the capability of a device to connect directly to a satellite
+ * network. This is in contrast to carrier-based satellite connectivity, which is a property of a
+ * given mobile data subscription.
+ */
+interface DeviceBasedSatelliteRepository {
+    /** See [SatelliteConnectionState] for available states */
+    val connectionState: Flow<SatelliteConnectionState>
+
+    /** 0-4 level (similar to wifi and mobile) */
+    // @IntRange(from = 0, to = 4)
+    val signalStrength: Flow<Int>
+
+    /** Clients must observe this property, as device-based satellite is location-dependent */
+    val isSatelliteAllowedForCurrentLocation: Flow<Boolean>
+}
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/satellite/data/prod/DeviceBasedSatelliteRepositoryImpl.kt b/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/satellite/data/prod/DeviceBasedSatelliteRepositoryImpl.kt
new file mode 100644
index 0000000..8fc8b2f
--- /dev/null
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/satellite/data/prod/DeviceBasedSatelliteRepositoryImpl.kt
@@ -0,0 +1,268 @@
+/*
+ * Copyright (C) 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.systemui.statusbar.pipeline.satellite.data.prod
+
+import android.os.OutcomeReceiver
+import android.telephony.satellite.NtnSignalStrengthCallback
+import android.telephony.satellite.SatelliteManager
+import android.telephony.satellite.SatelliteStateCallback
+import com.android.systemui.common.coroutine.ConflatedCallbackFlow.conflatedCallbackFlow
+import com.android.systemui.dagger.SysUISingleton
+import com.android.systemui.dagger.qualifiers.Application
+import com.android.systemui.dagger.qualifiers.Background
+import com.android.systemui.statusbar.pipeline.satellite.data.DeviceBasedSatelliteRepository
+import com.android.systemui.statusbar.pipeline.satellite.data.prod.SatelliteSupport.Companion.whenSupported
+import com.android.systemui.statusbar.pipeline.satellite.data.prod.SatelliteSupport.NotSupported
+import com.android.systemui.statusbar.pipeline.satellite.data.prod.SatelliteSupport.Supported
+import com.android.systemui.statusbar.pipeline.satellite.data.prod.SatelliteSupport.Unknown
+import com.android.systemui.statusbar.pipeline.satellite.shared.model.SatelliteConnectionState
+import com.android.systemui.util.kotlin.getOrNull
+import com.android.systemui.util.time.SystemClock
+import java.util.Optional
+import javax.inject.Inject
+import kotlin.coroutines.resume
+import kotlinx.coroutines.CoroutineDispatcher
+import kotlinx.coroutines.CoroutineScope
+import kotlinx.coroutines.ExperimentalCoroutinesApi
+import kotlinx.coroutines.asExecutor
+import kotlinx.coroutines.channels.awaitClose
+import kotlinx.coroutines.delay
+import kotlinx.coroutines.flow.Flow
+import kotlinx.coroutines.flow.MutableStateFlow
+import kotlinx.coroutines.flow.collectLatest
+import kotlinx.coroutines.flow.distinctUntilChanged
+import kotlinx.coroutines.flow.flatMapLatest
+import kotlinx.coroutines.flow.flowOf
+import kotlinx.coroutines.flow.flowOn
+import kotlinx.coroutines.flow.map
+import kotlinx.coroutines.launch
+import kotlinx.coroutines.suspendCancellableCoroutine
+import kotlinx.coroutines.withContext
+
+/**
+ * A SatelliteManager that has responded that it has satellite support. Use [SatelliteSupport] to
+ * get one
+ */
+private typealias SupportedSatelliteManager = SatelliteManager
+
+/**
+ * "Supported" here means supported by the device. The value of this should be stable during the
+ * process lifetime.
+ */
+private sealed interface SatelliteSupport {
+    /** Not yet fetched */
+    data object Unknown : SatelliteSupport
+
+    /**
+     * SatelliteManager says that this mode is supported. Note that satellite manager can never be
+     * null now
+     */
+    data class Supported(val satelliteManager: SupportedSatelliteManager) : SatelliteSupport
+
+    /**
+     * Either we were told that there is no support for this feature, or the manager is null, or
+     * some other exception occurred while querying for support.
+     */
+    data object NotSupported : SatelliteSupport
+
+    @OptIn(ExperimentalCoroutinesApi::class)
+    companion object {
+        /** Convenience function to switch to the supported flow */
+        fun <T> Flow<SatelliteSupport>.whenSupported(
+            supported: (SatelliteManager) -> Flow<T>,
+            orElse: Flow<T>,
+        ): Flow<T> = flatMapLatest {
+            when (it) {
+                is Supported -> supported(it.satelliteManager)
+                else -> orElse
+            }
+        }
+    }
+}
+
+/**
+ * Basically your everyday run-of-the-mill system service listener, with three notable exceptions.
+ *
+ * First, there is an availability bit that we are tracking via [SatelliteManager]. See
+ * [isSatelliteAllowedForCurrentLocation] for the implementation details. The thing to note about
+ * this bit is that there is no callback that exists. Therefore we implement a simple polling
+ * mechanism here. Since the underlying bit is location-dependent, we simply poll every hour (see
+ * [POLLING_INTERVAL_MS]) and see what the current state is.
+ *
+ * Secondly, there are cases when simply requesting information from SatelliteManager can fail. See
+ * [SatelliteSupport] for details on how we track the state. What's worth noting here is that
+ * SUPPORTED is a stronger guarantee than [satelliteManager] being null. Therefore, the fundamental
+ * data flows here ([connectionState], [signalStrength],...) are wrapped in the convenience method
+ * [SatelliteSupport.whenSupported]. By defining flows as simple functions based on a
+ * [SupportedSatelliteManager], we can guarantee that the manager is non-null AND that it has told
+ * us that satellite is supported. Therefore, we don't expect exceptions to be thrown.
+ *
+ * Lastly, this class is designed to wait a full minute of process uptime before making any requests
+ * to the satellite manager. The hope is that by waiting we don't have to retry due to a modem that
+ * is still booting up or anything like that. We can tune or remove this behavior in the future if
+ * necessary.
+ */
+@SysUISingleton
+class DeviceBasedSatelliteRepositoryImpl
+@Inject
+constructor(
+    satelliteManagerOpt: Optional<SatelliteManager>,
+    @Background private val bgDispatcher: CoroutineDispatcher,
+    @Application private val scope: CoroutineScope,
+    private val systemClock: SystemClock,
+) : DeviceBasedSatelliteRepository {
+
+    private val satelliteManager: SatelliteManager?
+
+    override val isSatelliteAllowedForCurrentLocation: MutableStateFlow<Boolean>
+
+    // Some calls into satellite manager will throw exceptions if it is not supported.
+    // This is never expected to change after boot, but may need to be retried in some cases
+    private val satelliteSupport: MutableStateFlow<SatelliteSupport> = MutableStateFlow(Unknown)
+
+    init {
+        satelliteManager = satelliteManagerOpt.getOrNull()
+
+        isSatelliteAllowedForCurrentLocation = MutableStateFlow(false)
+
+        if (satelliteManager != null) {
+            // First, check that satellite is supported on this device
+            scope.launch {
+                ensureMinUptime(systemClock, MIN_UPTIME)
+                satelliteSupport.value = satelliteManager.checkSatelliteSupported()
+
+                // We only need to check location availability if this mode is supported
+                if (satelliteSupport.value is Supported) {
+                    isSatelliteAllowedForCurrentLocation.subscriptionCount
+                        .map { it > 0 }
+                        .distinctUntilChanged()
+                        .collectLatest { hasSubscribers ->
+                            if (hasSubscribers) {
+                                /*
+                                 * As there is no listener available for checking satellite allowed,
+                                 * we must poll. Defaulting to polling at most once every hour while
+                                 * active. Subsequent OOS events will restart the job, so a flaky
+                                 * connection might cause more frequent checks.
+                                 */
+                                while (true) {
+                                    checkIsSatelliteAllowed()
+                                    delay(POLLING_INTERVAL_MS)
+                                }
+                            }
+                        }
+                }
+            }
+        } else {
+            satelliteSupport.value = NotSupported
+        }
+    }
+
+    override val connectionState =
+        satelliteSupport.whenSupported(
+            supported = ::connectionStateFlow,
+            orElse = flowOf(SatelliteConnectionState.Off)
+        )
+
+    // By using the SupportedSatelliteManager here, we expect registration never to fail
+    private fun connectionStateFlow(sm: SupportedSatelliteManager): Flow<SatelliteConnectionState> =
+        conflatedCallbackFlow {
+                val cb = SatelliteStateCallback { state ->
+                    trySend(SatelliteConnectionState.fromModemState(state))
+                }
+
+                sm.registerForSatelliteModemStateChanged(bgDispatcher.asExecutor(), cb)
+
+                awaitClose { sm.unregisterForSatelliteModemStateChanged(cb) }
+            }
+            .flowOn(bgDispatcher)
+
+    override val signalStrength =
+        satelliteSupport.whenSupported(supported = ::signalStrengthFlow, orElse = flowOf(0))
+
+    // By using the SupportedSatelliteManager here, we expect registration never to fail
+    private fun signalStrengthFlow(sm: SupportedSatelliteManager) =
+        conflatedCallbackFlow {
+                val cb = NtnSignalStrengthCallback { signalStrength ->
+                    trySend(signalStrength.level)
+                }
+
+                sm.registerForNtnSignalStrengthChanged(bgDispatcher.asExecutor(), cb)
+
+                awaitClose { sm.unregisterForNtnSignalStrengthChanged(cb) }
+            }
+            .flowOn(bgDispatcher)
+
+    /** Fire off a request to check for satellite availability. Always runs on the bg context */
+    private suspend fun checkIsSatelliteAllowed() =
+        withContext(bgDispatcher) {
+            satelliteManager?.requestIsSatelliteCommunicationAllowedForCurrentLocation(
+                bgDispatcher.asExecutor(),
+                object : OutcomeReceiver<Boolean, SatelliteManager.SatelliteException> {
+                    override fun onError(e: SatelliteManager.SatelliteException) {
+                        android.util.Log.e(TAG, "Found exception when checking for satellite: ", e)
+                        isSatelliteAllowedForCurrentLocation.value = false
+                    }
+
+                    override fun onResult(allowed: Boolean) {
+                        isSatelliteAllowedForCurrentLocation.value = allowed
+                    }
+                }
+            )
+        }
+
+    private suspend fun SatelliteManager.checkSatelliteSupported(): SatelliteSupport =
+        suspendCancellableCoroutine { continuation ->
+            val cb =
+                object : OutcomeReceiver<Boolean, SatelliteManager.SatelliteException> {
+                    override fun onResult(supported: Boolean) {
+                        continuation.resume(
+                            if (supported) {
+                                Supported(satelliteManager = this@checkSatelliteSupported)
+                            } else {
+                                NotSupported
+                            }
+                        )
+                    }
+
+                    override fun onError(error: SatelliteManager.SatelliteException) {
+                        // Assume that an error means it's not supported
+                        continuation.resume(NotSupported)
+                    }
+                }
+
+            requestIsSatelliteSupported(bgDispatcher.asExecutor(), cb)
+        }
+
+    companion object {
+        // TTL for satellite polling is one hour
+        const val POLLING_INTERVAL_MS: Long = 1000 * 60 * 60
+
+        // Let the system boot up and stabilize before we check for system support
+        const val MIN_UPTIME: Long = 1000 * 60
+
+        private const val TAG = "DeviceBasedSatelliteRepo"
+
+        /** If our process hasn't been up for at least MIN_UPTIME, delay until we reach that time */
+        private suspend fun ensureMinUptime(clock: SystemClock, uptime: Long) {
+            val timeTilMinUptime =
+                uptime - (clock.uptimeMillis() - android.os.Process.getStartUptimeMillis())
+            if (timeTilMinUptime > 0) {
+                delay(timeTilMinUptime)
+            }
+        }
+    }
+}
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/satellite/domain/interactor/DeviceBasedSatelliteInteractor.kt b/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/satellite/domain/interactor/DeviceBasedSatelliteInteractor.kt
new file mode 100644
index 0000000..8779577
--- /dev/null
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/satellite/domain/interactor/DeviceBasedSatelliteInteractor.kt
@@ -0,0 +1,99 @@
+/*
+ * Copyright (C) 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.systemui.statusbar.pipeline.satellite.domain.interactor
+
+import com.android.internal.telephony.flags.Flags
+import com.android.systemui.dagger.SysUISingleton
+import com.android.systemui.dagger.qualifiers.Application
+import com.android.systemui.statusbar.pipeline.mobile.domain.interactor.MobileIconsInteractor
+import com.android.systemui.statusbar.pipeline.satellite.data.DeviceBasedSatelliteRepository
+import com.android.systemui.statusbar.pipeline.satellite.shared.model.SatelliteConnectionState
+import javax.inject.Inject
+import kotlinx.coroutines.CoroutineScope
+import kotlinx.coroutines.ExperimentalCoroutinesApi
+import kotlinx.coroutines.flow.Flow
+import kotlinx.coroutines.flow.SharingStarted
+import kotlinx.coroutines.flow.combine
+import kotlinx.coroutines.flow.flatMapLatest
+import kotlinx.coroutines.flow.flowOf
+import kotlinx.coroutines.flow.map
+import kotlinx.coroutines.flow.stateIn
+
+@SysUISingleton
+class DeviceBasedSatelliteInteractor
+@Inject
+constructor(
+    val repo: DeviceBasedSatelliteRepository,
+    iconsInteractor: MobileIconsInteractor,
+    @Application scope: CoroutineScope,
+) {
+    /** Must be observed by any UI showing Satellite iconography */
+    val isSatelliteAllowed =
+        if (Flags.oemEnabledSatelliteFlag()) {
+                repo.isSatelliteAllowedForCurrentLocation
+            } else {
+                flowOf(false)
+            }
+            .stateIn(scope, SharingStarted.WhileSubscribed(), false)
+
+    /** See [SatelliteConnectionState] for relevant states */
+    val connectionState =
+        if (Flags.oemEnabledSatelliteFlag()) {
+                repo.connectionState
+            } else {
+
+                flowOf(SatelliteConnectionState.Off)
+            }
+            .stateIn(scope, SharingStarted.WhileSubscribed(), SatelliteConnectionState.Off)
+
+    /** 0-4 description of the connection strength */
+    val signalStrength =
+        if (Flags.oemEnabledSatelliteFlag()) {
+                repo.signalStrength
+            } else {
+                flowOf(0)
+            }
+            .stateIn(scope, SharingStarted.WhileSubscribed(), 0)
+
+    /** When all connections are considered OOS, satellite connectivity is potentially valid */
+    val areAllConnectionsOutOfService =
+        if (Flags.oemEnabledSatelliteFlag()) {
+                iconsInteractor.icons.aggregateOver(selector = { intr -> intr.isInService }) {
+                    isInServiceList ->
+                    isInServiceList.all { !it }
+                }
+            } else {
+                flowOf(false)
+            }
+            .stateIn(scope, SharingStarted.WhileSubscribed(), false)
+}
+
+/**
+ * aggregateOver allows us to combine over the leaf-nodes of successive lists emitted from the
+ * top-level flow. Re-emits if the list changes, or any of the intermediate values change.
+ *
+ * Provides a way to connect the reactivity of the top-level flow with the reactivity of an
+ * arbitrarily-defined relationship ([selector]) from R to the flow that R exposes.
+ */
+@OptIn(ExperimentalCoroutinesApi::class)
+private inline fun <R, reified S, T> Flow<List<R>>.aggregateOver(
+    crossinline selector: (R) -> Flow<S>,
+    crossinline transform: (Array<S>) -> T
+): Flow<T> {
+    return map { list -> list.map { selector(it) } }
+        .flatMapLatest { newFlows -> combine(newFlows) { newVals -> transform(newVals) } }
+}
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/satellite/shared/model/SatelliteConnectionState.kt b/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/satellite/shared/model/SatelliteConnectionState.kt
new file mode 100644
index 0000000..bfe2941
--- /dev/null
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/pipeline/satellite/shared/model/SatelliteConnectionState.kt
@@ -0,0 +1,64 @@
+/*
+ * Copyright (C) 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.systemui.statusbar.pipeline.satellite.shared.model
+
+import android.telephony.satellite.SatelliteManager
+import android.telephony.satellite.SatelliteManager.SATELLITE_MODEM_STATE_CONNECTED
+import android.telephony.satellite.SatelliteManager.SATELLITE_MODEM_STATE_DATAGRAM_RETRYING
+import android.telephony.satellite.SatelliteManager.SATELLITE_MODEM_STATE_DATAGRAM_TRANSFERRING
+import android.telephony.satellite.SatelliteManager.SATELLITE_MODEM_STATE_IDLE
+import android.telephony.satellite.SatelliteManager.SATELLITE_MODEM_STATE_LISTENING
+import android.telephony.satellite.SatelliteManager.SATELLITE_MODEM_STATE_NOT_CONNECTED
+import android.telephony.satellite.SatelliteManager.SATELLITE_MODEM_STATE_OFF
+import android.telephony.satellite.SatelliteManager.SATELLITE_MODEM_STATE_UNAVAILABLE
+import android.telephony.satellite.SatelliteManager.SATELLITE_MODEM_STATE_UNKNOWN
+
+enum class SatelliteConnectionState {
+    // State is unknown or undefined
+    Unknown,
+    // Radio is off
+    Off,
+    // Radio is on, but not yet connected
+    On,
+    // Radio is connected, aka satellite is available for use
+    Connected;
+
+    companion object {
+        // TODO(b/316635648): validate these states. We don't need the level of granularity that
+        //  SatelliteManager gives us.
+        fun fromModemState(@SatelliteManager.SatelliteModemState modemState: Int) =
+            when (modemState) {
+                // Transferring data is connected
+                SATELLITE_MODEM_STATE_CONNECTED,
+                SATELLITE_MODEM_STATE_DATAGRAM_TRANSFERRING,
+                SATELLITE_MODEM_STATE_DATAGRAM_RETRYING -> Connected
+
+                // Modem is on but not connected
+                SATELLITE_MODEM_STATE_IDLE,
+                SATELLITE_MODEM_STATE_LISTENING,
+                SATELLITE_MODEM_STATE_NOT_CONNECTED -> On
+
+                // Consider unavailable equivalent to Off
+                SATELLITE_MODEM_STATE_UNAVAILABLE,
+                SATELLITE_MODEM_STATE_OFF -> Off
+
+                // Else, we don't know what's up
+                SATELLITE_MODEM_STATE_UNKNOWN -> Unknown
+                else -> Unknown
+            }
+    }
+}
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/policy/BatteryControllerImpl.java b/packages/SystemUI/src/com/android/systemui/statusbar/policy/BatteryControllerImpl.java
index 41ed76d..45078e3 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/policy/BatteryControllerImpl.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/policy/BatteryControllerImpl.java
@@ -20,6 +20,7 @@
 import static android.os.BatteryManager.CHARGING_POLICY_DEFAULT;
 import static android.os.BatteryManager.EXTRA_CHARGING_STATUS;
 import static android.os.BatteryManager.EXTRA_PRESENT;
+
 import static com.android.settingslib.fuelgauge.BatterySaverLogging.SAVER_ENABLED_QS;
 import static com.android.systemui.util.DumpUtilsKt.asIndenting;
 
@@ -61,6 +62,7 @@
 import java.util.ArrayList;
 import java.util.List;
 import java.util.concurrent.atomic.AtomicReference;
+import java.util.function.Consumer;
 
 import javax.annotation.concurrent.GuardedBy;
 
@@ -448,50 +450,38 @@
         firePowerSaveChanged();
     }
 
+    protected final void dispatchSafeChange(Consumer<BatteryStateChangeCallback> action) {
+        ArrayList<BatteryStateChangeCallback> copy;
+        synchronized (mChangeCallbacks) {
+            copy = new ArrayList<>(mChangeCallbacks);
+        }
+        final int n = copy.size();
+        for (int i = 0; i < n; i++) {
+            action.accept(copy.get(i));
+        }
+    }
+
     protected void fireBatteryLevelChanged() {
         mLogger.logBatteryLevelChangedCallback(mLevel, mPluggedIn, mCharging);
-        synchronized (mChangeCallbacks) {
-            final int N = mChangeCallbacks.size();
-            for (int i = 0; i < N; i++) {
-                mChangeCallbacks.get(i).onBatteryLevelChanged(mLevel, mPluggedIn, mCharging);
-            }
-        }
+        dispatchSafeChange(
+                (callback) -> callback.onBatteryLevelChanged(mLevel, mPluggedIn, mCharging));
     }
 
     private void fireBatteryUnknownStateChanged() {
-        synchronized (mChangeCallbacks) {
-            final int n = mChangeCallbacks.size();
-            for (int i = 0; i < n; i++) {
-                mChangeCallbacks.get(i).onBatteryUnknownStateChanged(mStateUnknown);
-            }
-        }
+        dispatchSafeChange((callback) -> callback.onBatteryUnknownStateChanged(mStateUnknown));
     }
 
     private void firePowerSaveChanged() {
-        synchronized (mChangeCallbacks) {
-            final int N = mChangeCallbacks.size();
-            for (int i = 0; i < N; i++) {
-                mChangeCallbacks.get(i).onPowerSaveChanged(mPowerSave);
-            }
-        }
+        dispatchSafeChange((callback) -> callback.onPowerSaveChanged(mPowerSave));
     }
 
     private void fireIsBatteryDefenderChanged() {
-        synchronized (mChangeCallbacks) {
-            final int n = mChangeCallbacks.size();
-            for (int i = 0; i < n; i++) {
-                mChangeCallbacks.get(i).onIsBatteryDefenderChanged(mIsBatteryDefender);
-            }
-        }
+        dispatchSafeChange((callback) -> callback.onIsBatteryDefenderChanged(mIsBatteryDefender));
     }
 
     private void fireIsIncompatibleChargingChanged() {
-        synchronized (mChangeCallbacks) {
-            final int n = mChangeCallbacks.size();
-            for (int i = 0; i < n; i++) {
-                mChangeCallbacks.get(i).onIsIncompatibleChargingChanged(mIsIncompatibleCharging);
-            }
-        }
+        dispatchSafeChange(
+                (callback) -> callback.onIsIncompatibleChargingChanged(mIsIncompatibleCharging));
     }
 
     @Override
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/policy/BluetoothControllerImpl.java b/packages/SystemUI/src/com/android/systemui/statusbar/policy/BluetoothControllerImpl.java
index 53b343c..fc2f6e9 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/policy/BluetoothControllerImpl.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/policy/BluetoothControllerImpl.java
@@ -436,6 +436,8 @@
     @Override
     public void onServiceDisconnected() {}
 
+    // IMPORTANT: This handler guarantees that any operations on the list of callbacks is
+    // sequential, so no concurrent exceptions
     private final class H extends Handler {
         private final ArrayList<BluetoothController.Callback> mCallbacks = new ArrayList<>();
 
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/policy/CastControllerImpl.java b/packages/SystemUI/src/com/android/systemui/statusbar/policy/CastControllerImpl.java
index b06ebe9..149c8fa 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/policy/CastControllerImpl.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/policy/CastControllerImpl.java
@@ -35,9 +35,9 @@
 import androidx.annotation.VisibleForTesting;
 
 import com.android.internal.annotations.GuardedBy;
-import com.android.systemui.res.R;
 import com.android.systemui.dagger.SysUISingleton;
 import com.android.systemui.dump.DumpManager;
+import com.android.systemui.res.R;
 import com.android.systemui.util.Utils;
 
 import java.io.PrintWriter;
@@ -291,11 +291,12 @@
 
     @VisibleForTesting
     void fireOnCastDevicesChanged() {
+        final ArrayList<Callback> callbacks;
         synchronized (mCallbacks) {
-            for (Callback callback : mCallbacks) {
-                fireOnCastDevicesChanged(callback);
-            }
-
+            callbacks = new ArrayList<>(mCallbacks);
+        }
+        for (Callback callback : callbacks) {
+            fireOnCastDevicesChanged(callback);
         }
     }
 
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/policy/DataSaverControllerImpl.java b/packages/SystemUI/src/com/android/systemui/statusbar/policy/DataSaverControllerImpl.java
index 8207012..6319781 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/policy/DataSaverControllerImpl.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/policy/DataSaverControllerImpl.java
@@ -36,10 +36,12 @@
     }
 
     private void handleRestrictBackgroundChanged(boolean isDataSaving) {
+        ArrayList<DataSaverController.Listener> copy;
         synchronized (mListeners) {
-            for (int i = 0; i < mListeners.size(); i++) {
-                mListeners.get(i).onDataSaverChanged(isDataSaving);
-            }
+            copy = new ArrayList<>(mListeners);
+        }
+        for (int i = 0; i < copy.size(); i++) {
+            copy.get(i).onDataSaverChanged(isDataSaving);
         }
     }
 
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/policy/FlashlightControllerImpl.java b/packages/SystemUI/src/com/android/systemui/statusbar/policy/FlashlightControllerImpl.java
index 5dcafb3..b98eff8 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/policy/FlashlightControllerImpl.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/policy/FlashlightControllerImpl.java
@@ -202,10 +202,12 @@
 
     private void dispatchListeners(int message, boolean argument) {
         synchronized (mListeners) {
-            final int N = mListeners.size();
+            final ArrayList<WeakReference<FlashlightController.FlashlightListener>> copy =
+                    new ArrayList<>(mListeners);
+            final int n = copy.size();
             boolean cleanup = false;
-            for (int i = 0; i < N; i++) {
-                FlashlightListener l = mListeners.get(i).get();
+            for (int i = 0; i < n; i++) {
+                FlashlightListener l = copy.get(i).get();
                 if (l != null) {
                     if (message == DISPATCH_ERROR) {
                         l.onFlashlightError();
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/policy/IndividualSensorPrivacyControllerImpl.java b/packages/SystemUI/src/com/android/systemui/statusbar/policy/IndividualSensorPrivacyControllerImpl.java
index fffd839..87dfc99 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/policy/IndividualSensorPrivacyControllerImpl.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/policy/IndividualSensorPrivacyControllerImpl.java
@@ -119,7 +119,8 @@
             mHardwareToggleState.put(sensor, enabled);
         }
 
-        for (Callback callback : mCallbacks) {
+        Set<Callback> copy = new ArraySet<>(mCallbacks);
+        for (Callback callback : copy) {
             callback.onSensorBlockedChanged(sensor, isSensorBlocked(sensor));
         }
     }
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/policy/LocationControllerImpl.java b/packages/SystemUI/src/com/android/systemui/statusbar/policy/LocationControllerImpl.java
index e5f72eb..9eee5d0 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/policy/LocationControllerImpl.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/policy/LocationControllerImpl.java
@@ -356,6 +356,8 @@
         updateActiveLocationRequests();
     }
 
+    // IMPORTANT: This handler guarantees that any operations on the list of callbacks is
+    // sequential, so no concurrent exceptions
     private final class H extends Handler {
         private static final int MSG_LOCATION_SETTINGS_CHANGED = 1;
         private static final int MSG_LOCATION_ACTIVE_CHANGED = 2;
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/policy/NextAlarmControllerImpl.java b/packages/SystemUI/src/com/android/systemui/statusbar/policy/NextAlarmControllerImpl.java
index 63b9ff9..b7d8ee3 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/policy/NextAlarmControllerImpl.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/policy/NextAlarmControllerImpl.java
@@ -124,9 +124,10 @@
     }
 
     private void fireNextAlarmChanged() {
-        int n = mChangeCallbacks.size();
+        ArrayList<NextAlarmChangeCallback> copy = new ArrayList<>(mChangeCallbacks);
+        int n = copy.size();
         for (int i = 0; i < n; i++) {
-            mChangeCallbacks.get(i).onNextAlarmChanged(mNextAlarm);
+            copy.get(i).onNextAlarmChanged(mNextAlarm);
         }
     }
 }
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/policy/SafetyController.java b/packages/SystemUI/src/com/android/systemui/statusbar/policy/SafetyController.java
index f3d183c..0176abd 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/policy/SafetyController.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/policy/SafetyController.java
@@ -100,10 +100,13 @@
     }
 
     private void handleSafetyCenterEnableChange() {
+        final ArrayList<SafetyController.Listener> copy;
         synchronized (mListeners) {
-            for (int i = 0; i < mListeners.size(); i++) {
-                mListeners.get(i).onSafetyCenterEnableChanged(mSafetyCenterEnabled);
-            }
+            copy = new ArrayList<>(mListeners);
+        }
+        final int n = copy.size();
+        for (int i = 0; i < n; i++) {
+            copy.get(i).onSafetyCenterEnableChanged(mSafetyCenterEnabled);
         }
     }
 
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/policy/SecurityControllerImpl.java b/packages/SystemUI/src/com/android/systemui/statusbar/policy/SecurityControllerImpl.java
index 4a4d4e1..5d69f36 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/policy/SecurityControllerImpl.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/policy/SecurityControllerImpl.java
@@ -50,12 +50,12 @@
 import com.android.internal.annotations.GuardedBy;
 import com.android.internal.net.LegacyVpnInfo;
 import com.android.internal.net.VpnConfig;
-import com.android.systemui.res.R;
 import com.android.systemui.broadcast.BroadcastDispatcher;
 import com.android.systemui.dagger.SysUISingleton;
 import com.android.systemui.dagger.qualifiers.Background;
 import com.android.systemui.dagger.qualifiers.Main;
 import com.android.systemui.dump.DumpManager;
+import com.android.systemui.res.R;
 import com.android.systemui.settings.UserTracker;
 
 import org.xmlpull.v1.XmlPullParserException;
@@ -429,10 +429,12 @@
     }
 
     private void fireCallbacks() {
+        final ArrayList<SecurityControllerCallback> copy;
         synchronized (mCallbacks) {
-            for (SecurityControllerCallback callback : mCallbacks) {
-                callback.onStateChanged();
-            }
+            copy = new ArrayList<>(mCallbacks);
+        }
+        for (SecurityControllerCallback callback : copy) {
+            callback.onStateChanged();
         }
     }
 
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/policy/ZenModeControllerImpl.java b/packages/SystemUI/src/com/android/systemui/statusbar/policy/ZenModeControllerImpl.java
index 66bf527..df210b0 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/policy/ZenModeControllerImpl.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/policy/ZenModeControllerImpl.java
@@ -48,12 +48,12 @@
 import com.android.systemui.dagger.qualifiers.Main;
 import com.android.systemui.dump.DumpManager;
 import com.android.systemui.settings.UserTracker;
-import com.android.systemui.util.Utils;
 import com.android.systemui.util.settings.GlobalSettings;
 
 import java.io.PrintWriter;
 import java.util.ArrayList;
 import java.util.Objects;
+import java.util.function.Consumer;
 
 import javax.inject.Inject;
 
@@ -243,46 +243,43 @@
     }
 
     private void fireNextAlarmChanged() {
-        synchronized (mCallbacksLock) {
-            Utils.safeForeach(mCallbacks, c -> c.onNextAlarmChanged());
-        }
+        fireSafeChange(Callback::onNextAlarmChanged);
     }
 
     private void fireEffectsSuppressorChanged() {
-        synchronized (mCallbacksLock) {
-            Utils.safeForeach(mCallbacks, c -> c.onEffectsSupressorChanged());
-        }
+        fireSafeChange(Callback::onEffectsSupressorChanged);
     }
 
     private void fireZenChanged(int zen) {
-        synchronized (mCallbacksLock) {
-            Utils.safeForeach(mCallbacks, c -> c.onZenChanged(zen));
-        }
+        fireSafeChange(c -> c.onZenChanged(zen));
     }
 
     private void fireZenAvailableChanged(boolean available) {
-        synchronized (mCallbacksLock) {
-            Utils.safeForeach(mCallbacks, c -> c.onZenAvailableChanged(available));
-        }
+        fireSafeChange(c -> c.onZenAvailableChanged(available));
     }
 
     private void fireManualRuleChanged(ZenRule rule) {
-        synchronized (mCallbacksLock) {
-            Utils.safeForeach(mCallbacks, c -> c.onManualRuleChanged(rule));
-        }
+        fireSafeChange(c -> c.onManualRuleChanged(rule));
     }
 
     private void fireConsolidatedPolicyChanged(NotificationManager.Policy policy) {
+        fireSafeChange(c -> c.onConsolidatedPolicyChanged(policy));
+    }
+
+    private void fireSafeChange(Consumer<Callback> action) {
+        final ArrayList<Callback> copy;
         synchronized (mCallbacksLock) {
-            Utils.safeForeach(mCallbacks, c -> c.onConsolidatedPolicyChanged(policy));
+            copy = new ArrayList<>(mCallbacks);
+        }
+        final int n = copy.size();
+        for (int i = 0; i < n; i++) {
+            action.accept(copy.get(i));
         }
     }
 
     @VisibleForTesting
     protected void fireConfigChanged(ZenModeConfig config) {
-        synchronized (mCallbacksLock) {
-            Utils.safeForeach(mCallbacks, c -> c.onConfigChanged(config));
-        }
+        fireSafeChange(c -> c.onConfigChanged(config));
     }
 
     @VisibleForTesting
diff --git a/packages/SystemUI/src/com/android/systemui/util/ReferenceExt.kt b/packages/SystemUI/src/com/android/systemui/util/ReferenceExt.kt
index ac04d31..4f7dce3 100644
--- a/packages/SystemUI/src/com/android/systemui/util/ReferenceExt.kt
+++ b/packages/SystemUI/src/com/android/systemui/util/ReferenceExt.kt
@@ -2,6 +2,7 @@
 
 import java.lang.ref.SoftReference
 import java.lang.ref.WeakReference
+import java.util.concurrent.atomic.AtomicReference
 import kotlin.properties.ReadWriteProperty
 import kotlin.reflect.KProperty
 
@@ -48,3 +49,25 @@
         }
     }
 }
+
+/**
+ * Creates a nullable Kotlin idiomatic [AtomicReference].
+ *
+ * Usage:
+ * ```
+ * var atomicReferenceObj: Object? by nullableAtomicReference(null)
+ * atomicReferenceObj = Object()
+ * ```
+ */
+fun <T> nullableAtomicReference(obj: T? = null): ReadWriteProperty<Any?, T?> {
+    return object : ReadWriteProperty<Any?, T?> {
+        val t = AtomicReference(obj)
+        override fun getValue(thisRef: Any?, property: KProperty<*>): T? {
+            return t.get()
+        }
+
+        override fun setValue(thisRef: Any?, property: KProperty<*>, value: T?) {
+            t.set(value)
+        }
+    }
+}
diff --git a/packages/SystemUI/src/com/android/systemui/util/service/ObservableServiceConnection.java b/packages/SystemUI/src/com/android/systemui/util/service/ObservableServiceConnection.java
index df5162a..3d724e1 100644
--- a/packages/SystemUI/src/com/android/systemui/util/service/ObservableServiceConnection.java
+++ b/packages/SystemUI/src/com/android/systemui/util/service/ObservableServiceConnection.java
@@ -22,12 +22,17 @@
 import android.content.Intent;
 import android.content.ServiceConnection;
 import android.os.IBinder;
+import android.util.IndentingPrintWriter;
 import android.util.Log;
 
+import androidx.annotation.NonNull;
+
 import com.android.systemui.dagger.qualifiers.Main;
 import com.android.systemui.settings.UserTracker;
+import com.android.systemui.util.DumpUtilsKt;
 import com.android.systemui.util.annotations.WeaklyReferencedCallback;
 
+import java.io.PrintWriter;
 import java.lang.annotation.Retention;
 import java.lang.annotation.RetentionPolicy;
 import java.lang.ref.WeakReference;
@@ -244,6 +249,21 @@
         });
     }
 
+    void dump(@NonNull PrintWriter pw) {
+        IndentingPrintWriter ipw = DumpUtilsKt.asIndenting(pw);
+        ipw.println("ObservableServiceConnection state:");
+        DumpUtilsKt.withIncreasedIndent(ipw, () -> {
+            ipw.println("mServiceIntent: " + mServiceIntent);
+            ipw.println("mLastDisconnectReason: " + mLastDisconnectReason.orElse(-1));
+            ipw.println("Callbacks:");
+            DumpUtilsKt.withIncreasedIndent(ipw, () -> {
+                for (WeakReference<Callback<T>> cbRef : mCallbacks) {
+                    ipw.println(cbRef.get());
+                }
+            });
+        });
+    }
+
     private void applyToCallbacksLocked(Consumer<Callback<T>> applicator) {
         final Iterator<WeakReference<Callback<T>>> iterator = mCallbacks.iterator();
 
diff --git a/packages/SystemUI/src/com/android/systemui/util/service/PersistentConnectionManager.java b/packages/SystemUI/src/com/android/systemui/util/service/PersistentConnectionManager.java
index 6e19bed..9b72eb7 100644
--- a/packages/SystemUI/src/com/android/systemui/util/service/PersistentConnectionManager.java
+++ b/packages/SystemUI/src/com/android/systemui/util/service/PersistentConnectionManager.java
@@ -17,6 +17,7 @@
 package com.android.systemui.util.service;
 
 import static com.android.systemui.util.service.dagger.ObservableServiceModule.BASE_RECONNECT_DELAY_MS;
+import static com.android.systemui.util.service.dagger.ObservableServiceModule.DUMPSYS_NAME;
 import static com.android.systemui.util.service.dagger.ObservableServiceModule.MAX_RECONNECT_ATTEMPTS;
 import static com.android.systemui.util.service.dagger.ObservableServiceModule.MIN_CONNECTION_DURATION_MS;
 import static com.android.systemui.util.service.dagger.ObservableServiceModule.OBSERVER;
@@ -24,9 +25,15 @@
 
 import android.util.Log;
 
+import androidx.annotation.NonNull;
+
+import com.android.systemui.Dumpable;
+import com.android.systemui.dump.DumpManager;
 import com.android.systemui.util.concurrency.DelayableExecutor;
 import com.android.systemui.util.time.SystemClock;
 
+import java.io.PrintWriter;
+
 import javax.inject.Inject;
 import javax.inject.Named;
 
@@ -35,7 +42,7 @@
  * {@link ObservableServiceConnection}.
  * @param <T> The transformed connection type handled by the service.
  */
-public class PersistentConnectionManager<T> {
+public class PersistentConnectionManager<T> implements Dumpable {
     private static final String TAG = "PersistentConnManager";
     private static final boolean DEBUG = Log.isLoggable(TAG, Log.DEBUG);
 
@@ -45,6 +52,8 @@
     private final int mMaxReconnectAttempts;
     private final int mMinConnectionDuration;
     private final Observer mObserver;
+    private final DumpManager mDumpManager;
+    private final String mDumpsysName;
 
     private int mReconnectAttempts = 0;
     private Runnable mCurrentReconnectCancelable;
@@ -89,6 +98,8 @@
     public PersistentConnectionManager(
             SystemClock clock,
             DelayableExecutor mainExecutor,
+            DumpManager dumpManager,
+            @Named(DUMPSYS_NAME) String dumpsysName,
             @Named(SERVICE_CONNECTION) ObservableServiceConnection<T> serviceConnection,
             @Named(MAX_RECONNECT_ATTEMPTS) int maxReconnectAttempts,
             @Named(BASE_RECONNECT_DELAY_MS) int baseReconnectDelayMs,
@@ -98,6 +109,8 @@
         mMainExecutor = mainExecutor;
         mConnection = serviceConnection;
         mObserver = observer;
+        mDumpManager = dumpManager;
+        mDumpsysName = TAG + "#" + dumpsysName;
 
         mMaxReconnectAttempts = maxReconnectAttempts;
         mBaseReconnectDelayMs = baseReconnectDelayMs;
@@ -108,6 +121,7 @@
      * Begins the {@link PersistentConnectionManager} by connecting to the associated service.
      */
     public void start() {
+        mDumpManager.registerCriticalDumpable(mDumpsysName, this);
         mConnection.addCallback(mConnectionCallback);
         mObserver.addCallback(mObserverCallback);
         initiateConnectionAttempt();
@@ -120,6 +134,32 @@
         mConnection.removeCallback(mConnectionCallback);
         mObserver.removeCallback(mObserverCallback);
         mConnection.unbind();
+        mDumpManager.unregisterDumpable(mDumpsysName);
+    }
+
+    /**
+     * Add a callback to the {@link ObservableServiceConnection}.
+     * @param callback The callback to add.
+     */
+    public void addConnectionCallback(ObservableServiceConnection.Callback<T> callback) {
+        mConnection.addCallback(callback);
+    }
+
+    /**
+     * Remove a callback from the {@link ObservableServiceConnection}.
+     * @param callback The callback to remove.
+     */
+    public void removeConnectionCallback(ObservableServiceConnection.Callback<T> callback) {
+        mConnection.removeCallback(callback);
+    }
+
+    @Override
+    public void dump(@NonNull PrintWriter pw, @NonNull String[] args) {
+        pw.println("mMaxReconnectAttempts: " + mMaxReconnectAttempts);
+        pw.println("mBaseReconnectDelayMs: " + mBaseReconnectDelayMs);
+        pw.println("mMinConnectionDuration: " + mMinConnectionDuration);
+        pw.println("mReconnectAttempts: " + mReconnectAttempts);
+        mConnection.dump(pw);
     }
 
     private void initiateConnectionAttempt() {
diff --git a/packages/SystemUI/src/com/android/systemui/util/service/dagger/ObservableServiceModule.java b/packages/SystemUI/src/com/android/systemui/util/service/dagger/ObservableServiceModule.java
index bcf34f8..c52c524 100644
--- a/packages/SystemUI/src/com/android/systemui/util/service/dagger/ObservableServiceModule.java
+++ b/packages/SystemUI/src/com/android/systemui/util/service/dagger/ObservableServiceModule.java
@@ -19,14 +19,14 @@
 
 import android.content.res.Resources;
 
-import com.android.systemui.res.R;
 import com.android.systemui.dagger.qualifiers.Main;
-
-import javax.inject.Named;
+import com.android.systemui.res.R;
 
 import dagger.Module;
 import dagger.Provides;
 
+import javax.inject.Named;
+
 /**
  * Module containing components and parameters for
  * {@link com.android.systemui.util.service.ObservableServiceConnection}
@@ -41,6 +41,7 @@
     public static final String MIN_CONNECTION_DURATION_MS = "min_connection_duration_ms";
     public static final String SERVICE_CONNECTION = "service_connection";
     public static final String OBSERVER = "observer";
+    public static final String DUMPSYS_NAME = "dumpsys_name";
 
     @Provides
     @Named(MAX_RECONNECT_ATTEMPTS)
diff --git a/packages/SystemUI/tests/src/com/android/systemui/FaceScanningProviderFactoryTest.kt b/packages/SystemUI/tests/src/com/android/systemui/FaceScanningProviderFactoryTest.kt
index 342494d..46936d6 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/FaceScanningProviderFactoryTest.kt
+++ b/packages/SystemUI/tests/src/com/android/systemui/FaceScanningProviderFactoryTest.kt
@@ -25,6 +25,7 @@
 import com.android.internal.R
 import com.android.keyguard.KeyguardUpdateMonitor
 import com.android.systemui.biometrics.AuthController
+import com.android.systemui.biometrics.data.repository.FakeFacePropertyRepository
 import com.android.systemui.decor.FaceScanningProviderFactory
 import com.android.systemui.log.ScreenDecorationsLogger
 import com.android.systemui.log.logcatLogBuffer
@@ -53,6 +54,8 @@
 
     @Mock private lateinit var keyguardUpdateMonitor: KeyguardUpdateMonitor
 
+    private val facePropertyRepository = FakeFacePropertyRepository()
+
     private val displayId = 2
 
     @Before
@@ -86,9 +89,10 @@
                 keyguardUpdateMonitor,
                 mock(Executor::class.java),
                 ScreenDecorationsLogger(logcatLogBuffer("FaceScanningProviderFactoryTest")),
+                facePropertyRepository,
             )
 
-        whenever(authController.faceSensorLocation).thenReturn(Point(10, 10))
+        facePropertyRepository.setSensorLocation(Point(10, 10))
     }
 
     @Test
diff --git a/packages/SystemUI/tests/src/com/android/systemui/ScreenDecorationsTest.java b/packages/SystemUI/tests/src/com/android/systemui/ScreenDecorationsTest.java
index c094df5..c07148b 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/ScreenDecorationsTest.java
+++ b/packages/SystemUI/tests/src/com/android/systemui/ScreenDecorationsTest.java
@@ -54,6 +54,7 @@
 import android.content.res.TypedArray;
 import android.graphics.Path;
 import android.graphics.PixelFormat;
+import android.graphics.Point;
 import android.graphics.Rect;
 import android.graphics.drawable.Drawable;
 import android.hardware.display.DisplayManager;
@@ -80,6 +81,7 @@
 
 import com.android.keyguard.KeyguardUpdateMonitor;
 import com.android.systemui.biometrics.AuthController;
+import com.android.systemui.biometrics.data.repository.FakeFacePropertyRepository;
 import com.android.systemui.decor.CornerDecorProvider;
 import com.android.systemui.decor.CutoutDecorProviderFactory;
 import com.android.systemui.decor.CutoutDecorProviderImpl;
@@ -101,6 +103,7 @@
 import com.android.systemui.statusbar.events.PrivacyDotViewController;
 import com.android.systemui.util.concurrency.FakeExecutor;
 import com.android.systemui.util.concurrency.FakeThreadFactory;
+import com.android.systemui.util.kotlin.JavaAdapter;
 import com.android.systemui.util.settings.FakeSettings;
 import com.android.systemui.util.settings.SecureSettings;
 import com.android.systemui.util.time.FakeSystemClock;
@@ -108,8 +111,6 @@
 import org.junit.Before;
 import org.junit.Test;
 import org.junit.runner.RunWith;
-import org.mockito.ArgumentCaptor;
-import org.mockito.Captor;
 import org.mockito.Mock;
 import org.mockito.MockitoAnnotations;
 import org.mockito.invocation.InvocationOnMock;
@@ -169,8 +170,11 @@
     private PrivacyDotViewController.ShowingListener mPrivacyDotShowingListener;
     @Mock
     private CutoutDecorProviderFactory mCutoutFactory;
-    @Captor
-    private ArgumentCaptor<AuthController.Callback> mAuthControllerCallback;
+    @Mock
+    private JavaAdapter mJavaAdapter;
+
+    private FakeFacePropertyRepository mFakeFacePropertyRepository =
+            new FakeFacePropertyRepository();
     private List<DecorProvider> mMockCutoutList;
 
     @Before
@@ -227,20 +231,23 @@
         doAnswer(it -> !(mMockCutoutList.isEmpty())).when(mCutoutFactory).getHasProviders();
         doReturn(mMockCutoutList).when(mCutoutFactory).getProviders();
 
+        mFakeFacePropertyRepository.setSensorLocation(new Point(10, 10));
+
         mFaceScanningDecorProvider = spy(new FaceScanningOverlayProviderImpl(
                 BOUNDS_POSITION_TOP,
                 mAuthController,
                 mStatusBarStateController,
                 mKeyguardUpdateMonitor,
                 mExecutor,
-                new ScreenDecorationsLogger(logcatLogBuffer("TestLogBuffer"))));
+                new ScreenDecorationsLogger(logcatLogBuffer("TestLogBuffer")),
+                mFakeFacePropertyRepository));
 
         mScreenDecorations = spy(new ScreenDecorations(mContext, mSecureSettings,
                 mCommandRegistry, mUserTracker, mDisplayTracker, mDotViewController,
                 mThreadFactory,
                 mPrivacyDotDecorProviderFactory, mFaceScanningProviderFactory,
                 new ScreenDecorationsLogger(logcatLogBuffer("TestLogBuffer")),
-                mAuthController) {
+                mFakeFacePropertyRepository, mJavaAdapter) {
             @Override
             public void start() {
                 super.start();
@@ -1235,9 +1242,9 @@
                 mSecureSettings, mCommandRegistry, mUserTracker, mDisplayTracker,
                 mDotViewController,
                 mThreadFactory, mPrivacyDotDecorProviderFactory, mFaceScanningProviderFactory,
-                new ScreenDecorationsLogger(logcatLogBuffer("TestLogBuffer")), mAuthController);
+                new ScreenDecorationsLogger(logcatLogBuffer("TestLogBuffer")),
+                mFakeFacePropertyRepository, mJavaAdapter);
         screenDecorations.start();
-        verify(mAuthController).addCallback(mAuthControllerCallback.capture());
         when(mContext.getDisplay()).thenReturn(mDisplay);
         when(mDisplay.getDisplayInfo(any())).thenAnswer(new Answer<Boolean>() {
             @Override
@@ -1252,9 +1259,9 @@
         });
         mExecutor.runAllReady();
         clearInvocations(mFaceScanningDecorProvider);
-
-        AuthController.Callback callback = mAuthControllerCallback.getValue();
-        callback.onFaceSensorLocationChanged();
+        final Point location = new Point();
+        mFakeFacePropertyRepository.setSensorLocation(location);
+        screenDecorations.onFaceSensorLocationChanged(location);
         mExecutor.runAllReady();
 
         verify(mFaceScanningDecorProvider).onReloadResAndMeasure(any(),
diff --git a/packages/SystemUI/tests/src/com/android/systemui/accessibility/fontscaling/FontScalingDialogDelegateTest.kt b/packages/SystemUI/tests/src/com/android/systemui/accessibility/fontscaling/FontScalingDialogDelegateTest.kt
index c525711..9b6c8cd 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/accessibility/fontscaling/FontScalingDialogDelegateTest.kt
+++ b/packages/SystemUI/tests/src/com/android/systemui/accessibility/fontscaling/FontScalingDialogDelegateTest.kt
@@ -25,14 +25,12 @@
 import android.widget.Button
 import android.widget.SeekBar
 import androidx.test.filters.SmallTest
-import com.android.systemui.res.R
 import com.android.systemui.SysuiTestCase
 import com.android.systemui.animation.DialogLaunchAnimator
 import com.android.systemui.common.ui.view.SeekBarWithIconButtonsView
 import com.android.systemui.common.ui.view.SeekBarWithIconButtonsView.OnSeekBarWithIconButtonsChangeListener
-import com.android.systemui.flags.FakeFeatureFlags
-import com.android.systemui.flags.Flags
 import com.android.systemui.model.SysUiState
+import com.android.systemui.res.R
 import com.android.systemui.settings.UserTracker
 import com.android.systemui.statusbar.phone.SystemUIDialog
 import com.android.systemui.statusbar.phone.SystemUIDialog.DEFAULT_DISMISS_ON_DEVICE_LOCK
@@ -78,7 +76,6 @@
     @Mock private lateinit var dialogManager: SystemUIDialogManager
     @Mock private lateinit var dialogFactory: SystemUIDialog.Factory
     @Mock private lateinit var userTracker: UserTracker
-    private val featureFlags = FakeFeatureFlags()
     @Mock private lateinit var sysuiState: SysUiState
     @Mock private lateinit var dialogLaunchAnimator: DialogLaunchAnimator
 
@@ -88,7 +85,6 @@
         testableLooper = TestableLooper.get(this)
         val mainHandler = Handler(testableLooper.looper)
         systemSettings = FakeSettings()
-        featureFlags.set(Flags.WM_ENABLE_PREDICTIVE_BACK_QS_DIALOG_ANIM, true)
         // Guarantee that the systemSettings always starts with the default font scale.
         systemSettings.putFloatForUser(Settings.System.FONT_SCALE, 1.0f, userTracker.userId)
         secureSettings = FakeSettings()
@@ -96,29 +92,32 @@
         backgroundDelayableExecutor = FakeExecutor(systemClock)
         whenever(sysuiState.setFlag(anyInt(), anyBoolean())).thenReturn(sysuiState)
 
-        fontScalingDialogDelegate = spy(FontScalingDialogDelegate(
-                mContext,
-                dialogFactory,
-                LayoutInflater.from(mContext),
-                systemSettings,
-                secureSettings,
-                systemClock,
-                userTracker,
-                mainHandler,
-                backgroundDelayableExecutor
-            ))
+        fontScalingDialogDelegate =
+            spy(
+                FontScalingDialogDelegate(
+                    mContext,
+                    dialogFactory,
+                    LayoutInflater.from(mContext),
+                    systemSettings,
+                    secureSettings,
+                    systemClock,
+                    userTracker,
+                    mainHandler,
+                    backgroundDelayableExecutor
+                )
+            )
 
-        dialog = SystemUIDialog(
-            mContext,
-            0,
-            DEFAULT_DISMISS_ON_DEVICE_LOCK,
-            featureFlags,
-            dialogManager,
-            sysuiState,
-            fakeBroadcastDispatcher,
-            dialogLaunchAnimator,
-            fontScalingDialogDelegate
-        )
+        dialog =
+            SystemUIDialog(
+                mContext,
+                0,
+                DEFAULT_DISMISS_ON_DEVICE_LOCK,
+                dialogManager,
+                sysuiState,
+                fakeBroadcastDispatcher,
+                dialogLaunchAnimator,
+                fontScalingDialogDelegate
+            )
 
         whenever(dialogFactory.create(any(), any())).thenReturn(dialog)
     }
@@ -299,11 +298,7 @@
         // Default seekbar progress for font size is 1, simulate dragging to 0 without
         // releasing the finger
         changeListener.onStartTrackingTouch(seekBar)
-        changeListener.onProgressChanged(
-            seekBar,
-            /* progress= */ 0,
-            /* fromUser= */ false
-        )
+        changeListener.onProgressChanged(seekBar, /* progress= */ 0, /* fromUser= */ false)
         backgroundDelayableExecutor.advanceClockToNext()
         backgroundDelayableExecutor.runAllReady()
 
diff --git a/packages/SystemUI/tests/src/com/android/systemui/biometrics/AuthRippleControllerTest.kt b/packages/SystemUI/tests/src/com/android/systemui/biometrics/AuthRippleControllerTest.kt
index c143bc0..a47e288 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/biometrics/AuthRippleControllerTest.kt
+++ b/packages/SystemUI/tests/src/com/android/systemui/biometrics/AuthRippleControllerTest.kt
@@ -29,6 +29,7 @@
 import com.android.keyguard.logging.KeyguardLogger
 import com.android.systemui.Flags.FLAG_LIGHT_REVEAL_MIGRATION
 import com.android.systemui.SysuiTestCase
+import com.android.systemui.biometrics.data.repository.FakeFacePropertyRepository
 import com.android.systemui.log.logcatLogBuffer
 import com.android.systemui.flags.FeatureFlags
 import com.android.systemui.keyguard.WakefulnessLifecycle
@@ -93,6 +94,7 @@
     @Mock
     private lateinit var fpSensorProp: FingerprintSensorPropertiesInternal
 
+    private val facePropertyRepository = FakeFacePropertyRepository()
     private val displayMetrics = DisplayMetrics()
 
     @Captor
@@ -126,6 +128,7 @@
             KeyguardLogger(logcatLogBuffer(AuthRippleController.TAG)),
             biometricUnlockController,
             lightRevealScrim,
+            facePropertyRepository,
             rippleView,
         )
         controller.init()
@@ -202,7 +205,7 @@
 
     @Test
     fun testNullFaceSensorLocationDoesNothing() {
-        `when`(authController.faceSensorLocation).thenReturn(null)
+        facePropertyRepository.setSensorLocation(null)
         controller.onViewAttached()
 
         val captor = ArgumentCaptor.forClass(KeyguardUpdateMonitorCallback::class.java)
@@ -270,7 +273,7 @@
     fun testAnimatorRunWhenWakeAndUnlock_faceUdfpsFingerDown() {
         mSetFlagsRule.disableFlags(FLAG_LIGHT_REVEAL_MIGRATION)
         val faceLocation = Point(5, 5)
-        `when`(authController.faceSensorLocation).thenReturn(faceLocation)
+        facePropertyRepository.setSensorLocation(faceLocation)
         controller.onViewAttached()
         `when`(keyguardStateController.isShowing).thenReturn(true)
         `when`(biometricUnlockController.isWakeAndUnlock).thenReturn(true)
diff --git a/packages/SystemUI/tests/src/com/android/systemui/biometrics/UdfpsUtilsTest.java b/packages/SystemUI/tests/src/com/android/systemui/biometrics/UdfpsUtilsTest.java
index 2aeba9a..3dcb3f8 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/biometrics/UdfpsUtilsTest.java
+++ b/packages/SystemUI/tests/src/com/android/systemui/biometrics/UdfpsUtilsTest.java
@@ -20,6 +20,7 @@
 
 import android.content.res.Resources;
 import android.graphics.Rect;
+import android.hardware.fingerprint.FingerprintSensorProperties;
 import android.view.Surface;
 
 import androidx.test.filters.SmallTest;
@@ -63,28 +64,32 @@
         assertThat(
                 mUdfpsUtils.onTouchOutsideOfSensorArea(true, mContext,
                         0 /* touchX */, 0/* touchY */,
-                        new UdfpsOverlayParams(new Rect(), new Rect(), 0, 0, 1f, rotation)
+                        new UdfpsOverlayParams(new Rect(), new Rect(), 0, 0, 1f, rotation,
+                                FingerprintSensorProperties.TYPE_UDFPS_OPTICAL)
                 )
         ).isEqualTo(mTouchHints[0]);
         // touch at 90 degrees
         assertThat(
                 mUdfpsUtils.onTouchOutsideOfSensorArea(true, mContext,
                         0 /* touchX */, -1/* touchY */,
-                        new UdfpsOverlayParams(new Rect(), new Rect(), 0, 0, 1f, rotation)
+                        new UdfpsOverlayParams(new Rect(), new Rect(), 0, 0, 1f, rotation,
+                                FingerprintSensorProperties.TYPE_UDFPS_OPTICAL)
                 )
         ).isEqualTo(mTouchHints[1]);
         // touch at 180 degrees
         assertThat(
                 mUdfpsUtils.onTouchOutsideOfSensorArea(true, mContext,
                         -1 /* touchX */, 0/* touchY */,
-                        new UdfpsOverlayParams(new Rect(), new Rect(), 0, 0, 1f, rotation)
+                        new UdfpsOverlayParams(new Rect(), new Rect(), 0, 0, 1f, rotation,
+                                FingerprintSensorProperties.TYPE_UDFPS_OPTICAL)
                 )
         ).isEqualTo(mTouchHints[2]);
         // touch at 270 degrees
         assertThat(
                 mUdfpsUtils.onTouchOutsideOfSensorArea(true, mContext,
                         0 /* touchX */, 1/* touchY */,
-                        new UdfpsOverlayParams(new Rect(), new Rect(), 0, 0, 1f, rotation)
+                        new UdfpsOverlayParams(new Rect(), new Rect(), 0, 0, 1f, rotation,
+                                FingerprintSensorProperties.TYPE_UDFPS_OPTICAL)
                 )
         ).isEqualTo(mTouchHints[3]);
     }
@@ -97,28 +102,32 @@
         assertThat(
                 mUdfpsUtils.onTouchOutsideOfSensorArea(true, mContext,
                         0 /* touchX */, 0 /* touchY */,
-                        new UdfpsOverlayParams(new Rect(), new Rect(), 0, 0, 1f, rotation)
+                        new UdfpsOverlayParams(new Rect(), new Rect(), 0, 0, 1f, rotation,
+                                FingerprintSensorProperties.TYPE_UDFPS_OPTICAL)
                 )
         ).isEqualTo(mTouchHints[1]);
         // touch at 90 degrees -> 180 degrees
         assertThat(
                 mUdfpsUtils.onTouchOutsideOfSensorArea(true, mContext,
                         0 /* touchX */, -1 /* touchY */,
-                        new UdfpsOverlayParams(new Rect(), new Rect(), 0, 0, 1f, rotation)
+                        new UdfpsOverlayParams(new Rect(), new Rect(), 0, 0, 1f, rotation,
+                                FingerprintSensorProperties.TYPE_UDFPS_OPTICAL)
                 )
         ).isEqualTo(mTouchHints[2]);
         // touch at 180 degrees -> 270 degrees
         assertThat(
                 mUdfpsUtils.onTouchOutsideOfSensorArea(true, mContext,
                         -1 /* touchX */, 0 /* touchY */,
-                        new UdfpsOverlayParams(new Rect(), new Rect(), 0, 0, 1f, rotation)
+                        new UdfpsOverlayParams(new Rect(), new Rect(), 0, 0, 1f, rotation,
+                                FingerprintSensorProperties.TYPE_UDFPS_OPTICAL)
                 )
         ).isEqualTo(mTouchHints[3]);
         // touch at 270 degrees -> 0 degrees
         assertThat(
                 mUdfpsUtils.onTouchOutsideOfSensorArea(true, mContext,
                         0 /* touchX */, 1/* touchY */,
-                        new UdfpsOverlayParams(new Rect(), new Rect(), 0, 0, 1f, rotation)
+                        new UdfpsOverlayParams(new Rect(), new Rect(), 0, 0, 1f, rotation,
+                                FingerprintSensorProperties.TYPE_UDFPS_OPTICAL)
                 )
         ).isEqualTo(mTouchHints[0]);
     }
@@ -131,28 +140,32 @@
         assertThat(
                 mUdfpsUtils.onTouchOutsideOfSensorArea(true, mContext,
                         0 /* touchX */, 0/* touchY */,
-                        new UdfpsOverlayParams(new Rect(), new Rect(), 0, 0, 1f, rotation)
+                        new UdfpsOverlayParams(new Rect(), new Rect(), 0, 0, 1f, rotation,
+                                FingerprintSensorProperties.TYPE_UDFPS_OPTICAL)
                 )
         ).isEqualTo(mTouchHints[3]);
         // touch at 90 degrees -> 0 degrees
         assertThat(
                 mUdfpsUtils.onTouchOutsideOfSensorArea(true, mContext,
                         0 /* touchX */, -1/* touchY */,
-                        new UdfpsOverlayParams(new Rect(), new Rect(), 0, 0, 1f, rotation)
+                        new UdfpsOverlayParams(new Rect(), new Rect(), 0, 0, 1f, rotation,
+                                FingerprintSensorProperties.TYPE_UDFPS_OPTICAL)
                 )
         ).isEqualTo(mTouchHints[0]);
         // touch at 180 degrees -> 90 degrees
         assertThat(
                 mUdfpsUtils.onTouchOutsideOfSensorArea(true, mContext,
                         -1 /* touchX */, 0/* touchY */,
-                        new UdfpsOverlayParams(new Rect(), new Rect(), 0, 0, 1f, rotation)
+                        new UdfpsOverlayParams(new Rect(), new Rect(), 0, 0, 1f, rotation,
+                                FingerprintSensorProperties.TYPE_UDFPS_OPTICAL)
                 )
         ).isEqualTo(mTouchHints[1]);
         // touch at 270 degrees -> 180 degrees
         assertThat(
                 mUdfpsUtils.onTouchOutsideOfSensorArea(true, mContext,
                         0 /* touchX */, 1/* touchY */,
-                        new UdfpsOverlayParams(new Rect(), new Rect(), 0, 0, 1f, rotation)
+                        new UdfpsOverlayParams(new Rect(), new Rect(), 0, 0, 1f, rotation,
+                                FingerprintSensorProperties.TYPE_UDFPS_OPTICAL)
                 )
         ).isEqualTo(mTouchHints[2]);
     }
diff --git a/packages/SystemUI/tests/src/com/android/systemui/biometrics/data/repository/DisplayStateRepositoryTest.kt b/packages/SystemUI/tests/src/com/android/systemui/biometrics/data/repository/DisplayStateRepositoryTest.kt
index 834179bf..a84778a 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/biometrics/data/repository/DisplayStateRepositoryTest.kt
+++ b/packages/SystemUI/tests/src/com/android/systemui/biometrics/data/repository/DisplayStateRepositoryTest.kt
@@ -19,6 +19,7 @@
 import android.hardware.devicestate.DeviceStateManager
 import android.hardware.display.DisplayManager
 import android.os.Handler
+import android.util.Size
 import android.view.Display
 import android.view.DisplayInfo
 import android.view.Surface
@@ -147,6 +148,40 @@
             displayListenerCaptor.value.onDisplayChanged(Surface.ROTATION_180)
             assertThat(currentRotation).isEqualTo(DisplayRotation.ROTATION_180)
         }
+
+    @Test
+    fun updatesCurrentSize_whenDisplayStateChanges() =
+        testScope.runTest {
+            val currentSize by collectLastValue(underTest.currentDisplaySize)
+            runCurrent()
+
+            verify(displayManager)
+                .registerDisplayListener(
+                    displayListenerCaptor.capture(),
+                    same(handler),
+                    eq(DisplayManager.EVENT_FLAG_DISPLAY_CHANGED)
+                )
+
+            whenever(display.getDisplayInfo(any())).then {
+                val info = it.getArgument<DisplayInfo>(0)
+                info.rotation = Surface.ROTATION_0
+                info.logicalWidth = 100
+                info.logicalHeight = 200
+                return@then true
+            }
+            displayListenerCaptor.value.onDisplayChanged(Surface.ROTATION_0)
+            assertThat(currentSize).isEqualTo(Size(100, 200))
+
+            whenever(display.getDisplayInfo(any())).then {
+                val info = it.getArgument<DisplayInfo>(0)
+                info.rotation = Surface.ROTATION_90
+                info.logicalWidth = 100
+                info.logicalHeight = 200
+                return@then true
+            }
+            displayListenerCaptor.value.onDisplayChanged(Surface.ROTATION_180)
+            assertThat(currentSize).isEqualTo(Size(200, 100))
+        }
 }
 
 private fun DeviceStateManager.captureCallback() =
diff --git a/packages/SystemUI/tests/src/com/android/systemui/biometrics/data/repository/FacePropertyRepositoryImplTest.kt b/packages/SystemUI/tests/src/com/android/systemui/biometrics/data/repository/FacePropertyRepositoryImplTest.kt
index c14ad6a..9f24d5d 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/biometrics/data/repository/FacePropertyRepositoryImplTest.kt
+++ b/packages/SystemUI/tests/src/com/android/systemui/biometrics/data/repository/FacePropertyRepositoryImplTest.kt
@@ -17,10 +17,12 @@
 
 package com.android.systemui.biometrics.data.repository
 
+import android.graphics.Point
 import android.hardware.biometrics.BiometricConstants.BIOMETRIC_LOCKOUT_NONE
 import android.hardware.biometrics.BiometricConstants.BIOMETRIC_LOCKOUT_PERMANENT
 import android.hardware.biometrics.BiometricConstants.BIOMETRIC_LOCKOUT_TIMED
 import android.hardware.biometrics.SensorProperties
+import android.hardware.camera2.CameraManager
 import android.hardware.face.FaceManager
 import android.hardware.face.FaceSensorPropertiesInternal
 import android.hardware.face.IFaceAuthenticatorsRegisteredCallback
@@ -28,9 +30,12 @@
 import com.android.systemui.SysuiTestCase
 import com.android.systemui.biometrics.shared.model.LockoutMode
 import com.android.systemui.biometrics.shared.model.SensorStrength
+import com.android.systemui.common.ui.data.repository.FakeConfigurationRepository
 import com.android.systemui.coroutines.collectLastValue
+import com.android.systemui.res.R
 import com.android.systemui.util.mockito.whenever
 import com.google.common.truth.Truth.assertThat
+import java.util.concurrent.Executor
 import kotlinx.coroutines.ExperimentalCoroutinesApi
 import kotlinx.coroutines.test.StandardTestDispatcher
 import kotlinx.coroutines.test.TestDispatcher
@@ -45,6 +50,7 @@
 import org.mockito.ArgumentCaptor
 import org.mockito.Captor
 import org.mockito.Mock
+import org.mockito.Mockito.any
 import org.mockito.Mockito.verify
 import org.mockito.junit.MockitoJUnit
 import org.mockito.junit.MockitoRule
@@ -53,23 +59,56 @@
 @SmallTest
 @RunWith(JUnit4::class)
 class FacePropertyRepositoryImplTest : SysuiTestCase() {
+    companion object {
+        private const val LOGICAL_CAMERA_ID_OUTER_FRONT = "0"
+        private const val LOGICAL_CAMERA_ID_INNER_FRONT = "1"
+        private const val PHYSICAL_CAMERA_ID_OUTER_FRONT = "5"
+        private const val PHYSICAL_CAMERA_ID_INNER_FRONT = "6"
+        private val OUTER_FRONT_SENSOR_LOCATION = intArrayOf(100, 10, 20)
+        private val INNER_FRONT_SENSOR_LOCATION = intArrayOf(200, 20, 30)
+    }
+
     @JvmField @Rule val mockitoRule: MockitoRule = MockitoJUnit.rule()
 
     private lateinit var underTest: FacePropertyRepository
     private lateinit var dispatcher: TestDispatcher
     private lateinit var testScope: TestScope
 
+    private val displayStateRepository = FakeDisplayStateRepository()
+    private val configurationRepository = FakeConfigurationRepository()
+
     @Captor private lateinit var callback: ArgumentCaptor<IFaceAuthenticatorsRegisteredCallback>
     @Mock private lateinit var faceManager: FaceManager
+    @Captor private lateinit var cameraCallback: ArgumentCaptor<CameraManager.AvailabilityCallback>
+    @Mock private lateinit var cameraManager: CameraManager
     @Before
     fun setup() {
+        overrideResource(R.string.config_protectedCameraId, LOGICAL_CAMERA_ID_OUTER_FRONT)
+        overrideResource(R.string.config_protectedPhysicalCameraId, PHYSICAL_CAMERA_ID_OUTER_FRONT)
+        overrideResource(R.string.config_protectedInnerCameraId, LOGICAL_CAMERA_ID_INNER_FRONT)
+        overrideResource(
+            R.string.config_protectedInnerPhysicalCameraId,
+            PHYSICAL_CAMERA_ID_INNER_FRONT
+        )
+        overrideResource(R.array.config_face_auth_props, OUTER_FRONT_SENSOR_LOCATION)
+        overrideResource(R.array.config_inner_face_auth_props, INNER_FRONT_SENSOR_LOCATION)
+
         dispatcher = StandardTestDispatcher()
         testScope = TestScope(dispatcher)
         underTest = createRepository(faceManager)
     }
 
     private fun createRepository(manager: FaceManager? = faceManager) =
-        FacePropertyRepositoryImpl(testScope.backgroundScope, dispatcher, manager)
+        FacePropertyRepositoryImpl(
+            context,
+            context.mainExecutor,
+            testScope.backgroundScope,
+            dispatcher,
+            manager,
+            cameraManager,
+            displayStateRepository,
+            configurationRepository,
+        )
 
     @Test
     fun whenFaceManagerIsNotPresentIsNull() =
@@ -129,6 +168,75 @@
             assertThat(underTest.getLockoutMode(userId)).isEqualTo(LockoutMode.NONE)
         }
 
+    @Test
+    fun providesTheSensorLocationOfOuterCameraFromOnPhysicalCameraAvailable() {
+        testScope.runTest {
+            runCurrent()
+            collectLastValue(underTest.sensorLocation)
+
+            verify(faceManager).addAuthenticatorsRegisteredCallback(callback.capture())
+            callback.value.onAllAuthenticatorsRegistered(
+                listOf(createSensorProperties(1, SensorProperties.STRENGTH_STRONG))
+            )
+            runCurrent()
+            verify(cameraManager)
+                .registerAvailabilityCallback(any(Executor::class.java), cameraCallback.capture())
+
+            cameraCallback.value.onPhysicalCameraAvailable("1", PHYSICAL_CAMERA_ID_OUTER_FRONT)
+            runCurrent()
+
+            val sensorLocation by collectLastValue(underTest.sensorLocation)
+            assertThat(sensorLocation)
+                .isEqualTo(Point(OUTER_FRONT_SENSOR_LOCATION[0], OUTER_FRONT_SENSOR_LOCATION[1]))
+        }
+    }
+
+    @Test
+    fun providesTheSensorLocationOfInnerCameraFromOnPhysicalCameraAvailable() {
+        testScope.runTest {
+            runCurrent()
+            collectLastValue(underTest.sensorLocation)
+
+            verify(faceManager).addAuthenticatorsRegisteredCallback(callback.capture())
+            callback.value.onAllAuthenticatorsRegistered(
+                listOf(createSensorProperties(1, SensorProperties.STRENGTH_STRONG))
+            )
+            runCurrent()
+            verify(cameraManager)
+                .registerAvailabilityCallback(any(Executor::class.java), cameraCallback.capture())
+
+            cameraCallback.value.onPhysicalCameraAvailable("1", PHYSICAL_CAMERA_ID_INNER_FRONT)
+            runCurrent()
+
+            val sensorLocation by collectLastValue(underTest.sensorLocation)
+            assertThat(sensorLocation)
+                .isEqualTo(Point(INNER_FRONT_SENSOR_LOCATION[0], INNER_FRONT_SENSOR_LOCATION[1]))
+        }
+    }
+
+    @Test
+    fun providesTheSensorLocationOfCameraFromOnPhysicalCameraUnavailable() {
+        testScope.runTest {
+            runCurrent()
+            collectLastValue(underTest.sensorLocation)
+
+            verify(faceManager).addAuthenticatorsRegisteredCallback(callback.capture())
+            callback.value.onAllAuthenticatorsRegistered(
+                listOf(createSensorProperties(1, SensorProperties.STRENGTH_STRONG))
+            )
+            runCurrent()
+            verify(cameraManager)
+                .registerAvailabilityCallback(any(Executor::class.java), cameraCallback.capture())
+
+            cameraCallback.value.onPhysicalCameraUnavailable("1", PHYSICAL_CAMERA_ID_INNER_FRONT)
+            runCurrent()
+
+            val sensorLocation by collectLastValue(underTest.sensorLocation)
+            assertThat(sensorLocation)
+                .isEqualTo(Point(OUTER_FRONT_SENSOR_LOCATION[0], OUTER_FRONT_SENSOR_LOCATION[1]))
+        }
+    }
+
     private fun createSensorProperties(id: Int, strength: Int) =
         FaceSensorPropertiesInternal(id, strength, 0, emptyList(), 1, false, false, false)
 }
diff --git a/packages/SystemUI/tests/src/com/android/systemui/bluetooth/BroadcastDialogDelegateTest.java b/packages/SystemUI/tests/src/com/android/systemui/bluetooth/BroadcastDialogDelegateTest.java
index 3ff43c6..7d5aec6 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/bluetooth/BroadcastDialogDelegateTest.java
+++ b/packages/SystemUI/tests/src/com/android/systemui/bluetooth/BroadcastDialogDelegateTest.java
@@ -17,7 +17,9 @@
 package com.android.systemui.bluetooth;
 
 import static com.android.systemui.statusbar.phone.SystemUIDialog.DEFAULT_DISMISS_ON_DEVICE_LOCK;
+
 import static com.google.common.truth.Truth.assertThat;
+
 import static org.mockito.ArgumentMatchers.anyBoolean;
 import static org.mockito.ArgumentMatchers.anyInt;
 import static org.mockito.Mockito.any;
@@ -40,8 +42,6 @@
 import com.android.systemui.SysuiTestCase;
 import com.android.systemui.animation.DialogLaunchAnimator;
 import com.android.systemui.broadcast.BroadcastSender;
-import com.android.systemui.flags.FakeFeatureFlags;
-import com.android.systemui.flags.Flags;
 import com.android.systemui.media.dialog.MediaOutputDialogFactory;
 import com.android.systemui.model.SysUiState;
 import com.android.systemui.res.R;
@@ -72,7 +72,6 @@
             LocalBluetoothLeBroadcast.class);
     private final BroadcastSender mBroadcastSender = mock(BroadcastSender.class);
     private BroadcastDialogDelegate mBroadcastDialogDelegate;
-    private FakeFeatureFlags mFeatureFlags = new FakeFeatureFlags();
     @Mock SystemUIDialog.Factory mSystemUIDialogFactory;
     @Mock SystemUIDialogManager mDialogManager;
     @Mock SysUiState mSysUiState;
@@ -91,7 +90,6 @@
         when(mLocalBluetoothManager.getProfileManager()).thenReturn(mLocalBluetoothProfileManager);
         when(mLocalBluetoothProfileManager.getLeAudioBroadcastProfile()).thenReturn(null);
 
-        mFeatureFlags.set(Flags.WM_ENABLE_PREDICTIVE_BACK_QS_DIALOG_ANIM, true);
         when(mSysUiState.setFlag(anyInt(), anyBoolean())).thenReturn(mSysUiState);
         when(mSystemUIDialogFactory.create(any(), any())).thenReturn(mDialog);
 
@@ -110,7 +108,6 @@
                 mContext,
                 0,
                 DEFAULT_DISMISS_ON_DEVICE_LOCK,
-                mFeatureFlags,
                 mDialogManager,
                 mSysUiState,
                 getFakeBroadcastDispatcher(),
diff --git a/packages/SystemUI/tests/src/com/android/systemui/media/controls/pipeline/MediaDataCombineLatestTest.java b/packages/SystemUI/tests/src/com/android/systemui/media/controls/pipeline/MediaDataCombineLatestTest.java
index 0a5b124..fb101dd 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/media/controls/pipeline/MediaDataCombineLatestTest.java
+++ b/packages/SystemUI/tests/src/com/android/systemui/media/controls/pipeline/MediaDataCombineLatestTest.java
@@ -78,7 +78,7 @@
         mMediaData = new MediaData(
                 USER_ID, true, APP, null, ARTIST, TITLE, null,
                 new ArrayList<>(), new ArrayList<>(), null, PACKAGE, null, null, null, true, null,
-                MediaData.PLAYBACK_LOCAL, false, KEY, false, false, false, 0L,
+                MediaData.PLAYBACK_LOCAL, false, KEY, false, false, false, 0L, 0L,
                 InstanceId.fakeInstanceId(-1), -1, false, null);
         mDeviceData = new MediaDeviceData(true, null, DEVICE_NAME, null, false);
     }
diff --git a/packages/SystemUI/tests/src/com/android/systemui/reardisplay/RearDisplayDialogControllerTest.java b/packages/SystemUI/tests/src/com/android/systemui/reardisplay/RearDisplayDialogControllerTest.java
index 35bf775..dc211303 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/reardisplay/RearDisplayDialogControllerTest.java
+++ b/packages/SystemUI/tests/src/com/android/systemui/reardisplay/RearDisplayDialogControllerTest.java
@@ -83,7 +83,6 @@
     public void setup() {
         MockitoAnnotations.initMocks(this);
 
-        mFeatureFlags.set(Flags.WM_ENABLE_PREDICTIVE_BACK_QS_DIALOG_ANIM, true);
         when(mSysUiState.setFlag(anyInt(), anyBoolean())).thenReturn(mSysUiState);
         when(mSystemUIDialogFactory.create()).thenReturn(mSystemUIDialog);
         when(mSystemUIDialog.getContext()).thenReturn(mContext);
diff --git a/packages/SystemUI/tests/src/com/android/systemui/recordissue/RecordIssueDialogDelegateTest.kt b/packages/SystemUI/tests/src/com/android/systemui/recordissue/RecordIssueDialogDelegateTest.kt
index 7ce51ae..86ab01c 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/recordissue/RecordIssueDialogDelegateTest.kt
+++ b/packages/SystemUI/tests/src/com/android/systemui/recordissue/RecordIssueDialogDelegateTest.kt
@@ -105,7 +105,6 @@
             spy(
                 SystemUIDialog.Factory(
                     context,
-                    flags,
                     systemUIDialogManager,
                     sysuiState,
                     broadcastDispatcher,
diff --git a/packages/SystemUI/tests/src/com/android/systemui/screenrecord/RecordingControllerTest.java b/packages/SystemUI/tests/src/com/android/systemui/screenrecord/RecordingControllerTest.java
index cb90cc5..0ba99f2 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/screenrecord/RecordingControllerTest.java
+++ b/packages/SystemUI/tests/src/com/android/systemui/screenrecord/RecordingControllerTest.java
@@ -44,7 +44,6 @@
 import com.android.systemui.animation.DialogLaunchAnimator;
 import com.android.systemui.broadcast.BroadcastDispatcher;
 import com.android.systemui.flags.FakeFeatureFlags;
-import com.android.systemui.flags.FeatureFlags;
 import com.android.systemui.flags.Flags;
 import com.android.systemui.mediaprojection.MediaProjectionMetricsLogger;
 import com.android.systemui.mediaprojection.SessionCreationSource;
@@ -113,7 +112,6 @@
 
         mDialogFactory = new TestSystemUIDialogFactory(
                 mContext,
-                mFeatureFlags,
                 Dependency.get(SystemUIDialogManager.class),
                 Dependency.get(SysUiState.class),
                 Dependency.get(BroadcastDispatcher.class),
@@ -313,14 +311,12 @@
 
         TestSystemUIDialogFactory(
                 Context context,
-                FeatureFlags featureFlags,
                 SystemUIDialogManager systemUIDialogManager,
                 SysUiState sysUiState,
                 BroadcastDispatcher broadcastDispatcher,
                 DialogLaunchAnimator dialogLaunchAnimator) {
             super(
                     context,
-                    featureFlags,
                     systemUIDialogManager,
                     sysUiState,
                     broadcastDispatcher,
diff --git a/packages/SystemUI/tests/src/com/android/systemui/screenrecord/ScreenRecordPermissionDialogDelegateTest.kt b/packages/SystemUI/tests/src/com/android/systemui/screenrecord/ScreenRecordPermissionDialogDelegateTest.kt
index 8f696e7..2399536 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/screenrecord/ScreenRecordPermissionDialogDelegateTest.kt
+++ b/packages/SystemUI/tests/src/com/android/systemui/screenrecord/ScreenRecordPermissionDialogDelegateTest.kt
@@ -74,7 +74,6 @@
         val systemUIDialogFactory =
             SystemUIDialog.Factory(
                 context,
-                Dependency.get(FeatureFlags::class.java),
                 Dependency.get(SystemUIDialogManager::class.java),
                 Dependency.get(SysUiState::class.java),
                 Dependency.get(BroadcastDispatcher::class.java),
diff --git a/packages/SystemUI/tests/src/com/android/systemui/shade/NotificationPanelViewControllerBaseTest.java b/packages/SystemUI/tests/src/com/android/systemui/shade/NotificationPanelViewControllerBaseTest.java
index 3132767..a206581 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/shade/NotificationPanelViewControllerBaseTest.java
+++ b/packages/SystemUI/tests/src/com/android/systemui/shade/NotificationPanelViewControllerBaseTest.java
@@ -152,7 +152,9 @@
 import com.android.systemui.statusbar.notification.DynamicPrivacyController;
 import com.android.systemui.statusbar.notification.NotificationWakeUpCoordinator;
 import com.android.systemui.statusbar.notification.NotificationWakeUpCoordinatorLogger;
+import com.android.systemui.statusbar.notification.data.repository.NotificationsKeyguardViewStateRepository;
 import com.android.systemui.statusbar.notification.domain.interactor.ActiveNotificationsInteractor;
+import com.android.systemui.statusbar.notification.domain.interactor.NotificationsKeyguardInteractor;
 import com.android.systemui.statusbar.notification.row.NotificationGutsManager;
 import com.android.systemui.statusbar.notification.stack.AmbientState;
 import com.android.systemui.statusbar.notification.stack.NotificationListContainer;
@@ -586,6 +588,10 @@
         when(mPrimaryBouncerToGoneTransitionViewModel.getLockscreenAlpha())
                 .thenReturn(emptyFlow());
 
+        NotificationsKeyguardViewStateRepository notifsKeyguardViewStateRepository =
+                new NotificationsKeyguardViewStateRepository();
+        NotificationsKeyguardInteractor notifsKeyguardInteractor =
+                new NotificationsKeyguardInteractor(notifsKeyguardViewStateRepository);
         NotificationWakeUpCoordinator coordinator =
                 new NotificationWakeUpCoordinator(
                         mDumpManager,
@@ -596,7 +602,8 @@
                         mKeyguardBypassController,
                         mDozeParameters,
                         mScreenOffAnimationController,
-                        new NotificationWakeUpCoordinatorLogger(logcatLogBuffer()));
+                        new NotificationWakeUpCoordinatorLogger(logcatLogBuffer()),
+                        notifsKeyguardInteractor);
         mConfigurationController = new ConfigurationControllerImpl(mContext);
         PulseExpansionHandler expansionHandler = new PulseExpansionHandler(
                 mContext,
diff --git a/packages/SystemUI/tests/src/com/android/systemui/statusbar/notification/NotificationWakeUpCoordinatorTest.kt b/packages/SystemUI/tests/src/com/android/systemui/statusbar/notification/NotificationWakeUpCoordinatorTest.kt
index 438b33d..039fef9 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/statusbar/notification/NotificationWakeUpCoordinatorTest.kt
+++ b/packages/SystemUI/tests/src/com/android/systemui/statusbar/notification/NotificationWakeUpCoordinatorTest.kt
@@ -22,12 +22,14 @@
 import com.android.systemui.SysuiTestCase
 import com.android.systemui.animation.AnimatorTestRule
 import com.android.systemui.dump.DumpManager
+import com.android.systemui.kosmos.Kosmos
 import com.android.systemui.log.logcatLogBuffer
 import com.android.systemui.plugins.statusbar.StatusBarStateController
 import com.android.systemui.shade.ShadeViewController.Companion.WAKEUP_ANIMATION_DELAY_MS
 import com.android.systemui.statusbar.StatusBarState
 import com.android.systemui.statusbar.notification.stack.NotificationStackScrollLayoutController
 import com.android.systemui.statusbar.notification.stack.StackStateAnimator.ANIMATION_DURATION_WAKEUP
+import com.android.systemui.statusbar.notification.stack.domain.interactor.notificationsKeyguardInteractor
 import com.android.systemui.statusbar.phone.DozeParameters
 import com.android.systemui.statusbar.phone.KeyguardBypassController
 import com.android.systemui.statusbar.phone.ScreenOffAnimationController
@@ -54,6 +56,8 @@
 
     @get:Rule val animatorTestRule = AnimatorTestRule()
 
+    private val kosmos = Kosmos()
+
     private val dumpManager: DumpManager = mock()
     private val headsUpManager: HeadsUpManager = mock()
     private val statusBarStateController: StatusBarStateController = mock()
@@ -100,6 +104,7 @@
                 dozeParameters,
                 screenOffAnimationController,
                 logger,
+                kosmos.notificationsKeyguardInteractor,
             )
         statusBarStateCallback = withArgCaptor {
             verify(statusBarStateController).addCallback(capture())
diff --git a/packages/SystemUI/tests/src/com/android/systemui/statusbar/notification/data/repository/NotificationsKeyguardViewStateRepositoryTest.kt b/packages/SystemUI/tests/src/com/android/systemui/statusbar/notification/data/repository/NotificationsKeyguardViewStateRepositoryTest.kt
deleted file mode 100644
index 170f651..0000000
--- a/packages/SystemUI/tests/src/com/android/systemui/statusbar/notification/data/repository/NotificationsKeyguardViewStateRepositoryTest.kt
+++ /dev/null
@@ -1,88 +0,0 @@
-/*
- * Copyright (C) 2023 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-package com.android.systemui.statusbar.notification.data.repository
-
-import androidx.test.filters.SmallTest
-import com.android.systemui.SysUITestComponent
-import com.android.systemui.SysUITestModule
-import com.android.systemui.SysuiTestCase
-import com.android.systemui.collectLastValue
-import com.android.systemui.dagger.SysUISingleton
-import com.android.systemui.runCurrent
-import com.android.systemui.runTest
-import com.android.systemui.statusbar.notification.NotificationWakeUpCoordinator
-import com.android.systemui.util.mockito.whenever
-import com.android.systemui.util.mockito.withArgCaptor
-import com.google.common.truth.Truth.assertThat
-import dagger.BindsInstance
-import dagger.Component
-import org.junit.Test
-import org.mockito.Mockito.verify
-
-@SmallTest
-class NotificationsKeyguardViewStateRepositoryTest : SysuiTestCase() {
-
-    @SysUISingleton
-    @Component(modules = [SysUITestModule::class])
-    interface TestComponent : SysUITestComponent<NotificationsKeyguardViewStateRepositoryImpl> {
-
-        val mockWakeUpCoordinator: NotificationWakeUpCoordinator
-
-        @Component.Factory
-        interface Factory {
-            fun create(
-                @BindsInstance test: SysuiTestCase,
-            ): TestComponent
-        }
-    }
-
-    private val testComponent: TestComponent =
-        DaggerNotificationsKeyguardViewStateRepositoryTest_TestComponent.factory()
-            .create(test = this)
-
-    @Test
-    fun areNotifsFullyHidden_reflectsWakeUpCoordinator() =
-        testComponent.runTest {
-            whenever(mockWakeUpCoordinator.notificationsFullyHidden).thenReturn(false)
-            val notifsFullyHidden by collectLastValue(underTest.areNotificationsFullyHidden)
-            runCurrent()
-
-            assertThat(notifsFullyHidden).isFalse()
-
-            withArgCaptor { verify(mockWakeUpCoordinator).addListener(capture()) }
-                .onFullyHiddenChanged(true)
-            runCurrent()
-
-            assertThat(notifsFullyHidden).isTrue()
-        }
-
-    @Test
-    fun isPulseExpanding_reflectsWakeUpCoordinator() =
-        testComponent.runTest {
-            whenever(mockWakeUpCoordinator.isPulseExpanding()).thenReturn(false)
-            val isPulseExpanding by collectLastValue(underTest.isPulseExpanding)
-            runCurrent()
-
-            assertThat(isPulseExpanding).isFalse()
-
-            withArgCaptor { verify(mockWakeUpCoordinator).addListener(capture()) }
-                .onPulseExpandingChanged(true)
-            runCurrent()
-
-            assertThat(isPulseExpanding).isTrue()
-        }
-}
diff --git a/packages/SystemUI/tests/src/com/android/systemui/statusbar/notification/domain/interactor/NotificationsKeyguardInteractorTest.kt b/packages/SystemUI/tests/src/com/android/systemui/statusbar/notification/domain/interactor/NotificationsKeyguardInteractorTest.kt
index bb3113a..3593f5b 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/statusbar/notification/domain/interactor/NotificationsKeyguardInteractorTest.kt
+++ b/packages/SystemUI/tests/src/com/android/systemui/statusbar/notification/domain/interactor/NotificationsKeyguardInteractorTest.kt
@@ -21,7 +21,6 @@
 import com.android.systemui.dagger.SysUISingleton
 import com.android.systemui.runCurrent
 import com.android.systemui.runTest
-import com.android.systemui.statusbar.notification.data.repository.FakeNotificationsKeyguardViewStateRepository
 import com.google.common.truth.Truth.assertThat
 import dagger.BindsInstance
 import dagger.Component
@@ -33,9 +32,6 @@
     @SysUISingleton
     @Component(modules = [SysUITestModule::class])
     interface TestComponent : SysUITestComponent<NotificationsKeyguardInteractor> {
-
-        val repository: FakeNotificationsKeyguardViewStateRepository
-
         @Component.Factory
         interface Factory {
             fun create(@BindsInstance test: SysuiTestCase): TestComponent
@@ -48,13 +44,13 @@
     @Test
     fun areNotifsFullyHidden_reflectsRepository() =
         testComponent.runTest {
-            repository.setNotificationsFullyHidden(false)
+            underTest.setNotificationsFullyHidden(false)
             val notifsFullyHidden by collectLastValue(underTest.areNotificationsFullyHidden)
             runCurrent()
 
             assertThat(notifsFullyHidden).isFalse()
 
-            repository.setNotificationsFullyHidden(true)
+            underTest.setNotificationsFullyHidden(true)
             runCurrent()
 
             assertThat(notifsFullyHidden).isTrue()
@@ -63,13 +59,13 @@
     @Test
     fun isPulseExpanding_reflectsRepository() =
         testComponent.runTest {
-            repository.setPulseExpanding(false)
+            underTest.setPulseExpanding(false)
             val isPulseExpanding by collectLastValue(underTest.isPulseExpanding)
             runCurrent()
 
             assertThat(isPulseExpanding).isFalse()
 
-            repository.setPulseExpanding(true)
+            underTest.setPulseExpanding(true)
             runCurrent()
 
             assertThat(isPulseExpanding).isTrue()
diff --git a/packages/SystemUI/tests/src/com/android/systemui/statusbar/notification/icon/domain/interactor/NotificationIconsInteractorTest.kt b/packages/SystemUI/tests/src/com/android/systemui/statusbar/notification/icon/domain/interactor/NotificationIconsInteractorTest.kt
index 47feccf..7faf562 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/statusbar/notification/icon/domain/interactor/NotificationIconsInteractorTest.kt
+++ b/packages/SystemUI/tests/src/com/android/systemui/statusbar/notification/icon/domain/interactor/NotificationIconsInteractorTest.kt
@@ -29,8 +29,8 @@
 import com.android.systemui.statusbar.notification.data.model.activeNotificationModel
 import com.android.systemui.statusbar.notification.data.repository.ActiveNotificationListRepository
 import com.android.systemui.statusbar.notification.data.repository.ActiveNotificationsStore
-import com.android.systemui.statusbar.notification.data.repository.FakeNotificationsKeyguardViewStateRepository
 import com.android.systemui.statusbar.notification.domain.interactor.HeadsUpNotificationIconInteractor
+import com.android.systemui.statusbar.notification.domain.interactor.NotificationsKeyguardInteractor
 import com.android.systemui.statusbar.notification.shared.byIsAmbient
 import com.android.systemui.statusbar.notification.shared.byIsLastMessageFromReply
 import com.android.systemui.statusbar.notification.shared.byIsPulsing
@@ -61,7 +61,7 @@
     interface TestComponent : SysUITestComponent<NotificationIconsInteractor> {
 
         val activeNotificationListRepository: ActiveNotificationListRepository
-        val keyguardViewStateRepository: FakeNotificationsKeyguardViewStateRepository
+        val notificationsKeyguardInteractor: NotificationsKeyguardInteractor
 
         @Component.Factory
         interface Factory {
@@ -136,7 +136,7 @@
     fun filteredEntrySet_noPulsing_notifsNotFullyHidden() =
         testComponent.runTest {
             val filteredSet by collectLastValue(underTest.filteredNotifSet(showPulsing = false))
-            keyguardViewStateRepository.setNotificationsFullyHidden(false)
+            notificationsKeyguardInteractor.setNotificationsFullyHidden(false)
             assertThat(filteredSet).comparingElementsUsing(byIsPulsing).doesNotContain(true)
         }
 
@@ -144,7 +144,7 @@
     fun filteredEntrySet_noPulsing_notifsFullyHidden() =
         testComponent.runTest {
             val filteredSet by collectLastValue(underTest.filteredNotifSet(showPulsing = false))
-            keyguardViewStateRepository.setNotificationsFullyHidden(true)
+            notificationsKeyguardInteractor.setNotificationsFullyHidden(true)
             assertThat(filteredSet).comparingElementsUsing(byIsPulsing).contains(true)
         }
 }
@@ -161,7 +161,7 @@
 
         val activeNotificationListRepository: ActiveNotificationListRepository
         val deviceEntryRepository: FakeDeviceEntryRepository
-        val keyguardViewStateRepository: FakeNotificationsKeyguardViewStateRepository
+        val notificationsKeyguardInteractor: NotificationsKeyguardInteractor
 
         @Component.Factory
         interface Factory {
@@ -222,7 +222,7 @@
         testComponent.runTest {
             val filteredSet by collectLastValue(underTest.aodNotifs)
             deviceEntryRepository.setBypassEnabled(false)
-            keyguardViewStateRepository.setNotificationsFullyHidden(false)
+            notificationsKeyguardInteractor.setNotificationsFullyHidden(false)
             assertThat(filteredSet).comparingElementsUsing(byIsPulsing).contains(true)
         }
 
@@ -231,7 +231,7 @@
         testComponent.runTest {
             val filteredSet by collectLastValue(underTest.aodNotifs)
             deviceEntryRepository.setBypassEnabled(false)
-            keyguardViewStateRepository.setNotificationsFullyHidden(true)
+            notificationsKeyguardInteractor.setNotificationsFullyHidden(true)
             assertThat(filteredSet).comparingElementsUsing(byIsPulsing).contains(true)
         }
 
@@ -240,7 +240,7 @@
         testComponent.runTest {
             val filteredSet by collectLastValue(underTest.aodNotifs)
             deviceEntryRepository.setBypassEnabled(true)
-            keyguardViewStateRepository.setNotificationsFullyHidden(false)
+            notificationsKeyguardInteractor.setNotificationsFullyHidden(false)
             assertThat(filteredSet).comparingElementsUsing(byIsPulsing).doesNotContain(true)
         }
 
@@ -249,7 +249,7 @@
         testComponent.runTest {
             val filteredSet by collectLastValue(underTest.aodNotifs)
             deviceEntryRepository.setBypassEnabled(true)
-            keyguardViewStateRepository.setNotificationsFullyHidden(true)
+            notificationsKeyguardInteractor.setNotificationsFullyHidden(true)
             assertThat(filteredSet).comparingElementsUsing(byIsPulsing).contains(true)
         }
 }
@@ -266,7 +266,7 @@
 
         val activeNotificationListRepository: ActiveNotificationListRepository
         val headsUpIconsInteractor: HeadsUpNotificationIconInteractor
-        val keyguardViewStateRepository: FakeNotificationsKeyguardViewStateRepository
+        val notificationsKeyguardInteractor: NotificationsKeyguardInteractor
         val notificationListenerSettingsRepository: NotificationListenerSettingsRepository
 
         @Component.Factory
diff --git a/packages/SystemUI/tests/src/com/android/systemui/statusbar/phone/ManagedProfileControllerImplTest.kt b/packages/SystemUI/tests/src/com/android/systemui/statusbar/phone/ManagedProfileControllerImplTest.kt
index 7eba3b46..c44c178 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/statusbar/phone/ManagedProfileControllerImplTest.kt
+++ b/packages/SystemUI/tests/src/com/android/systemui/statusbar/phone/ManagedProfileControllerImplTest.kt
@@ -22,11 +22,15 @@
 import com.android.systemui.SysuiTestCase
 import com.android.systemui.settings.UserTracker
 import com.android.systemui.util.concurrency.FakeExecutor
+import com.android.systemui.util.mockito.any
+import com.android.systemui.util.mockito.argumentCaptor
+import com.android.systemui.util.mockito.capture
 import com.android.systemui.util.time.FakeSystemClock
 import junit.framework.Assert
 import org.junit.Before
 import org.junit.Test
 import org.mockito.Mock
+import org.mockito.Mockito.verify
 import org.mockito.Mockito.`when`
 import org.mockito.MockitoAnnotations
 
@@ -72,6 +76,34 @@
         Assert.assertEquals(true, controller.hasActiveProfile())
     }
 
+    @Test
+    fun callbackRemovedWhileDispatching_doesntCrash() {
+        var remove = false
+        val callback =
+            object : ManagedProfileController.Callback {
+                override fun onManagedProfileChanged() {
+                    if (remove) {
+                        controller.removeCallback(this)
+                    }
+                }
+
+                override fun onManagedProfileRemoved() {
+                    if (remove) {
+                        controller.removeCallback(this)
+                    }
+                }
+            }
+        controller.addCallback(callback)
+        controller.addCallback(TestCallback)
+
+        remove = true
+        setupWorkingProfile(1)
+
+        val captor = argumentCaptor<UserTracker.Callback>()
+        verify(userTracker).addCallback(capture(captor), any())
+        captor.value.onProfilesChanged(userManager.getEnabledProfiles(1))
+    }
+
     private fun setupWorkingProfile(userId: Int) {
         `when`(userManager.getEnabledProfiles(userId))
             .thenReturn(
diff --git a/packages/SystemUI/tests/src/com/android/systemui/statusbar/phone/StatusBarIconControllerImplTest.kt b/packages/SystemUI/tests/src/com/android/systemui/statusbar/phone/StatusBarIconControllerImplTest.kt
index 6f04f36..f6a8243 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/statusbar/phone/StatusBarIconControllerImplTest.kt
+++ b/packages/SystemUI/tests/src/com/android/systemui/statusbar/phone/StatusBarIconControllerImplTest.kt
@@ -23,6 +23,9 @@
 import com.android.systemui.statusbar.CommandQueue
 import com.android.systemui.statusbar.phone.StatusBarIconController.TAG_PRIMARY
 import com.android.systemui.statusbar.phone.StatusBarIconControllerImpl.EXTERNAL_SLOT_SUFFIX
+import com.android.systemui.statusbar.pipeline.icons.shared.BindableIconsRegistry
+import com.android.systemui.statusbar.pipeline.icons.shared.model.BindableIcon
+import com.android.systemui.statusbar.pipeline.icons.shared.model.ModernStatusBarViewCreator
 import com.android.systemui.util.mockito.kotlinArgumentCaptor
 import com.android.systemui.util.mockito.mock
 import com.google.common.truth.Truth.assertThat
@@ -49,14 +52,15 @@
         iconList = StatusBarIconList(arrayOf())
         underTest =
             StatusBarIconControllerImpl(
-                context,
-                commandQueue,
-                mock(),
-                mock(),
-                mock(),
-                mock(),
-                iconList,
-                mock(),
+                /* context = */ context,
+                /* commandQueue = */ commandQueue,
+                /* demoModeController = */ mock(),
+                /* configurationController = */ mock(),
+                /* tunerService = */ mock(),
+                /* dumpManager = */ mock(),
+                /* statusBarIconList = */ iconList,
+                /* statusBarPipelineFlags = */ mock(),
+                /* modernIconsRegistry = */ mock(),
             )
         underTest.addIconGroup(iconGroup)
         val commandQueueCallbacksCaptor = kotlinArgumentCaptor<CommandQueue.Callbacks>()
@@ -366,6 +370,31 @@
         assertThat(iconList.slots[0].name).isEqualTo("myslot$EXTERNAL_SLOT_SUFFIX")
     }
 
+    @Test
+    fun bindableIcons_addedOnInit() {
+        val fakeIcon = FakeBindableIcon("test_slot")
+
+        iconList = StatusBarIconList(arrayOf())
+
+        // WHEN there are registered icons
+        underTest =
+            StatusBarIconControllerImpl(
+                /* context = */ context,
+                /* commandQueue = */ commandQueue,
+                /* demoModeController = */ mock(),
+                /* configurationController = */ mock(),
+                /* tunerService = */ mock(),
+                /* dumpManager = */ mock(),
+                /* statusBarIconList = */ iconList,
+                /* statusBarPipelineFlags = */ mock(),
+                /* modernIconsRegistry = */ FakeBindableIconsRegistry(listOf(fakeIcon)),
+            )
+
+        // THEN they are properly added to the list on init
+        assertThat(iconList.getIconHolder("test_slot", 0))
+            .isInstanceOf(StatusBarIconHolder.BindableIconHolder::class.java)
+    }
+
     private fun createExternalIcon(): StatusBarIcon {
         return StatusBarIcon(
             "external.package",
@@ -377,3 +406,20 @@
         )
     }
 }
+
+class FakeBindableIconsRegistry(
+    override val bindableIcons: List<BindableIcon>,
+) : BindableIconsRegistry
+
+class FakeBindableIcon(
+    override val slot: String,
+    override val shouldBindIcon: Boolean = true,
+) : BindableIcon {
+    // Track initialized so we can know that our icon was properly bound
+    var hasInitialized = false
+
+    override val initializer = ModernStatusBarViewCreator { _ ->
+        hasInitialized = true
+        mock()
+    }
+}
diff --git a/packages/SystemUI/tests/src/com/android/systemui/statusbar/phone/StatusBarIconControllerTest.java b/packages/SystemUI/tests/src/com/android/systemui/statusbar/phone/StatusBarIconControllerTest.java
index 0ff6f20..ca31623 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/statusbar/phone/StatusBarIconControllerTest.java
+++ b/packages/SystemUI/tests/src/com/android/systemui/statusbar/phone/StatusBarIconControllerTest.java
@@ -43,6 +43,7 @@
 import com.android.systemui.statusbar.phone.StatusBarIconController.DarkIconManager;
 import com.android.systemui.statusbar.phone.StatusBarIconController.IconManager;
 import com.android.systemui.statusbar.pipeline.StatusBarPipelineFlags;
+import com.android.systemui.statusbar.pipeline.icons.shared.BindableIconsRegistry;
 import com.android.systemui.statusbar.pipeline.mobile.ui.MobileUiAdapter;
 import com.android.systemui.statusbar.pipeline.mobile.ui.viewmodel.MobileIconsViewModel;
 import com.android.systemui.statusbar.pipeline.wifi.ui.WifiUiAdapter;
@@ -108,7 +109,8 @@
                 mock(TunerService.class),
                 mock(DumpManager.class),
                 mock(StatusBarIconList.class),
-                flags
+                flags,
+                mock(BindableIconsRegistry.class)
         );
 
         iconController.addIconGroup(manager);
diff --git a/packages/SystemUI/tests/src/com/android/systemui/statusbar/pipeline/satellite/data/prod/DeviceBasedSatelliteRepositoryImplTest.kt b/packages/SystemUI/tests/src/com/android/systemui/statusbar/pipeline/satellite/data/prod/DeviceBasedSatelliteRepositoryImplTest.kt
new file mode 100644
index 0000000..a906a89
--- /dev/null
+++ b/packages/SystemUI/tests/src/com/android/systemui/statusbar/pipeline/satellite/data/prod/DeviceBasedSatelliteRepositoryImplTest.kt
@@ -0,0 +1,391 @@
+/*
+ * Copyright (C) 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.systemui.statusbar.pipeline.satellite.data.prod
+
+import android.os.OutcomeReceiver
+import android.os.Process
+import android.telephony.satellite.NtnSignalStrength
+import android.telephony.satellite.NtnSignalStrengthCallback
+import android.telephony.satellite.SatelliteManager
+import android.telephony.satellite.SatelliteManager.SATELLITE_MODEM_STATE_CONNECTED
+import android.telephony.satellite.SatelliteManager.SATELLITE_MODEM_STATE_DATAGRAM_RETRYING
+import android.telephony.satellite.SatelliteManager.SATELLITE_MODEM_STATE_DATAGRAM_TRANSFERRING
+import android.telephony.satellite.SatelliteManager.SATELLITE_MODEM_STATE_IDLE
+import android.telephony.satellite.SatelliteManager.SATELLITE_MODEM_STATE_LISTENING
+import android.telephony.satellite.SatelliteManager.SATELLITE_MODEM_STATE_NOT_CONNECTED
+import android.telephony.satellite.SatelliteManager.SATELLITE_MODEM_STATE_OFF
+import android.telephony.satellite.SatelliteManager.SATELLITE_MODEM_STATE_UNAVAILABLE
+import android.telephony.satellite.SatelliteManager.SATELLITE_MODEM_STATE_UNKNOWN
+import android.telephony.satellite.SatelliteManager.SatelliteException
+import android.telephony.satellite.SatelliteStateCallback
+import androidx.test.filters.SmallTest
+import com.android.systemui.SysuiTestCase
+import com.android.systemui.coroutines.collectLastValue
+import com.android.systemui.statusbar.pipeline.satellite.data.prod.DeviceBasedSatelliteRepositoryImpl.Companion.MIN_UPTIME
+import com.android.systemui.statusbar.pipeline.satellite.data.prod.DeviceBasedSatelliteRepositoryImpl.Companion.POLLING_INTERVAL_MS
+import com.android.systemui.statusbar.pipeline.satellite.shared.model.SatelliteConnectionState
+import com.android.systemui.util.mockito.any
+import com.android.systemui.util.mockito.whenever
+import com.android.systemui.util.mockito.withArgCaptor
+import com.android.systemui.util.time.FakeSystemClock
+import com.google.common.truth.Truth.assertThat
+import java.util.Optional
+import kotlin.test.Test
+import kotlinx.coroutines.ExperimentalCoroutinesApi
+import kotlinx.coroutines.flow.launchIn
+import kotlinx.coroutines.flow.onEach
+import kotlinx.coroutines.test.StandardTestDispatcher
+import kotlinx.coroutines.test.TestScope
+import kotlinx.coroutines.test.advanceTimeBy
+import kotlinx.coroutines.test.runCurrent
+import kotlinx.coroutines.test.runTest
+import org.junit.Before
+import org.mockito.Mock
+import org.mockito.Mockito
+import org.mockito.Mockito.doAnswer
+import org.mockito.Mockito.never
+import org.mockito.Mockito.verify
+import org.mockito.MockitoAnnotations
+
+@Suppress("EXPERIMENTAL_IS_NOT_ENABLED")
+@OptIn(ExperimentalCoroutinesApi::class)
+@SmallTest
+class DeviceBasedSatelliteRepositoryImplTest : SysuiTestCase() {
+    private lateinit var underTest: DeviceBasedSatelliteRepositoryImpl
+
+    @Mock private lateinit var satelliteManager: SatelliteManager
+
+    private val systemClock = FakeSystemClock()
+    private val dispatcher = StandardTestDispatcher()
+    private val testScope = TestScope(dispatcher)
+
+    @Before
+    fun setUp() {
+        MockitoAnnotations.initMocks(this)
+    }
+
+    @Test
+    fun nullSatelliteManager_usesDefaultValues() =
+        testScope.runTest {
+            setupDefaultRepo()
+            underTest =
+                DeviceBasedSatelliteRepositoryImpl(
+                    Optional.empty(),
+                    dispatcher,
+                    testScope.backgroundScope,
+                    systemClock,
+                )
+
+            val connectionState by collectLastValue(underTest.connectionState)
+            val strength by collectLastValue(underTest.signalStrength)
+            val allowed by collectLastValue(underTest.isSatelliteAllowedForCurrentLocation)
+
+            assertThat(connectionState).isEqualTo(SatelliteConnectionState.Off)
+            assertThat(strength).isEqualTo(0)
+            assertThat(allowed).isFalse()
+        }
+
+    @Test
+    fun connectionState_mapsFromSatelliteModemState() =
+        testScope.runTest {
+            setupDefaultRepo()
+            val latest by collectLastValue(underTest.connectionState)
+            runCurrent()
+            val callback =
+                withArgCaptor<SatelliteStateCallback> {
+                    verify(satelliteManager).registerForSatelliteModemStateChanged(any(), capture())
+                }
+
+            // Mapping from modem state to SatelliteConnectionState is rote, just run all of the
+            // possibilities here
+
+            // Off states
+            callback.onSatelliteModemStateChanged(SATELLITE_MODEM_STATE_OFF)
+            assertThat(latest).isEqualTo(SatelliteConnectionState.Off)
+            callback.onSatelliteModemStateChanged(SATELLITE_MODEM_STATE_UNAVAILABLE)
+            assertThat(latest).isEqualTo(SatelliteConnectionState.Off)
+
+            // On states
+            callback.onSatelliteModemStateChanged(SATELLITE_MODEM_STATE_IDLE)
+            assertThat(latest).isEqualTo(SatelliteConnectionState.On)
+            callback.onSatelliteModemStateChanged(SATELLITE_MODEM_STATE_LISTENING)
+            assertThat(latest).isEqualTo(SatelliteConnectionState.On)
+            callback.onSatelliteModemStateChanged(SATELLITE_MODEM_STATE_NOT_CONNECTED)
+            assertThat(latest).isEqualTo(SatelliteConnectionState.On)
+
+            // Connected states
+            callback.onSatelliteModemStateChanged(SATELLITE_MODEM_STATE_CONNECTED)
+            assertThat(latest).isEqualTo(SatelliteConnectionState.Connected)
+            callback.onSatelliteModemStateChanged(SATELLITE_MODEM_STATE_DATAGRAM_TRANSFERRING)
+            assertThat(latest).isEqualTo(SatelliteConnectionState.Connected)
+            callback.onSatelliteModemStateChanged(SATELLITE_MODEM_STATE_DATAGRAM_RETRYING)
+            assertThat(latest).isEqualTo(SatelliteConnectionState.Connected)
+
+            // Unknown states
+            callback.onSatelliteModemStateChanged(SATELLITE_MODEM_STATE_UNKNOWN)
+            assertThat(latest).isEqualTo(SatelliteConnectionState.Unknown)
+            // Garbage value (for completeness' sake)
+            callback.onSatelliteModemStateChanged(123456)
+            assertThat(latest).isEqualTo(SatelliteConnectionState.Unknown)
+        }
+
+    @Test
+    fun signalStrength_readsSatelliteManagerState() =
+        testScope.runTest {
+            setupDefaultRepo()
+            val latest by collectLastValue(underTest.signalStrength)
+            runCurrent()
+            val callback =
+                withArgCaptor<NtnSignalStrengthCallback> {
+                    verify(satelliteManager).registerForNtnSignalStrengthChanged(any(), capture())
+                }
+
+            assertThat(latest).isNull()
+
+            callback.onNtnSignalStrengthChanged(NtnSignalStrength(1))
+            assertThat(latest).isEqualTo(1)
+
+            callback.onNtnSignalStrengthChanged(NtnSignalStrength(2))
+            assertThat(latest).isEqualTo(2)
+
+            callback.onNtnSignalStrengthChanged(NtnSignalStrength(3))
+            assertThat(latest).isEqualTo(3)
+
+            callback.onNtnSignalStrengthChanged(NtnSignalStrength(4))
+            assertThat(latest).isEqualTo(4)
+        }
+
+    @Test
+    fun isSatelliteAllowed_readsSatelliteManagerState_enabled() =
+        testScope.runTest {
+            setupDefaultRepo()
+            // GIVEN satellite is allowed in this location
+            val allowed = true
+
+            doAnswer {
+                    val receiver = it.arguments[1] as OutcomeReceiver<Boolean, SatelliteException>
+                    receiver.onResult(allowed)
+                    null
+                }
+                .`when`(satelliteManager)
+                .requestIsSatelliteCommunicationAllowedForCurrentLocation(
+                    any(),
+                    any<OutcomeReceiver<Boolean, SatelliteException>>()
+                )
+
+            val latest by collectLastValue(underTest.isSatelliteAllowedForCurrentLocation)
+
+            assertThat(latest).isTrue()
+        }
+
+    @Test
+    fun isSatelliteAllowed_readsSatelliteManagerState_disabled() =
+        testScope.runTest {
+            setupDefaultRepo()
+            // GIVEN satellite is not allowed in this location
+            val allowed = false
+
+            doAnswer {
+                    val receiver = it.arguments[1] as OutcomeReceiver<Boolean, SatelliteException>
+                    receiver.onResult(allowed)
+                    null
+                }
+                .`when`(satelliteManager)
+                .requestIsSatelliteCommunicationAllowedForCurrentLocation(
+                    any(),
+                    any<OutcomeReceiver<Boolean, SatelliteException>>()
+                )
+
+            val latest by collectLastValue(underTest.isSatelliteAllowedForCurrentLocation)
+
+            assertThat(latest).isFalse()
+        }
+
+    @Test
+    fun isSatelliteAllowed_pollsOnTimeout() =
+        testScope.runTest {
+            setupDefaultRepo()
+            // GIVEN satellite is not allowed in this location
+            var allowed = false
+
+            doAnswer {
+                    val receiver = it.arguments[1] as OutcomeReceiver<Boolean, SatelliteException>
+                    receiver.onResult(allowed)
+                    null
+                }
+                .`when`(satelliteManager)
+                .requestIsSatelliteCommunicationAllowedForCurrentLocation(
+                    any(),
+                    any<OutcomeReceiver<Boolean, SatelliteException>>()
+                )
+
+            val latest by collectLastValue(underTest.isSatelliteAllowedForCurrentLocation)
+
+            assertThat(latest).isFalse()
+
+            // WHEN satellite becomes enabled
+            allowed = true
+
+            // WHEN the timeout has not yet been reached
+            advanceTimeBy(POLLING_INTERVAL_MS / 2)
+
+            // THEN the value is still false
+            assertThat(latest).isFalse()
+
+            // WHEN time advances beyond the polling interval
+            advanceTimeBy(POLLING_INTERVAL_MS / 2 + 1)
+
+            // THEN then new value is emitted
+            assertThat(latest).isTrue()
+        }
+
+    @Test
+    fun isSatelliteAllowed_pollingRestartsWhenCollectionRestarts() =
+        testScope.runTest {
+            setupDefaultRepo()
+            // Use the old school launch/cancel so we can simulate subscribers arriving and leaving
+
+            var latest: Boolean? = false
+            var job =
+                underTest.isSatelliteAllowedForCurrentLocation.onEach { latest = it }.launchIn(this)
+
+            // GIVEN satellite is not allowed in this location
+            var allowed = false
+
+            doAnswer {
+                    val receiver = it.arguments[1] as OutcomeReceiver<Boolean, SatelliteException>
+                    receiver.onResult(allowed)
+                    null
+                }
+                .`when`(satelliteManager)
+                .requestIsSatelliteCommunicationAllowedForCurrentLocation(
+                    any(),
+                    any<OutcomeReceiver<Boolean, SatelliteException>>()
+                )
+
+            assertThat(latest).isFalse()
+
+            // WHEN satellite becomes enabled
+            allowed = true
+
+            // WHEN the job is restarted
+            advanceTimeBy(POLLING_INTERVAL_MS / 2)
+
+            job.cancel()
+            job =
+                underTest.isSatelliteAllowedForCurrentLocation.onEach { latest = it }.launchIn(this)
+
+            // THEN the value is re-fetched
+            assertThat(latest).isTrue()
+
+            job.cancel()
+        }
+
+    @Test
+    fun isSatelliteAllowed_falseWhenErrorOccurs() =
+        testScope.runTest {
+            setupDefaultRepo()
+            doAnswer {
+                    val receiver = it.arguments[1] as OutcomeReceiver<Boolean, SatelliteException>
+                    receiver.onError(SatelliteException(1 /* unused */))
+                    null
+                }
+                .`when`(satelliteManager)
+                .requestIsSatelliteCommunicationAllowedForCurrentLocation(
+                    any(),
+                    any<OutcomeReceiver<Boolean, SatelliteException>>()
+                )
+
+            val latest by collectLastValue(underTest.isSatelliteAllowedForCurrentLocation)
+
+            assertThat(latest).isFalse()
+        }
+
+    @Test
+    fun satelliteNotSupported_listenersAreNotRegistered() =
+        testScope.runTest {
+            setupDefaultRepo()
+            // GIVEN satellite is not supported
+            setUpRepo(
+                uptime = MIN_UPTIME,
+                satMan = satelliteManager,
+                satelliteSupported = false,
+            )
+
+            // WHEN data is requested from the repo
+            val connectionState by collectLastValue(underTest.connectionState)
+            val signalStrength by collectLastValue(underTest.signalStrength)
+
+            // THEN the manager is not asked for the information, and default values are returned
+            verify(satelliteManager, never()).registerForSatelliteModemStateChanged(any(), any())
+            verify(satelliteManager, never()).registerForNtnSignalStrengthChanged(any(), any())
+        }
+
+    @Test
+    fun repoDoesNotCheckForSupportUntilMinUptime() =
+        testScope.runTest {
+            // GIVEN we init 100ms after sysui starts up
+            setUpRepo(
+                uptime = 100,
+                satMan = satelliteManager,
+                satelliteSupported = true,
+            )
+
+            // WHEN data is requested
+            val connectionState by collectLastValue(underTest.connectionState)
+            val signalStrength by collectLastValue(underTest.signalStrength)
+
+            // THEN we have not yet talked to satellite manager, since we are well before MIN_UPTIME
+            Mockito.verifyZeroInteractions(satelliteManager)
+
+            // WHEN enough time has passed
+            systemClock.advanceTime(MIN_UPTIME)
+            runCurrent()
+
+            // THEN we finally register with the satellite manager
+            verify(satelliteManager).registerForSatelliteModemStateChanged(any(), any())
+        }
+
+    private fun setUpRepo(
+        uptime: Long = MIN_UPTIME,
+        satMan: SatelliteManager? = satelliteManager,
+        satelliteSupported: Boolean = true,
+    ) {
+        doAnswer {
+                val callback: OutcomeReceiver<Boolean, SatelliteException> =
+                    it.getArgument(1) as OutcomeReceiver<Boolean, SatelliteException>
+                callback.onResult(satelliteSupported)
+            }
+            .whenever(satelliteManager)
+            .requestIsSatelliteSupported(any(), any())
+
+        systemClock.setUptimeMillis(Process.getStartUptimeMillis() + uptime)
+
+        underTest =
+            DeviceBasedSatelliteRepositoryImpl(
+                if (satMan != null) Optional.of(satMan) else Optional.empty(),
+                dispatcher,
+                testScope.backgroundScope,
+                systemClock,
+            )
+    }
+
+    // Set system time to MIN_UPTIME and create a repo with satellite supported
+    private fun setupDefaultRepo() {
+        setUpRepo(uptime = MIN_UPTIME, satMan = satelliteManager, satelliteSupported = true)
+    }
+}
diff --git a/packages/SystemUI/tests/src/com/android/systemui/statusbar/pipeline/satellite/data/prod/FakeDeviceBasedSatelliteRepository.kt b/packages/SystemUI/tests/src/com/android/systemui/statusbar/pipeline/satellite/data/prod/FakeDeviceBasedSatelliteRepository.kt
new file mode 100644
index 0000000..5fa2d33
--- /dev/null
+++ b/packages/SystemUI/tests/src/com/android/systemui/statusbar/pipeline/satellite/data/prod/FakeDeviceBasedSatelliteRepository.kt
@@ -0,0 +1,29 @@
+/*
+ * Copyright (C) 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.systemui.statusbar.pipeline.satellite.data.prod
+
+import com.android.systemui.statusbar.pipeline.satellite.data.DeviceBasedSatelliteRepository
+import com.android.systemui.statusbar.pipeline.satellite.shared.model.SatelliteConnectionState.Off
+import kotlinx.coroutines.flow.MutableStateFlow
+
+class FakeDeviceBasedSatelliteRepository() : DeviceBasedSatelliteRepository {
+    override val connectionState = MutableStateFlow(Off)
+
+    override val signalStrength = MutableStateFlow(0)
+
+    override val isSatelliteAllowedForCurrentLocation = MutableStateFlow(false)
+}
diff --git a/packages/SystemUI/tests/src/com/android/systemui/statusbar/pipeline/satellite/domain/interactor/DeviceBasedSatelliteInteractorTest.kt b/packages/SystemUI/tests/src/com/android/systemui/statusbar/pipeline/satellite/domain/interactor/DeviceBasedSatelliteInteractorTest.kt
new file mode 100644
index 0000000..e010b86
--- /dev/null
+++ b/packages/SystemUI/tests/src/com/android/systemui/statusbar/pipeline/satellite/domain/interactor/DeviceBasedSatelliteInteractorTest.kt
@@ -0,0 +1,322 @@
+/*
+ * Copyright (C) 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.systemui.statusbar.pipeline.satellite.domain.interactor
+
+import androidx.test.filters.SmallTest
+import com.android.internal.telephony.flags.Flags.FLAG_OEM_ENABLED_SATELLITE_FLAG
+import com.android.systemui.SysuiTestCase
+import com.android.systemui.coroutines.collectLastValue
+import com.android.systemui.statusbar.pipeline.mobile.domain.interactor.FakeMobileIconsInteractor
+import com.android.systemui.statusbar.pipeline.mobile.util.FakeMobileMappingsProxy
+import com.android.systemui.statusbar.pipeline.satellite.data.prod.FakeDeviceBasedSatelliteRepository
+import com.android.systemui.statusbar.pipeline.satellite.shared.model.SatelliteConnectionState
+import com.android.systemui.util.mockito.mock
+import com.google.common.truth.Truth.assertThat
+import kotlin.test.Test
+import kotlinx.coroutines.test.StandardTestDispatcher
+import kotlinx.coroutines.test.TestScope
+import kotlinx.coroutines.test.runTest
+import org.junit.Before
+
+@SmallTest
+class DeviceBasedSatelliteInteractorTest : SysuiTestCase() {
+    private lateinit var underTest: DeviceBasedSatelliteInteractor
+
+    private val dispatcher = StandardTestDispatcher()
+    private val testScope = TestScope(dispatcher)
+
+    private val iconsInteractor =
+        FakeMobileIconsInteractor(
+            FakeMobileMappingsProxy(),
+            mock(),
+        )
+
+    private val repo = FakeDeviceBasedSatelliteRepository()
+
+    @Before
+    fun setUp() {
+        mSetFlagsRule.enableFlags(FLAG_OEM_ENABLED_SATELLITE_FLAG)
+
+        underTest =
+            DeviceBasedSatelliteInteractor(
+                repo,
+                iconsInteractor,
+                testScope.backgroundScope,
+            )
+    }
+
+    @Test
+    fun isSatelliteAllowed_falseWhenNotAllowed() =
+        testScope.runTest {
+            val latest by collectLastValue(underTest.isSatelliteAllowed)
+
+            // WHEN satellite is allowed
+            repo.isSatelliteAllowedForCurrentLocation.value = false
+
+            // THEN the interactor returns false due to the flag value
+            assertThat(latest).isFalse()
+        }
+
+    @Test
+    fun isSatelliteAllowed_trueWhenAllowed() =
+        testScope.runTest {
+            val latest by collectLastValue(underTest.isSatelliteAllowed)
+
+            // WHEN satellite is allowed
+            repo.isSatelliteAllowedForCurrentLocation.value = true
+
+            // THEN the interactor returns false due to the flag value
+            assertThat(latest).isTrue()
+        }
+
+    @Test
+    fun isSatelliteAllowed_offWhenFlagIsOff() =
+        testScope.runTest {
+            // GIVEN feature is disabled
+            mSetFlagsRule.disableFlags(FLAG_OEM_ENABLED_SATELLITE_FLAG)
+
+            // Remake the interactor so the flag is read
+            underTest =
+                DeviceBasedSatelliteInteractor(
+                    repo,
+                    iconsInteractor,
+                    testScope.backgroundScope,
+                )
+
+            val latest by collectLastValue(underTest.isSatelliteAllowed)
+
+            // WHEN satellite is allowed
+            repo.isSatelliteAllowedForCurrentLocation.value = true
+
+            // THEN the interactor returns false due to the flag value
+            assertThat(latest).isFalse()
+        }
+
+    @Test
+    fun connectionState_matchesRepositoryValue() =
+        testScope.runTest {
+            val latest by collectLastValue(underTest.connectionState)
+
+            // Off
+            repo.connectionState.value = SatelliteConnectionState.Off
+            assertThat(latest).isEqualTo(SatelliteConnectionState.Off)
+
+            // On
+            repo.connectionState.value = SatelliteConnectionState.On
+            assertThat(latest).isEqualTo(SatelliteConnectionState.On)
+
+            // Connected
+            repo.connectionState.value = SatelliteConnectionState.Connected
+            assertThat(latest).isEqualTo(SatelliteConnectionState.Connected)
+
+            // Unknown
+            repo.connectionState.value = SatelliteConnectionState.Unknown
+            assertThat(latest).isEqualTo(SatelliteConnectionState.Unknown)
+        }
+
+    @Test
+    fun connectionState_offWhenFeatureIsDisabled() =
+        testScope.runTest {
+            // GIVEN the flag is disabled
+            mSetFlagsRule.disableFlags(FLAG_OEM_ENABLED_SATELLITE_FLAG)
+
+            // Remake the interactor so the flag is read
+            underTest =
+                DeviceBasedSatelliteInteractor(
+                    repo,
+                    iconsInteractor,
+                    testScope.backgroundScope,
+                )
+
+            val latest by collectLastValue(underTest.connectionState)
+
+            // THEN the state is always Off, regardless of status in system_server
+
+            // Off
+            repo.connectionState.value = SatelliteConnectionState.Off
+            assertThat(latest).isEqualTo(SatelliteConnectionState.Off)
+
+            // On
+            repo.connectionState.value = SatelliteConnectionState.On
+            assertThat(latest).isEqualTo(SatelliteConnectionState.Off)
+
+            // Connected
+            repo.connectionState.value = SatelliteConnectionState.Connected
+            assertThat(latest).isEqualTo(SatelliteConnectionState.Off)
+
+            // Unknown
+            repo.connectionState.value = SatelliteConnectionState.Unknown
+            assertThat(latest).isEqualTo(SatelliteConnectionState.Off)
+        }
+
+    @Test
+    fun signalStrength_matchesRepo() =
+        testScope.runTest {
+            val latest by collectLastValue(underTest.signalStrength)
+
+            repo.signalStrength.value = 1
+            assertThat(latest).isEqualTo(1)
+
+            repo.signalStrength.value = 2
+            assertThat(latest).isEqualTo(2)
+
+            repo.signalStrength.value = 3
+            assertThat(latest).isEqualTo(3)
+
+            repo.signalStrength.value = 4
+            assertThat(latest).isEqualTo(4)
+        }
+
+    @Test
+    fun signalStrength_zeroWhenDisabled() =
+        testScope.runTest {
+            // GIVEN the flag is enabled
+            mSetFlagsRule.disableFlags(FLAG_OEM_ENABLED_SATELLITE_FLAG)
+
+            // Remake the interactor so the flag is read
+            underTest =
+                DeviceBasedSatelliteInteractor(
+                    repo,
+                    iconsInteractor,
+                    testScope.backgroundScope,
+                )
+
+            val latest by collectLastValue(underTest.signalStrength)
+
+            // THEN the value is always 0, regardless of what the system says
+            repo.signalStrength.value = 1
+            assertThat(latest).isEqualTo(0)
+
+            repo.signalStrength.value = 2
+            assertThat(latest).isEqualTo(0)
+
+            repo.signalStrength.value = 3
+            assertThat(latest).isEqualTo(0)
+
+            repo.signalStrength.value = 4
+            assertThat(latest).isEqualTo(0)
+        }
+
+    @Test
+    fun areAllConnectionsOutOfService_twoConnectionsOos_yes() =
+        testScope.runTest {
+            val latest by collectLastValue(underTest.areAllConnectionsOutOfService)
+
+            // GIVEN, 2 connections
+            val i1 = iconsInteractor.getMobileConnectionInteractorForSubId(1)
+            val i2 = iconsInteractor.getMobileConnectionInteractorForSubId(2)
+
+            // WHEN all of the connections are OOS
+            i1.isInService.value = false
+            i2.isInService.value = false
+
+            // THEN the value is propagated to this interactor
+            assertThat(latest).isTrue()
+        }
+
+    @Test
+    fun areAllConnectionsOutOfService_oneConnectionOos_yes() =
+        testScope.runTest {
+            val latest by collectLastValue(underTest.areAllConnectionsOutOfService)
+
+            // GIVEN, 1 connection
+            val i1 = iconsInteractor.getMobileConnectionInteractorForSubId(1)
+
+            // WHEN all of the connections are OOS
+            i1.isInService.value = false
+
+            // THEN the value is propagated to this interactor
+            assertThat(latest).isTrue()
+        }
+
+    @Test
+    fun areAllConnectionsOutOfService_oneConnectionInService_no() =
+        testScope.runTest {
+            val latest by collectLastValue(underTest.areAllConnectionsOutOfService)
+
+            // GIVEN, 1 connection
+            val i1 = iconsInteractor.getMobileConnectionInteractorForSubId(1)
+
+            // WHEN all of the connections are NOT OOS
+            i1.isInService.value = true
+
+            // THEN the value is propagated to this interactor
+            assertThat(latest).isFalse()
+        }
+
+    @Test
+    fun areAllConnectionsOutOfService_twoConnectionsOneInService_no() =
+        testScope.runTest {
+            val latest by collectLastValue(underTest.areAllConnectionsOutOfService)
+
+            // GIVEN, 2 connection
+            val i1 = iconsInteractor.getMobileConnectionInteractorForSubId(1)
+            val i2 = iconsInteractor.getMobileConnectionInteractorForSubId(2)
+
+            // WHEN at least 1 connection is NOT OOS.
+            i1.isInService.value = false
+            i2.isInService.value = true
+
+            // THEN the value is propagated to this interactor
+            assertThat(latest).isFalse()
+        }
+
+    @Test
+    fun areAllConnectionsOutOfService_twoConnectionsInService_no() =
+        testScope.runTest {
+            val latest by collectLastValue(underTest.areAllConnectionsOutOfService)
+
+            // GIVEN, 2 connection
+            val i1 = iconsInteractor.getMobileConnectionInteractorForSubId(1)
+            val i2 = iconsInteractor.getMobileConnectionInteractorForSubId(1)
+
+            // WHEN all connections are NOT OOS.
+            i1.isInService.value = true
+            i2.isInService.value = true
+
+            // THEN the value is propagated to this interactor
+            assertThat(latest).isFalse()
+        }
+
+    @Test
+    fun areAllConnectionsOutOfService_falseWhenFlagIsOff() =
+        testScope.runTest {
+            // GIVEN the flag is disabled
+            mSetFlagsRule.disableFlags(FLAG_OEM_ENABLED_SATELLITE_FLAG)
+
+            // Remake the interactor so the flag is read
+            underTest =
+                DeviceBasedSatelliteInteractor(
+                    repo,
+                    iconsInteractor,
+                    testScope.backgroundScope,
+                )
+
+            val latest by collectLastValue(underTest.areAllConnectionsOutOfService)
+
+            // GIVEN a condition that should return true (all conections OOS)
+
+            val i1 = iconsInteractor.getMobileConnectionInteractorForSubId(1)
+            val i2 = iconsInteractor.getMobileConnectionInteractorForSubId(1)
+
+            i1.isInService.value = true
+            i2.isInService.value = true
+
+            // THEN the value is still false, because the flag is off
+            assertThat(latest).isFalse()
+        }
+}
diff --git a/packages/SystemUI/tests/src/com/android/systemui/statusbar/policy/BatteryControllerTest.java b/packages/SystemUI/tests/src/com/android/systemui/statusbar/policy/BatteryControllerTest.java
index 2f79955..a5c766d 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/statusbar/policy/BatteryControllerTest.java
+++ b/packages/SystemUI/tests/src/com/android/systemui/statusbar/policy/BatteryControllerTest.java
@@ -17,10 +17,12 @@
 package com.android.systemui.statusbar.policy;
 
 import static android.os.BatteryManager.EXTRA_PRESENT;
+
 import static com.android.dx.mockito.inline.extended.ExtendedMockito.inOrder;
 import static com.android.dx.mockito.inline.extended.ExtendedMockito.mockitoSession;
 import static com.android.dx.mockito.inline.extended.ExtendedMockito.staticMockMarker;
 import static com.android.settingslib.fuelgauge.BatterySaverLogging.SAVER_ENABLED_QS;
+
 import static org.mockito.Mockito.atLeastOnce;
 import static org.mockito.Mockito.mock;
 import static org.mockito.Mockito.verify;
@@ -59,6 +61,7 @@
 
 import java.util.ArrayList;
 import java.util.List;
+import java.util.concurrent.atomic.AtomicBoolean;
 
 @SmallTest
 @RunWith(AndroidTestingRunner.class)
@@ -286,6 +289,24 @@
         Assert.assertFalse(mBatteryController.isIncompatibleCharging());
     }
 
+    @Test
+    public void callbackRemovedWhileDispatching_doesntCrash() {
+        final AtomicBoolean remove = new AtomicBoolean(false);
+        BatteryStateChangeCallback callback = new BatteryStateChangeCallback() {
+            @Override
+            public void onBatteryLevelChanged(int level, boolean pluggedIn, boolean charging) {
+                if (remove.get()) {
+                    mBatteryController.removeCallback(this);
+                }
+            }
+        };
+        mBatteryController.addCallback(callback);
+        // Add another callback so the iteration continues
+        mBatteryController.addCallback(new BatteryStateChangeCallback() {});
+        remove.set(true);
+        mBatteryController.fireBatteryLevelChanged();
+    }
+
     private void setupIncompatibleCharging() {
         final List<UsbPort> usbPorts = new ArrayList<>();
         usbPorts.add(mUsbPort);
diff --git a/packages/SystemUI/tests/src/com/android/systemui/statusbar/policy/CastControllerImplTest.java b/packages/SystemUI/tests/src/com/android/systemui/statusbar/policy/CastControllerImplTest.java
index b8e4306..68c1b8d 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/statusbar/policy/CastControllerImplTest.java
+++ b/packages/SystemUI/tests/src/com/android/systemui/statusbar/policy/CastControllerImplTest.java
@@ -127,6 +127,25 @@
         }
     }
 
+    /** Regression test for b/317700495 */
+    @Test
+    public void removeCallbackWhileIterating_doesntCrash() {
+        final AtomicBoolean remove = new AtomicBoolean(false);
+        Callback callback = new Callback() {
+            @Override
+            public void onCastDevicesChanged() {
+                if (remove.get()) {
+                    mController.removeCallback(this);
+                }
+            }
+        };
+        mController.addCallback(callback);
+        // Add another callback so the iteration continues
+        mController.addCallback(() -> {});
+        remove.set(true);
+        mController.fireOnCastDevicesChanged();
+    }
+
     @Test
     public void hasConnectedCastDevice_connected() {
         CastController.CastDevice castDevice = new CastController.CastDevice();
diff --git a/packages/SystemUI/tests/src/com/android/systemui/statusbar/policy/FlashlightControllerImplTest.kt b/packages/SystemUI/tests/src/com/android/systemui/statusbar/policy/FlashlightControllerImplTest.kt
index db0029a..777fa28 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/statusbar/policy/FlashlightControllerImplTest.kt
+++ b/packages/SystemUI/tests/src/com/android/systemui/statusbar/policy/FlashlightControllerImplTest.kt
@@ -26,6 +26,8 @@
 import com.android.systemui.broadcast.BroadcastSender
 import com.android.systemui.dump.DumpManager
 import com.android.systemui.util.concurrency.FakeExecutor
+import com.android.systemui.util.mockito.argumentCaptor
+import com.android.systemui.util.mockito.capture
 import com.android.systemui.util.settings.FakeSettings
 import com.android.systemui.util.time.FakeSystemClock
 import java.util.concurrent.Executor
@@ -128,11 +130,42 @@
         verify(cameraManager).setTorchMode(id, enable)
     }
 
+    @Test
+    fun testCallbackRemovedWhileDispatching_doesntCrash() {
+        injectCamera()
+        var remove = false
+        val callback = object : FlashlightController.FlashlightListener {
+            override fun onFlashlightChanged(enabled: Boolean) {
+                if (remove) {
+                    controller.removeCallback(this)
+                }
+            }
+
+            override fun onFlashlightError() {}
+
+            override fun onFlashlightAvailabilityChanged(available: Boolean) {}
+        }
+        controller.addCallback(callback)
+        controller.addCallback(object : FlashlightController.FlashlightListener {
+            override fun onFlashlightChanged(enabled: Boolean) {}
+
+            override fun onFlashlightError() {}
+
+            override fun onFlashlightAvailabilityChanged(available: Boolean) {}
+        })
+        backgroundExecutor.runAllReady()
+
+        val captor = argumentCaptor<CameraManager.TorchCallback>()
+        verify(cameraManager).registerTorchCallback(any(), capture(captor))
+        remove = true
+        captor.value.onTorchModeChanged(ID, true)
+    }
+
     private fun injectCamera(
         flash: Boolean = true,
         facing: Int = CameraCharacteristics.LENS_FACING_BACK
     ): String {
-        val cameraID = "ID"
+        val cameraID = ID
         val camera = CameraCharacteristics(CameraMetadataNative().apply {
             set(CameraCharacteristics.FLASH_INFO_AVAILABLE, flash)
             set(CameraCharacteristics.LENS_FACING, facing)
@@ -141,4 +174,8 @@
         `when`(cameraManager.getCameraCharacteristics(cameraID)).thenReturn(camera)
         return cameraID
     }
+
+    companion object {
+        private const val ID = "ID"
+    }
 }
diff --git a/packages/SystemUI/tests/src/com/android/systemui/statusbar/policy/SafetyControllerTest.kt b/packages/SystemUI/tests/src/com/android/systemui/statusbar/policy/SafetyControllerTest.kt
index 89989ce..b03edaf 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/statusbar/policy/SafetyControllerTest.kt
+++ b/packages/SystemUI/tests/src/com/android/systemui/statusbar/policy/SafetyControllerTest.kt
@@ -27,6 +27,7 @@
 import androidx.test.filters.SmallTest
 import com.android.systemui.SysuiTestCase
 import com.android.systemui.util.mockito.any
+import com.google.common.truth.Truth.assertThat
 import org.junit.Assert.assertEquals
 import org.junit.Before
 import org.junit.Test
@@ -130,4 +131,61 @@
         controller.mPermControllerChangeReceiver.onReceive(context, testIntent)
         verify(listener, never()).onSafetyCenterEnableChanged(true)
     }
+
+    @Test
+    fun listenerRemovedWhileDispatching_doesNotCrash() {
+        var remove = false
+        val callback = object : SafetyController.Listener {
+            override fun onSafetyCenterEnableChanged(isSafetyCenterEnabled: Boolean) {
+                if (remove) {
+                    controller.removeCallback(this)
+                }
+            }
+        }
+
+        controller.addCallback(callback)
+        controller.addCallback {}
+
+        remove = true
+
+        `when`(scm.isSafetyCenterEnabled).thenReturn(true)
+        val testIntent = Intent(Intent.ACTION_PACKAGE_CHANGED)
+        testIntent.data = Uri.parse("package:$TEST_PC_PKG")
+        controller.mPermControllerChangeReceiver.onReceive(context, testIntent)
+    }
+
+    @Test
+    fun listenerRemovedWhileDispatching_otherCallbacksCalled() {
+        var remove = false
+        var called = false
+
+        val callback1 = object : SafetyController.Listener {
+            override fun onSafetyCenterEnableChanged(isSafetyCenterEnabled: Boolean) {
+                if (remove) {
+                    controller.removeCallback(this)
+                }
+            }
+        }
+
+        val callback2 = object : SafetyController.Listener {
+            override fun onSafetyCenterEnableChanged(isSafetyCenterEnabled: Boolean) {
+                // When the first callback is removed, we track if this is called
+                if (remove) {
+                    called = true
+                }
+            }
+        }
+
+        controller.addCallback(callback1)
+        controller.addCallback(callback2)
+
+        remove = true
+
+        `when`(scm.isSafetyCenterEnabled).thenReturn(true)
+        val testIntent = Intent(Intent.ACTION_PACKAGE_CHANGED)
+        testIntent.data = Uri.parse("package:$TEST_PC_PKG")
+        controller.mPermControllerChangeReceiver.onReceive(context, testIntent)
+
+        assertThat(called).isTrue()
+    }
 }
\ No newline at end of file
diff --git a/packages/SystemUI/tests/src/com/android/systemui/statusbar/policy/SecurityControllerTest.java b/packages/SystemUI/tests/src/com/android/systemui/statusbar/policy/SecurityControllerTest.java
index c35bc69..1dab84e 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/statusbar/policy/SecurityControllerTest.java
+++ b/packages/SystemUI/tests/src/com/android/systemui/statusbar/policy/SecurityControllerTest.java
@@ -63,6 +63,7 @@
 import java.util.ArrayList;
 import java.util.Arrays;
 import java.util.List;
+import java.util.concurrent.atomic.AtomicBoolean;
 
 @SmallTest
 @RunWith(AndroidJUnit4.class)
@@ -217,6 +218,28 @@
                 ), any(NetworkCallback.class));
     }
 
+    @Test
+    public void testRemoveCallbackWhileDispatch_doesntCrash() {
+        final AtomicBoolean remove = new AtomicBoolean(false);
+        SecurityController.SecurityControllerCallback callback =
+                new SecurityController.SecurityControllerCallback() {
+                    @Override
+                    public void onStateChanged() {
+                        if (remove.get()) {
+                            mSecurityController.removeCallback(this);
+                        }
+                    }
+                };
+        mSecurityController.addCallback(callback);
+        // Add another callback so the iteration continues
+        mSecurityController.addCallback(() -> {});
+        mBgExecutor.runAllReady();
+        remove.set(true);
+
+        mSecurityController.onUserSwitched(10);
+        mBgExecutor.runAllReady();
+    }
+
     /**
      * refresh CA certs by sending a user unlocked broadcast for the desired user
      */
diff --git a/packages/SystemUI/tests/src/com/android/systemui/statusbar/policy/ZenModeControllerImplTest.java b/packages/SystemUI/tests/src/com/android/systemui/statusbar/policy/ZenModeControllerImplTest.java
index 6825f65..f1a2c28 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/statusbar/policy/ZenModeControllerImplTest.java
+++ b/packages/SystemUI/tests/src/com/android/systemui/statusbar/policy/ZenModeControllerImplTest.java
@@ -47,6 +47,7 @@
 import org.mockito.MockitoAnnotations;
 
 import java.util.List;
+import java.util.concurrent.atomic.AtomicBoolean;
 import java.util.concurrent.atomic.AtomicInteger;
 
 @SmallTest
@@ -174,4 +175,26 @@
         }
 
     }
+
+    @Test
+    public void testCallbackRemovedWhileDispatching_doesntCrash() {
+        final AtomicBoolean remove = new AtomicBoolean(false);
+        mGlobalSettings.putInt(Settings.Global.ZEN_MODE, Settings.Global.ZEN_MODE_OFF);
+        TestableLooper.get(this).processAllMessages();
+        final ZenModeController.Callback callback = new ZenModeController.Callback() {
+            @Override
+            public void onZenChanged(int zen) {
+                if (remove.get()) {
+                    mController.removeCallback(this);
+                }
+            }
+        };
+        mController.addCallback(callback);
+        mController.addCallback(new ZenModeController.Callback() {});
+
+        remove.set(true);
+
+        mGlobalSettings.putInt(Settings.Global.ZEN_MODE, Settings.Global.ZEN_MODE_NO_INTERRUPTIONS);
+        TestableLooper.get(this).processAllMessages();
+    }
 }
diff --git a/packages/SystemUI/tests/src/com/android/systemui/unfold/progress/MainThreadUnfoldTransitionProgressProviderTest.kt b/packages/SystemUI/tests/src/com/android/systemui/unfold/progress/MainThreadUnfoldTransitionProgressProviderTest.kt
index 4e61b89..2bc05fc 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/unfold/progress/MainThreadUnfoldTransitionProgressProviderTest.kt
+++ b/packages/SystemUI/tests/src/com/android/systemui/unfold/progress/MainThreadUnfoldTransitionProgressProviderTest.kt
@@ -16,6 +16,8 @@
 
 package com.android.systemui.unfold.progress
 
+import android.os.Handler
+import android.os.HandlerThread
 import android.os.Looper
 import android.testing.AndroidTestingRunner
 import android.testing.TestableLooper.RunWithLooper
@@ -24,6 +26,7 @@
 import com.android.systemui.unfold.TestUnfoldTransitionProvider
 import com.android.systemui.utils.os.FakeHandler
 import kotlin.test.Test
+import kotlinx.coroutines.test.runTest
 import org.junit.runner.RunWith
 
 @RunWith(AndroidTestingRunner::class)
@@ -93,4 +96,13 @@
 
         listener.assertNotStarted()
     }
+
+    @Test
+    fun addCallback_fromBackgroundThread_succeeds() = runTest {
+        val bgHandler = Handler(HandlerThread("TestBgThread").apply { start() }.looper)
+        bgHandler.runWithScissors({ progressProvider.addCallback(listener) }, 5000L)
+
+        wrappedProgressProvider.onTransitionStarted()
+        listener.assertStarted()
+    }
 }
diff --git a/packages/SystemUI/tests/src/com/android/systemui/util/service/PersistentConnectionManagerTest.java b/packages/SystemUI/tests/src/com/android/systemui/util/service/PersistentConnectionManagerTest.java
index db0139c..55c49ee 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/util/service/PersistentConnectionManagerTest.java
+++ b/packages/SystemUI/tests/src/com/android/systemui/util/service/PersistentConnectionManagerTest.java
@@ -24,6 +24,7 @@
 import androidx.test.filters.SmallTest;
 
 import com.android.systemui.SysuiTestCase;
+import com.android.systemui.dump.DumpManager;
 import com.android.systemui.util.concurrency.FakeExecutor;
 import com.android.systemui.util.time.FakeSystemClock;
 
@@ -41,6 +42,7 @@
     private static final int MAX_RETRIES = 5;
     private static final int RETRY_DELAY_MS = 1000;
     private static final int CONNECTION_MIN_DURATION_MS = 5000;
+    private static final String DUMPSYS_NAME = "dumpsys_name";
 
     private FakeSystemClock mFakeClock = new FakeSystemClock();
     private FakeExecutor mFakeExecutor = new FakeExecutor(mFakeClock);
@@ -49,8 +51,14 @@
     private ObservableServiceConnection<Proxy> mConnection;
 
     @Mock
+    private ObservableServiceConnection.Callback<Proxy> mConnectionCallback;
+
+    @Mock
     private Observer mObserver;
 
+    @Mock
+    private DumpManager mDumpManager;
+
     private static class Proxy {
     }
 
@@ -63,6 +71,8 @@
         mConnectionManager = new PersistentConnectionManager<>(
                 mFakeClock,
                 mFakeExecutor,
+                mDumpManager,
+                DUMPSYS_NAME,
                 mConnection,
                 MAX_RETRIES,
                 RETRY_DELAY_MS,
@@ -154,4 +164,16 @@
         callbackCaptor.getValue().onSourceChanged();
         verify(mConnection).bind();
     }
+
+    @Test
+    public void testAddConnectionCallback() {
+        mConnectionManager.addConnectionCallback(mConnectionCallback);
+        verify(mConnection).addCallback(mConnectionCallback);
+    }
+
+    @Test
+    public void testRemoveConnectionCallback() {
+        mConnectionManager.removeConnectionCallback(mConnectionCallback);
+        verify(mConnection).removeCallback(mConnectionCallback);
+    }
 }
diff --git a/packages/SystemUI/tests/utils/src/com/android/systemui/biometrics/data/repository/FakeDisplayStateRepository.kt b/packages/SystemUI/tests/utils/src/com/android/systemui/biometrics/data/repository/FakeDisplayStateRepository.kt
index 3fdeb30..3b5ff38 100644
--- a/packages/SystemUI/tests/utils/src/com/android/systemui/biometrics/data/repository/FakeDisplayStateRepository.kt
+++ b/packages/SystemUI/tests/utils/src/com/android/systemui/biometrics/data/repository/FakeDisplayStateRepository.kt
@@ -17,6 +17,7 @@
 
 package com.android.systemui.biometrics.data.repository
 
+import android.util.Size
 import com.android.systemui.biometrics.shared.model.DisplayRotation
 import kotlinx.coroutines.flow.MutableStateFlow
 import kotlinx.coroutines.flow.StateFlow
@@ -29,6 +30,9 @@
     private val _currentRotation = MutableStateFlow<DisplayRotation>(DisplayRotation.ROTATION_0)
     override val currentRotation: StateFlow<DisplayRotation> = _currentRotation.asStateFlow()
 
+    private val _currentDisplaySize = MutableStateFlow<Size>(Size(0, 0))
+    override val currentDisplaySize: StateFlow<Size> = _currentDisplaySize.asStateFlow()
+
     override val isReverseDefaultRotation = false
 
     fun setIsInRearDisplayMode(isInRearDisplayMode: Boolean) {
@@ -38,4 +42,8 @@
     fun setCurrentRotation(currentRotation: DisplayRotation) {
         _currentRotation.value = currentRotation
     }
+
+    fun setCurrentDisplaySize(size: Size) {
+        _currentDisplaySize.value = size
+    }
 }
diff --git a/packages/SystemUI/tests/utils/src/com/android/systemui/biometrics/data/repository/FakeFacePropertyRepository.kt b/packages/SystemUI/tests/utils/src/com/android/systemui/biometrics/data/repository/FakeFacePropertyRepository.kt
index 51ce9f0..77f501f 100644
--- a/packages/SystemUI/tests/utils/src/com/android/systemui/biometrics/data/repository/FakeFacePropertyRepository.kt
+++ b/packages/SystemUI/tests/utils/src/com/android/systemui/biometrics/data/repository/FakeFacePropertyRepository.kt
@@ -17,6 +17,7 @@
 
 package com.android.systemui.biometrics.data.repository
 
+import android.graphics.Point
 import com.android.systemui.biometrics.shared.model.LockoutMode
 import kotlinx.coroutines.flow.MutableStateFlow
 import kotlinx.coroutines.flow.StateFlow
@@ -28,6 +29,10 @@
 
     private val lockoutModesForUser = mutableMapOf<Int, LockoutMode>()
 
+    private val faceSensorLocation = MutableStateFlow<Point?>(null)
+    override val sensorLocation: StateFlow<Point?>
+        get() = faceSensorLocation
+
     fun setLockoutMode(userId: Int, mode: LockoutMode) {
         lockoutModesForUser[userId] = mode
     }
@@ -38,4 +43,8 @@
     fun setSensorInfo(value: FaceSensorInfo?) {
         faceSensorInfo.value = value
     }
+
+    fun setSensorLocation(value: Point?) {
+        faceSensorLocation.value = value
+    }
 }
diff --git a/packages/SystemUI/tests/utils/src/com/android/systemui/communal/data/repository/FakeCommunalMediaRepository.kt b/packages/SystemUI/tests/utils/src/com/android/systemui/communal/data/repository/FakeCommunalMediaRepository.kt
index 3ab1b6c..3ea3ccf 100644
--- a/packages/SystemUI/tests/utils/src/com/android/systemui/communal/data/repository/FakeCommunalMediaRepository.kt
+++ b/packages/SystemUI/tests/utils/src/com/android/systemui/communal/data/repository/FakeCommunalMediaRepository.kt
@@ -16,8 +16,24 @@
 
 package com.android.systemui.communal.data.repository
 
+import com.android.systemui.communal.data.model.CommunalMediaModel
+import kotlinx.coroutines.flow.Flow
 import kotlinx.coroutines.flow.MutableStateFlow
 
-class FakeCommunalMediaRepository(
-    override val mediaPlaying: MutableStateFlow<Boolean> = MutableStateFlow(false)
-) : CommunalMediaRepository
+class FakeCommunalMediaRepository : CommunalMediaRepository {
+    private val _mediaModel = MutableStateFlow(CommunalMediaModel.INACTIVE)
+
+    override val mediaModel: Flow<CommunalMediaModel> = _mediaModel
+
+    fun mediaActive(timestamp: Long = 0L) {
+        _mediaModel.value =
+            CommunalMediaModel(
+                hasAnyMediaOrRecommendation = true,
+                createdTimestampMillis = timestamp,
+            )
+    }
+
+    fun mediaInactive() {
+        _mediaModel.value = CommunalMediaModel.INACTIVE
+    }
+}
diff --git a/packages/SystemUI/tests/utils/src/com/android/systemui/communal/data/repository/FakeCommunalRepository.kt b/packages/SystemUI/tests/utils/src/com/android/systemui/communal/data/repository/FakeCommunalRepository.kt
index c85c27e..e82cae4 100644
--- a/packages/SystemUI/tests/utils/src/com/android/systemui/communal/data/repository/FakeCommunalRepository.kt
+++ b/packages/SystemUI/tests/utils/src/com/android/systemui/communal/data/repository/FakeCommunalRepository.kt
@@ -9,6 +9,7 @@
 import kotlinx.coroutines.flow.MutableStateFlow
 import kotlinx.coroutines.flow.SharingStarted
 import kotlinx.coroutines.flow.StateFlow
+import kotlinx.coroutines.flow.asStateFlow
 import kotlinx.coroutines.flow.flatMapLatest
 import kotlinx.coroutines.flow.flowOf
 import kotlinx.coroutines.flow.stateIn
@@ -52,4 +53,12 @@
     fun setIsCommunalHubShowing(isCommunalHubShowing: Boolean) {
         _isCommunalHubShowing.value = isCommunalHubShowing
     }
+
+    private val _isCtaTileInViewModeVisible: MutableStateFlow<Boolean> = MutableStateFlow(true)
+    override val isCtaTileInViewModeVisible: Flow<Boolean> =
+        _isCtaTileInViewModeVisible.asStateFlow()
+
+    override fun setCtaTileInViewModeVisibility(isVisible: Boolean) {
+        _isCtaTileInViewModeVisible.value = isVisible
+    }
 }
diff --git a/packages/SystemUI/tests/utils/src/com/android/systemui/communal/data/repository/FakeCommunalWidgetRepository.kt b/packages/SystemUI/tests/utils/src/com/android/systemui/communal/data/repository/FakeCommunalWidgetRepository.kt
index c6f12e2..397dc1a 100644
--- a/packages/SystemUI/tests/utils/src/com/android/systemui/communal/data/repository/FakeCommunalWidgetRepository.kt
+++ b/packages/SystemUI/tests/utils/src/com/android/systemui/communal/data/repository/FakeCommunalWidgetRepository.kt
@@ -1,15 +1,38 @@
 package com.android.systemui.communal.data.repository
 
+import android.content.ComponentName
 import com.android.systemui.communal.shared.model.CommunalWidgetContentModel
+import kotlinx.coroutines.CoroutineScope
+import kotlinx.coroutines.coroutineScope
 import kotlinx.coroutines.flow.Flow
+import kotlinx.coroutines.flow.MutableSharedFlow
 import kotlinx.coroutines.flow.MutableStateFlow
+import kotlinx.coroutines.launch
 
 /** Fake implementation of [CommunalWidgetRepository] */
-class FakeCommunalWidgetRepository : CommunalWidgetRepository {
+class FakeCommunalWidgetRepository(private val coroutineScope: CoroutineScope) :
+    CommunalWidgetRepository {
     private val _communalWidgets = MutableStateFlow<List<CommunalWidgetContentModel>>(emptyList())
     override val communalWidgets: Flow<List<CommunalWidgetContentModel>> = _communalWidgets
+    private val _widgetAdded = MutableSharedFlow<Int>()
+    val widgetAdded: Flow<Int> = _widgetAdded
+
+    private var nextWidgetId = 1
 
     fun setCommunalWidgets(inventory: List<CommunalWidgetContentModel>) {
         _communalWidgets.value = inventory
     }
+
+    override fun addWidget(
+        provider: ComponentName,
+        priority: Int,
+        configureWidget: suspend (id: Int) -> Boolean
+    ) {
+        coroutineScope.launch {
+            val id = nextWidgetId++
+            if (configureWidget.invoke(id)) {
+                _widgetAdded.emit(id)
+            }
+        }
+    }
 }
diff --git a/packages/SystemUI/tests/utils/src/com/android/systemui/communal/domain/interactor/CommunalInteractorFactory.kt b/packages/SystemUI/tests/utils/src/com/android/systemui/communal/domain/interactor/CommunalInteractorFactory.kt
index faacce6..eb287ee 100644
--- a/packages/SystemUI/tests/utils/src/com/android/systemui/communal/domain/interactor/CommunalInteractorFactory.kt
+++ b/packages/SystemUI/tests/utils/src/com/android/systemui/communal/domain/interactor/CommunalInteractorFactory.kt
@@ -36,7 +36,8 @@
     fun create(
         testScope: TestScope = TestScope(),
         communalRepository: FakeCommunalRepository = FakeCommunalRepository(),
-        widgetRepository: FakeCommunalWidgetRepository = FakeCommunalWidgetRepository(),
+        widgetRepository: FakeCommunalWidgetRepository =
+            FakeCommunalWidgetRepository(testScope.backgroundScope),
         mediaRepository: FakeCommunalMediaRepository = FakeCommunalMediaRepository(),
         smartspaceRepository: FakeSmartspaceRepository = FakeSmartspaceRepository(),
         tutorialRepository: FakeCommunalTutorialRepository = FakeCommunalTutorialRepository(),
diff --git a/packages/SystemUI/tests/utils/src/com/android/systemui/statusbar/notification/data/FakeStatusBarNotificationsDataLayerModule.kt b/packages/SystemUI/tests/utils/src/com/android/systemui/statusbar/notification/data/FakeStatusBarNotificationsDataLayerModule.kt
index 788e3aa..1ffc9f4 100644
--- a/packages/SystemUI/tests/utils/src/com/android/systemui/statusbar/notification/data/FakeStatusBarNotificationsDataLayerModule.kt
+++ b/packages/SystemUI/tests/utils/src/com/android/systemui/statusbar/notification/data/FakeStatusBarNotificationsDataLayerModule.kt
@@ -15,8 +15,6 @@
  */
 package com.android.systemui.statusbar.notification.data
 
-import com.android.systemui.statusbar.notification.data.repository.FakeNotificationsKeyguardStateRepositoryModule
 import dagger.Module
 
-@Module(includes = [FakeNotificationsKeyguardStateRepositoryModule::class])
-object FakeStatusBarNotificationsDataLayerModule
+@Module(includes = []) object FakeStatusBarNotificationsDataLayerModule
diff --git a/packages/SystemUI/tests/utils/src/com/android/systemui/statusbar/notification/data/repository/FakeNotificationsKeyguardViewStateRepository.kt b/packages/SystemUI/tests/utils/src/com/android/systemui/statusbar/notification/data/repository/FakeNotificationsKeyguardViewStateRepository.kt
deleted file mode 100644
index 5d3cb4d..0000000
--- a/packages/SystemUI/tests/utils/src/com/android/systemui/statusbar/notification/data/repository/FakeNotificationsKeyguardViewStateRepository.kt
+++ /dev/null
@@ -1,49 +0,0 @@
-/*
- * Copyright (C) 2023 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-package com.android.systemui.statusbar.notification.data.repository
-
-import com.android.systemui.dagger.SysUISingleton
-import dagger.Binds
-import dagger.Module
-import javax.inject.Inject
-import kotlinx.coroutines.flow.Flow
-import kotlinx.coroutines.flow.MutableStateFlow
-
-@SysUISingleton
-class FakeNotificationsKeyguardViewStateRepository @Inject constructor() :
-    NotificationsKeyguardViewStateRepository {
-    private val _notificationsFullyHidden = MutableStateFlow(false)
-    override val areNotificationsFullyHidden: Flow<Boolean> = _notificationsFullyHidden
-
-    private val _isPulseExpanding = MutableStateFlow(false)
-    override val isPulseExpanding: Flow<Boolean> = _isPulseExpanding
-
-    fun setNotificationsFullyHidden(fullyHidden: Boolean) {
-        _notificationsFullyHidden.value = fullyHidden
-    }
-
-    fun setPulseExpanding(expanding: Boolean) {
-        _isPulseExpanding.value = expanding
-    }
-}
-
-@Module
-interface FakeNotificationsKeyguardStateRepositoryModule {
-    @Binds
-    fun bindFake(
-        fake: FakeNotificationsKeyguardViewStateRepository
-    ): NotificationsKeyguardViewStateRepository
-}
diff --git a/packages/SystemUI/tests/utils/src/com/android/systemui/statusbar/notification/data/repository/NotificationsKeyguardViewStateRepositoryKosmos.kt b/packages/SystemUI/tests/utils/src/com/android/systemui/statusbar/notification/data/repository/NotificationsKeyguardViewStateRepositoryKosmos.kt
index f2b9da4..df7fd94 100644
--- a/packages/SystemUI/tests/utils/src/com/android/systemui/statusbar/notification/data/repository/NotificationsKeyguardViewStateRepositoryKosmos.kt
+++ b/packages/SystemUI/tests/utils/src/com/android/systemui/statusbar/notification/data/repository/NotificationsKeyguardViewStateRepositoryKosmos.kt
@@ -18,7 +18,5 @@
 
 import com.android.systemui.kosmos.Kosmos
 
-var Kosmos.notificationsKeyguardViewStateRepository: NotificationsKeyguardViewStateRepository by
-    Kosmos.Fixture { fakeNotificationsKeyguardViewStateRepository }
-val Kosmos.fakeNotificationsKeyguardViewStateRepository by
-    Kosmos.Fixture { FakeNotificationsKeyguardViewStateRepository() }
+val Kosmos.notificationsKeyguardViewStateRepository: NotificationsKeyguardViewStateRepository by
+    Kosmos.Fixture { NotificationsKeyguardViewStateRepository() }
diff --git a/packages/SystemUI/tests/utils/src/com/android/systemui/statusbar/notification/stack/domain/interactor/NotificationsKeyguardInteractorKosmos.kt b/packages/SystemUI/tests/utils/src/com/android/systemui/statusbar/notification/stack/domain/interactor/NotificationsKeyguardInteractorKosmos.kt
index 432464e..61a38b8 100644
--- a/packages/SystemUI/tests/utils/src/com/android/systemui/statusbar/notification/stack/domain/interactor/NotificationsKeyguardInteractorKosmos.kt
+++ b/packages/SystemUI/tests/utils/src/com/android/systemui/statusbar/notification/stack/domain/interactor/NotificationsKeyguardInteractorKosmos.kt
@@ -18,13 +18,11 @@
 
 import com.android.systemui.kosmos.Kosmos
 import com.android.systemui.kosmos.Kosmos.Fixture
-import com.android.systemui.kosmos.testDispatcher
 import com.android.systemui.statusbar.notification.data.repository.notificationsKeyguardViewStateRepository
 import com.android.systemui.statusbar.notification.domain.interactor.NotificationsKeyguardInteractor
 
 val Kosmos.notificationsKeyguardInteractor by Fixture {
     NotificationsKeyguardInteractor(
         repository = notificationsKeyguardViewStateRepository,
-        backgroundDispatcher = testDispatcher,
     )
 }
diff --git a/packages/SystemUI/unfold/src/com/android/systemui/unfold/progress/MainThreadUnfoldTransitionProgressProvider.kt b/packages/SystemUI/unfold/src/com/android/systemui/unfold/progress/MainThreadUnfoldTransitionProgressProvider.kt
index 9bdf3d5..fdce147 100644
--- a/packages/SystemUI/unfold/src/com/android/systemui/unfold/progress/MainThreadUnfoldTransitionProgressProvider.kt
+++ b/packages/SystemUI/unfold/src/com/android/systemui/unfold/progress/MainThreadUnfoldTransitionProgressProvider.kt
@@ -24,12 +24,16 @@
 import dagger.assisted.Assisted
 import dagger.assisted.AssistedFactory
 import dagger.assisted.AssistedInject
+import java.util.Collections.synchronizedMap
 
 /**
  * [UnfoldTransitionProgressProvider] that forwards all progress to the main thread handler.
  *
  * This is needed when progress are calculated in the background, but some listeners need the
  * callbacks in the main thread.
+ *
+ * Note that this class assumes that the root provider has thread safe callback registration, as
+ * they might be called from any thread.
  */
 class MainThreadUnfoldTransitionProgressProvider
 @AssistedInject
@@ -38,27 +42,20 @@
     @Assisted private val rootProvider: UnfoldTransitionProgressProvider
 ) : UnfoldTransitionProgressProvider {
 
-    private val listenerMap = mutableMapOf<TransitionProgressListener, TransitionProgressListener>()
+    private val listenerMap: MutableMap<TransitionProgressListener, TransitionProgressListener> =
+        synchronizedMap(mutableMapOf())
 
     override fun addCallback(listener: TransitionProgressListener) {
-        assertMainThread()
         val proxy = TransitionProgressListerProxy(listener)
         rootProvider.addCallback(proxy)
         listenerMap[listener] = proxy
     }
 
     override fun removeCallback(listener: TransitionProgressListener) {
-        assertMainThread()
         val proxy = listenerMap.remove(listener) ?: return
         rootProvider.removeCallback(proxy)
     }
 
-    private fun assertMainThread() {
-        check(mainHandler.looper.isCurrentThread) {
-            "Should be called from the main thread, but this is ${Thread.currentThread()}"
-        }
-    }
-
     override fun destroy() {
         rootProvider.destroy()
     }
diff --git a/packages/overlays/NoCutoutOverlay/res/values/config.xml b/packages/overlays/NoCutoutOverlay/res/values/config.xml
index ed0340b..b44a153a 100644
--- a/packages/overlays/NoCutoutOverlay/res/values/config.xml
+++ b/packages/overlays/NoCutoutOverlay/res/values/config.xml
@@ -20,10 +20,17 @@
          black in software (to avoid aliasing or emulate a cutout that is not physically existent).
      -->
     <bool name="config_fillMainBuiltInDisplayCutout">false</bool>
+    <!-- Whether the display cutout region of the secondary built-in display should be forced to
+         black in software (to avoid aliasing or emulate a cutout that is not physically existent).
+     -->
+    <bool name="config_fillSecondaryBuiltInDisplayCutout">false</bool>
 
     <!-- If true, and there is a cutout on the main built in display, the cutout will be masked
          by shrinking the display such that it does not overlap the cutout area. -->
     <bool name="config_maskMainBuiltInDisplayCutout">true</bool>
+    <!-- If true, and there is a cutout on the secondary built in display, the cutout will be masked
+         by shrinking the display such that it does not overlap the cutout area. -->
+    <bool name="config_maskSecondaryBuiltInDisplayCutout">true</bool>
 
     <!-- Height of the status bar -->
     <dimen name="status_bar_height_portrait">28dp</dimen>
diff --git a/proto/src/criticalevents/critical_event_log.proto b/proto/src/criticalevents/critical_event_log.proto
index 9cda267..cffcd09 100644
--- a/proto/src/criticalevents/critical_event_log.proto
+++ b/proto/src/criticalevents/critical_event_log.proto
@@ -60,8 +60,11 @@
     JavaCrash java_crash = 5;
     NativeCrash native_crash = 6;
     SystemServerStarted system_server_started = 7;
+    InstallPackages install_packages = 8;
   }
 
+  message InstallPackages {}
+
   message SystemServerStarted {}
 
   message Watchdog {
diff --git a/services/companion/java/com/android/server/companion/AssociationRequestsProcessor.java b/services/companion/java/com/android/server/companion/AssociationRequestsProcessor.java
index a6ed846..4b3772a 100644
--- a/services/companion/java/com/android/server/companion/AssociationRequestsProcessor.java
+++ b/services/companion/java/com/android/server/companion/AssociationRequestsProcessor.java
@@ -284,7 +284,7 @@
         final AssociationInfo association = new AssociationInfo(id, userId, packageName,
                 /* tag */ null, macAddress, displayName, deviceProfile, associatedDevice,
                 selfManaged, /* notifyOnDeviceNearby */ false, /* revoked */ false,
-                timestamp, Long.MAX_VALUE, /* systemDataSyncFlags */ 0);
+                /* pending */ false, timestamp, Long.MAX_VALUE, /* systemDataSyncFlags */ 0);
 
         // Add role holder for association (if specified) and add new association to store.
         maybeGrantRoleAndStoreAssociation(association, callback, resultReceiver);
diff --git a/services/companion/java/com/android/server/companion/BackupRestoreProcessor.java b/services/companion/java/com/android/server/companion/BackupRestoreProcessor.java
index a7dbd1c..e4cc1f8 100644
--- a/services/companion/java/com/android/server/companion/BackupRestoreProcessor.java
+++ b/services/companion/java/com/android/server/companion/BackupRestoreProcessor.java
@@ -18,6 +18,8 @@
 
 import static android.os.UserHandle.getCallingUserId;
 
+import static com.android.server.companion.CompanionDeviceManagerService.PerUserAssociationSet;
+
 import android.annotation.NonNull;
 import android.annotation.SuppressLint;
 import android.annotation.UserIdInt;
@@ -26,9 +28,11 @@
 import android.companion.datatransfer.SystemDataTransferRequest;
 import android.content.pm.ApplicationInfo;
 import android.content.pm.PackageManagerInternal;
+import android.util.ArraySet;
 import android.util.Log;
 import android.util.Slog;
 
+import com.android.internal.annotations.GuardedBy;
 import com.android.internal.util.CollectionUtils;
 import com.android.server.companion.datatransfer.SystemDataTransferRequestStore;
 
@@ -58,6 +62,14 @@
     @NonNull
     private final AssociationRequestsProcessor mAssociationRequestsProcessor;
 
+    /**
+     * A structure that consists of a set of restored associations that are pending corresponding
+     * companion app to be installed.
+     */
+    @GuardedBy("mAssociationsPendingAppInstall")
+    private final PerUserAssociationSet mAssociationsPendingAppInstall =
+            new PerUserAssociationSet();
+
     BackupRestoreProcessor(@NonNull CompanionDeviceManagerService service,
                            @NonNull AssociationStoreImpl associationStore,
                            @NonNull PersistentDataStore persistentStore,
@@ -124,7 +136,7 @@
         byte[] requestsPayload = new byte[buffer.getInt()];
         buffer.get(requestsPayload);
         List<SystemDataTransferRequest> restoredRequestsForUser =
-                mSystemDataTransferRequestStore.readRequestsFromPayload(requestsPayload);
+                mSystemDataTransferRequestStore.readRequestsFromPayload(requestsPayload, userId);
 
         // Get a list of installed packages ahead of time.
         List<ApplicationInfo> installedApps = mPackageManager.getInstalledApplications(
@@ -170,7 +182,7 @@
                 mAssociationRequestsProcessor.maybeGrantRoleAndStoreAssociation(newAssociation,
                         null, null);
             } else {
-                // TODO(b/314992577): Check if package is installed before granting
+                addToPendingAppInstall(newAssociation);
             }
 
             // Re-map restored system data transfer requests to newly created associations
@@ -185,6 +197,30 @@
         mService.persistStateForUser(userId);
     }
 
+    void addToPendingAppInstall(@NonNull AssociationInfo association) {
+        association = (new AssociationInfo.Builder(association))
+                .setPending(true)
+                .build();
+
+        synchronized (mAssociationsPendingAppInstall) {
+            mAssociationsPendingAppInstall.forUser(association.getUserId()).add(association);
+        }
+    }
+
+    void removeFromPendingAppInstall(@NonNull AssociationInfo association) {
+        synchronized (mAssociationsPendingAppInstall) {
+            mAssociationsPendingAppInstall.forUser(association.getUserId()).remove(association);
+        }
+    }
+
+    @NonNull
+    Set<AssociationInfo> getAssociationsPendingAppInstallForUser(@UserIdInt int userId) {
+        synchronized (mAssociationsPendingAppInstall) {
+            // Return a copy.
+            return new ArraySet<>(mAssociationsPendingAppInstall.forUser(userId));
+        }
+    }
+
     /**
      * Detects and handles collision between restored association and local association. Returns
      * true if there has been a collision and false otherwise.
diff --git a/services/companion/java/com/android/server/companion/CompanionDeviceManagerService.java b/services/companion/java/com/android/server/companion/CompanionDeviceManagerService.java
index 858887a..056ec89 100644
--- a/services/companion/java/com/android/server/companion/CompanionDeviceManagerService.java
+++ b/services/companion/java/com/android/server/companion/CompanionDeviceManagerService.java
@@ -287,7 +287,9 @@
         final Set<Integer> usersToPersistStateFor = new ArraySet<>();
 
         for (AssociationInfo association : allAssociations) {
-            if (!association.isRevoked()) {
+            if (association.isPending()) {
+                mBackupRestoreProcessor.addToPendingAppInstall(association);
+            } else if (!association.isRevoked()) {
                 activeAssociations.add(association);
             } else if (maybeRemoveRoleHolderForAssociation(association)) {
                 // Nothing more to do here, but we'll need to persist all the associations to the
@@ -514,6 +516,9 @@
                 mAssociationStore.getAssociationsForUser(userId));
         // ... and add the revoked (removed) association, that are yet to be permanently removed.
         allAssociations.addAll(getPendingRoleHolderRemovalAssociationsForUser(userId));
+        // ... and add the restored associations that are pending missing package installation.
+        allAssociations.addAll(mBackupRestoreProcessor
+                .getAssociationsPendingAppInstallForUser(userId));
 
         final Map<String, Set<Integer>> usedIdsForUser = getPreviouslyUsedIdsForUser(userId);
 
@@ -583,7 +588,19 @@
 
     private void onPackageAddedInternal(@UserIdInt int userId, @NonNull String packageName) {
         if (DEBUG) Log.i(TAG, "onPackageAddedInternal() u" + userId + "/" + packageName);
-        // TODO(b/314992577): Retroactively grant roles for restored associations
+
+        Set<AssociationInfo> associationsPendingAppInstall = mBackupRestoreProcessor
+                .getAssociationsPendingAppInstallForUser(userId);
+        for (AssociationInfo association : associationsPendingAppInstall) {
+            if (!packageName.equals(association.getPackageName())) continue;
+
+            AssociationInfo newAssociation = new AssociationInfo.Builder(association)
+                    .setPending(false)
+                    .build();
+            mAssociationRequestsProcessor.maybeGrantRoleAndStoreAssociation(newAssociation,
+                    null, null);
+            mBackupRestoreProcessor.removeFromPendingAppInstall(association);
+        }
     }
 
     // Revoke associations if the selfManaged companion device does not connect for 3 months.
@@ -1152,6 +1169,15 @@
                 usedIds.put(it.getId(), true);
             }
 
+            // Some IDs may be reserved by associations that aren't stored yet due to missing
+            // package after a backup restoration. We don't want the ID to have been taken by
+            // another association by the time when it is activated from the package installation.
+            final Set<AssociationInfo> pendingAssociations = mBackupRestoreProcessor
+                    .getAssociationsPendingAppInstallForUser(userId);
+            for (AssociationInfo it: pendingAssociations) {
+                usedIds.put(it.getId(), true);
+            }
+
             // Second: collect all IDs that have been previously used for this package (and user).
             final Set<Integer> previouslyUsedIds =
                     getPreviouslyUsedIdsForPackageLocked(userId, packageName);
@@ -1718,7 +1744,7 @@
         }
     }
 
-    private static class PerUserAssociationSet extends PerUser<Set<AssociationInfo>> {
+    static class PerUserAssociationSet extends PerUser<Set<AssociationInfo>> {
         @Override
         protected @NonNull Set<AssociationInfo> create(int userId) {
             return new ArraySet<>();
diff --git a/services/companion/java/com/android/server/companion/PersistentDataStore.java b/services/companion/java/com/android/server/companion/PersistentDataStore.java
index dbaf7e8..1ebe65c 100644
--- a/services/companion/java/com/android/server/companion/PersistentDataStore.java
+++ b/services/companion/java/com/android/server/companion/PersistentDataStore.java
@@ -189,6 +189,7 @@
     private static final String XML_ATTR_SELF_MANAGED = "self_managed";
     private static final String XML_ATTR_NOTIFY_DEVICE_NEARBY = "notify_device_nearby";
     private static final String XML_ATTR_REVOKED = "revoked";
+    private static final String XML_ATTR_PENDING = "pending";
     private static final String XML_ATTR_TIME_APPROVED = "time_approved";
     private static final String XML_ATTR_LAST_TIME_CONNECTED = "last_time_connected";
     private static final String XML_ATTR_SYSTEM_DATA_SYNC_FLAGS = "system_data_sync_flags";
@@ -464,8 +465,8 @@
 
         out.add(new AssociationInfo(associationId, userId, appPackage, tag,
                 MacAddress.fromString(deviceAddress), null, profile, null,
-                /* managedByCompanionApp */ false, notify, /* revoked */ false, timeApproved,
-                Long.MAX_VALUE, /* systemDataSyncFlags */ 0));
+                /* managedByCompanionApp */ false, notify, /* revoked */ false, /* pending */ false,
+                timeApproved, Long.MAX_VALUE, /* systemDataSyncFlags */ 0));
     }
 
     private static void readAssociationsV1(@NonNull TypedXmlPullParser parser,
@@ -496,6 +497,7 @@
         final boolean selfManaged = readBooleanAttribute(parser, XML_ATTR_SELF_MANAGED);
         final boolean notify = readBooleanAttribute(parser, XML_ATTR_NOTIFY_DEVICE_NEARBY);
         final boolean revoked = readBooleanAttribute(parser, XML_ATTR_REVOKED, false);
+        final boolean pending = readBooleanAttribute(parser, XML_ATTR_PENDING, false);
         final long timeApproved = readLongAttribute(parser, XML_ATTR_TIME_APPROVED, 0L);
         final long lastTimeConnected = readLongAttribute(
                 parser, XML_ATTR_LAST_TIME_CONNECTED, Long.MAX_VALUE);
@@ -504,7 +506,7 @@
 
         final AssociationInfo associationInfo = createAssociationInfoNoThrow(associationId, userId,
                 appPackage, tag, macAddress, displayName, profile, selfManaged, notify, revoked,
-                timeApproved, lastTimeConnected, systemDataSyncFlags);
+                pending, timeApproved, lastTimeConnected, systemDataSyncFlags);
         if (associationInfo != null) {
             out.add(associationInfo);
         }
@@ -558,8 +560,8 @@
         writeBooleanAttribute(serializer, XML_ATTR_SELF_MANAGED, a.isSelfManaged());
         writeBooleanAttribute(
                 serializer, XML_ATTR_NOTIFY_DEVICE_NEARBY, a.isNotifyOnDeviceNearby());
-        writeBooleanAttribute(
-                serializer, XML_ATTR_REVOKED, a.isRevoked());
+        writeBooleanAttribute(serializer, XML_ATTR_REVOKED, a.isRevoked());
+        writeBooleanAttribute(serializer, XML_ATTR_PENDING, a.isPending());
         writeLongAttribute(serializer, XML_ATTR_TIME_APPROVED, a.getTimeApprovedMs());
         writeLongAttribute(
                 serializer, XML_ATTR_LAST_TIME_CONNECTED, a.getLastTimeConnectedMs());
@@ -603,14 +605,14 @@
             @UserIdInt int userId, @NonNull String appPackage, @Nullable String tag,
             @Nullable MacAddress macAddress, @Nullable CharSequence displayName,
             @Nullable String profile, boolean selfManaged, boolean notify, boolean revoked,
-            long timeApproved, long lastTimeConnected, int systemDataSyncFlags) {
+            boolean pending, long timeApproved, long lastTimeConnected, int systemDataSyncFlags) {
         AssociationInfo associationInfo = null;
         try {
             // We do not persist AssociatedDevice, which means that AssociationInfo retrieved from
             // datastore is not guaranteed to be identical to the one from initial association.
             associationInfo = new AssociationInfo(associationId, userId, appPackage, tag,
                     macAddress, displayName, profile, null, selfManaged, notify,
-                    revoked, timeApproved, lastTimeConnected, systemDataSyncFlags);
+                    revoked, pending, timeApproved, lastTimeConnected, systemDataSyncFlags);
         } catch (Exception e) {
             if (DEBUG) Log.w(TAG, "Could not create AssociationInfo", e);
         }
diff --git a/services/companion/java/com/android/server/companion/datatransfer/SystemDataTransferRequestStore.java b/services/companion/java/com/android/server/companion/datatransfer/SystemDataTransferRequestStore.java
index 8fe0454..51c5fd6 100644
--- a/services/companion/java/com/android/server/companion/datatransfer/SystemDataTransferRequestStore.java
+++ b/services/companion/java/com/android/server/companion/datatransfer/SystemDataTransferRequestStore.java
@@ -69,7 +69,6 @@
  *   <request
  *     association_id="1"
  *     data_type="1"
- *     user_id="12"
  *     is_user_consented="true"
  *   </request>
  * </requests>
@@ -86,7 +85,6 @@
 
     private static final String XML_ATTR_ASSOCIATION_ID = "association_id";
     private static final String XML_ATTR_DATA_TYPE = "data_type";
-    private static final String XML_ATTR_USER_ID = "user_id";
     private static final String XML_ATTR_IS_USER_CONSENTED = "is_user_consented";
 
     private static final int READ_FROM_DISK_TIMEOUT = 5; // in seconds
@@ -169,12 +167,12 @@
      * Parse the byte array containing XML information of system data transfer requests into
      * an array list of requests.
      */
-    public List<SystemDataTransferRequest> readRequestsFromPayload(byte[] payload) {
+    public List<SystemDataTransferRequest> readRequestsFromPayload(byte[] payload, int userId) {
         try (ByteArrayInputStream in = new ByteArrayInputStream(payload)) {
             final TypedXmlPullParser parser = Xml.resolvePullParser(in);
             XmlUtils.beginDocument(parser, XML_TAG_REQUESTS);
 
-            return readRequestsFromXml(parser);
+            return readRequestsFromXml(parser, userId);
         } catch (XmlPullParserException | IOException e) {
             Slog.e(LOG_TAG, "Error while reading requests file", e);
             return new ArrayList<>();
@@ -226,7 +224,7 @@
                 final TypedXmlPullParser parser = Xml.resolvePullParser(in);
                 XmlUtils.beginDocument(parser, XML_TAG_REQUESTS);
 
-                return readRequestsFromXml(parser);
+                return readRequestsFromXml(parser, userId);
             } catch (XmlPullParserException | IOException e) {
                 Slog.e(LOG_TAG, "Error while reading requests file", e);
                 return new ArrayList<>();
@@ -236,7 +234,8 @@
 
     @NonNull
     private ArrayList<SystemDataTransferRequest> readRequestsFromXml(
-            @NonNull TypedXmlPullParser parser) throws XmlPullParserException, IOException {
+            @NonNull TypedXmlPullParser parser, int userId)
+            throws XmlPullParserException, IOException {
         if (!isStartOfTag(parser, XML_TAG_REQUESTS)) {
             throw new XmlPullParserException("The XML doesn't have start tag: " + XML_TAG_REQUESTS);
         }
@@ -249,14 +248,15 @@
                 break;
             }
             if (isStartOfTag(parser, XML_TAG_REQUEST)) {
-                requests.add(readRequestFromXml(parser));
+                requests.add(readRequestFromXml(parser, userId));
             }
         }
 
         return requests;
     }
 
-    private SystemDataTransferRequest readRequestFromXml(@NonNull TypedXmlPullParser parser)
+    private SystemDataTransferRequest readRequestFromXml(@NonNull TypedXmlPullParser parser,
+            int userId)
             throws XmlPullParserException, IOException {
         if (!isStartOfTag(parser, XML_TAG_REQUEST)) {
             throw new XmlPullParserException("XML doesn't have start tag: " + XML_TAG_REQUEST);
@@ -264,7 +264,6 @@
 
         final int associationId = readIntAttribute(parser, XML_ATTR_ASSOCIATION_ID);
         final int dataType = readIntAttribute(parser, XML_ATTR_DATA_TYPE);
-        final int userId = readIntAttribute(parser, XML_ATTR_USER_ID);
         final boolean isUserConsented = readBooleanAttribute(parser, XML_ATTR_IS_USER_CONSENTED);
 
         switch (dataType) {
@@ -321,7 +320,6 @@
 
         writeIntAttribute(serializer, XML_ATTR_ASSOCIATION_ID, request.getAssociationId());
         writeIntAttribute(serializer, XML_ATTR_DATA_TYPE, request.getDataType());
-        writeIntAttribute(serializer, XML_ATTR_USER_ID, request.getUserId());
         writeBooleanAttribute(serializer, XML_ATTR_IS_USER_CONSENTED, request.isUserConsented());
 
         serializer.endTag(null, XML_TAG_REQUEST);
diff --git a/services/companion/java/com/android/server/companion/virtual/camera/VirtualCameraController.java b/services/companion/java/com/android/server/companion/virtual/camera/VirtualCameraController.java
index d089b05..2f9b6a5 100644
--- a/services/companion/java/com/android/server/companion/virtual/camera/VirtualCameraController.java
+++ b/services/companion/java/com/android/server/companion/virtual/camera/VirtualCameraController.java
@@ -55,9 +55,7 @@
     @GuardedBy("mCameras")
     private final Map<IBinder, CameraDescriptor> mCameras = new ArrayMap<>();
 
-    public VirtualCameraController() {
-        connectVirtualCameraService();
-    }
+    public VirtualCameraController() {}
 
     @VisibleForTesting
     VirtualCameraController(IVirtualCameraService virtualCameraService) {
diff --git a/services/core/Android.bp b/services/core/Android.bp
index dd001ec..a3fc3bf 100644
--- a/services/core/Android.bp
+++ b/services/core/Android.bp
@@ -203,6 +203,7 @@
         "com_android_wm_shell_flags_lib",
         "com.android.server.utils_aconfig-java",
         "service-jobscheduler-deviceidle.flags-aconfig-java",
+        "policy_flags_lib",
     ],
     javac_shard_size: 50,
     javacflags: [
diff --git a/services/core/java/com/android/server/BootReceiver.java b/services/core/java/com/android/server/BootReceiver.java
index 9f279b1..329aac6 100644
--- a/services/core/java/com/android/server/BootReceiver.java
+++ b/services/core/java/com/android/server/BootReceiver.java
@@ -48,6 +48,8 @@
 import com.android.modules.utils.TypedXmlPullParser;
 import com.android.modules.utils.TypedXmlSerializer;
 import com.android.server.am.DropboxRateLimiter;
+import com.android.server.os.TombstoneProtos;
+import com.android.server.os.TombstoneProtos.Tombstone;
 
 import org.xmlpull.v1.XmlPullParser;
 import org.xmlpull.v1.XmlPullParserException;
@@ -60,11 +62,14 @@
 import java.io.IOException;
 import java.nio.file.Files;
 import java.nio.file.attribute.PosixFilePermissions;
+import java.util.AbstractMap;
 import java.util.HashMap;
 import java.util.Iterator;
+import java.util.Map;
 import java.util.concurrent.locks.ReentrantLock;
 import java.util.regex.Matcher;
 import java.util.regex.Pattern;
+import java.util.stream.Collectors;
 
 /**
  * Performs a number of miscellaneous, non-system-critical actions
@@ -332,12 +337,12 @@
      *
      * @param ctx Context
      * @param tombstone path to the tombstone
-     * @param proto whether the tombstone is stored as proto
+     * @param tombstoneProto the parsed proto tombstone
      * @param processName the name of the process corresponding to the tombstone
      * @param tmpFileLock the lock for reading/writing tmp files
      */
     public static void addTombstoneToDropBox(
-                Context ctx, File tombstone, boolean proto, String processName,
+                Context ctx, File tombstone, Tombstone tombstoneProto, String processName,
                 ReentrantLock tmpFileLock) {
         final DropBoxManager db = ctx.getSystemService(DropBoxManager.class);
         if (db == null) {
@@ -347,31 +352,33 @@
 
         // Check if we should rate limit and abort early if needed.
         DropboxRateLimiter.RateLimitResult rateLimitResult =
-                sDropboxRateLimiter.shouldRateLimit(
-                        proto ? TAG_TOMBSTONE_PROTO_WITH_HEADERS : TAG_TOMBSTONE, processName);
+                sDropboxRateLimiter.shouldRateLimit(TAG_TOMBSTONE_PROTO_WITH_HEADERS, processName);
         if (rateLimitResult.shouldRateLimit()) return;
 
         HashMap<String, Long> timestamps = readTimestamps();
         try {
-            if (proto) {
-                if (recordFileTimestamp(tombstone, timestamps)) {
-                    // We need to attach the count indicating the number of dropped dropbox entries
-                    // due to rate limiting. Do this by enclosing the proto tombsstone in a
-                    // container proto that has the dropped entry count and the proto tombstone as
-                    // bytes (to avoid the complexity of reading and writing nested protos).
-                    tmpFileLock.lock();
-                    try {
-                        addAugmentedProtoToDropbox(tombstone, db, rateLimitResult);
-                    } finally {
-                        tmpFileLock.unlock();
-                    }
+            // Remove the memory data from the proto.
+            Tombstone tombstoneProtoWithoutMemory = removeMemoryFromTombstone(tombstoneProto);
+
+            final byte[] tombstoneBytes = tombstoneProtoWithoutMemory.toByteArray();
+
+            // Use JNI to call the c++ proto to text converter and add the headers to the tombstone.
+            String tombstoneWithoutMemory = new StringBuilder(getBootHeadersToLogAndUpdate())
+                    .append(rateLimitResult.createHeader())
+                    .append(getTombstoneText(tombstoneBytes))
+                    .toString();
+
+            // Add the tombstone without memory data to dropbox.
+            db.addText(TAG_TOMBSTONE, tombstoneWithoutMemory);
+
+            // Add the tombstone proto to dropbox.
+            if (recordFileTimestamp(tombstone, timestamps)) {
+                tmpFileLock.lock();
+                try {
+                    addAugmentedProtoToDropbox(tombstone, tombstoneBytes, db, rateLimitResult);
+                } finally {
+                    tmpFileLock.unlock();
                 }
-            } else {
-                // Add the header indicating how many events have been dropped due to rate limiting.
-                final String headers = getBootHeadersToLogAndUpdate()
-                        + rateLimitResult.createHeader();
-                addFileToDropBox(db, timestamps, headers, tombstone.getPath(), LOG_SIZE,
-                                 TAG_TOMBSTONE);
             }
         } catch (IOException e) {
             Slog.e(TAG, "Can't log tombstone", e);
@@ -380,11 +387,8 @@
     }
 
     private static void addAugmentedProtoToDropbox(
-                File tombstone, DropBoxManager db,
+                File tombstone, byte[] tombstoneBytes, DropBoxManager db,
                 DropboxRateLimiter.RateLimitResult rateLimitResult) throws IOException {
-        // Read the proto tombstone file as bytes.
-        final byte[] tombstoneBytes = Files.readAllBytes(tombstone.toPath());
-
         final File tombstoneProtoWithHeaders = File.createTempFile(
                 tombstone.getName(), ".tmp", TOMBSTONE_TMP_DIR);
         Files.setPosixFilePermissions(
@@ -417,6 +421,8 @@
         }
     }
 
+    private static native String getTombstoneText(byte[] tombstoneBytes);
+
     private static void addLastkToDropBox(
             DropBoxManager db, HashMap<String, Long> timestamps,
             String headers, String footers, String filename, int maxSize,
@@ -434,6 +440,31 @@
         addFileWithFootersToDropBox(db, timestamps, headers, footers, filename, maxSize, tag);
     }
 
+    /** Removes memory information from the Tombstone proto. */
+    @VisibleForTesting
+    public static Tombstone removeMemoryFromTombstone(Tombstone tombstoneProto) {
+        Tombstone.Builder tombstoneBuilder = tombstoneProto.toBuilder()
+                .clearMemoryMappings()
+                .clearThreads()
+                .putAllThreads(tombstoneProto.getThreadsMap().entrySet()
+                        .stream()
+                        .map(BootReceiver::clearMemoryDump)
+                        .collect(Collectors.toMap(e->e.getKey(), e->e.getValue())));
+
+        if (tombstoneProto.hasSignalInfo()) {
+            tombstoneBuilder.setSignalInfo(
+                    tombstoneProto.getSignalInfo().toBuilder().clearFaultAdjacentMetadata());
+        }
+
+        return tombstoneBuilder.build();
+    }
+
+    private static AbstractMap.SimpleEntry<Integer, TombstoneProtos.Thread> clearMemoryDump(
+            Map.Entry<Integer, TombstoneProtos.Thread> e) {
+        return new AbstractMap.SimpleEntry<Integer, TombstoneProtos.Thread>(
+            e.getKey(), e.getValue().toBuilder().clearMemoryDump().build());
+    }
+
     private static void addFileToDropBox(
             DropBoxManager db, HashMap<String, Long> timestamps,
             String headers, String filename, int maxSize, String tag) throws IOException {
diff --git a/services/core/java/com/android/server/OWNERS b/services/core/java/com/android/server/OWNERS
index e289a56..e923e30a 100644
--- a/services/core/java/com/android/server/OWNERS
+++ b/services/core/java/com/android/server/OWNERS
@@ -43,3 +43,6 @@
 per-file TelephonyRegistry.java = file:/telephony/OWNERS
 per-file UiModeManagerService.java = file:/packages/SystemUI/OWNERS
 per-file VcnManagementService.java = file:/services/core/java/com/android/server/vcn/OWNERS
+
+# SystemConfig
+per-file SystemConfig.java = file:/PACKAGE_MANAGER_OWNERS
diff --git a/services/core/java/com/android/server/SensitiveContentProtectionManagerService.java b/services/core/java/com/android/server/SensitiveContentProtectionManagerService.java
new file mode 100644
index 0000000..70bd4b3
--- /dev/null
+++ b/services/core/java/com/android/server/SensitiveContentProtectionManagerService.java
@@ -0,0 +1,188 @@
+/*
+ * Copyright (C) 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.server;
+
+import static com.android.internal.util.Preconditions.checkNotNull;
+
+import android.annotation.NonNull;
+import android.annotation.Nullable;
+import android.content.ComponentName;
+import android.content.Context;
+import android.media.projection.MediaProjectionInfo;
+import android.media.projection.MediaProjectionManager;
+import android.os.Handler;
+import android.os.Looper;
+import android.os.RemoteException;
+import android.os.UserHandle;
+import android.service.notification.NotificationListenerService;
+import android.service.notification.NotificationListenerService.RankingMap;
+import android.service.notification.StatusBarNotification;
+import android.util.ArraySet;
+import android.util.Log;
+
+import com.android.internal.annotations.VisibleForTesting;
+import com.android.server.wm.SensitiveContentPackages.PackageInfo;
+import com.android.server.wm.WindowManagerInternal;
+
+import java.util.Collections;
+import java.util.Set;
+
+/**
+ * Service that monitors for notifications with sensitive content and protects content from screen
+ * sharing
+ */
+public final class SensitiveContentProtectionManagerService extends SystemService {
+    private static final String TAG = "SensitiveContentProtect";
+    private static final boolean DEBUG = false;
+
+    @VisibleForTesting
+    NotificationListener mNotificationListener;
+    private @Nullable MediaProjectionManager mProjectionManager;
+    private @Nullable WindowManagerInternal mWindowManager;
+
+    private final MediaProjectionManager.Callback mProjectionCallback =
+            new MediaProjectionManager.Callback() {
+                @Override
+                public void onStart(MediaProjectionInfo info) {
+                    if (DEBUG) Log.d(TAG, "onStart projection: " + info);
+                    onProjectionStart();
+                }
+
+                @Override
+                public void onStop(MediaProjectionInfo info) {
+                    if (DEBUG) Log.d(TAG, "onStop projection: " + info);
+                    onProjectionEnd();
+                }
+            };
+
+    public SensitiveContentProtectionManagerService(@NonNull Context context) {
+        super(context);
+        mNotificationListener = new NotificationListener();
+    }
+
+    @Override
+    public void onStart() {}
+
+    @Override
+    public void onBootPhase(int phase) {
+        if (phase != SystemService.PHASE_BOOT_COMPLETED) {
+            return;
+        }
+
+        if (DEBUG) Log.d(TAG, "onBootPhase - PHASE_BOOT_COMPLETED");
+
+        init(getContext().getSystemService(MediaProjectionManager.class),
+                LocalServices.getService(WindowManagerInternal.class));
+    }
+
+    @VisibleForTesting
+    void init(MediaProjectionManager projectionManager,
+            WindowManagerInternal windowManager) {
+        if (DEBUG) Log.d(TAG, "init");
+
+        checkNotNull(projectionManager, "Failed to get valid MediaProjectionManager");
+        checkNotNull(windowManager, "Failed to get valid WindowManagerInternal");
+
+        mProjectionManager = projectionManager;
+        mWindowManager = windowManager;
+
+        // TODO(b/317250444): use MediaProjectionManagerService directly, reduces unnecessary
+        //  handler, delegate, and binder death recipient
+        mProjectionManager.addCallback(mProjectionCallback, new Handler(Looper.getMainLooper()));
+
+        try {
+            mNotificationListener.registerAsSystemService(getContext(),
+                    new ComponentName(getContext(), NotificationListener.class),
+                    UserHandle.USER_ALL);
+        } catch (RemoteException e) {
+            // Intra-process call, should never happen.
+        }
+    }
+
+    /** Cleanup any callbacks and listeners */
+    @VisibleForTesting
+    void onDestroy() {
+        if (mProjectionManager != null) {
+            mProjectionManager.removeCallback(mProjectionCallback);
+        }
+
+        try {
+            mNotificationListener.unregisterAsSystemService();
+        } catch (RemoteException e) {
+            // Intra-process call, should never happen.
+        }
+
+        if (mWindowManager != null) {
+            onProjectionEnd();
+        }
+    }
+
+    private void onProjectionStart() {
+        StatusBarNotification[] notifications;
+        try {
+            notifications = mNotificationListener.getActiveNotifications();
+        } catch (SecurityException e) {
+            Log.e(TAG, "SensitiveContentProtectionManagerService doesn't have access.", e);
+            notifications = new StatusBarNotification[0];
+        }
+
+        RankingMap rankingMap;
+        try {
+            rankingMap = mNotificationListener.getCurrentRanking();
+        } catch (SecurityException e) {
+            Log.e(TAG, "SensitiveContentProtectionManagerService doesn't have access.", e);
+            rankingMap = null;
+        }
+
+        // notify windowmanager of any currently posted sensitive content notifications
+        Set<PackageInfo> packageInfos = getSensitivePackagesFromNotifications(
+                notifications,
+                rankingMap);
+
+        mWindowManager.setShouldBlockScreenCaptureForApp(packageInfos);
+    }
+
+    private void onProjectionEnd() {
+        // notify windowmanager to clear any sensitive notifications observed during projection
+        // session
+        mWindowManager.setShouldBlockScreenCaptureForApp(Collections.emptySet());
+    }
+
+    private Set<PackageInfo> getSensitivePackagesFromNotifications(
+            StatusBarNotification[] notifications, RankingMap rankingMap) {
+        if (rankingMap == null) {
+            Log.w(TAG, "Ranking map not initialized.");
+            return Collections.emptySet();
+        }
+
+        Set<PackageInfo> sensitivePackages = new ArraySet<>();
+        for (StatusBarNotification sbn : notifications) {
+            NotificationListenerService.Ranking ranking =
+                    rankingMap.getRawRankingObject(sbn.getKey());
+            if (ranking != null && ranking.hasSensitiveContent()) {
+                PackageInfo info = new PackageInfo(sbn.getPackageName(), sbn.getUid());
+                sensitivePackages.add(info);
+            }
+        }
+        return sensitivePackages;
+    }
+
+    // TODO(b/317251408): add trigger that updates on onNotificationPosted,
+    //  onNotificationRankingUpdate and onListenerConnected
+    @VisibleForTesting
+    static class NotificationListener extends NotificationListenerService {}
+}
diff --git a/services/core/java/com/android/server/SystemConfig.java b/services/core/java/com/android/server/SystemConfig.java
index 40b29d7..3483c1a 100644
--- a/services/core/java/com/android/server/SystemConfig.java
+++ b/services/core/java/com/android/server/SystemConfig.java
@@ -315,6 +315,11 @@
     private final ArraySet<String> mBugreportWhitelistedPackages = new ArraySet<>();
     private final ArraySet<String> mAppDataIsolationWhitelistedApps = new ArraySet<>();
 
+    // These packages will be set as 'prevent disable', where they are no longer possible
+    // for the end user to disable via settings. This flag should only be used for packages
+    // which meet the 'force or keep enabled apps' policy.
+    private final ArrayList<String> mPreventUserDisablePackages = new ArrayList<>();
+
     // Map of packagesNames to userTypes. Stored temporarily until cleared by UserManagerService().
     private ArrayMap<String, Set<String>> mPackageToUserTypeWhitelist = new ArrayMap<>();
     private ArrayMap<String, Set<String>> mPackageToUserTypeBlacklist = new ArrayMap<>();
@@ -504,6 +509,10 @@
         return mAppDataIsolationWhitelistedApps;
     }
 
+    public @NonNull ArrayList<String> getPreventUserDisablePackages() {
+        return mPreventUserDisablePackages;
+    }
+
     /**
      * Gets map of packagesNames to userTypes, dictating on which user types each package should be
      * initially installed, and then removes this map from SystemConfig.
@@ -1309,6 +1318,16 @@
                         }
                         XmlUtils.skipCurrentTag(parser);
                     } break;
+                    case "prevent-disable": {
+                        String pkgname = parser.getAttributeValue(null, "package");
+                        if (pkgname == null) {
+                            Slog.w(TAG, "<" + name + "> without package in " + permFile
+                                    + " at " + parser.getPositionDescription());
+                        } else {
+                            mPreventUserDisablePackages.add(pkgname);
+                        }
+                        XmlUtils.skipCurrentTag(parser);
+                    } break;
                     case "install-in-user-type": {
                         // NB: We allow any directory permission to declare install-in-user-type.
                         readInstallInUserType(parser,
diff --git a/services/core/java/com/android/server/am/SettingsToPropertiesMapper.java b/services/core/java/com/android/server/am/SettingsToPropertiesMapper.java
index e7e721b..9db5d0a 100644
--- a/services/core/java/com/android/server/am/SettingsToPropertiesMapper.java
+++ b/services/core/java/com/android/server/am/SettingsToPropertiesMapper.java
@@ -176,6 +176,7 @@
         "system_performance",
         "system_sw_touch",
         "system_sw_usb",
+        "statsd",
         "test_suites",
         "text",
         "threadnetwork",
diff --git a/services/core/java/com/android/server/audio/FadeOutManager.java b/services/core/java/com/android/server/audio/FadeOutManager.java
index cbcd8f5..4d5bce5 100644
--- a/services/core/java/com/android/server/audio/FadeOutManager.java
+++ b/services/core/java/com/android/server/audio/FadeOutManager.java
@@ -29,6 +29,7 @@
 import android.util.SparseArray;
 
 import com.android.internal.annotations.GuardedBy;
+import com.android.server.utils.EventLogger;
 
 import java.io.PrintWriter;
 import java.util.ArrayList;
@@ -345,7 +346,8 @@
             }
             if (apc.getPlayerProxy() != null) {
                 applyVolumeShaperInternal(apc, piid, volShaper,
-                        skipRamp ? PLAY_SKIP_RAMP : PLAY_CREATE_IF_NEEDED);
+                        skipRamp ? PLAY_SKIP_RAMP : PLAY_CREATE_IF_NEEDED, skipRamp,
+                        PlaybackActivityMonitor.EVENT_TYPE_FADE_OUT);
                 mFadedPlayers.put(piid, volShaper);
             } else {
                 if (DEBUG) {
@@ -361,7 +363,8 @@
                 final AudioPlaybackConfiguration apc = players.get(piid);
                 if ((apc != null) && (apc.getPlayerProxy() != null)) {
                     applyVolumeShaperInternal(apc, piid, /* volShaperConfig= */ null,
-                            VolumeShaper.Operation.REVERSE);
+                            VolumeShaper.Operation.REVERSE, /* skipRamp= */ false,
+                            PlaybackActivityMonitor.EVENT_TYPE_FADE_IN);
                 } else {
                     // this piid was in the list of faded players, but wasn't found
                     if (DEBUG) {
@@ -373,6 +376,7 @@
             mFadedPlayers.clear();
         }
 
+        @GuardedBy("mLock")
         void fadeInPlayer(@NonNull AudioPlaybackConfiguration apc,
                 @Nullable VolumeShaper.Configuration config) {
             int piid = Integer.valueOf(apc.getPlayerInterfaceId());
@@ -385,10 +389,17 @@
                 return;
             }
 
+            VolumeShaper.Operation operation = VolumeShaper.Operation.REVERSE;
+            if (config != null) {
+                // replace and join the volumeshapers with (possibly) in progress fade out operation
+                // for a smoother fade in
+                operation = new VolumeShaper.Operation.Builder()
+                        .replace(mFadedPlayers.get(piid).getId(), /* join= */ true).build();
+            }
             mFadedPlayers.remove(piid);
             if (apc.getPlayerProxy() != null) {
-                applyVolumeShaperInternal(apc, piid, config,
-                        config != null ? PLAY_CREATE_IF_NEEDED : VolumeShaper.Operation.REVERSE);
+                applyVolumeShaperInternal(apc, piid, config, operation, /* skipRamp= */ false,
+                        PlaybackActivityMonitor.EVENT_TYPE_FADE_IN);
             } else {
                 if (DEBUG) {
                     Slog.v(TAG, "Error fading in player piid:" + piid
@@ -397,6 +408,7 @@
             }
         }
 
+        @GuardedBy("mLock")
         void clear() {
             if (mFadedPlayers.size() > 0) {
                 if (DEBUG) {
@@ -413,21 +425,40 @@
         }
 
         private void applyVolumeShaperInternal(AudioPlaybackConfiguration apc, int piid,
-                VolumeShaper.Configuration volShaperConfig, VolumeShaper.Operation operation) {
+                VolumeShaper.Configuration volShaperConfig, VolumeShaper.Operation operation,
+                boolean skipRamp, String eventType) {
             VolumeShaper.Configuration config = volShaperConfig;
             // when operation is reverse, use the fade out volume shaper config instead
             if (operation.equals(VolumeShaper.Operation.REVERSE)) {
                 config = mFadedPlayers.get(piid);
             }
             try {
-                PlaybackActivityMonitor.sEventLogger.enqueue(
-                        (new PlaybackActivityMonitor.FadeEvent(apc, config, operation))
-                                .printLog(TAG));
+                logFadeEvent(apc, piid, volShaperConfig, operation, skipRamp, eventType);
                 apc.getPlayerProxy().applyVolumeShaper(config, operation);
             } catch (Exception e) {
-                Slog.e(TAG, "Error fading player piid:" + piid + " uid:" + mUid
-                        + " operation:" + operation, e);
+                Slog.e(TAG, "Error " + eventType + " piid:" + piid + " uid:" + mUid, e);
             }
         }
+
+        private void logFadeEvent(AudioPlaybackConfiguration apc, int piid,
+                VolumeShaper.Configuration config, VolumeShaper.Operation operation,
+                boolean skipRamp, String eventType) {
+            if (eventType.equals(PlaybackActivityMonitor.EVENT_TYPE_FADE_OUT)) {
+                PlaybackActivityMonitor.sEventLogger.enqueue(
+                        (new PlaybackActivityMonitor.FadeOutEvent(apc, skipRamp, config, operation))
+                                .printLog(TAG));
+                return;
+            }
+
+            if (eventType.equals(PlaybackActivityMonitor.EVENT_TYPE_FADE_IN)) {
+                PlaybackActivityMonitor.sEventLogger.enqueue(
+                        (new PlaybackActivityMonitor.FadeInEvent(apc, skipRamp, config, operation))
+                                .printLog(TAG));
+                return;
+            }
+
+            PlaybackActivityMonitor.sEventLogger.enqueue(
+                    (new EventLogger.StringEvent(eventType + " piid:" + piid)).printLog(TAG));
+        }
     }
 }
diff --git a/services/core/java/com/android/server/audio/PlaybackActivityMonitor.java b/services/core/java/com/android/server/audio/PlaybackActivityMonitor.java
index e69fbbd..08da32e 100644
--- a/services/core/java/com/android/server/audio/PlaybackActivityMonitor.java
+++ b/services/core/java/com/android/server/audio/PlaybackActivityMonitor.java
@@ -84,6 +84,8 @@
     /*package*/ static final int VOLUME_SHAPER_SYSTEM_FADEOUT_ID = 2;
     /*package*/ static final int VOLUME_SHAPER_SYSTEM_MUTE_AWAIT_CONNECTION_ID = 3;
     /*package*/ static final int VOLUME_SHAPER_SYSTEM_STRONG_DUCK_ID = 4;
+    /*package*/ static final String EVENT_TYPE_FADE_OUT = "fading out";
+    /*package*/ static final String EVENT_TYPE_FADE_IN = "fading in";
 
     // ducking settings for a "normal duck" at -14dB
     private static final VolumeShaper.Configuration DUCK_VSHAPE =
@@ -1204,11 +1206,13 @@
                     return;
                 }
                 try {
-                    sEventLogger.enqueue((new DuckEvent(apc, skipRamp, mUseStrongDuck))
-                            .printLog(TAG));
-                    apc.getPlayerProxy().applyVolumeShaper(
-                            mUseStrongDuck ? STRONG_DUCK_VSHAPE : DUCK_VSHAPE,
-                            skipRamp ? PLAY_SKIP_RAMP : PLAY_CREATE_IF_NEEDED);
+                    VolumeShaper.Configuration config =
+                            mUseStrongDuck ? STRONG_DUCK_VSHAPE : DUCK_VSHAPE;
+                    VolumeShaper.Operation operation =
+                            skipRamp ? PLAY_SKIP_RAMP : PLAY_CREATE_IF_NEEDED;
+                    sEventLogger.enqueue((new DuckEvent(apc, skipRamp, mUseStrongDuck, config,
+                            operation)).printLog(TAG));
+                    apc.getPlayerProxy().applyVolumeShaper(config, operation);
                     mDuckedPlayers.add(piid);
                 } catch (Exception e) {
                     Log.e(TAG, "Error ducking player piid:" + piid + " uid:" + mUid, e);
@@ -1363,58 +1367,41 @@
         }
     }
 
-    static final class FadeEvent extends EventLogger.Event {
-        private final int mPlayerIId;
-        private final int mPlayerType;
-        private final int mClientUid;
-        private final int mClientPid;
-        private final AudioAttributes mPlayerAttr;
-        private final VolumeShaper.Configuration mVShaper;
-        private final VolumeShaper.Operation mVOperation;
-
-        FadeEvent(AudioPlaybackConfiguration apc, VolumeShaper.Configuration vShaper,
-                VolumeShaper.Operation vOperation) {
-            mPlayerIId = apc.getPlayerInterfaceId();
-            mClientUid = apc.getClientUid();
-            mClientPid = apc.getClientPid();
-            mPlayerAttr = apc.getAudioAttributes();
-            mPlayerType = apc.getPlayerType();
-            mVShaper = vShaper;
-            mVOperation = vOperation;
-        }
-
-        @Override
-        public String eventToString() {
-            return "Fade Event:" + " player piid:" + mPlayerIId
-                    + " uid/pid:" + mClientUid + "/" + mClientPid
-                    + " player type:"
-                    + AudioPlaybackConfiguration.toLogFriendlyPlayerType(mPlayerType)
-                    + " attr:" + mPlayerAttr
-                    + " volume shaper:" + mVShaper
-                    + " volume operation:" + mVOperation;
-        }
-    }
-
     private abstract static class VolumeShaperEvent extends EventLogger.Event {
         private final int mPlayerIId;
         private final boolean mSkipRamp;
         private final int mClientUid;
         private final int mClientPid;
+        private final int mPlayerType;
+        private final AudioAttributes mPlayerAttr;
+        private final VolumeShaper.Configuration mConfig;
+        private final VolumeShaper.Operation mOperation;
 
         abstract String getVSAction();
 
-        VolumeShaperEvent(@NonNull AudioPlaybackConfiguration apc, boolean skipRamp) {
+        VolumeShaperEvent(@NonNull AudioPlaybackConfiguration apc, boolean skipRamp,
+                VolumeShaper.Configuration config, VolumeShaper.Operation operation) {
             mPlayerIId = apc.getPlayerInterfaceId();
             mSkipRamp = skipRamp;
             mClientUid = apc.getClientUid();
             mClientPid = apc.getClientPid();
+            mPlayerAttr = apc.getAudioAttributes();
+            mPlayerType = apc.getPlayerType();
+            mConfig = config;
+            mOperation = operation;
         }
 
         @Override
         public String eventToString() {
-            return new StringBuilder(getVSAction()).append(" player piid:").append(mPlayerIId)
-                    .append(" uid/pid:").append(mClientUid).append("/").append(mClientPid)
-                    .append(" skip ramp:").append(mSkipRamp).toString();
+            return getVSAction()
+                    + " player piid:" + mPlayerIId
+                    + " uid/pid:" + mClientUid + "/" + mClientPid
+                    + " skip ramp:" + mSkipRamp
+                    + " player type:"
+                    + AudioPlaybackConfiguration.toLogFriendlyPlayerType(mPlayerType)
+                    + " attr:" + mPlayerAttr
+                    + " config:" + mConfig
+                    + " operation:" + mOperation;
         }
     }
 
@@ -1426,9 +1413,10 @@
             return mUseStrongDuck ? "ducking (strong)" : "ducking";
         }
 
-        DuckEvent(@NonNull AudioPlaybackConfiguration apc, boolean skipRamp, boolean useStrongDuck)
+        DuckEvent(@NonNull AudioPlaybackConfiguration apc, boolean skipRamp, boolean useStrongDuck,
+                VolumeShaper.Configuration config, VolumeShaper.Operation operation)
         {
-            super(apc, skipRamp);
+            super(apc, skipRamp, config, operation);
             mUseStrongDuck = useStrongDuck;
         }
     }
@@ -1436,11 +1424,24 @@
     static final class FadeOutEvent extends VolumeShaperEvent {
         @Override
         String getVSAction() {
-            return "fading out";
+            return EVENT_TYPE_FADE_OUT;
         }
 
-        FadeOutEvent(@NonNull AudioPlaybackConfiguration apc, boolean skipRamp) {
-            super(apc, skipRamp);
+        FadeOutEvent(@NonNull AudioPlaybackConfiguration apc, boolean skipRamp,
+                VolumeShaper.Configuration config, VolumeShaper.Operation operation) {
+            super(apc, skipRamp, config, operation);
+        }
+    }
+
+    static final class FadeInEvent extends VolumeShaperEvent {
+        @Override
+        String getVSAction() {
+            return EVENT_TYPE_FADE_IN;
+        }
+
+        FadeInEvent(@NonNull AudioPlaybackConfiguration apc, boolean skipRamp,
+                VolumeShaper.Configuration config, VolumeShaper.Operation operation) {
+            super(apc, skipRamp, config, operation);
         }
     }
 
diff --git a/services/core/java/com/android/server/audio/SoundDoseHelper.java b/services/core/java/com/android/server/audio/SoundDoseHelper.java
index c72632f..c2bc1e4 100644
--- a/services/core/java/com/android/server/audio/SoundDoseHelper.java
+++ b/services/core/java/com/android/server/audio/SoundDoseHelper.java
@@ -893,7 +893,7 @@
             if (AudioService.mStreamVolumeAlias[streamType] == AudioSystem.STREAM_MUSIC
                     && safeDevicesContains(device)) {
                 soundDose.updateAttenuation(
-                        AudioSystem.getStreamVolumeDB(AudioSystem.STREAM_MUSIC,
+                        -AudioSystem.getStreamVolumeDB(AudioSystem.STREAM_MUSIC,
                                 (newIndex + 5) / 10,
                                 device), device);
             }
diff --git a/services/core/java/com/android/server/criticalevents/CriticalEventLog.java b/services/core/java/com/android/server/criticalevents/CriticalEventLog.java
index 0814375..816c349 100644
--- a/services/core/java/com/android/server/criticalevents/CriticalEventLog.java
+++ b/services/core/java/com/android/server/criticalevents/CriticalEventLog.java
@@ -29,6 +29,7 @@
 import com.android.server.criticalevents.nano.CriticalEventProto;
 import com.android.server.criticalevents.nano.CriticalEventProto.AppNotResponding;
 import com.android.server.criticalevents.nano.CriticalEventProto.HalfWatchdog;
+import com.android.server.criticalevents.nano.CriticalEventProto.InstallPackages;
 import com.android.server.criticalevents.nano.CriticalEventProto.JavaCrash;
 import com.android.server.criticalevents.nano.CriticalEventProto.NativeCrash;
 import com.android.server.criticalevents.nano.CriticalEventProto.SystemServerStarted;
@@ -142,6 +143,13 @@
         return System.currentTimeMillis();
     }
 
+    /** Logs when one or more packages are installed. */
+    public void logInstallPackagesStarted() {
+        CriticalEventProto event = new CriticalEventProto();
+        event.setInstallPackages(new InstallPackages());
+        log(event);
+    }
+
     /** Logs when system server started. */
     public void logSystemServerStarted() {
         CriticalEventProto event = new CriticalEventProto();
diff --git a/services/core/java/com/android/server/display/DeviceStateToLayoutMap.java b/services/core/java/com/android/server/display/DeviceStateToLayoutMap.java
index 7cea9c4..e54f30f 100644
--- a/services/core/java/com/android/server/display/DeviceStateToLayoutMap.java
+++ b/services/core/java/com/android/server/display/DeviceStateToLayoutMap.java
@@ -27,6 +27,7 @@
 import com.android.internal.annotations.VisibleForTesting;
 import com.android.server.display.config.layout.Layouts;
 import com.android.server.display.config.layout.XmlParser;
+import com.android.server.display.feature.DisplayManagerFlags;
 import com.android.server.display.layout.DisplayIdProducer;
 import com.android.server.display.layout.Layout;
 
@@ -68,12 +69,15 @@
 
     private final SparseArray<Layout> mLayoutMap = new SparseArray<>();
     private final DisplayIdProducer mIdProducer;
+    private final boolean mIsPortInDisplayLayoutEnabled;
 
-    DeviceStateToLayoutMap(DisplayIdProducer idProducer) {
-        this(idProducer, getConfigFile());
+    DeviceStateToLayoutMap(DisplayIdProducer idProducer, DisplayManagerFlags flags) {
+        this(idProducer, flags, getConfigFile());
     }
 
-    DeviceStateToLayoutMap(DisplayIdProducer idProducer, File configFile) {
+    DeviceStateToLayoutMap(DisplayIdProducer idProducer, DisplayManagerFlags flags,
+            File configFile) {
+        mIsPortInDisplayLayoutEnabled = flags.isPortInDisplayLayoutEnabled();
         mIdProducer = idProducer;
         loadLayoutsFromConfig(configFile);
         createLayout(STATE_DEFAULT);
@@ -93,6 +97,7 @@
         ipw.println("DeviceStateToLayoutMap:");
         ipw.increaseIndent();
 
+        ipw.println("mIsPortInDisplayLayoutEnabled=" + mIsPortInDisplayLayoutEnabled);
         ipw.println("Registered Layouts:");
         for (int i = 0; i < mLayoutMap.size(); i++) {
             ipw.println("state(" + mLayoutMap.keyAt(i) + "): " + mLayoutMap.valueAt(i));
@@ -132,13 +137,15 @@
                 final Layout layout = createLayout(state);
                 for (com.android.server.display.config.layout.Display d: l.getDisplay()) {
                     assert layout != null;
+                    final DisplayAddress address = getDisplayAddressForLayoutDisplay(d);
+
                     int position = getPosition(d.getPosition());
                     BigInteger leadDisplayPhysicalId = d.getLeadDisplayAddress();
                     DisplayAddress leadDisplayAddress = leadDisplayPhysicalId == null ? null
                             : DisplayAddress.fromPhysicalDisplayId(
                                     leadDisplayPhysicalId.longValue());
                     layout.createDisplayLocked(
-                            DisplayAddress.fromPhysicalDisplayId(d.getAddress().longValue()),
+                            address,
                             d.isDefaultDisplay(),
                             d.isEnabled(),
                             d.getDisplayGroup(),
@@ -158,6 +165,20 @@
         }
     }
 
+    private DisplayAddress getDisplayAddressForLayoutDisplay(
+            @NonNull com.android.server.display.config.layout.Display display) {
+        BigInteger xmlAddress = display.getAddress_optional();
+        if (xmlAddress != null) {
+            return DisplayAddress.fromPhysicalDisplayId(xmlAddress.longValue());
+        }
+        if (!mIsPortInDisplayLayoutEnabled || display.getPort_optional() == null) {
+            throw new IllegalArgumentException(
+                  "Must specify a display identifier in display layout configuration: " + display);
+        }
+        return DisplayAddress.fromPortAndModel((int) display.getPort_optional().longValue(),
+                /* model= */ null);
+    }
+
     private int getPosition(@NonNull String position) {
         int positionInt = POSITION_UNKNOWN;
         if (FRONT_STRING.equals(position)) {
diff --git a/services/core/java/com/android/server/display/DisplayBrightnessState.java b/services/core/java/com/android/server/display/DisplayBrightnessState.java
index 9fcaa1e..d50a43a 100644
--- a/services/core/java/com/android/server/display/DisplayBrightnessState.java
+++ b/services/core/java/com/android/server/display/DisplayBrightnessState.java
@@ -33,6 +33,7 @@
     private final float mSdrBrightness;
 
     private final float mMaxBrightness;
+    private final float mMinBrightness;
     private final BrightnessReason mBrightnessReason;
     private final String mDisplayBrightnessStrategyName;
     private final boolean mShouldUseAutoBrightness;
@@ -50,6 +51,7 @@
         mShouldUseAutoBrightness = builder.getShouldUseAutoBrightness();
         mIsSlowChange = builder.isSlowChange();
         mMaxBrightness = builder.getMaxBrightness();
+        mMinBrightness = builder.getMinBrightness();
         mCustomAnimationRate = builder.getCustomAnimationRate();
         mShouldUpdateScreenBrightnessSetting = builder.shouldUpdateScreenBrightnessSetting();
     }
@@ -105,6 +107,13 @@
     }
 
     /**
+     * @return minimum allowed brightness
+     */
+    public float getMinBrightness() {
+        return mMinBrightness;
+    }
+
+    /**
      * @return custom animation rate
      */
     public float getCustomAnimationRate() {
@@ -131,6 +140,7 @@
         stringBuilder.append(getShouldUseAutoBrightness());
         stringBuilder.append("\n    isSlowChange:").append(mIsSlowChange);
         stringBuilder.append("\n    maxBrightness:").append(mMaxBrightness);
+        stringBuilder.append("\n    minBrightness:").append(mMinBrightness);
         stringBuilder.append("\n    customAnimationRate:").append(mCustomAnimationRate);
         stringBuilder.append("\n    shouldUpdateScreenBrightnessSetting:")
                 .append(mShouldUpdateScreenBrightnessSetting);
@@ -160,6 +170,7 @@
                 && mShouldUseAutoBrightness == otherState.getShouldUseAutoBrightness()
                 && mIsSlowChange == otherState.isSlowChange()
                 && mMaxBrightness == otherState.getMaxBrightness()
+                && mMinBrightness == otherState.getMinBrightness()
                 && mCustomAnimationRate == otherState.getCustomAnimationRate()
                 && mShouldUpdateScreenBrightnessSetting
                     == otherState.shouldUpdateScreenBrightnessSetting();
@@ -168,7 +179,8 @@
     @Override
     public int hashCode() {
         return Objects.hash(mBrightness, mSdrBrightness, mBrightnessReason,
-                mShouldUseAutoBrightness, mIsSlowChange, mMaxBrightness, mCustomAnimationRate,
+                mShouldUseAutoBrightness, mIsSlowChange, mMaxBrightness, mMinBrightness,
+                mCustomAnimationRate,
                 mShouldUpdateScreenBrightnessSetting);
     }
 
@@ -190,6 +202,7 @@
         private boolean mShouldUseAutoBrightness;
         private boolean mIsSlowChange;
         private float mMaxBrightness;
+        private float mMinBrightness;
         private float mCustomAnimationRate = CUSTOM_ANIMATION_RATE_NOT_SET;
         private boolean mShouldUpdateScreenBrightnessSetting;
 
@@ -208,6 +221,7 @@
             builder.setShouldUseAutoBrightness(state.getShouldUseAutoBrightness());
             builder.setIsSlowChange(state.isSlowChange());
             builder.setMaxBrightness(state.getMaxBrightness());
+            builder.setMinBrightness(state.getMinBrightness());
             builder.setCustomAnimationRate(state.getCustomAnimationRate());
             builder.setShouldUpdateScreenBrightnessSetting(
                     state.shouldUpdateScreenBrightnessSetting());
@@ -334,6 +348,20 @@
             return mMaxBrightness;
         }
 
+        /**
+         * See {@link DisplayBrightnessState#getMinBrightness()}.
+         */
+        public Builder setMinBrightness(float minBrightness) {
+            this.mMinBrightness = minBrightness;
+            return this;
+        }
+
+        /**
+         * See {@link DisplayBrightnessState#getMinBrightness()}.
+         */
+        public float getMinBrightness() {
+            return mMinBrightness;
+        }
 
         /**
          * See {@link DisplayBrightnessState#getCustomAnimationRate()}.
diff --git a/services/core/java/com/android/server/display/DisplayDeviceConfig.java b/services/core/java/com/android/server/display/DisplayDeviceConfig.java
index bd22e1d..4c4cf608 100644
--- a/services/core/java/com/android/server/display/DisplayDeviceConfig.java
+++ b/services/core/java/com/android/server/display/DisplayDeviceConfig.java
@@ -16,6 +16,7 @@
 
 package com.android.server.display;
 
+import static com.android.server.display.BrightnessMappingStrategy.INVALID_NITS;
 import static com.android.server.display.utils.DeviceConfigParsingUtils.ambientBrightnessThresholdsIntToFloat;
 import static com.android.server.display.utils.DeviceConfigParsingUtils.displayBrightnessThresholdsIntToFloat;
 
@@ -567,7 +568,8 @@
 
     public static final int DEFAULT_LOW_REFRESH_RATE = 60;
 
-    private static final float BRIGHTNESS_DEFAULT = 0.5f;
+    @VisibleForTesting
+    static final float BRIGHTNESS_DEFAULT = 0.5f;
     private static final String ETC_DIR = "etc";
     private static final String DISPLAY_CONFIG_DIR = "displayconfig";
     private static final String CONFIG_FILE_FORMAT = "display_%s.xml";
@@ -597,8 +599,6 @@
     // so -2 is used instead
     private static final float INVALID_BRIGHTNESS_IN_CONFIG = -2f;
 
-    static final float NITS_INVALID = -1;
-
     // Length of the ambient light horizon used to calculate the long term estimate of ambient
     // light.
     private static final int AMBIENT_LIGHT_LONG_HORIZON_MILLIS = 10000;
@@ -1031,11 +1031,12 @@
     /**
      * Calculates the nits value for the specified backlight value if a mapping exists.
      *
-     * @return The mapped nits or {@link #NITS_INVALID} if no mapping exits.
+     * @return The mapped nits or {@link BrightnessMappingStrategy.INVALID_NITS} if no mapping
+     * exits.
      */
     public float getNitsFromBacklight(float backlight) {
         if (mBacklightToNitsSpline == null) {
-            return NITS_INVALID;
+            return INVALID_NITS;
         }
         backlight = Math.max(backlight, mBacklightMinimum);
         return mBacklightToNitsSpline.interpolate(backlight);
@@ -1061,7 +1062,7 @@
 
         float backlight = getBacklightFromBrightness(brightness);
         float nits = getNitsFromBacklight(backlight);
-        if (nits == NITS_INVALID) {
+        if (nits == INVALID_NITS) {
             return PowerManager.BRIGHTNESS_INVALID;
         }
 
diff --git a/services/core/java/com/android/server/display/DisplayDeviceRepository.java b/services/core/java/com/android/server/display/DisplayDeviceRepository.java
index 67e612d..6164154 100644
--- a/services/core/java/com/android/server/display/DisplayDeviceRepository.java
+++ b/services/core/java/com/android/server/display/DisplayDeviceRepository.java
@@ -129,7 +129,9 @@
     public DisplayDevice getByAddressLocked(@NonNull DisplayAddress address) {
         for (int i = mDisplayDevices.size() - 1; i >= 0; i--) {
             final DisplayDevice device = mDisplayDevices.get(i);
-            if (address.equals(device.getDisplayDeviceInfoLocked().address)) {
+            final DisplayDeviceInfo info = device.getDisplayDeviceInfoLocked();
+            if (address.equals(info.address)
+                    || DisplayAddress.Physical.isPortMatch(address, info.address)) {
                 return device;
             }
         }
diff --git a/services/core/java/com/android/server/display/DisplayManagerService.java b/services/core/java/com/android/server/display/DisplayManagerService.java
index bc3f9dd..fbac924 100644
--- a/services/core/java/com/android/server/display/DisplayManagerService.java
+++ b/services/core/java/com/android/server/display/DisplayManagerService.java
@@ -1615,6 +1615,10 @@
                 if ((flags & VIRTUAL_DISPLAY_FLAG_TRUSTED) == 0) {
                     Slog.w(TAG, "Display created with home support but lacks "
                             + "VIRTUAL_DISPLAY_FLAG_TRUSTED, ignoring the home support request.");
+                } else if ((flags & VIRTUAL_DISPLAY_FLAG_AUTO_MIRROR) != 0) {
+                    Slog.w(TAG, "Display created with home support but has "
+                            + "VIRTUAL_DISPLAY_FLAG_AUTO_MIRROR, ignoring the home support "
+                            + "request.");
                 } else {
                     mWindowManagerInternal.setHomeSupportedOnDisplay(displayUniqueId,
                             Display.TYPE_VIRTUAL, true);
diff --git a/services/core/java/com/android/server/display/DisplayPowerController2.java b/services/core/java/com/android/server/display/DisplayPowerController2.java
index 7df6114..2d860c0 100644
--- a/services/core/java/com/android/server/display/DisplayPowerController2.java
+++ b/services/core/java/com/android/server/display/DisplayPowerController2.java
@@ -573,10 +573,10 @@
         mBrightnessClamperController = mInjector.getBrightnessClamperController(
                 mHandler, modeChangeCallback::run,
                 new BrightnessClamperController.DisplayDeviceData(
-                mUniqueDisplayId,
-                mThermalBrightnessThrottlingDataId,
-                logicalDisplay.getPowerThrottlingDataIdLocked(),
-                mDisplayDeviceConfig), mContext, flags);
+                        mUniqueDisplayId,
+                        mThermalBrightnessThrottlingDataId,
+                        logicalDisplay.getPowerThrottlingDataIdLocked(),
+                        mDisplayDeviceConfig), mContext, flags);
         // Seed the cached brightness
         saveBrightnessInfo(getScreenBrightnessSetting());
         mAutomaticBrightnessStrategy =
@@ -1508,7 +1508,6 @@
         // Note throttling effectively changes the allowed brightness range, so, similarly to HBM,
         // we broadcast this change through setting.
         final float unthrottledBrightnessState = brightnessState;
-
         DisplayBrightnessState clampedState = mBrightnessClamperController.clamp(mPowerRequest,
                 brightnessState, slowChange);
 
@@ -1522,11 +1521,12 @@
         if (updateScreenBrightnessSetting) {
             // Tell the rest of the system about the new brightness in case we had to change it
             // for things like auto-brightness or high-brightness-mode. Note that we do this
-            // only considering maxBrightness (ignroing brightness modifiers like low power or dim)
+            // only considering maxBrightness (ignoring brightness modifiers like low power or dim)
             // so that the slider accurately represents the full possible range,
             // even if they range changes what it means in absolute terms.
             mDisplayBrightnessController.updateScreenBrightnessSetting(
-                    Math.min(unthrottledBrightnessState, clampedState.getMaxBrightness()));
+                    MathUtils.constrain(unthrottledBrightnessState,
+                            clampedState.getMinBrightness(), clampedState.getMaxBrightness()));
         }
 
         // The current brightness to use has been calculated at this point, and HbmController should
@@ -1935,8 +1935,9 @@
             @Nullable DisplayBrightnessState state) {
         synchronized (mCachedBrightnessInfo) {
             float stateMax = state != null ? state.getMaxBrightness() : PowerManager.BRIGHTNESS_MAX;
-            final float minBrightness = Math.min(
-                    mBrightnessRangeController.getCurrentBrightnessMin(), stateMax);
+            float stateMin = state != null ? state.getMinBrightness() : PowerManager.BRIGHTNESS_MAX;
+            final float minBrightness = Math.max(stateMin, Math.min(
+                    mBrightnessRangeController.getCurrentBrightnessMin(), stateMax));
             final float maxBrightness = Math.min(
                     mBrightnessRangeController.getCurrentBrightnessMax(), stateMax);
             boolean changed = false;
@@ -1962,7 +1963,6 @@
             changed |=
                     mCachedBrightnessInfo.checkAndSetInt(mCachedBrightnessInfo.brightnessMaxReason,
                             mBrightnessClamperController.getBrightnessMaxReason());
-
             return changed;
         }
     }
@@ -2880,6 +2880,7 @@
                     event.getHbmMode() == BrightnessInfo.HIGH_BRIGHTNESS_MODE_HDR,
                     (modifier & BrightnessReason.MODIFIER_LOW_POWER) > 0,
                     mBrightnessClamperController.getBrightnessMaxReason(),
+                    // TODO: (flc) add brightnessMinReason here too.
                     (modifier & BrightnessReason.MODIFIER_DIMMED) > 0,
                     event.isRbcEnabled(),
                     (flags & BrightnessEvent.FLAG_INVALID_LUX) > 0,
diff --git a/services/core/java/com/android/server/display/DisplayPowerState.java b/services/core/java/com/android/server/display/DisplayPowerState.java
index bcf27b4..90bad12 100644
--- a/services/core/java/com/android/server/display/DisplayPowerState.java
+++ b/services/core/java/com/android/server/display/DisplayPowerState.java
@@ -333,6 +333,8 @@
     public void stop() {
         mStopped = true;
         mPhotonicModulator.interrupt();
+        mColorFadePrepared = false;
+        mColorFadeReady = true;
         if (mColorFade != null) {
             mAsyncDestroyExecutor.execute(mColorFade::destroy);
         }
@@ -419,7 +421,8 @@
         }
     };
 
-    private final Runnable mColorFadeDrawRunnable = new Runnable() {
+    @VisibleForTesting
+    final Runnable mColorFadeDrawRunnable = new Runnable() {
         @Override
         public void run() {
             mColorFadeDrawPending = false;
diff --git a/services/core/java/com/android/server/display/LocalDisplayAdapter.java b/services/core/java/com/android/server/display/LocalDisplayAdapter.java
index 25576ce..3a63330 100644
--- a/services/core/java/com/android/server/display/LocalDisplayAdapter.java
+++ b/services/core/java/com/android/server/display/LocalDisplayAdapter.java
@@ -19,6 +19,8 @@
 import static android.os.Trace.TRACE_TAG_WINDOW_MANAGER;
 import static android.view.Display.Mode.INVALID_MODE_ID;
 
+import static com.android.server.display.BrightnessMappingStrategy.INVALID_NITS;
+
 import android.annotation.Nullable;
 import android.app.ActivityThread;
 import android.content.Context;
@@ -956,8 +958,7 @@
 
                     void handleHdrSdrNitsChanged(float displayNits, float sdrNits) {
                         final float newHdrSdrRatio;
-                        if (displayNits != DisplayDeviceConfig.NITS_INVALID
-                                && sdrNits != DisplayDeviceConfig.NITS_INVALID) {
+                        if (displayNits != INVALID_NITS && sdrNits != INVALID_NITS) {
                             // Ensure the ratio stays >= 1.0f as values below that are nonsensical
                             newHdrSdrRatio = Math.max(1.f, displayNits / sdrNits);
                         } else {
diff --git a/services/core/java/com/android/server/display/LogicalDisplayMapper.java b/services/core/java/com/android/server/display/LogicalDisplayMapper.java
index 115111a..2e8de31 100644
--- a/services/core/java/com/android/server/display/LogicalDisplayMapper.java
+++ b/services/core/java/com/android/server/display/LogicalDisplayMapper.java
@@ -205,7 +205,7 @@
             @NonNull Handler handler, DisplayManagerFlags flags) {
         this(context, foldSettingProvider, repo, listener, syncRoot, handler,
                 new DeviceStateToLayoutMap((isDefault) -> isDefault ? DEFAULT_DISPLAY
-                        : sNextNonDefaultDisplayId++), flags);
+                        : sNextNonDefaultDisplayId++, flags), flags);
     }
 
     LogicalDisplayMapper(@NonNull Context context, FoldSettingProvider foldSettingProvider,
@@ -1094,8 +1094,8 @@
             final DisplayAddress address = displayLayout.getAddress();
             final DisplayDevice device = mDisplayDeviceRepo.getByAddressLocked(address);
             if (device == null) {
-                Slog.w(TAG, "The display device (" + address + "), is not available"
-                        + " for the display state " + mDeviceState);
+                Slog.w(TAG, "applyLayoutLocked: The display device (" + address + "), is not "
+                        + "available for the display state " + mDeviceState);
                 continue;
             }
 
diff --git a/services/core/java/com/android/server/display/brightness/BrightnessReason.java b/services/core/java/com/android/server/display/brightness/BrightnessReason.java
index 8fe5f21..bc443a8 100644
--- a/services/core/java/com/android/server/display/brightness/BrightnessReason.java
+++ b/services/core/java/com/android/server/display/brightness/BrightnessReason.java
@@ -46,8 +46,10 @@
     public static final int MODIFIER_LOW_POWER = 0x2;
     public static final int MODIFIER_HDR = 0x4;
     public static final int MODIFIER_THROTTLED = 0x8;
+    public static final int MODIFIER_MIN_LUX = 0x10;
+    public static final int MODIFIER_MIN_USER_SET_LOWER_BOUND = 0x20;
     public static final int MODIFIER_MASK = MODIFIER_DIMMED | MODIFIER_LOW_POWER | MODIFIER_HDR
-            | MODIFIER_THROTTLED;
+            | MODIFIER_THROTTLED | MODIFIER_MIN_LUX | MODIFIER_MIN_USER_SET_LOWER_BOUND;
 
     // ADJUSTMENT_*
     // These things can happen at any point, even if the main brightness reason doesn't
@@ -131,6 +133,12 @@
         if ((mModifier & MODIFIER_THROTTLED) != 0) {
             sb.append(" throttled");
         }
+        if ((mModifier & MODIFIER_MIN_LUX) != 0) {
+            sb.append(" lux_lower_bound");
+        }
+        if ((mModifier & MODIFIER_MIN_USER_SET_LOWER_BOUND) != 0) {
+            sb.append(" user_min_pref");
+        }
         int strlen = sb.length();
         if (sb.charAt(strlen - 1) == '[') {
             sb.setLength(strlen - 2);
diff --git a/services/core/java/com/android/server/display/brightness/clamper/BrightnessClamper.java b/services/core/java/com/android/server/display/brightness/clamper/BrightnessClamper.java
index 42ebc40..fab769e 100644
--- a/services/core/java/com/android/server/display/brightness/clamper/BrightnessClamper.java
+++ b/services/core/java/com/android/server/display/brightness/clamper/BrightnessClamper.java
@@ -30,6 +30,7 @@
 abstract class BrightnessClamper<T> {
 
     protected float mBrightnessCap = PowerManager.BRIGHTNESS_MAX;
+
     protected boolean mIsActive = false;
 
     @NonNull
@@ -75,6 +76,5 @@
         THERMAL,
         POWER,
         BEDTIME_MODE,
-        LUX,
     }
 }
diff --git a/services/core/java/com/android/server/display/brightness/clamper/BrightnessClamperController.java b/services/core/java/com/android/server/display/brightness/clamper/BrightnessClamperController.java
index 01694dd..2c02fc6 100644
--- a/services/core/java/com/android/server/display/brightness/clamper/BrightnessClamperController.java
+++ b/services/core/java/com/android/server/display/brightness/clamper/BrightnessClamperController.java
@@ -58,13 +58,14 @@
     private final Executor mExecutor;
     private final List<BrightnessClamper<? super DisplayDeviceData>> mClampers;
 
-    private final List<BrightnessModifier> mModifiers;
+    private final List<BrightnessStateModifier> mModifiers;
     private final DeviceConfig.OnPropertiesChangedListener mOnPropertiesChangedListener;
     private float mBrightnessCap = PowerManager.BRIGHTNESS_MAX;
 
     private float mCustomAnimationRate = DisplayBrightnessState.CUSTOM_ANIMATION_RATE_NOT_SET;
     @Nullable
     private Type mClamperType = null;
+
     private boolean mClamperApplied = false;
 
     public BrightnessClamperController(Handler handler,
@@ -92,7 +93,7 @@
 
         mClampers = injector.getClampers(handler, clamperChangeListenerInternal, data, flags,
                 context);
-        mModifiers = injector.getModifiers(context);
+        mModifiers = injector.getModifiers(flags, context, handler, clamperChangeListener);
         mOnPropertiesChangedListener =
                 properties -> mClampers.forEach(BrightnessClamper::onDeviceConfigChanged);
         start();
@@ -165,9 +166,10 @@
      * Used to dump ClampersController state.
      */
     public void dump(PrintWriter writer) {
-        writer.println("BrightnessClampersController:");
+        writer.println("BrightnessClamperController:");
         writer.println("  mBrightnessCap: " + mBrightnessCap);
         writer.println("  mClamperType: " + mClamperType);
+        writer.println("  mClamperApplied: " + mClamperApplied);
         IndentingPrintWriter ipw = new IndentingPrintWriter(writer, "    ");
         mClampers.forEach(clamper -> clamper.dump(ipw));
         mModifiers.forEach(modifier -> modifier.dump(ipw));
@@ -181,6 +183,7 @@
         mDeviceConfigParameterProvider.removeOnPropertiesChangedListener(
                 mOnPropertiesChangedListener);
         mClampers.forEach(BrightnessClamper::stop);
+        mModifiers.forEach(BrightnessStateModifier::stop);
     }
 
 
@@ -201,14 +204,14 @@
             customAnimationRate = minClamper.getCustomAnimationRate();
         }
 
-        if (mBrightnessCap != brightnessCap || mClamperType != clamperType
+        if (mBrightnessCap != brightnessCap
+                || mClamperType != clamperType
                 || mCustomAnimationRate != customAnimationRate) {
             mBrightnessCap = brightnessCap;
             mClamperType = clamperType;
             mCustomAnimationRate = customAnimationRate;
             mClamperChangeListenerExternal.onChanged();
         }
-
     }
 
     private void start() {
@@ -248,16 +251,17 @@
                 clampers.add(new BrightnessWearBedtimeModeClamper(handler, context,
                         clamperChangeListener, data));
             }
-            if (flags.isEvenDimmerEnabled()) {
-                clampers.add(new BrightnessMinClamper(handler, clamperChangeListener, context));
-            }
             return clampers;
         }
 
-        List<BrightnessModifier> getModifiers(Context context) {
-            List<BrightnessModifier> modifiers = new ArrayList<>();
+        List<BrightnessStateModifier> getModifiers(DisplayManagerFlags flags, Context context,
+                Handler handler, ClamperChangeListener listener) {
+            List<BrightnessStateModifier> modifiers = new ArrayList<>();
             modifiers.add(new DisplayDimModifier(context));
             modifiers.add(new BrightnessLowPowerModeModifier());
+            if (flags.isEvenDimmerEnabled()) {
+                modifiers.add(new BrightnessLowLuxModifier(handler, listener, context));
+            }
             return modifiers;
         }
     }
diff --git a/services/core/java/com/android/server/display/brightness/clamper/BrightnessLowLuxModifier.java b/services/core/java/com/android/server/display/brightness/clamper/BrightnessLowLuxModifier.java
new file mode 100644
index 0000000..7f1f7a9
--- /dev/null
+++ b/services/core/java/com/android/server/display/brightness/clamper/BrightnessLowLuxModifier.java
@@ -0,0 +1,176 @@
+/*
+ * Copyright (C) 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.server.display.brightness.clamper;
+
+import android.content.ContentResolver;
+import android.content.Context;
+import android.database.ContentObserver;
+import android.hardware.display.DisplayManagerInternal;
+import android.net.Uri;
+import android.os.Handler;
+import android.os.PowerManager;
+import android.os.UserHandle;
+import android.provider.Settings;
+import android.util.Slog;
+
+import com.android.internal.annotations.VisibleForTesting;
+import com.android.internal.display.BrightnessSynchronizer;
+import com.android.server.display.DisplayBrightnessState;
+import com.android.server.display.brightness.BrightnessReason;
+import com.android.server.display.utils.DebugUtils;
+
+import java.io.PrintWriter;
+
+/**
+ * Class used to prevent the screen brightness dipping below a certain value, based on current
+ * lux conditions and user preferred minimum.
+ */
+public class BrightnessLowLuxModifier implements
+        BrightnessStateModifier {
+
+    // To enable these logs, run:
+    // 'adb shell setprop persist.log.tag.BrightnessLowLuxModifier DEBUG && adb reboot'
+    private static final String TAG = "BrightnessLowLuxModifier";
+    private static final boolean DEBUG = DebugUtils.isDebuggable(TAG);
+    private final SettingsObserver mSettingsObserver;
+    private final ContentResolver mContentResolver;
+    private final Handler mHandler;
+    private final BrightnessClamperController.ClamperChangeListener mChangeListener;
+    protected float mSettingNitsLowerBound = PowerManager.BRIGHTNESS_MIN;
+    private int mReason;
+    private float mBrightnessLowerBound;
+    private boolean mIsActive;
+
+    @VisibleForTesting
+    BrightnessLowLuxModifier(Handler handler,
+            BrightnessClamperController.ClamperChangeListener listener, Context context) {
+        super();
+
+        mChangeListener = listener;
+        mHandler = handler;
+        mContentResolver = context.getContentResolver();
+        mSettingsObserver = new SettingsObserver(mHandler);
+        mHandler.post(() -> {
+            start();
+        });
+    }
+
+    /**
+     * Calculates new lower bound for brightness range, based on whether the setting is active,
+     * the user defined min brightness setting, and current lux environment.
+     */
+    @VisibleForTesting
+    public void recalculateLowerBound() {
+        int userId = UserHandle.USER_CURRENT;
+        float settingNitsLowerBound = Settings.Secure.getFloatForUser(
+                mContentResolver, Settings.Secure.EVEN_DIMMER_MIN_NITS,
+                /* def= */ PowerManager.BRIGHTNESS_MIN, userId);
+
+        boolean isActive = Settings.Secure.getIntForUser(mContentResolver,
+                Settings.Secure.EVEN_DIMMER_ACTIVATED,
+                /* def= */ 0, userId) == 1;
+
+        // TODO: luxBasedNitsLowerBound = mMinNitsToLuxSpline(currentLux);
+        float luxBasedNitsLowerBound = 0.0f;
+
+        // TODO: final float nitsLowerBound = isActive ? Math.max(settingNitsLowerBound,
+                // luxBasedNitsLowerBound) : PowerManager.BRIGHTNESS_MIN;
+
+        final int reason = settingNitsLowerBound > luxBasedNitsLowerBound
+                ? BrightnessReason.MODIFIER_MIN_USER_SET_LOWER_BOUND
+                : BrightnessReason.MODIFIER_MIN_LUX;
+
+        // TODO: brightnessLowerBound = nitsToBrightnessSpline(nitsLowerBound);
+        final float brightnessLowerBound = PowerManager.BRIGHTNESS_MIN;
+
+        if (mBrightnessLowerBound != brightnessLowerBound
+                || mReason != reason
+                || mIsActive != isActive) {
+            mIsActive = isActive;
+            mReason = reason;
+            if (DEBUG) {
+                Slog.i(TAG, "isActive: " + isActive
+                        + ", settingNitsLowerBound: " + settingNitsLowerBound
+                        + ", lowerBound: " + brightnessLowerBound);
+            }
+            mBrightnessLowerBound = brightnessLowerBound;
+            mChangeListener.onChanged();
+        }
+    }
+
+    @VisibleForTesting
+    public boolean isActive() {
+        return mIsActive;
+    }
+
+    @VisibleForTesting
+    public int getBrightnessReason() {
+        return mReason;
+    }
+
+    @VisibleForTesting
+    public float getBrightnessLowerBound() {
+        return mBrightnessLowerBound;
+    }
+
+    void start() {
+        recalculateLowerBound();
+    }
+
+    @Override
+    public void apply(DisplayManagerInternal.DisplayPowerRequest request,
+            DisplayBrightnessState.Builder stateBuilder) {
+        stateBuilder.setMinBrightness(mBrightnessLowerBound);
+        float boundedBrightness = Math.max(mBrightnessLowerBound, stateBuilder.getBrightness());
+        stateBuilder.setBrightness(boundedBrightness);
+
+        if (BrightnessSynchronizer.floatEquals(stateBuilder.getBrightness(),
+                mBrightnessLowerBound)) {
+            stateBuilder.getBrightnessReason().addModifier(mReason);
+        }
+    }
+
+    @Override
+    public void stop() {
+        mContentResolver.unregisterContentObserver(mSettingsObserver);
+    }
+
+    @Override
+    public void dump(PrintWriter pw) {
+        pw.println("BrightnessLowLuxModifier:");
+        pw.println("  mBrightnessLowerBound=" + mBrightnessLowerBound);
+        pw.println("  mIsActive=" + mIsActive);
+        pw.println("  mReason=" + mReason);
+    }
+
+    private final class SettingsObserver extends ContentObserver {
+        SettingsObserver(Handler handler) {
+            super(handler);
+            mContentResolver.registerContentObserver(
+                    Settings.Secure.getUriFor(Settings.Secure.EVEN_DIMMER_MIN_NITS),
+                    false, this);
+            mContentResolver.registerContentObserver(
+                    Settings.Secure.getUriFor(Settings.Secure.EVEN_DIMMER_ACTIVATED),
+                    false, this);
+        }
+
+        @Override
+        public void onChange(boolean selfChange, Uri uri) {
+            recalculateLowerBound();
+        }
+    }
+}
diff --git a/services/core/java/com/android/server/display/brightness/clamper/BrightnessMinClamper.java b/services/core/java/com/android/server/display/brightness/clamper/BrightnessMinClamper.java
deleted file mode 100644
index 71efca1..0000000
--- a/services/core/java/com/android/server/display/brightness/clamper/BrightnessMinClamper.java
+++ /dev/null
@@ -1,137 +0,0 @@
-/*
- * Copyright (C) 2023 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-package com.android.server.display.brightness.clamper;
-
-import android.content.ContentResolver;
-import android.content.Context;
-import android.database.ContentObserver;
-import android.net.Uri;
-import android.os.Handler;
-import android.os.PowerManager;
-import android.os.UserHandle;
-import android.provider.Settings;
-import android.util.Slog;
-
-import com.android.internal.annotations.VisibleForTesting;
-import com.android.server.display.utils.DebugUtils;
-
-import java.io.PrintWriter;
-
-/**
- * Class used to prevent the screen brightness dipping below a certain value, based on current
- * lux conditions.
- */
-public class BrightnessMinClamper extends BrightnessClamper {
-
-    // To enable these logs, run:
-    // 'adb shell setprop persist.log.tag.BrightnessMinClamper DEBUG && adb reboot'
-    private static final String TAG = "BrightnessMinClamper";
-    private static final boolean DEBUG = DebugUtils.isDebuggable(TAG);
-
-    private final SettingsObserver mSettingsObserver;
-
-    ContentResolver mContentResolver;
-    private float mNitsLowerBound;
-
-    @VisibleForTesting
-    BrightnessMinClamper(Handler handler,
-            BrightnessClamperController.ClamperChangeListener listener, Context context) {
-        super(handler, listener);
-
-        mContentResolver = context.getContentResolver();
-        mSettingsObserver = new SettingsObserver(mHandler);
-        mHandler.post(() -> {
-            start();
-        });
-    }
-
-    private void recalculateLowerBound() {
-        final int userId = UserHandle.USER_CURRENT;
-        float settingNitsLowerBound = Settings.Secure.getFloatForUser(
-                mContentResolver, Settings.Secure.EVEN_DIMMER_MIN_NITS,
-                /* def= */ PowerManager.BRIGHTNESS_MIN, userId);
-
-        boolean isActive = Settings.Secure.getIntForUser(mContentResolver,
-                Settings.Secure.EVEN_DIMMER_ACTIVATED,
-                /* def= */ 0, userId) == 1;
-
-        // TODO: luxBasedNitsLowerBound = mMinNitsToLuxSpline(currentLux);
-        float luxBasedNitsLowerBound = PowerManager.BRIGHTNESS_MIN;
-        final float nitsLowerBound = Math.max(settingNitsLowerBound, luxBasedNitsLowerBound);
-
-        if (mNitsLowerBound != nitsLowerBound || mIsActive != isActive) {
-            mIsActive = isActive;
-            mNitsLowerBound = nitsLowerBound;
-            if (DEBUG) {
-                Slog.i(TAG, "mIsActive: " + mIsActive);
-            }
-            // TODO: mBrightnessCap = nitsToBrightnessSpline(mNitsLowerBound);
-            mChangeListener.onChanged();
-        }
-    }
-
-    void start() {
-        recalculateLowerBound();
-    }
-
-
-    @Override
-    Type getType() {
-        return Type.LUX;
-    }
-
-    @Override
-    void onDeviceConfigChanged() {
-        // TODO
-    }
-
-    @Override
-    void onDisplayChanged(Object displayData) {
-
-    }
-
-    @Override
-    void stop() {
-        mContentResolver.unregisterContentObserver(mSettingsObserver);
-    }
-
-    @Override
-    void dump(PrintWriter pw) {
-        pw.println("BrightnessMinClamper:");
-        pw.println("  mBrightnessCap=" + mBrightnessCap);
-        pw.println("  mIsActive=" + mIsActive);
-        pw.println("  mNitsLowerBound=" + mNitsLowerBound);
-        super.dump(pw);
-    }
-
-    private final class SettingsObserver extends ContentObserver {
-        SettingsObserver(Handler handler) {
-            super(handler);
-            mContentResolver.registerContentObserver(
-                    Settings.Secure.getUriFor(Settings.Secure.EVEN_DIMMER_MIN_NITS),
-                    false, this);
-            mContentResolver.registerContentObserver(
-                    Settings.Secure.getUriFor(Settings.Secure.EVEN_DIMMER_ACTIVATED),
-                    false, this);
-        }
-
-        @Override
-        public void onChange(boolean selfChange, Uri uri) {
-            recalculateLowerBound();
-        }
-    }
-}
diff --git a/services/core/java/com/android/server/display/brightness/clamper/BrightnessModifier.java b/services/core/java/com/android/server/display/brightness/clamper/BrightnessModifier.java
index 112e63d..be8fa5a 100644
--- a/services/core/java/com/android/server/display/brightness/clamper/BrightnessModifier.java
+++ b/services/core/java/com/android/server/display/brightness/clamper/BrightnessModifier.java
@@ -26,7 +26,7 @@
 /**
  * Modifies current brightness based on request
  */
-abstract class BrightnessModifier {
+abstract class BrightnessModifier implements BrightnessStateModifier {
 
     private boolean mApplied = false;
 
@@ -37,7 +37,8 @@
 
     abstract int getModifier();
 
-    void apply(DisplayManagerInternal.DisplayPowerRequest request,
+    @Override
+    public void apply(DisplayManagerInternal.DisplayPowerRequest request,
             DisplayBrightnessState.Builder stateBuilder) {
         // If low power mode is enabled, scale brightness by screenLowPowerBrightnessFactor
         // as long as it is above the minimum threshold.
@@ -57,8 +58,14 @@
         }
     }
 
-    void dump(PrintWriter pw) {
+    @Override
+    public void dump(PrintWriter pw) {
         pw.println("BrightnessModifier:");
         pw.println("  mApplied=" + mApplied);
     }
+
+    @Override
+    public void stop() {
+        // do nothing
+    }
 }
diff --git a/services/core/java/com/android/server/display/brightness/clamper/BrightnessStateModifier.java b/services/core/java/com/android/server/display/brightness/clamper/BrightnessStateModifier.java
new file mode 100644
index 0000000..441ba8f
--- /dev/null
+++ b/services/core/java/com/android/server/display/brightness/clamper/BrightnessStateModifier.java
@@ -0,0 +1,45 @@
+/*
+ * Copyright (C) 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.server.display.brightness.clamper;
+
+import android.hardware.display.DisplayManagerInternal;
+
+import com.android.server.display.DisplayBrightnessState;
+
+import java.io.PrintWriter;
+
+public interface BrightnessStateModifier {
+    /**
+     * Applies the changes to brightness state, by modifying properties of the brightness
+     * state builder.
+     * @param request
+     * @param stateBuilder
+     */
+    void apply(DisplayManagerInternal.DisplayPowerRequest request,
+            DisplayBrightnessState.Builder stateBuilder);
+
+    /**
+     * Prints contents of this brightness state modifier
+     * @param printWriter
+     */
+    void dump(PrintWriter printWriter);
+
+    /**
+     * Called when stopped. Listeners can be unregistered here.
+     */
+    void stop();
+}
diff --git a/services/core/java/com/android/server/display/feature/DisplayManagerFlags.java b/services/core/java/com/android/server/display/feature/DisplayManagerFlags.java
index 35991b3..be48eb4 100644
--- a/services/core/java/com/android/server/display/feature/DisplayManagerFlags.java
+++ b/services/core/java/com/android/server/display/feature/DisplayManagerFlags.java
@@ -37,6 +37,9 @@
     // 'adb shell setprop persist.log.tag.DisplayManagerFlags DEBUG && adb reboot'
     private static final boolean DEBUG = DebugUtils.isDebuggable(TAG);
 
+    private final FlagState mPortInDisplayLayoutFlagState = new FlagState(
+            Flags.FLAG_ENABLE_PORT_IN_DISPLAY_LAYOUT,
+            Flags::enablePortInDisplayLayout);
 
     private final FlagState mConnectedDisplayManagementFlagState = new FlagState(
             Flags.FLAG_ENABLE_CONNECTED_DISPLAY_MANAGEMENT,
@@ -114,6 +117,13 @@
             Flags::refreshRateVotingTelemetry
     );
 
+    /**
+     * @return {@code true} if 'port' is allowed in display layout configuration file.
+     */
+    public boolean isPortInDisplayLayoutEnabled() {
+        return mPortInDisplayLayoutFlagState.isEnabled();
+    }
+
     /** Returns whether connected display management is enabled or not. */
     public boolean isConnectedDisplayManagementEnabled() {
         return mConnectedDisplayManagementFlagState.isEnabled();
diff --git a/services/core/java/com/android/server/display/feature/display_flags.aconfig b/services/core/java/com/android/server/display/feature/display_flags.aconfig
index e735282..c9569cb 100644
--- a/services/core/java/com/android/server/display/feature/display_flags.aconfig
+++ b/services/core/java/com/android/server/display/feature/display_flags.aconfig
@@ -3,6 +3,14 @@
 # Important: Flags must be accessed through DisplayManagerFlags.
 
 flag {
+    name: "enable_port_in_display_layout"
+    namespace: "display_manager"
+    description: "Allows refering to displays by port in display layout"
+    bug: "303058435"
+    is_fixed_read_only: true
+}
+
+flag {
     name: "enable_connected_display_management"
     namespace: "display_manager"
     description: "Feature flag for Connected Display management"
diff --git a/services/core/java/com/android/server/display/layout/Layout.java b/services/core/java/com/android/server/display/layout/Layout.java
index 40cb3303..8a362f7 100644
--- a/services/core/java/com/android/server/display/layout/Layout.java
+++ b/services/core/java/com/android/server/display/layout/Layout.java
@@ -200,13 +200,7 @@
      * @return True if the specified address is used in this layout.
      */
     public boolean contains(@NonNull DisplayAddress address) {
-        final int size = mDisplays.size();
-        for (int i = 0; i < size; i++) {
-            if (address.equals(mDisplays.get(i).getAddress())) {
-                return true;
-            }
-        }
-        return false;
+        return getByAddress(address) != null;
     }
 
     /**
@@ -237,6 +231,9 @@
             if (address.equals(display.getAddress())) {
                 return display;
             }
+            if (DisplayAddress.Physical.isPortMatch(address, display.getAddress())) {
+                return display;
+            }
         }
         return null;
     }
diff --git a/services/core/java/com/android/server/inputmethod/ClientController.java b/services/core/java/com/android/server/inputmethod/ClientController.java
new file mode 100644
index 0000000..2934640
--- /dev/null
+++ b/services/core/java/com/android/server/inputmethod/ClientController.java
@@ -0,0 +1,162 @@
+/*
+ * Copyright (C) 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.server.inputmethod;
+
+import android.annotation.NonNull;
+import android.content.pm.PackageManagerInternal;
+import android.os.IBinder;
+import android.os.RemoteException;
+import android.util.ArrayMap;
+import android.util.SparseArray;
+import android.view.inputmethod.InputBinding;
+
+import com.android.internal.annotations.GuardedBy;
+import com.android.internal.inputmethod.IInputMethodClient;
+import com.android.internal.inputmethod.IRemoteInputConnection;
+
+/**
+ * Store and manage {@link InputMethodManagerService} clients. This class was designed to be a
+ * singleton in {@link InputMethodManagerService} since it stores information about all clients,
+ * still the current client will be defined per display.
+ *
+ * <p>
+ * As part of the re-architecture plan (described in go/imms-rearchitecture-plan), the following
+ * fields and methods will be moved out from IMMS and placed here:
+ * <ul>
+ * <li>mCurClient (ClientState)</li>
+ * <li>mClients (ArrayMap of ClientState indexed by IBinder)</li>
+ * <li>mLastSwitchUserId</li>
+ * </ul>
+ * <p>
+ * Nested Classes (to move from IMMS):
+ * <ul>
+ * <li>ClientDeathRecipient</li>
+ * <li>ClientState<</li>
+ * </ul>
+ * <p>
+ * Methods to rewrite and/or extract from IMMS and move here:
+ * <ul>
+ * <li>addClient</li>
+ * <li>removeClient</li>
+ * <li>verifyClientAndPackageMatch</li>
+ * <li>setImeTraceEnabledForAllClients (make it reactive)</li>
+ * <li>unbindCurrentClient</li>
+ * </ul>
+ */
+// TODO(b/314150112): Update the Javadoc above, by removing the re-architecture steps, once this
+//  class is finalized
+final class ClientController {
+
+    // TODO(b/314150112): Make this field private when breaking the cycle with IMMS.
+    @GuardedBy("ImfLock.class")
+    final ArrayMap<IBinder, ClientState> mClients = new ArrayMap<>();
+
+    private final PackageManagerInternal mPackageManagerInternal;
+
+    ClientController(PackageManagerInternal packageManagerInternal) {
+        mPackageManagerInternal = packageManagerInternal;
+    }
+
+    @GuardedBy("ImfLock.class")
+    void addClient(IInputMethodClientInvoker clientInvoker,
+            IRemoteInputConnection inputConnection,
+            int selfReportedDisplayId, IBinder.DeathRecipient deathRecipient, int callerUid,
+            int callerPid) {
+        // TODO: Optimize this linear search.
+        final int numClients = mClients.size();
+        for (int i = 0; i < numClients; ++i) {
+            final ClientState state = mClients.valueAt(i);
+            if (state.mUid == callerUid && state.mPid == callerPid
+                    && state.mSelfReportedDisplayId == selfReportedDisplayId) {
+                throw new SecurityException("uid=" + callerUid + "/pid=" + callerPid
+                        + "/displayId=" + selfReportedDisplayId + " is already registered");
+            }
+        }
+        try {
+            clientInvoker.asBinder().linkToDeath(deathRecipient, 0 /* flags */);
+        } catch (RemoteException e) {
+            throw new IllegalStateException(e);
+        }
+        // We cannot fully avoid race conditions where the client UID already lost the access to
+        // the given self-reported display ID, even if the client is not maliciously reporting
+        // a fake display ID. Unconditionally returning SecurityException just because the
+        // client doesn't pass display ID verification can cause many test failures hence not an
+        // option right now.  At the same time
+        //    context.getSystemService(InputMethodManager.class)
+        // is expected to return a valid non-null instance at any time if we do not choose to
+        // have the client crash.  Thus we do not verify the display ID at all here.  Instead we
+        // later check the display ID every time the client needs to interact with the specified
+        // display.
+        mClients.put(clientInvoker.asBinder(), new ClientState(clientInvoker, inputConnection,
+                callerUid, callerPid, selfReportedDisplayId, deathRecipient));
+    }
+
+    @GuardedBy("ImfLock.class")
+    boolean verifyClientAndPackageMatch(
+            @NonNull IInputMethodClient client, @NonNull String packageName) {
+        ClientState cs = mClients.get(client.asBinder());
+        if (cs == null) {
+            throw new IllegalArgumentException("unknown client " + client.asBinder());
+        }
+        return InputMethodUtils.checkIfPackageBelongsToUid(
+                mPackageManagerInternal, cs.mUid, packageName);
+    }
+
+    static final class ClientState {
+        final IInputMethodClientInvoker mClient;
+        final IRemoteInputConnection mFallbackInputConnection;
+        final int mUid;
+        final int mPid;
+        final int mSelfReportedDisplayId;
+        final InputBinding mBinding;
+        final IBinder.DeathRecipient mClientDeathRecipient;
+
+        @GuardedBy("ImfLock.class")
+        boolean mSessionRequested;
+
+        @GuardedBy("ImfLock.class")
+        boolean mSessionRequestedForAccessibility;
+
+        @GuardedBy("ImfLock.class")
+        InputMethodManagerService.SessionState mCurSession;
+
+        @GuardedBy("ImfLock.class")
+        SparseArray<InputMethodManagerService.AccessibilitySessionState> mAccessibilitySessions =
+                new SparseArray<>();
+
+        @Override
+        public String toString() {
+            return "ClientState{" + Integer.toHexString(
+                    System.identityHashCode(this)) + " mUid=" + mUid
+                    + " mPid=" + mPid + " mSelfReportedDisplayId=" + mSelfReportedDisplayId + "}";
+        }
+
+        ClientState(IInputMethodClientInvoker client,
+                IRemoteInputConnection fallbackInputConnection,
+                int uid, int pid, int selfReportedDisplayId,
+                IBinder.DeathRecipient clientDeathRecipient) {
+            mClient = client;
+            mFallbackInputConnection = fallbackInputConnection;
+            mUid = uid;
+            mPid = pid;
+            mSelfReportedDisplayId = selfReportedDisplayId;
+            mBinding = new InputBinding(null /*conn*/, mFallbackInputConnection.asBinder(), mUid,
+                    mPid);
+            mClientDeathRecipient = clientDeathRecipient;
+        }
+    }
+}
diff --git a/services/core/java/com/android/server/inputmethod/HardwareKeyboardShortcutController.java b/services/core/java/com/android/server/inputmethod/HardwareKeyboardShortcutController.java
index f0e4b0f5..898d5a5 100644
--- a/services/core/java/com/android/server/inputmethod/HardwareKeyboardShortcutController.java
+++ b/services/core/java/com/android/server/inputmethod/HardwareKeyboardShortcutController.java
@@ -19,6 +19,8 @@
 import android.annotation.AnyThread;
 import android.annotation.NonNull;
 import android.annotation.Nullable;
+import android.annotation.UserIdInt;
+import android.util.ArrayMap;
 import android.view.inputmethod.InputMethodInfo;
 import android.view.inputmethod.InputMethodSubtype;
 
@@ -33,9 +35,26 @@
     @GuardedBy("ImfLock.class")
     private final ArrayList<InputMethodSubtypeHandle> mSubtypeHandles = new ArrayList<>();
 
+    @UserIdInt
+    private final int mUserId;
+
+    @AnyThread
+    @UserIdInt
+    int getUserId() {
+        return mUserId;
+    }
+
+    HardwareKeyboardShortcutController(
+            @NonNull ArrayMap<String, InputMethodInfo> methodMap, @UserIdInt int userId) {
+        mUserId = userId;
+        reset(methodMap);
+    }
+
     @GuardedBy("ImfLock.class")
-    void reset(@NonNull InputMethodUtils.InputMethodSettings settings) {
+    void reset(@NonNull ArrayMap<String, InputMethodInfo> methodMap) {
         mSubtypeHandles.clear();
+        final InputMethodUtils.InputMethodSettings settings =
+                new InputMethodUtils.InputMethodSettings(methodMap, mUserId);
         for (final InputMethodInfo imi : settings.getEnabledInputMethodListLocked()) {
             if (!imi.shouldShowInInputMethodPicker()) {
                 continue;
diff --git a/services/core/java/com/android/server/inputmethod/InputMethodManagerService.java b/services/core/java/com/android/server/inputmethod/InputMethodManagerService.java
index d722242..25ec683 100644
--- a/services/core/java/com/android/server/inputmethod/InputMethodManagerService.java
+++ b/services/core/java/com/android/server/inputmethod/InputMethodManagerService.java
@@ -48,6 +48,7 @@
 import static android.view.WindowManager.DISPLAY_IME_POLICY_HIDE;
 import static android.view.WindowManager.DISPLAY_IME_POLICY_LOCAL;
 
+import static com.android.server.inputmethod.ClientController.ClientState;
 import static com.android.server.inputmethod.ImeVisibilityStateComputer.ImeTargetWindowState;
 import static com.android.server.inputmethod.ImeVisibilityStateComputer.ImeVisibilityResult;
 import static com.android.server.inputmethod.ImeVisibilityStateComputer.STATE_HIDE_IME;
@@ -127,7 +128,6 @@
 import android.view.inputmethod.EditorInfo;
 import android.view.inputmethod.Flags;
 import android.view.inputmethod.ImeTracker;
-import android.view.inputmethod.InputBinding;
 import android.view.inputmethod.InputConnection;
 import android.view.inputmethod.InputMethod;
 import android.view.inputmethod.InputMethodEditorTraceProto.InputMethodClientsTraceFileProto;
@@ -273,13 +273,15 @@
     @NonNull
     private final String[] mNonPreemptibleInputMethods;
 
+    // TODO(b/314150112): Move this to ClientController.
     @UserIdInt
     private int mLastSwitchUserId;
 
     final Context mContext;
     final Resources mRes;
     private final Handler mHandler;
-    private final InputMethodSettings mSettings;
+    @NonNull
+    private InputMethodSettings mSettings;
     final SettingsObserver mSettingsObserver;
     private final SparseBooleanArray mLoggedDeniedGetInputMethodWindowVisibleHeightForUid =
             new SparseBooleanArray(0);
@@ -324,8 +326,9 @@
     // TODO: Instantiate mSwitchingController for each user.
     @NonNull
     private InputMethodSubtypeSwitchingController mSwitchingController;
-    final HardwareKeyboardShortcutController mHardwareKeyboardShortcutController =
-            new HardwareKeyboardShortcutController();
+    // TODO: Instantiate mHardwareKeyboardShortcutController for each user.
+    @NonNull
+    private HardwareKeyboardShortcutController mHardwareKeyboardShortcutController;
 
     /**
      * Tracks how many times {@link #mMethodMap} was updated.
@@ -391,7 +394,7 @@
     /**
      * Record session state for an accessibility service.
      */
-    private static class AccessibilitySessionState {
+    static class AccessibilitySessionState {
         final ClientState mClient;
         // Id of the accessibility service.
         final int mId;
@@ -415,58 +418,10 @@
         }
     }
 
-    private static final class ClientDeathRecipient implements IBinder.DeathRecipient {
-        private final InputMethodManagerService mImms;
-        private final IInputMethodClient mClient;
-
-        ClientDeathRecipient(InputMethodManagerService imms, IInputMethodClient client) {
-            mImms = imms;
-            mClient = client;
-        }
-
-        @Override
-        public void binderDied() {
-            mImms.removeClient(mClient);
-        }
-    }
-
-    static final class ClientState {
-        final IInputMethodClientInvoker mClient;
-        final IRemoteInputConnection mFallbackInputConnection;
-        final int mUid;
-        final int mPid;
-        final int mSelfReportedDisplayId;
-        final InputBinding mBinding;
-        final ClientDeathRecipient mClientDeathRecipient;
-
-        boolean mSessionRequested;
-        boolean mSessionRequestedForAccessibility;
-        SessionState mCurSession;
-        SparseArray<AccessibilitySessionState> mAccessibilitySessions = new SparseArray<>();
-
-        @Override
-        public String toString() {
-            return "ClientState{" + Integer.toHexString(
-                    System.identityHashCode(this)) + " mUid=" + mUid
-                    + " mPid=" + mPid + " mSelfReportedDisplayId=" + mSelfReportedDisplayId + "}";
-        }
-
-        ClientState(IInputMethodClientInvoker client,
-                IRemoteInputConnection fallbackInputConnection,
-                int uid, int pid, int selfReportedDisplayId,
-                ClientDeathRecipient clientDeathRecipient) {
-            mClient = client;
-            mFallbackInputConnection = fallbackInputConnection;
-            mUid = uid;
-            mPid = pid;
-            mSelfReportedDisplayId = selfReportedDisplayId;
-            mBinding = new InputBinding(null, mFallbackInputConnection.asBinder(), mUid, mPid);
-            mClientDeathRecipient = clientDeathRecipient;
-        }
-    }
-
-    @GuardedBy("ImfLock.class")
-    final ArrayMap<IBinder, ClientState> mClients = new ArrayMap<>();
+    /**
+     * Manages the IME clients.
+     */
+    private final ClientController mClientController;
 
     /**
      * Set once the system is ready to run third party code.
@@ -524,6 +479,7 @@
     /**
      * The client that is currently bound to an input method.
      */
+    // TODO(b/314150112): Move this to ClientController.
     @Nullable
     private ClientState mCurClient;
 
@@ -864,8 +820,9 @@
             @Nullable
             final String mImeSurfaceParentName;
 
-            Entry(ClientState client, EditorInfo editorInfo, String focusedWindowName,
-                    @SoftInputModeFlags int softInputMode, @SoftInputShowHideReason int reason,
+            Entry(ClientState client, EditorInfo editorInfo,
+                    String focusedWindowName, @SoftInputModeFlags int softInputMode,
+                    @SoftInputShowHideReason int reason,
                     boolean inFullscreenMode, String requestWindowName,
                     @Nullable String imeControlTargetName, @Nullable String imeTargetName,
                     @Nullable String imeSurfaceParentName) {
@@ -1629,7 +1586,7 @@
             if (userId != currentUserId) {
                 return;
             }
-            mSettings.switchCurrentUser(currentUserId);
+            mSettings = new InputMethodSettings(mMethodMap, userId);
             if (mSystemReady) {
                 // We need to rebuild IMEs.
                 buildInputMethodListLocked(false /* resetDefaultEnabledIme */);
@@ -1709,7 +1666,8 @@
         mSwitchingController =
                 InputMethodSubtypeSwitchingController.createInstanceLocked(context, mMethodMap,
                         userId);
-        mHardwareKeyboardShortcutController.reset(mSettings);
+        mHardwareKeyboardShortcutController =
+                new HardwareKeyboardShortcutController(mMethodMap, userId);
         mMenuController = new InputMethodMenuController(this);
         mBindingController =
                 bindingControllerForTesting != null
@@ -1719,6 +1677,7 @@
 
         mVisibilityStateComputer = new ImeVisibilityStateComputer(this);
         mVisibilityApplier = new DefaultImeVisibilityApplier(this);
+        mClientController = new ClientController(mPackageManagerInternal);
 
         mPreventImeStartupUnlessTextEditor = mRes.getBoolean(
                 com.android.internal.R.bool.config_preventImeStartupUnlessTextEditor);
@@ -1830,11 +1789,7 @@
         // ContentObserver should be registered again when the user is changed
         mSettingsObserver.registerContentObserverLocked(newUserId);
 
-        // If the system is not ready or the device is not yed unlocked by the user, then we use
-        // copy-on-write settings.
-        final boolean useCopyOnWriteSettings =
-                !mSystemReady || !mUserManagerInternal.isUserUnlockingOrUnlocked(newUserId);
-        mSettings.switchCurrentUser(newUserId);
+        mSettings = new InputMethodSettings(mMethodMap, newUserId);
         // Additional subtypes should be reset when the user is changed
         AdditionalSubtypeUtils.load(mAdditionalSubtypeMap, newUserId);
         final String defaultImiId = mSettings.getSelectedInputMethod();
@@ -1876,7 +1831,8 @@
         mLastSwitchUserId = newUserId;
 
         if (mIsInteractive && clientToBeReset != null) {
-            final ClientState cs = mClients.get(clientToBeReset.asBinder());
+            final ClientState cs =
+                    mClientController.mClients.get(clientToBeReset.asBinder());
             if (cs == null) {
                 // The client is already gone.
                 return;
@@ -1896,7 +1852,6 @@
             if (!mSystemReady) {
                 mSystemReady = true;
                 final int currentUserId = mSettings.getCurrentUserId();
-                mSettings.switchCurrentUser(currentUserId);
                 mStatusBarManagerInternal =
                         LocalServices.getService(StatusBarManagerInternal.class);
                 hideStatusBarIconLocked();
@@ -2214,43 +2169,22 @@
         // actually running.
         final int callerUid = Binder.getCallingUid();
         final int callerPid = Binder.getCallingPid();
+
+        // TODO(b/314150112): Move the death recipient logic to ClientController when moving
+        //     removeClient method.
+        final IBinder.DeathRecipient deathRecipient = () -> removeClient(client);
+        final IInputMethodClientInvoker clientInvoker =
+                IInputMethodClientInvoker.create(client, mHandler);
         synchronized (ImfLock.class) {
-            // TODO: Optimize this linear search.
-            final int numClients = mClients.size();
-            for (int i = 0; i < numClients; ++i) {
-                final ClientState state = mClients.valueAt(i);
-                if (state.mUid == callerUid && state.mPid == callerPid
-                        && state.mSelfReportedDisplayId == selfReportedDisplayId) {
-                    throw new SecurityException("uid=" + callerUid + "/pid=" + callerPid
-                            + "/displayId=" + selfReportedDisplayId + " is already registered.");
-                }
-            }
-            final ClientDeathRecipient deathRecipient = new ClientDeathRecipient(this, client);
-            try {
-                client.asBinder().linkToDeath(deathRecipient, 0 /* flags */);
-            } catch (RemoteException e) {
-                throw new IllegalStateException(e);
-            }
-            // We cannot fully avoid race conditions where the client UID already lost the access to
-            // the given self-reported display ID, even if the client is not maliciously reporting
-            // a fake display ID. Unconditionally returning SecurityException just because the
-            // client doesn't pass display ID verification can cause many test failures hence not an
-            // option right now.  At the same time
-            //    context.getSystemService(InputMethodManager.class)
-            // is expected to return a valid non-null instance at any time if we do not choose to
-            // have the client crash.  Thus we do not verify the display ID at all here.  Instead we
-            // later check the display ID every time the client needs to interact with the specified
-            // display.
-            final IInputMethodClientInvoker clientInvoker =
-                    IInputMethodClientInvoker.create(client, mHandler);
-            mClients.put(client.asBinder(), new ClientState(clientInvoker, inputConnection,
-                    callerUid, callerPid, selfReportedDisplayId, deathRecipient));
+            mClientController.addClient(clientInvoker, inputConnection, selfReportedDisplayId,
+                    deathRecipient, callerUid, callerPid);
         }
     }
 
+    // TODO(b/314150112): Move this to ClientController.
     void removeClient(IInputMethodClient client) {
         synchronized (ImfLock.class) {
-            ClientState cs = mClients.remove(client.asBinder());
+            ClientState cs = mClientController.mClients.remove(client.asBinder());
             if (cs != null) {
                 client.asBinder().unlinkToDeath(cs.mClientDeathRecipient, 0 /* flags */);
                 clearClientSessionLocked(cs);
@@ -2280,6 +2214,7 @@
         }
     }
 
+    // TODO(b/314150112): Move this to ClientController.
     @GuardedBy("ImfLock.class")
     void unbindCurrentClientLocked(@UnbindReason int unbindClientReason) {
         if (mCurClient != null) {
@@ -2332,7 +2267,10 @@
         }
     }
 
-    /** {@code true} when a {@link ClientState} has attached from starting the input connection. */
+    /**
+     * {@code true} when a {@link ClientState} has attached from starting the
+     * input connection.
+     */
     @GuardedBy("ImfLock.class")
     boolean hasAttachedClient() {
         return mCurClient != null;
@@ -2976,10 +2914,10 @@
     @GuardedBy("ImfLock.class")
     void clearClientSessionsLocked() {
         if (getCurMethodLocked() != null) {
-            final int numClients = mClients.size();
+            final int numClients = mClientController.mClients.size();
             for (int i = 0; i < numClients; ++i) {
-                clearClientSessionLocked(mClients.valueAt(i));
-                clearClientSessionForAccessibilityLocked(mClients.valueAt(i));
+                clearClientSessionLocked(mClientController.mClients.valueAt(i));
+                clearClientSessionForAccessibilityLocked(mClientController.mClients.valueAt(i));
             }
 
             finishSessionLocked(mEnabledSession);
@@ -3305,8 +3243,13 @@
             mSwitchingController = InputMethodSubtypeSwitchingController.createInstanceLocked(
                     mContext, mMethodMap, mSettings.getCurrentUserId());
         }
-
-        mHardwareKeyboardShortcutController.reset(mSettings);
+        // TODO: Instantiate mHardwareKeyboardShortcutController for each user.
+        if (mSettings.getCurrentUserId() == mHardwareKeyboardShortcutController.getUserId()) {
+            mHardwareKeyboardShortcutController.reset(mMethodMap);
+        } else {
+            mHardwareKeyboardShortcutController = new HardwareKeyboardShortcutController(
+                    mMethodMap, mSettings.getCurrentUserId());
+        }
         sendOnNavButtonFlagsChangedLocked();
     }
 
@@ -3509,9 +3452,12 @@
                     + " pref is disabled for user: " + userId);
             return;
         }
-        if (!verifyClientAndPackageMatch(client, delegatorPackageName)) {
-            Slog.w(TAG, "prepareStylusHandwritingDelegation() fail");
-            throw new IllegalArgumentException("Delegator doesn't match Uid");
+        synchronized (ImfLock.class) {
+            if (!mClientController.verifyClientAndPackageMatch(client,
+                    delegatorPackageName)) {
+                Slog.w(TAG, "prepareStylusHandwritingDelegation() fail");
+                throw new IllegalArgumentException("Delegator doesn't match Uid");
+            }
         }
         schedulePrepareStylusHandwritingDelegation(
                 userId, delegatePackageName, delegatorPackageName);
@@ -3537,30 +3483,17 @@
         return true;
     }
 
-    private boolean verifyClientAndPackageMatch(
-            @NonNull IInputMethodClient client, @NonNull String packageName) {
-        ClientState cs;
-        synchronized (ImfLock.class) {
-            cs = mClients.get(client.asBinder());
-        }
-        if (cs == null) {
-            throw new IllegalArgumentException("unknown client " + client.asBinder());
-        }
-        return InputMethodUtils.checkIfPackageBelongsToUid(
-                mPackageManagerInternal, cs.mUid, packageName);
-    }
-
     private boolean verifyDelegator(
             @NonNull IInputMethodClient client,
             @NonNull String delegatePackageName,
             @NonNull String delegatorPackageName,
             @InputMethodManager.HandwritingDelegateFlags int flags) {
-        if (!verifyClientAndPackageMatch(client, delegatePackageName)) {
-            Slog.w(TAG, "Delegate package does not belong to the same user. Ignoring"
-                    + " startStylusHandwriting");
-            return false;
-        }
         synchronized (ImfLock.class) {
+            if (!mClientController.verifyClientAndPackageMatch(client, delegatePackageName)) {
+                Slog.w(TAG, "Delegate package does not belong to the same user. Ignoring"
+                        + " startStylusHandwriting");
+                return false;
+            }
             boolean homeDelegatorAllowed =
                     (flags & InputMethodManager.HANDWRITING_DELEGATE_FLAG_HOME_DELEGATOR_ALLOWED)
                             != 0;
@@ -3823,7 +3756,7 @@
             return InputBindResult.INVALID_USER;
         }
 
-        final ClientState cs = mClients.get(client.asBinder());
+        final ClientState cs = mClientController.mClients.get(client.asBinder());
         if (cs == null) {
             throw new IllegalArgumentException("unknown client " + client.asBinder());
         }
@@ -3997,7 +3930,8 @@
             // We need to check if this is the current client with
             // focus in the window manager, to allow this call to
             // be made before input is started in it.
-            final ClientState cs = mClients.get(client.asBinder());
+            final ClientState cs =
+                    mClientController.mClients.get(client.asBinder());
             if (cs == null) {
                 ImeTracker.forLogging().onFailed(statsToken, ImeTracker.PHASE_SERVER_CLIENT_KNOWN);
                 throw new IllegalArgumentException("unknown client " + client.asBinder());
@@ -4621,7 +4555,7 @@
         ImeTracing.getInstance().startTrace(null /* printwriter */);
         ArrayMap<IBinder, ClientState> clients;
         synchronized (ImfLock.class) {
-            clients = new ArrayMap<>(mClients);
+            clients = new ArrayMap<>(mClientController.mClients);
         }
         for (ClientState state : clients.values()) {
             if (state != null) {
@@ -4639,7 +4573,7 @@
         ImeTracing.getInstance().stopTrace(null /* printwriter */);
         ArrayMap<IBinder, ClientState> clients;
         synchronized (ImfLock.class) {
-            clients = new ArrayMap<>(mClients);
+            clients = new ArrayMap<>(mClientController.mClients);
         }
         for (ClientState state : clients.values()) {
             if (state != null) {
@@ -5328,7 +5262,13 @@
             mSwitchingController = InputMethodSubtypeSwitchingController.createInstanceLocked(
                     mContext, mMethodMap, mSettings.getCurrentUserId());
         }
-        mHardwareKeyboardShortcutController.reset(mSettings);
+        // TODO: Instantiate mHardwareKeyboardShortcutController for each user.
+        if (mSettings.getCurrentUserId() == mHardwareKeyboardShortcutController.getUserId()) {
+            mHardwareKeyboardShortcutController.reset(mMethodMap);
+        } else {
+            mHardwareKeyboardShortcutController = new HardwareKeyboardShortcutController(
+                    mMethodMap, mSettings.getCurrentUserId());
+        }
 
         sendOnNavButtonFlagsChangedLocked();
 
@@ -5878,10 +5818,10 @@
                 // We only have sessions when we bound to an input method. Remove this session
                 // from all clients.
                 if (getCurMethodLocked() != null) {
-                    final int numClients = mClients.size();
+                    final int numClients = mClientController.mClients.size();
                     for (int i = 0; i < numClients; ++i) {
-                        clearClientSessionForAccessibilityLocked(mClients.valueAt(i),
-                                accessibilityConnectionId);
+                        clearClientSessionForAccessibilityLocked(
+                                mClientController.mClients.valueAt(i), accessibilityConnectionId);
                     }
                     AccessibilitySessionState session = mEnabledAccessibilitySessions.get(
                             accessibilityConnectionId);
@@ -6066,9 +6006,10 @@
                 info.dump(p, "    ");
             }
             p.println("  ClientStates:");
-            final int numClients = mClients.size();
+            // TODO(b/314150112): move client related dump info to ClientController#dump
+            final int numClients = mClientController.mClients.size();
             for (int i = 0; i < numClients; ++i) {
-                final ClientState ci = mClients.valueAt(i);
+                final ClientState ci = mClientController.mClients.valueAt(i);
                 p.println("  " + ci + ":");
                 p.println("    client=" + ci.mClient);
                 p.println("    fallbackInputConnection=" + ci.mFallbackInputConnection);
@@ -6687,7 +6628,7 @@
         boolean isImeTraceEnabled = ImeTracing.getInstance().isEnabled();
         ArrayMap<IBinder, ClientState> clients;
         synchronized (ImfLock.class) {
-            clients = new ArrayMap<>(mClients);
+            clients = new ArrayMap<>(mClientController.mClients);
         }
         for (ClientState state : clients.values()) {
             if (state != null) {
diff --git a/services/core/java/com/android/server/inputmethod/InputMethodUtils.java b/services/core/java/com/android/server/inputmethod/InputMethodUtils.java
index f9b06de..fb57c09 100644
--- a/services/core/java/com/android/server/inputmethod/InputMethodUtils.java
+++ b/services/core/java/com/android/server/inputmethod/InputMethodUtils.java
@@ -215,7 +215,7 @@
         private final ArrayMap<String, InputMethodInfo> mMethodMap;
 
         @UserIdInt
-        private int mCurrentUserId;
+        private final int mCurrentUserId;
 
         private static void buildEnabledInputMethodsSettingString(
                 StringBuilder builder, Pair<String, ArrayList<String>> ime) {
@@ -229,18 +229,6 @@
 
         InputMethodSettings(ArrayMap<String, InputMethodInfo> methodMap, @UserIdInt int userId) {
             mMethodMap = methodMap;
-            switchCurrentUser(userId);
-        }
-
-        /**
-         * Must be called when the current user is changed.
-         *
-         * @param userId The user ID.
-         */
-        void switchCurrentUser(@UserIdInt int userId) {
-            if (DEBUG) {
-                Slog.d(TAG, "--- Switch the current user from " + mCurrentUserId + " to " + userId);
-            }
             mCurrentUserId = userId;
             String ime = getSelectedInputMethod();
             String defaultDeviceIme = getSelectedDefaultDeviceInputMethod();
diff --git a/services/core/java/com/android/server/media/MediaSession2Record.java b/services/core/java/com/android/server/media/MediaSession2Record.java
index 07b333a..393e7ef 100644
--- a/services/core/java/com/android/server/media/MediaSession2Record.java
+++ b/services/core/java/com/android/server/media/MediaSession2Record.java
@@ -198,7 +198,12 @@
                 mIsConnected = true;
                 service = mService;
             }
-            service.onSessionActiveStateChanged(MediaSession2Record.this);
+
+            // TODO (b/318745416): Add support for FGS in MediaSession2. Passing a
+            // null playback state means the owning process will not be allowed to
+            // run in the foreground.
+            service.onSessionActiveStateChanged(MediaSession2Record.this,
+                    /* playbackState= */ null);
         }
 
         @Override
diff --git a/services/core/java/com/android/server/media/MediaSessionRecord.java b/services/core/java/com/android/server/media/MediaSessionRecord.java
index cce66e2..53f780e 100644
--- a/services/core/java/com/android/server/media/MediaSessionRecord.java
+++ b/services/core/java/com/android/server/media/MediaSessionRecord.java
@@ -1144,7 +1144,7 @@
             mIsActive = active;
             long token = Binder.clearCallingIdentity();
             try {
-                mService.onSessionActiveStateChanged(MediaSessionRecord.this);
+                mService.onSessionActiveStateChanged(MediaSessionRecord.this, mPlaybackState);
             } finally {
                 Binder.restoreCallingIdentity(token);
             }
diff --git a/services/core/java/com/android/server/media/MediaSessionService.java b/services/core/java/com/android/server/media/MediaSessionService.java
index 2affdfc..2cd3ab1 100644
--- a/services/core/java/com/android/server/media/MediaSessionService.java
+++ b/services/core/java/com/android/server/media/MediaSessionService.java
@@ -260,7 +260,8 @@
         return mGlobalPrioritySession != null && mGlobalPrioritySession.isActive();
     }
 
-    void onSessionActiveStateChanged(MediaSessionRecordImpl record) {
+    void onSessionActiveStateChanged(
+            MediaSessionRecordImpl record, @Nullable PlaybackState playbackState) {
         synchronized (mLock) {
             FullUserRecord user = getFullUserRecordLocked(record.getUserId());
             if (user == null) {
@@ -287,7 +288,9 @@
                 user.mPriorityStack.onSessionActiveStateChanged(record);
             }
             setForegroundServiceAllowance(
-                    record, /* allowRunningInForeground= */ record.isActive());
+                    record,
+                    /* allowRunningInForeground= */ record.isActive()
+                            && (playbackState == null || playbackState.isActive()));
             mHandler.postSessionsChanged(record);
         }
     }
@@ -386,7 +389,9 @@
             user.mPriorityStack.onPlaybackStateChanged(record, shouldUpdatePriority);
             if (playbackState != null) {
                 setForegroundServiceAllowance(
-                        record, playbackState.shouldAllowServiceToRunInForeground());
+                        record,
+                        /* allowRunningInForeground= */ playbackState.isActive()
+                                && record.isActive());
             }
         }
     }
diff --git a/services/core/java/com/android/server/notification/NotificationAttentionHelper.java b/services/core/java/com/android/server/notification/NotificationAttentionHelper.java
index 6b7db2d..a6f71c2 100644
--- a/services/core/java/com/android/server/notification/NotificationAttentionHelper.java
+++ b/services/core/java/com/android/server/notification/NotificationAttentionHelper.java
@@ -94,8 +94,6 @@
 
     private static final float DEFAULT_VOLUME = 1.0f;
     // TODO (b/291899544): remove for release
-    private static final String POLITE_STRATEGY1 = "rule1";
-    private static final String POLITE_STRATEGY2 = "rule2";
     private static final int DEFAULT_NOTIFICATION_COOLDOWN_ENABLED = 1;
     private static final int DEFAULT_NOTIFICATION_COOLDOWN_ENABLED_FOR_WORK = 0;
     private static final int DEFAULT_NOTIFICATION_COOLDOWN_ALL = 1;
@@ -146,7 +144,6 @@
     private boolean mNotificationCooldownApplyToAll;
     private boolean mNotificationCooldownVibrateUnlocked;
 
-    private boolean mEnablePoliteNotificationsFeature;
     private final PolitenessStrategy mStrategy;
     private int mCurrentWorkProfileId = UserHandle.USER_NULL;
 
@@ -192,9 +189,7 @@
                 .build();
         mInCallNotificationVolume = resources.getFloat(R.dimen.config_inCallNotificationVolume);
 
-        mEnablePoliteNotificationsFeature = Flags.politeNotifications();
-
-        if (mEnablePoliteNotificationsFeature) {
+        if (Flags.politeNotifications()) {
             mStrategy = getPolitenessStrategy();
         } else {
             mStrategy = null;
@@ -205,21 +200,23 @@
     }
 
     private PolitenessStrategy getPolitenessStrategy() {
-        final String politenessStrategy = mFlagResolver.getStringValue(
-                NotificationFlags.NOTIF_COOLDOWN_RULE);
-
-        if (POLITE_STRATEGY2.equals(politenessStrategy)) {
-            return new Strategy2(mFlagResolver.getIntValue(NotificationFlags.NOTIF_COOLDOWN_T1),
+        if (Flags.crossAppPoliteNotifications()) {
+            PolitenessStrategy appStrategy = new StrategyPerApp(
+                    mFlagResolver.getIntValue(NotificationFlags.NOTIF_COOLDOWN_T1),
                     mFlagResolver.getIntValue(NotificationFlags.NOTIF_COOLDOWN_T2),
                     mFlagResolver.getIntValue(NotificationFlags.NOTIF_VOLUME1),
-                    mFlagResolver.getIntValue(NotificationFlags.NOTIF_VOLUME2));
-        } else {
-            if (!POLITE_STRATEGY1.equals(politenessStrategy)) {
-                Log.w(TAG, "Invalid cooldown strategy: " + politenessStrategy + ". Defaulting to "
-                        + POLITE_STRATEGY1);
-            }
+                    mFlagResolver.getIntValue(NotificationFlags.NOTIF_VOLUME2),
+                    mFlagResolver.getIntValue(NotificationFlags.NOTIF_COOLDOWN_COUNTER_RESET));
 
-            return new Strategy1(mFlagResolver.getIntValue(NotificationFlags.NOTIF_COOLDOWN_T1),
+            return new StrategyGlobal(
+                    mFlagResolver.getIntValue(NotificationFlags.NOTIF_COOLDOWN_T1),
+                    mFlagResolver.getIntValue(NotificationFlags.NOTIF_COOLDOWN_T2),
+                    mFlagResolver.getIntValue(NotificationFlags.NOTIF_VOLUME1),
+                    mFlagResolver.getIntValue(NotificationFlags.NOTIF_VOLUME2),
+                    appStrategy);
+        } else {
+            return new StrategyPerApp(
+                    mFlagResolver.getIntValue(NotificationFlags.NOTIF_COOLDOWN_T1),
                     mFlagResolver.getIntValue(NotificationFlags.NOTIF_COOLDOWN_T2),
                     mFlagResolver.getIntValue(NotificationFlags.NOTIF_VOLUME1),
                     mFlagResolver.getIntValue(NotificationFlags.NOTIF_VOLUME2),
@@ -266,7 +263,7 @@
         mContext.getContentResolver().registerContentObserver(
                 SettingsObserver.NOTIFICATION_LIGHT_PULSE_URI, false, mSettingsObserver,
                 UserHandle.USER_ALL);
-        if (mEnablePoliteNotificationsFeature) {
+        if (Flags.politeNotifications()) {
             mContext.getContentResolver().registerContentObserver(
                     SettingsObserver.NOTIFICATION_COOLDOWN_ENABLED_URI, false, mSettingsObserver,
                     UserHandle.USER_ALL);
@@ -280,7 +277,7 @@
     }
 
     private void loadUserSettings() {
-        if (mEnablePoliteNotificationsFeature) {
+        if (Flags.politeNotifications()) {
             try {
                 mCurrentWorkProfileId = getManagedProfileId(ActivityManager.getCurrentUser());
 
@@ -301,11 +298,14 @@
                     mContext.getContentResolver(),
                     Settings.System.NOTIFICATION_COOLDOWN_ALL, DEFAULT_NOTIFICATION_COOLDOWN_ALL,
                     UserHandle.USER_CURRENT) != 0;
-                mNotificationCooldownVibrateUnlocked = Settings.System.getIntForUser(
-                    mContext.getContentResolver(),
-                    Settings.System.NOTIFICATION_COOLDOWN_VIBRATE_UNLOCKED,
-                    DEFAULT_NOTIFICATION_COOLDOWN_VIBRATE_UNLOCKED,
-                    UserHandle.USER_CURRENT) != 0;
+                mStrategy.setApplyCooldownPerPackage(mNotificationCooldownApplyToAll);
+                if (Flags.vibrateWhileUnlocked()) {
+                    mNotificationCooldownVibrateUnlocked = Settings.System.getIntForUser(
+                        mContext.getContentResolver(),
+                        Settings.System.NOTIFICATION_COOLDOWN_VIBRATE_UNLOCKED,
+                        DEFAULT_NOTIFICATION_COOLDOWN_VIBRATE_UNLOCKED,
+                        UserHandle.USER_CURRENT) != 0;
+                }
             } catch (Exception e) {
                 Log.e(TAG, "Failed to read Settings: " + e);
             }
@@ -482,10 +482,10 @@
                     getPolitenessState(record));
         }
         record.setAudiblyAlerted(buzz || beep);
-        if (mEnablePoliteNotificationsFeature) {
+        if (Flags.politeNotifications()) {
             // Update last alert time
             if (buzz || beep) {
-                record.getChannel().setLastNotificationUpdateTimeMs(System.currentTimeMillis());
+                mStrategy.setLastNotificationUpdateTimeMs(record, System.currentTimeMillis());
             }
         }
         return buzzBeepBlinkLoggingCode;
@@ -618,7 +618,7 @@
 
     private boolean isPoliteNotificationFeatureEnabled(final NotificationRecord record) {
         // Check feature flag
-        if (!mEnablePoliteNotificationsFeature) {
+        if (!Flags.politeNotifications()) {
             return false;
         }
 
@@ -1064,9 +1064,13 @@
         // Volume for muted state
         protected final float mVolumeMuted;
 
+        protected boolean mApplyPerPackage;
+        protected final Map<String, Long> mLastUpdatedTimestampByPackage;
+
         public PolitenessStrategy(int timeoutPolite, int timeoutMuted, int volumePolite,
                 int volumeMuted) {
             mVolumeStates = new HashMap<>();
+            mLastUpdatedTimestampByPackage = new HashMap<>();
 
             this.mTimeoutPolite = timeoutPolite;
             this.mTimeoutMuted = timeoutMuted;
@@ -1076,10 +1080,38 @@
 
         abstract void onNotificationPosted(NotificationRecord record);
 
+        /**
+         *  Set true if the cooldown strategy should apply per app(package).
+         *  Otherwise apply per conversation channel.
+         * @param applyPerPackage if the cooldown should be applied per app
+         */
+        void setApplyCooldownPerPackage(boolean applyPerPackage) {
+            mApplyPerPackage = applyPerPackage;
+        }
+
+        boolean shouldIgnoreNotification(final NotificationRecord record) {
+            // Ignore group summaries
+            return (record.getSbn().isGroup() && record.getSbn().getNotification()
+                    .isGroupSummary());
+        }
+
+        /**
+         * Get the key that determines the grouping for the cooldown behavior.
+         *
+         * @param record the notification being posted
+         * @return the key to group this notification under
+         */
         String getChannelKey(final NotificationRecord record) {
-            // use conversationId if it's a conversation
+            // Use conversationId if it's a conversation
             String channelId = record.getChannel().getConversationId() != null
                     ? record.getChannel().getConversationId() : record.getChannel().getId();
+
+            // Use only the package name to apply cooldown per app, unless the user explicitly
+            // changed the channel notification sound => treat separately
+            if (mApplyPerPackage && !record.getChannel().hasUserSetSound()) {
+                channelId = "";
+            }
+
             return record.getSbn().getNormalizedUserId() + ":" + record.getSbn().getPackageName()
                     + ":" + channelId;
         }
@@ -1121,12 +1153,59 @@
             final String key = getChannelKey(record);
             // reset to default state after user interaction
             mVolumeStates.put(key, POLITE_STATE_DEFAULT);
-            record.getChannel().setLastNotificationUpdateTimeMs(0);
+            setLastNotificationUpdateTimeMs(record, 0);
         }
 
         public final @PolitenessState int getPolitenessState(final NotificationRecord record) {
             return mVolumeStates.getOrDefault(getChannelKey(record), POLITE_STATE_DEFAULT);
         }
+
+        void setLastNotificationUpdateTimeMs(final NotificationRecord record,
+                long timestampMillis) {
+            record.getChannel().setLastNotificationUpdateTimeMs(timestampMillis);
+            mLastUpdatedTimestampByPackage.put(record.getSbn().getPackageName(), timestampMillis);
+        }
+
+        long getLastNotificationUpdateTimeMs(final NotificationRecord record) {
+            if (record.getChannel().hasUserSetSound() || !mApplyPerPackage) {
+                return record.getChannel().getLastNotificationUpdateTimeMs();
+            } else {
+                return mLastUpdatedTimestampByPackage.getOrDefault(record.getSbn().getPackageName(),
+                        0L);
+            }
+        }
+
+        @PolitenessState int getNextState(@PolitenessState final int currState,
+                final long timeSinceLastNotif) {
+            @PolitenessState int nextState = currState;
+            switch (currState) {
+                case POLITE_STATE_DEFAULT:
+                    if (timeSinceLastNotif < mTimeoutPolite) {
+                        nextState = POLITE_STATE_POLITE;
+                    }
+                    break;
+                case POLITE_STATE_POLITE:
+                    if (timeSinceLastNotif < mTimeoutMuted) {
+                        nextState = POLITE_STATE_MUTED;
+                    } else if (timeSinceLastNotif > mTimeoutPolite) {
+                        nextState = POLITE_STATE_DEFAULT;
+                    } else {
+                        nextState = POLITE_STATE_POLITE;
+                    }
+                    break;
+                case POLITE_STATE_MUTED:
+                    if (timeSinceLastNotif > mTimeoutMuted) {
+                        nextState = POLITE_STATE_POLITE;
+                    } else {
+                        nextState = POLITE_STATE_MUTED;
+                    }
+                    break;
+                default:
+                    Log.w(TAG, "getNextState unexpected volume state: " + currState);
+                    break;
+            }
+            return nextState;
+        }
     }
 
     // TODO b/270456865: Only one of the two strategies will be released.
@@ -1143,72 +1222,51 @@
      *  after timeoutMuted.
      *  - Transitions back to the default state after a user interaction with a notification.
      */
-    public static class Strategy1 extends PolitenessStrategy {
+    private static class StrategyPerApp extends PolitenessStrategy {
         // Keep track of the number of notifications posted per channel
         private final Map<String, Integer> mNumPosted;
         // Reset to default state if number of posted notifications exceed this value when muted
         private final int mMaxPostedForReset;
 
-        public Strategy1(int timeoutPolite, int timeoutMuted, int volumePolite, int volumeMuted,
-                int maxPosted) {
+        public StrategyPerApp(int timeoutPolite, int timeoutMuted, int volumePolite,
+                int volumeMuted, int maxPosted) {
             super(timeoutPolite, timeoutMuted, volumePolite, volumeMuted);
 
             mNumPosted = new HashMap<>();
             mMaxPostedForReset = maxPosted;
 
             if (DEBUG) {
-                Log.i(TAG, "Strategy1: " + timeoutPolite + " " + timeoutMuted);
+                Log.i(TAG, "StrategyPerApp: " + timeoutPolite + " " + timeoutMuted);
             }
         }
 
         @Override
         public void onNotificationPosted(final NotificationRecord record) {
-            long timeSinceLastNotif = System.currentTimeMillis()
-                    - record.getChannel().getLastNotificationUpdateTimeMs();
+            if (shouldIgnoreNotification(record)) {
+                return;
+            }
+
+            long timeSinceLastNotif =
+                    System.currentTimeMillis() - getLastNotificationUpdateTimeMs(record);
 
             final String key = getChannelKey(record);
-            @PolitenessState int volState = getPolitenessState(record);
+            @PolitenessState final int currState = getPolitenessState(record);
+            @PolitenessState int nextState = getNextState(currState, timeSinceLastNotif);
 
+            // Reset to default state if number of posted notifications exceed this value when muted
             int numPosted = mNumPosted.getOrDefault(key, 0) + 1;
             mNumPosted.put(key, numPosted);
-
-            switch (volState) {
-                case POLITE_STATE_DEFAULT:
-                    if (timeSinceLastNotif < mTimeoutPolite) {
-                        volState = POLITE_STATE_POLITE;
-                    }
-                    break;
-                case POLITE_STATE_POLITE:
-                    if (timeSinceLastNotif < mTimeoutMuted) {
-                        volState = POLITE_STATE_MUTED;
-                    } else if (timeSinceLastNotif > mTimeoutPolite) {
-                        volState = POLITE_STATE_DEFAULT;
-                    } else {
-                        volState = POLITE_STATE_POLITE;
-                    }
-                    break;
-                case POLITE_STATE_MUTED:
-                    if (timeSinceLastNotif > mTimeoutMuted) {
-                        volState = POLITE_STATE_POLITE;
-                    } else {
-                        volState = POLITE_STATE_MUTED;
-                    }
-                    if (numPosted >= mMaxPostedForReset) {
-                        volState = POLITE_STATE_DEFAULT;
-                        mNumPosted.put(key, 0);
-                    }
-                    break;
-                default:
-                    Log.w(TAG, "onNotificationPosted unexpected volume state: " + volState);
-                    break;
+            if (currState == POLITE_STATE_MUTED && numPosted >= mMaxPostedForReset) {
+                nextState = POLITE_STATE_DEFAULT;
+                mNumPosted.put(key, 0);
             }
 
             if (DEBUG) {
                 Log.i(TAG, "onNotificationPosted time delta: " + timeSinceLastNotif + " vol state: "
-                        + volState + " key: " + key + " numposted " + numPosted);
+                        + nextState + " key: " + key + " numposted " + numPosted);
             }
 
-            mVolumeStates.put(key, volState);
+            mVolumeStates.put(key, nextState);
         }
 
         @Override
@@ -1219,61 +1277,98 @@
     }
 
     /**
-     *  Polite notification strategy 2:
-     *   - Transitions from default (loud) => muted state if a notification
-     *   alerts the same channel before timeoutPolite.
-     *   - Transitions from polite => default state if a notification
-     *  alerts the same channel before timeoutMuted.
-     *   - Transitions from muted => default state if a notification alerts after timeoutMuted,
-     *  otherwise transitions to the polite state.
-     *   - Transitions back to the default state after a user interaction with a notification.
+     * Global (cross-app) strategy.
      */
-    public static class Strategy2 extends PolitenessStrategy {
-        public Strategy2(int timeoutPolite, int timeoutMuted, int volumePolite, int volumeMuted) {
+    private static class StrategyGlobal extends PolitenessStrategy {
+        private static final String COMMON_KEY = "cross_app_common_key";
+
+        private final PolitenessStrategy mAppStrategy;
+        private long mLastNotificationTimestamp = 0;
+
+        public StrategyGlobal(int timeoutPolite, int timeoutMuted, int volumePolite,
+                int volumeMuted, PolitenessStrategy appStrategy) {
             super(timeoutPolite, timeoutMuted, volumePolite, volumeMuted);
 
+            mAppStrategy = appStrategy;
+
             if (DEBUG) {
-                Log.i(TAG, "Strategy2: " + timeoutPolite + " " + timeoutMuted);
+                Log.i(TAG, "StrategyGlobal: " + timeoutPolite + " " + timeoutMuted);
             }
         }
 
         @Override
-        public void onNotificationPosted(final NotificationRecord record) {
-            long timeSinceLastNotif = System.currentTimeMillis()
-                    - record.getChannel().getLastNotificationUpdateTimeMs();
+        void onNotificationPosted(NotificationRecord record) {
+            if (shouldIgnoreNotification(record)) {
+                return;
+            }
+
+            long timeSinceLastNotif =
+                    System.currentTimeMillis() - getLastNotificationUpdateTimeMs(record);
 
             final String key = getChannelKey(record);
-            @PolitenessState int volState = getPolitenessState(record);
-
-            switch (volState) {
-                case POLITE_STATE_DEFAULT:
-                    if (timeSinceLastNotif < mTimeoutPolite) {
-                        volState = POLITE_STATE_MUTED;
-                    }
-                    break;
-                case POLITE_STATE_POLITE:
-                    if (timeSinceLastNotif > mTimeoutMuted) {
-                        volState = POLITE_STATE_DEFAULT;
-                    }
-                    break;
-                case POLITE_STATE_MUTED:
-                    if (timeSinceLastNotif > mTimeoutMuted) {
-                        volState = POLITE_STATE_DEFAULT;
-                    } else {
-                        volState = POLITE_STATE_POLITE;
-                    }
-                    break;
-                default:
-                    Log.w(TAG, "onNotificationPosted unexpected volume state: " + volState);
-                    break;
-            }
+            @PolitenessState final int currState = getPolitenessState(record);
+            @PolitenessState int nextState = getNextState(currState, timeSinceLastNotif);
 
             if (DEBUG) {
-                Log.i(TAG, "onNotificationPosted time delta: " + timeSinceLastNotif + " vol state: "
-                        + volState + " key: " + key);
+                Log.i(TAG, "StrategyGlobal onNotificationPosted time delta: " + timeSinceLastNotif
+                        + " vol state: " + nextState + " key: " + key);
             }
 
-            mVolumeStates.put(key, volState);
+            mVolumeStates.put(key, nextState);
+
+            mAppStrategy.onNotificationPosted(record);
+        }
+
+        @Override
+        public float getSoundVolume(final NotificationRecord record) {
+            final @PolitenessState int globalVolState = getPolitenessState(record);
+            final @PolitenessState int appVolState = mAppStrategy.getPolitenessState(record);
+
+            // Prioritize the most polite outcome
+            if (globalVolState > appVolState) {
+                return super.getSoundVolume(record);
+            } else {
+                return mAppStrategy.getSoundVolume(record);
+            }
+        }
+
+        @Override
+        public void onUserInteraction(final NotificationRecord record) {
+            super.onUserInteraction(record);
+            mAppStrategy.onUserInteraction(record);
+        }
+
+        @Override
+        String getChannelKey(final NotificationRecord record) {
+            // If the user explicitly changed the channel notification sound:
+            // handle as a separate channel
+            if (record.getChannel().hasUserSetSound()) {
+                return super.getChannelKey(record);
+            } else {
+                // Use one global key per user
+                return record.getSbn().getNormalizedUserId() + ":" + COMMON_KEY;
+            }
+        }
+
+        @Override
+        public void setLastNotificationUpdateTimeMs(NotificationRecord record,
+                long timestampMillis) {
+            super.setLastNotificationUpdateTimeMs(record, timestampMillis);
+            mLastNotificationTimestamp = timestampMillis;
+        }
+
+        long getLastNotificationUpdateTimeMs(final NotificationRecord record) {
+            if (record.getChannel().hasUserSetSound()) {
+                return super.getLastNotificationUpdateTimeMs(record);
+            } else {
+                return mLastNotificationTimestamp;
+            }
+        }
+
+        @Override
+        void setApplyCooldownPerPackage(boolean applyPerPackage) {
+            super.setApplyCooldownPerPackage(applyPerPackage);
+            mAppStrategy.setApplyCooldownPerPackage(applyPerPackage);
         }
     }
 
@@ -1338,7 +1433,7 @@
                     updateLightsLocked();
                 }
             }
-            if (mEnablePoliteNotificationsFeature) {
+            if (Flags.politeNotifications()) {
                 if (NOTIFICATION_COOLDOWN_ENABLED_URI.equals(uri)) {
                     mNotificationCooldownEnabled = Settings.System.getIntForUser(
                             mContext.getContentResolver(),
@@ -1363,13 +1458,16 @@
                             Settings.System.NOTIFICATION_COOLDOWN_ALL,
                             DEFAULT_NOTIFICATION_COOLDOWN_ALL, UserHandle.USER_CURRENT)
                             != 0;
+                    mStrategy.setApplyCooldownPerPackage(mNotificationCooldownApplyToAll);
                 }
-                if (NOTIFICATION_COOLDOWN_VIBRATE_UNLOCKED_URI.equals(uri)) {
-                    mNotificationCooldownVibrateUnlocked = Settings.System.getIntForUser(
+                if (Flags.vibrateWhileUnlocked()) {
+                    if (NOTIFICATION_COOLDOWN_VIBRATE_UNLOCKED_URI.equals(uri)) {
+                        mNotificationCooldownVibrateUnlocked = Settings.System.getIntForUser(
                             mContext.getContentResolver(),
                             Settings.System.NOTIFICATION_COOLDOWN_VIBRATE_UNLOCKED,
                             DEFAULT_NOTIFICATION_COOLDOWN_VIBRATE_UNLOCKED,
                             UserHandle.USER_CURRENT) != 0;
+                    }
                 }
             }
         }
diff --git a/services/core/java/com/android/server/notification/NotificationHistoryManager.java b/services/core/java/com/android/server/notification/NotificationHistoryManager.java
index 6a46048..e3880c3 100644
--- a/services/core/java/com/android/server/notification/NotificationHistoryManager.java
+++ b/services/core/java/com/android/server/notification/NotificationHistoryManager.java
@@ -118,6 +118,10 @@
         }
     }
 
+    public void onUserAdded(@UserIdInt int userId) {
+        mSettingsObserver.update(null, userId);
+    }
+
     public void onUserStopped(@UserIdInt int userId) {
         synchronized (mLock) {
             mUserUnlockedStates.put(userId, false);
@@ -401,9 +405,7 @@
                     false, this, UserHandle.USER_ALL);
             synchronized (mLock) {
                 for (UserInfo userInfo : mUserManager.getUsers()) {
-                    if (!userInfo.isProfile()) {
-                        update(null, userInfo.id);
-                    }
+                    update(null, userInfo.id);
                 }
             }
         }
@@ -424,10 +426,7 @@
                 boolean historyEnabled = Settings.Secure.getIntForUser(resolver,
                         Settings.Secure.NOTIFICATION_HISTORY_ENABLED, 0, userId)
                         != 0;
-                int[] profiles = mUserManager.getProfileIds(userId, true);
-                for (int profileId : profiles) {
-                    onHistoryEnabledChanged(profileId, historyEnabled);
-                }
+                onHistoryEnabledChanged(userId, historyEnabled);
             }
         }
     }
diff --git a/services/core/java/com/android/server/notification/NotificationManagerService.java b/services/core/java/com/android/server/notification/NotificationManagerService.java
index 7fbc085..9ed3559 100755
--- a/services/core/java/com/android/server/notification/NotificationManagerService.java
+++ b/services/core/java/com/android/server/notification/NotificationManagerService.java
@@ -2025,6 +2025,8 @@
                     if (!mUserProfiles.isProfileUser(userId)) {
                         allowDefaultApprovedServices(userId);
                     }
+                    mHistoryManager.onUserAdded(userId);
+                    mSettingsObserver.update(null, userId);
                 }
             } else if (action.equals(Intent.ACTION_USER_REMOVED)) {
                 final int userId = intent.getIntExtra(Intent.EXTRA_USER_HANDLE, USER_NULL);
@@ -2137,13 +2139,8 @@
                 mPreferencesHelper.updateBubblesEnabled();
             }
             if (uri == null || NOTIFICATION_HISTORY_ENABLED.equals(uri)) {
-                final IntArray userIds = mUserProfiles.getCurrentProfileIds();
-
-                for (int i = 0; i < userIds.size(); i++) {
-                    mArchive.updateHistoryEnabled(userIds.get(i),
-                            Settings.Secure.getIntForUser(resolver,
-                                    Settings.Secure.NOTIFICATION_HISTORY_ENABLED, 0,
-                                    userIds.get(i)) == 1);
+                for (UserInfo userInfo : mUm.getUsers()) {
+                    update(uri, userInfo.id);
                 }
             }
             if (uri == null || NOTIFICATION_SHOW_MEDIA_ON_QUICK_SETTINGS_URI.equals(uri)) {
@@ -2164,6 +2161,17 @@
                 }
             }
         }
+
+        public void update(Uri uri, int userId) {
+            ContentResolver resolver = getContext().getContentResolver();
+            if (uri == null || NOTIFICATION_HISTORY_ENABLED.equals(uri)) {
+                mArchive.updateHistoryEnabled(userId,
+                        Settings.Secure.getIntForUser(resolver,
+                                Settings.Secure.NOTIFICATION_HISTORY_ENABLED, 0,
+                                userId) == 1);
+                // note: this setting is also handled in NotificationHistoryManager
+            }
+        }
     }
 
     private SettingsObserver mSettingsObserver;
diff --git a/services/core/java/com/android/server/notification/ZenModeHelper.java b/services/core/java/com/android/server/notification/ZenModeHelper.java
index 3244aff..db64a75 100644
--- a/services/core/java/com/android/server/notification/ZenModeHelper.java
+++ b/services/core/java/com/android/server/notification/ZenModeHelper.java
@@ -893,48 +893,206 @@
     }
 
     void populateZenRule(String pkg, AutomaticZenRule automaticZenRule, ZenRule rule,
-            @ConfigChangeOrigin int origin, boolean isNew) {
-        // TODO: b/308671593,b/311406021 - Handle origins more precisely:
-        //  - USER can override anything and updates bitmask of user-modified fields;
-        //  - SYSTEM_OR_SYSTEMUI can override anything and preserves bitmask;
-        //  - APP can only update if not user-modified.
-        if (rule.enabled != automaticZenRule.isEnabled()) {
-            rule.snoozing = false;
-        }
-        rule.name = automaticZenRule.getName();
-        rule.condition = null;
-        rule.conditionId = automaticZenRule.getConditionId();
-        rule.enabled = automaticZenRule.isEnabled();
-        rule.modified = automaticZenRule.isModified();
-        rule.zenPolicy = automaticZenRule.getZenPolicy();
+                         @ConfigChangeOrigin int origin, boolean isNew) {
         if (Flags.modesApi()) {
-            rule.zenDeviceEffects = fixZenDeviceEffects(
-                    rule.zenDeviceEffects,
-                    automaticZenRule.getDeviceEffects(),
-                    origin);
-        }
-        rule.zenMode = NotificationManager.zenModeFromInterruptionFilter(
-                automaticZenRule.getInterruptionFilter(), Global.ZEN_MODE_OFF);
-        rule.configurationActivity = automaticZenRule.getConfigurationActivity();
+            // These values can always be edited by the app, so we apply changes immediately.
+            if (isNew) {
+                rule.id = ZenModeConfig.newRuleId();
+                rule.creationTime = System.currentTimeMillis();
+                rule.component = automaticZenRule.getOwner();
+                rule.pkg = pkg;
+            }
 
-        if (isNew) {
-            rule.id = ZenModeConfig.newRuleId();
-            rule.creationTime = System.currentTimeMillis();
-            rule.component = automaticZenRule.getOwner();
-            rule.pkg = pkg;
-        }
-
-        if (Flags.modesApi()) {
+            rule.condition = null;
+            rule.conditionId = automaticZenRule.getConditionId();
+            if (rule.enabled != automaticZenRule.isEnabled()) {
+                rule.snoozing = false;
+            }
+            rule.enabled = automaticZenRule.isEnabled();
+            rule.configurationActivity = automaticZenRule.getConfigurationActivity();
             rule.allowManualInvocation = automaticZenRule.isManualInvocationAllowed();
-            rule.iconResName = drawableResIdToResName(rule.pkg, automaticZenRule.getIconResId());
+            rule.iconResName =
+                    drawableResIdToResName(rule.pkg, automaticZenRule.getIconResId());
             rule.triggerDescription = automaticZenRule.getTriggerDescription();
             rule.type = automaticZenRule.getType();
+            // TODO: b/310620812 - Remove this once FLAG_MODES_API is inlined.
+            rule.modified = automaticZenRule.isModified();
+
+            // Name is treated differently than other values:
+            // App is allowed to update name if the name was not modified by the user (even if
+            // other values have been modified). In this way, if the locale of an app changes,
+            // i18n of the rule name can still occur even if the user has customized the rule
+            // contents.
+            String previousName = rule.name;
+            if (isNew || doesOriginAlwaysUpdateValues(origin)
+                    || (rule.userModifiedFields & AutomaticZenRule.FIELD_NAME) == 0) {
+                rule.name = automaticZenRule.getName();
+            }
+
+            // For the remaining values, rules can always have all values updated if:
+            // * the rule is newly added, or
+            // * the request comes from an origin that can always update values, like the user, or
+            // * the rule has not yet been user modified, and thus can be updated by the app.
+            boolean updateValues = isNew || doesOriginAlwaysUpdateValues(origin)
+                    || rule.canBeUpdatedByApp();
+
+            // For all other values, if updates are not allowed, we discard the update.
+            if (!updateValues) {
+                return;
+            }
+
+            // Updates the bitmasks if the origin of the change is the user.
+            boolean updateBitmask = (origin == UPDATE_ORIGIN_USER);
+
+            if (updateBitmask && !TextUtils.equals(previousName, automaticZenRule.getName())) {
+                rule.userModifiedFields |= AutomaticZenRule.FIELD_NAME;
+            }
+            int newZenMode = NotificationManager.zenModeFromInterruptionFilter(
+                    automaticZenRule.getInterruptionFilter(), Global.ZEN_MODE_OFF);
+            if (updateBitmask && rule.zenMode != newZenMode) {
+                rule.userModifiedFields |= AutomaticZenRule.FIELD_INTERRUPTION_FILTER;
+            }
+
+            // Updates the values in the ZenRule itself.
+            rule.zenMode = newZenMode;
+
+            // Updates the bitmask and values for all policy fields, based on the origin.
+            rule.zenPolicy = updatePolicy(rule.zenPolicy, automaticZenRule.getZenPolicy(),
+                    updateBitmask);
+            // Updates the bitmask and values for all device effect fields, based on the origin.
+            rule.zenDeviceEffects = updateZenDeviceEffects(
+                    rule.zenDeviceEffects, automaticZenRule.getDeviceEffects(),
+                    origin == UPDATE_ORIGIN_APP, updateBitmask);
+        } else {
+            if (rule.enabled != automaticZenRule.isEnabled()) {
+                rule.snoozing = false;
+            }
+            rule.name = automaticZenRule.getName();
+            rule.condition = null;
+            rule.conditionId = automaticZenRule.getConditionId();
+            rule.enabled = automaticZenRule.isEnabled();
+            rule.modified = automaticZenRule.isModified();
+            rule.zenPolicy = automaticZenRule.getZenPolicy();
+            if (Flags.modesApi()) {
+                rule.zenDeviceEffects = updateZenDeviceEffects(
+                        rule.zenDeviceEffects,
+                        automaticZenRule.getDeviceEffects(),
+                        origin == UPDATE_ORIGIN_APP,
+                        origin == UPDATE_ORIGIN_USER);
+            }
+            rule.zenMode = NotificationManager.zenModeFromInterruptionFilter(
+                    automaticZenRule.getInterruptionFilter(), Global.ZEN_MODE_OFF);
+            rule.configurationActivity = automaticZenRule.getConfigurationActivity();
+
+            if (isNew) {
+                rule.id = ZenModeConfig.newRuleId();
+                rule.creationTime = System.currentTimeMillis();
+                rule.component = automaticZenRule.getOwner();
+                rule.pkg = pkg;
+            }
         }
     }
 
     /**
-     * Fix {@link ZenDeviceEffects} that are being stored as part of a new or updated ZenRule.
-     *
+     * Returns true when fields can always be updated, based on the provided origin of an AZR
+     * change. (Note that regardless of origin, fields can always be updated if they're not already
+     * user modified.)
+     */
+    private static boolean doesOriginAlwaysUpdateValues(@ConfigChangeOrigin int origin) {
+        return origin == UPDATE_ORIGIN_USER || origin == UPDATE_ORIGIN_SYSTEM_OR_SYSTEMUI;
+    }
+
+    /**
+     * Modifies {@link ZenPolicy} that is being stored as part of a new or updated ZenRule.
+     * Returns a policy based on {@code oldPolicy}, but with fields updated to match
+     * {@code newPolicy} where they differ, and updating the internal user-modified bitmask to
+     * track these changes, if applicable based on {@code origin}.
+     */
+    @Nullable
+    private ZenPolicy updatePolicy(@Nullable ZenPolicy oldPolicy, @Nullable ZenPolicy newPolicy,
+                                   boolean updateBitmask) {
+        // If the update is to make the policy null, we don't need to update the bitmask,
+        // because it won't be stored anywhere anyway.
+        if (newPolicy == null) {
+            return null;
+        }
+
+        // If oldPolicy is null, we compare against the default policy when determining which
+        // fields in the bitmask should be marked as updated.
+        if (oldPolicy == null) {
+            oldPolicy = mDefaultConfig.toZenPolicy();
+        }
+
+        int userModifiedFields = oldPolicy.getUserModifiedFields();
+        if (updateBitmask) {
+            if (oldPolicy.getPriorityMessageSenders() != newPolicy.getPriorityMessageSenders()) {
+                userModifiedFields |= ZenPolicy.FIELD_MESSAGES;
+            }
+            if (oldPolicy.getPriorityCallSenders() != newPolicy.getPriorityCallSenders()) {
+                userModifiedFields |= ZenPolicy.FIELD_CALLS;
+            }
+            if (oldPolicy.getPriorityConversationSenders()
+                    != newPolicy.getPriorityConversationSenders()) {
+                userModifiedFields |= ZenPolicy.FIELD_CONVERSATIONS;
+            }
+            if (oldPolicy.getAllowedChannels() != newPolicy.getAllowedChannels()) {
+                userModifiedFields |= ZenPolicy.FIELD_ALLOW_CHANNELS;
+            }
+            if (oldPolicy.getPriorityCategoryReminders()
+                    != newPolicy.getPriorityCategoryReminders()) {
+                userModifiedFields |= ZenPolicy.FIELD_PRIORITY_CATEGORY_REMINDERS;
+            }
+            if (oldPolicy.getPriorityCategoryEvents() != newPolicy.getPriorityCategoryEvents()) {
+                userModifiedFields |= ZenPolicy.FIELD_PRIORITY_CATEGORY_EVENTS;
+            }
+            if (oldPolicy.getPriorityCategoryRepeatCallers()
+                    != newPolicy.getPriorityCategoryRepeatCallers()) {
+                userModifiedFields |= ZenPolicy.FIELD_PRIORITY_CATEGORY_REPEAT_CALLERS;
+            }
+            if (oldPolicy.getPriorityCategoryAlarms() != newPolicy.getPriorityCategoryAlarms()) {
+                userModifiedFields |= ZenPolicy.FIELD_PRIORITY_CATEGORY_ALARMS;
+            }
+            if (oldPolicy.getPriorityCategoryMedia() != newPolicy.getPriorityCategoryMedia()) {
+                userModifiedFields |= ZenPolicy.FIELD_PRIORITY_CATEGORY_MEDIA;
+            }
+            if (oldPolicy.getPriorityCategorySystem() != newPolicy.getPriorityCategorySystem()) {
+                userModifiedFields |= ZenPolicy.FIELD_PRIORITY_CATEGORY_SYSTEM;
+            }
+            // Visual effects
+            if (oldPolicy.getVisualEffectFullScreenIntent()
+                    != newPolicy.getVisualEffectFullScreenIntent()) {
+                userModifiedFields |= ZenPolicy.FIELD_VISUAL_EFFECT_FULL_SCREEN_INTENT;
+            }
+            if (oldPolicy.getVisualEffectLights() != newPolicy.getVisualEffectLights()) {
+                userModifiedFields |= ZenPolicy.FIELD_VISUAL_EFFECT_LIGHTS;
+            }
+            if (oldPolicy.getVisualEffectPeek() != newPolicy.getVisualEffectPeek()) {
+                userModifiedFields |= ZenPolicy.FIELD_VISUAL_EFFECT_PEEK;
+            }
+            if (oldPolicy.getVisualEffectStatusBar() != newPolicy.getVisualEffectStatusBar()) {
+                userModifiedFields |= ZenPolicy.FIELD_VISUAL_EFFECT_STATUS_BAR;
+            }
+            if (oldPolicy.getVisualEffectBadge() != newPolicy.getVisualEffectBadge()) {
+                userModifiedFields |= ZenPolicy.FIELD_VISUAL_EFFECT_BADGE;
+            }
+            if (oldPolicy.getVisualEffectAmbient() != newPolicy.getVisualEffectAmbient()) {
+                userModifiedFields |= ZenPolicy.FIELD_VISUAL_EFFECT_AMBIENT;
+            }
+            if (oldPolicy.getVisualEffectNotificationList()
+                    != newPolicy.getVisualEffectNotificationList()) {
+                userModifiedFields |= ZenPolicy.FIELD_VISUAL_EFFECT_NOTIFICATION_LIST;
+            }
+        }
+
+        // After all bitmask changes have been made, sets the bitmask.
+        return new ZenPolicy.Builder(newPolicy).setUserModifiedFields(userModifiedFields).build();
+    }
+
+    /**
+     * Modifies {@link ZenDeviceEffects} that are being stored as part of a new or updated ZenRule.
+     * Returns a {@link ZenDeviceEffects} based on {@code oldEffects}, but with fields updated to
+     * match {@code newEffects} where they differ, and updating the internal user-modified bitmask
+     * to track these changes, if applicable based on {@code origin}.
      * <ul>
      *     <li> Apps cannot turn on hidden effects (those tagged as {@code @hide}) since they are
      *     intended for platform-specific rules (e.g. wearables). If it's a new rule, we blank them
@@ -942,38 +1100,85 @@
      * </ul>
      */
     @Nullable
-    private static ZenDeviceEffects fixZenDeviceEffects(@Nullable ZenDeviceEffects oldEffects,
-            @Nullable ZenDeviceEffects newEffects, @ConfigChangeOrigin int origin) {
-        // TODO: b/308671593,b/311406021 - Handle origins more precisely:
-        //  - USER can override anything and updates bitmask of user-modified fields;
-        //  - SYSTEM_OR_SYSTEMUI can override anything and preserves bitmask;
-        //  - APP can only update if not user-modified.
-        if (origin != UPDATE_ORIGIN_APP) {
-            return newEffects;
-        }
-
+    private static ZenDeviceEffects updateZenDeviceEffects(@Nullable ZenDeviceEffects oldEffects,
+                                                           @Nullable ZenDeviceEffects newEffects,
+                                                           boolean isFromApp,
+                                                           boolean updateBitmask) {
         if (newEffects == null) {
             return null;
         }
-        if (oldEffects != null) {
-            return new ZenDeviceEffects.Builder(newEffects)
-                    .setShouldDisableAutoBrightness(oldEffects.shouldDisableAutoBrightness())
-                    .setShouldDisableTapToWake(oldEffects.shouldDisableTapToWake())
-                    .setShouldDisableTiltToWake(oldEffects.shouldDisableTiltToWake())
-                    .setShouldDisableTouch(oldEffects.shouldDisableTouch())
-                    .setShouldMinimizeRadioUsage(oldEffects.shouldMinimizeRadioUsage())
-                    .setShouldMaximizeDoze(oldEffects.shouldMaximizeDoze())
-                    .build();
-        } else {
-            return new ZenDeviceEffects.Builder(newEffects)
-                    .setShouldDisableAutoBrightness(false)
-                    .setShouldDisableTapToWake(false)
-                    .setShouldDisableTiltToWake(false)
-                    .setShouldDisableTouch(false)
-                    .setShouldMinimizeRadioUsage(false)
-                    .setShouldMaximizeDoze(false)
-                    .build();
+
+        // Since newEffects is not null, we want to adopt all the new provided device effects.
+        ZenDeviceEffects.Builder builder = new ZenDeviceEffects.Builder(newEffects);
+
+        if (isFromApp) {
+            if (oldEffects != null) {
+                // We can do this because we know we don't need to update the bitmask FROM_APP.
+                return builder
+                        .setShouldDisableAutoBrightness(oldEffects.shouldDisableAutoBrightness())
+                        .setShouldDisableTapToWake(oldEffects.shouldDisableTapToWake())
+                        .setShouldDisableTiltToWake(oldEffects.shouldDisableTiltToWake())
+                        .setShouldDisableTouch(oldEffects.shouldDisableTouch())
+                        .setShouldMinimizeRadioUsage(oldEffects.shouldMinimizeRadioUsage())
+                        .setShouldMaximizeDoze(oldEffects.shouldMaximizeDoze())
+                        .build();
+            } else {
+                return builder
+                        .setShouldDisableAutoBrightness(false)
+                        .setShouldDisableTapToWake(false)
+                        .setShouldDisableTiltToWake(false)
+                        .setShouldDisableTouch(false)
+                        .setShouldMinimizeRadioUsage(false)
+                        .setShouldMaximizeDoze(false)
+                        .build();
+            }
         }
+
+        // If oldEffects is null, we compare against the default device effects object when
+        // determining which fields in the bitmask should be marked as updated.
+        if (oldEffects == null) {
+            oldEffects = new ZenDeviceEffects.Builder().build();
+        }
+
+        int userModifiedFields = oldEffects.getUserModifiedFields();
+        if (updateBitmask) {
+            if (oldEffects.shouldDisplayGrayscale() != newEffects.shouldDisplayGrayscale()) {
+                userModifiedFields |= ZenDeviceEffects.FIELD_GRAYSCALE;
+            }
+            if (oldEffects.shouldSuppressAmbientDisplay()
+                    != newEffects.shouldSuppressAmbientDisplay()) {
+                userModifiedFields |= ZenDeviceEffects.FIELD_SUPPRESS_AMBIENT_DISPLAY;
+            }
+            if (oldEffects.shouldDimWallpaper() != newEffects.shouldDimWallpaper()) {
+                userModifiedFields |= ZenDeviceEffects.FIELD_DIM_WALLPAPER;
+            }
+            if (oldEffects.shouldUseNightMode() != newEffects.shouldUseNightMode()) {
+                userModifiedFields |= ZenDeviceEffects.FIELD_NIGHT_MODE;
+            }
+            if (oldEffects.shouldDisableAutoBrightness()
+                    != newEffects.shouldDisableAutoBrightness()) {
+                userModifiedFields |= ZenDeviceEffects.FIELD_DISABLE_AUTO_BRIGHTNESS;
+            }
+            if (oldEffects.shouldDisableTapToWake() != newEffects.shouldDisableTapToWake()) {
+                userModifiedFields |= ZenDeviceEffects.FIELD_DISABLE_TAP_TO_WAKE;
+            }
+            if (oldEffects.shouldDisableTiltToWake() != newEffects.shouldDisableTiltToWake()) {
+                userModifiedFields |= ZenDeviceEffects.FIELD_DISABLE_TILT_TO_WAKE;
+            }
+            if (oldEffects.shouldDisableTouch() != newEffects.shouldDisableTouch()) {
+                userModifiedFields |= ZenDeviceEffects.FIELD_DISABLE_TOUCH;
+            }
+            if (oldEffects.shouldMinimizeRadioUsage() != newEffects.shouldMinimizeRadioUsage()) {
+                userModifiedFields |= ZenDeviceEffects.FIELD_MINIMIZE_RADIO_USAGE;
+            }
+            if (oldEffects.shouldMaximizeDoze() != newEffects.shouldMaximizeDoze()) {
+                userModifiedFields |= ZenDeviceEffects.FIELD_MAXIMIZE_DOZE;
+            }
+        }
+
+        // Since newEffects is not null, we want to adopt all the new provided device effects.
+        // Set the usermodifiedFields value separately, to reflect the updated bitmask.
+        return builder.setUserModifiedFields(userModifiedFields).build();
     }
 
     private AutomaticZenRule zenRuleToAutomaticZenRule(ZenRule rule) {
@@ -992,6 +1197,7 @@
                     .setOwner(rule.component)
                     .setConfigurationActivity(rule.configurationActivity)
                     .setTriggerDescription(rule.triggerDescription)
+                    .setUserModifiedFields(rule.userModifiedFields)
                     .build();
         } else {
             azr = new AutomaticZenRule(rule.name, rule.component,
@@ -2023,6 +2229,7 @@
         if (resId == 0) {
             return null;
         }
+        Objects.requireNonNull(packageName);
         try {
             final Resources res = mPm.getResourcesForApplication(packageName);
             return res.getResourceName(resId);
diff --git a/services/core/java/com/android/server/notification/flags.aconfig b/services/core/java/com/android/server/notification/flags.aconfig
index 49db7fc..47967db 100644
--- a/services/core/java/com/android/server/notification/flags.aconfig
+++ b/services/core/java/com/android/server/notification/flags.aconfig
@@ -56,4 +56,11 @@
   namespace: "systemui"
   description: "When this flag is on, NMS will no longer call removeMessage() and hasCallbacks() on Handler"
   bug: "311051285"
+}
+
+flag {
+  name: "notification_test"
+  namespace: "systemui"
+  description: "Timing test, no functionality"
+  bug: "316931130"
 }
\ No newline at end of file
diff --git a/services/core/java/com/android/server/os/NativeTombstoneManager.java b/services/core/java/com/android/server/os/NativeTombstoneManager.java
index f6e7ef3..9ce3cb3 100644
--- a/services/core/java/com/android/server/os/NativeTombstoneManager.java
+++ b/services/core/java/com/android/server/os/NativeTombstoneManager.java
@@ -41,14 +41,13 @@
 import android.system.StructStat;
 import android.util.Slog;
 import android.util.SparseArray;
-import android.util.proto.ProtoInputStream;
-import android.util.proto.ProtoParseException;
 
 import com.android.internal.annotations.GuardedBy;
 import com.android.server.BootReceiver;
 import com.android.server.ServiceThread;
 import com.android.server.os.TombstoneProtos.Cause;
 import com.android.server.os.TombstoneProtos.Tombstone;
+import com.android.server.os.protobuf.CodedInputStream;
 
 import libcore.io.IoUtils;
 
@@ -130,18 +129,21 @@
             return;
         }
 
-        String processName = "UNKNOWN";
         final boolean isProtoFile = filename.endsWith(".pb");
-        File protoPath = isProtoFile ? path : new File(path.getAbsolutePath() + ".pb");
-
-        Optional<TombstoneFile> parsedTombstone = handleProtoTombstone(protoPath, isProtoFile);
-        if (parsedTombstone.isPresent()) {
-            processName = parsedTombstone.get().getProcessName();
+        if (!isProtoFile) {
+            return;
         }
-        BootReceiver.addTombstoneToDropBox(mContext, path, isProtoFile, processName, mTmpFileLock);
+
+        Optional<ParsedTombstone> parsedTombstone = handleProtoTombstone(path, true);
+        if (parsedTombstone.isPresent()) {
+            BootReceiver.addTombstoneToDropBox(
+                    mContext, path, parsedTombstone.get().getTombstone(),
+                    parsedTombstone.get().getProcessName(), mTmpFileLock);
+        }
     }
 
-    private Optional<TombstoneFile> handleProtoTombstone(File path, boolean addToList) {
+    private Optional<ParsedTombstone> handleProtoTombstone(
+            File path, boolean addToList) {
         final String filename = path.getName();
         if (!filename.endsWith(".pb")) {
             Slog.w(TAG, "unexpected tombstone name: " + path);
@@ -171,7 +173,7 @@
             return Optional.empty();
         }
 
-        final Optional<TombstoneFile> parsedTombstone = TombstoneFile.parse(pfd);
+        final Optional<ParsedTombstone> parsedTombstone = TombstoneFile.parse(pfd);
         if (!parsedTombstone.isPresent()) {
             IoUtils.closeQuietly(pfd);
             return Optional.empty();
@@ -184,7 +186,7 @@
                     previous.dispose();
                 }
 
-                mTombstones.put(number, parsedTombstone.get());
+                mTombstones.put(number, parsedTombstone.get().getTombstoneFile());
             }
         }
 
@@ -332,6 +334,27 @@
         }
     }
 
+    static class ParsedTombstone {
+        TombstoneFile mTombstoneFile;
+        Tombstone mTombstone;
+        ParsedTombstone(TombstoneFile tombstoneFile, Tombstone tombstone) {
+            mTombstoneFile = tombstoneFile;
+            mTombstone = tombstone;
+        }
+
+        public String getProcessName() {
+            return mTombstoneFile.getProcessName();
+        }
+
+        public TombstoneFile getTombstoneFile() {
+            return mTombstoneFile;
+        }
+
+        public Tombstone getTombstone() {
+            return mTombstone;
+        }
+    }
+
     static class TombstoneFile {
         final ParcelFileDescriptor mPfd;
 
@@ -414,67 +437,21 @@
             }
         }
 
-        static Optional<TombstoneFile> parse(ParcelFileDescriptor pfd) {
-            final FileInputStream is = new FileInputStream(pfd.getFileDescriptor());
-            final ProtoInputStream stream = new ProtoInputStream(is);
+        static Optional<ParsedTombstone> parse(ParcelFileDescriptor pfd) {
+            Tombstone tombstoneProto;
+            try (FileInputStream is = new FileInputStream(pfd.getFileDescriptor())) {
+                final byte[] tombstoneBytes = is.readAllBytes();
 
-            int pid = 0;
-            int uid = 0;
-            String processName = null;
-            String crashReason = "";
-            String selinuxLabel = "";
-
-            try {
-                while (stream.nextField() != ProtoInputStream.NO_MORE_FIELDS) {
-                    switch (stream.getFieldNumber()) {
-                        case (int) Tombstone.PID:
-                            pid = stream.readInt(Tombstone.PID);
-                            break;
-
-                        case (int) Tombstone.UID:
-                            uid = stream.readInt(Tombstone.UID);
-                            break;
-
-                        case (int) Tombstone.COMMAND_LINE:
-                            if (processName == null) {
-                                processName = stream.readString(Tombstone.COMMAND_LINE);
-                            }
-                            break;
-
-                        case (int) Tombstone.CAUSES:
-                            if (!crashReason.equals("")) {
-                                // Causes appear in decreasing order of likelihood. For now we only
-                                // want the most likely crash reason here, so ignore all others.
-                                break;
-                            }
-                            long token = stream.start(Tombstone.CAUSES);
-                        cause:
-                            while (stream.nextField() != ProtoInputStream.NO_MORE_FIELDS) {
-                                switch (stream.getFieldNumber()) {
-                                    case (int) Cause.HUMAN_READABLE:
-                                        crashReason = stream.readString(Cause.HUMAN_READABLE);
-                                        break cause;
-
-                                    default:
-                                        break;
-                                }
-                            }
-                            stream.end(token);
-                            break;
-
-                        case (int) Tombstone.SELINUX_LABEL:
-                            selinuxLabel = stream.readString(Tombstone.SELINUX_LABEL);
-                            break;
-
-                        default:
-                            break;
-                    }
-                }
-            } catch (IOException | ProtoParseException ex) {
+                tombstoneProto = Tombstone.parseFrom(
+                        CodedInputStream.newInstance(tombstoneBytes));
+            } catch (IOException ex) {
                 Slog.e(TAG, "Failed to parse tombstone", ex);
                 return Optional.empty();
             }
 
+            int pid = tombstoneProto.getPid();
+            int uid = tombstoneProto.getUid();
+
             if (!UserHandle.isApp(uid)) {
                 Slog.e(TAG, "Tombstone's UID (" + uid + ") not an app, ignoring");
                 return Optional.empty();
@@ -491,6 +468,7 @@
             final int userId = UserHandle.getUserId(uid);
             final int appId = UserHandle.getAppId(uid);
 
+            String selinuxLabel = tombstoneProto.getSelinuxLabel();
             if (!selinuxLabel.startsWith("u:r:untrusted_app")) {
                 Slog.e(TAG, "Tombstone has invalid selinux label (" + selinuxLabel + "), ignoring");
                 return Optional.empty();
@@ -502,11 +480,30 @@
             result.mAppId = appId;
             result.mPid = pid;
             result.mUid = uid;
-            result.mProcessName = processName == null ? "" : processName;
+            result.mProcessName = getCmdLineProcessName(tombstoneProto);
             result.mTimestampMs = timestampMs;
-            result.mCrashReason = crashReason;
+            result.mCrashReason = getCrashReason(tombstoneProto);
 
-            return Optional.of(result);
+            return Optional.of(new ParsedTombstone(result, tombstoneProto));
+        }
+
+        private static String getCmdLineProcessName(Tombstone tombstoneProto) {
+            for (String cmdline : tombstoneProto.getCommandLineList()) {
+                if (cmdline != null) {
+                    return cmdline;
+                }
+            }
+            return "";
+        }
+
+        private static String getCrashReason(Tombstone tombstoneProto) {
+            for (Cause cause : tombstoneProto.getCausesList()) {
+                if (cause.getHumanReadable() != null
+                        && !cause.getHumanReadable().equals("")) {
+                    return cause.getHumanReadable();
+                }
+            }
+            return "";
         }
 
         public IParcelFileDescriptorRetriever getPfdRetriever() {
diff --git a/services/core/java/com/android/server/pm/InstallPackageHelper.java b/services/core/java/com/android/server/pm/InstallPackageHelper.java
index 992d8eb..dd9541e 100644
--- a/services/core/java/com/android/server/pm/InstallPackageHelper.java
+++ b/services/core/java/com/android/server/pm/InstallPackageHelper.java
@@ -175,6 +175,7 @@
 import com.android.server.art.model.ArtFlags;
 import com.android.server.art.model.DexoptParams;
 import com.android.server.art.model.DexoptResult;
+import com.android.server.criticalevents.CriticalEventLog;
 import com.android.server.pm.Installer.LegacyDexoptDisabledException;
 import com.android.server.pm.dex.ArtManagerService;
 import com.android.server.pm.dex.DexManager;
@@ -957,6 +958,7 @@
         final Set<String> scannedPackages = new ArraySet<>(requests.size());
         final Map<String, Settings.VersionInfo> versionInfos = new ArrayMap<>(requests.size());
         final Map<String, Boolean> createdAppId = new ArrayMap<>(requests.size());
+        CriticalEventLog.getInstance().logInstallPackagesStarted();
         boolean success = false;
         try {
             Trace.traceBegin(TRACE_TAG_PACKAGE_MANAGER, "installPackagesLI");
diff --git a/services/core/java/com/android/server/pm/PackageArchiver.java b/services/core/java/com/android/server/pm/PackageArchiver.java
index 376b061..a4af5e7 100644
--- a/services/core/java/com/android/server/pm/PackageArchiver.java
+++ b/services/core/java/com/android/server/pm/PackageArchiver.java
@@ -27,6 +27,7 @@
 import static android.content.pm.PackageInstaller.EXTRA_UNARCHIVE_STATUS;
 import static android.content.pm.PackageInstaller.STATUS_PENDING_USER_ACTION;
 import static android.content.pm.PackageInstaller.UNARCHIVAL_OK;
+import static android.content.pm.PackageInstaller.UNARCHIVAL_STATUS_UNSET;
 import static android.content.pm.PackageManager.DELETE_ARCHIVE;
 import static android.content.pm.PackageManager.DELETE_KEEP_DATA;
 import static android.content.pm.PackageManager.INSTALL_UNARCHIVE_DRAFT;
@@ -100,6 +101,7 @@
 import java.util.List;
 import java.util.Map;
 import java.util.Objects;
+import java.util.Set;
 import java.util.concurrent.CompletableFuture;
 
 /**
@@ -210,7 +212,6 @@
                                 return;
                             }
 
-                            // TODO(b/278553670) Add special strings for the delete dialog
                             mPm.mInstallerService.uninstall(
                                     new VersionedPackage(packageName,
                                             PackageManager.VERSION_CODE_HIGHEST),
@@ -264,7 +265,7 @@
         try {
             // TODO(b/311709794) Make showUnarchivalConfirmation dependent on the compat options.
             requestUnarchive(packageName, callerPackageName,
-                    getOrCreateUnarchiveIntentSender(userId, packageName),
+                    getOrCreateLauncherListener(userId, packageName),
                     UserHandle.of(userId),
                     false /* showUnarchivalConfirmation= */);
         } catch (Throwable t) {
@@ -329,7 +330,7 @@
         return true;
     }
 
-    private IntentSender getOrCreateUnarchiveIntentSender(int userId, String packageName) {
+    private IntentSender getOrCreateLauncherListener(int userId, String packageName) {
         Pair<Integer, String> key = Pair.create(userId, packageName);
         synchronized (mLauncherIntentSenders) {
             IntentSender intentSender = mLauncherIntentSenders.get(key);
@@ -515,7 +516,6 @@
     /**
      * Returns true if the app is archivable.
      */
-    // TODO(b/299299569) Exclude system apps
     public boolean isAppArchivable(@NonNull String packageName, @NonNull UserHandle user) {
         Objects.requireNonNull(packageName);
         Objects.requireNonNull(user);
@@ -685,15 +685,14 @@
                 PackageInstaller.SessionParams.MODE_FULL_INSTALL);
         sessionParams.setAppPackageName(packageName);
         sessionParams.installFlags = INSTALL_UNARCHIVE_DRAFT;
-        sessionParams.unarchiveIntentSender = statusReceiver;
 
         int installerUid = mPm.snapshotComputer().getPackageUid(installerPackage, 0, userId);
         // Handles case of repeated unarchival calls for the same package.
-        // TODO(b/316881759) Allow attaching multiple intentSenders to one session.
         int existingSessionId = mPm.mInstallerService.getExistingDraftSessionId(installerUid,
                 sessionParams,
                 userId);
         if (existingSessionId != PackageInstaller.SessionInfo.INVALID_ID) {
+            attachListenerToSession(statusReceiver, existingSessionId, userId);
             return existingSessionId;
         }
 
@@ -702,12 +701,34 @@
                 installerPackage, mContext.getAttributionTag(),
                 installerUid,
                 userId);
+        attachListenerToSession(statusReceiver, sessionId, userId);
+
         // TODO(b/297358628) Also cleanup sessions upon device restart.
         mPm.mHandler.postDelayed(() -> mPm.mInstallerService.cleanupDraftIfUnclaimed(sessionId),
                 getUnarchiveForegroundTimeout());
         return sessionId;
     }
 
+    private void attachListenerToSession(IntentSender statusReceiver, int existingSessionId,
+            int userId) {
+        PackageInstallerSession session = mPm.mInstallerService.getSession(existingSessionId);
+        int status = session.getUnarchivalStatus();
+        // Here we handle a race condition that might happen when an installer reports UNARCHIVAL_OK
+        // but hasn't created a session yet. Without this the listener would never receive a success
+        // response.
+        if (status == UNARCHIVAL_OK) {
+            notifyUnarchivalListener(UNARCHIVAL_OK, session.getInstallerPackageName(),
+                    session.params.appPackageName, /* requiredStorageBytes= */ 0,
+                    /* userActionIntent= */ null, Set.of(statusReceiver), userId);
+            return;
+        } else if (status != UNARCHIVAL_STATUS_UNSET) {
+            throw new IllegalStateException(TextUtils.formatSimple("Session %s has unarchive status"
+                    + "%s but is still active.", session.sessionId, status));
+        }
+
+        session.registerUnarchivalListener(statusReceiver);
+    }
+
     /**
      * Returns the icon of an archived app. This is the icon of the main activity of the app.
      *
@@ -883,13 +904,7 @@
 
     void notifyUnarchivalListener(int status, String installerPackageName, String appPackageName,
             long requiredStorageBytes, @Nullable PendingIntent userActionIntent,
-            @Nullable IntentSender unarchiveIntentSender, int userId) {
-        if (unarchiveIntentSender == null) {
-            // Maybe this can happen if the installer calls reportUnarchivalStatus twice in quick
-            // succession.
-            return;
-        }
-
+            Set<IntentSender> unarchiveIntentSenders, int userId) {
         final Intent broadcastIntent = new Intent();
         broadcastIntent.putExtra(PackageInstaller.EXTRA_PACKAGE_NAME, appPackageName);
         broadcastIntent.putExtra(EXTRA_UNARCHIVE_STATUS, status);
@@ -909,15 +924,16 @@
         final BroadcastOptions options = BroadcastOptions.makeBasic();
         options.setPendingIntentBackgroundActivityStartMode(
                 MODE_BACKGROUND_ACTIVITY_START_DENIED);
-        try {
-            unarchiveIntentSender.sendIntent(mContext, 0, broadcastIntent, /* onFinished= */ null,
-                    /* handler= */ null, /* requiredPermission= */ null,
-                    options.toBundle());
-        } catch (IntentSender.SendIntentException e) {
-            Slog.e(TAG, TextUtils.formatSimple("Failed to send unarchive intent"), e);
-        } finally {
-            synchronized (mLauncherIntentSenders) {
-                mLauncherIntentSenders.remove(Pair.create(userId, appPackageName));
+        for (IntentSender intentSender : unarchiveIntentSenders) {
+            try {
+                intentSender.sendIntent(mContext, 0, broadcastIntent, /* onFinished= */ null,
+                        /* handler= */ null, /* requiredPermission= */ null, options.toBundle());
+            } catch (IntentSender.SendIntentException e) {
+                Slog.e(TAG, TextUtils.formatSimple("Failed to send unarchive intent"), e);
+            } finally {
+                synchronized (mLauncherIntentSenders) {
+                    mLauncherIntentSenders.remove(Pair.create(userId, appPackageName));
+                }
             }
         }
     }
diff --git a/services/core/java/com/android/server/pm/PackageInstallerService.java b/services/core/java/com/android/server/pm/PackageInstallerService.java
index cbd65a4..a9118d4 100644
--- a/services/core/java/com/android/server/pm/PackageInstallerService.java
+++ b/services/core/java/com/android/server/pm/PackageInstallerService.java
@@ -291,9 +291,7 @@
     @NonNull
     private final RequestThrottle mSettingsWriteRequest = new RequestThrottle(IoThread.getHandler(),
             () -> {
-                synchronized (mSessions) {
-                    return writeSessionsLocked();
-                }
+                return writeSessions();
             });
 
     public PackageInstallerService(Context context, PackageManagerService pm,
@@ -600,9 +598,16 @@
                 mHistoricalSessionsByInstaller.get(installerUid) + 1);
     }
 
-    @GuardedBy("mSessions")
-    private boolean writeSessionsLocked() {
-        if (LOGD) Slog.v(TAG, "writeSessionsLocked()");
+    private boolean writeSessions() {
+        if (LOGD) Slog.v(TAG, "writeSessions()");
+        final PackageInstallerSession[] sessions;
+        synchronized (mSessions) {
+            final int size = mSessions.size();
+            sessions = new PackageInstallerSession[size];
+            for (int i = 0; i < size; i++) {
+                sessions[i] = mSessions.valueAt(i);
+            }
+        }
 
         FileOutputStream fos = null;
         try {
@@ -611,9 +616,7 @@
             final TypedXmlSerializer out = Xml.resolveSerializer(fos);
             out.startDocument(null, true);
             out.startTag(null, TAG_SESSIONS);
-            final int size = mSessions.size();
-            for (int i = 0; i < size; i++) {
-                final PackageInstallerSession session = mSessions.valueAt(i);
+            for (var session : sessions) {
                 session.write(out, mSessionsDir);
             }
             out.endTag(null, TAG_SESSIONS);
@@ -1756,26 +1759,8 @@
                         binderUid, unarchiveId));
             }
 
-            IntentSender unarchiveIntentSender = session.params.unarchiveIntentSender;
-            if (unarchiveIntentSender == null) {
-                throw new IllegalStateException(
-                        TextUtils.formatSimple(
-                                "Unarchival status for ID %s has already been set or a "
-                                        + "session has been created for it already by the "
-                                        + "caller.",
-                                unarchiveId));
-            }
-
-            // Execute expensive calls outside the sync block.
-            mPm.mHandler.post(
-                    () -> mPackageArchiver.notifyUnarchivalListener(status,
-                            session.getInstallerPackageName(),
-                            session.params.appPackageName, requiredStorageBytes, userActionIntent,
-                            unarchiveIntentSender, userId));
-            session.params.unarchiveIntentSender = null;
-            if (status != UNARCHIVAL_OK) {
-                Binder.withCleanCallingIdentity(session::abandon);
-            }
+            session.reportUnarchivalStatus(unarchiveId, status, requiredStorageBytes,
+                    userActionIntent);
         }
     }
 
diff --git a/services/core/java/com/android/server/pm/PackageInstallerSession.java b/services/core/java/com/android/server/pm/PackageInstallerSession.java
index 4adb60c..117d03f 100644
--- a/services/core/java/com/android/server/pm/PackageInstallerSession.java
+++ b/services/core/java/com/android/server/pm/PackageInstallerSession.java
@@ -22,6 +22,8 @@
 import static android.content.pm.DataLoaderType.INCREMENTAL;
 import static android.content.pm.DataLoaderType.STREAMING;
 import static android.content.pm.PackageInstaller.LOCATION_DATA_APP;
+import static android.content.pm.PackageInstaller.UNARCHIVAL_OK;
+import static android.content.pm.PackageInstaller.UNARCHIVAL_STATUS_UNSET;
 import static android.content.pm.PackageItemInfo.MAX_SAFE_LABEL_LENGTH;
 import static android.content.pm.PackageManager.INSTALL_FAILED_ABORTED;
 import static android.content.pm.PackageManager.INSTALL_FAILED_BAD_SIGNATURE;
@@ -65,6 +67,7 @@
 import android.app.BroadcastOptions;
 import android.app.Notification;
 import android.app.NotificationManager;
+import android.app.PendingIntent;
 import android.app.admin.DevicePolicyEventLogger;
 import android.app.admin.DevicePolicyManager;
 import android.app.admin.DevicePolicyManagerInternal;
@@ -97,6 +100,7 @@
 import android.content.pm.PackageInstaller.PreapprovalDetails;
 import android.content.pm.PackageInstaller.SessionInfo;
 import android.content.pm.PackageInstaller.SessionParams;
+import android.content.pm.PackageInstaller.UnarchivalStatus;
 import android.content.pm.PackageInstaller.UserActionReason;
 import android.content.pm.PackageManager;
 import android.content.pm.PackageManager.PackageInfoFlags;
@@ -771,6 +775,10 @@
     private final List<String> mResolvedInstructionSets = new ArrayList<>();
     @GuardedBy("mLock")
     private final List<String> mResolvedNativeLibPaths = new ArrayList<>();
+
+    @GuardedBy("mLock")
+    private final Set<IntentSender> mUnarchivalListeners = new ArraySet<>();
+
     @GuardedBy("mLock")
     private File mInheritedFilesBase;
     @GuardedBy("mLock")
@@ -796,6 +804,9 @@
     @GuardedBy("mLock")
     private int mValidatedTargetSdk = INVALID_TARGET_SDK_VERSION;
 
+    @UnarchivalStatus
+    private int mUnarchivalStatus = UNARCHIVAL_STATUS_UNSET;
+
     private static final FileFilter sAddedApkFilter = new FileFilter() {
         @Override
         public boolean accept(File file) {
@@ -5088,6 +5099,44 @@
         }
     }
 
+    void registerUnarchivalListener(IntentSender intentSender) {
+        synchronized (mLock) {
+            this.mUnarchivalListeners.add(intentSender);
+        }
+    }
+
+    Set<IntentSender> getUnarchivalListeners() {
+        synchronized (mLock) {
+            return new ArraySet<>(mUnarchivalListeners);
+        }
+    }
+
+    void reportUnarchivalStatus(@UnarchivalStatus int status, int unarchiveId,
+            long requiredStorageBytes, PendingIntent userActionIntent) {
+        if (getUnarchivalStatus() != UNARCHIVAL_STATUS_UNSET) {
+            throw new IllegalStateException(
+                    TextUtils.formatSimple(
+                            "Unarchival status for ID %s has already been set or a session has "
+                                    + "been created for it already by the caller.",
+                            unarchiveId));
+        }
+        mUnarchivalStatus = status;
+
+        // Execute expensive calls outside the sync block.
+        mPm.mHandler.post(
+                () -> mPm.mInstallerService.mPackageArchiver.notifyUnarchivalListener(status,
+                        getInstallerPackageName(), params.appPackageName, requiredStorageBytes,
+                        userActionIntent, getUnarchivalListeners(), userId));
+        if (status != UNARCHIVAL_OK) {
+            Binder.withCleanCallingIdentity(this::abandon);
+        }
+    }
+
+    @UnarchivalStatus
+    int getUnarchivalStatus() {
+        return this.mUnarchivalStatus;
+    }
+
     /**
      * Free up storage used by this session and its children.
      * Must not be called on a child session.
diff --git a/services/core/java/com/android/server/pm/PackageMonitorCallbackHelper.java b/services/core/java/com/android/server/pm/PackageMonitorCallbackHelper.java
index d05e4c6..cf5de89 100644
--- a/services/core/java/com/android/server/pm/PackageMonitorCallbackHelper.java
+++ b/services/core/java/com/android/server/pm/PackageMonitorCallbackHelper.java
@@ -48,6 +48,7 @@
 class PackageMonitorCallbackHelper {
 
     private static final boolean DEBUG = false;
+    private static final String TAG = "PackageMonitorCallbackHelper";
 
     @NonNull
     private final Object mLock = new Object();
@@ -243,25 +244,33 @@
                 return;
             }
             int registerUid = registerUser.getUid();
+            if (allowUids != null && registerUid != Process.SYSTEM_UID
+                    && !ArrayUtils.contains(allowUids, registerUid)) {
+                if (DEBUG) {
+                    Slog.w(TAG, "Skip invoke PackageMonitorCallback for " + intent.getAction()
+                            + ", uid " + registerUid);
+                }
+                return;
+            }
+            Intent newIntent = intent;
             if (filterExtrasFunction != null) {
                 final Bundle extras = intent.getExtras();
                 if (extras != null) {
                     final Bundle filteredExtras = filterExtrasFunction.apply(registerUid, extras);
-                    if (filteredExtras != null) {
-                        intent.replaceExtras(filteredExtras);
+                    if (filteredExtras == null) {
+                        // caller is unable to access this intent
+                        if (DEBUG) {
+                            Slog.w(TAG,
+                                    "Skip invoke PackageMonitorCallback for " + intent.getAction()
+                                            + " because null filteredExtras");
+                        }
+                        return;
                     }
+                    newIntent = new Intent(newIntent);
+                    newIntent.replaceExtras(filteredExtras);
                 }
             }
-            if (allowUids != null && registerUid != Process.SYSTEM_UID
-                    && !ArrayUtils.contains(allowUids, registerUid)) {
-                if (DEBUG) {
-                    Slog.w("PackageMonitorCallbackHelper",
-                            "Skip invoke PackageMonitorCallback for " + intent.getAction()
-                                    + ", uid " + registerUid);
-                }
-                return;
-            }
-            invokeCallback(callback, intent);
+            invokeCallback(callback, newIntent);
         }));
     }
 
diff --git a/services/core/java/com/android/server/pm/verify/domain/proxy/DomainVerificationProxyV1.java b/services/core/java/com/android/server/pm/verify/domain/proxy/DomainVerificationProxyV1.java
index 752eb53..17c901e 100644
--- a/services/core/java/com/android/server/pm/verify/domain/proxy/DomainVerificationProxyV1.java
+++ b/services/core/java/com/android/server/pm/verify/domain/proxy/DomainVerificationProxyV1.java
@@ -254,6 +254,14 @@
             String packageName = verifications.valueAt(index).second;
             AndroidPackage pkg = mConnection.getPackage(packageName);
 
+            if (pkg == null) {
+                if (DEBUG_BROADCASTS) {
+                    Slog.d(TAG,
+                            "Skip sendBroadcasts because null AndroidPackage for " + packageName);
+                }
+                continue;
+            }
+
             String hostsString = buildHostsString(pkg);
 
             Intent intent = new Intent(Intent.ACTION_INTENT_FILTER_NEEDS_VERIFICATION)
diff --git a/services/core/java/com/android/server/policy/Android.bp b/services/core/java/com/android/server/policy/Android.bp
new file mode 100644
index 0000000..fa55bf0
--- /dev/null
+++ b/services/core/java/com/android/server/policy/Android.bp
@@ -0,0 +1,10 @@
+aconfig_declarations {
+    name: "policy_flags",
+    package: "com.android.server.policy",
+    srcs: ["*.aconfig"],
+}
+
+java_aconfig_library {
+    name: "policy_flags_lib",
+    aconfig_declarations: "policy_flags",
+}
diff --git a/services/core/java/com/android/server/policy/PhoneWindowManager.java b/services/core/java/com/android/server/policy/PhoneWindowManager.java
index f651dbf..bf669fb 100644
--- a/services/core/java/com/android/server/policy/PhoneWindowManager.java
+++ b/services/core/java/com/android/server/policy/PhoneWindowManager.java
@@ -1301,7 +1301,7 @@
                     Settings.Global.putInt(mContext.getContentResolver(),
                             Settings.Global.THEATER_MODE_ON, 0);
                     if (!interactive) {
-                        wakeUpFromWakeKey(eventTime, KEYCODE_POWER);
+                        wakeUpFromWakeKey(eventTime, KEYCODE_POWER, /* isDown= */ false);
                     }
                 } else {
                     Slog.i(TAG, "Toggling theater mode on.");
@@ -1317,7 +1317,7 @@
             case MULTI_PRESS_POWER_BRIGHTNESS_BOOST:
                 Slog.i(TAG, "Starting brightness boost.");
                 if (!interactive) {
-                    wakeUpFromWakeKey(eventTime, KEYCODE_POWER);
+                    wakeUpFromWakeKey(eventTime, KEYCODE_POWER, /* isDown= */ false);
                 }
                 mPowerManager.boostScreenBrightness(eventTime);
                 break;
@@ -5185,7 +5185,8 @@
     public int interceptMotionBeforeQueueingNonInteractive(int displayId, int source, int action,
             long whenNanos, int policyFlags) {
         if ((policyFlags & FLAG_WAKE) != 0) {
-            if (mWindowWakeUpPolicy.wakeUpFromMotion(whenNanos / 1000000)) {
+            if (mWindowWakeUpPolicy.wakeUpFromMotion(
+                        whenNanos / 1000000, source, action == MotionEvent.ACTION_DOWN)) {
                 // Woke up. Pass motion events to user.
                 return ACTION_PASS_TO_USER;
             }
@@ -5199,7 +5200,8 @@
         // there will be no dream to intercept the touch and wake into ambient.  The device should
         // wake up in this case.
         if (isTheaterModeEnabled() && (policyFlags & FLAG_WAKE) != 0) {
-            if (mWindowWakeUpPolicy.wakeUpFromMotion(whenNanos / 1000000)) {
+            if (mWindowWakeUpPolicy.wakeUpFromMotion(
+                        whenNanos / 1000000, source, action == MotionEvent.ACTION_DOWN)) {
                 // Woke up. Pass motion events to user.
                 return ACTION_PASS_TO_USER;
             }
@@ -5534,11 +5536,14 @@
     }
 
     private void wakeUpFromWakeKey(KeyEvent event) {
-        wakeUpFromWakeKey(event.getEventTime(), event.getKeyCode());
+        wakeUpFromWakeKey(
+                event.getEventTime(),
+                event.getKeyCode(),
+                event.getAction() == KeyEvent.ACTION_DOWN);
     }
 
-    private void wakeUpFromWakeKey(long eventTime, int keyCode) {
-        if (mWindowWakeUpPolicy.wakeUpFromKey(eventTime, keyCode)) {
+    private void wakeUpFromWakeKey(long eventTime, int keyCode, boolean isDown) {
+        if (mWindowWakeUpPolicy.wakeUpFromKey(eventTime, keyCode, isDown)) {
             final boolean keyCanLaunchHome = keyCode == KEYCODE_HOME || keyCode == KEYCODE_POWER;
             // Start HOME with "reason" extra if sleeping for more than mWakeUpToLastStateTimeout
             if (shouldWakeUpWithHomeIntent() &&  keyCanLaunchHome) {
diff --git a/services/core/java/com/android/server/policy/WindowWakeUpPolicy.java b/services/core/java/com/android/server/policy/WindowWakeUpPolicy.java
index 392d0d4..a790950 100644
--- a/services/core/java/com/android/server/policy/WindowWakeUpPolicy.java
+++ b/services/core/java/com/android/server/policy/WindowWakeUpPolicy.java
@@ -24,6 +24,9 @@
 import static android.os.PowerManager.WAKE_REASON_WAKE_MOTION;
 import static android.view.KeyEvent.KEYCODE_POWER;
 
+import static com.android.server.policy.Flags.supportInputWakeupDelegate;
+
+import android.annotation.Nullable;
 import android.content.Context;
 import android.content.res.Resources;
 import android.os.PowerManager;
@@ -31,7 +34,11 @@
 import android.os.SystemClock;
 import android.provider.Settings;
 import android.util.Slog;
+import android.view.KeyEvent;
 
+import com.android.internal.annotations.VisibleForTesting;
+import com.android.internal.os.Clock;
+import com.android.server.LocalServices;
 
 /** Policy controlling the decision and execution of window-related wake ups. */
 class WindowWakeUpPolicy {
@@ -41,18 +48,27 @@
 
     private final Context mContext;
     private final PowerManager mPowerManager;
+    private final Clock mClock;
 
     private final boolean mAllowTheaterModeWakeFromKey;
     private final boolean mAllowTheaterModeWakeFromPowerKey;
     private final boolean mAllowTheaterModeWakeFromMotion;
-    private final boolean mAllowTheaterModeWakeFromMotionWhenNotDreaming;
     private final boolean mAllowTheaterModeWakeFromCameraLens;
     private final boolean mAllowTheaterModeWakeFromLidSwitch;
     private final boolean mAllowTheaterModeWakeFromWakeGesture;
 
+    // The policy will handle input-based wake ups if this delegate is null.
+    @Nullable private WindowWakeUpPolicyInternal.InputWakeUpDelegate mInputWakeUpDelegate;
+
     WindowWakeUpPolicy(Context context) {
+        this(context, Clock.SYSTEM_CLOCK);
+    }
+
+    @VisibleForTesting
+    WindowWakeUpPolicy(Context context, Clock clock) {
         mContext = context;
         mPowerManager = context.getSystemService(PowerManager.class);
+        mClock = clock;
 
         final Resources res = context.getResources();
         mAllowTheaterModeWakeFromKey = res.getBoolean(
@@ -62,14 +78,26 @@
                     com.android.internal.R.bool.config_allowTheaterModeWakeFromPowerKey);
         mAllowTheaterModeWakeFromMotion = res.getBoolean(
                 com.android.internal.R.bool.config_allowTheaterModeWakeFromMotion);
-        mAllowTheaterModeWakeFromMotionWhenNotDreaming = res.getBoolean(
-                com.android.internal.R.bool.config_allowTheaterModeWakeFromMotionWhenNotDreaming);
         mAllowTheaterModeWakeFromCameraLens = res.getBoolean(
                 com.android.internal.R.bool.config_allowTheaterModeWakeFromCameraLens);
         mAllowTheaterModeWakeFromLidSwitch = res.getBoolean(
                 com.android.internal.R.bool.config_allowTheaterModeWakeFromLidSwitch);
         mAllowTheaterModeWakeFromWakeGesture = res.getBoolean(
                 com.android.internal.R.bool.config_allowTheaterModeWakeFromGesture);
+        if (supportInputWakeupDelegate()) {
+            LocalServices.addService(WindowWakeUpPolicyInternal.class, new LocalService());
+        }
+    }
+
+    private final class LocalService implements WindowWakeUpPolicyInternal {
+        @Override
+        public void setInputWakeUpDelegate(@Nullable InputWakeUpDelegate delegate) {
+            if (!supportInputWakeupDelegate()) {
+                Slog.w(TAG, "Input wake up delegates not supported.");
+                return;
+            }
+            mInputWakeUpDelegate = delegate;
+        }
     }
 
     /**
@@ -77,31 +105,49 @@
      *
      * @param eventTime the timestamp of the event in {@link SystemClock#uptimeMillis()}.
      * @param keyCode the {@link android.view.KeyEvent} key code of the key event.
+     * @param isDown {@code true} if the event's action is {@link KeyEvent#ACTION_DOWN}.
      * @return {@code true} if the policy allows the requested wake up and the request has been
      *      executed; {@code false} otherwise.
      */
-    boolean wakeUpFromKey(long eventTime, int keyCode) {
+    boolean wakeUpFromKey(long eventTime, int keyCode, boolean isDown) {
         final boolean wakeAllowedDuringTheaterMode =
                 keyCode == KEYCODE_POWER
                         ? mAllowTheaterModeWakeFromPowerKey
                         : mAllowTheaterModeWakeFromKey;
-        return wakeUp(
+        if (!canWakeUp(wakeAllowedDuringTheaterMode)) {
+            if (DEBUG) Slog.d(TAG, "Unable to wake up from " + KeyEvent.keyCodeToString(keyCode));
+            return false;
+        }
+        if (mInputWakeUpDelegate != null
+                && mInputWakeUpDelegate.wakeUpFromKey(eventTime, keyCode, isDown)) {
+            return true;
+        }
+        wakeUp(
                 eventTime,
-                wakeAllowedDuringTheaterMode,
                 keyCode == KEYCODE_POWER ? WAKE_REASON_POWER_BUTTON : WAKE_REASON_WAKE_KEY,
                 keyCode == KEYCODE_POWER ? "POWER" : "KEY");
+        return true;
     }
 
     /**
      * Wakes up from a motion event.
      *
      * @param eventTime the timestamp of the event in {@link SystemClock#uptimeMillis()}.
+     * @param isDown {@code true} if the event's action is {@link MotionEvent#ACTION_DOWN}.
      * @return {@code true} if the policy allows the requested wake up and the request has been
      *      executed; {@code false} otherwise.
      */
-    boolean wakeUpFromMotion(long eventTime) {
-        return wakeUp(
-                eventTime, mAllowTheaterModeWakeFromMotion, WAKE_REASON_WAKE_MOTION, "MOTION");
+    boolean wakeUpFromMotion(long eventTime, int source, boolean isDown) {
+        if (!canWakeUp(mAllowTheaterModeWakeFromMotion)) {
+            if (DEBUG) Slog.d(TAG, "Unable to wake up from motion.");
+            return false;
+        }
+        if (mInputWakeUpDelegate != null
+                && mInputWakeUpDelegate.wakeUpFromMotion(eventTime, source, isDown)) {
+            return true;
+        }
+        wakeUp(eventTime, WAKE_REASON_WAKE_MOTION, "MOTION");
+        return true;
     }
 
     /**
@@ -112,11 +158,12 @@
      *      executed; {@code false} otherwise.
      */
     boolean wakeUpFromCameraCover(long eventTime) {
-        return wakeUp(
-                eventTime,
-                mAllowTheaterModeWakeFromCameraLens,
-                WAKE_REASON_CAMERA_LAUNCH,
-                "CAMERA_COVER");
+        if (!canWakeUp(mAllowTheaterModeWakeFromCameraLens)) {
+            if (DEBUG) Slog.d(TAG, "Unable to wake up from camera cover.");
+            return false;
+        }
+        wakeUp(eventTime, WAKE_REASON_CAMERA_LAUNCH, "CAMERA_COVER");
+        return true;
     }
 
     /**
@@ -126,11 +173,12 @@
      *      executed; {@code false} otherwise.
      */
     boolean wakeUpFromLid() {
-        return wakeUp(
-                SystemClock.uptimeMillis(),
-                mAllowTheaterModeWakeFromLidSwitch,
-                WAKE_REASON_LID,
-                "LID");
+        if (!canWakeUp(mAllowTheaterModeWakeFromLidSwitch)) {
+            if (DEBUG) Slog.d(TAG, "Unable to wake up from lid.");
+            return false;
+        }
+        wakeUp(mClock.uptimeMillis(), WAKE_REASON_LID, "LID");
+        return true;
     }
 
     /**
@@ -140,11 +188,12 @@
      *      executed; {@code false} otherwise.
      */
     boolean wakeUpFromPowerKeyCameraGesture() {
-        return wakeUp(
-                SystemClock.uptimeMillis(),
-                mAllowTheaterModeWakeFromPowerKey,
-                WAKE_REASON_CAMERA_LAUNCH,
-                "CAMERA_GESTURE_PREVENT_LOCK");
+        if (!canWakeUp(mAllowTheaterModeWakeFromPowerKey)) {
+            if (DEBUG) Slog.d(TAG, "Unable to wake up from power key camera gesture.");
+            return false;
+        }
+        wakeUp(mClock.uptimeMillis(), WAKE_REASON_CAMERA_LAUNCH, "CAMERA_GESTURE_PREVENT_LOCK");
+        return true;
     }
 
     /**
@@ -154,23 +203,23 @@
      *      executed; {@code false} otherwise.
      */
     boolean wakeUpFromWakeGesture() {
-        return wakeUp(
-                SystemClock.uptimeMillis(),
-                mAllowTheaterModeWakeFromWakeGesture,
-                WAKE_REASON_GESTURE,
-                "GESTURE");
+        if (!canWakeUp(mAllowTheaterModeWakeFromWakeGesture)) {
+            if (DEBUG) Slog.d(TAG, "Unable to wake up from gesture.");
+            return false;
+        }
+        wakeUp(mClock.uptimeMillis(), WAKE_REASON_GESTURE, "GESTURE");
+        return true;
     }
 
-    private boolean wakeUp(
-            long wakeTime, boolean wakeInTheaterMode, @WakeReason int reason, String details) {
+    private boolean canWakeUp(boolean wakeInTheaterMode) {
         final boolean isTheaterModeEnabled =
                 Settings.Global.getInt(
                         mContext.getContentResolver(), Settings.Global.THEATER_MODE_ON, 0) == 1;
-        if (!wakeInTheaterMode && isTheaterModeEnabled) {
-            if (DEBUG) Slog.d(TAG, "Unable to wake up from " + details);
-            return false;
-        }
+        return wakeInTheaterMode || !isTheaterModeEnabled;
+    }
+
+    /** Wakes up {@link PowerManager}. */
+    private void wakeUp(long wakeTime, @WakeReason int reason, String details) {
         mPowerManager.wakeUp(wakeTime, reason, "android.policy:" + details);
-        return true;
     }
 }
diff --git a/services/core/java/com/android/server/policy/WindowWakeUpPolicyInternal.java b/services/core/java/com/android/server/policy/WindowWakeUpPolicyInternal.java
new file mode 100644
index 0000000..66a0035
--- /dev/null
+++ b/services/core/java/com/android/server/policy/WindowWakeUpPolicyInternal.java
@@ -0,0 +1,75 @@
+/*
+ * Copyright (C) 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.server.policy;
+
+import android.annotation.Nullable;
+import android.os.SystemClock;
+
+import com.android.internal.annotations.Keep;
+import com.android.server.LocalServices;
+
+/** Policy controlling the decision and execution of window-related wake ups. */
+@Keep
+public interface WindowWakeUpPolicyInternal {
+
+    /**
+     * A delegate that can choose to intercept Input-related wake ups.
+     *
+     * <p>This delegate is not meant to control policy decisions on whether or not to wake up. The
+     * policy makes that decision, and forwards the wake up request to the delegate as necessary.
+     * Therefore, the role of the delegate is to handle the actual "waking" of the device in
+     * response to the respective input event.
+     */
+    @Keep
+    interface InputWakeUpDelegate {
+        /**
+         * Wakes up the device in response to a key event.
+         *
+         * @param eventTime the timestamp of the event in {@link SystemClock#uptimeMillis()}.
+         * @param keyCode the {@link android.view.KeyEvent} key code of the key event.
+         * @param isDown {@code true} if the event's action is {@link KeyEvent#ACTION_DOWN}.
+         * @return {@code true} if the delegate handled the wake up. {@code false} if the delegate
+         *      decided not to handle the wake up. The policy will execute the wake up in this case.
+         */
+        boolean wakeUpFromKey(long eventTime, int keyCode, boolean isDown);
+        /**
+         * Wakes up the device in response to a motion event.
+         *
+         * @param eventTime the timestamp of the event in {@link SystemClock#uptimeMillis()}.
+         * @param source the {@link android.view.InputDevice} source that caused the event.
+         * @param isDown {@code true} if the event's action is {@link MotionEvent#ACTION_DOWN}.
+         * @return {@code true} if the delegate handled the wake up. {@code false} if the delegate
+         *      decided not to handle the wake up. The policy will execute the wake up in this case.
+         */
+        boolean wakeUpFromMotion(long eventTime, int source, boolean isDown);
+    }
+
+    /**
+     * Allows injecting a delegate for controlling input-based wake ups.
+     *
+     * <p>A delegate can be injected to the policy by system_server components only, and should be
+     * done via the {@link LocalServices} interface.
+     *
+     * <p>There can at most be one active delegate. If there's no delegate set (or if a {@code null}
+     * delegate is set), the policy will handle waking up the device in response to input events.
+     *
+     * @param delegate an implementation of {@link InputWakeUpDelegate} that handles input-based
+     *      wake up requests. {@code null} to let the policy handle these wake ups.
+     */
+    @Keep
+    void setInputWakeUpDelegate(@Nullable InputWakeUpDelegate delegate);
+}
diff --git a/services/core/java/com/android/server/policy/window_policy_flags.aconfig b/services/core/java/com/android/server/policy/window_policy_flags.aconfig
new file mode 100644
index 0000000..ed981e0
--- /dev/null
+++ b/services/core/java/com/android/server/policy/window_policy_flags.aconfig
@@ -0,0 +1,8 @@
+package: "com.android.server.policy"
+
+flag {
+    name: "support_input_wakeup_delegate"
+    namespace: "wear_frameworks"
+    description: "Whether or not window policy allows injecting input wake-up delegate."
+    bug: "298055811"
+}
\ No newline at end of file
diff --git a/services/core/java/com/android/server/trust/TEST_MAPPING b/services/core/java/com/android/server/trust/TEST_MAPPING
index fa46acd..0de7c28 100644
--- a/services/core/java/com/android/server/trust/TEST_MAPPING
+++ b/services/core/java/com/android/server/trust/TEST_MAPPING
@@ -12,6 +12,19 @@
         ]
       }
     ],
+    "postsubmit": [
+      {
+        "name": "FrameworksMockingServicesTests",
+        "options": [
+          {
+            "include-filter": "com.android.server.trust"
+          },
+          {
+            "exclude-annotation": "androidx.test.filters.FlakyTest"
+          }
+        ]
+      }
+    ],
     "trust-tablet": [
       {
         "name": "TrustTests",
diff --git a/services/core/java/com/android/server/trust/TrustManagerService.java b/services/core/java/com/android/server/trust/TrustManagerService.java
index 9a85c42..5d716fc 100644
--- a/services/core/java/com/android/server/trust/TrustManagerService.java
+++ b/services/core/java/com/android/server/trust/TrustManagerService.java
@@ -74,6 +74,7 @@
 import android.view.WindowManagerGlobal;
 
 import com.android.internal.annotations.GuardedBy;
+import com.android.internal.annotations.VisibleForTesting;
 import com.android.internal.content.PackageMonitor;
 import com.android.internal.infra.AndroidFuture;
 import com.android.internal.util.DumpUtils;
@@ -1439,6 +1440,13 @@
         if (biometricManager == null) {
             return new long[0];
         }
+        if (android.security.Flags.fixUnlockedDeviceRequiredKeysV2()
+                && mLockPatternUtils.isProfileWithUnifiedChallenge(userId)) {
+            // Profiles with unified challenge have their own set of biometrics, but the device
+            // unlock happens via the parent user.  In this case Keystore needs to be given the list
+            // of biometric SIDs from the parent user, not the profile.
+            userId = resolveProfileParent(userId);
+        }
         return biometricManager.getAuthenticatorIds(userId);
     }
 
@@ -1758,6 +1766,11 @@
         }
     };
 
+    @VisibleForTesting
+    void waitForIdle() {
+        mHandler.runWithScissors(() -> {}, 0);
+    }
+
     private boolean isTrustUsuallyManagedInternal(int userId) {
         synchronized (mTrustUsuallyManagedForUser) {
             int i = mTrustUsuallyManagedForUser.indexOfKey(userId);
diff --git a/services/core/java/com/android/server/wallpaper/WallpaperData.java b/services/core/java/com/android/server/wallpaper/WallpaperData.java
index b0b66cf..5c86701 100644
--- a/services/core/java/com/android/server/wallpaper/WallpaperData.java
+++ b/services/core/java/com/android/server/wallpaper/WallpaperData.java
@@ -130,6 +130,28 @@
      */
     final Rect cropHint = new Rect(0, 0, 0, 0);
 
+    // Describes the context of a call to WallpaperManagerService#bindWallpaperComponentLocked
+    enum BindSource {
+        UNKNOWN,
+        CONNECT_LOCKED,
+        CONNECTION_TRY_TO_REBIND,
+        INITIALIZE_FALLBACK,
+        PACKAGE_UPDATE_FINISHED,
+        RESTORE_SETTINGS_LIVE_FAILURE,
+        RESTORE_SETTINGS_LIVE_SUCCESS,
+        RESTORE_SETTINGS_STATIC,
+        SET_LIVE,
+        SET_LIVE_TO_CLEAR,
+        SET_STATIC,
+        SWITCH_WALLPAPER_FAILURE,
+        SWITCH_WALLPAPER_SWITCH_USER,
+        SWITCH_WALLPAPER_UNLOCK_USER,
+    }
+
+    // Context in which this wallpaper was bound. Intended for use in resolving b/301073479 but may
+    // be useful after the issue is resolved as well.
+    BindSource mBindSource = BindSource.UNKNOWN;
+
     // map of which -> File
     private final SparseArray<File> mWallpaperFiles = new SparseArray<>();
     private final SparseArray<File> mCropFiles = new SparseArray<>();
diff --git a/services/core/java/com/android/server/wallpaper/WallpaperDataParser.java b/services/core/java/com/android/server/wallpaper/WallpaperDataParser.java
index 5f8bbe5..de98df5 100644
--- a/services/core/java/com/android/server/wallpaper/WallpaperDataParser.java
+++ b/services/core/java/com/android/server/wallpaper/WallpaperDataParser.java
@@ -46,6 +46,7 @@
 import com.android.internal.util.JournaledFile;
 import com.android.modules.utils.TypedXmlPullParser;
 import com.android.modules.utils.TypedXmlSerializer;
+import com.android.server.wallpaper.WallpaperData.BindSource;
 
 import libcore.io.IoUtils;
 
@@ -314,6 +315,14 @@
         wpData.mPadding.right = getAttributeInt(parser, "paddingRight", 0);
         wpData.mPadding.bottom = getAttributeInt(parser, "paddingBottom", 0);
         wallpaper.mWallpaperDimAmount = getAttributeFloat(parser, "dimAmount", 0f);
+        BindSource bindSource;
+        try {
+            bindSource = Enum.valueOf(BindSource.class,
+                    getAttributeString(parser, "bindSource", BindSource.UNKNOWN.name()));
+        } catch (IllegalArgumentException | NullPointerException e) {
+            bindSource = BindSource.UNKNOWN;
+        }
+        wallpaper.mBindSource = bindSource;
         int dimAmountsCount = getAttributeInt(parser, "dimAmountsCount", 0);
         if (dimAmountsCount > 0) {
             SparseArray<Float> allDimAmounts = new SparseArray<>(dimAmountsCount);
@@ -364,6 +373,11 @@
         return parser.getAttributeFloat(null, name, defValue);
     }
 
+    private String getAttributeString(XmlPullParser parser, String name, String defValue) {
+        String s = parser.getAttributeValue(null, name);
+        return (s != null) ? s : defValue;
+    }
+
     void saveSettingsLocked(int userId, WallpaperData wallpaper, WallpaperData lockWallpaper) {
         JournaledFile journal = makeJournaledFile(userId);
         FileOutputStream fstream = null;
@@ -423,6 +437,7 @@
         }
 
         out.attributeFloat(null, "dimAmount", wallpaper.mWallpaperDimAmount);
+        out.attribute(null, "bindSource", wallpaper.mBindSource.name());
         int dimAmountsCount = wallpaper.mUidToDimAmount.size();
         out.attributeInt(null, "dimAmountsCount", dimAmountsCount);
         if (dimAmountsCount > 0) {
diff --git a/services/core/java/com/android/server/wallpaper/WallpaperManagerService.java b/services/core/java/com/android/server/wallpaper/WallpaperManagerService.java
index 1485b96..3782b42 100644
--- a/services/core/java/com/android/server/wallpaper/WallpaperManagerService.java
+++ b/services/core/java/com/android/server/wallpaper/WallpaperManagerService.java
@@ -122,6 +122,7 @@
 import com.android.server.SystemService;
 import com.android.server.pm.UserManagerInternal;
 import com.android.server.utils.TimingsTraceAndSlog;
+import com.android.server.wallpaper.WallpaperData.BindSource;
 import com.android.server.wm.ActivityTaskManagerInternal;
 import com.android.server.wm.WindowManagerInternal;
 
@@ -335,6 +336,7 @@
                     };
 
                     // If this was the system wallpaper, rebind...
+                    wallpaper.mBindSource = BindSource.SET_STATIC;
                     bindWallpaperComponentLocked(mImageWallpaper, true, false, wallpaper,
                             callback);
                 }
@@ -354,6 +356,7 @@
                         }
                     };
 
+                    wallpaper.mBindSource = BindSource.SET_STATIC;
                     bindWallpaperComponentLocked(mImageWallpaper, true /* force */,
                             false /* fromUser */, wallpaper, callback);
                 } else if (isAppliedToLock) {
@@ -811,6 +814,7 @@
                 Slog.w(TAG, "Failed attaching wallpaper on display", e);
                 if (wallpaper != null && !wallpaper.wallpaperUpdating
                         && connection.getConnectedEngineSize() == 0) {
+                    wallpaper.mBindSource = BindSource.CONNECT_LOCKED;
                     bindWallpaperComponentLocked(null /* componentName */, false /* force */,
                             false /* fromUser */, wallpaper, null /* reply */);
                 }
@@ -1035,6 +1039,7 @@
                 final ComponentName wpService = mWallpaper.wallpaperComponent;
                 // The broadcast of package update could be delayed after service disconnected. Try
                 // to re-bind the service for 10 seconds.
+                mWallpaper.mBindSource = BindSource.CONNECTION_TRY_TO_REBIND;
                 if (bindWallpaperComponentLocked(
                         wpService, true, false, mWallpaper, null)) {
                     mWallpaper.connection.scheduleTimeoutLocked();
@@ -1321,6 +1326,7 @@
                         }
                         wallpaper.wallpaperUpdating = false;
                         clearWallpaperComponentLocked(wallpaper);
+                        wallpaper.mBindSource = BindSource.PACKAGE_UPDATE_FINISHED;
                         if (!bindWallpaperComponentLocked(wpService, false, false,
                                 wallpaper, null)) {
                             Slog.w(TAG, "Wallpaper " + wpService
@@ -1711,6 +1717,7 @@
                 if (mHomeWallpaperWaitingForUnlock) {
                     final WallpaperData systemWallpaper =
                             getWallpaperSafeLocked(userId, FLAG_SYSTEM);
+                    systemWallpaper.mBindSource = BindSource.SWITCH_WALLPAPER_UNLOCK_USER;
                     switchWallpaper(systemWallpaper, null);
                     // TODO(b/278261563): call notifyCallbacksLocked inside switchWallpaper
                     notifyCallbacksLocked(systemWallpaper);
@@ -1718,6 +1725,7 @@
                 if (mLockWallpaperWaitingForUnlock) {
                     final WallpaperData lockWallpaper =
                             getWallpaperSafeLocked(userId, FLAG_LOCK);
+                    lockWallpaper.mBindSource = BindSource.SWITCH_WALLPAPER_UNLOCK_USER;
                     switchWallpaper(lockWallpaper, null);
                     notifyCallbacksLocked(lockWallpaper);
                 }
@@ -1838,6 +1846,7 @@
         // delete them in order to show the default wallpaper.
         clearWallpaperBitmaps(wallpaper);
 
+        fallback.mBindSource = BindSource.SWITCH_WALLPAPER_FAILURE;
         bindWallpaperComponentLocked(mImageWallpaper, true, false, fallback, reply);
         if ((wallpaper.mWhich & FLAG_SYSTEM) != 0) mHomeWallpaperWaitingForUnlock = true;
         if ((wallpaper.mWhich & FLAG_LOCK) != 0) mLockWallpaperWaitingForUnlock = true;
@@ -2963,6 +2972,8 @@
                  */
                 boolean forceRebind = force || (same && systemIsBoth && which == FLAG_SYSTEM);
 
+                newWallpaper.mBindSource =
+                        (name == null) ? BindSource.SET_LIVE_TO_CLEAR : BindSource.SET_LIVE;
                 bindSuccess = bindWallpaperComponentLocked(name, /* force */
                         forceRebind, /* fromUser */ true, newWallpaper, reply);
                 if (bindSuccess) {
@@ -3530,6 +3541,7 @@
             mFallbackWallpaper = new WallpaperData(systemUserId, FLAG_SYSTEM);
             mFallbackWallpaper.allowBackup = false;
             mFallbackWallpaper.wallpaperId = makeWallpaperIdLocked();
+            mFallbackWallpaper.mBindSource = BindSource.INITIALIZE_FALLBACK;
             bindWallpaperComponentLocked(mDefaultWallpaperComponent, true, false,
                     mFallbackWallpaper, null);
         }
@@ -3553,11 +3565,13 @@
             wallpaper.allowBackup = true;   // by definition if it was restored
             if (wallpaper.nextWallpaperComponent != null
                     && !wallpaper.nextWallpaperComponent.equals(mImageWallpaper)) {
+                wallpaper.mBindSource = BindSource.RESTORE_SETTINGS_LIVE_SUCCESS;
                 if (!bindWallpaperComponentLocked(wallpaper.nextWallpaperComponent, false, false,
                         wallpaper, null)) {
                     // No such live wallpaper or other failure; fall back to the default
                     // live wallpaper (since the profile being restored indicated that the
                     // user had selected a live rather than static one).
+                    wallpaper.mBindSource = BindSource.RESTORE_SETTINGS_LIVE_FAILURE;
                     bindWallpaperComponentLocked(null, false, false, wallpaper, null);
                 }
                 success = true;
@@ -3575,6 +3589,7 @@
                         + " id=" + wallpaper.wallpaperId);
                 if (success) {
                     mWallpaperCropper.generateCrop(wallpaper); // based on the new image + metadata
+                    wallpaper.mBindSource = BindSource.RESTORE_SETTINGS_STATIC;
                     bindWallpaperComponentLocked(wallpaper.nextWallpaperComponent, true, false,
                             wallpaper, null);
                 }
@@ -3608,7 +3623,8 @@
         pw.print(" User "); pw.print(wallpaper.userId);
         pw.print(": id="); pw.print(wallpaper.wallpaperId);
         pw.print(": mWhich="); pw.print(wallpaper.mWhich);
-        pw.print(": mSystemWasBoth="); pw.println(wallpaper.mSystemWasBoth);
+        pw.print(": mSystemWasBoth="); pw.print(wallpaper.mSystemWasBoth);
+        pw.print(": mBindSource="); pw.println(wallpaper.mBindSource.name());
         pw.println(" Display state:");
         mWallpaperDisplayHelper.forEachDisplayData(wpSize -> {
             pw.print("  displayId=");
diff --git a/services/core/java/com/android/server/wm/ActivityRecord.java b/services/core/java/com/android/server/wm/ActivityRecord.java
index febcc05..3a792d0 100644
--- a/services/core/java/com/android/server/wm/ActivityRecord.java
+++ b/services/core/java/com/android/server/wm/ActivityRecord.java
@@ -2181,7 +2181,8 @@
             // The result receiver is the transition receiver, which will handle the shared element
             // exit transition.
             mHasSceneTransition = options.getAnimationType() == ANIM_SCENE_TRANSITION
-                    && options.getResultReceiver() != null;
+                    && options.getSceneTransitionInfo() != null
+                    && options.getSceneTransitionInfo().getResultReceiver() != null;
             final PendingIntent usageReport = options.getUsageTimeReport();
             if (usageReport != null) {
                 appTimeTracker = new AppTimeTracker(usageReport);
@@ -2494,7 +2495,14 @@
 
         ProtoLog.v(WM_DEBUG_STARTING_WINDOW, "Creating SnapshotStartingData");
         mStartingData = new SnapshotStartingData(mWmService, snapshot, typeParams);
-        if (task.forAllLeafTaskFragments(TaskFragment::isEmbedded)) {
+        if ((!mStyleFillsParent && task.getChildCount() > 1)
+                || task.forAllLeafTaskFragments(TaskFragment::isEmbedded)) {
+            // Case 1:
+            // If it is moving a Task{[0]=main activity, [1]=translucent activity} to front, use
+            // shared starting window so that the transition doesn't need to wait for the activity
+            // behind the translucent activity. Also, onFirstWindowDrawn will check all visible
+            // activities are drawn in the task to remove the snapshot starting window.
+            // Case 2:
             // Associate with the task so if this activity is resized by task fragment later, the
             // starting window can keep the same bounds as the task.
             associateStartingDataWithTask();
@@ -5178,16 +5186,15 @@
         return mPendingOptions;
     }
 
-    ActivityOptions takeOptions() {
-        if (DEBUG_TRANSITION) Slog.i(TAG, "Taking options for " + this + " callers="
-                + Debug.getCallers(6));
+    ActivityOptions.SceneTransitionInfo takeSceneTransitionInfo() {
+        if (DEBUG_TRANSITION) {
+            Slog.i(TAG, "Taking SceneTransitionInfo for " + this + " callers="
+                    + Debug.getCallers(6));
+        }
         if (mPendingOptions == null) return null;
         final ActivityOptions opts = mPendingOptions;
         mPendingOptions = null;
-        // Strip sensitive information from options before sending it to app.
-        opts.setRemoteTransition(null);
-        opts.setRemoteAnimationAdapter(null);
-        return opts;
+        return opts.getSceneTransitionInfo();
     }
 
     RemoteTransition takeRemoteTransition() {
@@ -6153,7 +6160,7 @@
 
             try {
                 mAtmService.getLifecycleManager().scheduleTransactionItem(app.getThread(),
-                        StartActivityItem.obtain(token, takeOptions()));
+                        StartActivityItem.obtain(token, takeSceneTransitionInfo()));
             } catch (Exception e) {
                 Slog.w(TAG, "Exception thrown sending start: " + intent.getComponent(), e);
             }
@@ -6258,8 +6265,11 @@
 
     void handleAlreadyVisible() {
         try {
-            if (returningOptions != null) {
-                app.getThread().scheduleOnNewActivityOptions(token, returningOptions.toBundle());
+            if (returningOptions != null
+                    && returningOptions.getAnimationType() == ANIM_SCENE_TRANSITION
+                    && returningOptions.getSceneTransitionInfo() != null) {
+                app.getThread().scheduleOnNewSceneTransitionInfo(token,
+                        returningOptions.getSceneTransitionInfo());
             }
         } catch(RemoteException e) {
         }
@@ -6608,10 +6618,6 @@
         return hasProcess() && !app.isCrashing() && !app.isNotResponding();
     }
 
-    void startFreezingScreenLocked(int configChanges) {
-        startFreezingScreenLocked(app, configChanges);
-    }
-
     void startFreezingScreenLocked(WindowProcessController app, int configChanges) {
         if (mayFreezeScreenLocked(app)) {
             if (getParent() == null) {
@@ -8095,12 +8101,8 @@
      * Set the last reported configuration to the client. Should be called whenever
      * a new merged configuration is sent to the client for this activity.
      */
-    void setLastReportedConfiguration(@NonNull MergedConfiguration config) {
-        setLastReportedConfiguration(config.getGlobalConfiguration(),
-            config.getOverrideConfiguration());
-    }
-
-    private void setLastReportedConfiguration(Configuration global, Configuration override) {
+    void setLastReportedConfiguration(@NonNull Configuration global,
+            @NonNull Configuration override) {
         mLastReportedConfiguration.setConfiguration(global, override);
     }
 
@@ -9634,7 +9636,7 @@
             configChangeFlags |= changes;
             if (mVisible && mAtmService.mTmpUpdateConfigurationResult.mIsUpdating
                     && !mTransitionController.isShellTransitionsEnabled()) {
-                startFreezingScreenLocked(mAtmService.mTmpUpdateConfigurationResult.changes);
+                startFreezingScreenLocked(app, mAtmService.mTmpUpdateConfigurationResult.changes);
             }
             final boolean displayMayChange = mTmpConfig.windowConfiguration.getDisplayRotation()
                     != getWindowConfiguration().getDisplayRotation()
@@ -10621,6 +10623,14 @@
 
     @Override
     boolean isSyncFinished(BLASTSyncEngine.SyncGroup group) {
+        if (task != null && task.mSharedStartingData != null) {
+            final WindowState startingWin = task.topStartingWindow();
+            if (startingWin != null && startingWin.mSyncState == SYNC_STATE_READY
+                    && mDisplayContent.mUnknownAppVisibilityController.allResolved()) {
+                // The sync is ready if a drawn starting window covered the task.
+                return true;
+            }
+        }
         if (!super.isSyncFinished(group)) return false;
         if (mDisplayContent != null && mDisplayContent.mUnknownAppVisibilityController
                 .isVisibilityUnknown(this)) {
diff --git a/services/core/java/com/android/server/wm/ActivityTaskSupervisor.java b/services/core/java/com/android/server/wm/ActivityTaskSupervisor.java
index 1872f6e..ec0e3e7 100644
--- a/services/core/java/com/android/server/wm/ActivityTaskSupervisor.java
+++ b/services/core/java/com/android/server/wm/ActivityTaskSupervisor.java
@@ -134,7 +134,6 @@
 import android.os.WorkSource;
 import android.provider.MediaStore;
 import android.util.ArrayMap;
-import android.util.MergedConfiguration;
 import android.util.Slog;
 import android.util.SparseArray;
 import android.util.SparseIntArray;
@@ -820,8 +819,6 @@
         proc.pauseConfigurationDispatch();
 
         try {
-            r.startFreezingScreenLocked(proc, 0);
-
             // schedule launch ticks to collect information about slow apps.
             r.startLaunchTickingLocked();
             r.lastLaunchTime = SystemClock.uptimeMillis();
@@ -908,13 +905,9 @@
                         r.intent.getComponent().getPackageName(), NOTIFY_PACKAGE_USE_ACTIVITY);
                 mService.getAppWarningsLocked().onStartActivity(r);
 
-                // Because we could be starting an Activity in the system process this may not go
-                // across a Binder interface which would create a new Configuration. Consequently
-                // we have to always create a new Configuration here.
                 final Configuration procConfig = proc.prepareConfigurationForLaunchingActivity();
-                final MergedConfiguration mergedConfiguration = new MergedConfiguration(
-                        procConfig, r.getMergedOverrideConfiguration());
-                r.setLastReportedConfiguration(mergedConfiguration);
+                final Configuration overrideConfig = r.getMergedOverrideConfiguration();
+                r.setLastReportedConfiguration(procConfig, overrideConfig);
 
                 logIfTransactionTooLarge(r.intent, r.getSavedState());
 
@@ -932,13 +925,10 @@
                 final int deviceId = getDeviceIdForDisplayId(r.getDisplayId());
                 final LaunchActivityItem launchActivityItem = LaunchActivityItem.obtain(r.token,
                         r.intent, System.identityHashCode(r), r.info,
-                        // TODO: Have this take the merged configuration instead of separate global
-                        // and override configs.
-                        mergedConfiguration.getGlobalConfiguration(),
-                        mergedConfiguration.getOverrideConfiguration(), deviceId,
+                        procConfig, overrideConfig, deviceId,
                         r.getFilteredReferrer(r.launchedFromPackage), task.voiceInteractor,
                         proc.getReportedProcState(), r.getSavedState(), r.getPersistentSavedState(),
-                        results, newIntents, r.takeOptions(), isTransitionForward,
+                        results, newIntents, r.takeSceneTransitionInfo(), isTransitionForward,
                         proc.createProfilerInfoIfNeeded(), r.assistToken, activityClientController,
                         r.shareableActivityToken, r.getLaunchedFromBubble(), fragmentToken);
 
diff --git a/services/core/java/com/android/server/wm/DeferredDisplayUpdater.java b/services/core/java/com/android/server/wm/DeferredDisplayUpdater.java
index 975fdc0..0f9e5b0 100644
--- a/services/core/java/com/android/server/wm/DeferredDisplayUpdater.java
+++ b/services/core/java/com/android/server/wm/DeferredDisplayUpdater.java
@@ -179,6 +179,12 @@
             if (physicalDisplayUpdated) {
                 onDisplayUpdated(transition, fromRotation, startBounds);
             } else {
+                final TransitionRequestInfo.DisplayChange displayChange =
+                        getCurrentDisplayChange(fromRotation, startBounds);
+                mDisplayContent.mTransitionController.requestStartTransition(transition,
+                        /* startTask= */ null, /* remoteTransition= */ null, displayChange);
+                mDisplayContent.mTransitionController.setDisplaySyncMethod(displayChange,
+                        mDisplayContent);
                 transition.setAllReady();
             }
         });
@@ -204,15 +210,8 @@
         return new DisplayInfo(mNonOverrideDisplayInfo);
     }
 
-    /**
-     * Called when physical display is updated, this could happen e.g. on foldable
-     * devices when the physical underlying display is replaced. This method should be called
-     * when the new display info is already applied to the WM hierarchy.
-     *
-     * @param fromRotation rotation before the display change
-     * @param startBounds  display bounds before the display change
-     */
-    private void onDisplayUpdated(@NonNull Transition transition, int fromRotation,
+    @NonNull
+    private TransitionRequestInfo.DisplayChange getCurrentDisplayChange(int fromRotation,
             @NonNull Rect startBounds) {
         final Rect endBounds = new Rect(0, 0, mDisplayContent.mInitialDisplayWidth,
                 mDisplayContent.mInitialDisplayHeight);
@@ -224,6 +223,23 @@
         displayChange.setEndAbsBounds(endBounds);
         displayChange.setStartRotation(fromRotation);
         displayChange.setEndRotation(toRotation);
+        return displayChange;
+    }
+
+    /**
+     * Called when physical display is updated, this could happen e.g. on foldable
+     * devices when the physical underlying display is replaced. This method should be called
+     * when the new display info is already applied to the WM hierarchy.
+     *
+     * @param fromRotation rotation before the display change
+     * @param startBounds  display bounds before the display change
+     */
+    private void onDisplayUpdated(@NonNull Transition transition, int fromRotation,
+            @NonNull Rect startBounds) {
+        final int toRotation = mDisplayContent.getRotation();
+
+        final TransitionRequestInfo.DisplayChange displayChange =
+                getCurrentDisplayChange(fromRotation, startBounds);
         displayChange.setPhysicalDisplayChanged(true);
 
         mDisplayContent.mTransitionController.requestStartTransition(transition,
diff --git a/services/core/java/com/android/server/wm/DisplayPolicy.java b/services/core/java/com/android/server/wm/DisplayPolicy.java
index 460a68f..63ca592 100644
--- a/services/core/java/com/android/server/wm/DisplayPolicy.java
+++ b/services/core/java/com/android/server/wm/DisplayPolicy.java
@@ -40,6 +40,7 @@
 import static android.view.WindowManager.LayoutParams.FLAG_NOT_TOUCHABLE;
 import static android.view.WindowManager.LayoutParams.LAYOUT_IN_DISPLAY_CUTOUT_MODE_ALWAYS;
 import static android.view.WindowManager.LayoutParams.PRIVATE_FLAG_CONSUME_IME_INSETS;
+import static android.view.WindowManager.LayoutParams.PRIVATE_FLAG_EDGE_TO_EDGE_ENFORCED;
 import static android.view.WindowManager.LayoutParams.PRIVATE_FLAG_FORCE_DRAW_BAR_BACKGROUNDS;
 import static android.view.WindowManager.LayoutParams.PRIVATE_FLAG_IMMERSIVE_CONFIRMATION_WINDOW;
 import static android.view.WindowManager.LayoutParams.PRIVATE_FLAG_INTERCEPT_GLOBAL_DRAG_AND_DROP;
@@ -959,15 +960,17 @@
 
             case TYPE_BASE_APPLICATION:
 
-                // A non-translucent main app window isn't allowed to fit insets, as it would create
-                // a hole on the display!
+                // A non-translucent main app window isn't allowed to fit insets or display cutouts,
+                // as it would create a hole on the display!
                 if (attrs.isFullscreen() && win.mActivityRecord != null
                         && win.mActivityRecord.fillsParent()
-                        && (win.mAttrs.privateFlags & PRIVATE_FLAG_FORCE_DRAW_BAR_BACKGROUNDS) != 0
-                        && attrs.getFitInsetsTypes() != 0) {
+                        && (attrs.privateFlags & PRIVATE_FLAG_FORCE_DRAW_BAR_BACKGROUNDS) != 0
+                        && (attrs.getFitInsetsTypes() != 0
+                                || (attrs.privateFlags & PRIVATE_FLAG_EDGE_TO_EDGE_ENFORCED) != 0
+                                        && attrs.layoutInDisplayCutoutMode
+                                                != LAYOUT_IN_DISPLAY_CUTOUT_MODE_ALWAYS)) {
                     throw new IllegalArgumentException("Illegal attributes: Main activity window"
-                            + " that isn't translucent trying to fit insets: "
-                            + attrs.getFitInsetsTypes()
+                            + " that isn't translucent trying to fit insets or display cutouts."
                             + " attrs=" + attrs);
                 }
                 break;
diff --git a/services/core/java/com/android/server/wm/SensitiveContentPackages.java b/services/core/java/com/android/server/wm/SensitiveContentPackages.java
new file mode 100644
index 0000000..3862b82
--- /dev/null
+++ b/services/core/java/com/android/server/wm/SensitiveContentPackages.java
@@ -0,0 +1,83 @@
+/*
+ * Copyright (C) 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.server.wm;
+
+import android.annotation.NonNull;
+import android.util.ArraySet;
+
+import java.io.PrintWriter;
+import java.util.Objects;
+import java.util.Set;
+
+/**
+ * Cache of distinct package/uid pairs that require being blocked from screen capture. This class is
+ * not threadsafe and any call site should hold {@link WindowManagerGlobalLock}
+ */
+public class SensitiveContentPackages {
+    private final ArraySet<PackageInfo> mProtectedPackages = new ArraySet<>();
+
+    /** Returns {@code true} if package/uid pair should be blocked from screen capture */
+    public boolean shouldBlockScreenCaptureForApp(String pkg, int uid) {
+        for (int i = 0; i < mProtectedPackages.size(); i++) {
+            PackageInfo info = mProtectedPackages.valueAt(i);
+            if (info != null && info.mPkg.equals(pkg) && info.mUid == uid) {
+                return true;
+            }
+        }
+        return false;
+    }
+
+    /** Replaces the set of package/uid pairs to set that should be blocked from screen capture */
+    public void setShouldBlockScreenCaptureForApp(@NonNull Set<PackageInfo> packageInfos) {
+        mProtectedPackages.clear();
+        mProtectedPackages.addAll(packageInfos);
+    }
+
+    void dump(PrintWriter pw) {
+        final String innerPrefix = "  ";
+        pw.println("SensitiveContentPackages:");
+        pw.println(innerPrefix + "Packages that should block screen capture ("
+                + mProtectedPackages.size() + "):");
+        for (PackageInfo info : mProtectedPackages) {
+            pw.println(innerPrefix + "  package=" + info.mPkg + "  uid=" + info.mUid);
+        }
+    }
+
+    /** Helper class that represents a package/uid pair */
+    public static class PackageInfo {
+        private String mPkg;
+        private int mUid;
+
+        public PackageInfo(String pkg, int uid) {
+            this.mPkg = pkg;
+            this.mUid = uid;
+        }
+
+        @Override
+        public boolean equals(Object o) {
+            if (this == o) return true;
+            if (!(o instanceof PackageInfo)) return false;
+            PackageInfo that = (PackageInfo) o;
+            return mUid == that.mUid && Objects.equals(mPkg, that.mPkg);
+        }
+
+        @Override
+        public int hashCode() {
+            return Objects.hash(mPkg, mUid);
+        }
+    }
+}
diff --git a/services/core/java/com/android/server/wm/Task.java b/services/core/java/com/android/server/wm/Task.java
index d556f09..a7a6bf2 100644
--- a/services/core/java/com/android/server/wm/Task.java
+++ b/services/core/java/com/android/server/wm/Task.java
@@ -1411,12 +1411,13 @@
         return isUidPresent;
     }
 
+    WindowState topStartingWindow() {
+        return getWindow(w -> w.mAttrs.type == TYPE_APPLICATION_STARTING);
+    }
+
     ActivityRecord topActivityContainsStartingWindow() {
-        if (getParent() == null) {
-            return null;
-        }
-        return getActivity((r) -> r.getWindow(window ->
-                window.getBaseType() == TYPE_APPLICATION_STARTING) != null);
+        final WindowState startingWindow = topStartingWindow();
+        return startingWindow != null ? startingWindow.mActivityRecord : null;
     }
 
     /**
@@ -3698,6 +3699,16 @@
                 }
                 wc.assignLayer(t, layer++);
 
+                // Boost the adjacent TaskFragment for dimmer if needed.
+                final TaskFragment taskFragment = wc.asTaskFragment();
+                if (taskFragment != null && taskFragment.isEmbedded()
+                        && taskFragment.isVisibleRequested()) {
+                    final TaskFragment adjacentTf = taskFragment.getAdjacentTaskFragment();
+                    if (adjacentTf != null && adjacentTf.shouldBoostDimmer()) {
+                        adjacentTf.assignLayer(t, layer++);
+                    }
+                }
+
                 // Place the decor surface just above the owner TaskFragment.
                 if (mDecorSurfaceContainer != null && !decorSurfacePlaced
                         && wc == mDecorSurfaceContainer.mOwnerTaskFragment) {
@@ -4784,6 +4795,7 @@
         }
         if (top.isAttached()) {
             top.setWindowingMode(WINDOWING_MODE_UNDEFINED);
+            top.mWaitForEnteringPinnedMode = false;
         }
     }
 
diff --git a/services/core/java/com/android/server/wm/TaskFragment.java b/services/core/java/com/android/server/wm/TaskFragment.java
index f51bd1b..f56759f 100644
--- a/services/core/java/com/android/server/wm/TaskFragment.java
+++ b/services/core/java/com/android/server/wm/TaskFragment.java
@@ -39,6 +39,7 @@
 import static android.os.Process.SYSTEM_UID;
 import static android.os.UserHandle.USER_NULL;
 import static android.view.Display.INVALID_DISPLAY;
+import static android.view.WindowManager.LayoutParams.FLAG_DIM_BEHIND;
 import static android.view.WindowManager.TRANSIT_CLOSE;
 import static android.view.WindowManager.TRANSIT_FLAG_OPEN_BEHIND;
 import static android.view.WindowManager.TRANSIT_NONE;
@@ -2995,6 +2996,30 @@
         }, false /* traverseTopToBottom */);
     }
 
+    boolean shouldBoostDimmer() {
+        if (asTask() != null || !isDimmingOnParentTask()) {
+            // early return if not embedded or should not dim on parent Task.
+            return false;
+        }
+
+        final TaskFragment adjacentTf = getAdjacentTaskFragment();
+        if (adjacentTf == null) {
+            // early return if no adjacent TF.
+            return false;
+        }
+
+        if (getParent().mChildren.indexOf(adjacentTf) < getParent().mChildren.indexOf(this)) {
+            // early return if this TF already has higher z-ordering.
+            return false;
+        }
+
+        // boost if there's an Activity window that has FLAG_DIM_BEHIND flag.
+        return forAllWindows(
+                (w) -> (w.mAttrs.flags & FLAG_DIM_BEHIND) != 0 && w.mActivityRecord != null
+                        && w.mActivityRecord.isEmbedded() && (w.mActivityRecord.isVisibleRequested()
+                        || w.mActivityRecord.isVisible()), true);
+    }
+
     @Override
     Dimmer getDimmer() {
         // If this is in an embedded TaskFragment and we want the dim applies on the TaskFragment.
diff --git a/services/core/java/com/android/server/wm/TransitionController.java b/services/core/java/com/android/server/wm/TransitionController.java
index c3aca6f..708d63e 100644
--- a/services/core/java/com/android/server/wm/TransitionController.java
+++ b/services/core/java/com/android/server/wm/TransitionController.java
@@ -634,8 +634,8 @@
     }
 
     /** Sets the sync method for the display change. */
-    private void setDisplaySyncMethod(@NonNull TransitionRequestInfo.DisplayChange displayChange,
-            @NonNull Transition displayTransition, @NonNull DisplayContent displayContent) {
+    void setDisplaySyncMethod(@NonNull TransitionRequestInfo.DisplayChange displayChange,
+            @NonNull DisplayContent displayContent) {
         final Rect startBounds = displayChange.getStartAbsBounds();
         final Rect endBounds = displayChange.getEndAbsBounds();
         if (startBounds == null || endBounds == null) return;
@@ -686,7 +686,7 @@
                     trigger != null ? trigger.asTask() : null, remoteTransition, displayChange);
             if (newTransition != null && displayChange != null && trigger != null
                     && trigger.asDisplayContent() != null) {
-                setDisplaySyncMethod(displayChange, newTransition, trigger.asDisplayContent());
+                setDisplaySyncMethod(displayChange, trigger.asDisplayContent());
             }
         }
         if (trigger != null) {
diff --git a/services/core/java/com/android/server/wm/WallpaperController.java b/services/core/java/com/android/server/wm/WallpaperController.java
index 33ef3c5..a9f0554 100644
--- a/services/core/java/com/android/server/wm/WallpaperController.java
+++ b/services/core/java/com/android/server/wm/WallpaperController.java
@@ -183,18 +183,21 @@
                 && (mWallpaperTarget == w || w.isDrawFinishedLw())) {
             if (DEBUG_WALLPAPER) Slog.v(TAG, "Found wallpaper target: " + w);
             mFindResults.setWallpaperTarget(w);
+            mFindResults.setIsWallpaperTargetForLetterbox(w.hasWallpaperForLetterboxBackground());
             if (w == mWallpaperTarget && w.isAnimating(TRANSITION | PARENTS)) {
                 // The current wallpaper target is animating, so we'll look behind it for
                 // another possible target and figure out what is going on later.
                 if (DEBUG_WALLPAPER) Slog.v(TAG,
                         "Win " + w + ": token animating, looking behind.");
             }
-            mFindResults.setIsWallpaperTargetForLetterbox(w.hasWallpaperForLetterboxBackground());
             // While the keyguard is going away, both notification shade and a normal activity such
             // as a launcher can satisfy criteria for a wallpaper target. In this case, we should
             // chose the normal activity, otherwise wallpaper becomes invisible when a new animation
             // starts before the keyguard going away animation finishes.
-            return w.mActivityRecord != null;
+            if (w.mActivityRecord == null && mDisplayContent.isKeyguardGoingAway()) {
+                return false;
+            }
+            return true;
         }
         return false;
     };
diff --git a/services/core/java/com/android/server/wm/WindowContainer.java b/services/core/java/com/android/server/wm/WindowContainer.java
index e28262d..bdea1bc 100644
--- a/services/core/java/com/android/server/wm/WindowContainer.java
+++ b/services/core/java/com/android/server/wm/WindowContainer.java
@@ -3938,7 +3938,13 @@
     @Nullable
     BLASTSyncEngine.SyncGroup getSyncGroup() {
         if (mSyncGroup != null) return mSyncGroup;
-        if (mParent != null) return mParent.getSyncGroup();
+        WindowContainer<?> parent = mParent;
+        while (parent != null) {
+            if (parent.mSyncGroup != null) {
+                return parent.mSyncGroup;
+            }
+            parent = parent.mParent;
+        }
         return null;
     }
 
@@ -3972,7 +3978,7 @@
      * @param cancel If true, this is being finished because it is leaving the sync group rather
      *               than due to the sync group completing.
      */
-    void finishSync(Transaction outMergedTransaction, BLASTSyncEngine.SyncGroup group,
+    void finishSync(Transaction outMergedTransaction, @Nullable BLASTSyncEngine.SyncGroup group,
             boolean cancel) {
         if (mSyncState == SYNC_STATE_NONE) return;
         final BLASTSyncEngine.SyncGroup syncGroup = getSyncGroup();
@@ -4000,7 +4006,8 @@
         if (!isVisibleRequested()) {
             return true;
         }
-        if (mSyncState == SYNC_STATE_NONE) {
+        if (mSyncState == SYNC_STATE_NONE && getSyncGroup() != null) {
+            Slog.i(TAG, "prepareSync in isSyncFinished: " + this);
             prepareSync();
         }
         if (mSyncState == SYNC_STATE_WAITING_FOR_DRAW) {
@@ -4059,16 +4066,18 @@
             }
             if (newParent == null) {
                 // This is getting removed.
+                final BLASTSyncEngine.SyncGroup syncGroup = getSyncGroup();
                 if (oldParent.mSyncState != SYNC_STATE_NONE) {
                     // In order to keep the transaction in sync, merge it into the parent.
-                    finishSync(oldParent.mSyncTransaction, getSyncGroup(), true /* cancel */);
-                } else if (mSyncGroup != null) {
-                    // This is watched directly by the sync-group, so merge this transaction into
-                    // into the sync-group so it isn't lost
-                    finishSync(mSyncGroup.getOrphanTransaction(), mSyncGroup, true /* cancel */);
+                    finishSync(oldParent.mSyncTransaction, syncGroup, true /* cancel */);
+                } else if (syncGroup != null) {
+                    // This is watched by the sync-group, so merge this transaction into the
+                    // sync-group for not losing the operations in the transaction.
+                    finishSync(syncGroup.getOrphanTransaction(), syncGroup, true /* cancel */);
                 } else {
-                    throw new IllegalStateException("This container is in sync mode without a sync"
-                            + " group: " + this);
+                    Slog.wtf(TAG, this + " is in sync mode without a sync group");
+                    // Make sure the removal transaction take effect.
+                    finishSync(getPendingTransaction(), null /* group */, true /* cancel */);
                 }
                 return;
             } else if (mSyncGroup == null) {
diff --git a/services/core/java/com/android/server/wm/WindowManagerInternal.java b/services/core/java/com/android/server/wm/WindowManagerInternal.java
index 516d37c..22b690e 100644
--- a/services/core/java/com/android/server/wm/WindowManagerInternal.java
+++ b/services/core/java/com/android/server/wm/WindowManagerInternal.java
@@ -51,6 +51,7 @@
 import com.android.internal.policy.KeyInterceptionInfo;
 import com.android.server.input.InputManagerService;
 import com.android.server.policy.WindowManagerPolicy;
+import com.android.server.wm.SensitiveContentPackages.PackageInfo;
 
 import java.lang.annotation.Retention;
 import java.util.List;
@@ -1012,4 +1013,12 @@
      */
     public abstract void setOrientationRequestPolicy(boolean respected,
             int[] fromOrientations, int[] toOrientations);
+
+    /**
+     * Set whether screen capture should be disabled for all windows of a specific app windows based
+     * on sensitive content protections.
+     *
+     * @param packageInfos set of {@link PackageInfo} whose windows should be blocked from capture
+     */
+    public abstract void setShouldBlockScreenCaptureForApp(@NonNull Set<PackageInfo> packageInfos);
 }
diff --git a/services/core/java/com/android/server/wm/WindowManagerService.java b/services/core/java/com/android/server/wm/WindowManagerService.java
index 502912a..c63cc43 100644
--- a/services/core/java/com/android/server/wm/WindowManagerService.java
+++ b/services/core/java/com/android/server/wm/WindowManagerService.java
@@ -123,6 +123,7 @@
 import static com.android.server.wm.LetterboxConfiguration.LETTERBOX_BACKGROUND_SOLID_COLOR;
 import static com.android.server.wm.LetterboxConfiguration.LETTERBOX_BACKGROUND_WALLPAPER;
 import static com.android.server.wm.RootWindowContainer.MATCH_ATTACHED_TASK_OR_RECENT_TASKS;
+import static com.android.server.wm.SensitiveContentPackages.PackageInfo;
 import static com.android.server.wm.SurfaceAnimator.ANIMATION_TYPE_ALL;
 import static com.android.server.wm.SurfaceAnimator.ANIMATION_TYPE_APP_TRANSITION;
 import static com.android.server.wm.SurfaceAnimator.ANIMATION_TYPE_RECENTS;
@@ -312,6 +313,7 @@
 import android.window.WindowContextInfo;
 
 import com.android.internal.R;
+import com.android.internal.annotations.GuardedBy;
 import com.android.internal.annotations.VisibleForTesting;
 import com.android.internal.os.IResultReceiver;
 import com.android.internal.policy.IKeyguardDismissCallback;
@@ -366,6 +368,7 @@
 import java.util.NoSuchElementException;
 import java.util.Objects;
 import java.util.Optional;
+import java.util.Set;
 import java.util.concurrent.CountDownLatch;
 import java.util.concurrent.TimeUnit;
 import java.util.function.Function;
@@ -1053,6 +1056,9 @@
 
     SystemPerformanceHinter mSystemPerformanceHinter;
 
+    @GuardedBy("mGlobalLock")
+    final SensitiveContentPackages mSensitiveContentPackages = new SensitiveContentPackages();
+
     /** Listener to notify activity manager about app transitions. */
     final WindowManagerInternal.AppTransitionListener mActivityManagerAppTransitionNotifier
             = new WindowManagerInternal.AppTransitionListener() {
@@ -1797,7 +1803,12 @@
 
             // Don't do layout here, the window must call
             // relayout to be displayed, so we'll do it there.
-            win.getParent().assignChildLayers();
+            if (win.mActivityRecord != null && win.mActivityRecord.isEmbedded()) {
+                // Assign child layers from the parent Task if the Activity is embedded.
+                win.getTask().assignChildLayers();
+            } else {
+                win.getParent().assignChildLayers();
+            }
 
             if (focusChanged) {
                 displayContent.getInputMonitor().setInputFocusLw(displayContent.mCurrentFocus,
@@ -1931,12 +1942,13 @@
 
     /**
      * Set whether screen capture is disabled for all windows of a specific user from
-     * the device policy cache.
+     * the device policy cache, or specific windows based on sensitive content protections.
      */
     @Override
     public void refreshScreenCaptureDisabled() {
         int callingUid = Binder.getCallingUid();
-        if (callingUid != SYSTEM_UID) {
+        // MY_UID (Process.myUid()) should always be SYSTEM_UID here, but using MY_UID for tests
+        if (callingUid != MY_UID) {
             throw new SecurityException("Only system can call refreshScreenCaptureDisabled.");
         }
 
@@ -7169,6 +7181,7 @@
             }
             mSystemPerformanceHinter.dump(pw, "");
             mTrustedPresentationListenerController.dump(pw);
+            mSensitiveContentPackages.dump(pw);
         }
     }
 
@@ -8550,6 +8563,14 @@
             InputTarget inputTarget = WindowManagerService.this.getInputTargetFromToken(inputToken);
             return inputTarget == null ? null : inputTarget.getWindowToken();
         }
+
+        @Override
+        public void setShouldBlockScreenCaptureForApp(Set<PackageInfo> packageInfos) {
+            synchronized (mGlobalLock) {
+                mSensitiveContentPackages.setShouldBlockScreenCaptureForApp(packageInfos);
+                WindowManagerService.this.refreshScreenCaptureDisabled();
+            }
+        }
     }
 
     private final class ImeTargetVisibilityPolicyImpl extends ImeTargetVisibilityPolicy {
diff --git a/services/core/java/com/android/server/wm/WindowState.java b/services/core/java/com/android/server/wm/WindowState.java
index 0b43be7..56f2bc3 100644
--- a/services/core/java/com/android/server/wm/WindowState.java
+++ b/services/core/java/com/android/server/wm/WindowState.java
@@ -1896,6 +1896,14 @@
         if ((mAttrs.flags & WindowManager.LayoutParams.FLAG_SECURE) != 0) {
             return true;
         }
+
+        if (com.android.server.notification.Flags.sensitiveNotificationAppProtection()) {
+            if (mWmService.mSensitiveContentPackages
+                    .shouldBlockScreenCaptureForApp(getOwningPackage(), getOwningUid())) {
+                return true;
+            }
+        }
+
         return !DevicePolicyCache.getInstance().isScreenCaptureAllowed(mShowUserId);
     }
 
diff --git a/services/core/jni/Android.bp b/services/core/jni/Android.bp
index dfa9dce..775570c 100644
--- a/services/core/jni/Android.bp
+++ b/services/core/jni/Android.bp
@@ -37,6 +37,7 @@
         "com_android_server_adb_AdbDebuggingManager.cpp",
         "com_android_server_am_BatteryStatsService.cpp",
         "com_android_server_biometrics_SurfaceToNativeHandleConverter.cpp",
+        "com_android_server_BootReceiver.cpp",
         "com_android_server_ConsumerIrService.cpp",
         "com_android_server_companion_virtual_InputController.cpp",
         "com_android_server_devicepolicy_CryptoTestHelper.cpp",
@@ -94,6 +95,16 @@
     header_libs: [
         "bionic_libc_platform_headers",
     ],
+
+    static_libs: [
+        "libunwindstack",
+    ],
+
+    whole_static_libs: [
+        "libdebuggerd_tombstone_proto_to_text",
+    ],
+
+    runtime_libs: ["libdexfile"],
 }
 
 cc_defaults {
diff --git a/services/core/jni/OWNERS b/services/core/jni/OWNERS
index cc08488..15eb7c6 100644
--- a/services/core/jni/OWNERS
+++ b/services/core/jni/OWNERS
@@ -33,3 +33,7 @@
 
 # Bug component : 158088 = per-file *AnrTimer*
 per-file *AnrTimer* = file:/PERFORMANCE_OWNERS
+
+# Bug component : 158088 = per-file com_android_server_utils_AnrTimer*.java
+per-file com_android_server_utils_AnrTimer*.java = file:/PERFORMANCE_OWNERS
+per-file com_android_server_BootReceiver.cpp = file:/STABILITY_OWNERS
diff --git a/services/core/jni/com_android_server_BootReceiver.cpp b/services/core/jni/com_android_server_BootReceiver.cpp
new file mode 100644
index 0000000..3892d28
--- /dev/null
+++ b/services/core/jni/com_android_server_BootReceiver.cpp
@@ -0,0 +1,57 @@
+/*
+ * Copyright (C) 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <libdebuggerd/tombstone.h>
+#include <nativehelper/JNIHelp.h>
+
+#include <sstream>
+
+#include "jni.h"
+#include "tombstone.pb.h"
+
+namespace android {
+
+static void writeToString(std::stringstream& ss, const std::string& line, bool should_log) {
+    ss << line << std::endl;
+}
+
+static jstring com_android_server_BootReceiver_getTombstoneText(JNIEnv* env, jobject,
+                                                                jbyteArray tombstoneBytes) {
+    Tombstone tombstone;
+    tombstone.ParseFromArray(env->GetByteArrayElements(tombstoneBytes, 0),
+                             env->GetArrayLength(tombstoneBytes));
+
+    std::stringstream tombstoneString;
+
+    tombstone_proto_to_text(tombstone,
+                            std::bind(&writeToString, std::ref(tombstoneString),
+                                      std::placeholders::_1, std::placeholders::_2));
+
+    return env->NewStringUTF(tombstoneString.str().c_str());
+}
+
+static const JNINativeMethod sMethods[] = {
+        /* name, signature, funcPtr */
+        {"getTombstoneText", "([B)Ljava/lang/String;",
+         (jstring*)com_android_server_BootReceiver_getTombstoneText},
+};
+
+int register_com_android_server_BootReceiver(JNIEnv* env) {
+    return jniRegisterNativeMethods(env, "com/android/server/BootReceiver", sMethods,
+                                    NELEM(sMethods));
+}
+
+} // namespace android
diff --git a/services/core/jni/com_android_server_utils_AnrTimer.cpp b/services/core/jni/com_android_server_utils_AnrTimer.cpp
index 97b18fa..1e48ace 100644
--- a/services/core/jni/com_android_server_utils_AnrTimer.cpp
+++ b/services/core/jni/com_android_server_utils_AnrTimer.cpp
@@ -486,9 +486,11 @@
     void remove(AnrTimerService const* service) {
         AutoMutex _l(lock_);
         timer_id_t front = headTimerId();
-        for (auto i = running_.begin(); i != running_.end(); i++) {
+        for (auto i = running_.begin(); i != running_.end(); ) {
             if (i->service == service) {
-                running_.erase(i);
+                i = running_.erase(i);
+            } else {
+                i++;
             }
         }
         if (front != headTimerId()) restartLocked();
diff --git a/services/core/jni/onload.cpp b/services/core/jni/onload.cpp
index f3158d1..a4b1f84 100644
--- a/services/core/jni/onload.cpp
+++ b/services/core/jni/onload.cpp
@@ -52,10 +52,10 @@
 int register_android_server_HardwarePropertiesManagerService(JNIEnv* env);
 int register_android_server_SyntheticPasswordManager(JNIEnv* env);
 int register_android_hardware_display_DisplayViewport(JNIEnv* env);
-int register_android_server_utils_AnrTimer(JNIEnv *env);
 int register_android_server_am_OomConnection(JNIEnv* env);
 int register_android_server_am_CachedAppOptimizer(JNIEnv* env);
 int register_android_server_am_LowMemDetector(JNIEnv* env);
+int register_android_server_utils_AnrTimer(JNIEnv *env);
 int register_com_android_server_soundtrigger_middleware_AudioSessionProviderImpl(JNIEnv* env);
 int register_com_android_server_soundtrigger_middleware_ExternalCaptureStateTracker(JNIEnv* env);
 int register_android_server_com_android_server_pm_PackageManagerShellCommandDataLoader(JNIEnv* env);
@@ -66,6 +66,7 @@
 int register_android_server_sensor_SensorService(JavaVM* vm, JNIEnv* env);
 int register_android_server_companion_virtual_InputController(JNIEnv* env);
 int register_android_server_app_GameManagerService(JNIEnv* env);
+int register_com_android_server_BootReceiver(JNIEnv* env);
 int register_com_android_server_wm_TaskFpsCallbackController(JNIEnv* env);
 int register_com_android_server_display_DisplayControl(JNIEnv* env);
 int register_com_android_server_SystemClockTime(JNIEnv* env);
@@ -114,10 +115,10 @@
     register_android_server_storage_AppFuse(env);
     register_android_server_SyntheticPasswordManager(env);
     register_android_hardware_display_DisplayViewport(env);
-    register_android_server_utils_AnrTimer(env);
     register_android_server_am_OomConnection(env);
     register_android_server_am_CachedAppOptimizer(env);
     register_android_server_am_LowMemDetector(env);
+    register_android_server_utils_AnrTimer(env);
     register_com_android_server_soundtrigger_middleware_AudioSessionProviderImpl(env);
     register_com_android_server_soundtrigger_middleware_ExternalCaptureStateTracker(env);
     register_android_server_com_android_server_pm_PackageManagerShellCommandDataLoader(env);
@@ -128,6 +129,7 @@
     register_android_server_sensor_SensorService(vm, env);
     register_android_server_companion_virtual_InputController(env);
     register_android_server_app_GameManagerService(env);
+    register_com_android_server_BootReceiver(env);
     register_com_android_server_wm_TaskFpsCallbackController(env);
     register_com_android_server_display_DisplayControl(env);
     register_com_android_server_SystemClockTime(env);
diff --git a/services/core/xsd/display-layout-config/display-layout-config.xsd b/services/core/xsd/display-layout-config/display-layout-config.xsd
index 4e95465..73c13ce 100644
--- a/services/core/xsd/display-layout-config/display-layout-config.xsd
+++ b/services/core/xsd/display-layout-config/display-layout-config.xsd
@@ -49,7 +49,7 @@
 
     <xs:complexType name="display">
         <xs:sequence>
-            <xs:element name="address" type="xs:nonNegativeInteger"/>
+            <xs:group ref="displayReference" minOccurs="1" maxOccurs="1"/>
             <xs:element name="position" type="xs:string" minOccurs="0" maxOccurs="1" />
             <xs:element name="brightnessThrottlingMapId" type="xs:string" minOccurs="0" maxOccurs="1" />
             <xs:element name="powerThrottlingMapId" type="xs:string" minOccurs="0" maxOccurs="1" />
@@ -67,4 +67,11 @@
             </xs:simpleType>
         </xs:attribute>
     </xs:complexType>
+
+    <xs:group name="displayReference">
+        <xs:choice>
+            <xs:element name="address" type="xs:nonNegativeInteger" minOccurs="0"/>
+            <xs:element name="port" type="xs:nonNegativeInteger" minOccurs="0"/>
+        </xs:choice>
+    </xs:group>
 </xs:schema>
diff --git a/services/core/xsd/display-layout-config/schema/current.txt b/services/core/xsd/display-layout-config/schema/current.txt
index 195cae5..0d2f6a8 100644
--- a/services/core/xsd/display-layout-config/schema/current.txt
+++ b/services/core/xsd/display-layout-config/schema/current.txt
@@ -3,22 +3,24 @@
 
   public class Display {
     ctor public Display();
-    method public java.math.BigInteger getAddress();
+    method public java.math.BigInteger getAddress_optional();
     method public String getBrightnessThrottlingMapId();
     method public String getDisplayGroup();
     method public java.math.BigInteger getLeadDisplayAddress();
+    method public java.math.BigInteger getPort_optional();
     method public String getPosition();
     method public String getPowerThrottlingMapId();
     method public String getRefreshRateThermalThrottlingMapId();
     method public String getRefreshRateZoneId();
     method public boolean isDefaultDisplay();
     method public boolean isEnabled();
-    method public void setAddress(java.math.BigInteger);
+    method public void setAddress_optional(java.math.BigInteger);
     method public void setBrightnessThrottlingMapId(String);
     method public void setDefaultDisplay(boolean);
     method public void setDisplayGroup(String);
     method public void setEnabled(boolean);
     method public void setLeadDisplayAddress(java.math.BigInteger);
+    method public void setPort_optional(java.math.BigInteger);
     method public void setPosition(String);
     method public void setPowerThrottlingMapId(String);
     method public void setRefreshRateThermalThrottlingMapId(String);
diff --git a/services/java/com/android/server/SystemConfigService.java b/services/java/com/android/server/SystemConfigService.java
index 6e82907..fd21a32 100644
--- a/services/java/com/android/server/SystemConfigService.java
+++ b/services/java/com/android/server/SystemConfigService.java
@@ -21,6 +21,8 @@
 import android.Manifest;
 import android.content.ComponentName;
 import android.content.Context;
+import android.content.pm.PackageManagerInternal;
+import android.os.Binder;
 import android.os.ISystemConfig;
 import android.util.ArrayMap;
 import android.util.ArraySet;
@@ -108,6 +110,15 @@
                     "Caller must hold " + Manifest.permission.QUERY_ALL_PACKAGES);
             return new ArrayList<>(SystemConfig.getInstance().getDefaultVrComponents());
         }
+
+        @Override
+        public List<String> getPreventUserDisablePackages() {
+            PackageManagerInternal pmi = LocalServices.getService(PackageManagerInternal.class);
+            return SystemConfig.getInstance().getPreventUserDisablePackages().stream()
+                    .filter(preventUserDisablePackage ->
+                            pmi.canQueryPackage(Binder.getCallingUid(), preventUserDisablePackage))
+                    .collect(toList());
+        }
     };
 
     public SystemConfigService(Context context) {
diff --git a/services/java/com/android/server/SystemServer.java b/services/java/com/android/server/SystemServer.java
index 1185a4e..86ad494 100644
--- a/services/java/com/android/server/SystemServer.java
+++ b/services/java/com/android/server/SystemServer.java
@@ -2965,6 +2965,12 @@
             t.traceEnd();
         }
 
+        if (com.android.server.notification.Flags.sensitiveNotificationAppProtection()) {
+            t.traceBegin("StartSensitiveContentProtectionManager");
+            mSystemServiceManager.startService(SensitiveContentProtectionManagerService.class);
+            t.traceEnd();
+        }
+
         // These are needed to propagate to the runnable below.
         final NetworkManagementService networkManagementF = networkManagement;
         final NetworkPolicyManagerService networkPolicyF = networkPolicy;
diff --git a/services/robotests/Android.bp b/services/robotests/Android.bp
index 52eae21..a70802a 100644
--- a/services/robotests/Android.bp
+++ b/services/robotests/Android.bp
@@ -57,9 +57,13 @@
     ],
     static_libs: [
         "androidx.test.ext.truth",
+        "Settings-robo-testutils",
+        "SettingsLib-robo-testutils",
     ],
 
     instrumentation_for: "FrameworksServicesLib",
+
+    upstream: true,
 }
 
 filegroup {
diff --git a/services/robotests/backup/Android.bp b/services/robotests/backup/Android.bp
index 8b9efb3..569786b 100644
--- a/services/robotests/backup/Android.bp
+++ b/services/robotests/backup/Android.bp
@@ -57,6 +57,8 @@
     // Include the testing libraries
     libs: [
         "mockito-robolectric-prebuilt",
+        "Settings-robo-testutils",
+        "SettingsLib-robo-testutils",
         "platform-test-annotations",
         "testng",
         "truth",
@@ -64,4 +66,6 @@
 
     instrumentation_for: "BackupFrameworksServicesLib",
 
+    upstream: true,
+
 }
diff --git a/services/robotests/backup/config/robolectric.properties b/services/robotests/backup/config/robolectric.properties
index 850557a..1ebf6d4 100644
--- a/services/robotests/backup/config/robolectric.properties
+++ b/services/robotests/backup/config/robolectric.properties
@@ -1 +1,3 @@
-sdk=NEWEST_SDK
\ No newline at end of file
+sdk=NEWEST_SDK
+looperMode=LEGACY
+shadows=com.android.server.testing.shadows.FrameworkShadowLooper
diff --git a/services/robotests/backup/src/com/android/server/backup/fullbackup/AppMetadataBackupWriterTest.java b/services/robotests/backup/src/com/android/server/backup/fullbackup/AppMetadataBackupWriterTest.java
index ee5a534..6839a06 100644
--- a/services/robotests/backup/src/com/android/server/backup/fullbackup/AppMetadataBackupWriterTest.java
+++ b/services/robotests/backup/src/com/android/server/backup/fullbackup/AppMetadataBackupWriterTest.java
@@ -57,6 +57,7 @@
             ShadowBackupDataOutput.class,
             ShadowEnvironment.class,
             ShadowFullBackup.class,
+            ShadowSigningInfo.class,
         })
 public class AppMetadataBackupWriterTest {
     private static final String TEST_PACKAGE = "com.test.package";
diff --git a/services/robotests/backup/src/com/android/server/backup/fullbackup/ShadowSigningInfo.java b/services/robotests/backup/src/com/android/server/backup/fullbackup/ShadowSigningInfo.java
new file mode 100644
index 0000000..53d807c
--- /dev/null
+++ b/services/robotests/backup/src/com/android/server/backup/fullbackup/ShadowSigningInfo.java
@@ -0,0 +1,27 @@
+/*
+ * Copyright (C) 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.server.backup.fullbackup;
+
+import static android.os.Build.VERSION_CODES.P;
+
+import android.content.pm.SigningInfo;
+
+import org.robolectric.annotation.Implements;
+
+@Implements(value = SigningInfo.class, minSdk = P)
+public class ShadowSigningInfo {
+}
diff --git a/services/robotests/src/com/android/server/location/gnss/NtpNetworkTimeHelperTest.java b/services/robotests/src/com/android/server/location/gnss/NtpNetworkTimeHelperTest.java
index 4949091..0092763 100644
--- a/services/robotests/src/com/android/server/location/gnss/NtpNetworkTimeHelperTest.java
+++ b/services/robotests/src/com/android/server/location/gnss/NtpNetworkTimeHelperTest.java
@@ -35,6 +35,7 @@
 import org.mockito.MockitoAnnotations;
 import org.robolectric.RobolectricTestRunner;
 import org.robolectric.RuntimeEnvironment;
+import org.robolectric.annotation.LooperMode;
 import org.robolectric.shadows.ShadowLooper;
 
 import java.util.concurrent.CountDownLatch;
@@ -45,6 +46,7 @@
  */
 @RunWith(RobolectricTestRunner.class)
 @Presubmit
+@LooperMode(LooperMode.Mode.LEGACY)
 public class NtpNetworkTimeHelperTest {
 
     private static final long MOCK_NTP_TIME = 1519930775453L;
diff --git a/services/robotests/src/com/android/server/testing/shadows/FrameworkShadowLooper.java b/services/robotests/src/com/android/server/testing/shadows/FrameworkShadowLooper.java
index 16d16cd..3681bd4 100644
--- a/services/robotests/src/com/android/server/testing/shadows/FrameworkShadowLooper.java
+++ b/services/robotests/src/com/android/server/testing/shadows/FrameworkShadowLooper.java
@@ -21,12 +21,15 @@
 import org.robolectric.annotation.Implementation;
 import org.robolectric.annotation.Implements;
 import org.robolectric.annotation.RealObject;
+import org.robolectric.shadows.LooperShadowPicker;
+import org.robolectric.shadows.ShadowLegacyLooper;
 import org.robolectric.shadows.ShadowLooper;
+import org.robolectric.shadows.ShadowPausedLooper;
 
 import java.util.Optional;
 
-@Implements(value = Looper.class)
-public class FrameworkShadowLooper extends ShadowLooper {
+@Implements(value = Looper.class, shadowPicker = FrameworkShadowLooper.Picker.class)
+public class FrameworkShadowLooper extends ShadowLegacyLooper {
     @RealObject private Looper mLooper;
     private Optional<Boolean> mIsCurrentThread = Optional.empty();
 
@@ -45,4 +48,10 @@
         }
         return Thread.currentThread() == mLooper.getThread();
     }
+
+    public static class Picker extends LooperShadowPicker<ShadowLooper> {
+        public Picker() {
+            super(FrameworkShadowLooper.class, ShadowPausedLooper.class);
+        }
+    }
 }
diff --git a/services/robotests/src/com/android/server/testing/shadows/ShadowApplicationPackageManager.java b/services/robotests/src/com/android/server/testing/shadows/ShadowApplicationPackageManager.java
index 4a99486..1da6759 100644
--- a/services/robotests/src/com/android/server/testing/shadows/ShadowApplicationPackageManager.java
+++ b/services/robotests/src/com/android/server/testing/shadows/ShadowApplicationPackageManager.java
@@ -95,7 +95,6 @@
         sPackageAppEnabledStates.put(packageName, Integer.valueOf(newState));  // flags unused here.
     }
 
-    @Override
     protected PackageInfo getPackageInfoAsUser(String packageName, int flags, int userId)
             throws NameNotFoundException {
         if (!sPackageInfos.containsKey(packageName)) {
diff --git a/services/tests/InputMethodSystemServerTests/Android.bp b/services/tests/InputMethodSystemServerTests/Android.bp
index ffe6dc5..56423b9 100644
--- a/services/tests/InputMethodSystemServerTests/Android.bp
+++ b/services/tests/InputMethodSystemServerTests/Android.bp
@@ -40,6 +40,7 @@
         "frameworks-base-testutils",
         "mockito-target-extended-minus-junit4",
         "platform-test-annotations",
+        "ravenwood-junit",
         "services.core",
         "service-permission.stubs.system_server",
         "servicestests-core-utils",
@@ -66,6 +67,28 @@
     },
 }
 
+android_ravenwood_test {
+    name: "FrameworksInputMethodSystemServerTests_host",
+    static_libs: [
+        "androidx.annotation_annotation",
+        "androidx.test.rules",
+        "framework",
+        "mockito_ravenwood",
+        "ravenwood-runtime",
+        "ravenwood-utils",
+        "services",
+    ],
+    libs: [
+        "android.test.base",
+        "android.test.runner",
+    ],
+    srcs: [
+        "src/com/android/server/inputmethod/**/ClientControllerTest.java",
+    ],
+    sdk_version: "test_current",
+    auto_gen_config: true,
+}
+
 android_test {
     name: "FrameworksImeTests",
     defaults: [
@@ -88,6 +111,7 @@
         "frameworks-base-testutils",
         "mockito-target-extended-minus-junit4",
         "platform-test-annotations",
+        "ravenwood-junit",
         "services.core",
         "service-permission.stubs.system_server",
         "servicestests-core-utils",
diff --git a/services/tests/InputMethodSystemServerTests/src/com/android/server/inputmethod/ClientControllerTest.java b/services/tests/InputMethodSystemServerTests/src/com/android/server/inputmethod/ClientControllerTest.java
new file mode 100644
index 0000000..3c8f5c9
--- /dev/null
+++ b/services/tests/InputMethodSystemServerTests/src/com/android/server/inputmethod/ClientControllerTest.java
@@ -0,0 +1,97 @@
+/*
+ * Copyright (C) 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package com.android.server.inputmethod;
+
+import static com.google.common.truth.Truth.assertThat;
+
+import static org.junit.Assert.assertThrows;
+import static org.mockito.Mockito.when;
+
+import android.content.pm.PackageManagerInternal;
+import android.os.Handler;
+import android.os.IBinder;
+import android.os.Looper;
+import android.platform.test.annotations.IgnoreUnderRavenwood;
+import android.platform.test.ravenwood.RavenwoodRule;
+import android.view.Display;
+import android.view.inputmethod.InputBinding;
+
+import com.android.internal.inputmethod.IInputMethodClient;
+import com.android.internal.inputmethod.IRemoteInputConnection;
+
+import org.junit.Before;
+import org.junit.Rule;
+import org.junit.Test;
+import org.mockito.Mock;
+import org.mockito.MockitoAnnotations;
+
+
+// This test is designed to run on both device and host (Ravenwood) side.
+public final class ClientControllerTest {
+    private static final int ANY_DISPLAY_ID = Display.DEFAULT_DISPLAY;
+    private static final int ANY_CALLER_UID = 1;
+    private static final int ANY_CALLER_PID = 1;
+
+    @Rule
+    public final RavenwoodRule mRavenwood = new RavenwoodRule.Builder()
+            .setProvideMainThread(true).build();
+
+    @Mock
+    private PackageManagerInternal mMockPackageManagerInternal;
+
+    @Mock(extraInterfaces = IBinder.class)
+    private IInputMethodClient mClient;
+
+    @Mock
+    private IRemoteInputConnection mConnection;
+
+    @Mock
+    private IBinder.DeathRecipient mDeathRecipient;
+
+    private Handler mHandler;
+
+    private ClientController mController;
+
+    @Before
+    public void setUp() {
+        MockitoAnnotations.initMocks(this);
+        mHandler = new Handler(Looper.getMainLooper());
+        mController = new ClientController(mMockPackageManagerInternal);
+        when(mClient.asBinder()).thenReturn((IBinder) mClient);
+    }
+
+    @Test
+    // TODO(b/314150112): Enable host side mode for this test once b/315544364 is fixed.
+    @IgnoreUnderRavenwood(blockedBy = {InputBinding.class, IInputMethodClientInvoker.class})
+    public void testAddClient_cannotAddTheSameClientTwice() {
+        var invoker = IInputMethodClientInvoker.create(mClient, mHandler);
+
+        synchronized (ImfLock.class) {
+            mController.addClient(invoker, mConnection, ANY_DISPLAY_ID, mDeathRecipient,
+                    ANY_CALLER_UID, ANY_CALLER_PID);
+
+            SecurityException thrown = assertThrows(SecurityException.class,
+                    () -> {
+                        synchronized (ImfLock.class) {
+                            mController.addClient(invoker, mConnection, ANY_DISPLAY_ID,
+                                    mDeathRecipient, ANY_CALLER_UID, ANY_CALLER_PID);
+                        }
+                    });
+            assertThat(thrown.getMessage()).isEqualTo(
+                    "uid=1/pid=1/displayId=0 is already registered");
+        }
+    }
+}
diff --git a/services/tests/InputMethodSystemServerTests/src/com/android/server/inputmethod/DefaultImeVisibilityApplierTest.java b/services/tests/InputMethodSystemServerTests/src/com/android/server/inputmethod/DefaultImeVisibilityApplierTest.java
index 3199e06..438bea4 100644
--- a/services/tests/InputMethodSystemServerTests/src/com/android/server/inputmethod/DefaultImeVisibilityApplierTest.java
+++ b/services/tests/InputMethodSystemServerTests/src/com/android/server/inputmethod/DefaultImeVisibilityApplierTest.java
@@ -22,6 +22,7 @@
 import static com.android.internal.inputmethod.SoftInputShowHideReason.HIDE_SOFT_INPUT;
 import static com.android.internal.inputmethod.SoftInputShowHideReason.HIDE_SWITCH_USER;
 import static com.android.internal.inputmethod.SoftInputShowHideReason.SHOW_SOFT_INPUT;
+import static com.android.server.inputmethod.ClientController.ClientState;
 import static com.android.server.inputmethod.ImeVisibilityStateComputer.STATE_HIDE_IME;
 import static com.android.server.inputmethod.ImeVisibilityStateComputer.STATE_HIDE_IME_EXPLICIT;
 import static com.android.server.inputmethod.ImeVisibilityStateComputer.STATE_HIDE_IME_NOT_ALWAYS;
@@ -68,8 +69,7 @@
         super.setUp();
         mVisibilityApplier =
                 (DefaultImeVisibilityApplier) mInputMethodManagerService.getVisibilityApplier();
-        mInputMethodManagerService.setAttachedClientForTesting(
-                mock(InputMethodManagerService.ClientState.class));
+        mInputMethodManagerService.setAttachedClientForTesting(mock(ClientState.class));
     }
 
     @Test
diff --git a/services/tests/displayservicetests/src/com/android/server/display/DeviceStateToLayoutMapTest.java b/services/tests/displayservicetests/src/com/android/server/display/DeviceStateToLayoutMapTest.java
index 8cc3408..567792e 100644
--- a/services/tests/displayservicetests/src/com/android/server/display/DeviceStateToLayoutMapTest.java
+++ b/services/tests/displayservicetests/src/com/android/server/display/DeviceStateToLayoutMapTest.java
@@ -25,6 +25,7 @@
 
 import androidx.test.filters.SmallTest;
 
+import com.android.server.display.feature.DisplayManagerFlags;
 import com.android.server.display.layout.DisplayIdProducer;
 import com.android.server.display.layout.Layout;
 
@@ -45,6 +46,7 @@
     private DeviceStateToLayoutMap mDeviceStateToLayoutMap;
 
     @Mock DisplayIdProducer mDisplayIdProducerMock;
+    @Mock DisplayManagerFlags mMockFlags;
 
     @Before
     public void setUp() throws IOException {
@@ -52,7 +54,7 @@
 
         Mockito.when(mDisplayIdProducerMock.getId(false)).thenReturn(1);
 
-        setupDeviceStateToLayoutMap();
+        setupDeviceStateToLayoutMap(getContent());
     }
 
     //////////////////
@@ -268,6 +270,41 @@
                 IllegalArgumentException.class, () -> layout.postProcessLocked());
     }
 
+    @Test
+    public void testPortInLayout_disabledFlag() {
+        Mockito.when(mMockFlags.isPortInDisplayLayoutEnabled()).thenReturn(false);
+        assertThrows("Expected IllegalArgumentException when using <port>",
+                IllegalArgumentException.class,
+                () -> setupDeviceStateToLayoutMap(getPortContent()));
+    }
+
+    @Test
+    public void testPortInLayout_readLayout() throws Exception {
+        Mockito.when(mMockFlags.isPortInDisplayLayoutEnabled()).thenReturn(true);
+        setupDeviceStateToLayoutMap(getPortContent());
+
+        Layout configLayout = mDeviceStateToLayoutMap.get(0);
+
+        Layout testLayout = new Layout();
+        testLayout.createDisplayLocked(DisplayAddress.fromPortAndModel(123, null),
+                /* isDefault= */ true, /* isEnabled= */ true, /* displayGroupName= */ null,
+                mDisplayIdProducerMock,  Layout.Display.POSITION_UNKNOWN,
+                /* leadDisplayAddress= */ null, /* brightnessThrottlingMapId= */ null,
+                /* refreshRateZoneId= */ null,
+                /* refreshRateThermalThrottlingMapId= */ null,
+                /* powerThrottlingMapId= */ null);
+        testLayout.createDisplayLocked(DisplayAddress.fromPhysicalDisplayId(78910L),
+                /* isDefault= */ false, /* isEnabled= */ false, /* displayGroupName= */ null,
+                mDisplayIdProducerMock, Layout.Display.POSITION_UNKNOWN,
+                /* leadDisplayAddress= */ null, /* brightnessThrottlingMapId= */ null,
+                /* refreshRateZoneId= */ null,
+                /* refreshRateThermalThrottlingMapId= */ null,
+                /* powerThrottlingMapId= */ null);
+        testLayout.postProcessLocked();
+
+        assertEquals(testLayout, configLayout);
+    }
+
     ////////////////////
     // Helper Methods //
     ////////////////////
@@ -287,13 +324,28 @@
                 /* powerThrottlingMapId= */ null);
     }
 
-    private void setupDeviceStateToLayoutMap() throws IOException {
+    private void setupDeviceStateToLayoutMap(String content) throws IOException {
         Path tempFile = Files.createTempFile("device_state_layout_map", ".tmp");
-        Files.write(tempFile, getContent().getBytes(StandardCharsets.UTF_8));
-        mDeviceStateToLayoutMap = new DeviceStateToLayoutMap(mDisplayIdProducerMock,
+        Files.write(tempFile, content.getBytes(StandardCharsets.UTF_8));
+        mDeviceStateToLayoutMap = new DeviceStateToLayoutMap(mDisplayIdProducerMock, mMockFlags,
                 tempFile.toFile());
     }
 
+    private String getPortContent() {
+        return "<?xml version='1.0' encoding='utf-8' standalone='yes' ?>\n"
+                +  "<layouts>\n"
+                +    "<layout>\n"
+                +      "<state>0</state> \n"
+                +      "<display enabled=\"true\" defaultDisplay=\"true\">\n"
+                +        "<port>123</port>\n"
+                +      "</display>\n"
+                +      "<display enabled=\"false\">\n"
+                +        "<address>78910</address>\n"
+                +      "</display>\n"
+                +    "</layout>\n"
+                +  "</layouts>\n";
+    }
+
     private String getContent() {
         return "<?xml version='1.0' encoding='utf-8' standalone='yes' ?>\n"
                 +  "<layouts>\n"
diff --git a/services/tests/displayservicetests/src/com/android/server/display/DisplayBrightnessStateTest.java b/services/tests/displayservicetests/src/com/android/server/display/DisplayBrightnessStateTest.java
index eb6e8b4..ad4d91f 100644
--- a/services/tests/displayservicetests/src/com/android/server/display/DisplayBrightnessStateTest.java
+++ b/services/tests/displayservicetests/src/com/android/server/display/DisplayBrightnessStateTest.java
@@ -96,6 +96,8 @@
                 .append(displayBrightnessState.isSlowChange())
                 .append("\n    maxBrightness:")
                 .append(displayBrightnessState.getMaxBrightness())
+                .append("\n    minBrightness:")
+                .append(displayBrightnessState.getMinBrightness())
                 .append("\n    customAnimationRate:")
                 .append(displayBrightnessState.getCustomAnimationRate())
                 .append("\n    shouldUpdateScreenBrightnessSetting:")
diff --git a/services/tests/displayservicetests/src/com/android/server/display/DisplayDeviceConfigTest.java b/services/tests/displayservicetests/src/com/android/server/display/DisplayDeviceConfigTest.java
index e370f55..c67e7c5 100644
--- a/services/tests/displayservicetests/src/com/android/server/display/DisplayDeviceConfigTest.java
+++ b/services/tests/displayservicetests/src/com/android/server/display/DisplayDeviceConfigTest.java
@@ -41,6 +41,7 @@
 import android.content.res.Resources;
 import android.content.res.TypedArray;
 import android.hardware.display.DisplayManagerInternal;
+import android.os.PowerManager;
 import android.os.Temperature;
 import android.provider.Settings;
 import android.util.SparseArray;
@@ -109,6 +110,43 @@
     }
 
     @Test
+    public void testDefaultValues() {
+        when(mResources.getString(com.android.internal.R.string.config_displayLightSensorType))
+                .thenReturn("test_light_sensor");
+        when(mResources.getBoolean(R.bool.config_automatic_brightness_available)).thenReturn(true);
+
+        mDisplayDeviceConfig = DisplayDeviceConfig.create(mContext, /* useConfigXml= */ false,
+                mFlags);
+
+        assertEquals(DisplayDeviceConfig.BRIGHTNESS_DEFAULT,
+                mDisplayDeviceConfig.getBrightnessDefault(), ZERO_DELTA);
+        assertEquals(PowerManager.BRIGHTNESS_MAX,
+                mDisplayDeviceConfig.getBrightnessRampFastDecrease(), ZERO_DELTA);
+        assertEquals(PowerManager.BRIGHTNESS_MAX,
+                mDisplayDeviceConfig.getBrightnessRampFastIncrease(), ZERO_DELTA);
+        assertEquals(PowerManager.BRIGHTNESS_MAX,
+                mDisplayDeviceConfig.getBrightnessRampSlowDecrease(), ZERO_DELTA);
+        assertEquals(PowerManager.BRIGHTNESS_MAX,
+                mDisplayDeviceConfig.getBrightnessRampSlowIncrease(), ZERO_DELTA);
+        assertEquals(PowerManager.BRIGHTNESS_MAX,
+                mDisplayDeviceConfig.getBrightnessRampSlowDecreaseIdle(), ZERO_DELTA);
+        assertEquals(PowerManager.BRIGHTNESS_MAX,
+                mDisplayDeviceConfig.getBrightnessRampSlowIncreaseIdle(), ZERO_DELTA);
+        assertEquals(0, mDisplayDeviceConfig.getBrightnessRampDecreaseMaxMillis());
+        assertEquals(0, mDisplayDeviceConfig.getBrightnessRampIncreaseMaxMillis());
+        assertEquals(0, mDisplayDeviceConfig.getBrightnessRampDecreaseMaxIdleMillis());
+        assertEquals(0, mDisplayDeviceConfig.getBrightnessRampIncreaseMaxIdleMillis());
+        assertNull(mDisplayDeviceConfig.getNits());
+        assertNull(mDisplayDeviceConfig.getBacklight());
+        assertEquals(0.3f, mDisplayDeviceConfig.getBacklightFromBrightness(0.3f), ZERO_DELTA);
+        assertEquals("test_light_sensor", mDisplayDeviceConfig.getAmbientLightSensor().type);
+        assertEquals("", mDisplayDeviceConfig.getAmbientLightSensor().name);
+        assertNull(mDisplayDeviceConfig.getProximitySensor().type);
+        assertNull(mDisplayDeviceConfig.getProximitySensor().name);
+        assertTrue(mDisplayDeviceConfig.isAutoBrightnessAvailable());
+    }
+
+    @Test
     public void testConfigValuesFromDisplayConfig() throws IOException {
         setupDisplayDeviceConfigFromDisplayConfigFile();
 
@@ -681,6 +719,7 @@
 
         assertEquals("test_light_sensor", mDisplayDeviceConfig.getAmbientLightSensor().type);
         assertEquals("", mDisplayDeviceConfig.getAmbientLightSensor().name);
+        assertTrue(mDisplayDeviceConfig.isAutoBrightnessAvailable());
 
         assertEquals(brightnessIntToFloat(35),
                 mDisplayDeviceConfig.getBrightnessCapForWearBedtimeMode(), ZERO_DELTA);
@@ -807,6 +846,24 @@
                 mDisplayDeviceConfig.getAutoBrightnessBrighteningLevelsNits(), SMALL_DELTA);
     }
 
+    @Test
+    public void testIsAutoBrightnessAvailable_EnabledInConfigResource() throws IOException {
+        when(mResources.getBoolean(R.bool.config_automatic_brightness_available)).thenReturn(true);
+
+        setupDisplayDeviceConfigFromDisplayConfigFile();
+
+        assertTrue(mDisplayDeviceConfig.isAutoBrightnessAvailable());
+    }
+
+    @Test
+    public void testIsAutoBrightnessAvailable_DisabledInConfigResource() throws IOException {
+        when(mResources.getBoolean(R.bool.config_automatic_brightness_available)).thenReturn(false);
+
+        setupDisplayDeviceConfigFromDisplayConfigFile();
+
+        assertFalse(mDisplayDeviceConfig.isAutoBrightnessAvailable());
+    }
+
     private String getValidLuxThrottling() {
         return "<luxThrottling>\n"
                 + "    <brightnessLimitMap>\n"
@@ -1176,7 +1233,7 @@
                 +           "<nits>" + NITS[2] + "</nits>\n"
                 +       "</point>\n"
                 +   "</screenBrightnessMap>\n"
-                +   "<autoBrightness>\n"
+                +   "<autoBrightness enabled=\"true\">\n"
                 +       "<brighteningLightDebounceMillis>2000</brighteningLightDebounceMillis>\n"
                 +       "<darkeningLightDebounceMillis>1000</darkeningLightDebounceMillis>\n"
                 + (includeIdleMode ? getRampSpeedsIdle() : "")
@@ -1593,6 +1650,7 @@
 
         when(mResources.getString(com.android.internal.R.string.config_displayLightSensorType))
                 .thenReturn("test_light_sensor");
+        when(mResources.getBoolean(R.bool.config_automatic_brightness_available)).thenReturn(true);
 
         when(mResources.getInteger(
                 R.integer.config_autoBrightnessBrighteningLightDebounce))
diff --git a/services/tests/displayservicetests/src/com/android/server/display/DisplayPowerStateTest.kt b/services/tests/displayservicetests/src/com/android/server/display/DisplayPowerStateTest.kt
index dafbbb3..33d3020 100644
--- a/services/tests/displayservicetests/src/com/android/server/display/DisplayPowerStateTest.kt
+++ b/services/tests/displayservicetests/src/com/android/server/display/DisplayPowerStateTest.kt
@@ -16,16 +16,24 @@
 
 package com.android.server.display
 
+import android.content.Context
+import android.os.Looper
 import android.view.Display
 import androidx.test.filters.SmallTest
 import org.junit.Before
 import org.junit.Rule
 import org.junit.Test
+import org.mockito.ArgumentMatchers.anyFloat
+import org.mockito.ArgumentMatchers.anyInt
+import org.mockito.ArgumentMatchers.eq
 import org.mockito.junit.MockitoJUnit
 
 import org.mockito.kotlin.argumentCaptor
+import org.mockito.kotlin.clearInvocations
 import org.mockito.kotlin.mock
+import org.mockito.kotlin.never
 import org.mockito.kotlin.verify
+import org.mockito.kotlin.whenever
 import java.util.concurrent.Executor
 
 @SmallTest
@@ -39,11 +47,16 @@
     private val mockBlanker = mock<DisplayBlanker>()
     private val mockColorFade = mock<ColorFade>()
     private val mockExecutor = mock<Executor>()
+    private val mockContext = mock<Context>()
 
     @Before
     fun setUp() {
+        if (Looper.myLooper() == null) {
+            Looper.prepare()
+        }
         displayPowerState = DisplayPowerState(mockBlanker, mockColorFade, 123, Display.STATE_ON,
                 mockExecutor)
+        whenever(mockColorFade.prepare(eq(mockContext), anyInt())).thenReturn(true)
     }
 
     @Test
@@ -56,4 +69,31 @@
 
         verify(mockColorFade).destroy()
     }
+
+    @Test
+    fun `GIVEN not prepared WHEN draw runnable is called THEN colorFade not drawn`() {
+        displayPowerState.mColorFadeDrawRunnable.run()
+
+        verify(mockColorFade, never()).draw(anyFloat())
+    }
+    @Test
+    fun `GIVEN prepared WHEN draw runnable is called THEN colorFade is drawn`() {
+        displayPowerState.prepareColorFade(mockContext, ColorFade.MODE_FADE)
+        clearInvocations(mockColorFade)
+
+        displayPowerState.mColorFadeDrawRunnable.run()
+
+        verify(mockColorFade).draw(anyFloat())
+    }
+
+    @Test
+    fun `GIVEN prepared AND stopped WHEN draw runnable is called THEN colorFade is not drawn`() {
+        displayPowerState.prepareColorFade(mockContext, ColorFade.MODE_FADE)
+        clearInvocations(mockColorFade)
+        displayPowerState.stop()
+
+        displayPowerState.mColorFadeDrawRunnable.run()
+
+        verify(mockColorFade, never()).draw(anyFloat())
+    }
 }
\ No newline at end of file
diff --git a/services/tests/displayservicetests/src/com/android/server/display/LocalDisplayAdapterTest.java b/services/tests/displayservicetests/src/com/android/server/display/LocalDisplayAdapterTest.java
index 00f9892..c92ce25 100644
--- a/services/tests/displayservicetests/src/com/android/server/display/LocalDisplayAdapterTest.java
+++ b/services/tests/displayservicetests/src/com/android/server/display/LocalDisplayAdapterTest.java
@@ -176,6 +176,10 @@
         when(mockArray.length()).thenReturn(0);
         when(mMockedResources.obtainTypedArray(R.array.config_maskBuiltInDisplayCutoutArray))
                 .thenReturn(mockArray);
+        when(mMockedResources.obtainTypedArray(R.array.config_displayCutoutSideOverrideArray))
+                .thenReturn(mockArray);
+        when(mMockedResources.getStringArray(R.array.config_mainBuiltInDisplayCutoutSideOverride))
+                .thenReturn(new String[]{});
         when(mMockedResources.obtainTypedArray(R.array.config_waterfallCutoutArray))
                 .thenReturn(mockArray);
         when(mMockedResources.obtainTypedArray(R.array.config_roundedCornerRadiusArray))
diff --git a/services/tests/displayservicetests/src/com/android/server/display/LogicalDisplayMapperTest.java b/services/tests/displayservicetests/src/com/android/server/display/LogicalDisplayMapperTest.java
index 28ec896..bed6f92 100644
--- a/services/tests/displayservicetests/src/com/android/server/display/LogicalDisplayMapperTest.java
+++ b/services/tests/displayservicetests/src/com/android/server/display/LogicalDisplayMapperTest.java
@@ -49,8 +49,9 @@
 import static org.mockito.ArgumentMatchers.eq;
 import static org.mockito.Mockito.atLeastOnce;
 import static org.mockito.Mockito.clearInvocations;
-import static org.mockito.Mockito.times;
 import static org.mockito.Mockito.never;
+import static org.mockito.Mockito.spy;
+import static org.mockito.Mockito.times;
 import static org.mockito.Mockito.verify;
 import static org.mockito.Mockito.when;
 
@@ -83,7 +84,6 @@
 import org.mockito.Captor;
 import org.mockito.Mock;
 import org.mockito.MockitoAnnotations;
-import org.mockito.Spy;
 
 import java.io.File;
 import java.io.InputStream;
@@ -111,14 +111,14 @@
     private final DisplayIdProducer mIdProducer = (isDefault) ->
             isDefault ? DEFAULT_DISPLAY : sNextNonDefaultDisplayId++;
 
+    private DeviceStateToLayoutMap mDeviceStateToLayoutMapSpy;
+
     @Mock LogicalDisplayMapper.Listener mListenerMock;
     @Mock Context mContextMock;
     @Mock FoldSettingProvider mFoldSettingProviderMock;
     @Mock Resources mResourcesMock;
     @Mock IPowerManager mIPowerManagerMock;
     @Mock IThermalService mIThermalServiceMock;
-    @Spy DeviceStateToLayoutMap mDeviceStateToLayoutMapSpy =
-            new DeviceStateToLayoutMap(mIdProducer, NON_EXISTING_FILE);
     @Mock DisplayManagerFlags mFlagsMock;
     @Mock DisplayAdapter mDisplayAdapterMock;
 
@@ -131,6 +131,8 @@
         System.setProperty("dexmaker.share_classloader", "true");
         MockitoAnnotations.initMocks(this);
 
+        mDeviceStateToLayoutMapSpy =
+                spy(new DeviceStateToLayoutMap(mIdProducer, mFlagsMock, NON_EXISTING_FILE));
         mDisplayDeviceRepo = new DisplayDeviceRepository(
                 new DisplayManagerService.SyncRoot(),
                 new PersistentDataStore(new PersistentDataStore.Injector() {
diff --git a/services/tests/displayservicetests/src/com/android/server/display/brightness/BrightnessReasonTest.java b/services/tests/displayservicetests/src/com/android/server/display/brightness/BrightnessReasonTest.java
index e58b3e8..990c383 100644
--- a/services/tests/displayservicetests/src/com/android/server/display/brightness/BrightnessReasonTest.java
+++ b/services/tests/displayservicetests/src/com/android/server/display/brightness/BrightnessReasonTest.java
@@ -58,9 +58,14 @@
 
     @Test
     public void setModifierDoesntSetIfModifierIsBeyondExtremes() {
-        int extremeModifier = 0x16;
+        int extremeModifier = 0x40; // equal to BrightnessReason.MODIFIER_MASK * 2
+
+        // reset modifier
+        mBrightnessReason.setModifier(0);
+
+        // test extreme
         mBrightnessReason.setModifier(extremeModifier);
-        assertEquals(mBrightnessReason.getModifier(), BrightnessReason.MODIFIER_LOW_POWER);
+        assertEquals(0, mBrightnessReason.getModifier());
     }
 
     @Test
diff --git a/services/tests/displayservicetests/src/com/android/server/display/brightness/clamper/BrightnessClamperControllerTest.java b/services/tests/displayservicetests/src/com/android/server/display/brightness/clamper/BrightnessClamperControllerTest.java
index 6ba7368..5294943 100644
--- a/services/tests/displayservicetests/src/com/android/server/display/brightness/clamper/BrightnessClamperControllerTest.java
+++ b/services/tests/displayservicetests/src/com/android/server/display/brightness/clamper/BrightnessClamperControllerTest.java
@@ -29,8 +29,10 @@
 import android.os.Handler;
 import android.os.PowerManager;
 import android.provider.DeviceConfig;
+import android.testing.TestableContext;
 
 import androidx.test.filters.SmallTest;
+import androidx.test.platform.app.InstrumentationRegistry;
 
 import com.android.server.display.DisplayBrightnessState;
 import com.android.server.display.brightness.BrightnessReason;
@@ -39,6 +41,7 @@
 import com.android.server.testutils.TestHandler;
 
 import org.junit.Before;
+import org.junit.Rule;
 import org.junit.Test;
 import org.mockito.ArgumentCaptor;
 import org.mockito.Mock;
@@ -52,14 +55,15 @@
 
     private final TestHandler mTestHandler = new TestHandler(null);
 
+    @Rule
+    public final TestableContext mMockContext = new TestableContext(
+            InstrumentationRegistry.getInstrumentation().getContext());
     @Mock
     private BrightnessClamperController.ClamperChangeListener mMockExternalListener;
 
     @Mock
     private BrightnessClamperController.DisplayDeviceData mMockDisplayDeviceData;
     @Mock
-    private Context mMockContext;
-    @Mock
     private DeviceConfigParameterProvider mMockDeviceConfigParameterProvider;
     @Mock
     private BrightnessClamper<BrightnessClamperController.DisplayDeviceData> mMockClamper;
@@ -231,6 +235,13 @@
         assertEquals(initialSlowChange, state.isSlowChange());
     }
 
+    @Test
+    public void testStop() {
+        mClamperController.stop();
+        verify(mMockModifier).stop();
+        verify(mMockClamper).stop();
+    }
+
     private BrightnessClamperController createBrightnessClamperController() {
         return new BrightnessClamperController(mTestInjector, mTestHandler, mMockExternalListener,
                 mMockDisplayDeviceData, mMockContext, mFlags);
@@ -240,14 +251,14 @@
 
         private final List<BrightnessClamper<? super BrightnessClamperController.DisplayDeviceData>>
                 mClampers;
-        private final List<BrightnessModifier> mModifiers;
+        private final List<BrightnessStateModifier> mModifiers;
 
         private BrightnessClamperController.ClamperChangeListener mCapturedChangeListener;
 
         private TestInjector(
                 List<BrightnessClamper<? super BrightnessClamperController.DisplayDeviceData>>
                         clampers,
-                List<BrightnessModifier> modifiers) {
+                List<BrightnessStateModifier> modifiers) {
             mClampers = clampers;
             mModifiers = modifiers;
         }
@@ -268,7 +279,8 @@
         }
 
         @Override
-        List<BrightnessModifier> getModifiers(Context context) {
+        List<BrightnessStateModifier> getModifiers(DisplayManagerFlags flags, Context context,
+                Handler handler, BrightnessClamperController.ClamperChangeListener listener) {
             return mModifiers;
         }
     }
diff --git a/services/tests/displayservicetests/src/com/android/server/display/brightness/clamper/BrightnessLowLuxModifierTest.kt b/services/tests/displayservicetests/src/com/android/server/display/brightness/clamper/BrightnessLowLuxModifierTest.kt
new file mode 100644
index 0000000..ac7d1f5
--- /dev/null
+++ b/services/tests/displayservicetests/src/com/android/server/display/brightness/clamper/BrightnessLowLuxModifierTest.kt
@@ -0,0 +1,91 @@
+/*
+ * Copyright (C) 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package com.android.server.display.brightness.clamper
+
+import android.os.PowerManager
+import android.os.UserHandle
+import android.provider.Settings
+import android.testing.TestableContext
+import androidx.test.platform.app.InstrumentationRegistry
+import com.android.server.display.brightness.BrightnessReason
+import com.android.server.testutils.TestHandler
+import com.google.common.truth.Truth.assertThat
+import org.junit.Before
+import org.junit.Test
+import org.mockito.kotlin.mock
+
+private const val userId = UserHandle.USER_CURRENT
+
+class BrightnessLowLuxModifierTest {
+
+    private var mockClamperChangeListener =
+            mock<BrightnessClamperController.ClamperChangeListener>()
+
+    val context = TestableContext(
+            InstrumentationRegistry.getInstrumentation().getContext())
+
+    private val testHandler = TestHandler(null)
+    private lateinit var modifier: BrightnessLowLuxModifier
+
+    @Before
+    fun setUp() {
+        modifier = BrightnessLowLuxModifier(testHandler, mockClamperChangeListener, context)
+        testHandler.flush()
+    }
+
+    @Test
+    fun testThrottlingBounds() {
+        Settings.Secure.putIntForUser(context.contentResolver,
+                Settings.Secure.EVEN_DIMMER_ACTIVATED, 1, userId) // true
+        Settings.Secure.putFloatForUser(context.contentResolver,
+                Settings.Secure.EVEN_DIMMER_MIN_NITS, 0.7f, userId)
+        modifier.recalculateLowerBound()
+        testHandler.flush()
+        assertThat(modifier.isActive).isTrue()
+
+        // TODO: code currently returns MIN/MAX; update with lux values
+        assertThat(modifier.brightnessLowerBound).isEqualTo(PowerManager.BRIGHTNESS_MIN)
+    }
+
+    @Test
+    fun testGetReason_UserSet() {
+        Settings.Secure.putIntForUser(context.contentResolver,
+                Settings.Secure.EVEN_DIMMER_ACTIVATED, 1, userId)
+        Settings.Secure.putFloatForUser(context.contentResolver,
+                Settings.Secure.EVEN_DIMMER_MIN_NITS, 0.7f, userId)
+        modifier.recalculateLowerBound()
+        testHandler.flush()
+        assertThat(modifier.isActive).isTrue()
+
+        // Test restriction from user setting
+        assertThat(modifier.brightnessReason)
+                .isEqualTo(BrightnessReason.MODIFIER_MIN_USER_SET_LOWER_BOUND)
+    }
+
+    @Test
+    fun testGetReason_Lux() {
+        Settings.Secure.putIntForUser(context.contentResolver,
+                Settings.Secure.EVEN_DIMMER_ACTIVATED, 1, userId)
+        Settings.Secure.putFloatForUser(context.contentResolver,
+                Settings.Secure.EVEN_DIMMER_MIN_NITS, 0.0f, userId)
+        modifier.recalculateLowerBound()
+        testHandler.flush()
+        assertThat(modifier.isActive).isTrue()
+
+        // Test restriction from lux setting
+        assertThat(modifier.brightnessReason).isEqualTo(BrightnessReason.MODIFIER_MIN_LUX)
+    }
+}
diff --git a/services/tests/mockingservicestests/src/com/android/server/SensitiveContentProtectionManagerServiceTest.java b/services/tests/mockingservicestests/src/com/android/server/SensitiveContentProtectionManagerServiceTest.java
new file mode 100644
index 0000000..b363fd4
--- /dev/null
+++ b/services/tests/mockingservicestests/src/com/android/server/SensitiveContentProtectionManagerServiceTest.java
@@ -0,0 +1,381 @@
+/*
+ * Copyright (C) 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.server;
+
+import static androidx.test.platform.app.InstrumentationRegistry.getInstrumentation;
+
+import static org.mockito.ArgumentMatchers.any;
+import static org.mockito.ArgumentMatchers.eq;
+import static org.mockito.Mockito.doReturn;
+import static org.mockito.Mockito.doThrow;
+import static org.mockito.Mockito.mock;
+import static org.mockito.Mockito.spy;
+import static org.mockito.Mockito.verify;
+import static org.mockito.Mockito.when;
+
+import android.media.projection.MediaProjectionInfo;
+import android.media.projection.MediaProjectionManager;
+import android.service.notification.NotificationListenerService.Ranking;
+import android.service.notification.NotificationListenerService.RankingMap;
+import android.service.notification.StatusBarNotification;
+import android.testing.AndroidTestingRunner;
+import android.testing.TestableContext;
+import android.testing.TestableLooper.RunWithLooper;
+
+import androidx.test.filters.SmallTest;
+
+import com.android.server.wm.SensitiveContentPackages.PackageInfo;
+import com.android.server.wm.WindowManagerInternal;
+
+import org.junit.After;
+import org.junit.Before;
+import org.junit.Rule;
+import org.junit.Test;
+import org.junit.runner.RunWith;
+import org.mockito.ArgumentCaptor;
+import org.mockito.Captor;
+import org.mockito.Mock;
+import org.mockito.Mockito;
+import org.mockito.MockitoAnnotations;
+
+import java.util.Collections;
+import java.util.Set;
+
+@SmallTest
+@RunWith(AndroidTestingRunner.class)
+@RunWithLooper
+public class SensitiveContentProtectionManagerServiceTest {
+    private static final String NOTIFICATION_KEY_1 = "com.android.server.notification.TEST_KEY_1";
+    private static final String NOTIFICATION_KEY_2 = "com.android.server.notification.TEST_KEY_2";
+
+    private static final String NOTIFICATION_PKG_1 = "com.android.server.notification.one";
+    private static final String NOTIFICATION_PKG_2 = "com.android.server.notification.two";
+
+    private static final int NOTIFICATION_UID_1 = 5;
+    private static final int NOTIFICATION_UID_2 = 6;
+
+    @Rule
+    public final TestableContext mContext =
+            new TestableContext(getInstrumentation().getTargetContext(), null);
+
+    private SensitiveContentProtectionManagerService mSensitiveContentProtectionManagerService;
+
+    @Captor
+    ArgumentCaptor<MediaProjectionManager.Callback> mMediaProjectionCallbackCaptor;
+
+    @Mock
+    private MediaProjectionManager mProjectionManager;
+
+    @Mock
+    private WindowManagerInternal mWindowManager;
+
+    @Mock
+    private StatusBarNotification mNotification1;
+
+    @Mock
+    private StatusBarNotification mNotification2;
+
+    @Mock
+    private RankingMap mRankingMap;
+
+    @Mock
+    private Ranking mSensitiveRanking;
+
+    @Mock
+    private Ranking mNonSensitiveRanking;
+
+    @Before
+    public void setUp() {
+        MockitoAnnotations.initMocks(this);
+
+        mSensitiveContentProtectionManagerService =
+                new SensitiveContentProtectionManagerService(mContext);
+
+        mSensitiveContentProtectionManagerService.mNotificationListener =
+                spy(mSensitiveContentProtectionManagerService.mNotificationListener);
+
+        // Setup RankingMap and two possilbe rankings
+        when(mSensitiveRanking.hasSensitiveContent()).thenReturn(true);
+        when(mNonSensitiveRanking.hasSensitiveContent()).thenReturn(false);
+        doReturn(mRankingMap)
+                .when(mSensitiveContentProtectionManagerService.mNotificationListener)
+                .getCurrentRanking();
+
+        setupSensitiveNotification();
+
+        mSensitiveContentProtectionManagerService.init(mProjectionManager, mWindowManager);
+
+        // Obtain useful mMediaProjectionCallback
+        verify(mProjectionManager).addCallback(mMediaProjectionCallbackCaptor.capture(), any());
+    }
+
+    @After
+    public void tearDown() {
+        mSensitiveContentProtectionManagerService.onDestroy();
+    }
+
+    private Set<PackageInfo> setupSensitiveNotification() {
+        // Setup Notification Values
+        when(mNotification1.getKey()).thenReturn(NOTIFICATION_KEY_1);
+        when(mNotification1.getPackageName()).thenReturn(NOTIFICATION_PKG_1);
+        when(mNotification1.getUid()).thenReturn(NOTIFICATION_UID_1);
+
+        when(mNotification2.getKey()).thenReturn(NOTIFICATION_KEY_2);
+        when(mNotification2.getPackageName()).thenReturn(NOTIFICATION_PKG_2);
+        when(mNotification2.getUid()).thenReturn(NOTIFICATION_UID_1);
+
+        StatusBarNotification[] mNotifications =
+                new StatusBarNotification[] {mNotification1, mNotification2};
+        doReturn(mNotifications)
+                .when(mSensitiveContentProtectionManagerService.mNotificationListener)
+                .getActiveNotifications();
+
+        when(mRankingMap.getRawRankingObject(eq(NOTIFICATION_KEY_1)))
+                .thenReturn(mSensitiveRanking);
+        when(mRankingMap.getRawRankingObject(eq(NOTIFICATION_KEY_2)))
+                .thenReturn(mNonSensitiveRanking);
+
+        return Set.of(new PackageInfo(NOTIFICATION_PKG_1, NOTIFICATION_UID_1));
+    }
+
+    private Set<PackageInfo> setupMultipleSensitiveNotificationsFromSamePackageAndUid() {
+        // Setup Notification Values
+        when(mNotification1.getKey()).thenReturn(NOTIFICATION_KEY_1);
+        when(mNotification1.getPackageName()).thenReturn(NOTIFICATION_PKG_1);
+        when(mNotification1.getUid()).thenReturn(NOTIFICATION_UID_1);
+
+        when(mNotification2.getKey()).thenReturn(NOTIFICATION_KEY_2);
+        when(mNotification2.getPackageName()).thenReturn(NOTIFICATION_PKG_1);
+        when(mNotification2.getUid()).thenReturn(NOTIFICATION_UID_1);
+
+        StatusBarNotification[] mNotifications =
+                new StatusBarNotification[] {mNotification1, mNotification2};
+        doReturn(mNotifications)
+                .when(mSensitiveContentProtectionManagerService.mNotificationListener)
+                .getActiveNotifications();
+
+        when(mRankingMap.getRawRankingObject(eq(NOTIFICATION_KEY_1)))
+                .thenReturn(mSensitiveRanking);
+        when(mRankingMap.getRawRankingObject(eq(NOTIFICATION_KEY_2)))
+                .thenReturn(mSensitiveRanking);
+
+        return Set.of(new PackageInfo(NOTIFICATION_PKG_1, NOTIFICATION_UID_1));
+    }
+
+    private Set<PackageInfo> setupMultipleSensitiveNotificationsFromDifferentPackage() {
+        // Setup Notification Values
+        when(mNotification1.getKey()).thenReturn(NOTIFICATION_KEY_1);
+        when(mNotification1.getPackageName()).thenReturn(NOTIFICATION_PKG_1);
+        when(mNotification1.getUid()).thenReturn(NOTIFICATION_UID_1);
+
+        when(mNotification2.getKey()).thenReturn(NOTIFICATION_KEY_2);
+        when(mNotification2.getPackageName()).thenReturn(NOTIFICATION_PKG_2);
+        when(mNotification2.getUid()).thenReturn(NOTIFICATION_UID_1);
+
+        StatusBarNotification[] mNotifications =
+                new StatusBarNotification[] {mNotification1, mNotification2};
+        doReturn(mNotifications)
+                .when(mSensitiveContentProtectionManagerService.mNotificationListener)
+                .getActiveNotifications();
+
+        when(mRankingMap.getRawRankingObject(eq(NOTIFICATION_KEY_1)))
+                .thenReturn(mSensitiveRanking);
+        when(mRankingMap.getRawRankingObject(eq(NOTIFICATION_KEY_2)))
+                .thenReturn(mSensitiveRanking);
+
+        return Set.of(new PackageInfo(NOTIFICATION_PKG_1, NOTIFICATION_UID_1),
+                new PackageInfo(NOTIFICATION_PKG_2, NOTIFICATION_UID_1));
+    }
+
+    private Set<PackageInfo> setupMultipleSensitiveNotificationsFromDifferentUid() {
+        // Setup Notification Values
+        when(mNotification1.getKey()).thenReturn(NOTIFICATION_KEY_1);
+        when(mNotification1.getPackageName()).thenReturn(NOTIFICATION_PKG_1);
+        when(mNotification1.getUid()).thenReturn(NOTIFICATION_UID_1);
+
+        when(mNotification2.getKey()).thenReturn(NOTIFICATION_KEY_2);
+        when(mNotification2.getPackageName()).thenReturn(NOTIFICATION_PKG_1);
+        when(mNotification2.getUid()).thenReturn(NOTIFICATION_UID_2);
+
+        StatusBarNotification[] mNotifications =
+                new StatusBarNotification[] {mNotification1, mNotification2};
+        doReturn(mNotifications)
+                .when(mSensitiveContentProtectionManagerService.mNotificationListener)
+                .getActiveNotifications();
+
+        when(mRankingMap.getRawRankingObject(eq(NOTIFICATION_KEY_1)))
+                .thenReturn(mSensitiveRanking);
+        when(mRankingMap.getRawRankingObject(eq(NOTIFICATION_KEY_2)))
+                .thenReturn(mSensitiveRanking);
+
+        return Set.of(new PackageInfo(NOTIFICATION_PKG_1, NOTIFICATION_UID_1),
+                new PackageInfo(NOTIFICATION_PKG_1, NOTIFICATION_UID_2));
+    }
+
+    private void setupNoSensitiveNotifications() {
+        // Setup Notification Values
+        when(mNotification1.getKey()).thenReturn(NOTIFICATION_KEY_1);
+        when(mNotification1.getPackageName()).thenReturn(NOTIFICATION_PKG_1);
+        when(mNotification1.getUid()).thenReturn(NOTIFICATION_UID_1);
+
+        StatusBarNotification[] mNotifications = new StatusBarNotification[] {mNotification1};
+        doReturn(mNotifications)
+                .when(mSensitiveContentProtectionManagerService.mNotificationListener)
+                .getActiveNotifications();
+
+        when(mRankingMap.getRawRankingObject(eq(NOTIFICATION_KEY_1)))
+                .thenReturn(mNonSensitiveRanking);
+    }
+
+    private void setupNoNotifications() {
+        // Setup Notification Values
+        StatusBarNotification[] mNotifications = new StatusBarNotification[] {};
+        doReturn(mNotifications)
+                .when(mSensitiveContentProtectionManagerService.mNotificationListener)
+                .getActiveNotifications();
+    }
+
+    @Test
+    public void mediaProjectionOnStart_onProjectionStart_setWmBlockedPackages() {
+        Set<PackageInfo> expectedBlockedPackages = setupSensitiveNotification();
+
+        mMediaProjectionCallbackCaptor.getValue().onStart(mock(MediaProjectionInfo.class));
+
+        verify(mWindowManager).setShouldBlockScreenCaptureForApp(expectedBlockedPackages);
+    }
+
+    @Test
+    public void mediaProjectionOnStart_noSensitiveNotifications_noBlockedPackages() {
+        setupNoSensitiveNotifications();
+
+        mMediaProjectionCallbackCaptor.getValue().onStart(mock(MediaProjectionInfo.class));
+
+        verify(mWindowManager).setShouldBlockScreenCaptureForApp(Collections.emptySet());
+    }
+
+    @Test
+    public void mediaProjectionOnStart_noNotifications_noBlockedPackages() {
+        setupNoNotifications();
+
+        mMediaProjectionCallbackCaptor.getValue().onStart(mock(MediaProjectionInfo.class));
+
+        verify(mWindowManager).setShouldBlockScreenCaptureForApp(Collections.emptySet());
+    }
+
+    @Test
+    public void mediaProjectionOnStart_multipleNotifications_setWmBlockedPackages() {
+        Set<PackageInfo> expectedBlockedPackages =
+                setupMultipleSensitiveNotificationsFromSamePackageAndUid();
+
+        mMediaProjectionCallbackCaptor.getValue().onStart(mock(MediaProjectionInfo.class));
+
+        verify(mWindowManager).setShouldBlockScreenCaptureForApp(expectedBlockedPackages);
+    }
+
+    @Test
+    public void mediaProjectionOnStart_multiplePackages_setWmBlockedPackages() {
+        Set<PackageInfo> expectedBlockedPackages =
+                setupMultipleSensitiveNotificationsFromDifferentPackage();
+
+        mMediaProjectionCallbackCaptor.getValue().onStart(mock(MediaProjectionInfo.class));
+
+        verify(mWindowManager).setShouldBlockScreenCaptureForApp(expectedBlockedPackages);
+    }
+
+    @Test
+    public void mediaProjectionOnStart_multipleUid_setWmBlockedPackages() {
+        Set<PackageInfo> expectedBlockedPackages =
+                setupMultipleSensitiveNotificationsFromDifferentUid();
+
+        mMediaProjectionCallbackCaptor.getValue().onStart(mock(MediaProjectionInfo.class));
+
+        verify(mWindowManager).setShouldBlockScreenCaptureForApp(expectedBlockedPackages);
+    }
+
+    @Test
+    public void mediaProjectionOnStop_onProjectionEnd_clearWmBlockedPackages() {
+        setupSensitiveNotification();
+
+        MediaProjectionInfo mediaProjectionInfo = mock(MediaProjectionInfo.class);
+        mMediaProjectionCallbackCaptor.getValue().onStart(mediaProjectionInfo);
+        Mockito.reset(mWindowManager);
+
+        mMediaProjectionCallbackCaptor.getValue().onStop(mediaProjectionInfo);
+
+        verify(mWindowManager).setShouldBlockScreenCaptureForApp(Collections.emptySet());
+    }
+
+    @Test
+    public void mediaProjectionOnStart_afterOnStop_onProjectionStart_setWmBlockedPackages() {
+        Set<PackageInfo> expectedBlockedPackages = setupSensitiveNotification();
+
+        MediaProjectionInfo mediaProjectionInfo = mock(MediaProjectionInfo.class);
+        mMediaProjectionCallbackCaptor.getValue().onStart(mediaProjectionInfo);
+        mMediaProjectionCallbackCaptor.getValue().onStop(mediaProjectionInfo);
+        Mockito.reset(mWindowManager);
+
+        mMediaProjectionCallbackCaptor.getValue().onStart(mediaProjectionInfo);
+
+        verify(mWindowManager).setShouldBlockScreenCaptureForApp(expectedBlockedPackages);
+    }
+
+    @Test
+    public void mediaProjectionOnStart_getActiveNotificationsThrows_noBlockedPackages() {
+        doThrow(SecurityException.class)
+                .when(mSensitiveContentProtectionManagerService.mNotificationListener)
+                .getActiveNotifications();
+
+        mMediaProjectionCallbackCaptor.getValue().onStart(mock(MediaProjectionInfo.class));
+
+        verify(mWindowManager).setShouldBlockScreenCaptureForApp(Collections.emptySet());
+    }
+
+    @Test
+    public void mediaProjectionOnStart_getCurrentRankingThrows_noBlockedPackages() {
+        doThrow(SecurityException.class)
+                .when(mSensitiveContentProtectionManagerService.mNotificationListener)
+                .getCurrentRanking();
+
+        mMediaProjectionCallbackCaptor.getValue().onStart(mock(MediaProjectionInfo.class));
+
+        verify(mWindowManager).setShouldBlockScreenCaptureForApp(Collections.emptySet());
+    }
+
+    @Test
+    public void mediaProjectionOnStart_getCurrentRanking_nullRankingMap_noBlockedPackages() {
+        doReturn(null)
+                .when(mSensitiveContentProtectionManagerService.mNotificationListener)
+                .getCurrentRanking();
+
+        mMediaProjectionCallbackCaptor.getValue().onStart(mock(MediaProjectionInfo.class));
+
+        verify(mWindowManager).setShouldBlockScreenCaptureForApp(Collections.emptySet());
+    }
+
+    @Test
+    public void mediaProjectionOnStart_getCurrentRanking_missingRanking_noBlockedPackages() {
+        when(mRankingMap.getRawRankingObject(eq(NOTIFICATION_KEY_1))).thenReturn(null);
+
+        doReturn(mRankingMap)
+                .when(mSensitiveContentProtectionManagerService.mNotificationListener)
+                .getCurrentRanking();
+
+        mMediaProjectionCallbackCaptor.getValue().onStart(mock(MediaProjectionInfo.class));
+
+        verify(mWindowManager).setShouldBlockScreenCaptureForApp(Collections.emptySet());
+    }
+}
diff --git a/services/tests/mockingservicestests/src/com/android/server/pm/PackageArchiverTest.java b/services/tests/mockingservicestests/src/com/android/server/pm/PackageArchiverTest.java
index e5ecdc4..0403c64 100644
--- a/services/tests/mockingservicestests/src/com/android/server/pm/PackageArchiverTest.java
+++ b/services/tests/mockingservicestests/src/com/android/server/pm/PackageArchiverTest.java
@@ -210,6 +210,9 @@
                 anyInt())).thenReturn(1);
         when(mInstallerService.getExistingDraftSessionId(anyInt(), any(), anyInt())).thenReturn(
                 PackageInstaller.SessionInfo.INVALID_ID);
+        PackageInstallerSession session = mock(PackageInstallerSession.class);
+        when(mInstallerService.getSession(anyInt())).thenReturn(session);
+        when(session.getUnarchivalStatus()).thenReturn(PackageInstaller.UNARCHIVAL_STATUS_UNSET);
         doReturn(new ParceledListSlice<>(List.of(mock(ResolveInfo.class))))
                 .when(mPackageManagerService).queryIntentReceivers(any(), any(), any(), anyLong(),
                         eq(mUserId));
diff --git a/services/tests/mockingservicestests/src/com/android/server/pm/PackageMonitorCallbackHelperTest.java b/services/tests/mockingservicestests/src/com/android/server/pm/PackageMonitorCallbackHelperTest.java
index 60cedcf..24e7242 100644
--- a/services/tests/mockingservicestests/src/com/android/server/pm/PackageMonitorCallbackHelperTest.java
+++ b/services/tests/mockingservicestests/src/com/android/server/pm/PackageMonitorCallbackHelperTest.java
@@ -108,6 +108,20 @@
     }
 
     @Test
+    public void testPackageMonitorCallback_SuspendNoAccessCallbackNotCalled() throws Exception {
+        BiFunction<Integer, Bundle, Bundle> filterExtras = (callingUid, intentExtras) -> null;
+
+        IRemoteCallback callback = createMockPackageMonitorCallback();
+        mPackageMonitorCallbackHelper.registerPackageMonitorCallback(callback, 0 /* userId */,
+                Binder.getCallingUid());
+        mPackageMonitorCallbackHelper.notifyPackageMonitor(Intent.ACTION_PACKAGES_SUSPENDED,
+                FAKE_PACKAGE_NAME, createFakeBundle(), new int[]{0}, null /* instantUserIds */,
+                null /* broadcastAllowList */, mHandler, filterExtras);
+
+        verify(callback, after(WAIT_CALLBACK_CALLED_IN_MS).never()).sendResult(any());
+    }
+
+    @Test
     public void testPackageMonitorCallback_SuspendCallbackCalled() throws Exception {
         Bundle result = new Bundle();
         result.putInt(Intent.EXTRA_UID, FAKE_PACKAGE_UID);
diff --git a/services/tests/mockingservicestests/src/com/android/server/trust/TrustManagerServiceTest.java b/services/tests/mockingservicestests/src/com/android/server/trust/TrustManagerServiceTest.java
index 9851bc1..97e94e3 100644
--- a/services/tests/mockingservicestests/src/com/android/server/trust/TrustManagerServiceTest.java
+++ b/services/tests/mockingservicestests/src/com/android/server/trust/TrustManagerServiceTest.java
@@ -16,24 +16,24 @@
 
 package com.android.server.trust;
 
-import static android.content.pm.PackageManager.PERMISSION_GRANTED;
-
 import static com.android.dx.mockito.inline.extended.ExtendedMockito.any;
+import static com.android.dx.mockito.inline.extended.ExtendedMockito.anyBoolean;
 import static com.android.dx.mockito.inline.extended.ExtendedMockito.anyInt;
 import static com.android.dx.mockito.inline.extended.ExtendedMockito.argThat;
+import static com.android.dx.mockito.inline.extended.ExtendedMockito.doAnswer;
 import static com.android.dx.mockito.inline.extended.ExtendedMockito.doReturn;
 import static com.android.dx.mockito.inline.extended.ExtendedMockito.eq;
 import static com.android.dx.mockito.inline.extended.ExtendedMockito.mock;
-import static com.android.dx.mockito.inline.extended.ExtendedMockito.mockitoSession;
 import static com.android.dx.mockito.inline.extended.ExtendedMockito.verify;
 import static com.android.dx.mockito.inline.extended.ExtendedMockito.when;
 
 import static com.google.common.truth.Truth.assertThat;
 
-import static org.mockito.ArgumentMatchers.anyBoolean;
-
 import android.Manifest;
 import android.annotation.Nullable;
+import android.app.ActivityManager;
+import android.app.IActivityManager;
+import android.app.admin.DevicePolicyManager;
 import android.app.trust.ITrustListener;
 import android.app.trust.ITrustManager;
 import android.content.BroadcastReceiver;
@@ -45,14 +45,23 @@
 import android.content.pm.PackageManager;
 import android.content.pm.ResolveInfo;
 import android.content.pm.ServiceInfo;
+import android.content.pm.UserInfo;
+import android.hardware.biometrics.BiometricManager;
 import android.net.Uri;
+import android.os.Bundle;
 import android.os.Handler;
+import android.os.HandlerThread;
 import android.os.IBinder;
 import android.os.RemoteException;
 import android.os.ServiceManager;
 import android.os.UserHandle;
-import android.os.test.TestLooper;
+import android.os.UserManager;
+import android.platform.test.annotations.RequiresFlagsEnabled;
+import android.platform.test.flag.junit.CheckFlagsRule;
+import android.platform.test.flag.junit.DeviceFlagsValueProvider;
 import android.provider.Settings;
+import android.security.Authorization;
+import android.security.authorization.IKeystoreAuthorization;
 import android.service.trust.TrustAgentService;
 import android.testing.TestableContext;
 import android.view.IWindowManager;
@@ -61,12 +70,11 @@
 import androidx.test.core.app.ApplicationProvider;
 
 import com.android.internal.widget.LockPatternUtils;
+import com.android.modules.utils.testing.ExtendedMockitoRule;
 import com.android.server.LocalServices;
 import com.android.server.SystemService;
 import com.android.server.SystemServiceManager;
 
-import com.google.android.collect.Lists;
-
 import org.junit.After;
 import org.junit.Before;
 import org.junit.Rule;
@@ -74,37 +82,74 @@
 import org.mockito.ArgumentCaptor;
 import org.mockito.ArgumentMatcher;
 import org.mockito.Mock;
-import org.mockito.MockitoSession;
-import org.mockito.junit.MockitoJUnit;
-import org.mockito.junit.MockitoRule;
 
 import java.util.ArrayList;
-import java.util.Collections;
-import java.util.Random;
+import java.util.Collection;
+import java.util.List;
 
 public class TrustManagerServiceTest {
 
     @Rule
-    public MockitoRule mMockitoRule = MockitoJUnit.rule();
+    public final ExtendedMockitoRule mExtendedMockitoRule = new ExtendedMockitoRule.Builder(this)
+            .spyStatic(ActivityManager.class)
+            .spyStatic(Authorization.class)
+            .mockStatic(ServiceManager.class)
+            .mockStatic(WindowManagerGlobal.class)
+            .build();
+
+    @Rule
+    public final CheckFlagsRule mCheckFlagsRule = DeviceFlagsValueProvider.createCheckFlagsRule();
+
     @Rule
     public final MockContext mMockContext = new MockContext(
             ApplicationProvider.getApplicationContext());
 
     private static final String URI_SCHEME_PACKAGE = "package";
-    private static final int TEST_USER_ID = UserHandle.USER_SYSTEM;
+    private static final int TEST_USER_ID = 50;
+    private static final int PARENT_USER_ID = 60;
+    private static final int PROFILE_USER_ID = 70;
+    private static final long[] PARENT_BIOMETRIC_SIDS = new long[] { 600L, 601L };
+    private static final long[] PROFILE_BIOMETRIC_SIDS = new long[] { 700L, 701L };
 
-    private final TestLooper mLooper = new TestLooper();
     private final ArrayList<ResolveInfo> mTrustAgentResolveInfoList = new ArrayList<>();
-    private final LockPatternUtils mLockPatternUtils = new LockPatternUtils(mMockContext);
-    private final TrustManagerService mService = new TrustManagerService(mMockContext);
+    private final ArrayList<ComponentName> mKnownTrustAgents = new ArrayList<>();
+    private final ArrayList<ComponentName> mEnabledTrustAgents = new ArrayList<>();
 
-    @Mock
-    private PackageManager mPackageManagerMock;
+    private @Mock ActivityManager mActivityManager;
+    private @Mock BiometricManager mBiometricManager;
+    private @Mock DevicePolicyManager mDevicePolicyManager;
+    private @Mock IKeystoreAuthorization mKeystoreAuthorization;
+    private @Mock LockPatternUtils mLockPatternUtils;
+    private @Mock PackageManager mPackageManager;
+    private @Mock UserManager mUserManager;
+    private @Mock IWindowManager mWindowManager;
+
+    private HandlerThread mHandlerThread;
+    private TrustManagerService.Injector mInjector;
+    private TrustManagerService mService;
+    private ITrustManager mTrustManager;
 
     @Before
-    public void setUp() {
-        resetTrustAgentLockSettings();
-        LocalServices.addService(SystemServiceManager.class, mock(SystemServiceManager.class));
+    public void setUp() throws Exception {
+        when(mActivityManager.isUserRunning(TEST_USER_ID)).thenReturn(true);
+        doReturn(mock(IActivityManager.class)).when(() -> ActivityManager.getService());
+
+        doReturn(mKeystoreAuthorization).when(() -> Authorization.getService());
+
+        when(mLockPatternUtils.getDevicePolicyManager()).thenReturn(mDevicePolicyManager);
+        when(mLockPatternUtils.isSecure(TEST_USER_ID)).thenReturn(true);
+        when(mLockPatternUtils.getKnownTrustAgents(TEST_USER_ID)).thenReturn(mKnownTrustAgents);
+        when(mLockPatternUtils.getEnabledTrustAgents(TEST_USER_ID)).thenReturn(mEnabledTrustAgents);
+        doAnswer(invocation -> {
+            mKnownTrustAgents.clear();
+            mKnownTrustAgents.addAll((Collection<ComponentName>) invocation.getArgument(0));
+            return null;
+        }).when(mLockPatternUtils).setKnownTrustAgents(any(), eq(TEST_USER_ID));
+        doAnswer(invocation -> {
+            mEnabledTrustAgents.clear();
+            mEnabledTrustAgents.addAll((Collection<ComponentName>) invocation.getArgument(0));
+            return null;
+        }).when(mLockPatternUtils).setEnabledTrustAgents(any(), eq(TEST_USER_ID));
 
         ArgumentMatcher<Intent> trustAgentIntentMatcher = new ArgumentMatcher<Intent>() {
             @Override
@@ -112,17 +157,43 @@
                 return TrustAgentService.SERVICE_INTERFACE.equals(argument.getAction());
             }
         };
-        when(mPackageManagerMock.queryIntentServicesAsUser(argThat(trustAgentIntentMatcher),
+        when(mPackageManager.queryIntentServicesAsUser(argThat(trustAgentIntentMatcher),
                 anyInt(), anyInt())).thenReturn(mTrustAgentResolveInfoList);
-        when(mPackageManagerMock.checkPermission(any(), any())).thenReturn(
+        when(mPackageManager.checkPermission(any(), any())).thenReturn(
                 PackageManager.PERMISSION_GRANTED);
-        mMockContext.setMockPackageManager(mPackageManagerMock);
+
+        when(mUserManager.getAliveUsers()).thenReturn(
+                List.of(new UserInfo(TEST_USER_ID, "user", UserInfo.FLAG_FULL)));
+
+        when(mWindowManager.isKeyguardLocked()).thenReturn(true);
+
+        mMockContext.addMockSystemService(ActivityManager.class, mActivityManager);
+        mMockContext.addMockSystemService(BiometricManager.class, mBiometricManager);
+        mMockContext.setMockPackageManager(mPackageManager);
+        mMockContext.addMockSystemService(UserManager.class, mUserManager);
+        doReturn(mWindowManager).when(() -> WindowManagerGlobal.getWindowManagerService());
+        LocalServices.addService(SystemServiceManager.class, mock(SystemServiceManager.class));
+
+        grantPermission(Manifest.permission.ACCESS_KEYGUARD_SECURE_STORAGE);
+        grantPermission(Manifest.permission.TRUST_LISTENER);
+
+        mHandlerThread = new HandlerThread("handler");
+        mHandlerThread.start();
+        mInjector = new TrustManagerService.Injector(mLockPatternUtils, mHandlerThread.getLooper());
+        mService = new TrustManagerService(mMockContext, mInjector);
+
+        // Get the ITrustManager from the new TrustManagerService.
+        mService.onStart();
+        ArgumentCaptor<IBinder> binderArgumentCaptor = ArgumentCaptor.forClass(IBinder.class);
+        verify(() -> ServiceManager.addService(eq(Context.TRUST_SERVICE),
+                    binderArgumentCaptor.capture(), anyBoolean(), anyInt()));
+        mTrustManager = ITrustManager.Stub.asInterface(binderArgumentCaptor.getValue());
     }
 
     @After
     public void tearDown() {
-        resetTrustAgentLockSettings();
         LocalServices.removeServiceForTest(SystemServiceManager.class);
+        mHandlerThread.quit();
     }
 
     @Test
@@ -142,10 +213,9 @@
 
         bootService();
 
-        assertThat(mLockPatternUtils.getEnabledTrustAgents(TEST_USER_ID)).containsExactly(
-                systemTrustAgent1, systemTrustAgent2);
-        assertThat(mLockPatternUtils.getKnownTrustAgents(TEST_USER_ID)).containsExactly(
-                systemTrustAgent1, systemTrustAgent2, userTrustAgent1, userTrustAgent2);
+        assertThat(mEnabledTrustAgents).containsExactly(systemTrustAgent1, systemTrustAgent2);
+        assertThat(mKnownTrustAgents).containsExactly(systemTrustAgent1, systemTrustAgent2,
+                    userTrustAgent1, userTrustAgent2);
     }
 
     @Test
@@ -162,10 +232,8 @@
 
         bootService();
 
-        assertThat(mLockPatternUtils.getEnabledTrustAgents(TEST_USER_ID)).containsExactly(
-                defaultTrustAgent);
-        assertThat(mLockPatternUtils.getKnownTrustAgents(TEST_USER_ID)).containsExactly(
-                systemTrustAgent, defaultTrustAgent);
+        assertThat(mEnabledTrustAgents).containsExactly(defaultTrustAgent);
+        assertThat(mKnownTrustAgents).containsExactly(systemTrustAgent, defaultTrustAgent);
     }
 
     @Test
@@ -174,16 +242,16 @@
                 "com.android/.SystemTrustAgent");
         ComponentName trustAgent2 = ComponentName.unflattenFromString(
                 "com.android/.AnotherSystemTrustAgent");
-        initializeEnabledAgents(trustAgent1);
+        mEnabledTrustAgents.add(trustAgent1);
+        Settings.Secure.putIntForUser(mMockContext.getContentResolver(),
+                Settings.Secure.TRUST_AGENTS_INITIALIZED, 1, TEST_USER_ID);
         addTrustAgent(trustAgent1, /* isSystemApp= */ true);
         addTrustAgent(trustAgent2, /* isSystemApp= */ true);
 
         bootService();
 
-        assertThat(mLockPatternUtils.getEnabledTrustAgents(TEST_USER_ID)).containsExactly(
-                trustAgent1);
-        assertThat(mLockPatternUtils.getKnownTrustAgents(TEST_USER_ID)).containsExactly(
-                trustAgent1, trustAgent2);
+        assertThat(mEnabledTrustAgents).containsExactly(trustAgent1);
+        assertThat(mKnownTrustAgents).containsExactly(trustAgent1, trustAgent2);
     }
 
     @Test
@@ -192,17 +260,17 @@
                 "com.android/.SystemTrustAgent");
         ComponentName trustAgent2 = ComponentName.unflattenFromString(
                 "com.android/.AnotherSystemTrustAgent");
-        initializeEnabledAgents(trustAgent1);
-        initializeKnownAgents(trustAgent1);
+        Settings.Secure.putIntForUser(mMockContext.getContentResolver(),
+                Settings.Secure.TRUST_AGENTS_INITIALIZED, 1, TEST_USER_ID);
+        Settings.Secure.putIntForUser(mMockContext.getContentResolver(),
+                Settings.Secure.KNOWN_TRUST_AGENTS_INITIALIZED, 1, TEST_USER_ID);
         addTrustAgent(trustAgent1, /* isSystemApp= */ true);
         addTrustAgent(trustAgent2, /* isSystemApp= */ true);
 
         bootService();
 
-        assertThat(mLockPatternUtils.getEnabledTrustAgents(TEST_USER_ID)).containsExactly(
-                trustAgent1, trustAgent2);
-        assertThat(mLockPatternUtils.getKnownTrustAgents(TEST_USER_ID)).containsExactly(
-                trustAgent1, trustAgent2);
+        assertThat(mEnabledTrustAgents).containsExactly(trustAgent1, trustAgent2);
+        assertThat(mKnownTrustAgents).containsExactly(trustAgent1, trustAgent2);
     }
 
     @Test
@@ -214,10 +282,8 @@
 
         mMockContext.sendPackageChangedBroadcast(newAgentComponentName);
 
-        assertThat(mLockPatternUtils.getEnabledTrustAgents(TEST_USER_ID)).containsExactly(
-                newAgentComponentName);
-        assertThat(mLockPatternUtils.getKnownTrustAgents(TEST_USER_ID)).containsExactly(
-                newAgentComponentName);
+        assertThat(mEnabledTrustAgents).containsExactly(newAgentComponentName);
+        assertThat(mKnownTrustAgents).containsExactly(newAgentComponentName);
     }
 
     @Test
@@ -235,10 +301,8 @@
 
         mMockContext.sendPackageChangedBroadcast(newAgentComponentName);
 
-        assertThat(mLockPatternUtils.getEnabledTrustAgents(TEST_USER_ID)).containsExactly(
-                defaultTrustAgent);
-        assertThat(mLockPatternUtils.getKnownTrustAgents(TEST_USER_ID)).containsExactly(
-                defaultTrustAgent, newAgentComponentName);
+        assertThat(mEnabledTrustAgents).containsExactly(defaultTrustAgent);
+        assertThat(mKnownTrustAgents).containsExactly(defaultTrustAgent, newAgentComponentName);
     }
 
     @Test
@@ -250,9 +314,8 @@
 
         mMockContext.sendPackageChangedBroadcast(newAgentComponentName);
 
-        assertThat(mLockPatternUtils.getEnabledTrustAgents(TEST_USER_ID)).isEmpty();
-        assertThat(mLockPatternUtils.getKnownTrustAgents(TEST_USER_ID)).containsExactly(
-                newAgentComponentName);
+        assertThat(mEnabledTrustAgents).isEmpty();
+        assertThat(mKnownTrustAgents).containsExactly(newAgentComponentName);
     }
 
     @Test
@@ -265,50 +328,88 @@
         addTrustAgent(systemTrustAgent2, /* isSystemApp= */ true);
         bootService();
         // Simulate user turning off systemTrustAgent2
-        mLockPatternUtils.setEnabledTrustAgents(Collections.singletonList(systemTrustAgent1),
-                TEST_USER_ID);
+        mLockPatternUtils.setEnabledTrustAgents(List.of(systemTrustAgent1), TEST_USER_ID);
 
         mMockContext.sendPackageChangedBroadcast(systemTrustAgent2);
 
-        assertThat(mLockPatternUtils.getEnabledTrustAgents(TEST_USER_ID)).containsExactly(
-                systemTrustAgent1);
+        assertThat(mEnabledTrustAgents).containsExactly(systemTrustAgent1);
     }
 
     @Test
     public void reportEnabledTrustAgentsChangedInformsListener() throws RemoteException {
-        final LockPatternUtils utils = mock(LockPatternUtils.class);
-        final TrustManagerService service = new TrustManagerService(mMockContext,
-                new TrustManagerService.Injector(utils, mLooper.getLooper()));
         final ITrustListener trustListener = mock(ITrustListener.class);
-        final IWindowManager windowManager = mock(IWindowManager.class);
-        final int userId = new Random().nextInt();
+        mTrustManager.registerTrustListener(trustListener);
+        mService.waitForIdle();
+        mTrustManager.reportEnabledTrustAgentsChanged(TEST_USER_ID);
+        mService.waitForIdle();
+        verify(trustListener).onEnabledTrustAgentsChanged(TEST_USER_ID);
+    }
 
-        mMockContext.getTestablePermissions().setPermission(Manifest.permission.TRUST_LISTENER,
-                PERMISSION_GRANTED);
+    // Tests that when the device is locked for a managed profile with a *unified* challenge, the
+    // device locked notification that is sent to Keystore contains the biometric SIDs of the parent
+    // user, not the profile.  This matches the authentication that is needed to unlock the device
+    // for the profile again.
+    @Test
+    @RequiresFlagsEnabled(android.security.Flags.FLAG_FIX_UNLOCKED_DEVICE_REQUIRED_KEYS_V2)
+    public void testLockDeviceForManagedProfileWithUnifiedChallenge_usesParentBiometricSids()
+            throws Exception {
+        setupMocksForProfile(/* unifiedChallenge= */ true);
 
-        when(utils.getKnownTrustAgents(anyInt())).thenReturn(new ArrayList<>());
+        when(mWindowManager.isKeyguardLocked()).thenReturn(false);
+        mTrustManager.reportKeyguardShowingChanged();
+        verify(mKeystoreAuthorization).onDeviceUnlocked(PARENT_USER_ID, null);
+        verify(mKeystoreAuthorization).onDeviceUnlocked(PROFILE_USER_ID, null);
 
-        MockitoSession mockSession = mockitoSession()
-                .initMocks(this)
-                .mockStatic(ServiceManager.class)
-                .mockStatic(WindowManagerGlobal.class)
-                .startMocking();
+        when(mWindowManager.isKeyguardLocked()).thenReturn(true);
+        mTrustManager.reportKeyguardShowingChanged();
+        verify(mKeystoreAuthorization)
+                .onDeviceLocked(eq(PARENT_USER_ID), eq(PARENT_BIOMETRIC_SIDS));
+        verify(mKeystoreAuthorization)
+                .onDeviceLocked(eq(PROFILE_USER_ID), eq(PARENT_BIOMETRIC_SIDS));
+    }
 
-        doReturn(windowManager).when(() -> {
-            WindowManagerGlobal.getWindowManagerService();
-        });
+    // Tests that when the device is locked for a managed profile with a *separate* challenge, the
+    // device locked notification that is sent to Keystore contains the biometric SIDs of the
+    // profile itself.  This matches the authentication that is needed to unlock the device for the
+    // profile again.
+    @Test
+    public void testLockDeviceForManagedProfileWithSeparateChallenge_usesProfileBiometricSids()
+            throws Exception {
+        setupMocksForProfile(/* unifiedChallenge= */ false);
 
-        service.onStart();
-        ArgumentCaptor<IBinder> binderArgumentCaptor = ArgumentCaptor.forClass(IBinder.class);
-        verify(() -> ServiceManager.addService(eq(Context.TRUST_SERVICE),
-                binderArgumentCaptor.capture(), anyBoolean(), anyInt()));
-        ITrustManager manager = ITrustManager.Stub.asInterface(binderArgumentCaptor.getValue());
-        manager.registerTrustListener(trustListener);
-        mLooper.dispatchAll();
-        manager.reportEnabledTrustAgentsChanged(userId);
-        mLooper.dispatchAll();
-        verify(trustListener).onEnabledTrustAgentsChanged(eq(userId));
-        mockSession.finishMocking();
+        mTrustManager.setDeviceLockedForUser(PROFILE_USER_ID, false);
+        verify(mKeystoreAuthorization).onDeviceUnlocked(PROFILE_USER_ID, null);
+
+        mTrustManager.setDeviceLockedForUser(PROFILE_USER_ID, true);
+        verify(mKeystoreAuthorization)
+                .onDeviceLocked(eq(PROFILE_USER_ID), eq(PROFILE_BIOMETRIC_SIDS));
+    }
+
+    private void setupMocksForProfile(boolean unifiedChallenge) {
+        UserInfo parent = new UserInfo(PARENT_USER_ID, "parent", UserInfo.FLAG_FULL);
+        UserInfo profile = new UserInfo(PROFILE_USER_ID, "profile", UserInfo.FLAG_MANAGED_PROFILE);
+        when(mUserManager.getAliveUsers()).thenReturn(List.of(parent, profile));
+        when(mUserManager.getUserInfo(PARENT_USER_ID)).thenReturn(parent);
+        when(mUserManager.getUserInfo(PROFILE_USER_ID)).thenReturn(profile);
+        when(mUserManager.getProfileParent(PROFILE_USER_ID)).thenReturn(parent);
+        when(mUserManager.getEnabledProfileIds(PARENT_USER_ID))
+                .thenReturn(new int[] { PROFILE_USER_ID });
+
+        when(mLockPatternUtils.isSecure(anyInt())).thenReturn(true);
+        when(mLockPatternUtils.isProfileWithUnifiedChallenge(PROFILE_USER_ID))
+                .thenReturn(unifiedChallenge);
+        when(mLockPatternUtils.isManagedProfileWithUnifiedChallenge(PROFILE_USER_ID))
+                .thenReturn(unifiedChallenge);
+        when(mLockPatternUtils.isSeparateProfileChallengeEnabled(PROFILE_USER_ID))
+                .thenReturn(!unifiedChallenge);
+
+        when(mBiometricManager.getAuthenticatorIds(PARENT_USER_ID))
+                .thenReturn(PARENT_BIOMETRIC_SIDS);
+        when(mBiometricManager.getAuthenticatorIds(PROFILE_USER_ID))
+                .thenReturn(PROFILE_BIOMETRIC_SIDS);
+
+        bootService();
+        mService.onUserSwitching(null, new SystemService.TargetUser(parent));
     }
 
     private void addTrustAgent(ComponentName agentComponentName, boolean isSystemApp) {
@@ -327,27 +428,16 @@
         mTrustAgentResolveInfoList.add(resolveInfo);
     }
 
-    private void initializeEnabledAgents(ComponentName... enabledAgents) {
-        mLockPatternUtils.setEnabledTrustAgents(Lists.newArrayList(enabledAgents), TEST_USER_ID);
-        Settings.Secure.putIntForUser(mMockContext.getContentResolver(),
-                Settings.Secure.TRUST_AGENTS_INITIALIZED, 1, TEST_USER_ID);
-    }
-
-    private void initializeKnownAgents(ComponentName... knownAgents) {
-        mLockPatternUtils.setKnownTrustAgents(Lists.newArrayList(knownAgents), TEST_USER_ID);
-        Settings.Secure.putIntForUser(mMockContext.getContentResolver(),
-                Settings.Secure.KNOWN_TRUST_AGENTS_INITIALIZED, 1, TEST_USER_ID);
-    }
-
     private void bootService() {
         mService.onBootPhase(SystemService.PHASE_SYSTEM_SERVICES_READY);
         mService.onBootPhase(SystemService.PHASE_THIRD_PARTY_APPS_CAN_START);
         mService.onBootPhase(SystemService.PHASE_BOOT_COMPLETED);
+        mMockContext.sendUserStartedBroadcast();
     }
 
-    private void resetTrustAgentLockSettings() {
-        mLockPatternUtils.setEnabledTrustAgents(Collections.emptyList(), TEST_USER_ID);
-        mLockPatternUtils.setKnownTrustAgents(Collections.emptyList(), TEST_USER_ID);
+    private void grantPermission(String permission) {
+        mMockContext.getTestablePermissions().setPermission(
+                permission, PackageManager.PERMISSION_GRANTED);
     }
 
     /** A mock Context that allows the test process to send protected broadcasts. */
@@ -355,6 +445,8 @@
 
         private final ArrayList<BroadcastReceiver> mPackageChangedBroadcastReceivers =
                 new ArrayList<>();
+        private final ArrayList<BroadcastReceiver> mUserStartedBroadcastReceivers =
+                new ArrayList<>();
 
         MockContext(Context base) {
             super(base);
@@ -369,10 +461,18 @@
             if (filter.hasAction(Intent.ACTION_PACKAGE_CHANGED)) {
                 mPackageChangedBroadcastReceivers.add(receiver);
             }
+            if (filter.hasAction(Intent.ACTION_USER_STARTED)) {
+                mUserStartedBroadcastReceivers.add(receiver);
+            }
             return super.registerReceiverAsUser(receiver, user, filter, broadcastPermission,
                     scheduler);
         }
 
+        @Override
+        public void sendBroadcastAsUser(Intent intent, UserHandle user,
+                @Nullable String receiverPermission, @Nullable Bundle options) {
+        }
+
         void sendPackageChangedBroadcast(ComponentName changedComponent) {
             Intent intent = new Intent(
                     Intent.ACTION_PACKAGE_CHANGED,
@@ -386,5 +486,13 @@
                 receiver.onReceive(this, intent);
             }
         }
+
+        void sendUserStartedBroadcast() {
+            Intent intent = new Intent(Intent.ACTION_USER_STARTED)
+                    .putExtra(Intent.EXTRA_USER_HANDLE, TEST_USER_ID);
+            for (BroadcastReceiver receiver : mUserStartedBroadcastReceivers) {
+                receiver.onReceive(this, intent);
+            }
+        }
     }
 }
diff --git a/services/tests/servicestests/Android.bp b/services/tests/servicestests/Android.bp
index 9b84190..0045026 100644
--- a/services/tests/servicestests/Android.bp
+++ b/services/tests/servicestests/Android.bp
@@ -215,6 +215,16 @@
 }
 
 java_library {
+    name: "mockito-test-utils",
+    srcs: [
+        "utils-mockito/**/*.kt",
+    ],
+    static_libs: [
+        "mockito-target-minus-junit4",
+    ],
+}
+
+java_library {
     name: "servicestests-utils-mockito-extended",
     srcs: [
         "utils/**/*.java",
diff --git a/services/tests/servicestests/src/com/android/server/BootReceiverTest.java b/services/tests/servicestests/src/com/android/server/BootReceiverTest.java
new file mode 100644
index 0000000..523c5c0
--- /dev/null
+++ b/services/tests/servicestests/src/com/android/server/BootReceiverTest.java
@@ -0,0 +1,97 @@
+/*
+ * Copyright (C) 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.server;
+
+import static com.google.common.truth.Truth.assertThat;
+
+import android.test.AndroidTestCase;
+
+import com.android.server.os.TombstoneProtos;
+import com.android.server.os.TombstoneProtos.Tombstone;
+
+public class BootReceiverTest extends AndroidTestCase {
+    private static final String TAG = "BootReceiverTest";
+
+    public void testRemoveMemoryFromTombstone() {
+        Tombstone tombstoneBase = Tombstone.newBuilder()
+                .setBuildFingerprint("build_fingerprint")
+                .setRevision("revision")
+                .setPid(123)
+                .setTid(23)
+                .setUid(34)
+                .setSelinuxLabel("selinux_label")
+                .addCommandLine("cmd1")
+                .addCommandLine("cmd2")
+                .addCommandLine("cmd3")
+                .setProcessUptime(300)
+                .setAbortMessage("abort")
+                .addCauses(TombstoneProtos.Cause.newBuilder()
+                        .setHumanReadable("cause1")
+                        .setMemoryError(TombstoneProtos.MemoryError.newBuilder()
+                                .setTool(TombstoneProtos.MemoryError.Tool.SCUDO)
+                                .setType(TombstoneProtos.MemoryError.Type.DOUBLE_FREE)))
+                .addLogBuffers(TombstoneProtos.LogBuffer.newBuilder().setName("name").addLogs(
+                        TombstoneProtos.LogMessage.newBuilder()
+                                .setTimestamp("123")
+                                .setMessage("message")))
+                .addOpenFds(TombstoneProtos.FD.newBuilder().setFd(1).setPath("path"))
+                .build();
+
+        Tombstone tombstoneWithoutMemory = tombstoneBase.toBuilder()
+                .putThreads(1, TombstoneProtos.Thread.newBuilder()
+                        .setId(1)
+                        .setName("thread1")
+                        .addRegisters(TombstoneProtos.Register.newBuilder().setName("r1").setU64(1))
+                        .addRegisters(TombstoneProtos.Register.newBuilder().setName("r2").setU64(2))
+                        .addBacktraceNote("backtracenote1")
+                        .addUnreadableElfFiles("files1")
+                        .setTaggedAddrCtrl(1)
+                        .setPacEnabledKeys(10)
+                        .build())
+                .build();
+
+        Tombstone tombstoneWithMemory = tombstoneBase.toBuilder()
+                .addMemoryMappings(TombstoneProtos.MemoryMapping.newBuilder()
+                        .setBeginAddress(1)
+                        .setEndAddress(100)
+                        .setOffset(10)
+                        .setRead(true)
+                        .setWrite(true)
+                        .setExecute(false)
+                        .setMappingName("mapping")
+                        .setBuildId("build")
+                        .setLoadBias(70))
+                .putThreads(1, TombstoneProtos.Thread.newBuilder()
+                        .setId(1)
+                        .setName("thread1")
+                        .addRegisters(TombstoneProtos.Register.newBuilder().setName("r1").setU64(1))
+                        .addRegisters(TombstoneProtos.Register.newBuilder().setName("r2").setU64(2))
+                        .addBacktraceNote("backtracenote1")
+                        .addUnreadableElfFiles("files1")
+                        .addMemoryDump(TombstoneProtos.MemoryDump.newBuilder()
+                                .setRegisterName("register1")
+                                .setMappingName("mapping")
+                                .setBeginAddress(10))
+                        .setTaggedAddrCtrl(1)
+                        .setPacEnabledKeys(10)
+                        .build())
+                .build();
+
+        assertThat(BootReceiver.removeMemoryFromTombstone(tombstoneWithMemory))
+                .isEqualTo(tombstoneWithoutMemory);
+    }
+}
diff --git a/services/tests/servicestests/src/com/android/server/companion/virtual/VirtualDeviceManagerServiceTest.java b/services/tests/servicestests/src/com/android/server/companion/virtual/VirtualDeviceManagerServiceTest.java
index 995d1f4..276c832 100644
--- a/services/tests/servicestests/src/com/android/server/companion/virtual/VirtualDeviceManagerServiceTest.java
+++ b/services/tests/servicestests/src/com/android/server/companion/virtual/VirtualDeviceManagerServiceTest.java
@@ -1982,8 +1982,8 @@
         return new AssociationInfo(associationId, /* userId= */ 0, /* packageName=*/ null,
                 /* tag= */ null, MacAddress.BROADCAST_ADDRESS, /* displayName= */ "", deviceProfile,
                 /* associatedDevice= */ null, /* selfManaged= */ true,
-                /* notifyOnDeviceNearby= */ false, /* revoked= */false,  /* timeApprovedMs= */0,
-                /* lastTimeConnectedMs= */0, /* systemDataSyncFlags= */ -1);
+                /* notifyOnDeviceNearby= */ false, /* revoked= */ false, /* pending= */ false,
+                /* timeApprovedMs= */0, /* lastTimeConnectedMs= */0, /* systemDataSyncFlags= */ -1);
     }
 
     /** Helper class to drop permissions temporarily and restore them at the end of a test. */
diff --git a/services/tests/servicestests/src/com/android/server/inputmethod/InputMethodUtilsTest.java b/services/tests/servicestests/src/com/android/server/inputmethod/InputMethodUtilsTest.java
index a2f8c8b..6b85a32 100644
--- a/services/tests/servicestests/src/com/android/server/inputmethod/InputMethodUtilsTest.java
+++ b/services/tests/servicestests/src/com/android/server/inputmethod/InputMethodUtilsTest.java
@@ -25,10 +25,8 @@
 import static org.junit.Assert.assertNotNull;
 import static org.junit.Assert.assertNull;
 import static org.junit.Assert.assertTrue;
-import static org.mockito.Mockito.atLeastOnce;
 import static org.mockito.Mockito.doReturn;
 import static org.mockito.Mockito.mock;
-import static org.mockito.Mockito.verify;
 import static org.mockito.Mockito.when;
 
 import android.content.ContentResolver;
@@ -1223,35 +1221,6 @@
                 StartInputFlags.VIEW_HAS_FOCUS | StartInputFlags.IS_TEXT_EDITOR));
     }
 
-    @Test
-    public void testInputMethodSettings_SwitchCurrentUser() {
-        TestContext ownerUserContext = createMockContext(0 /* userId */);
-        final InputMethodInfo systemIme = createFakeInputMethodInfo(
-                "SystemIme", "fake.latin", true /* isSystem */);
-        final InputMethodInfo nonSystemIme = createFakeInputMethodInfo("NonSystemIme",
-                "fake.voice0", false /* isSystem */);
-        final ArrayMap<String, InputMethodInfo> methodMap = new ArrayMap<>();
-        methodMap.put(systemIme.getId(), systemIme);
-
-        // Init InputMethodSettings for the owner user (userId=0), verify calls can get the
-        // corresponding user's context, contentResolver and the resources configuration.
-        InputMethodUtils.InputMethodSettings settings = new InputMethodUtils.InputMethodSettings(
-                methodMap, 0 /* userId */);
-        assertEquals(0, settings.getCurrentUserId());
-
-        settings.getEnabledInputMethodSubtypeListLocked(nonSystemIme, true);
-        verify(ownerUserContext.getResources(), atLeastOnce()).getConfiguration();
-
-        // Calling switchCurrentUser to the secondary user (userId=10), verify calls can get the
-        // corresponding user's context, contentResolver and the resources configuration.
-        settings.switchCurrentUser(10 /* userId */);
-        assertEquals(10, settings.getCurrentUserId());
-
-        settings.getEnabledInputMethodSubtypeListLocked(nonSystemIme, true);
-        verify(TestContext.getSecondaryUserContext().getResources(),
-                atLeastOnce()).getConfiguration();
-    }
-
     private static IntArray createSubtypeHashCodeArrayFromStr(String subtypeHashCodesStr) {
         final IntArray subtypes = new IntArray();
         final TextUtils.SimpleStringSplitter imeSubtypeSplitter =
diff --git a/services/tests/servicestests/src/com/android/server/pm/parsing/AndroidPackageParsingValidationTest.kt b/services/tests/servicestests/src/com/android/server/pm/parsing/AndroidPackageParsingValidationTest.kt
index 6a088d9..757abde 100644
--- a/services/tests/servicestests/src/com/android/server/pm/parsing/AndroidPackageParsingValidationTest.kt
+++ b/services/tests/servicestests/src/com/android/server/pm/parsing/AndroidPackageParsingValidationTest.kt
@@ -157,7 +157,7 @@
         validateTagCount("uses-library", 1000, tag)
         validateTagCount("activity-alias", 4000, tag)
         validateTagCount("provider", 8000, tag)
-        validateTagCount("activity", 40000, tag)
+        validateTagCount("activity", 30000, tag)
     }
 
     @Test
@@ -465,7 +465,8 @@
             R.styleable.AndroidManifestData_pathAdvancedPattern,
             4000
         )
-        validateTagAttr(tag, "mimeType", R.styleable.AndroidManifestData_mimeType, 512)
+        validateTagAttr(tag, "mimeType", R.styleable.AndroidManifestData_mimeType, 255)
+        validateTagAttr(tag, "mimeGroup", R.styleable.AndroidManifestData_mimeGroup, 1024)
     }
 
     @Test
diff --git a/services/tests/uiservicestests/src/com/android/server/notification/NotificationAttentionHelperTest.java b/services/tests/uiservicestests/src/com/android/server/notification/NotificationAttentionHelperTest.java
index cf8548c..1b77b99 100644
--- a/services/tests/uiservicestests/src/com/android/server/notification/NotificationAttentionHelperTest.java
+++ b/services/tests/uiservicestests/src/com/android/server/notification/NotificationAttentionHelperTest.java
@@ -19,17 +19,21 @@
 import static android.app.Notification.GROUP_ALERT_ALL;
 import static android.app.Notification.GROUP_ALERT_CHILDREN;
 import static android.app.Notification.GROUP_ALERT_SUMMARY;
+import static android.app.NotificationManager.IMPORTANCE_DEFAULT;
 import static android.app.NotificationManager.IMPORTANCE_HIGH;
 import static android.app.NotificationManager.IMPORTANCE_LOW;
 import static android.app.NotificationManager.IMPORTANCE_MIN;
 import static android.app.NotificationManager.Policy.SUPPRESSED_EFFECT_LIGHTS;
 import static android.media.AudioAttributes.USAGE_NOTIFICATION;
 import static android.media.AudioAttributes.USAGE_NOTIFICATION_RINGTONE;
+
 import static junit.framework.Assert.assertFalse;
 import static junit.framework.Assert.assertNull;
 import static junit.framework.Assert.assertTrue;
+
 import static org.junit.Assert.assertEquals;
 import static org.junit.Assert.assertNotEquals;
+
 import static org.mockito.ArgumentMatchers.anyFloat;
 import static org.mockito.ArgumentMatchers.any;
 import static org.mockito.ArgumentMatchers.anyBoolean;
@@ -195,7 +199,8 @@
         // TODO (b/291907312): remove feature flag
         mSetFlagsRule.enableFlags(Flags.FLAG_REFACTOR_ATTENTION_HELPER);
         // Disable feature flags by default. Tests should enable as needed.
-        mSetFlagsRule.disableFlags(Flags.FLAG_POLITE_NOTIFICATIONS, Flags.FLAG_EXPIRE_BITMAPS);
+        mSetFlagsRule.disableFlags(Flags.FLAG_POLITE_NOTIFICATIONS,
+                Flags.FLAG_CROSS_APP_POLITE_NOTIFICATIONS, Flags.FLAG_VIBRATE_WHILE_UNLOCKED);
 
         mService = spy(new NotificationManagerService(getContext(), mNotificationRecordLogger,
             mNotificationInstanceIdSequence));
@@ -364,10 +369,20 @@
     }
 
     private NotificationRecord getNotificationRecord(int id,
-        boolean insistent, boolean once,
-        boolean noisy, boolean buzzy, boolean lights, boolean defaultVibration,
-        boolean defaultSound, boolean defaultLights, String groupKey, int groupAlertBehavior,
-        boolean isLeanback, UserHandle userHandle) {
+            boolean insistent, boolean once,
+            boolean noisy, boolean buzzy, boolean lights, boolean defaultVibration,
+            boolean defaultSound, boolean defaultLights, String groupKey, int groupAlertBehavior,
+            boolean isLeanback, UserHandle userHandle) {
+        return getNotificationRecord(id, insistent, once, noisy, buzzy, lights, defaultVibration,
+                defaultSound, defaultLights, groupKey, groupAlertBehavior, isLeanback, userHandle,
+                mPkg);
+    }
+
+    private NotificationRecord getNotificationRecord(int id,
+            boolean insistent, boolean once,
+            boolean noisy, boolean buzzy, boolean lights, boolean defaultVibration,
+            boolean defaultSound, boolean defaultLights, String groupKey, int groupAlertBehavior,
+            boolean isLeanback, UserHandle userHandle, String packageName) {
 
         final Builder builder = new Builder(getContext())
             .setContentTitle("foo")
@@ -427,8 +442,8 @@
         when(packageManager.hasSystemFeature(PackageManager.FEATURE_LEANBACK))
             .thenReturn(isLeanback);
 
-        StatusBarNotification sbn = new StatusBarNotification(mPkg, mPkg, id, mTag, mUid,
-            mPid, n, userHandle, null, System.currentTimeMillis());
+        StatusBarNotification sbn = new StatusBarNotification(packageName, packageName, id, mTag,
+                mUid, mPid, n, userHandle, null, System.currentTimeMillis());
         NotificationRecord r = new NotificationRecord(context, sbn, mChannel);
         mService.addNotification(r);
         return r;
@@ -1990,7 +2005,6 @@
     public void testBeepVolume_politeNotif() throws Exception {
         mSetFlagsRule.enableFlags(Flags.FLAG_POLITE_NOTIFICATIONS);
         TestableFlagResolver flagResolver = new TestableFlagResolver();
-        flagResolver.setFlagOverride(NotificationFlags.NOTIF_COOLDOWN_RULE, "rule1");
         flagResolver.setFlagOverride(NotificationFlags.NOTIF_VOLUME1, 50);
         flagResolver.setFlagOverride(NotificationFlags.NOTIF_VOLUME2, 0);
         initAttentionHelper(flagResolver);
@@ -2015,13 +2029,11 @@
         assertNotEquals(-1, r.getLastAudiblyAlertedMs());
     }
 
-    // TODO b/270456865: Only one of the two strategies will be released.
-    //  The other one need to be removed
     @Test
-    public void testBeepVolume_politeNotif_Strategy2() throws Exception {
+    public void testBeepVolume_politeNotif_GlobalStrategy() throws Exception {
         mSetFlagsRule.enableFlags(Flags.FLAG_POLITE_NOTIFICATIONS);
+        mSetFlagsRule.enableFlags(Flags.FLAG_CROSS_APP_POLITE_NOTIFICATIONS);
         TestableFlagResolver flagResolver = new TestableFlagResolver();
-        flagResolver.setFlagOverride(NotificationFlags.NOTIF_COOLDOWN_RULE, "rule2");
         flagResolver.setFlagOverride(NotificationFlags.NOTIF_VOLUME1, 50);
         flagResolver.setFlagOverride(NotificationFlags.NOTIF_VOLUME2, 0);
         initAttentionHelper(flagResolver);
@@ -2032,14 +2044,58 @@
         mAttentionHelper.buzzBeepBlinkLocked(r, DEFAULT_SIGNALS);
         Mockito.reset(mRingtonePlayer);
 
-        // update should beep at 0% volume
-        r.isUpdate = true;
-        mAttentionHelper.buzzBeepBlinkLocked(r, DEFAULT_SIGNALS);
+        // Use different package for next notifications
+        NotificationRecord r2 = getNotificationRecord(mId, false /* insistent */, false /* once */,
+                true /* noisy */, false /* buzzy*/, false /* lights */, true, true,
+                false, null, Notification.GROUP_ALERT_ALL, false, mUser, "anotherPkg");
+
+        // update should beep at 50% volume
+        mAttentionHelper.buzzBeepBlinkLocked(r2, DEFAULT_SIGNALS);
+        verifyBeepVolume(0.5f);
+
+        // Use different package for next notifications
+        NotificationRecord r3 = getNotificationRecord(mId, false /* insistent */, false /* once */,
+                true /* noisy */, false /* buzzy*/, false /* lights */, true, true,
+                false, null, Notification.GROUP_ALERT_ALL, false, mUser, "yetAnotherPkg");
+
+        // 2nd update should beep at 0% volume
+        Mockito.reset(mRingtonePlayer);
+        mAttentionHelper.buzzBeepBlinkLocked(r3, DEFAULT_SIGNALS);
         verifyBeepVolume(0.0f);
 
+        verify(mAccessibilityService, times(3)).sendAccessibilityEvent(any(), anyInt());
+        assertNotEquals(-1, r.getLastAudiblyAlertedMs());
+    }
+
+    @Test
+    public void testBeepVolume_politeNotif_GlobalStrategy_ChannelHasUserSound() throws Exception {
+        mSetFlagsRule.enableFlags(Flags.FLAG_POLITE_NOTIFICATIONS);
+        mSetFlagsRule.enableFlags(Flags.FLAG_CROSS_APP_POLITE_NOTIFICATIONS);
+        TestableFlagResolver flagResolver = new TestableFlagResolver();
+        flagResolver.setFlagOverride(NotificationFlags.NOTIF_VOLUME1, 50);
+        flagResolver.setFlagOverride(NotificationFlags.NOTIF_VOLUME2, 0);
+        initAttentionHelper(flagResolver);
+
+        NotificationRecord r = getBeepyNotification();
+
+        // set up internal state
+        mAttentionHelper.buzzBeepBlinkLocked(r, DEFAULT_SIGNALS);
+        Mockito.reset(mRingtonePlayer);
+
+        // Use package with user-set sounds for next notifications
+        mChannel = new NotificationChannel("test2", "test2", IMPORTANCE_DEFAULT);
+        mChannel.lockFields(NotificationChannel.USER_LOCKED_SOUND);
+        NotificationRecord r2 = getNotificationRecord(mId, false /* insistent */, false /* once */,
+                true /* noisy */, false /* buzzy*/, false /* lights */, true, true,
+                false, null, Notification.GROUP_ALERT_ALL, false, mUser, "anotherPkg");
+
+        // update should beep at 100% volume
+        mAttentionHelper.buzzBeepBlinkLocked(r2, DEFAULT_SIGNALS);
+        verifyBeepVolume(1.0f);
+
         // 2nd update should beep at 50% volume
         Mockito.reset(mRingtonePlayer);
-        mAttentionHelper.buzzBeepBlinkLocked(r, DEFAULT_SIGNALS);
+        mAttentionHelper.buzzBeepBlinkLocked(r2, DEFAULT_SIGNALS);
         verifyBeepVolume(0.5f);
 
         verify(mAccessibilityService, times(3)).sendAccessibilityEvent(any(), anyInt());
@@ -2047,10 +2103,101 @@
     }
 
     @Test
+    public void testBeepVolume_politeNotif_applyPerApp() throws Exception {
+        mSetFlagsRule.enableFlags(Flags.FLAG_POLITE_NOTIFICATIONS);
+        mSetFlagsRule.disableFlags(Flags.FLAG_CROSS_APP_POLITE_NOTIFICATIONS);
+        TestableFlagResolver flagResolver = new TestableFlagResolver();
+        flagResolver.setFlagOverride(NotificationFlags.NOTIF_VOLUME1, 50);
+        flagResolver.setFlagOverride(NotificationFlags.NOTIF_VOLUME2, 0);
+        // NOTIFICATION_COOLDOWN_ALL setting is enabled
+        Settings.System.putInt(getContext().getContentResolver(),
+                Settings.System.NOTIFICATION_COOLDOWN_ALL, 1);
+        initAttentionHelper(flagResolver);
+
+        NotificationRecord r = getBeepyNotification();
+
+        // set up internal state
+        mAttentionHelper.buzzBeepBlinkLocked(r, DEFAULT_SIGNALS);
+        Mockito.reset(mRingtonePlayer);
+
+        // Use different channel for next notifications
+        mChannel = new NotificationChannel("test2", "test2", IMPORTANCE_DEFAULT);
+
+        // update should beep at 50% volume
+        NotificationRecord r2 = getBeepyNotification();
+        mAttentionHelper.buzzBeepBlinkLocked(r2, DEFAULT_SIGNALS);
+        verifyBeepVolume(0.5f);
+
+        // 2nd update should beep at 0% volume
+        Mockito.reset(mRingtonePlayer);
+        mAttentionHelper.buzzBeepBlinkLocked(r2, DEFAULT_SIGNALS);
+        verifyBeepVolume(0.0f);
+
+        // Use different package for next notifications
+        NotificationRecord r3 = getNotificationRecord(mId, false /* insistent */, false /* once */,
+                true /* noisy */, false /* buzzy*/, false /* lights */, true, true,
+                false, null, Notification.GROUP_ALERT_ALL, false, mUser, "anotherPkg");
+
+        // Update from new package should beep at 100% volume
+        Mockito.reset(mRingtonePlayer);
+        mAttentionHelper.buzzBeepBlinkLocked(r3, DEFAULT_SIGNALS);
+        verifyBeepVolume(1.0f);
+
+        verify(mAccessibilityService, times(4)).sendAccessibilityEvent(any(), anyInt());
+        assertNotEquals(-1, r.getLastAudiblyAlertedMs());
+    }
+
+    @Test
+    public void testBeepVolume_politeNotif_applyPerApp_ChannelHasUserSound() throws Exception {
+        mSetFlagsRule.enableFlags(Flags.FLAG_POLITE_NOTIFICATIONS);
+        mSetFlagsRule.disableFlags(Flags.FLAG_CROSS_APP_POLITE_NOTIFICATIONS);
+        TestableFlagResolver flagResolver = new TestableFlagResolver();
+        flagResolver.setFlagOverride(NotificationFlags.NOTIF_VOLUME1, 50);
+        flagResolver.setFlagOverride(NotificationFlags.NOTIF_VOLUME2, 0);
+        // NOTIFICATION_COOLDOWN_ALL setting is enabled
+        Settings.System.putInt(getContext().getContentResolver(),
+                Settings.System.NOTIFICATION_COOLDOWN_ALL, 1);
+        initAttentionHelper(flagResolver);
+
+        NotificationRecord r = getBeepyNotification();
+
+        // set up internal state
+        mAttentionHelper.buzzBeepBlinkLocked(r, DEFAULT_SIGNALS);
+        Mockito.reset(mRingtonePlayer);
+
+        // Use different channel for next notifications
+        mChannel = new NotificationChannel("test2", "test2", IMPORTANCE_DEFAULT);
+        mChannel.lockFields(NotificationChannel.USER_LOCKED_SOUND);
+
+        // update should beep at 100% volume
+        NotificationRecord r2 = getBeepyNotification();
+        mAttentionHelper.buzzBeepBlinkLocked(r2, DEFAULT_SIGNALS);
+        verifyBeepVolume(1.0f);
+
+        // 2nd update should beep at 50% volume
+        Mockito.reset(mRingtonePlayer);
+        mAttentionHelper.buzzBeepBlinkLocked(r2, DEFAULT_SIGNALS);
+        verifyBeepVolume(0.5f);
+
+        // Use different package for next notifications
+        mChannel = new NotificationChannel("test3", "test3", IMPORTANCE_DEFAULT);
+        NotificationRecord r3 = getNotificationRecord(mId, false /* insistent */, false /* once */,
+                true /* noisy */, false /* buzzy*/, false /* lights */, true, true,
+                false, null, Notification.GROUP_ALERT_ALL, false, mUser, "anotherPkg");
+
+        // Update from new package should beep at 100% volume
+        Mockito.reset(mRingtonePlayer);
+        mAttentionHelper.buzzBeepBlinkLocked(r3, DEFAULT_SIGNALS);
+        verifyBeepVolume(1.0f);
+
+        verify(mAccessibilityService, times(4)).sendAccessibilityEvent(any(), anyInt());
+        assertNotEquals(-1, r.getLastAudiblyAlertedMs());
+    }
+
+    @Test
     public void testVibrationIntensity_politeNotif() throws Exception {
         mSetFlagsRule.enableFlags(Flags.FLAG_POLITE_NOTIFICATIONS);
         TestableFlagResolver flagResolver = new TestableFlagResolver();
-        flagResolver.setFlagOverride(NotificationFlags.NOTIF_COOLDOWN_RULE, "rule1");
         flagResolver.setFlagOverride(NotificationFlags.NOTIF_VOLUME1, 50);
         flagResolver.setFlagOverride(NotificationFlags.NOTIF_VOLUME2, 0);
         initAttentionHelper(flagResolver);
@@ -2076,37 +2223,9 @@
     }
 
     @Test
-    public void testVibrationIntensity_politeNotif_Strategy2() throws Exception {
-        mSetFlagsRule.enableFlags(Flags.FLAG_POLITE_NOTIFICATIONS);
-        TestableFlagResolver flagResolver = new TestableFlagResolver();
-        flagResolver.setFlagOverride(NotificationFlags.NOTIF_COOLDOWN_RULE, "rule2");
-        flagResolver.setFlagOverride(NotificationFlags.NOTIF_VOLUME1, 50);
-        flagResolver.setFlagOverride(NotificationFlags.NOTIF_VOLUME2, 0);
-        initAttentionHelper(flagResolver);
-
-        NotificationRecord r = getBuzzyBeepyNotification();
-
-        // set up internal state
-        mAttentionHelper.buzzBeepBlinkLocked(r, DEFAULT_SIGNALS);
-
-        VibratorHelper vibratorHelper = mAttentionHelper.getVibratorHelper();
-        Mockito.reset(vibratorHelper);
-
-        // update should buzz at 0% intensity
-        r.isUpdate = true;
-        mAttentionHelper.buzzBeepBlinkLocked(r, DEFAULT_SIGNALS);
-
-        verify(vibratorHelper, times(1)).scale(any(), eq(0.0f));
-        Mockito.reset(vibratorHelper);
-
-        // 2nd update should buzz at 50% intensity
-        mAttentionHelper.buzzBeepBlinkLocked(r, DEFAULT_SIGNALS);
-        verify(vibratorHelper, times(1)).scale(any(), eq(0.5f));
-    }
-
-    @Test
     public void testBuzzOnlyOnScreenUnlock_politeNotif() throws Exception {
         mSetFlagsRule.enableFlags(Flags.FLAG_POLITE_NOTIFICATIONS);
+        mSetFlagsRule.enableFlags(Flags.FLAG_VIBRATE_WHILE_UNLOCKED);
         TestableFlagResolver flagResolver = new TestableFlagResolver();
 
         // When NOTIFICATION_COOLDOWN_VIBRATE_UNLOCKED setting is enabled
@@ -2161,7 +2280,6 @@
     public void testBeepVolume_politeNotif_workProfile() throws Exception {
         mSetFlagsRule.enableFlags(Flags.FLAG_POLITE_NOTIFICATIONS);
         TestableFlagResolver flagResolver = new TestableFlagResolver();
-        flagResolver.setFlagOverride(NotificationFlags.NOTIF_COOLDOWN_RULE, "rule1");
         flagResolver.setFlagOverride(NotificationFlags.NOTIF_VOLUME1, 50);
         flagResolver.setFlagOverride(NotificationFlags.NOTIF_VOLUME2, 0);
 
@@ -2202,7 +2320,6 @@
     public void testBeepVolume_politeNotif_workProfile_disabled() throws Exception {
         mSetFlagsRule.enableFlags(Flags.FLAG_POLITE_NOTIFICATIONS);
         TestableFlagResolver flagResolver = new TestableFlagResolver();
-        flagResolver.setFlagOverride(NotificationFlags.NOTIF_COOLDOWN_RULE, "rule1");
         flagResolver.setFlagOverride(NotificationFlags.NOTIF_VOLUME1, 50);
         flagResolver.setFlagOverride(NotificationFlags.NOTIF_VOLUME2, 0);
 
diff --git a/services/tests/uiservicestests/src/com/android/server/notification/NotificationHistoryManagerTest.java b/services/tests/uiservicestests/src/com/android/server/notification/NotificationHistoryManagerTest.java
index 5892793..c10c3c2 100644
--- a/services/tests/uiservicestests/src/com/android/server/notification/NotificationHistoryManagerTest.java
+++ b/services/tests/uiservicestests/src/com/android/server/notification/NotificationHistoryManagerTest.java
@@ -170,6 +170,10 @@
         Settings.Secure.putIntForUser(getContext().getContentResolver(),
                 Settings.Secure.NOTIFICATION_HISTORY_ENABLED, 0, USER_SYSTEM);
         mHistoryManager.mSettingsObserver.update(null, USER_SYSTEM);
+        // fake cloned settings to profile
+        Settings.Secure.putIntForUser(getContext().getContentResolver(),
+                Settings.Secure.NOTIFICATION_HISTORY_ENABLED, 0, mProfileId);
+        mHistoryManager.mSettingsObserver.update(null, mProfileId);
 
         // unlock user, verify that history is disabled for self and profile
         mHistoryManager.onUserUnlocked(USER_SYSTEM);
@@ -181,6 +185,37 @@
     }
 
     @Test
+    public void testAddProfile_historyEnabledInPrimary() {
+        // create a history
+        mHistoryManager.onUserUnlocked(MIN_SECONDARY_USER_ID);
+        assertThat(mHistoryManager.doesHistoryExistForUser(MIN_SECONDARY_USER_ID)).isTrue();
+
+        // fake Settings#CLONE_TO_MANAGED_PROFILE
+        int newProfileId = 99;
+        Settings.Secure.putIntForUser(getContext().getContentResolver(),
+                Settings.Secure.NOTIFICATION_HISTORY_ENABLED, 1, newProfileId);
+        mUsers = new ArrayList<>();
+        UserInfo userFullSecondary = new UserInfo();
+        userFullSecondary.id = MIN_SECONDARY_USER_ID;
+        mUsers.add(userFullSecondary);
+        UserInfo userProfile = new UserInfo();
+        userProfile.id = newProfileId;
+        mUsers.add(userProfile);
+        when(mUserManager.getUsers()).thenReturn(mUsers);
+
+        mProfiles = new int[] {MIN_SECONDARY_USER_ID, userProfile.id};
+        when(mUserManager.getProfileIds(MIN_SECONDARY_USER_ID, true)).thenReturn(mProfiles);
+        when(mUserManager.getProfileIds(userProfile.id, true))
+                .thenReturn(new int[] {userProfile.id});
+        when(mUserManager.getProfileParent(userProfile.id)).thenReturn(userFullSecondary);
+
+        // add profile
+        mHistoryManager.onUserAdded(newProfileId);
+        mHistoryManager.onUserUnlocked(newProfileId);
+        assertThat(mHistoryManager.doesHistoryExistForUser(newProfileId)).isTrue();
+    }
+
+    @Test
     public void testOnUserUnlocked_historyDisabledThenEnabled() {
         // create a history
         mHistoryManager.onUserUnlocked(USER_SYSTEM);
diff --git a/services/tests/uiservicestests/src/com/android/server/notification/NotificationManagerServiceTest.java b/services/tests/uiservicestests/src/com/android/server/notification/NotificationManagerServiceTest.java
index f1edd9a..c1f35cc 100755
--- a/services/tests/uiservicestests/src/com/android/server/notification/NotificationManagerServiceTest.java
+++ b/services/tests/uiservicestests/src/com/android/server/notification/NotificationManagerServiceTest.java
@@ -958,22 +958,24 @@
         mTestNotificationChannel.setAllowBubbles(channelEnabled);
     }
 
-    private void setUpPrefsForHistory(int uid, boolean globalEnabled) throws Exception {
+    private void setUpPrefsForHistory(@UserIdInt int userId, boolean globalEnabled)
+            throws Exception {
         initNMS(SystemService.PHASE_ACTIVITY_MANAGER_READY);
 
         // Sets NOTIFICATION_HISTORY_ENABLED setting for calling process uid
         Settings.Secure.putIntForUser(mContext.getContentResolver(),
-                Settings.Secure.NOTIFICATION_HISTORY_ENABLED, globalEnabled ? 1 : 0, uid);
+                Settings.Secure.NOTIFICATION_HISTORY_ENABLED, globalEnabled ? 1 : 0, userId);
         // Sets NOTIFICATION_HISTORY_ENABLED setting for uid 0
         Settings.Secure.putInt(mContext.getContentResolver(),
                 Settings.Secure.NOTIFICATION_HISTORY_ENABLED, globalEnabled ? 1 : 0);
+        setUsers(new int[] {0, userId});
 
         // Forces an update by calling observe on mSettingsObserver, which picks up the settings
         // changes above.
         mService.onBootPhase(SystemService.PHASE_THIRD_PARTY_APPS_CAN_START, mMainLooper);
 
         assertEquals(globalEnabled, Settings.Secure.getIntForUser(mContext.getContentResolver(),
-                Settings.Secure.NOTIFICATION_HISTORY_ENABLED, 0 /* =def */, uid) != 0);
+                Settings.Secure.NOTIFICATION_HISTORY_ENABLED, 0 /* =def */, userId) != 0);
     }
 
     private StatusBarNotification generateSbn(String pkg, int uid, long postTime, int userId) {
@@ -10443,7 +10445,7 @@
     @Test
     public void testHandleOnPackageRemoved_ClearsHistory() throws Exception {
         // Enables Notification History setting
-        setUpPrefsForHistory(mUid, true /* =enabled */);
+        setUpPrefsForHistory(mUserId, true /* =enabled */);
 
         // Posts a notification to the mTestNotificationChannel.
         final NotificationRecord notif = generateNotificationRecord(
diff --git a/services/tests/uiservicestests/src/com/android/server/notification/ZenDeviceEffectsTest.java b/services/tests/uiservicestests/src/com/android/server/notification/ZenDeviceEffectsTest.java
index 999e33c..3d8ec2e 100644
--- a/services/tests/uiservicestests/src/com/android/server/notification/ZenDeviceEffectsTest.java
+++ b/services/tests/uiservicestests/src/com/android/server/notification/ZenDeviceEffectsTest.java
@@ -18,19 +18,31 @@
 
 import static com.google.common.truth.Truth.assertThat;
 
+import android.app.Flags;
 import android.os.Parcel;
+import android.platform.test.flag.junit.SetFlagsRule;
 import android.service.notification.ZenDeviceEffects;
 
 import androidx.test.runner.AndroidJUnit4;
 
 import com.android.server.UiServiceTestCase;
 
+import org.junit.Before;
+import org.junit.Rule;
 import org.junit.Test;
 import org.junit.runner.RunWith;
 
 @RunWith(AndroidJUnit4.class)
 public class ZenDeviceEffectsTest extends UiServiceTestCase {
 
+    @Rule
+    public final SetFlagsRule mSetFlagsRule = new SetFlagsRule();
+
+    @Before
+    public final void setUp() {
+        mSetFlagsRule.enableFlags(Flags.FLAG_MODES_API);
+    }
+
     @Test
     public void builder() {
         ZenDeviceEffects deviceEffects = new ZenDeviceEffects.Builder()
@@ -40,6 +52,7 @@
                 .setShouldMaximizeDoze(true)
                 .setShouldUseNightMode(false)
                 .setShouldSuppressAmbientDisplay(false).setShouldSuppressAmbientDisplay(true)
+                .setUserModifiedFields(8)
                 .build();
 
         assertThat(deviceEffects.shouldDimWallpaper()).isTrue();
@@ -52,6 +65,7 @@
         assertThat(deviceEffects.shouldMinimizeRadioUsage()).isFalse();
         assertThat(deviceEffects.shouldUseNightMode()).isFalse();
         assertThat(deviceEffects.shouldSuppressAmbientDisplay()).isTrue();
+        assertThat(deviceEffects.getUserModifiedFields()).isEqualTo(8);
     }
 
     @Test
@@ -83,6 +97,7 @@
                 .setShouldMinimizeRadioUsage(true)
                 .setShouldUseNightMode(true)
                 .setShouldSuppressAmbientDisplay(true)
+                .setUserModifiedFields(6)
                 .build();
 
         Parcel parcel = Parcel.obtain();
@@ -101,6 +116,7 @@
         assertThat(copy.shouldUseNightMode()).isTrue();
         assertThat(copy.shouldSuppressAmbientDisplay()).isTrue();
         assertThat(copy.shouldDisplayGrayscale()).isFalse();
+        assertThat(copy.getUserModifiedFields()).isEqualTo(6);
     }
 
     @Test
diff --git a/services/tests/uiservicestests/src/com/android/server/notification/ZenModeConfigTest.java b/services/tests/uiservicestests/src/com/android/server/notification/ZenModeConfigTest.java
index 3185c50..177d645 100644
--- a/services/tests/uiservicestests/src/com/android/server/notification/ZenModeConfigTest.java
+++ b/services/tests/uiservicestests/src/com/android/server/notification/ZenModeConfigTest.java
@@ -19,12 +19,15 @@
 import static android.app.AutomaticZenRule.TYPE_BEDTIME;
 import static android.service.notification.ZenPolicy.CONVERSATION_SENDERS_IMPORTANT;
 
+import static com.google.common.truth.Truth.assertThat;
+
 import static junit.framework.TestCase.assertEquals;
 import static junit.framework.TestCase.assertFalse;
 import static junit.framework.TestCase.assertNotNull;
 import static junit.framework.TestCase.assertNull;
 import static junit.framework.TestCase.assertTrue;
 
+import android.app.AutomaticZenRule;
 import android.app.Flags;
 import android.app.NotificationManager.Policy;
 import android.content.ComponentName;
@@ -46,6 +49,7 @@
 import com.android.modules.utils.TypedXmlSerializer;
 import com.android.server.UiServiceTestCase;
 
+import org.junit.Before;
 import org.junit.Rule;
 import org.junit.Test;
 import org.junit.runner.RunWith;
@@ -83,6 +87,11 @@
     @Rule
     public final SetFlagsRule mSetFlagsRule = new SetFlagsRule();
 
+    @Before
+    public final void setUp() {
+        mSetFlagsRule.enableFlags(Flags.FLAG_MODES_API);
+    }
+
     @Test
     public void testPriorityOnlyMutingAllNotifications() {
         ZenModeConfig config = getMutedRingerConfig();
@@ -275,6 +284,7 @@
         assertEquals(expected.getPriorityCallSenders(), actual.getPriorityCallSenders());
         assertEquals(expected.getPriorityMessageSenders(), actual.getPriorityMessageSenders());
         assertEquals(expected.getAllowedChannels(), actual.getAllowedChannels());
+        assertEquals(expected.getUserModifiedFields(), actual.getUserModifiedFields());
     }
 
     @Test
@@ -327,6 +337,53 @@
     }
 
     @Test
+    public void testCanBeUpdatedByApp_nullPolicyAndDeviceEffects() throws Exception {
+        ZenModeConfig.ZenRule rule = new ZenModeConfig.ZenRule();
+        rule.zenPolicy = null;
+        rule.zenDeviceEffects = null;
+
+        assertThat(rule.canBeUpdatedByApp()).isTrue();
+
+        rule.userModifiedFields = 1;
+        assertThat(rule.canBeUpdatedByApp()).isFalse();
+    }
+
+    @Test
+    public void testCanBeUpdatedByApp_policyModified() throws Exception {
+        ZenPolicy.Builder policyBuilder = new ZenPolicy.Builder().setUserModifiedFields(0);
+        ZenPolicy policy = policyBuilder.build();
+
+        ZenModeConfig.ZenRule rule = new ZenModeConfig.ZenRule();
+        rule.zenPolicy = policy;
+
+        assertThat(rule.userModifiedFields).isEqualTo(0);
+        assertThat(rule.canBeUpdatedByApp()).isTrue();
+
+        policy = policyBuilder.setUserModifiedFields(1).build();
+        assertThat(policy.getUserModifiedFields()).isEqualTo(1);
+        rule.zenPolicy = policy;
+        assertThat(rule.canBeUpdatedByApp()).isFalse();
+    }
+
+    @Test
+    public void testCanBeUpdatedByApp_deviceEffectsModified() throws Exception {
+        ZenDeviceEffects.Builder deviceEffectsBuilder =
+                new ZenDeviceEffects.Builder().setUserModifiedFields(0);
+        ZenDeviceEffects deviceEffects = deviceEffectsBuilder.build();
+
+        ZenModeConfig.ZenRule rule = new ZenModeConfig.ZenRule();
+        rule.zenDeviceEffects = deviceEffects;
+
+        assertThat(rule.userModifiedFields).isEqualTo(0);
+        assertThat(rule.canBeUpdatedByApp()).isTrue();
+
+        deviceEffects = deviceEffectsBuilder.setUserModifiedFields(1).build();
+        assertThat(deviceEffects.getUserModifiedFields()).isEqualTo(1);
+        rule.zenDeviceEffects = deviceEffects;
+        assertThat(rule.canBeUpdatedByApp()).isFalse();
+    }
+
+    @Test
     public void testWriteToParcel() {
         mSetFlagsRule.enableFlags(Flags.FLAG_MODES_API);
 
@@ -347,6 +404,7 @@
 
         rule.allowManualInvocation = ALLOW_MANUAL;
         rule.type = TYPE;
+        rule.userModifiedFields = 16;
         rule.iconResName = ICON_RES_NAME;
         rule.triggerDescription = TRIGGER_DESC;
 
@@ -371,6 +429,7 @@
         assertEquals(rule.allowManualInvocation, parceled.allowManualInvocation);
         assertEquals(rule.iconResName, parceled.iconResName);
         assertEquals(rule.type, parceled.type);
+        assertEquals(rule.userModifiedFields, parceled.userModifiedFields);
         assertEquals(rule.triggerDescription, parceled.triggerDescription);
         assertEquals(rule.zenPolicy, parceled.zenPolicy);
         assertEquals(rule, parceled);
@@ -448,6 +507,7 @@
 
         rule.allowManualInvocation = ALLOW_MANUAL;
         rule.type = TYPE;
+        rule.userModifiedFields = 4;
         rule.iconResName = ICON_RES_NAME;
         rule.triggerDescription = TRIGGER_DESC;
 
@@ -476,6 +536,7 @@
 
         assertEquals(rule.allowManualInvocation, fromXml.allowManualInvocation);
         assertEquals(rule.type, fromXml.type);
+        assertEquals(rule.userModifiedFields, fromXml.userModifiedFields);
         assertEquals(rule.triggerDescription, fromXml.triggerDescription);
         assertEquals(rule.iconResName, fromXml.iconResName);
     }
@@ -550,6 +611,22 @@
     }
 
     @Test
+    public void testRuleXml_userModifiedField() throws Exception {
+        ZenModeConfig.ZenRule rule = new ZenModeConfig.ZenRule();
+        rule.userModifiedFields |= AutomaticZenRule.FIELD_NAME;
+        assertThat(rule.userModifiedFields).isEqualTo(1);
+        assertThat(rule.canBeUpdatedByApp()).isFalse();
+
+        ByteArrayOutputStream baos = new ByteArrayOutputStream();
+        writeRuleXml(rule, baos);
+        ByteArrayInputStream bais = new ByteArrayInputStream(baos.toByteArray());
+        ZenModeConfig.ZenRule fromXml = readRuleXml(bais);
+
+        assertThat(fromXml.userModifiedFields).isEqualTo(rule.userModifiedFields);
+        assertThat(fromXml.canBeUpdatedByApp()).isFalse();
+    }
+
+    @Test
     public void testZenPolicyXml_classic() throws Exception {
         ZenPolicy policy = new ZenPolicy.Builder()
                 .allowCalls(ZenPolicy.PEOPLE_TYPE_CONTACTS)
@@ -615,6 +692,7 @@
                 .allowChannels(ZenPolicy.CHANNEL_TYPE_NONE)
                 .hideAllVisualEffects()
                 .showVisualEffect(ZenPolicy.VISUAL_EFFECT_AMBIENT, true)
+                .setUserModifiedFields(4)
                 .build();
 
         ByteArrayOutputStream baos = new ByteArrayOutputStream();
@@ -649,6 +727,7 @@
         assertEquals(policy.getVisualEffectAmbient(), fromXml.getVisualEffectAmbient());
         assertEquals(policy.getVisualEffectNotificationList(),
                 fromXml.getVisualEffectNotificationList());
+        assertEquals(policy.getUserModifiedFields(), fromXml.getUserModifiedFields());
     }
 
     private ZenModeConfig getMutedRingerConfig() {
diff --git a/services/tests/uiservicestests/src/com/android/server/notification/ZenModeDiffTest.java b/services/tests/uiservicestests/src/com/android/server/notification/ZenModeDiffTest.java
index 93cd44e..7e92e42 100644
--- a/services/tests/uiservicestests/src/com/android/server/notification/ZenModeDiffTest.java
+++ b/services/tests/uiservicestests/src/com/android/server/notification/ZenModeDiffTest.java
@@ -76,7 +76,7 @@
                     ? Set.of()
                     : Set.of(RuleDiff.FIELD_TYPE, RuleDiff.FIELD_TRIGGER_DESCRIPTION,
                             RuleDiff.FIELD_ICON_RES, RuleDiff.FIELD_ALLOW_MANUAL,
-                            RuleDiff.FIELD_ZEN_DEVICE_EFFECTS);
+                            RuleDiff.FIELD_ZEN_DEVICE_EFFECTS, RuleDiff.FIELD_USER_MODIFIED_FIELDS);
 
     // allowPriorityChannels is flagged by android.app.modes_api
     public static final Set<String> ZEN_MODE_CONFIG_FLAGGED_FIELDS =
@@ -304,6 +304,7 @@
             rule.zenDeviceEffects = new ZenDeviceEffects.Builder()
                     .setShouldDimWallpaper(true)
                     .build();
+            rule.userModifiedFields = AutomaticZenRule.FIELD_NAME;
         }
         return rule;
     }
diff --git a/services/tests/uiservicestests/src/com/android/server/notification/ZenModeHelperTest.java b/services/tests/uiservicestests/src/com/android/server/notification/ZenModeHelperTest.java
index f84d8e9..9eed974 100644
--- a/services/tests/uiservicestests/src/com/android/server/notification/ZenModeHelperTest.java
+++ b/services/tests/uiservicestests/src/com/android/server/notification/ZenModeHelperTest.java
@@ -21,6 +21,9 @@
 import static android.app.NotificationManager.AUTOMATIC_RULE_STATUS_DEACTIVATED;
 import static android.app.NotificationManager.AUTOMATIC_RULE_STATUS_DISABLED;
 import static android.app.NotificationManager.AUTOMATIC_RULE_STATUS_ENABLED;
+import static android.app.NotificationManager.INTERRUPTION_FILTER_ALARMS;
+import static android.app.NotificationManager.INTERRUPTION_FILTER_ALL;
+import static android.app.NotificationManager.INTERRUPTION_FILTER_PRIORITY;
 import static android.app.NotificationManager.Policy.CONVERSATION_SENDERS_ANYONE;
 import static android.app.NotificationManager.Policy.CONVERSATION_SENDERS_IMPORTANT;
 import static android.app.NotificationManager.Policy.PRIORITY_CATEGORY_ALARMS;
@@ -2197,7 +2200,7 @@
     }
 
     @Test
-    public void addAutomaticZenRule_fromUser_respectsHiddenEffects() {
+    public void addAutomaticZenRule_fromUser_respectsHiddenEffects() throws Exception {
         mSetFlagsRule.enableFlags(Flags.FLAG_MODES_API);
 
         ZenDeviceEffects zde = new ZenDeviceEffects.Builder()
@@ -2222,7 +2225,13 @@
                 "reasons", 0);
 
         AutomaticZenRule savedRule = mZenModeHelper.getAutomaticZenRule(ruleId);
-        assertThat(savedRule.getDeviceEffects()).isEqualTo(zde);
+
+        // savedRule.getDeviceEffects() is equal to zde, except for the userModifiedFields.
+        // So we clear before comparing.
+        ZenDeviceEffects savedEffects = new ZenDeviceEffects.Builder(savedRule.getDeviceEffects())
+                .setUserModifiedFields(0).build();
+
+        assertThat(savedEffects).isEqualTo(zde);
     }
 
     @Test
@@ -2298,8 +2307,11 @@
                 UPDATE_ORIGIN_SYSTEM_OR_SYSTEMUI, "reasons", 0);
 
         ZenDeviceEffects updateFromUser = new ZenDeviceEffects.Builder()
-                .setShouldUseNightMode(true) // Good
-                .setShouldMaximizeDoze(true) // Also good
+                .setShouldUseNightMode(true)
+                .setShouldMaximizeDoze(true)
+                // Just to emphasize that unset values default to false;
+                // even with this line removed, tap to wake would be set to false.
+                .setShouldDisableTapToWake(false)
                 .build();
         mZenModeHelper.updateAutomaticZenRule(ruleId,
                 new AutomaticZenRule.Builder("Rule", CONDITION_ID)
@@ -2308,7 +2320,13 @@
                 UPDATE_ORIGIN_USER, "reasons", 0);
 
         AutomaticZenRule savedRule = mZenModeHelper.getAutomaticZenRule(ruleId);
-        assertThat(savedRule.getDeviceEffects()).isEqualTo(updateFromUser);
+
+        // savedRule.getDeviceEffects() is equal to updateFromUser, except for the
+        // userModifiedFields, so we clear before comparing.
+        ZenDeviceEffects savedEffects = new ZenDeviceEffects.Builder(savedRule.getDeviceEffects())
+                .setUserModifiedFields(0).build();
+
+        assertThat(savedEffects).isEqualTo(updateFromUser);
     }
 
     @Test
@@ -3321,6 +3339,7 @@
 
         rule.allowManualInvocation = ALLOW_MANUAL;
         rule.type = TYPE;
+        rule.userModifiedFields = AutomaticZenRule.FIELD_NAME;
         rule.iconResName = ICON_RES_NAME;
         rule.triggerDescription = TRIGGER_DESC;
 
@@ -3335,6 +3354,7 @@
         assertEquals(POLICY, actual.getZenPolicy());
         assertEquals(CONFIG_ACTIVITY, actual.getConfigurationActivity());
         assertEquals(TYPE, actual.getType());
+        assertEquals(AutomaticZenRule.FIELD_NAME, actual.getUserModifiedFields());
         assertEquals(ALLOW_MANUAL, actual.isManualInvocationAllowed());
         assertEquals(CREATION_TIME, actual.getCreationTime());
         assertEquals(OWNER.getPackageName(), actual.getPackageName());
@@ -3376,10 +3396,480 @@
         assertEquals(ALLOW_MANUAL, rule.allowManualInvocation);
         assertEquals(OWNER.getPackageName(), rule.getPkg());
         assertEquals(ICON_RES_NAME, rule.iconResName);
+        // Because the origin of the update is the app, we don't expect the bitmask to change.
+        assertEquals(0, rule.userModifiedFields);
         assertEquals(TRIGGER_DESC, rule.triggerDescription);
     }
 
     @Test
+    @EnableFlags(Flags.FLAG_MODES_API)
+    public void automaticZenRuleToZenRule_updatesNameUnlessUserModified() {
+        // Add a starting rule with the name OriginalName.
+        AutomaticZenRule azrBase = new AutomaticZenRule.Builder("OriginalName", CONDITION_ID)
+                .setInterruptionFilter(INTERRUPTION_FILTER_PRIORITY)
+                .build();
+        String ruleId = mZenModeHelper.addAutomaticZenRule(mContext.getPackageName(),
+                azrBase, UPDATE_ORIGIN_APP, "reason", Process.SYSTEM_UID);
+        AutomaticZenRule rule = mZenModeHelper.getAutomaticZenRule(ruleId);
+
+        // Checks the name can be changed by the app because the user has not modified it.
+        AutomaticZenRule azrUpdate = new AutomaticZenRule.Builder(rule)
+                .setName("NewName")
+                .build();
+        mZenModeHelper.updateAutomaticZenRule(ruleId, azrUpdate, UPDATE_ORIGIN_APP, "reason",
+                Process.SYSTEM_UID);
+        rule = mZenModeHelper.getAutomaticZenRule(ruleId);
+        assertThat(rule.getName()).isEqualTo("NewName");
+        assertThat(rule.canUpdate()).isTrue();
+
+        // The user modifies some other field in the rule, which makes the rule as a whole not
+        // app modifiable.
+        azrUpdate = new AutomaticZenRule.Builder(rule)
+                .setInterruptionFilter(INTERRUPTION_FILTER_ALARMS)
+                .build();
+        mZenModeHelper.updateAutomaticZenRule(ruleId, azrUpdate, UPDATE_ORIGIN_USER, "reason",
+                Process.SYSTEM_UID);
+        rule = mZenModeHelper.getAutomaticZenRule(ruleId);
+        assertThat(rule.getUserModifiedFields())
+                .isEqualTo(AutomaticZenRule.FIELD_INTERRUPTION_FILTER);
+        assertThat(rule.canUpdate()).isFalse();
+
+        // ...but the app can still modify the name, because the name itself hasn't been modified
+        // by the user.
+        azrUpdate = new AutomaticZenRule.Builder(rule)
+                .setName("NewAppName")
+                .build();
+        mZenModeHelper.updateAutomaticZenRule(ruleId, azrUpdate, UPDATE_ORIGIN_APP, "reason",
+                Process.SYSTEM_UID);
+        rule = mZenModeHelper.getAutomaticZenRule(ruleId);
+        assertThat(rule.getName()).isEqualTo("NewAppName");
+
+        // The user modifies the name.
+        azrUpdate = new AutomaticZenRule.Builder(rule)
+                .setName("UserProvidedName")
+                .build();
+        mZenModeHelper.updateAutomaticZenRule(ruleId, azrUpdate, UPDATE_ORIGIN_USER, "reason",
+                Process.SYSTEM_UID);
+        rule = mZenModeHelper.getAutomaticZenRule(ruleId);
+        assertThat(rule.getName()).isEqualTo("UserProvidedName");
+        assertThat(rule.getUserModifiedFields()).isEqualTo(AutomaticZenRule.FIELD_NAME
+                | AutomaticZenRule.FIELD_INTERRUPTION_FILTER);
+
+        // The app is no longer able to modify the name.
+        azrUpdate = new AutomaticZenRule.Builder(rule)
+                .setName("NewAppName")
+                .build();
+        mZenModeHelper.updateAutomaticZenRule(ruleId, azrUpdate, UPDATE_ORIGIN_APP, "reason",
+                Process.SYSTEM_UID);
+        rule = mZenModeHelper.getAutomaticZenRule(ruleId);
+        assertThat(rule.getName()).isEqualTo("UserProvidedName");
+    }
+
+    @Test
+    @EnableFlags(Flags.FLAG_MODES_API)
+    public void automaticZenRuleToZenRule_updatesBitmaskAndValueForUserOrigin() {
+        // Adds a starting rule with empty zen policies and device effects
+        AutomaticZenRule azrBase = new AutomaticZenRule.Builder(NAME, CONDITION_ID)
+                .setZenPolicy(new ZenPolicy.Builder().build())
+                .setDeviceEffects(new ZenDeviceEffects.Builder().build())
+                .build();
+        // Adds the rule using the app, to avoid having any user modified bits set.
+        String ruleId = mZenModeHelper.addAutomaticZenRule(mContext.getPackageName(),
+                azrBase, UPDATE_ORIGIN_APP, "reason", Process.SYSTEM_UID);
+        AutomaticZenRule rule = mZenModeHelper.getAutomaticZenRule(ruleId);
+
+        // Modifies the zen policy and device effects
+        ZenPolicy policy = new ZenPolicy.Builder(rule.getZenPolicy())
+                .allowChannels(ZenPolicy.CHANNEL_TYPE_PRIORITY)
+                .build();
+        ZenDeviceEffects deviceEffects =
+                new ZenDeviceEffects.Builder(rule.getDeviceEffects())
+                .setShouldDisplayGrayscale(true)
+                .build();
+        AutomaticZenRule azrUpdate = new AutomaticZenRule.Builder(rule)
+                .setInterruptionFilter(INTERRUPTION_FILTER_PRIORITY)
+                .setZenPolicy(policy)
+                .setDeviceEffects(deviceEffects)
+                .build();
+
+        // Update the rule with the AZR from origin user.
+        mZenModeHelper.updateAutomaticZenRule(ruleId, azrUpdate, UPDATE_ORIGIN_USER, "reason",
+                Process.SYSTEM_UID);
+        rule = mZenModeHelper.getAutomaticZenRule(ruleId);
+
+        // UPDATE_ORIGIN_USER should change the bitmask and change the values.
+        assertThat(rule.getInterruptionFilter()).isEqualTo(INTERRUPTION_FILTER_PRIORITY);
+        assertThat(rule.getUserModifiedFields())
+                .isEqualTo(AutomaticZenRule.FIELD_INTERRUPTION_FILTER);
+        assertThat(rule.getZenPolicy().getUserModifiedFields())
+                .isEqualTo(ZenPolicy.FIELD_ALLOW_CHANNELS);
+        assertThat(rule.getZenPolicy().getAllowedChannels())
+                .isEqualTo(ZenPolicy.CHANNEL_TYPE_PRIORITY);
+        assertThat(rule.getDeviceEffects().getUserModifiedFields())
+                .isEqualTo(ZenDeviceEffects.FIELD_GRAYSCALE);
+        assertThat(rule.getDeviceEffects().shouldDisplayGrayscale()).isTrue();
+    }
+
+    @Test
+    @EnableFlags(Flags.FLAG_MODES_API)
+    public void automaticZenRuleToZenRule_doesNotUpdateValuesForInitUserOrigin() {
+        // Adds a starting rule with empty zen policies and device effects
+        AutomaticZenRule azrBase = new AutomaticZenRule.Builder(NAME, CONDITION_ID)
+                .setInterruptionFilter(INTERRUPTION_FILTER_ALL) // Already the default, no change
+                .setZenPolicy(new ZenPolicy.Builder()
+                        .allowReminders(false)
+                        .build())
+                .setDeviceEffects(new ZenDeviceEffects.Builder()
+                        .setShouldDisplayGrayscale(false)
+                        .build())
+                .build();
+        // Adds the rule using the user, to set user-modified bits.
+        String ruleId = mZenModeHelper.addAutomaticZenRule(mContext.getPackageName(),
+                azrBase, UPDATE_ORIGIN_USER, "reason", Process.SYSTEM_UID);
+        AutomaticZenRule rule = mZenModeHelper.getAutomaticZenRule(ruleId);
+        assertThat(rule.canUpdate()).isFalse();
+        assertThat(rule.getUserModifiedFields()).isEqualTo(AutomaticZenRule.FIELD_NAME);
+
+        ZenPolicy policy = new ZenPolicy.Builder(rule.getZenPolicy())
+                .allowReminders(true)
+                .build();
+        ZenDeviceEffects deviceEffects = new ZenDeviceEffects.Builder(rule.getDeviceEffects())
+                .setShouldDisplayGrayscale(true)
+                .build();
+        AutomaticZenRule azrUpdate = new AutomaticZenRule.Builder(rule)
+                .setInterruptionFilter(INTERRUPTION_FILTER_PRIORITY)
+                .setZenPolicy(policy)
+                .setDeviceEffects(deviceEffects)
+                .build();
+
+        // Attempts to update the rule with the AZR from origin init user.
+        mZenModeHelper.updateAutomaticZenRule(ruleId, azrUpdate, UPDATE_ORIGIN_INIT_USER, "reason",
+                Process.SYSTEM_UID);
+        AutomaticZenRule unchangedRule = mZenModeHelper.getAutomaticZenRule(ruleId);
+
+        // UPDATE_ORIGIN_INIT_USER does not change the bitmask or values if rule is user modified.
+        // TODO: b/318506692 - Remove once we check that INIT origins can't call add/updateAZR.
+        assertThat(unchangedRule.getUserModifiedFields()).isEqualTo(rule.getUserModifiedFields());
+        assertThat(unchangedRule.getInterruptionFilter()).isEqualTo(INTERRUPTION_FILTER_ALL);
+        assertThat(unchangedRule.getZenPolicy().getUserModifiedFields()).isEqualTo(
+                rule.getZenPolicy().getUserModifiedFields());
+        assertThat(unchangedRule.getZenPolicy().getPriorityCategoryReminders()).isEqualTo(
+                ZenPolicy.STATE_DISALLOW);
+        assertThat(unchangedRule.getDeviceEffects().getUserModifiedFields()).isEqualTo(
+                rule.getDeviceEffects().getUserModifiedFields());
+        assertThat(unchangedRule.getDeviceEffects().shouldDisplayGrayscale()).isFalse();
+
+        // Creates a new rule with the AZR from origin init user.
+        String newRuleId = mZenModeHelper.addAutomaticZenRule(mContext.getPackageName(),
+                azrUpdate, UPDATE_ORIGIN_INIT_USER, "reason", Process.SYSTEM_UID);
+        AutomaticZenRule newRule = mZenModeHelper.getAutomaticZenRule(newRuleId);
+
+        // UPDATE_ORIGIN_INIT_USER does change the values if the rule is new,
+        // but does not update the bitmask.
+        assertThat(newRule.getUserModifiedFields()).isEqualTo(0);
+        assertThat(newRule.getInterruptionFilter()).isEqualTo(INTERRUPTION_FILTER_PRIORITY);
+        assertThat(newRule.getZenPolicy().getUserModifiedFields()).isEqualTo(0);
+        assertThat(newRule.getZenPolicy().getPriorityCategoryReminders())
+                .isEqualTo(ZenPolicy.STATE_ALLOW);
+        assertThat(newRule.getDeviceEffects().getUserModifiedFields()).isEqualTo(0);
+        assertThat(newRule.getDeviceEffects().shouldDisplayGrayscale()).isTrue();
+    }
+
+    @Test
+    @EnableFlags(Flags.FLAG_MODES_API)
+    public void automaticZenRuleToZenRule_updatesValuesForSystemUiOrigin() {
+        // Adds a starting rule with empty zen policies and device effects
+        AutomaticZenRule azrBase = new AutomaticZenRule.Builder(NAME, CONDITION_ID)
+                .setInterruptionFilter(INTERRUPTION_FILTER_ALL)
+                .setZenPolicy(new ZenPolicy.Builder()
+                        .allowReminders(false)
+                        .build())
+                .setDeviceEffects(new ZenDeviceEffects.Builder()
+                        .setShouldDisplayGrayscale(false)
+                        .build())
+                .build();
+        // Adds the rule using the app, to avoid having any user modified bits set.
+        String ruleId = mZenModeHelper.addAutomaticZenRule(mContext.getPackageName(),
+                azrBase, UPDATE_ORIGIN_APP, "reason", Process.SYSTEM_UID);
+        AutomaticZenRule rule = mZenModeHelper.getAutomaticZenRule(ruleId);
+
+        // Modifies the zen policy and device effects
+        ZenPolicy policy = new ZenPolicy.Builder(rule.getZenPolicy())
+                .allowReminders(true)
+                .build();
+        ZenDeviceEffects deviceEffects =
+                new ZenDeviceEffects.Builder(rule.getDeviceEffects())
+                        .setShouldDisplayGrayscale(true)
+                        .build();
+        AutomaticZenRule azrUpdate = new AutomaticZenRule.Builder(rule)
+                .setInterruptionFilter(INTERRUPTION_FILTER_PRIORITY)
+                .setZenPolicy(policy)
+                .setDeviceEffects(deviceEffects)
+                .build();
+
+        // Update the rule with the AZR from origin systemUI.
+        mZenModeHelper.updateAutomaticZenRule(ruleId, azrUpdate, UPDATE_ORIGIN_SYSTEM_OR_SYSTEMUI,
+                "reason", Process.SYSTEM_UID);
+        rule = mZenModeHelper.getAutomaticZenRule(ruleId);
+
+        // UPDATE_ORIGIN_SYSTEM_OR_SYSTEMUI should change the value but NOT update the bitmask.
+        assertThat(rule.getUserModifiedFields()).isEqualTo(0);
+        assertThat(rule.getZenPolicy().getUserModifiedFields()).isEqualTo(0);
+        assertThat(rule.getZenPolicy().getPriorityCategoryReminders())
+                .isEqualTo(ZenPolicy.STATE_ALLOW);
+        assertThat(rule.getDeviceEffects().getUserModifiedFields()).isEqualTo(0);
+        assertThat(rule.getDeviceEffects().shouldDisplayGrayscale()).isTrue();
+    }
+
+    @Test
+    @EnableFlags(Flags.FLAG_MODES_API)
+    public void automaticZenRuleToZenRule_updatesValuesIfRuleNotUserModified() {
+        // Adds a starting rule with empty zen policies and device effects
+        AutomaticZenRule azrBase = new AutomaticZenRule.Builder(NAME, CONDITION_ID)
+                .setInterruptionFilter(INTERRUPTION_FILTER_ALL)
+                .setZenPolicy(new ZenPolicy.Builder()
+                        .allowReminders(false)
+                        .build())
+                .setDeviceEffects(new ZenDeviceEffects.Builder()
+                        .setShouldDisplayGrayscale(false)
+                        .build())
+                .build();
+        // Adds the rule using the app, to avoid having any user modified bits set.
+        String ruleId = mZenModeHelper.addAutomaticZenRule(mContext.getPackageName(),
+                azrBase, UPDATE_ORIGIN_APP, "reason", Process.SYSTEM_UID);
+        AutomaticZenRule rule = mZenModeHelper.getAutomaticZenRule(ruleId);
+        assertThat(rule.canUpdate()).isTrue();
+
+        ZenPolicy policy = new ZenPolicy.Builder()
+                .allowReminders(true)
+                .build();
+        ZenDeviceEffects deviceEffects = new ZenDeviceEffects.Builder()
+                .setShouldDisplayGrayscale(true)
+                .build();
+        AutomaticZenRule azrUpdate =  new AutomaticZenRule.Builder(rule)
+                .setInterruptionFilter(INTERRUPTION_FILTER_ALARMS)
+                .setZenPolicy(policy)
+                .setDeviceEffects(deviceEffects)
+                .build();
+
+        // Since the rule is not already user modified, UPDATE_ORIGIN_UNKNOWN can modify the rule.
+        // The bitmask is not modified.
+        mZenModeHelper.updateAutomaticZenRule(ruleId, azrUpdate, UPDATE_ORIGIN_UNKNOWN, "reason",
+                Process.SYSTEM_UID);
+        AutomaticZenRule unchangedRule = mZenModeHelper.getAutomaticZenRule(ruleId);
+
+        assertThat(unchangedRule.getUserModifiedFields()).isEqualTo(rule.getUserModifiedFields());
+        assertThat(unchangedRule.getInterruptionFilter()).isEqualTo(INTERRUPTION_FILTER_ALARMS);
+        assertThat(unchangedRule.getZenPolicy().getUserModifiedFields()).isEqualTo(
+                rule.getZenPolicy().getUserModifiedFields());
+        assertThat(unchangedRule.getZenPolicy().getPriorityCategoryReminders())
+                .isEqualTo(ZenPolicy.STATE_ALLOW);
+        assertThat(unchangedRule.getDeviceEffects().getUserModifiedFields()).isEqualTo(
+                rule.getDeviceEffects().getUserModifiedFields());
+        assertThat(unchangedRule.getDeviceEffects().shouldDisplayGrayscale()).isTrue();
+
+        // Creates another rule, this time from user. This will have user modified bits set.
+        String ruleIdUser = mZenModeHelper.addAutomaticZenRule(mContext.getPackageName(),
+                azrBase, UPDATE_ORIGIN_USER, "reason", Process.SYSTEM_UID);
+        AutomaticZenRule ruleUser = mZenModeHelper.getAutomaticZenRule(ruleIdUser);
+        assertThat(ruleUser.canUpdate()).isFalse();
+
+        // Zen rule update coming from unknown origin. This cannot fully update the rule, because
+        // the rule is already considered user modified.
+        mZenModeHelper.updateAutomaticZenRule(ruleIdUser, azrUpdate, UPDATE_ORIGIN_UNKNOWN,
+                "reason", Process.SYSTEM_UID);
+        ruleUser = mZenModeHelper.getAutomaticZenRule(ruleIdUser);
+
+        // UPDATE_ORIGIN_UNKNOWN can only change the value if the rule is not already user modified,
+        // so the rule is not changed, and neither is the bitmask.
+        assertThat(ruleUser.getInterruptionFilter()).isEqualTo(INTERRUPTION_FILTER_ALL);
+        // Interruption Filter All is the default value, so it's not included as a modified field.
+        assertThat(ruleUser.getUserModifiedFields() | AutomaticZenRule.FIELD_NAME).isGreaterThan(0);
+        assertThat(ruleUser.getZenPolicy().getUserModifiedFields()
+                | ZenPolicy.FIELD_PRIORITY_CATEGORY_REMINDERS).isGreaterThan(0);
+        assertThat(ruleUser.getZenPolicy().getPriorityCategoryReminders())
+                .isEqualTo(ZenPolicy.STATE_DISALLOW);
+        assertThat(ruleUser.getDeviceEffects().getUserModifiedFields()
+                | ZenDeviceEffects.FIELD_GRAYSCALE).isGreaterThan(0);
+        assertThat(ruleUser.getDeviceEffects().shouldDisplayGrayscale()).isFalse();
+    }
+
+    @Test
+    @EnableFlags(Flags.FLAG_MODES_API)
+    public void automaticZenRuleToZenRule_updatesValuesIfRuleNew() {
+        // Adds a starting rule with empty zen policies and device effects
+        AutomaticZenRule azrBase = new AutomaticZenRule.Builder(NAME, CONDITION_ID)
+                .setInterruptionFilter(INTERRUPTION_FILTER_ALARMS)
+                .setZenPolicy(new ZenPolicy.Builder()
+                        .allowReminders(true)
+                        .build())
+                .setDeviceEffects(new ZenDeviceEffects.Builder()
+                        .setShouldDisplayGrayscale(true)
+                        .build())
+                .build();
+        // Adds the rule using origin unknown, to show that a new rule is always allowed.
+        String ruleId = mZenModeHelper.addAutomaticZenRule(mContext.getPackageName(),
+                azrBase, UPDATE_ORIGIN_UNKNOWN, "reason", Process.SYSTEM_UID);
+        AutomaticZenRule rule = mZenModeHelper.getAutomaticZenRule(ruleId);
+
+        // The values are modified but the bitmask is not.
+        assertThat(rule.canUpdate()).isTrue();
+        assertThat(rule.getZenPolicy().getPriorityCategoryReminders())
+                .isEqualTo(ZenPolicy.STATE_ALLOW);
+        assertThat(rule.getDeviceEffects().shouldDisplayGrayscale()).isTrue();
+    }
+
+    @Test
+    @EnableFlags(Flags.FLAG_MODES_API)
+    public void automaticZenRuleToZenRule_nullDeviceEffectsUpdate() {
+        // Adds a starting rule with empty zen policies and device effects
+        AutomaticZenRule azrBase = new AutomaticZenRule.Builder(NAME, CONDITION_ID)
+                .setDeviceEffects(new ZenDeviceEffects.Builder().build())
+                .build();
+        // Adds the rule using the app, to avoid having any user modified bits set.
+        String ruleId = mZenModeHelper.addAutomaticZenRule(mContext.getPackageName(),
+                azrBase, UPDATE_ORIGIN_APP, "reason", Process.SYSTEM_UID);
+        AutomaticZenRule rule = mZenModeHelper.getAutomaticZenRule(ruleId);
+
+        AutomaticZenRule azr = new AutomaticZenRule.Builder(azrBase)
+                // Sets Device Effects to null
+                .setDeviceEffects(null)
+                .build();
+
+        // Zen rule update coming from unknown origin, but since the rule isn't already
+        // user modified, it can be updated.
+        mZenModeHelper.updateAutomaticZenRule(ruleId, azr, UPDATE_ORIGIN_UNKNOWN, "reason",
+                Process.SYSTEM_UID);
+        rule = mZenModeHelper.getAutomaticZenRule(ruleId);
+
+        // When AZR's ZenDeviceEffects is null, the updated rule's device effects will be null.
+        assertThat(rule.getDeviceEffects()).isNull();
+    }
+
+    @Test
+    @EnableFlags(Flags.FLAG_MODES_API)
+    public void automaticZenRuleToZenRule_nullPolicyUpdate() {
+        // Adds a starting rule with empty zen policies and device effects
+        AutomaticZenRule azrBase = new AutomaticZenRule.Builder(NAME, CONDITION_ID)
+                .setZenPolicy(new ZenPolicy.Builder().build())
+                .build();
+        // Adds the rule using the app, to avoid having any user modified bits set.
+        String ruleId = mZenModeHelper.addAutomaticZenRule(mContext.getPackageName(),
+                azrBase, UPDATE_ORIGIN_APP, "reason", Process.SYSTEM_UID);
+        AutomaticZenRule rule = mZenModeHelper.getAutomaticZenRule(ruleId);
+        assertThat(rule.canUpdate()).isTrue();
+
+        AutomaticZenRule azr = new AutomaticZenRule.Builder(azrBase)
+                // Set zen policy to null
+                .setZenPolicy(null)
+                .build();
+
+        // Zen rule update coming from unknown origin, but since the rule isn't already
+        // user modified, it can be updated.
+        mZenModeHelper.updateAutomaticZenRule(ruleId, azr, UPDATE_ORIGIN_UNKNOWN, "reason",
+                Process.SYSTEM_UID);
+        rule = mZenModeHelper.getAutomaticZenRule(ruleId);
+
+        // When AZR's ZenPolicy is null, we expect the updated rule's policy to be null.
+        assertThat(rule.getZenPolicy()).isNull();
+    }
+
+    @Test
+    @EnableFlags(Flags.FLAG_MODES_API)
+    public void automaticZenRuleToZenRule_nullToNonNullPolicyUpdate() {
+        when(mContext.checkCallingPermission(anyString()))
+                .thenReturn(PackageManager.PERMISSION_GRANTED);
+        // Adds a starting rule with empty zen policies and device effects
+        AutomaticZenRule azrBase = new AutomaticZenRule.Builder(NAME, CONDITION_ID)
+                .setZenPolicy(null)
+                // .setDeviceEffects(new ZenDeviceEffects.Builder().build())
+                .build();
+        // Adds the rule using the app, to avoid having any user modified bits set.
+        String ruleId = mZenModeHelper.addAutomaticZenRule(mContext.getPackageName(),
+                azrBase, UPDATE_ORIGIN_APP, "reason", Process.SYSTEM_UID);
+        AutomaticZenRule rule = mZenModeHelper.getAutomaticZenRule(ruleId);
+        assertThat(rule.canUpdate()).isTrue();
+
+        // Create a fully populated ZenPolicy.
+        ZenPolicy policy = new ZenPolicy.Builder()
+                .allowChannels(ZenPolicy.CHANNEL_TYPE_NONE) // Differs from the default
+                .allowReminders(true) // Differs from the default
+                .allowEvents(true) // Differs from the default
+                .allowConversations(ZenPolicy.CONVERSATION_SENDERS_IMPORTANT)
+                .allowMessages(PEOPLE_TYPE_STARRED)
+                .allowCalls(PEOPLE_TYPE_STARRED)
+                .allowRepeatCallers(true)
+                .allowAlarms(true)
+                .allowMedia(true)
+                .allowSystem(true) // Differs from the default
+                .showFullScreenIntent(true) // Differs from the default
+                .showLights(true) // Differs from the default
+                .showPeeking(true) // Differs from the default
+                .showStatusBarIcons(true)
+                .showBadges(true)
+                .showInAmbientDisplay(true) // Differs from the default
+                .showInNotificationList(true)
+                .build();
+        AutomaticZenRule azr = new AutomaticZenRule.Builder(azrBase)
+                .setZenPolicy(policy)
+                .build();
+
+        // Applies the update to the rule.
+        // Default config defined in getDefaultConfigParser() is used as the original rule.
+        mZenModeHelper.updateAutomaticZenRule(ruleId, azr, UPDATE_ORIGIN_USER, "reason",
+                Process.SYSTEM_UID);
+        rule = mZenModeHelper.getAutomaticZenRule(ruleId);
+
+        // New ZenPolicy differs from the default config
+        assertThat(rule.getZenPolicy()).isNotNull();
+        assertThat(rule.getZenPolicy().getAllowedChannels()).isEqualTo(ZenPolicy.CHANNEL_TYPE_NONE);
+        assertThat(rule.canUpdate()).isFalse();
+        assertThat(rule.getZenPolicy().getUserModifiedFields()).isEqualTo(
+                ZenPolicy.FIELD_ALLOW_CHANNELS
+                | ZenPolicy.FIELD_PRIORITY_CATEGORY_REMINDERS
+                | ZenPolicy.FIELD_PRIORITY_CATEGORY_EVENTS
+                | ZenPolicy.FIELD_PRIORITY_CATEGORY_SYSTEM
+                | ZenPolicy.FIELD_VISUAL_EFFECT_FULL_SCREEN_INTENT
+                | ZenPolicy.FIELD_VISUAL_EFFECT_LIGHTS
+                | ZenPolicy.FIELD_VISUAL_EFFECT_PEEK
+                | ZenPolicy.FIELD_VISUAL_EFFECT_AMBIENT
+        );
+    }
+
+    @Test
+    @EnableFlags(Flags.FLAG_MODES_API)
+    public void automaticZenRuleToZenRule_nullToNonNullDeviceEffectsUpdate() {
+        // Adds a starting rule with empty zen policies and device effects
+        AutomaticZenRule azrBase = new AutomaticZenRule.Builder(NAME, CONDITION_ID)
+                .setDeviceEffects(null)
+                .build();
+        // Adds the rule using the app, to avoid having any user modified bits set.
+        String ruleId = mZenModeHelper.addAutomaticZenRule(mContext.getPackageName(),
+                azrBase, UPDATE_ORIGIN_APP, "reason", Process.SYSTEM_UID);
+        AutomaticZenRule rule = mZenModeHelper.getAutomaticZenRule(ruleId);
+        assertThat(rule.canUpdate()).isTrue();
+
+        ZenDeviceEffects deviceEffects = new ZenDeviceEffects.Builder()
+                .setShouldDisplayGrayscale(true)
+                .build();
+        AutomaticZenRule azr = new AutomaticZenRule.Builder(rule)
+                .setDeviceEffects(deviceEffects)
+                .build();
+
+        // Applies the update to the rule.
+        mZenModeHelper.updateAutomaticZenRule(ruleId, azr, UPDATE_ORIGIN_USER, "reason",
+                Process.SYSTEM_UID);
+        rule = mZenModeHelper.getAutomaticZenRule(ruleId);
+
+        // New ZenDeviceEffects is used; all fields considered set, since previously were null.
+        assertThat(rule.getDeviceEffects()).isNotNull();
+        assertThat(rule.getDeviceEffects().shouldDisplayGrayscale()).isTrue();
+        assertThat(rule.canUpdate()).isFalse();
+        assertThat(rule.getDeviceEffects().getUserModifiedFields()).isEqualTo(
+                ZenDeviceEffects.FIELD_GRAYSCALE);
+    }
+
+    @Test
     public void testUpdateAutomaticRule_disabled_triggersBroadcast() throws Exception {
         setupZenConfig();
 
diff --git a/services/tests/uiservicestests/src/com/android/server/notification/ZenPolicyTest.java b/services/tests/uiservicestests/src/com/android/server/notification/ZenPolicyTest.java
index 2f4f891c..21c96d6 100644
--- a/services/tests/uiservicestests/src/com/android/server/notification/ZenPolicyTest.java
+++ b/services/tests/uiservicestests/src/com/android/server/notification/ZenPolicyTest.java
@@ -34,6 +34,7 @@
 
 import com.google.protobuf.nano.InvalidProtocolBufferNanoException;
 
+import org.junit.Before;
 import org.junit.Rule;
 import org.junit.Test;
 import org.junit.runner.RunWith;
@@ -49,6 +50,11 @@
     @Rule
     public final SetFlagsRule mSetFlagsRule = new SetFlagsRule();
 
+    @Before
+    public final void setUp() {
+        mSetFlagsRule.enableFlags(Flags.FLAG_MODES_API);
+    }
+
     @Test
     public void testZenPolicyApplyAllowedToDisallowed() {
         ZenPolicy.Builder builder = new ZenPolicy.Builder();
@@ -640,6 +646,54 @@
     }
 
     @Test
+    public void testFromParcel() {
+        ZenPolicy.Builder builder = new ZenPolicy.Builder();
+        builder.setUserModifiedFields(10);
+
+        ZenPolicy policy = builder.build();
+        assertThat(policy.getUserModifiedFields()).isEqualTo(10);
+
+        Parcel parcel = Parcel.obtain();
+        policy.writeToParcel(parcel, 0);
+        parcel.setDataPosition(0);
+
+        ZenPolicy fromParcel = ZenPolicy.CREATOR.createFromParcel(parcel);
+        assertThat(fromParcel.getUserModifiedFields()).isEqualTo(10);
+    }
+
+    @Test
+    public void testPolicy_userModifiedFields() {
+        ZenPolicy.Builder builder = new ZenPolicy.Builder();
+        builder.setUserModifiedFields(10);
+        assertThat(builder.build().getUserModifiedFields()).isEqualTo(10);
+
+        builder.setUserModifiedFields(0);
+        assertThat(builder.build().getUserModifiedFields()).isEqualTo(0);
+    }
+
+    @Test
+    public void testPolicyBuilder_constructFromPolicy() {
+        ZenPolicy.Builder builder = new ZenPolicy.Builder();
+        ZenPolicy policy = builder.allowRepeatCallers(true).allowAlarms(false)
+                .showLights(true).showBadges(false)
+                .allowChannels(ZenPolicy.CHANNEL_TYPE_PRIORITY)
+                .setUserModifiedFields(20).build();
+
+        ZenPolicy newPolicy = new ZenPolicy.Builder(policy).build();
+
+        assertThat(newPolicy.getPriorityCategoryAlarms()).isEqualTo(ZenPolicy.STATE_DISALLOW);
+        assertThat(newPolicy.getPriorityCategoryCalls()).isEqualTo(ZenPolicy.STATE_UNSET);
+        assertThat(newPolicy.getPriorityCategoryRepeatCallers()).isEqualTo(ZenPolicy.STATE_ALLOW);
+
+        assertThat(newPolicy.getVisualEffectLights()).isEqualTo(ZenPolicy.STATE_ALLOW);
+        assertThat(newPolicy.getVisualEffectBadge()).isEqualTo(ZenPolicy.STATE_DISALLOW);
+        assertThat(newPolicy.getVisualEffectPeek()).isEqualTo(ZenPolicy.STATE_UNSET);
+
+        assertThat(newPolicy.getAllowedChannels()).isEqualTo(ZenPolicy.CHANNEL_TYPE_PRIORITY);
+        assertThat(newPolicy.getUserModifiedFields()).isEqualTo(20);
+    }
+
+    @Test
     public void testTooLongLists_fromParcel() {
         ArrayList<Integer> longList = new ArrayList<Integer>(50);
         for (int i = 0; i < 50; i++) {
diff --git a/services/tests/wmtests/src/com/android/server/policy/WindowWakeUpPolicyTests.java b/services/tests/wmtests/src/com/android/server/policy/WindowWakeUpPolicyTests.java
new file mode 100644
index 0000000..c3da903
--- /dev/null
+++ b/services/tests/wmtests/src/com/android/server/policy/WindowWakeUpPolicyTests.java
@@ -0,0 +1,354 @@
+/*
+ * Copyright (C) 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.server.policy;
+
+import static android.os.PowerManager.WAKE_REASON_CAMERA_LAUNCH;
+import static android.os.PowerManager.WAKE_REASON_LID;
+import static android.os.PowerManager.WAKE_REASON_GESTURE;
+import static android.os.PowerManager.WAKE_REASON_POWER_BUTTON;
+import static android.os.PowerManager.WAKE_REASON_WAKE_KEY;
+import static android.os.PowerManager.WAKE_REASON_WAKE_MOTION;
+import static android.view.InputDevice.SOURCE_ROTARY_ENCODER;
+import static android.view.InputDevice.SOURCE_TOUCHSCREEN;
+import static android.view.KeyEvent.KEYCODE_HOME;
+import static android.view.KeyEvent.KEYCODE_POWER;
+import static android.view.KeyEvent.KEYCODE_STEM_PRIMARY;
+
+import static com.android.internal.R.bool.config_allowTheaterModeWakeFromKey;
+import static com.android.internal.R.bool.config_allowTheaterModeWakeFromPowerKey;
+import static com.android.internal.R.bool.config_allowTheaterModeWakeFromMotion;
+import static com.android.internal.R.bool.config_allowTheaterModeWakeFromCameraLens;
+import static com.android.internal.R.bool.config_allowTheaterModeWakeFromLidSwitch;
+import static com.android.internal.R.bool.config_allowTheaterModeWakeFromGesture;
+import static com.android.server.policy.Flags.FLAG_SUPPORT_INPUT_WAKEUP_DELEGATE;
+
+import static com.google.common.truth.Truth.assertThat;
+import static com.google.common.truth.Truth.assertWithMessage;
+
+import static org.mockito.ArgumentMatchers.anyBoolean;
+import static org.mockito.ArgumentMatchers.anyInt;
+import static org.mockito.ArgumentMatchers.anyLong;
+import static org.mockito.ArgumentMatchers.anyString;
+import static org.mockito.Mockito.never;
+import static org.mockito.Mockito.spy;
+import static org.mockito.Mockito.verify;
+import static org.mockito.Mockito.when;
+
+import android.content.Context;
+import android.content.ContextWrapper;
+import android.content.res.Resources;
+import android.os.PowerManager;
+import android.platform.test.flag.junit.SetFlagsRule;
+import android.provider.Settings;
+
+import androidx.test.InstrumentationRegistry;
+
+import com.android.internal.os.Clock;
+import com.android.internal.util.test.FakeSettingsProvider;
+import com.android.internal.util.test.FakeSettingsProviderRule;
+import com.android.server.LocalServices;
+
+import org.junit.Before;
+import org.junit.Rule;
+import org.junit.Test;
+import org.mockito.Mock;
+import org.mockito.Mockito;
+import org.mockito.junit.MockitoJUnit;
+import org.mockito.junit.MockitoRule;
+
+import java.util.function.BooleanSupplier;
+/**
+ * Test class for {@link WindowWakeUpPolicy}.
+ *
+ * <p>Build/Install/Run: atest WmTests:WindowWakeUpPolicyTests
+ */
+public final class WindowWakeUpPolicyTests {
+    @Rule public MockitoRule mMockitoRule = MockitoJUnit.rule();
+    @Rule public FakeSettingsProviderRule mSettingsProviderRule = FakeSettingsProvider.rule();
+    @Rule public final SetFlagsRule mSetFlagsRule = new SetFlagsRule();
+
+    @Mock PowerManager mPowerManager;
+    @Mock Clock mClock;
+    @Mock WindowWakeUpPolicyInternal.InputWakeUpDelegate mInputWakeUpDelegate;
+
+    private Context mContextSpy;
+    private Resources mResourcesSpy;
+
+    private WindowWakeUpPolicy mPolicy;
+
+    @Before
+    public void setUp() {
+        mContextSpy = spy(new ContextWrapper(InstrumentationRegistry.getContext()));
+        mResourcesSpy = spy(mContextSpy.getResources());
+        when(mContextSpy.getResources()).thenReturn(mResourcesSpy);
+        when(mContextSpy.getSystemService(PowerManager.class)).thenReturn(mPowerManager);
+        LocalServices.removeServiceForTest(WindowWakeUpPolicyInternal.class);
+    }
+
+    @Test
+    public void testSupportsInputWakeDelegatse_publishesLocalService() {
+        mSetFlagsRule.enableFlags(FLAG_SUPPORT_INPUT_WAKEUP_DELEGATE);
+
+        mPolicy = new WindowWakeUpPolicy(mContextSpy, mClock);
+
+        assertThat(LocalServices.getService(WindowWakeUpPolicyInternal.class)).isNotNull();
+    }
+
+    @Test
+    public void testDoesNotSupportInputWakeDelegatse_doesNotPublishLocalService() {
+        mSetFlagsRule.disableFlags(FLAG_SUPPORT_INPUT_WAKEUP_DELEGATE);
+
+        mPolicy = new WindowWakeUpPolicy(mContextSpy, mClock);
+
+        assertThat(LocalServices.getService(WindowWakeUpPolicyInternal.class)).isNull();
+    }
+
+    @Test
+    public void testMotionWakeUpDelegation_wakePowerManagerIfDelegateDoesNotHandleWake() {
+        setTheaterModeEnabled(false);
+        mSetFlagsRule.enableFlags(FLAG_SUPPORT_INPUT_WAKEUP_DELEGATE);
+        mPolicy = new WindowWakeUpPolicy(mContextSpy, mClock);
+        LocalServices.getService(WindowWakeUpPolicyInternal.class)
+                .setInputWakeUpDelegate(mInputWakeUpDelegate);
+
+        setDelegatedMotionWakeUpResult(true);
+
+        // Verify the policy wake up call succeeds because of the call on the delegate, and not
+        // because of a PowerManager wake up.
+        assertThat(mPolicy.wakeUpFromMotion(200, SOURCE_TOUCHSCREEN, true)).isTrue();
+        verify(mInputWakeUpDelegate).wakeUpFromMotion(200, SOURCE_TOUCHSCREEN, true);
+        verifyNoPowerManagerWakeUp();
+
+        setDelegatedMotionWakeUpResult(false);
+
+        // Verify the policy wake up call succeeds because of the PowerManager wake up, since the
+        // delegate would not handle the wake up request.
+        assertThat(mPolicy.wakeUpFromMotion(300, SOURCE_ROTARY_ENCODER, false)).isTrue();
+        verify(mInputWakeUpDelegate).wakeUpFromMotion(300, SOURCE_ROTARY_ENCODER, false);
+        verify(mPowerManager).wakeUp(300, WAKE_REASON_WAKE_MOTION, "android.policy:MOTION");
+    }
+
+    @Test
+    public void testKeyWakeUpDelegation_wakePowerManagerIfDelegateDoesNotHandleWake() {
+        setTheaterModeEnabled(false);
+        mSetFlagsRule.enableFlags(FLAG_SUPPORT_INPUT_WAKEUP_DELEGATE);
+        mPolicy = new WindowWakeUpPolicy(mContextSpy, mClock);
+        LocalServices.getService(WindowWakeUpPolicyInternal.class)
+                .setInputWakeUpDelegate(mInputWakeUpDelegate);
+
+        setDelegatedKeyWakeUpResult(true);
+
+        // Verify the policy wake up call succeeds because of the call on the delegate, and not
+        // because of a PowerManager wake up.
+        assertThat(mPolicy.wakeUpFromKey(200, KEYCODE_POWER, true)).isTrue();
+        verify(mInputWakeUpDelegate).wakeUpFromKey(200, KEYCODE_POWER, true);
+        verifyNoPowerManagerWakeUp();
+
+        setDelegatedKeyWakeUpResult(false);
+
+        // Verify the policy wake up call succeeds because of the PowerManager wake up, since the
+        // delegate would not handle the wake up request.
+        assertThat(mPolicy.wakeUpFromKey(300, KEYCODE_STEM_PRIMARY, false)).isTrue();
+        verify(mInputWakeUpDelegate).wakeUpFromKey(300, KEYCODE_STEM_PRIMARY, false);
+        verify(mPowerManager).wakeUp(300, WAKE_REASON_WAKE_KEY, "android.policy:KEY");
+    }
+
+    @Test
+    public void testDelegatedKeyWakeIsSubjectToPolicyChecks() {
+        mSetFlagsRule.enableFlags(FLAG_SUPPORT_INPUT_WAKEUP_DELEGATE);
+        setDelegatedKeyWakeUpResult(true);
+        setTheaterModeEnabled(true);
+        setBooleanRes(config_allowTheaterModeWakeFromKey, false);
+        setBooleanRes(config_allowTheaterModeWakeFromPowerKey, false);
+        mPolicy = new WindowWakeUpPolicy(mContextSpy, mClock);
+        LocalServices.getService(WindowWakeUpPolicyInternal.class)
+                .setInputWakeUpDelegate(mInputWakeUpDelegate);
+
+        // Check that the wake up does not happen because the theater mode policy check fails.
+        assertThat(mPolicy.wakeUpFromKey(200, KEYCODE_POWER, true)).isFalse();
+        verify(mInputWakeUpDelegate, never()).wakeUpFromKey(anyLong(), anyInt(), anyBoolean());
+    }
+
+    @Test
+    public void testDelegatedMotionWakeIsSubjectToPolicyChecks() {
+        mSetFlagsRule.enableFlags(FLAG_SUPPORT_INPUT_WAKEUP_DELEGATE);
+        setDelegatedMotionWakeUpResult(true);
+        setTheaterModeEnabled(true);
+        setBooleanRes(config_allowTheaterModeWakeFromMotion, false);
+        mPolicy = new WindowWakeUpPolicy(mContextSpy, mClock);
+        LocalServices.getService(WindowWakeUpPolicyInternal.class)
+                .setInputWakeUpDelegate(mInputWakeUpDelegate);
+
+        // Check that the wake up does not happen because the theater mode policy check fails.
+        assertThat(mPolicy.wakeUpFromMotion(200, SOURCE_TOUCHSCREEN, true)).isFalse();
+        verify(mInputWakeUpDelegate, never()).wakeUpFromMotion(anyLong(), anyInt(), anyBoolean());
+    }
+
+    @Test
+    public void testWakeUpFromMotion() {
+        runPowerManagerUpChecks(
+                () -> mPolicy.wakeUpFromMotion(mClock.uptimeMillis(), SOURCE_TOUCHSCREEN, true),
+                config_allowTheaterModeWakeFromMotion,
+                WAKE_REASON_WAKE_MOTION,
+                "android.policy:MOTION");
+    }
+
+    @Test
+    public void testWakeUpFromKey_nonPowerKey() {
+        runPowerManagerUpChecks(
+                () -> mPolicy.wakeUpFromKey(mClock.uptimeMillis(), KEYCODE_HOME, true),
+                config_allowTheaterModeWakeFromKey,
+                WAKE_REASON_WAKE_KEY,
+                "android.policy:KEY");
+    }
+
+    @Test
+    public void testWakeUpFromKey_powerKey() {
+        // Disable the resource affecting all wake keys because it affects power key as well.
+        // That way, power key wake during theater mode will solely be controlled by
+        // `config_allowTheaterModeWakeFromPowerKey` in the checks.
+        setBooleanRes(config_allowTheaterModeWakeFromKey, false);
+
+        // Test with power key
+        runPowerManagerUpChecks(
+                () -> mPolicy.wakeUpFromKey(mClock.uptimeMillis(), KEYCODE_POWER, true),
+                config_allowTheaterModeWakeFromPowerKey,
+                WAKE_REASON_POWER_BUTTON,
+                "android.policy:POWER");
+
+        // Test that power key wake ups happen during theater mode as long as wake-keys are allowed
+        // even if the power-key specific theater mode config is disabled.
+        setBooleanRes(config_allowTheaterModeWakeFromPowerKey, false);
+        runPowerManagerUpChecks(
+                () -> mPolicy.wakeUpFromKey(mClock.uptimeMillis(), KEYCODE_POWER, false),
+                config_allowTheaterModeWakeFromKey,
+                WAKE_REASON_POWER_BUTTON,
+                "android.policy:POWER");
+    }
+
+    @Test
+    public void testWakeUpFromLid() {
+        runPowerManagerUpChecks(
+                () -> mPolicy.wakeUpFromLid(),
+                config_allowTheaterModeWakeFromLidSwitch,
+                WAKE_REASON_LID,
+                "android.policy:LID");
+    }
+
+    @Test
+    public void testWakeUpFromWakeGesture() {
+        runPowerManagerUpChecks(
+                () -> mPolicy.wakeUpFromWakeGesture(),
+                config_allowTheaterModeWakeFromGesture,
+                WAKE_REASON_GESTURE,
+                "android.policy:GESTURE");
+    }
+
+    @Test
+    public void testwakeUpFromCameraCover() {
+        runPowerManagerUpChecks(
+                () -> mPolicy.wakeUpFromCameraCover(mClock.uptimeMillis()),
+                config_allowTheaterModeWakeFromCameraLens,
+                WAKE_REASON_CAMERA_LAUNCH,
+                "android.policy:CAMERA_COVER");
+    }
+
+    @Test
+    public void testWakeUpFromPowerKeyCameraGesture() {
+        // Disable the resource affecting all wake keys because it affects power key as well.
+        // That way, power key wake during theater mode will solely be controlled by
+        // `config_allowTheaterModeWakeFromPowerKey` in the checks.
+        setBooleanRes(config_allowTheaterModeWakeFromKey, false);
+
+        runPowerManagerUpChecks(
+                () -> mPolicy.wakeUpFromPowerKeyCameraGesture(),
+                config_allowTheaterModeWakeFromPowerKey,
+                WAKE_REASON_CAMERA_LAUNCH,
+                "android.policy:CAMERA_GESTURE_PREVENT_LOCK");
+    }
+
+    private void runPowerManagerUpChecks(
+            BooleanSupplier wakeUpCall,
+            int theatherModeWakeResId,
+            int expectedWakeReason,
+            String expectedWakeDetails) {
+        // Test under theater mode enabled.
+        setTheaterModeEnabled(true);
+
+        Mockito.reset(mPowerManager);
+        setBooleanRes(theatherModeWakeResId, true);
+        mPolicy = new WindowWakeUpPolicy(mContextSpy, mClock);
+        setUptimeMillis(200);
+        assertWithMessage("Wake should happen in theater mode when config allows it.")
+                .that(wakeUpCall.getAsBoolean()).isTrue();
+        verify(mPowerManager).wakeUp(200L, expectedWakeReason, expectedWakeDetails);
+
+        Mockito.reset(mPowerManager);
+        setBooleanRes(theatherModeWakeResId, false);
+        mPolicy = new WindowWakeUpPolicy(mContextSpy, mClock);
+        setUptimeMillis(250);
+        assertWithMessage("Wake should not happen in theater mode when config disallows it.")
+                .that(wakeUpCall.getAsBoolean()).isFalse();
+        verifyNoPowerManagerWakeUp();
+
+        // Cases when theater mode is disabled.
+        setTheaterModeEnabled(false);
+
+        Mockito.reset(mPowerManager);
+        setBooleanRes(theatherModeWakeResId, true);
+        mPolicy = new WindowWakeUpPolicy(mContextSpy, mClock);
+        setUptimeMillis(300);
+        assertWithMessage("Wake should happen when not in theater mode.")
+                .that(wakeUpCall.getAsBoolean()).isTrue();
+        verify(mPowerManager).wakeUp(300L, expectedWakeReason, expectedWakeDetails);
+
+        Mockito.reset(mPowerManager);
+        setBooleanRes(theatherModeWakeResId, false);
+        mPolicy = new WindowWakeUpPolicy(mContextSpy, mClock);
+        setUptimeMillis(350);
+        assertWithMessage("Wake should happen when not in theater mode.")
+                .that(wakeUpCall.getAsBoolean()).isTrue();
+        verify(mPowerManager).wakeUp(350L, expectedWakeReason, expectedWakeDetails);
+    }
+
+    private void verifyNoPowerManagerWakeUp() {
+        verify(mPowerManager, never()).wakeUp(anyLong(), anyInt(), anyString());
+    }
+
+    private void setBooleanRes(int resId, boolean val) {
+        when(mResourcesSpy.getBoolean(resId)).thenReturn(val);
+    }
+
+    private void setUptimeMillis(long uptimeMillis) {
+        when(mClock.uptimeMillis()).thenReturn(uptimeMillis);
+    }
+
+    private void setTheaterModeEnabled(boolean enabled) {
+        Settings.Global.putInt(
+                mContextSpy.getContentResolver(), Settings.Global.THEATER_MODE_ON, enabled ? 1 : 0);
+    }
+
+    private void setDelegatedMotionWakeUpResult(boolean result) {
+        when(mInputWakeUpDelegate.wakeUpFromMotion(anyLong(), anyInt(), anyBoolean()))
+                .thenReturn(result);
+    }
+
+    private void setDelegatedKeyWakeUpResult(boolean result) {
+        when(mInputWakeUpDelegate.wakeUpFromKey(anyLong(), anyInt(), anyBoolean()))
+                .thenReturn(result);
+    }
+}
diff --git a/services/tests/wmtests/src/com/android/server/wm/ActivityRecordTests.java b/services/tests/wmtests/src/com/android/server/wm/ActivityRecordTests.java
index f049b33..f5282cb 100644
--- a/services/tests/wmtests/src/com/android/server/wm/ActivityRecordTests.java
+++ b/services/tests/wmtests/src/com/android/server/wm/ActivityRecordTests.java
@@ -143,7 +143,6 @@
 import android.os.RemoteException;
 import android.platform.test.annotations.Presubmit;
 import android.provider.DeviceConfig;
-import android.util.MergedConfiguration;
 import android.util.MutableBoolean;
 import android.view.DisplayInfo;
 import android.view.IRemoteAnimationFinishedCallback;
@@ -395,8 +394,7 @@
         activity.setState(RESUMED, "Testing");
 
         task.onRequestedOverrideConfigurationChanged(task.getConfiguration());
-        activity.setLastReportedConfiguration(new MergedConfiguration(new Configuration(),
-                activity.getConfiguration()));
+        activity.setLastReportedConfiguration(new Configuration(), activity.getConfiguration());
 
         activity.info.configChanges &= ~CONFIG_ORIENTATION;
         final Configuration newConfig = new Configuration(task.getConfiguration());
@@ -420,8 +418,7 @@
         activity.setState(RESUMED, "Testing");
 
         task.onRequestedOverrideConfigurationChanged(task.getConfiguration());
-        activity.setLastReportedConfiguration(new MergedConfiguration(new Configuration(),
-                activity.getConfiguration()));
+        activity.setLastReportedConfiguration(new Configuration(), activity.getConfiguration());
 
         activity.info.configChanges &= ~CONFIG_ORIENTATION;
         final Configuration newConfig = new Configuration(task.getConfiguration());
@@ -447,8 +444,7 @@
         activity.setState(RESUMED, "Testing");
 
         task.onRequestedOverrideConfigurationChanged(task.getConfiguration());
-        activity.setLastReportedConfiguration(new MergedConfiguration(new Configuration(),
-                activity.getConfiguration()));
+        activity.setLastReportedConfiguration(new Configuration(), activity.getConfiguration());
 
         activity.info.configChanges &= ~CONFIG_ORIENTATION;
         final Configuration newConfig = new Configuration(task.getConfiguration());
@@ -468,8 +464,7 @@
         activity.setState(RESUMED, "Testing");
 
         task.onRequestedOverrideConfigurationChanged(task.getConfiguration());
-        activity.setLastReportedConfiguration(new MergedConfiguration(new Configuration(),
-                activity.getConfiguration()));
+        activity.setLastReportedConfiguration(new Configuration(), activity.getConfiguration());
 
         activity.info.configChanges &= ~ActivityInfo.CONFIG_FONT_SCALE;
         final Configuration newConfig = new Configuration(task.getConfiguration());
@@ -571,8 +566,7 @@
                 .build();
         activity.setState(RESUMED, "Testing");
 
-        activity.setLastReportedConfiguration(new MergedConfiguration(new Configuration(),
-                activity.getConfiguration()));
+        activity.setLastReportedConfiguration(new Configuration(), activity.getConfiguration());
 
         clearInvocations(mClientLifecycleManager);
 
@@ -799,8 +793,7 @@
             doReturn(false).when(stack).isTranslucent(any());
             assertTrue(task.shouldBeVisible(null /* starting */));
 
-            activity.setLastReportedConfiguration(new MergedConfiguration(new Configuration(),
-                    activity.getConfiguration()));
+            activity.setLastReportedConfiguration(new Configuration(), activity.getConfiguration());
 
             final Configuration newConfig = new Configuration(activity.getConfiguration());
             final int shortSide = newConfig.screenWidthDp == newConfig.screenHeightDp
@@ -846,7 +839,7 @@
     }
 
     @Test
-    public void testTakeOptions() {
+    public void testTakeSceneTransitionInfo() {
         final ActivityRecord activity = createActivityWithTask();
         ActivityOptions opts = ActivityOptions.makeRemoteAnimation(
                 new RemoteAnimationAdapter(new Stub() {
@@ -864,7 +857,9 @@
                     }
                 }, 0, 0));
         activity.updateOptionsLocked(opts);
-        assertNotNull(activity.takeOptions());
+        // Ensure the SceneTransitionInfo is null (since the ActivityOptions is for remote
+        // animation and AR#takeSceneTransitionInfo also clear the AR#mPendingOptions
+        assertNull(activity.takeSceneTransitionInfo());
         assertNull(activity.getOptions());
 
         final AppTransition appTransition = activity.mDisplayContent.mAppTransition;
diff --git a/services/tests/wmtests/src/com/android/server/wm/BackNavigationControllerTests.java b/services/tests/wmtests/src/com/android/server/wm/BackNavigationControllerTests.java
index ac18f80..d83824a 100644
--- a/services/tests/wmtests/src/com/android/server/wm/BackNavigationControllerTests.java
+++ b/services/tests/wmtests/src/com/android/server/wm/BackNavigationControllerTests.java
@@ -464,9 +464,10 @@
         // Simulate ActivityOptions#makeSceneTransitionAnimation
         final Bundle myBundle = new Bundle();
         myBundle.putInt(ActivityOptions.KEY_ANIM_TYPE, ANIM_SCENE_TRANSITION);
-        myBundle.putParcelable("android:activity.transitionCompleteListener",
-                mock(android.os.ResultReceiver.class));
         final ActivityOptions options = new ActivityOptions(myBundle);
+        final ActivityOptions.SceneTransitionInfo info = new ActivityOptions.SceneTransitionInfo();
+        info.setResultReceiver(mock(android.os.ResultReceiver.class));
+        options.setSceneTransitionInfo(info);
 
         final ActivityRecord testActivity = new ActivityBuilder(mAtm)
                 .setCreateTask(true)
diff --git a/services/tests/wmtests/src/com/android/server/wm/DisplayContentDeferredUpdateTests.java b/services/tests/wmtests/src/com/android/server/wm/DisplayContentDeferredUpdateTests.java
index dfa595c..99d354a 100644
--- a/services/tests/wmtests/src/com/android/server/wm/DisplayContentDeferredUpdateTests.java
+++ b/services/tests/wmtests/src/com/android/server/wm/DisplayContentDeferredUpdateTests.java
@@ -55,6 +55,11 @@
 @RunWith(WindowTestRunner.class)
 public class DisplayContentDeferredUpdateTests extends WindowTestsBase {
 
+    // The fields to override the current DisplayInfo.
+    private String mUniqueId;
+    private int mColorMode;
+    private int mLogicalDensityDpi;
+
     @Override
     protected void onBeforeSystemServicesCreated() {
         // Set other flags to their default values
@@ -73,7 +78,7 @@
     public void testUpdate_deferrableFieldChangedTransitionStarted_deferrableFieldUpdated() {
         performInitialDisplayUpdate();
 
-        givenDisplayInfo(/* uniqueId= */ "old");
+        mUniqueId = "old";
         Runnable onUpdated = mock(Runnable.class);
         mDisplayContent.requestDisplayUpdate(onUpdated);
 
@@ -82,11 +87,21 @@
         verify(onUpdated).run();
         clearInvocations(mDisplayContent.mTransitionController, onUpdated);
 
-        givenDisplayInfo(/* uniqueId= */ "new");
+        mUniqueId = "new";
         mDisplayContent.requestDisplayUpdate(onUpdated);
         captureStartTransitionCollection().getValue().onCollectStarted(/* deferred= */ true);
         verify(onUpdated).run();
+        verify(mDisplayContent.mTransitionController).requestStartTransition(
+                any(), any(), any(), any());
         assertThat(mDisplayContent.getDisplayInfo().uniqueId).isEqualTo("new");
+        clearInvocations(mDisplayContent.mTransitionController, onUpdated);
+
+        mLogicalDensityDpi += 100;
+        mDisplayContent.requestDisplayUpdate(onUpdated);
+        captureStartTransitionCollection().getValue().onCollectStarted(/* deferred= */ true);
+        verify(onUpdated).run();
+        verify(mDisplayContent.mTransitionController).requestStartTransition(
+                any(), any(), any(), any());
     }
 
     @Test
@@ -94,7 +109,8 @@
         performInitialDisplayUpdate();
 
         // Update only color mode (non-deferrable field) and keep the same unique id
-        givenDisplayInfo(/* uniqueId= */ "initial_unique_id", /* colorMode= */ 123);
+        mUniqueId = "initial_unique_id";
+        mColorMode = 123;
         Runnable onUpdated = mock(Runnable.class);
         mDisplayContent.requestDisplayUpdate(onUpdated);
 
@@ -107,7 +123,8 @@
         performInitialDisplayUpdate();
 
         // Update only color mode (non-deferrable field) and keep the same unique id
-        givenDisplayInfo(/* uniqueId= */ "initial_unique_id", /* colorMode= */ 123);
+        mUniqueId = "initial_unique_id";
+        mColorMode = 123;
         mDisplayContent.requestDisplayUpdate(mock(Runnable.class));
 
         assertThat(mDisplayContent.getDisplayInfo().colorMode).isEqualTo(123);
@@ -116,7 +133,7 @@
 
         // Update unique id (deferrable field), keep the same color mode,
         // this update should be deferred
-        givenDisplayInfo(/* uniqueId= */ "new_unique_id", /* colorMode= */ 123);
+        mUniqueId = "new_unique_id";
         mDisplayContent.requestDisplayUpdate(mock(Runnable.class));
 
         assertThat(mDisplayContent.getDisplayInfo().colorMode).isEqualTo(123);
@@ -126,7 +143,7 @@
         // Update color mode again and keep the same unique id, color mode update
         // should not be deferred, unique id update is still deferred as transition
         // has not started collecting yet
-        givenDisplayInfo(/* uniqueId= */ "new_unique_id", /* colorMode= */ 456);
+        mColorMode = 456;
         Runnable onUpdated = mock(Runnable.class);
         mDisplayContent.requestDisplayUpdate(onUpdated);
 
@@ -146,14 +163,14 @@
     @Test
     public void testUpdate_deferrableFieldUpdatedTransitionPending_fieldNotUpdated() {
         performInitialDisplayUpdate();
-        givenDisplayInfo(/* uniqueId= */ "old");
+        mUniqueId = "old";
         Runnable onUpdated = mock(Runnable.class);
         mDisplayContent.requestDisplayUpdate(onUpdated);
         captureStartTransitionCollection().getValue().onCollectStarted(/* deferred= */ true);
         verify(onUpdated).run();
         clearInvocations(mDisplayContent.mTransitionController, onUpdated);
 
-        givenDisplayInfo(/* uniqueId= */ "new");
+        mUniqueId = "new";
         mDisplayContent.requestDisplayUpdate(onUpdated);
 
         captureStartTransitionCollection(); // do not continue by not starting the collection
@@ -164,7 +181,7 @@
     @Test
     public void testTwoDisplayUpdates_transitionStarted_displayUpdated() {
         performInitialDisplayUpdate();
-        givenDisplayInfo(/* uniqueId= */ "old");
+        mUniqueId = "old";
         Runnable onUpdated = mock(Runnable.class);
         mDisplayContent.requestDisplayUpdate(onUpdated);
         captureStartTransitionCollection().getValue()
@@ -173,10 +190,10 @@
         clearInvocations(mDisplayContent.mTransitionController, onUpdated);
 
         // Perform two display updates while WM is 'busy'
-        givenDisplayInfo(/* uniqueId= */ "new1");
+        mUniqueId = "new1";
         Runnable onUpdated1 = mock(Runnable.class);
         mDisplayContent.requestDisplayUpdate(onUpdated1);
-        givenDisplayInfo(/* uniqueId= */ "new2");
+        mUniqueId = "new2";
         Runnable onUpdated2 = mock(Runnable.class);
         mDisplayContent.requestDisplayUpdate(onUpdated2);
 
@@ -215,22 +232,19 @@
         return callbackCaptor;
     }
 
-    private void givenDisplayInfo(String uniqueId) {
-        givenDisplayInfo(uniqueId, /* colorMode= */ 0);
-    }
+    private void performInitialDisplayUpdate() {
+        mUniqueId = "initial_unique_id";
+        mColorMode = 0;
+        mLogicalDensityDpi = 400;
 
-    private void givenDisplayInfo(String uniqueId, int colorMode) {
         spyOn(mDisplayContent.mDisplay);
         doAnswer(invocation -> {
             DisplayInfo info = invocation.getArgument(0);
-            info.uniqueId = uniqueId;
-            info.colorMode = colorMode;
+            info.uniqueId = mUniqueId;
+            info.colorMode = mColorMode;
+            info.logicalDensityDpi = mLogicalDensityDpi;
             return null;
         }).when(mDisplayContent.mDisplay).getDisplayInfo(any());
-    }
-
-    private void performInitialDisplayUpdate() {
-        givenDisplayInfo(/* uniqueId= */ "initial_unique_id", /* colorMode= */ 0);
         Runnable onUpdated = mock(Runnable.class);
         mDisplayContent.requestDisplayUpdate(onUpdated);
     }
diff --git a/services/tests/wmtests/src/com/android/server/wm/RootWindowContainerTests.java b/services/tests/wmtests/src/com/android/server/wm/RootWindowContainerTests.java
index 28fecd6..6013063 100644
--- a/services/tests/wmtests/src/com/android/server/wm/RootWindowContainerTests.java
+++ b/services/tests/wmtests/src/com/android/server/wm/RootWindowContainerTests.java
@@ -76,7 +76,6 @@
 import android.os.PowerManager;
 import android.os.UserHandle;
 import android.platform.test.annotations.Presubmit;
-import android.util.MergedConfiguration;
 import android.util.Pair;
 
 import androidx.test.filters.MediumTest;
@@ -545,8 +544,7 @@
         assertNotEquals(activity.getConfiguration().orientation, rotatedConfig.orientation);
         // Assume the activity was shown in different orientation. For example, the top activity is
         // landscape and the portrait lockscreen is shown.
-        activity.setLastReportedConfiguration(
-                new MergedConfiguration(mAtm.getGlobalConfiguration(), rotatedConfig));
+        activity.setLastReportedConfiguration(mAtm.getGlobalConfiguration(), rotatedConfig);
         activity.setState(STOPPED, "sleep");
 
         display.setIsSleeping(true);
diff --git a/services/tests/wmtests/src/com/android/server/wm/SensitiveContentPackagesTest.java b/services/tests/wmtests/src/com/android/server/wm/SensitiveContentPackagesTest.java
new file mode 100644
index 0000000..71dbc57
--- /dev/null
+++ b/services/tests/wmtests/src/com/android/server/wm/SensitiveContentPackagesTest.java
@@ -0,0 +1,104 @@
+/*
+ * Copyright (C) 2023 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.server.wm;
+
+import static org.junit.Assert.assertFalse;
+import static org.junit.Assert.assertTrue;
+
+import android.platform.test.annotations.Presubmit;
+
+import androidx.test.filters.SmallTest;
+
+import com.android.server.wm.SensitiveContentPackages.PackageInfo;
+
+import org.junit.After;
+import org.junit.Test;
+
+import java.util.Collections;
+import java.util.Set;
+
+/**
+ * Build/Install/Run:
+ *  atest WmTests:SensitiveContentPackagesTest
+ */
+@SmallTest
+@Presubmit
+public class SensitiveContentPackagesTest {
+    private static final String APP_PKG_1 = "com.android.server.wm.one";
+    private static final String APP_PKG_2 = "com.android.server.wm.two";
+    private static final String APP_PKG_3 = "com.android.server.wm.three";
+
+    private static final int APP_UID_1 = 5;
+    private static final int APP_UID_2 = 6;
+    private static final int APP_UID_3 = 7;
+
+
+    private final SensitiveContentPackages mSensitiveContentPackages =
+            new SensitiveContentPackages();
+
+    @After
+    public void tearDown() {
+        mSensitiveContentPackages.setShouldBlockScreenCaptureForApp(Collections.emptySet());
+    }
+
+    @Test
+    public void setShouldBlockScreenCaptureForApp() {
+        Set<PackageInfo> blockedApps =
+                Set.of(new PackageInfo(APP_PKG_1, APP_UID_1),
+                        new PackageInfo(APP_PKG_1, APP_UID_2),
+                        new PackageInfo(APP_PKG_2, APP_UID_1),
+                        new PackageInfo(APP_PKG_2, APP_UID_2));
+
+        mSensitiveContentPackages.setShouldBlockScreenCaptureForApp(blockedApps);
+
+        assertTrue(mSensitiveContentPackages.shouldBlockScreenCaptureForApp(APP_PKG_1, APP_UID_1));
+        assertTrue(mSensitiveContentPackages.shouldBlockScreenCaptureForApp(APP_PKG_1, APP_UID_2));
+        assertFalse(mSensitiveContentPackages.shouldBlockScreenCaptureForApp(APP_PKG_1, APP_UID_3));
+
+        assertTrue(mSensitiveContentPackages.shouldBlockScreenCaptureForApp(APP_PKG_2, APP_UID_1));
+        assertTrue(mSensitiveContentPackages.shouldBlockScreenCaptureForApp(APP_PKG_2, APP_UID_2));
+        assertFalse(mSensitiveContentPackages.shouldBlockScreenCaptureForApp(APP_PKG_2, APP_UID_3));
+
+        assertFalse(mSensitiveContentPackages.shouldBlockScreenCaptureForApp(APP_PKG_3, APP_UID_1));
+        assertFalse(mSensitiveContentPackages.shouldBlockScreenCaptureForApp(APP_PKG_3, APP_UID_2));
+        assertFalse(mSensitiveContentPackages.shouldBlockScreenCaptureForApp(APP_PKG_3, APP_UID_3));
+    }
+
+    @Test
+    public void setShouldBlockScreenCaptureForApp_empty() {
+        Set<PackageInfo> blockedApps =
+                Set.of(new PackageInfo(APP_PKG_1, APP_UID_1),
+                        new PackageInfo(APP_PKG_1, APP_UID_2),
+                        new PackageInfo(APP_PKG_2, APP_UID_1),
+                        new PackageInfo(APP_PKG_2, APP_UID_2));
+
+        mSensitiveContentPackages.setShouldBlockScreenCaptureForApp(blockedApps);
+        mSensitiveContentPackages.setShouldBlockScreenCaptureForApp(Collections.emptySet());
+
+        assertFalse(mSensitiveContentPackages.shouldBlockScreenCaptureForApp(APP_PKG_1, APP_UID_1));
+        assertFalse(mSensitiveContentPackages.shouldBlockScreenCaptureForApp(APP_PKG_1, APP_UID_2));
+        assertFalse(mSensitiveContentPackages.shouldBlockScreenCaptureForApp(APP_PKG_1, APP_UID_3));
+
+        assertFalse(mSensitiveContentPackages.shouldBlockScreenCaptureForApp(APP_PKG_2, APP_UID_1));
+        assertFalse(mSensitiveContentPackages.shouldBlockScreenCaptureForApp(APP_PKG_2, APP_UID_2));
+        assertFalse(mSensitiveContentPackages.shouldBlockScreenCaptureForApp(APP_PKG_2, APP_UID_3));
+
+        assertFalse(mSensitiveContentPackages.shouldBlockScreenCaptureForApp(APP_PKG_3, APP_UID_1));
+        assertFalse(mSensitiveContentPackages.shouldBlockScreenCaptureForApp(APP_PKG_3, APP_UID_2));
+        assertFalse(mSensitiveContentPackages.shouldBlockScreenCaptureForApp(APP_PKG_3, APP_UID_3));
+    }
+}
diff --git a/services/tests/wmtests/src/com/android/server/wm/SyncEngineTests.java b/services/tests/wmtests/src/com/android/server/wm/SyncEngineTests.java
index 810cbe8..6c5f975 100644
--- a/services/tests/wmtests/src/com/android/server/wm/SyncEngineTests.java
+++ b/services/tests/wmtests/src/com/android/server/wm/SyncEngineTests.java
@@ -16,6 +16,7 @@
 
 package com.android.server.wm;
 
+import static android.view.WindowManager.LayoutParams.TYPE_APPLICATION_STARTING;
 import static android.view.WindowManager.LayoutParams.TYPE_BASE_APPLICATION;
 
 import static com.android.dx.mockito.inline.extended.ExtendedMockito.doReturn;
@@ -134,6 +135,33 @@
         assertFalse(r.isSyncFinished(r.getSyncGroup()));
         r.finishRelaunching();
         assertTrue(r.isSyncFinished(r.getSyncGroup()));
+        assertEquals(SYNC_STATE_READY, r.mSyncState);
+
+        // If the container has finished the sync, isSyncFinished should not change the sync state.
+        final BLASTSyncEngine.SyncGroup syncGroup = r.getSyncGroup();
+        r.finishSync(mTransaction, syncGroup, false /* cancel */);
+        assertEquals(SYNC_STATE_NONE, r.mSyncState);
+        assertTrue(r.isSyncFinished(syncGroup));
+        assertEquals(SYNC_STATE_NONE, r.mSyncState);
+    }
+
+    @Test
+    public void testFinishSyncByStartingWindow() {
+        final ActivityRecord taskRoot = new ActivityBuilder(mAtm).setCreateTask(true).build();
+        final Task task = taskRoot.getTask();
+        final ActivityRecord translucentTop = new ActivityBuilder(mAtm).setTask(task)
+                .setActivityTheme(android.R.style.Theme_Translucent).build();
+        createWindow(null, TYPE_BASE_APPLICATION, taskRoot, "win");
+        final WindowState startingWindow = createWindow(null, TYPE_APPLICATION_STARTING,
+                translucentTop, "starting");
+        startingWindow.mStartingData = new SnapshotStartingData(mWm, null, 0);
+        task.mSharedStartingData = startingWindow.mStartingData;
+        task.prepareSync();
+
+        final BLASTSyncEngine.SyncGroup group = mock(BLASTSyncEngine.SyncGroup.class);
+        assertFalse(task.isSyncFinished(group));
+        startingWindow.onSyncFinishedDrawing();
+        assertTrue(task.isSyncFinished(group));
     }
 
     @Test
diff --git a/services/tests/wmtests/src/com/android/server/wm/TaskTests.java b/services/tests/wmtests/src/com/android/server/wm/TaskTests.java
index 45e1e95..b360800 100644
--- a/services/tests/wmtests/src/com/android/server/wm/TaskTests.java
+++ b/services/tests/wmtests/src/com/android/server/wm/TaskTests.java
@@ -43,6 +43,7 @@
 import static com.android.dx.mockito.inline.extended.ExtendedMockito.verify;
 import static com.android.server.policy.WindowManagerPolicy.USER_ROTATION_FREE;
 import static com.android.server.wm.Task.FLAG_FORCE_HIDDEN_FOR_TASK_ORG;
+import static com.android.server.wm.TaskFragment.EMBEDDED_DIM_AREA_PARENT_TASK;
 import static com.android.server.wm.TaskFragment.TASK_FRAGMENT_VISIBILITY_VISIBLE_BEHIND_TRANSLUCENT;
 
 import static com.google.common.truth.Truth.assertThat;
@@ -1620,6 +1621,29 @@
     }
 
     @Test
+    public void testBoostDimmingTaskFragmentOnTask() {
+        final TaskFragmentOrganizer organizer = new TaskFragmentOrganizer(Runnable::run);
+        final Task task = createTask(mDisplayContent);
+        final TaskFragment primary = createTaskFragmentWithEmbeddedActivity(task, organizer);
+        final TaskFragment secondary = createTaskFragmentWithEmbeddedActivity(task, organizer);
+        final SurfaceControl.Transaction t = mock(SurfaceControl.Transaction.class);
+
+        primary.mVisibleRequested = true;
+        secondary.mVisibleRequested = true;
+        primary.setAdjacentTaskFragment(secondary);
+        secondary.setAdjacentTaskFragment(primary);
+        primary.setEmbeddedDimArea(EMBEDDED_DIM_AREA_PARENT_TASK);
+        doReturn(true).when(primary).shouldBoostDimmer();
+        task.assignChildLayers(t);
+
+        // The layers are initially assigned via the hierarchy, but the primary will be boosted and
+        // assigned again to above of the secondary.
+        verify(primary).assignLayer(t, 0);
+        verify(secondary).assignLayer(t, 1);
+        verify(primary).assignLayer(t, 2);
+    }
+
+    @Test
     public void testMoveOrCreateDecorSurface() {
         final TaskFragmentOrganizer organizer = new TaskFragmentOrganizer(Runnable::run);
         final Task task =  new TaskBuilder(mSupervisor).setCreateActivity(true).build();
diff --git a/services/tests/wmtests/src/com/android/server/wm/WindowManagerServiceTests.java b/services/tests/wmtests/src/com/android/server/wm/WindowManagerServiceTests.java
index 21fee72..a1cc8d5 100644
--- a/services/tests/wmtests/src/com/android/server/wm/WindowManagerServiceTests.java
+++ b/services/tests/wmtests/src/com/android/server/wm/WindowManagerServiceTests.java
@@ -80,6 +80,7 @@
 import android.os.RemoteException;
 import android.os.UserHandle;
 import android.platform.test.annotations.Presubmit;
+import android.util.ArraySet;
 import android.util.MergedConfiguration;
 import android.view.ContentRecordingSession;
 import android.view.IWindow;
@@ -102,16 +103,19 @@
 import com.android.compatibility.common.util.AdoptShellPermissionsRule;
 import com.android.internal.os.IResultReceiver;
 import com.android.server.LocalServices;
+import com.android.server.wm.SensitiveContentPackages.PackageInfo;
 import com.android.server.wm.WindowManagerService.WindowContainerInfo;
 
 import com.google.common.truth.Expect;
 
+import org.junit.After;
 import org.junit.Rule;
 import org.junit.Test;
 import org.junit.runner.RunWith;
 import org.mockito.ArgumentCaptor;
 
 import java.util.ArrayList;
+import java.util.Collections;
 
 /**
  * Build/Install/Run:
@@ -133,6 +137,11 @@
     @Rule
     public Expect mExpect = Expect.create();
 
+    @After
+    public void tearDown() {
+        mWm.mSensitiveContentPackages.setShouldBlockScreenCaptureForApp(Collections.emptySet());
+    }
+
     @Test
     public void testIsRequestedOrientationMapped() {
         mWm.setOrientationRequestPolicy(/* isIgnoreOrientationRequestDisabled*/ true,
@@ -815,6 +824,42 @@
     }
 
     @Test
+    public void setShouldBlockScreenCaptureForApp() {
+        String testPackage = "test";
+        int ownerId1 = 20;
+        int ownerId2 = 21;
+        PackageInfo blockedPackage = new PackageInfo(testPackage, ownerId1);
+        ArraySet<PackageInfo> blockedPackages = new ArraySet();
+        blockedPackages.add(blockedPackage);
+
+        WindowManagerInternal wmInternal = LocalServices.getService(WindowManagerInternal.class);
+        wmInternal.setShouldBlockScreenCaptureForApp(blockedPackages);
+
+        assertTrue(mWm.mSensitiveContentPackages
+                .shouldBlockScreenCaptureForApp(testPackage, ownerId1));
+        assertFalse(mWm.mSensitiveContentPackages
+                .shouldBlockScreenCaptureForApp(testPackage, ownerId2));
+        verify(mWm).refreshScreenCaptureDisabled();
+    }
+
+    @Test
+    public void setShouldBlockScreenCaptureForApp_emptySet_clearsCache() {
+        String testPackage = "test";
+        int ownerId1 = 20;
+        PackageInfo blockedPackage = new PackageInfo(testPackage, ownerId1);
+        ArraySet<PackageInfo> blockedPackages = new ArraySet();
+        blockedPackages.add(blockedPackage);
+
+        WindowManagerInternal wmInternal = LocalServices.getService(WindowManagerInternal.class);
+        wmInternal.setShouldBlockScreenCaptureForApp(blockedPackages);
+        wmInternal.setShouldBlockScreenCaptureForApp(Collections.emptySet());
+
+        assertFalse(mWm.mSensitiveContentPackages
+                .shouldBlockScreenCaptureForApp(testPackage, ownerId1));
+        verify(mWm, times(2)).refreshScreenCaptureDisabled();
+    }
+
+    @Test
     public void testisLetterboxBackgroundMultiColored() {
         assertThat(setupLetterboxConfigurationWithBackgroundType(
                 LETTERBOX_BACKGROUND_APP_COLOR_BACKGROUND_FLOATING)).isTrue();
diff --git a/services/tests/wmtests/src/com/android/server/wm/WindowStateTests.java b/services/tests/wmtests/src/com/android/server/wm/WindowStateTests.java
index f24baba..fb4edfa 100644
--- a/services/tests/wmtests/src/com/android/server/wm/WindowStateTests.java
+++ b/services/tests/wmtests/src/com/android/server/wm/WindowStateTests.java
@@ -55,6 +55,7 @@
 import static com.android.dx.mockito.inline.extended.ExtendedMockito.spy;
 import static com.android.dx.mockito.inline.extended.ExtendedMockito.spyOn;
 import static com.android.dx.mockito.inline.extended.ExtendedMockito.verify;
+import static com.android.server.notification.Flags.FLAG_SENSITIVE_NOTIFICATION_APP_PROTECTION;
 import static com.android.server.wm.DisplayContent.IME_TARGET_CONTROL;
 import static com.android.server.wm.DisplayContent.IME_TARGET_LAYERING;
 import static com.android.server.wm.WindowContainer.SYNC_STATE_WAITING_FOR_DRAW;
@@ -90,6 +91,7 @@
 import android.os.InputConfig;
 import android.os.RemoteException;
 import android.platform.test.annotations.Presubmit;
+import android.platform.test.annotations.RequiresFlagsEnabled;
 import android.util.ArraySet;
 import android.util.MergedConfiguration;
 import android.view.Gravity;
@@ -109,7 +111,9 @@
 import androidx.test.filters.SmallTest;
 
 import com.android.server.testutils.StubTransaction;
+import com.android.server.wm.SensitiveContentPackages.PackageInfo;
 
+import org.junit.After;
 import org.junit.Test;
 import org.junit.runner.RunWith;
 
@@ -130,6 +134,11 @@
 @RunWith(WindowTestRunner.class)
 public class WindowStateTests extends WindowTestsBase {
 
+    @After
+    public void tearDown() {
+        mWm.mSensitiveContentPackages.setShouldBlockScreenCaptureForApp(Collections.emptySet());
+    }
+
     @Test
     public void testIsParentWindowHidden() {
         final WindowState parentWindow = createWindow(null, TYPE_APPLICATION, "parentWindow");
@@ -1373,6 +1382,28 @@
         assertThat(listener.mIsVisibleForImeTargetOverlay).isFalse();
     }
 
+    @Test
+    @RequiresFlagsEnabled(FLAG_SENSITIVE_NOTIFICATION_APP_PROTECTION)
+    public void testIsSecureLocked_sensitiveContentProtectionManagerEnabled() {
+        String testPackage = "test";
+        int ownerId1 = 20;
+        int ownerId2 = 21;
+        final WindowState window1 = createWindow(null, TYPE_APPLICATION, "window1", ownerId1);
+        final WindowState window2 = createWindow(null, TYPE_APPLICATION, "window2", ownerId2);
+
+        // Setting packagename for targeted feature
+        window1.mAttrs.packageName = testPackage;
+        window2.mAttrs.packageName = testPackage;
+
+        PackageInfo blockedPackage = new PackageInfo(testPackage, ownerId1);
+        ArraySet<PackageInfo> blockedPackages = new ArraySet();
+        blockedPackages.add(blockedPackage);
+        mWm.mSensitiveContentPackages.setShouldBlockScreenCaptureForApp(blockedPackages);
+
+        assertTrue(window1.isSecureLocked());
+        assertFalse(window2.isSecureLocked());
+    }
+
     private static class TestImeTargetChangeListener implements ImeTargetChangeListener {
         private IBinder mImeTargetToken;
         private boolean mIsRemoved;
diff --git a/telephony/java/android/telephony/SecurityAlgorithmUpdate.java b/telephony/java/android/telephony/SecurityAlgorithmUpdate.java
index 61d7ead..c902016 100644
--- a/telephony/java/android/telephony/SecurityAlgorithmUpdate.java
+++ b/telephony/java/android/telephony/SecurityAlgorithmUpdate.java
@@ -169,6 +169,7 @@
     public static final int SECURITY_ALGORITHM_NEA1 = 56;
     public static final int SECURITY_ALGORITHM_NEA2 = 57;
     public static final int SECURITY_ALGORITHM_NEA3 = 58;
+    public static final int SECURITY_ALGORITHM_IMS_NULL = 67;
     public static final int SECURITY_ALGORITHM_SIP_NULL = 68;
     public static final int SECURITY_ALGORITHM_AES_GCM = 69;
     public static final int SECURITY_ALGORITHM_AES_GMAC = 70;
@@ -176,9 +177,8 @@
     public static final int SECURITY_ALGORITHM_DES_EDE3_CBC = 72;
     public static final int SECURITY_ALGORITHM_AES_EDE3_CBC = 73;
     public static final int SECURITY_ALGORITHM_HMAC_SHA1_96 = 74;
-    public static final int SECURITY_ALGORITHM_HMAC_SHA1_96_NULL = 75;
-    public static final int SECURITY_ALGORITHM_HMAC_MD5_96 = 76;
-    public static final int SECURITY_ALGORITHM_HMAC_MD5_96_NULL = 77;
+    public static final int SECURITY_ALGORITHM_HMAC_MD5_96 = 75;
+    public static final int SECURITY_ALGORITHM_SRTP_NULL = 86;
     public static final int SECURITY_ALGORITHM_SRTP_AES_COUNTER = 87;
     public static final int SECURITY_ALGORITHM_SRTP_AES_F8 = 88;
     public static final int SECURITY_ALGORITHM_SRTP_HMAC_SHA1 = 89;
@@ -199,15 +199,15 @@
             SECURITY_ALGORITHM_UEA2, SECURITY_ALGORITHM_EEA0, SECURITY_ALGORITHM_EEA1,
             SECURITY_ALGORITHM_EEA2, SECURITY_ALGORITHM_EEA3, SECURITY_ALGORITHM_NEA0,
             SECURITY_ALGORITHM_NEA1, SECURITY_ALGORITHM_NEA2, SECURITY_ALGORITHM_NEA3,
-            SECURITY_ALGORITHM_SIP_NULL, SECURITY_ALGORITHM_AES_GCM,
+            SECURITY_ALGORITHM_IMS_NULL, SECURITY_ALGORITHM_SIP_NULL, SECURITY_ALGORITHM_AES_GCM,
             SECURITY_ALGORITHM_AES_GMAC, SECURITY_ALGORITHM_AES_CBC,
             SECURITY_ALGORITHM_DES_EDE3_CBC, SECURITY_ALGORITHM_AES_EDE3_CBC,
-            SECURITY_ALGORITHM_HMAC_SHA1_96, SECURITY_ALGORITHM_HMAC_SHA1_96_NULL,
-            SECURITY_ALGORITHM_HMAC_MD5_96, SECURITY_ALGORITHM_HMAC_MD5_96_NULL,
-            SECURITY_ALGORITHM_SRTP_AES_COUNTER, SECURITY_ALGORITHM_SRTP_AES_F8,
-            SECURITY_ALGORITHM_SRTP_HMAC_SHA1, SECURITY_ALGORITHM_ENCR_AES_GCM_16,
-            SECURITY_ALGORITHM_ENCR_AES_CBC, SECURITY_ALGORITHM_AUTH_HMAC_SHA2_256_128,
-            SECURITY_ALGORITHM_UNKNOWN, SECURITY_ALGORITHM_OTHER, SECURITY_ALGORITHM_ORYX})
+            SECURITY_ALGORITHM_HMAC_SHA1_96, SECURITY_ALGORITHM_HMAC_MD5_96,
+            SECURITY_ALGORITHM_SRTP_NULL, SECURITY_ALGORITHM_SRTP_AES_COUNTER,
+            SECURITY_ALGORITHM_SRTP_AES_F8, SECURITY_ALGORITHM_SRTP_HMAC_SHA1,
+            SECURITY_ALGORITHM_ENCR_AES_GCM_16, SECURITY_ALGORITHM_ENCR_AES_CBC,
+            SECURITY_ALGORITHM_AUTH_HMAC_SHA2_256_128, SECURITY_ALGORITHM_UNKNOWN,
+            SECURITY_ALGORITHM_OTHER, SECURITY_ALGORITHM_ORYX})
     public @interface SecurityAlgorithm {
     }
 
diff --git a/telephony/java/android/telephony/euicc/EuiccCardManager.java b/telephony/java/android/telephony/euicc/EuiccCardManager.java
index e981e1f..69594f2 100644
--- a/telephony/java/android/telephony/euicc/EuiccCardManager.java
+++ b/telephony/java/android/telephony/euicc/EuiccCardManager.java
@@ -183,6 +183,9 @@
      * @param cardId   The Id of the eUICC.
      * @param executor The executor through which the callback should be invoked.
      * @param callback The callback to get the result code and all the profiles.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     public void requestAllProfiles(String cardId, @CallbackExecutor Executor executor,
             ResultCallback<EuiccProfileInfo[]> callback) {
@@ -212,6 +215,9 @@
      * @param iccid    The iccid of the profile.
      * @param executor The executor through which the callback should be invoked.
      * @param callback The callback to get the result code and profile.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     public void requestProfile(String cardId, String iccid, @CallbackExecutor Executor executor,
             ResultCallback<EuiccProfileInfo> callback) {
@@ -244,6 +250,9 @@
      *                  ICCID is known, an APDU will be sent through to read the enabled profile.
      * @param executor  The executor through which the callback should be invoked.
      * @param callback  The callback to get the result code and the profile.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     public void requestEnabledProfileForPort(@NonNull String cardId, int portIndex,
             @NonNull @CallbackExecutor Executor executor,
@@ -276,6 +285,9 @@
      * @param refresh  Whether sending the REFRESH command to modem.
      * @param executor The executor through which the callback should be invoked.
      * @param callback The callback to get the result code.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     public void disableProfile(String cardId, String iccid, boolean refresh,
             @CallbackExecutor Executor executor, ResultCallback<Void> callback) {
@@ -307,6 +319,9 @@
      * @param refresh  Whether sending the REFRESH command to modem.
      * @param executor The executor through which the callback should be invoked.
      * @param callback The callback to get the result code and the EuiccProfileInfo enabled.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      * @deprecated instead use {@link #switchToProfile(String, String, int, boolean, Executor,
      * ResultCallback)}
      */
@@ -344,6 +359,9 @@
      * @param refresh   Whether sending the REFRESH command to modem.
      * @param executor  The executor through which the callback should be invoked.
      * @param callback  The callback to get the result code and the EuiccProfileInfo enabled.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     public void switchToProfile(@Nullable String cardId, @Nullable String iccid, int portIndex,
             boolean refresh, @NonNull @CallbackExecutor Executor executor,
@@ -375,6 +393,9 @@
      * @param nickname The nickname of the profile.
      * @param executor The executor through which the callback should be invoked.
      * @param callback The callback to get the result code.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     public void setNickname(String cardId, String iccid, String nickname,
             @CallbackExecutor Executor executor, ResultCallback<Void> callback) {
@@ -404,6 +425,9 @@
      * @param iccid The iccid of the profile.
      * @param executor The executor through which the callback should be invoked.
      * @param callback The callback to get the result code.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     public void deleteProfile(String cardId, String iccid, @CallbackExecutor Executor executor,
             ResultCallback<Void> callback) {
@@ -434,6 +458,9 @@
      *     EuiccCard for details.
      * @param executor The executor through which the callback should be invoked.
      * @param callback The callback to get the result code.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     public void resetMemory(String cardId, @ResetOption int options,
             @CallbackExecutor Executor executor, ResultCallback<Void> callback) {
@@ -462,6 +489,9 @@
      * @param cardId The Id of the eUICC.
      * @param executor The executor through which the callback should be invoked.
      * @param callback The callback to get the result code and the default SM-DP+ address.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     public void requestDefaultSmdpAddress(String cardId, @CallbackExecutor Executor executor,
             ResultCallback<String> callback) {
@@ -490,6 +520,9 @@
      * @param cardId The Id of the eUICC.
      * @param executor The executor through which the callback should be invoked.
      * @param callback The callback to get the result code and the SM-DS address.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     public void requestSmdsAddress(String cardId, @CallbackExecutor Executor executor,
             ResultCallback<String> callback) {
@@ -519,6 +552,9 @@
      * @param defaultSmdpAddress The default SM-DP+ address to set.
      * @param executor The executor through which the callback should be invoked.
      * @param callback The callback to get the result code.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     public void setDefaultSmdpAddress(String cardId, String defaultSmdpAddress,
             @CallbackExecutor Executor executor, ResultCallback<Void> callback) {
@@ -548,6 +584,9 @@
      * @param cardId The Id of the eUICC.
      * @param executor The executor through which the callback should be invoked.
      * @param callback the callback to get the result code and the rule authorisation table.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     public void requestRulesAuthTable(String cardId, @CallbackExecutor Executor executor,
             ResultCallback<EuiccRulesAuthTable> callback) {
@@ -576,6 +615,9 @@
      * @param cardId The Id of the eUICC.
      * @param executor The executor through which the callback should be invoked.
      * @param callback the callback to get the result code and the challenge.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     public void requestEuiccChallenge(String cardId, @CallbackExecutor Executor executor,
             ResultCallback<byte[]> callback) {
@@ -604,6 +646,9 @@
      * @param cardId The Id of the eUICC.
      * @param executor The executor through which the callback should be invoked.
      * @param callback the callback to get the result code and the info1.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     public void requestEuiccInfo1(String cardId, @CallbackExecutor Executor executor,
             ResultCallback<byte[]> callback) {
@@ -632,6 +677,9 @@
      * @param cardId The Id of the eUICC.
      * @param executor The executor through which the callback should be invoked.
      * @param callback the callback to get the result code and the info2.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     public void requestEuiccInfo2(String cardId, @CallbackExecutor Executor executor,
             ResultCallback<byte[]> callback) {
@@ -671,6 +719,9 @@
      * @param executor The executor through which the callback should be invoked.
      * @param callback the callback to get the result code and a byte array which represents a
      *     {@code AuthenticateServerResponse} defined in GSMA RSP v2.0+.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     public void authenticateServer(String cardId, String matchingId, byte[] serverSigned1,
             byte[] serverSignature1, byte[] euiccCiPkIdToBeUsed, byte[] serverCertificate,
@@ -716,6 +767,9 @@
      * @param executor The executor through which the callback should be invoked.
      * @param callback the callback to get the result code and a byte array which represents a
      *     {@code PrepareDownloadResponse} defined in GSMA RSP v2.0+
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     public void prepareDownload(String cardId, @Nullable byte[] hashCc, byte[] smdpSigned2,
             byte[] smdpSignature2, byte[] smdpCertificate, @CallbackExecutor Executor executor,
@@ -753,6 +807,9 @@
      * @param executor The executor through which the callback should be invoked.
      * @param callback the callback to get the result code and a byte array which represents a
      *     {@code LoadBoundProfilePackageResponse} defined in GSMA RSP v2.0+.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     public void loadBoundProfilePackage(String cardId, byte[] boundProfilePackage,
             @CallbackExecutor Executor executor, ResultCallback<byte[]> callback) {
@@ -787,6 +844,9 @@
      * @param executor The executor through which the callback should be invoked.
      * @param callback the callback to get the result code and an byte[] which represents a
      *     {@code CancelSessionResponse} defined in GSMA RSP v2.0+.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     public void cancelSession(String cardId, byte[] transactionId, @CancelReason int reason,
             @CallbackExecutor Executor executor, ResultCallback<byte[]> callback) {
@@ -820,6 +880,9 @@
      * @param events bits of the event types ({@link EuiccNotification.Event}) to list.
      * @param executor The executor through which the callback should be invoked.
      * @param callback the callback to get the result code and the list of notifications.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     public void listNotifications(String cardId, @EuiccNotification.Event int events,
             @CallbackExecutor Executor executor, ResultCallback<EuiccNotification[]> callback) {
@@ -850,6 +913,9 @@
      * @param events bits of the event types ({@link EuiccNotification.Event}) to list.
      * @param executor The executor through which the callback should be invoked.
      * @param callback the callback to get the result code and the list of notifications.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     public void retrieveNotificationList(String cardId, @EuiccNotification.Event int events,
             @CallbackExecutor Executor executor, ResultCallback<EuiccNotification[]> callback) {
@@ -880,6 +946,9 @@
      * @param seqNumber the sequence number of the notification.
      * @param executor The executor through which the callback should be invoked.
      * @param callback the callback to get the result code and the notification.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     public void retrieveNotification(String cardId, int seqNumber,
             @CallbackExecutor Executor executor, ResultCallback<EuiccNotification> callback) {
@@ -910,6 +979,9 @@
      * @param seqNumber the sequence number of the notification.
      * @param executor The executor through which the callback should be invoked.
      * @param callback the callback to get the result code.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     public void removeNotificationFromList(String cardId, int seqNumber,
             @CallbackExecutor Executor executor, ResultCallback<Void> callback) {
diff --git a/telephony/java/android/telephony/euicc/EuiccManager.java b/telephony/java/android/telephony/euicc/EuiccManager.java
index 86fbb04..09d2108 100644
--- a/telephony/java/android/telephony/euicc/EuiccManager.java
+++ b/telephony/java/android/telephony/euicc/EuiccManager.java
@@ -927,6 +927,9 @@
      * subscription APIs.
      *
      * @return true if embedded subscriptions are currently enabled.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     public boolean isEnabled() {
         // In the future, this may reach out to IEuiccController (if non-null) to check any dynamic
@@ -942,6 +945,9 @@
      * access to the EID of another eUICC.
      *
      * @return the EID. May be null if the eUICC is not ready.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     @Nullable
     public String getEid() {
@@ -963,6 +969,8 @@
      * @return the status of eUICC OTA. If the eUICC is not ready,
      *         {@link OtaStatus#EUICC_OTA_STATUS_UNAVAILABLE} will be returned.
      *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      * @hide
      */
     @SystemApi
@@ -1014,6 +1022,9 @@
      * @param subscription the subscription to download.
      * @param switchAfterDownload if true, the profile will be activated upon successful download.
      * @param callbackIntent a PendingIntent to launch when the operation completes.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     @RequiresPermission(Manifest.permission.WRITE_EMBEDDED_SUBSCRIPTIONS)
     public void downloadSubscription(DownloadableSubscription subscription,
@@ -1075,6 +1086,9 @@
      * @param resolutionExtras Resolution-specific extras depending on the result of the resolution.
      *     For example, this may indicate whether the user has consented or may include the input
      *     they provided.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      * @hide
      */
     @SystemApi
@@ -1111,6 +1125,9 @@
      *
      * @param subscription the subscription which needs metadata filled in
      * @param callbackIntent a PendingIntent to launch when the operation completes.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      * @hide
      */
     @SystemApi
@@ -1142,6 +1159,9 @@
      * internal system use only.
      *
      * @param callbackIntent a PendingIntent to launch when the operation completes.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      * @hide
      */
     @SystemApi
@@ -1163,6 +1183,9 @@
      * Returns information about the eUICC chip/device.
      *
      * @return the {@link EuiccInfo}. May be null if the eUICC is not ready.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     @Nullable
     public EuiccInfo getEuiccInfo() {
@@ -1188,6 +1211,9 @@
      *
      * @param subscriptionId the ID of the subscription to delete.
      * @param callbackIntent a PendingIntent to launch when the operation completes.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     @RequiresPermission(Manifest.permission.WRITE_EMBEDDED_SUBSCRIPTIONS)
     public void deleteSubscription(int subscriptionId, PendingIntent callbackIntent) {
@@ -1251,6 +1277,9 @@
      *     {@code android.Manifest.permission#WRITE_EMBEDDED_SUBSCRIPTIONS} permission, or the
      *     calling app must be authorized to manage the active subscription on the target eUICC.
      * @param callbackIntent a PendingIntent to launch when the operation completes.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     @RequiresPermission(Manifest.permission.WRITE_EMBEDDED_SUBSCRIPTIONS)
     public void switchToSubscription(int subscriptionId, PendingIntent callbackIntent) {
@@ -1312,6 +1341,9 @@
      *     {@link SubscriptionInfo#getPortIndex()}.
      * @param portIndex the index of the port to target for the enabled subscription
      * @param callbackIntent a PendingIntent to launch when the operation completes.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     @RequiresPermission(Manifest.permission.WRITE_EMBEDDED_SUBSCRIPTIONS)
     public void switchToSubscription(int subscriptionId, int portIndex,
@@ -1349,6 +1381,9 @@
      * @param subscriptionId the ID of the subscription to update.
      * @param nickname the new nickname to apply.
      * @param callbackIntent a PendingIntent to launch when the operation completes.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     @RequiresPermission(Manifest.permission.WRITE_EMBEDDED_SUBSCRIPTIONS)
     public void updateSubscriptionNickname(
@@ -1376,6 +1411,8 @@
      * @deprecated From R, callers should specify a flag for specific set of subscriptions to erase
      * and use {@link #eraseSubscriptions(int, PendingIntent)} instead
      *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      * @hide
      */
     @SystemApi
@@ -1402,6 +1439,8 @@
      * @param options flag indicating specific set of subscriptions to erase
      * @param callbackIntent a PendingIntent to launch when the operation completes.
      *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      * @hide
      */
     @SystemApi
@@ -1459,6 +1498,9 @@
      * determine whether a country is supported please check {@link #isSupportedCountry}.
      *
      * @param supportedCountries is a list of strings contains country ISO codes in uppercase.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      * @hide
      */
     @SystemApi
@@ -1487,6 +1529,9 @@
      * determine whether a country is supported please check {@link #isSupportedCountry}.
      *
      * @param unsupportedCountries is a list of strings contains country ISO codes in uppercase.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      * @hide
      */
     @SystemApi
@@ -1512,6 +1557,9 @@
      * {@code android.Manifest.permission#WRITE_EMBEDDED_SUBSCRIPTIONS} permission.
      *
      * @return list of strings contains country ISO codes in uppercase.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      * @hide
      */
     @SystemApi
@@ -1535,6 +1583,9 @@
      * {@code android.Manifest.permission#WRITE_EMBEDDED_SUBSCRIPTIONS} permission.
      *
      * @return list of strings contains country ISO codes in uppercase.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      * @hide
      */
     @SystemApi
@@ -1566,6 +1617,9 @@
      * @param countryIso should be the ISO-3166 country code is provided in uppercase 2 character
      * format.
      * @return whether the given country supports eUICC or not.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      * @hide
      */
     @SystemApi
@@ -1630,6 +1684,9 @@
      *
      * @param portIndex is an enumeration of the ports available on the UICC.
      * @return {@code true} if port is available
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_EUICC}.
      */
     public boolean isSimPortAvailable(int portIndex) {
         try {
diff --git a/telephony/java/android/telephony/ims/ImsMmTelManager.java b/telephony/java/android/telephony/ims/ImsMmTelManager.java
index 71bb329..551057f 100644
--- a/telephony/java/android/telephony/ims/ImsMmTelManager.java
+++ b/telephony/java/android/telephony/ims/ImsMmTelManager.java
@@ -779,6 +779,8 @@
      * @see android.telephony.CarrierConfigManager#KEY_CARRIER_VOLTE_AVAILABLE_BOOL
      * @throws IllegalArgumentException if the subscription associated with this operation is not
      * active (SIM is not inserted, ESIM inactive) or invalid.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @return true if the user's setting for advanced calling is enabled, false otherwise.
      */
     @SuppressAutoDoc // No support for device / profile owner or carrier privileges (b/72967236).
@@ -827,6 +829,8 @@
      * @see #isAdvancedCallingSettingEnabled()
      * @throws IllegalArgumentException if the subscription associated with this operation is not
      * active (SIM is not inserted, ESIM inactive) or invalid.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @hide
      */
     @RequiresPermission(Manifest.permission.MODIFY_PHONE_STATE)
@@ -865,6 +869,8 @@
      * @param capability The IMS MmTel capability to query.
      * @return {@code true} if the MmTel IMS capability is capable for this subscription, false
      *         otherwise.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @hide
      */
     @RequiresPermission(Manifest.permission.READ_PRIVILEGED_PHONE_STATE)
@@ -893,6 +899,8 @@
      * @param capability The IMS MmTel capability to query.
      * @return {@code true} if the MmTel IMS capability is available for this subscription, false
      *         otherwise.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @hide
      */
     @SystemApi
@@ -986,6 +994,8 @@
      *
      * @throws IllegalArgumentException if the subscription associated with this operation is not
      * active (SIM is not inserted, ESIM inactive) or invalid.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @return true if the user’s “Video Calling” setting is currently enabled.
      */
     @RequiresPermission(anyOf = {
@@ -1017,6 +1027,8 @@
      *
      * @throws IllegalArgumentException if the subscription associated with this operation is not
      * active (SIM is not inserted, ESIM inactive) or invalid.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @see #isVtSettingEnabled()
      * @hide
      */
@@ -1060,6 +1072,8 @@
      *
      * @throws IllegalArgumentException if the subscription associated with this operation is not
      * active (SIM is not inserted, ESIM inactive) or invalid.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      */
     @SuppressAutoDoc // No support for device / profile owner or carrier privileges (b/72967236).
     @RequiresPermission(anyOf = {
@@ -1090,6 +1104,8 @@
      *
      * @throws IllegalArgumentException if the subscription associated with this operation is not
      * active (SIM is not inserted, ESIM inactive) or invalid.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @param isEnabled true if the user's setting for Voice over WiFi is enabled, false otherwise=
      * @see #isVoWiFiSettingEnabled()
      * @hide
@@ -1148,6 +1164,8 @@
      *
      * @throws ImsException if the IMS service associated with this subscription is not available or
      * the IMS service is not available.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @return true if the user's setting for Voice over Cross SIM is enabled and false if it is not
      */
     @SuppressAutoDoc // No support for device / profile owner or carrier privileges (b/72967236).
@@ -1192,6 +1210,8 @@
      * </ul>
      * @throws ImsException if the IMS service associated with this subscription is not available or
      * the IMS service is not available.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @param isEnabled true if the user's setting for Voice over Cross SIM is enabled,
      *                 false otherwise
      * @see #isCrossSimCallingEnabled()
@@ -1233,6 +1253,8 @@
      *
      * @throws IllegalArgumentException if the subscription associated with this operation is not
      * active (SIM is not inserted, ESIM inactive) or invalid.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @return true if the user's setting for Voice over WiFi while roaming is enabled, false
      * if disabled.
      */
@@ -1267,6 +1289,8 @@
      *     false otherwise.
      * @throws IllegalArgumentException if the subscription associated with this operation is not
      * active (SIM is not inserted, ESIM inactive) or invalid.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @see #isVoWiFiRoamingSettingEnabled()
      * @hide
      */
@@ -1304,6 +1328,8 @@
      * - {@link #WIFI_MODE_WIFI_PREFERRED}
      * @throws IllegalArgumentException if the subscription associated with this operation is not
      * active (SIM is not inserted, ESIM inactive) or invalid.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @see #setVoWiFiSettingEnabled(boolean)
      * @hide
      */
@@ -1347,6 +1373,8 @@
      *
      * @throws IllegalArgumentException if the subscription associated with this operation is not
      * active (SIM is not inserted, ESIM inactive) or invalid.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @return The Voice over WiFi Mode preference set by the user, which can be one of the
      * following:
      * - {@link #WIFI_MODE_WIFI_ONLY}
@@ -1386,6 +1414,8 @@
      * - {@link #WIFI_MODE_WIFI_PREFERRED}
      * @throws IllegalArgumentException if the subscription associated with this operation is not
      * active (SIM is not inserted, ESIM inactive) or invalid.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @see #getVoWiFiModeSetting()
      * @hide
      */
@@ -1422,6 +1452,8 @@
      *     - {@link #WIFI_MODE_WIFI_PREFERRED}
      * @throws IllegalArgumentException if the subscription associated with this operation is not
      * active (SIM is not inserted, ESIM inactive) or invalid.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @see #setVoWiFiRoamingSettingEnabled(boolean)
      * @hide
      */
@@ -1458,6 +1490,8 @@
      *     - {@link #WIFI_MODE_WIFI_PREFERRED}
      * @throws IllegalArgumentException if the subscription associated with this operation is not
      * active (SIM is not inserted, ESIM inactive) or invalid.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @see #getVoWiFiRoamingModeSetting()
      * @hide
      */
@@ -1492,6 +1526,8 @@
      * settings.
      * @throws IllegalArgumentException if the subscription associated with this operation is not
      * active (SIM is not inserted, ESIM inactive) or invalid.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @param isEnabled if true RTT should be enabled during calls made on this subscription.
      * @hide
      */
@@ -1535,6 +1571,8 @@
      *
      * @throws IllegalArgumentException if the subscription associated with this operation is not
      * active (SIM is not inserted, ESIM inactive) or invalid.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @see android.telephony.CarrierConfigManager#KEY_CARRIER_VOLTE_TTY_SUPPORTED_BOOL
      */
     @SuppressAutoDoc // No support for device / profile owner or carrier privileges (b/72967236).
diff --git a/telephony/java/android/telephony/ims/ImsRcsManager.java b/telephony/java/android/telephony/ims/ImsRcsManager.java
index 2b49bcd..62d4263 100644
--- a/telephony/java/android/telephony/ims/ImsRcsManager.java
+++ b/telephony/java/android/telephony/ims/ImsRcsManager.java
@@ -250,6 +250,8 @@
      * the {@code ImsService} associated with the subscription is not available. This can happen if
      * the service crashed, for example. See {@link ImsException#getCode()} for a more detailed
      * reason.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      */
     @RequiresPermission(Manifest.permission.READ_PRECISE_PHONE_STATE)
     public void registerImsRegistrationCallback(
@@ -294,6 +296,8 @@
      * @param c The {@link RegistrationManager.RegistrationCallback} to be removed.
      * @see android.telephony.SubscriptionManager.OnSubscriptionsChangedListener
      * @see #registerImsRegistrationCallback(Executor, RegistrationCallback)
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      */
     @RequiresPermission(Manifest.permission.READ_PRECISE_PHONE_STATE)
     public void unregisterImsRegistrationCallback(
@@ -329,6 +333,8 @@
      * following: {@link RegistrationManager#REGISTRATION_STATE_NOT_REGISTERED},
      * {@link RegistrationManager#REGISTRATION_STATE_REGISTERING}, or
      * {@link RegistrationManager#REGISTRATION_STATE_REGISTERED}.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      */
     @RequiresPermission(Manifest.permission.READ_PRECISE_PHONE_STATE)
     public void getRegistrationState(@NonNull @CallbackExecutor Executor executor,
@@ -378,6 +384,8 @@
      * {@see AccessNetworkConstants#TRANSPORT_TYPE_WWAN},
      * {@see AccessNetworkConstants#TRANSPORT_TYPE_WLAN}, or
      * {@see AccessNetworkConstants#TRANSPORT_TYPE_INVALID}.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      */
     @RequiresPermission(Manifest.permission.READ_PRECISE_PHONE_STATE)
     public void getRegistrationTransportType(@NonNull @CallbackExecutor Executor executor,
@@ -435,6 +443,8 @@
      * {@link ImsRcsManager} is valid, but the ImsService associated with the subscription is not
      * available. This can happen if the ImsService has crashed, for example, or if the subscription
      * becomes inactive. See {@link ImsException#getCode()} for more information on the error codes.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @hide
      */
     @SystemApi
@@ -479,6 +489,8 @@
      * @see #addOnAvailabilityChangedListener(Executor, OnAvailabilityChangedListener)
      * @throws ImsException if the IMS service is not available when calling this method.
      * See {@link ImsException#getCode()} for more information on the error codes.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @hide
      */
     @SystemApi
@@ -525,6 +537,8 @@
      * @see android.telephony.CarrierConfigManager.Ims#KEY_ENABLE_PRESENCE_CAPABILITY_EXCHANGE_BOOL
      * @throws ImsException if the IMS service is not available when calling this method.
      * See {@link ImsException#getCode()} for more information on the error codes.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @hide
      */
     @SystemApi
@@ -563,6 +577,8 @@
      * @see #isCapable(int, int)
      * @throws ImsException if the IMS service is not available when calling this method.
      * See {@link ImsException#getCode()} for more information on the error codes.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @hide
      */
     @SystemApi
diff --git a/telephony/java/android/telephony/ims/ProvisioningManager.java b/telephony/java/android/telephony/ims/ProvisioningManager.java
index 1c5d1e9..62b8420 100644
--- a/telephony/java/android/telephony/ims/ProvisioningManager.java
+++ b/telephony/java/android/telephony/ims/ProvisioningManager.java
@@ -1300,8 +1300,10 @@
      * @param executor The executor that the callback methods will be called on.
      * @param callback The callback instance being registered.
      * @throws ImsException if the subscription associated with this callback is
-     * valid, but the {@link ImsService the service crashed, for example. See
+     * valid, but the service crashed, for example. See
      * {@link ImsException#getCode()} for a more detailed reason.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      */
     @RequiresPermission(Manifest.permission.READ_PRECISE_PHONE_STATE)
     public void registerFeatureProvisioningChangedCallback(
@@ -1327,6 +1329,8 @@
      *
      * @param callback The existing {@link FeatureProvisioningCallback} to be removed.
      * @see #registerFeatureProvisioningChangedCallback(Executor, FeatureProvisioningCallback)
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      */
     public void unregisterFeatureProvisioningChangedCallback(
             @NonNull FeatureProvisioningCallback callback) {
@@ -1347,6 +1351,8 @@
      * @return an integer value for the provided key, or
      * {@link ImsConfigImplBase#CONFIG_RESULT_UNKNOWN} if the key doesn't exist.
      * @throws IllegalArgumentException if the key provided was invalid.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @hide
      */
     @SystemApi
@@ -1369,6 +1375,8 @@
      * @return a String value for the provided key, {@code null} if the key doesn't exist, or
      * {@link StringResultError} if there was an error getting the value for the provided key.
      * @throws IllegalArgumentException if the key provided was invalid.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @hide
      */
     @SystemApi
@@ -1392,6 +1400,8 @@
      * @param key An integer that represents the provisioning key, which is defined by the OEM.
      * @param value a integer value for the provided key.
      * @return the result of setting the configuration value.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @hide
      *
      * Note: For compatibility purposes, the integer values [0 - 99] used in
@@ -1420,6 +1430,8 @@
      *     should be appropriately namespaced to avoid collision.
      * @param value a String value for the provided key.
      * @return the result of setting the configuration value.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @hide
      */
     @SystemApi
@@ -1451,6 +1463,9 @@
      *
      * @see CarrierConfigManager.Ims#KEY_MMTEL_REQUIRES_PROVISIONING_BUNDLE
      * @param isProvisioned true if the device is provisioned for UT over IMS, false otherwise.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      */
     @WorkerThread
     @RequiresPermission(Manifest.permission.MODIFY_PHONE_STATE)
@@ -1485,6 +1500,9 @@
      * @return true if the device is provisioned for the capability or does not require
      * provisioning, false if the capability does require provisioning and has not been
      * provisioned yet.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      */
     @WorkerThread
     @RequiresPermission(Manifest.permission.READ_PRECISE_PHONE_STATE)
@@ -1509,6 +1527,9 @@
      * @return true if the device is provisioned for the capability or does not require
      * provisioning, false if the capability does require provisioning and has not been
      * provisioned yet.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
+     *
      * @deprecated Use {@link #getRcsProvisioningStatusForCapability(int, int)} instead,
      * as this only retrieves provisioning information for
      * {@link ImsRegistrationImplBase#REGISTRATION_TECH_LTE}
@@ -1546,6 +1567,9 @@
      * @return true if the device is provisioned for the capability or does not require
      * provisioning, false if the capability does require provisioning and has not been
      * provisioned yet.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      */
     @WorkerThread
     @RequiresPermission(Manifest.permission.READ_PRECISE_PHONE_STATE)
@@ -1577,6 +1601,9 @@
      * @see CarrierConfigManager#KEY_CARRIER_RCS_PROVISIONING_REQUIRED_BOOL
      * @param isProvisioned true if the device is provisioned for the RCS capability specified,
      *                      false otherwise.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
+     *
      * @deprecated Use {@link #setRcsProvisioningStatusForCapability(int, int, boolean)} instead,
      * as this method only sets provisioning information for
      * {@link ImsRegistrationImplBase#REGISTRATION_TECH_LTE}
@@ -1615,6 +1642,9 @@
      * @see CarrierConfigManager.Ims#KEY_RCS_REQUIRES_PROVISIONING_BUNDLE
      * @param isProvisioned true if the device is provisioned for the RCS capability specified,
      *                      false otherwise.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      */
     @WorkerThread
     @RequiresPermission(Manifest.permission.MODIFY_PHONE_STATE)
@@ -1644,6 +1674,9 @@
      * @return true if provisioning is required for the MMTEL capability and IMS
      * registration technology specified, false if it is not required or if the device does not
      * support IMS.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      */
     @RequiresPermission(Manifest.permission.READ_PRECISE_PHONE_STATE)
     public boolean isProvisioningRequiredForCapability(
@@ -1672,6 +1705,9 @@
      * @return true if provisioning is required for the RCS capability and IMS
      * registration technology specified, false if it is not required or if the device does not
      * support IMS.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      */
     @RequiresPermission(Manifest.permission.READ_PRECISE_PHONE_STATE)
     public boolean isRcsProvisioningRequiredForCapability(
@@ -1700,10 +1736,14 @@
      * @param config The XML file to be read. ASCII/UTF8 encoded text if not compressed.
      * @param isCompressed The XML file is compressed in gzip format and must be decompressed
      *         before being read.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS_SINGLE_REGISTRATION}.
      * @hide
      */
     @SystemApi
     @RequiresPermission(Manifest.permission.MODIFY_PHONE_STATE)
+    @RequiresFeature(PackageManager.FEATURE_TELEPHONY_IMS_SINGLE_REGISTRATION)
     public void notifyRcsAutoConfigurationReceived(@NonNull byte[] config, boolean isCompressed) {
         if (config == null) {
             throw new IllegalArgumentException("Must include a non-null config XML file.");
@@ -1714,7 +1754,6 @@
         } catch (RemoteException e) {
             throw e.rethrowAsRuntimeException();
         }
-
     }
 
     /**
@@ -1787,10 +1826,14 @@
      * When the IMS/RCS service receives the RCS client configuration, it will detect
      * the change in the configuration, and trigger the auto-configuration as needed.
      * @param rcc RCS client configuration {@link RcsClientConfiguration}
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS_SINGLE_REGISTRATION}.
      * @hide
      */
     @SystemApi
     @RequiresPermission(Manifest.permission.PERFORM_IMS_SINGLE_REGISTRATION)
+    @RequiresFeature(PackageManager.FEATURE_TELEPHONY_IMS_SINGLE_REGISTRATION)
     public void setRcsClientConfiguration(
             @NonNull RcsClientConfiguration rcc) throws ImsException {
         try {
@@ -1826,6 +1869,7 @@
     @RequiresPermission(anyOf = {
             Manifest.permission.READ_PRIVILEGED_PHONE_STATE,
             Manifest.permission.PERFORM_IMS_SINGLE_REGISTRATION})
+    @RequiresFeature(PackageManager.FEATURE_TELEPHONY_IMS_SINGLE_REGISTRATION)
     public boolean isRcsVolteSingleRegistrationCapable() throws ImsException {
         try {
             return getITelephony().isRcsVolteSingleRegistrationCapable(mSubId);
@@ -1870,12 +1914,15 @@
     * params (See {@link #setRcsClientConfiguration}) and re register the
     * callback.
     * See {@link ImsException#getCode()} for a more detailed reason.
+    * @throws UnsupportedOperationException If the device does not have
+    *          {@link PackageManager#FEATURE_TELEPHONY_IMS_SINGLE_REGISTRATION}.
     * @hide
     */
     @SystemApi
     @RequiresPermission(anyOf = {
             Manifest.permission.READ_PRIVILEGED_PHONE_STATE,
             Manifest.permission.PERFORM_IMS_SINGLE_REGISTRATION})
+    @RequiresFeature(PackageManager.FEATURE_TELEPHONY_IMS_SINGLE_REGISTRATION)
     public void registerRcsProvisioningCallback(
             @NonNull @CallbackExecutor Executor executor,
             @NonNull RcsProvisioningCallback callback) throws ImsException {
@@ -1908,12 +1955,15 @@
      * @see #registerRcsProvisioningCallback(Executor, RcsProvisioningCallback)
      * @throws IllegalArgumentException if the subscription associated with
      * this callback is invalid.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS_SINGLE_REGISTRATION}.
      * @hide
      */
     @SystemApi
     @RequiresPermission(anyOf = {
             Manifest.permission.READ_PRIVILEGED_PHONE_STATE,
             Manifest.permission.PERFORM_IMS_SINGLE_REGISTRATION})
+    @RequiresFeature(PackageManager.FEATURE_TELEPHONY_IMS_SINGLE_REGISTRATION)
     public void unregisterRcsProvisioningCallback(
             @NonNull RcsProvisioningCallback callback) {
         try {
@@ -1935,10 +1985,14 @@
      * {@link RcsProvisioningCallback#onConfigurationReset}, then
      * {@link RcsProvisioningCallback#onConfigurationChanged} when the new
      * RCS configuration is received and notified by {@link #notifyRcsAutoConfigurationReceived}
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS_SINGLE_REGISTRATION}.
      * @hide
      */
     @SystemApi
     @RequiresPermission(Manifest.permission.PERFORM_IMS_SINGLE_REGISTRATION)
+    @RequiresFeature(PackageManager.FEATURE_TELEPHONY_IMS_SINGLE_REGISTRATION)
     public void triggerRcsReconfiguration() {
         try {
             getITelephony().triggerRcsReconfiguration(mSubId);
diff --git a/telephony/java/android/telephony/ims/RcsUceAdapter.java b/telephony/java/android/telephony/ims/RcsUceAdapter.java
index 3bb9be0..8925a9e 100644
--- a/telephony/java/android/telephony/ims/RcsUceAdapter.java
+++ b/telephony/java/android/telephony/ims/RcsUceAdapter.java
@@ -21,9 +21,11 @@
 import android.annotation.IntDef;
 import android.annotation.NonNull;
 import android.annotation.Nullable;
+import android.annotation.RequiresFeature;
 import android.annotation.RequiresPermission;
 import android.annotation.SystemApi;
 import android.content.Context;
+import android.content.pm.PackageManager;
 import android.net.Uri;
 import android.os.Binder;
 import android.os.IBinder;
@@ -49,6 +51,7 @@
  *
  * @see ImsRcsManager#getUceAdapter() for information on creating an instance of this class.
  */
+@RequiresFeature(PackageManager.FEATURE_TELEPHONY_IMS)
 public class RcsUceAdapter {
     private static final String TAG = "RcsUceAdapter";
 
@@ -585,6 +588,8 @@
      * {@link RcsUceAdapter} is valid, but the ImsService associated with the subscription is not
      * available. This can happen if the ImsService has crashed, for example, or if the subscription
      * becomes inactive. See {@link ImsException#getCode()} for more information on the error codes.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @hide
      */
     @SystemApi
@@ -682,6 +687,8 @@
      * {@link RcsUceAdapter} is valid, but the ImsService associated with the subscription is not
      * available. This can happen if the ImsService has crashed, for example, or if the subscription
      * becomes inactive. See {@link ImsException#getCode()} for more information on the error codes.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @hide
      */
     @SystemApi
@@ -759,6 +766,8 @@
      * {@link RcsUceAdapter} is valid, but the ImsService associated with the subscription is not
      * available. This can happen if the ImsService has crashed, for example, or if the subscription
      * becomes inactive. See {@link ImsException#getCode()} for more information on the error codes.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @hide
      */
     @SystemApi
@@ -800,6 +809,8 @@
      * the {@link ImsService} associated with the subscription is not available. This can happen if
      * the service crashed, for example. See {@link ImsException#getCode()} for a more detailed
      * reason.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @hide
      */
     @SystemApi
@@ -845,6 +856,8 @@
      * the {@link ImsService} associated with the subscription is not available. This can happen if
      * the service crashed, for example. See {@link ImsException#getCode()} for a more detailed
      * reason.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @hide
      */
     @SystemApi
@@ -901,6 +914,8 @@
      * {@link RcsUceAdapter} is valid, but the ImsService associated with the subscription is not
      * available. This can happen if the ImsService has crashed, for example, or if the subscription
      * becomes inactive. See {@link ImsException#getCode()} for more information on the error codes.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      */
     @RequiresPermission(Manifest.permission.READ_PHONE_STATE)
     public boolean isUceSettingEnabled() throws ImsException {
@@ -954,6 +969,8 @@
      * {@link RcsUceAdapter} is valid, but the ImsService associated with the subscription is not
      * available. This can happen if the ImsService has crashed, for example, or if the subscription
      * becomes inactive. See {@link ImsException#getCode()} for more information on the error codes.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS}.
      * @hide
      */
     @SystemApi
diff --git a/telephony/java/android/telephony/ims/SipDelegateManager.java b/telephony/java/android/telephony/ims/SipDelegateManager.java
index 25ebdd0..abf2105 100644
--- a/telephony/java/android/telephony/ims/SipDelegateManager.java
+++ b/telephony/java/android/telephony/ims/SipDelegateManager.java
@@ -525,6 +525,8 @@
      * @param callback The callback instance being registered.
      * @throws ImsException in the case that the callback can not be registered.
      * See {@link ImsException#getCode} for more information on when this is called.
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS_SINGLE_REGISTRATION}.
      */
     @RequiresPermission(Manifest.permission.READ_PRIVILEGED_PHONE_STATE)
     public void registerSipDialogStateCallback(@NonNull Executor executor,
@@ -557,6 +559,9 @@
      * {@link android.Manifest.permission#READ_PRIVILEGED_PHONE_STATE}
      *
      * @param callback The callback instance to be unregistered.
+     *
+     * @throws UnsupportedOperationException If the device does not have
+     *          {@link PackageManager#FEATURE_TELEPHONY_IMS_SINGLE_REGISTRATION}.
      */
     @RequiresPermission(Manifest.permission.READ_PRIVILEGED_PHONE_STATE)
     public void unregisterSipDialogStateCallback(@NonNull SipDialogStateCallback callback)
diff --git a/telephony/java/com/android/internal/telephony/ITelephony.aidl b/telephony/java/com/android/internal/telephony/ITelephony.aidl
index 84777c9..9b5ee0c 100644
--- a/telephony/java/com/android/internal/telephony/ITelephony.aidl
+++ b/telephony/java/com/android/internal/telephony/ITelephony.aidl
@@ -3055,6 +3055,29 @@
     boolean setEmergencyCallToSatelliteHandoverType(int handoverType, int delaySeconds);
 
     /**
+     * This API should be used by only CTS tests to forcefully set the country codes.
+     *
+     * @param reset {@code true} mean the overridden country codes should not be used, {@code false}
+     *              otherwise.
+     * @return {@code true} if the country code is set successfully, {@code false} otherwise.
+     */
+    boolean setCountryCodes(in boolean reset, in List<String> currentNetworkCountryCodes,
+            in Map cachedNetworkCountryCodes, in String locationCountryCode,
+            in long locationCountryCodeTimestampNanos);
+
+    /**
+     * This API should be used by only CTS tests to override the overlay configs of satellite
+     * access controller.
+     *
+     * @param reset {@code true} mean the overridden configs should not be used, {@code false}
+     *              otherwise.
+     * @return {@code true} if the overlay configs are set successfully, {@code false} otherwise.
+     */
+    boolean setSatelliteAccessControlOverlayConfigs(in boolean reset, in boolean isAllowed,
+            in String s2CellFile, in long locationFreshDurationNanos,
+            in List<String> satelliteCountryCodes);
+
+    /**
      * Test method to confirm the file contents are not altered.
      */
      @JavaPassthrough(annotation="@android.annotation.RequiresPermission("
diff --git a/tests/UpdatableSystemFontTest/src/com/android/updatablesystemfont/UpdatableSystemFontTest.java b/tests/UpdatableSystemFontTest/src/com/android/updatablesystemfont/UpdatableSystemFontTest.java
index ba9e4a8..f82d9ca 100644
--- a/tests/UpdatableSystemFontTest/src/com/android/updatablesystemfont/UpdatableSystemFontTest.java
+++ b/tests/UpdatableSystemFontTest/src/com/android/updatablesystemfont/UpdatableSystemFontTest.java
@@ -130,14 +130,13 @@
     private static final Pattern PATTERN_SYSTEM_FONT_FILES =
             Pattern.compile("^/(system|product)/fonts/");
 
-    private String mKeyId;
     private FontManager mFontManager;
     private UiDevice mUiDevice;
 
     @Before
     public void setUp() throws Exception {
         Context context = InstrumentationRegistry.getInstrumentation().getTargetContext();
-        mKeyId = insertCert(CERT_PATH);
+        insertCert(CERT_PATH);
         mFontManager = context.getSystemService(FontManager.class);
         expectCommandToSucceed("cmd font clear");
         mUiDevice = UiDevice.getInstance(InstrumentationRegistry.getInstrumentation());
@@ -147,9 +146,6 @@
     public void tearDown() throws Exception {
         // Ignore errors because this may fail if updatable system font is not enabled.
         runShellCommand("cmd font clear", null);
-        if (mKeyId != null) {
-            expectCommandToSucceed("mini-keyctl unlink " + mKeyId + " .fs-verity");
-        }
     }
 
     @Test
@@ -369,20 +365,11 @@
         assertThat(isFileOpenedBy(fontPath, EMOJI_RENDERING_TEST_APP_ID)).isFalse();
     }
 
-    private static String insertCert(String certPath) throws Exception {
-        Pair<String, String> result;
-        try (InputStream is = new FileInputStream(certPath)) {
-            result = runShellCommand("mini-keyctl padd asymmetric fsv_test .fs-verity", is);
-        }
+    private static void insertCert(String certPath) throws Exception {
         // /data/local/tmp is not readable by system server. Copy a cert file to /data/fonts
         final String copiedCert = "/data/fonts/debug_cert.der";
         runShellCommand("cp " + certPath + " " + copiedCert, null);
         runShellCommand("cmd font install-debug-cert " + copiedCert, null);
-        // Assert that there are no errors.
-        assertThat(result.second).isEmpty();
-        String keyId = result.first.trim();
-        assertThat(keyId).matches("^\\d+$");
-        return keyId;
     }
 
     private int updateFontFile(String fontPath, String signaturePath) throws IOException {