Merge "Add data bin and lib properties to sh_test"
diff --git a/android/Android.bp b/android/Android.bp
index 50faa44..a1b5159 100644
--- a/android/Android.bp
+++ b/android/Android.bp
@@ -15,6 +15,7 @@
"apex.go",
"api_levels.go",
"arch.go",
+ "bazel_overlay.go",
"config.go",
"csuite_config.go",
"defaults.go",
@@ -40,6 +41,7 @@
"paths.go",
"phony.go",
"prebuilt.go",
+ "prebuilt_build_tool.go",
"proto.go",
"register.go",
"rule_builder.go",
diff --git a/android/androidmk.go b/android/androidmk.go
index 7e86140..fafbfd6 100644
--- a/android/androidmk.go
+++ b/android/androidmk.go
@@ -183,12 +183,15 @@
name := amod.BaseModuleName()
var ret []string
+ var availableTaggedDists TaggedDistFiles
- availableTaggedDists := TaggedDistFiles{}
if a.DistFiles != nil {
availableTaggedDists = a.DistFiles
} else if a.OutputFile.Valid() {
availableTaggedDists = MakeDefaultDistFiles(a.OutputFile.Path())
+ } else {
+ // Nothing dist-able for this module.
+ return nil
}
// Iterate over this module's dist structs, merged from the dist and dists properties.
diff --git a/android/apex.go b/android/apex.go
index a7570dc..8c06b63 100644
--- a/android/apex.go
+++ b/android/apex.go
@@ -137,6 +137,7 @@
//
// "//apex_available:anyapex" is a pseudo APEX name that matches to any APEX.
// "//apex_available:platform" refers to non-APEX partitions like "system.img".
+ // "com.android.gki.*" matches any APEX module name with the prefix "com.android.gki.".
// Default is ["//apex_available:platform"].
Apex_available []string
@@ -213,6 +214,7 @@
const (
AvailableToPlatform = "//apex_available:platform"
AvailableToAnyApex = "//apex_available:anyapex"
+ AvailableToGkiApex = "com.android.gki.*"
)
func CheckAvailableForApex(what string, apex_available []string) bool {
@@ -222,7 +224,8 @@
return what == AvailableToPlatform
}
return InList(what, apex_available) ||
- (what != AvailableToPlatform && InList(AvailableToAnyApex, apex_available))
+ (what != AvailableToPlatform && InList(AvailableToAnyApex, apex_available)) ||
+ (strings.HasPrefix(what, "com.android.gki.") && InList(AvailableToGkiApex, apex_available))
}
func (m *ApexModuleBase) AvailableFor(what string) bool {
@@ -256,7 +259,7 @@
func (m *ApexModuleBase) checkApexAvailableProperty(mctx BaseModuleContext) {
for _, n := range m.ApexProperties.Apex_available {
- if n == AvailableToPlatform || n == AvailableToAnyApex {
+ if n == AvailableToPlatform || n == AvailableToAnyApex || n == AvailableToGkiApex {
continue
}
if !mctx.OtherModuleExists(n) && !mctx.Config().AllowMissingDependencies() {
@@ -293,7 +296,10 @@
for i, mod := range modules {
platformVariation := i == 0
if platformVariation && !mctx.Host() && !mod.(ApexModule).AvailableFor(AvailableToPlatform) {
- mod.SkipInstall()
+ // Do not install the module for platform, but still allow it to output
+ // uninstallable AndroidMk entries in certain cases when they have
+ // side effects.
+ mod.MakeUninstallable()
}
if !platformVariation {
mod.(ApexModule).apexModuleBase().ApexProperties.Info = m.apexVariations[i-1]
diff --git a/android/bazel_overlay.go b/android/bazel_overlay.go
new file mode 100644
index 0000000..a034282
--- /dev/null
+++ b/android/bazel_overlay.go
@@ -0,0 +1,76 @@
+// Copyright 2020 Google Inc. All rights reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+package android
+
+import (
+ "fmt"
+ "os"
+ "strings"
+
+ "github.com/google/blueprint"
+)
+
+// The Bazel Overlay singleton is responsible for generating the Ninja actions
+// for calling the soong_build primary builder in the main build.ninja file.
+func init() {
+ RegisterSingletonType("bazel_overlay", BazelOverlaySingleton)
+}
+
+func BazelOverlaySingleton() Singleton {
+ return &bazelOverlaySingleton{}
+}
+
+type bazelOverlaySingleton struct{}
+
+func (c *bazelOverlaySingleton) GenerateBuildActions(ctx SingletonContext) {
+ // Create a build and rule statement, using the Bazel overlay's WORKSPACE
+ // file as the output file marker.
+ var deps Paths
+ moduleListFilePath := pathForBuildToolDep(ctx, ctx.Config().moduleListFile)
+ deps = append(deps, moduleListFilePath)
+ deps = append(deps, pathForBuildToolDep(ctx, ctx.Config().ProductVariablesFileName))
+
+ bazelOverlayDirectory := PathForOutput(ctx, "bazel_overlay")
+ bazelOverlayWorkspaceFile := bazelOverlayDirectory.Join(ctx, "WORKSPACE")
+ primaryBuilder := primaryBuilderPath(ctx)
+ bazelOverlay := ctx.Rule(pctx, "bazelOverlay",
+ blueprint.RuleParams{
+ Command: fmt.Sprintf(
+ "rm -rf ${outDir}/* && %s --bazel_overlay_dir ${outDir} %s && echo WORKSPACE: `cat %s` > ${outDir}/.overlay-depfile.d",
+ primaryBuilder.String(),
+ strings.Join(os.Args[1:], " "),
+ moduleListFilePath.String(), // Use the contents of Android.bp.list as the depfile.
+ ),
+ CommandDeps: []string{primaryBuilder.String()},
+ Description: fmt.Sprintf(
+ "Creating the Bazel overlay workspace with %s at $outDir",
+ primaryBuilder.Base()),
+ Deps: blueprint.DepsGCC,
+ Depfile: "${outDir}/.overlay-depfile.d",
+ },
+ "outDir")
+
+ ctx.Build(pctx, BuildParams{
+ Rule: bazelOverlay,
+ Output: bazelOverlayWorkspaceFile,
+ Inputs: deps,
+ Args: map[string]string{
+ "outDir": bazelOverlayDirectory.String(),
+ },
+ })
+
+ // Add a phony target for building the bazel overlay
+ ctx.Phony("bazel_overlay", bazelOverlayWorkspaceFile)
+}
diff --git a/android/config.go b/android/config.go
index 3387706..a1e97c9 100644
--- a/android/config.go
+++ b/android/config.go
@@ -722,7 +722,7 @@
return Bool(c.productVariables.Allow_missing_dependencies)
}
-// Returns true if building without full platform sources.
+// Returns true if a full platform source tree cannot be assumed.
func (c *config) UnbundledBuild() bool {
return Bool(c.productVariables.Unbundled_build)
}
@@ -733,18 +733,15 @@
return Bool(c.productVariables.Unbundled_build_apps)
}
-func (c *config) UnbundledBuildUsePrebuiltSdks() bool {
- return Bool(c.productVariables.Unbundled_build) && !Bool(c.productVariables.Unbundled_build_sdks_from_source)
+// Returns true if building modules against prebuilt SDKs.
+func (c *config) AlwaysUsePrebuiltSdks() bool {
+ return Bool(c.productVariables.Always_use_prebuilt_sdks)
}
func (c *config) Fuchsia() bool {
return Bool(c.productVariables.Fuchsia)
}
-func (c *config) IsPdkBuild() bool {
- return Bool(c.productVariables.Pdk)
-}
-
func (c *config) MinimizeJavaDebugInfo() bool {
return Bool(c.productVariables.MinimizeJavaDebugInfo) && !Bool(c.productVariables.Eng)
}
@@ -913,34 +910,6 @@
return c.productVariables.ModulesLoadedByPrivilegedModules
}
-// Expected format for apexJarValue = <apex name>:<jar name>
-func SplitApexJarPair(ctx PathContext, str string) (string, string) {
- pair := strings.SplitN(str, ":", 2)
- if len(pair) == 2 {
- return pair[0], pair[1]
- } else {
- reportPathErrorf(ctx, "malformed (apex, jar) pair: '%s', expected format: <apex>:<jar>", str)
- return "error-apex", "error-jar"
- }
-}
-
-func GetJarsFromApexJarPairs(ctx PathContext, apexJarPairs []string) []string {
- modules := make([]string, len(apexJarPairs))
- for i, p := range apexJarPairs {
- _, jar := SplitApexJarPair(ctx, p)
- modules[i] = jar
- }
- return modules
-}
-
-func (c *config) BootJars() []string {
- ctx := NullPathContext{Config{
- config: c,
- }}
- return append(GetJarsFromApexJarPairs(ctx, c.productVariables.BootJars),
- GetJarsFromApexJarPairs(ctx, c.productVariables.UpdatableBootJars)...)
-}
-
func (c *config) DexpreoptGlobalConfig(ctx PathContext) ([]byte, error) {
if c.productVariables.DexpreoptGlobalConfig == nil {
return nil, nil
@@ -1275,3 +1244,185 @@
func (c *deviceConfig) BoardKernelBinaries() []string {
return c.config.productVariables.BoardKernelBinaries
}
+
+func (c *deviceConfig) BoardKernelModuleInterfaceVersions() []string {
+ return c.config.productVariables.BoardKernelModuleInterfaceVersions
+}
+
+// The ConfiguredJarList struct provides methods for handling a list of (apex, jar) pairs.
+// Such lists are used in the build system for things like bootclasspath jars or system server jars.
+// The apex part is either an apex name, or a special names "platform" or "system_ext". Jar is a
+// module name. The pairs come from Make product variables as a list of colon-separated strings.
+//
+// Examples:
+// - "com.android.art:core-oj"
+// - "platform:framework"
+// - "system_ext:foo"
+//
+type ConfiguredJarList struct {
+ apexes []string // A list of apex components.
+ jars []string // A list of jar components.
+}
+
+// The length of the list.
+func (l *ConfiguredJarList) Len() int {
+ return len(l.jars)
+}
+
+// Apex component of idx-th pair on the list.
+func (l *ConfiguredJarList) apex(idx int) string {
+ return l.apexes[idx]
+}
+
+// Jar component of idx-th pair on the list.
+func (l *ConfiguredJarList) Jar(idx int) string {
+ return l.jars[idx]
+}
+
+// If the list contains a pair with the given jar.
+func (l *ConfiguredJarList) ContainsJar(jar string) bool {
+ return InList(jar, l.jars)
+}
+
+// If the list contains the given (apex, jar) pair.
+func (l *ConfiguredJarList) containsApexJarPair(apex, jar string) bool {
+ for i := 0; i < l.Len(); i++ {
+ if apex == l.apex(i) && jar == l.Jar(i) {
+ return true
+ }
+ }
+ return false
+}
+
+// Index of the first pair with the given jar on the list, or -1 if none.
+func (l *ConfiguredJarList) IndexOfJar(jar string) int {
+ return IndexList(jar, l.jars)
+}
+
+// Append an (apex, jar) pair to the list.
+func (l *ConfiguredJarList) Append(apex string, jar string) {
+ l.apexes = append(l.apexes, apex)
+ l.jars = append(l.jars, jar)
+}
+
+// Filter out sublist.
+func (l *ConfiguredJarList) RemoveList(list ConfiguredJarList) {
+ apexes := make([]string, 0, l.Len())
+ jars := make([]string, 0, l.Len())
+
+ for i, jar := range l.jars {
+ apex := l.apex(i)
+ if !list.containsApexJarPair(apex, jar) {
+ apexes = append(apexes, apex)
+ jars = append(jars, jar)
+ }
+ }
+
+ l.apexes = apexes
+ l.jars = jars
+}
+
+// A copy of itself.
+func (l *ConfiguredJarList) CopyOf() ConfiguredJarList {
+ return ConfiguredJarList{CopyOf(l.apexes), CopyOf(l.jars)}
+}
+
+// A copy of the list of strings containing jar components.
+func (l *ConfiguredJarList) CopyOfJars() []string {
+ return CopyOf(l.jars)
+}
+
+// A copy of the list of strings with colon-separated (apex, jar) pairs.
+func (l *ConfiguredJarList) CopyOfApexJarPairs() []string {
+ pairs := make([]string, 0, l.Len())
+
+ for i, jar := range l.jars {
+ apex := l.apex(i)
+ pairs = append(pairs, apex+":"+jar)
+ }
+
+ return pairs
+}
+
+// A list of build paths based on the given directory prefix.
+func (l *ConfiguredJarList) BuildPaths(ctx PathContext, dir OutputPath) WritablePaths {
+ paths := make(WritablePaths, l.Len())
+ for i, jar := range l.jars {
+ paths[i] = dir.Join(ctx, ModuleStem(jar)+".jar")
+ }
+ return paths
+}
+
+func ModuleStem(module string) string {
+ // b/139391334: the stem of framework-minus-apex is framework. This is hard coded here until we
+ // find a good way to query the stem of a module before any other mutators are run.
+ if module == "framework-minus-apex" {
+ return "framework"
+ }
+ return module
+}
+
+// A list of on-device paths.
+func (l *ConfiguredJarList) DevicePaths(cfg Config, ostype OsType) []string {
+ paths := make([]string, l.Len())
+ for i, jar := range l.jars {
+ apex := l.apexes[i]
+ name := ModuleStem(jar) + ".jar"
+
+ var subdir string
+ if apex == "platform" {
+ subdir = "system/framework"
+ } else if apex == "system_ext" {
+ subdir = "system_ext/framework"
+ } else {
+ subdir = filepath.Join("apex", apex, "javalib")
+ }
+
+ if ostype.Class == Host {
+ paths[i] = filepath.Join(cfg.Getenv("OUT_DIR"), "host", cfg.PrebuiltOS(), subdir, name)
+ } else {
+ paths[i] = filepath.Join("/", subdir, name)
+ }
+ }
+ return paths
+}
+
+// Expected format for apexJarValue = <apex name>:<jar name>
+func splitConfiguredJarPair(ctx PathContext, str string) (string, string) {
+ pair := strings.SplitN(str, ":", 2)
+ if len(pair) == 2 {
+ return pair[0], pair[1]
+ } else {
+ reportPathErrorf(ctx, "malformed (apex, jar) pair: '%s', expected format: <apex>:<jar>", str)
+ return "error-apex", "error-jar"
+ }
+}
+
+func CreateConfiguredJarList(ctx PathContext, list []string) ConfiguredJarList {
+ apexes := make([]string, 0, len(list))
+ jars := make([]string, 0, len(list))
+
+ l := ConfiguredJarList{apexes, jars}
+
+ for _, apexjar := range list {
+ apex, jar := splitConfiguredJarPair(ctx, apexjar)
+ l.Append(apex, jar)
+ }
+
+ return l
+}
+
+func EmptyConfiguredJarList() ConfiguredJarList {
+ return ConfiguredJarList{}
+}
+
+var earlyBootJarsKey = NewOnceKey("earlyBootJars")
+
+func (c *config) BootJars() []string {
+ return c.Once(earlyBootJarsKey, func() interface{} {
+ ctx := NullPathContext{Config{c}}
+ list := CreateConfiguredJarList(ctx,
+ append(CopyOf(c.productVariables.BootJars), c.productVariables.UpdatableBootJars...))
+ return list.CopyOfJars()
+ }).([]string)
+}
diff --git a/android/defs.go b/android/defs.go
index 4552224..83daa03 100644
--- a/android/defs.go
+++ b/android/defs.go
@@ -69,7 +69,7 @@
// A symlink rule.
Symlink = pctx.AndroidStaticRule("Symlink",
blueprint.RuleParams{
- Command: "ln -f -s $fromPath $out",
+ Command: "rm -f $out && ln -f -s $fromPath $out",
Description: "symlink $out",
},
"fromPath")
diff --git a/android/filegroup.go b/android/filegroup.go
index ec522fc..68311e3 100644
--- a/android/filegroup.go
+++ b/android/filegroup.go
@@ -15,9 +15,7 @@
package android
import (
- "io"
"strings"
- "text/template"
)
func init() {
@@ -71,23 +69,8 @@
return append(Paths{}, fg.srcs...)
}
-var androidMkTemplate = template.Must(template.New("filegroup").Parse(`
-ifdef {{.makeVar}}
- $(error variable {{.makeVar}} set by soong module is already set in make)
-endif
-{{.makeVar}} := {{.value}}
-.KATI_READONLY := {{.makeVar}}
-`))
-
-func (fg *fileGroup) AndroidMk() AndroidMkData {
- return AndroidMkData{
- Custom: func(w io.Writer, name, prefix, moduleDir string, data AndroidMkData) {
- if makeVar := String(fg.properties.Export_to_make_var); makeVar != "" {
- androidMkTemplate.Execute(w, map[string]string{
- "makeVar": makeVar,
- "value": strings.Join(fg.srcs.Strings(), " "),
- })
- }
- },
+func (fg *fileGroup) MakeVars(ctx MakeVarsModuleContext) {
+ if makeVar := String(fg.properties.Export_to_make_var); makeVar != "" {
+ ctx.StrictRaw(makeVar, strings.Join(fg.srcs.Strings(), " "))
}
}
diff --git a/android/makevars.go b/android/makevars.go
index ff7c8e4..86f4b42 100644
--- a/android/makevars.go
+++ b/android/makevars.go
@@ -17,6 +17,7 @@
import (
"bytes"
"fmt"
+ "sort"
"strconv"
"strings"
@@ -34,43 +35,16 @@
}
///////////////////////////////////////////////////////////////////////////////
-// Interface for other packages to use to declare make variables
-type MakeVarsContext interface {
+
+// BaseMakeVarsContext contains the common functions for other packages to use
+// to declare make variables
+type BaseMakeVarsContext interface {
Config() Config
DeviceConfig() DeviceConfig
AddNinjaFileDeps(deps ...string)
- ModuleName(module blueprint.Module) string
- ModuleDir(module blueprint.Module) string
- ModuleSubDir(module blueprint.Module) string
- ModuleType(module blueprint.Module) string
- BlueprintFile(module blueprint.Module) string
-
- ModuleErrorf(module blueprint.Module, format string, args ...interface{})
- Errorf(format string, args ...interface{})
Failed() bool
- VisitAllModules(visit func(Module))
- VisitAllModulesIf(pred func(Module) bool, visit func(Module))
-
- // Verify the make variable matches the Soong version, fail the build
- // if it does not. If the make variable is empty, just set it.
- Strict(name, ninjaStr string)
- // Check to see if the make variable matches the Soong version, warn if
- // it does not. If the make variable is empty, just set it.
- Check(name, ninjaStr string)
-
- // These are equivalent to the above, but sort the make and soong
- // variables before comparing them. They also show the unique entries
- // in each list when displaying the difference, instead of the entire
- // string.
- StrictSorted(name, ninjaStr string)
- CheckSorted(name, ninjaStr string)
-
- // Evaluates a ninja string and returns the result. Used if more
- // complicated modification needs to happen before giving it to Make.
- Eval(ninjaStr string) (string, error)
-
// These are equivalent to Strict and Check, but do not attempt to
// evaluate the values before writing them to the Makefile. They can
// be used when all ninja variables have already been evaluated through
@@ -108,6 +82,48 @@
DistForGoalsWithFilename(goals []string, path Path, filename string)
}
+// MakeVarsContext contains the set of functions available for MakeVarsProvider
+// and SingletonMakeVarsProvider implementations.
+type MakeVarsContext interface {
+ BaseMakeVarsContext
+
+ ModuleName(module blueprint.Module) string
+ ModuleDir(module blueprint.Module) string
+ ModuleSubDir(module blueprint.Module) string
+ ModuleType(module blueprint.Module) string
+ BlueprintFile(module blueprint.Module) string
+
+ ModuleErrorf(module blueprint.Module, format string, args ...interface{})
+ Errorf(format string, args ...interface{})
+
+ VisitAllModules(visit func(Module))
+ VisitAllModulesIf(pred func(Module) bool, visit func(Module))
+
+ // Verify the make variable matches the Soong version, fail the build
+ // if it does not. If the make variable is empty, just set it.
+ Strict(name, ninjaStr string)
+ // Check to see if the make variable matches the Soong version, warn if
+ // it does not. If the make variable is empty, just set it.
+ Check(name, ninjaStr string)
+
+ // These are equivalent to the above, but sort the make and soong
+ // variables before comparing them. They also show the unique entries
+ // in each list when displaying the difference, instead of the entire
+ // string.
+ StrictSorted(name, ninjaStr string)
+ CheckSorted(name, ninjaStr string)
+
+ // Evaluates a ninja string and returns the result. Used if more
+ // complicated modification needs to happen before giving it to Make.
+ Eval(ninjaStr string) (string, error)
+}
+
+// MakeVarsModuleContext contains the set of functions available for modules
+// implementing the ModuleMakeVarsProvider interface.
+type MakeVarsModuleContext interface {
+ BaseMakeVarsContext
+}
+
var _ PathContext = MakeVarsContext(nil)
type MakeVarsProvider func(ctx MakeVarsContext)
@@ -135,6 +151,14 @@
return func(ctx MakeVarsContext) { singleton.MakeVars(ctx) }
}
+// ModuleMakeVarsProvider is a Module with an extra method to provide extra values to be exported to Make.
+type ModuleMakeVarsProvider interface {
+ Module
+
+ // MakeVars uses a MakeVarsModuleContext to provide extra values to be exported to Make.
+ MakeVars(ctx MakeVarsModuleContext)
+}
+
///////////////////////////////////////////////////////////////////////////////
func makeVarsSingletonFunc() Singleton {
@@ -209,10 +233,45 @@
dists = append(dists, mctx.dists...)
}
+ ctx.VisitAllModules(func(m Module) {
+ if provider, ok := m.(ModuleMakeVarsProvider); ok {
+ mctx := &makeVarsContext{
+ SingletonContext: ctx,
+ }
+
+ provider.MakeVars(mctx)
+
+ vars = append(vars, mctx.vars...)
+ phonies = append(phonies, mctx.phonies...)
+ dists = append(dists, mctx.dists...)
+ }
+ })
+
if ctx.Failed() {
return
}
+ sort.Slice(vars, func(i, j int) bool {
+ return vars[i].name < vars[j].name
+ })
+ sort.Slice(phonies, func(i, j int) bool {
+ return phonies[i].name < phonies[j].name
+ })
+ lessArr := func(a, b []string) bool {
+ if len(a) == len(b) {
+ for i := range a {
+ if a[i] < b[i] {
+ return true
+ }
+ }
+ return false
+ }
+ return len(a) < len(b)
+ }
+ sort.Slice(dists, func(i, j int) bool {
+ return lessArr(dists[i].goals, dists[j].goals) || lessArr(dists[i].paths, dists[j].paths)
+ })
+
outBytes := s.writeVars(vars)
if err := pathtools.WriteFileIfChanged(outFile, outBytes, 0666); err != nil {
diff --git a/android/module.go b/android/module.go
index a12cd9b..6956167 100644
--- a/android/module.go
+++ b/android/module.go
@@ -256,6 +256,7 @@
InstallForceOS() *OsType
SkipInstall()
IsSkipInstall() bool
+ MakeUninstallable()
ExportedToMake() bool
InitRc() Paths
VintfFragments() Paths
@@ -568,6 +569,12 @@
type TaggedDistFiles map[string]Paths
func MakeDefaultDistFiles(paths ...Path) TaggedDistFiles {
+ for _, path := range paths {
+ if path == nil {
+ panic("The path to a dist file cannot be nil.")
+ }
+ }
+
// The default OutputFile tag is the empty "" string.
return TaggedDistFiles{"": paths}
}
@@ -1046,6 +1053,15 @@
return m.commonProperties.SkipInstall == true
}
+// Similar to SkipInstall, but if the AndroidMk entry would set
+// LOCAL_UNINSTALLABLE_MODULE then this variant may still output that entry
+// rather than leaving it out altogether. That happens in cases where it would
+// have other side effects, in particular when it adds a NOTICE file target,
+// which other install targets might depend on.
+func (m *ModuleBase) MakeUninstallable() {
+ m.SkipInstall()
+}
+
func (m *ModuleBase) ExportedToMake() bool {
return m.commonProperties.NamespaceExportedToMake
}
@@ -1839,7 +1855,7 @@
// A regexp for removing boilerplate from BaseDependencyTag from the string representation of
// a dependency tag.
-var tagCleaner = regexp.MustCompile(`\QBaseDependencyTag:blueprint.BaseDependencyTag{}\E(, )?`)
+var tagCleaner = regexp.MustCompile(`\QBaseDependencyTag:{}\E(, )?`)
// PrettyPrintTag returns string representation of the tag, but prefers
// custom String() method if available.
@@ -1850,7 +1866,7 @@
}
// Otherwise, get a default string representation of the tag's struct.
- tagString := fmt.Sprintf("%#v", tag)
+ tagString := fmt.Sprintf("%T: %+v", tag, tag)
// Remove the boilerplate from BaseDependencyTag as it adds no value.
tagString = tagCleaner.ReplaceAllString(tagString, "")
diff --git a/android/neverallow.go b/android/neverallow.go
index 73829f1..aaea920 100644
--- a/android/neverallow.go
+++ b/android/neverallow.go
@@ -194,7 +194,7 @@
// This sometimes works because the APEX modules that contain derive_sdk and
// derive_sdk_prefer32 suppress the platform installation rules, but fails when
// the APEX modules contain the SDK variant and the platform variant still exists.
- "frameworks/base/apex/sdkextensions/derive_sdk",
+ "packages/modules/SdkExtensions/derive_sdk",
// These are for apps and shouldn't be used by non-SDK variant modules.
"prebuilts/ndk",
"tools/test/graphicsbenchmark/apps/sample_app",
diff --git a/android/prebuilt_build_tool.go b/android/prebuilt_build_tool.go
new file mode 100644
index 0000000..1dcf199
--- /dev/null
+++ b/android/prebuilt_build_tool.go
@@ -0,0 +1,94 @@
+// Copyright 2020 Google Inc. All rights reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+package android
+
+func init() {
+ RegisterModuleType("prebuilt_build_tool", prebuiltBuildToolFactory)
+}
+
+type prebuiltBuildToolProperties struct {
+ // Source file to be executed for this build tool
+ Src *string `android:"path,arch_variant"`
+
+ // Extra files that should trigger rules using this tool to rebuild
+ Deps []string `android:"path,arch_variant"`
+
+ // Create a make variable with the specified name that contains the path to
+ // this prebuilt built tool, relative to the root of the source tree.
+ Export_to_make_var *string
+}
+
+type prebuiltBuildTool struct {
+ ModuleBase
+ prebuilt Prebuilt
+
+ properties prebuiltBuildToolProperties
+
+ toolPath OptionalPath
+}
+
+func (t *prebuiltBuildTool) Name() string {
+ return t.prebuilt.Name(t.ModuleBase.Name())
+}
+
+func (t *prebuiltBuildTool) Prebuilt() *Prebuilt {
+ return &t.prebuilt
+}
+
+func (t *prebuiltBuildTool) DepsMutator(ctx BottomUpMutatorContext) {
+ if t.properties.Src == nil {
+ ctx.PropertyErrorf("src", "missing prebuilt source file")
+ }
+}
+
+func (t *prebuiltBuildTool) GenerateAndroidBuildActions(ctx ModuleContext) {
+ sourcePath := t.prebuilt.SingleSourcePath(ctx)
+ installedPath := PathForModuleOut(ctx, t.ModuleBase.Name())
+ deps := PathsForModuleSrc(ctx, t.properties.Deps)
+
+ ctx.Build(pctx, BuildParams{
+ Rule: Symlink,
+ Output: installedPath,
+ Input: sourcePath,
+ Implicits: deps,
+ Args: map[string]string{
+ "fromPath": "$$PWD/" + sourcePath.String(),
+ },
+ })
+
+ t.toolPath = OptionalPathForPath(installedPath)
+}
+
+func (t *prebuiltBuildTool) MakeVars(ctx MakeVarsModuleContext) {
+ if makeVar := String(t.properties.Export_to_make_var); makeVar != "" {
+ ctx.StrictRaw(makeVar, t.toolPath.String())
+ }
+}
+
+func (t *prebuiltBuildTool) HostToolPath() OptionalPath {
+ return t.toolPath
+}
+
+var _ HostToolProvider = &prebuiltBuildTool{}
+
+// prebuilt_build_tool is to declare prebuilts to be used during the build, particularly for use
+// in genrules with the "tools" property.
+func prebuiltBuildToolFactory() Module {
+ module := &prebuiltBuildTool{}
+ module.AddProperties(&module.properties)
+ InitSingleSourcePrebuiltModule(module, &module.properties, "Src")
+ InitAndroidArchModule(module, HostSupportedNoCross, MultilibFirst)
+ return module
+}
diff --git a/android/sdk.go b/android/sdk.go
index 28f5cd5..9ea7ff4 100644
--- a/android/sdk.go
+++ b/android/sdk.go
@@ -327,6 +327,12 @@
// SdkAware and be added with an SdkMemberTypeDependencyTag tag.
HasTransitiveSdkMembers() bool
+ // Return true if prebuilt host artifacts may be specific to the host OS. Only
+ // applicable to modules where HostSupported() is true. If this is true,
+ // snapshots will list each host OS variant explicitly and disable all other
+ // host OS'es.
+ IsHostOsDependent() bool
+
// Add dependencies from the SDK module to all the module variants the member
// type contributes to the SDK. `names` is the list of module names given in
// the member type property (as returned by SdkPropertyName()) in the SDK
@@ -389,6 +395,7 @@
PropertyName string
SupportsSdk bool
TransitiveSdkMembers bool
+ HostOsDependent bool
}
func (b *SdkMemberTypeBase) SdkPropertyName() string {
@@ -403,6 +410,10 @@
return b.TransitiveSdkMembers
}
+func (b *SdkMemberTypeBase) IsHostOsDependent() bool {
+ return b.HostOsDependent
+}
+
// Encapsulates the information about registered SdkMemberTypes.
type SdkMemberTypesRegistry struct {
// The list of types sorted by property name.
diff --git a/android/variable.go b/android/variable.go
index c1e1b42..1f21f34 100644
--- a/android/variable.go
+++ b/android/variable.go
@@ -214,30 +214,29 @@
AppsDefaultVersionName *string `json:",omitempty"`
- Allow_missing_dependencies *bool `json:",omitempty"`
- Unbundled_build *bool `json:",omitempty"`
- Unbundled_build_apps *bool `json:",omitempty"`
- Unbundled_build_sdks_from_source *bool `json:",omitempty"`
- Malloc_not_svelte *bool `json:",omitempty"`
- Malloc_zero_contents *bool `json:",omitempty"`
- Malloc_pattern_fill_contents *bool `json:",omitempty"`
- Safestack *bool `json:",omitempty"`
- HostStaticBinaries *bool `json:",omitempty"`
- Binder32bit *bool `json:",omitempty"`
- UseGoma *bool `json:",omitempty"`
- UseRBE *bool `json:",omitempty"`
- UseRBEJAVAC *bool `json:",omitempty"`
- UseRBER8 *bool `json:",omitempty"`
- UseRBED8 *bool `json:",omitempty"`
- Debuggable *bool `json:",omitempty"`
- Eng *bool `json:",omitempty"`
- Treble_linker_namespaces *bool `json:",omitempty"`
- Enforce_vintf_manifest *bool `json:",omitempty"`
- Pdk *bool `json:",omitempty"`
- Uml *bool `json:",omitempty"`
- Use_lmkd_stats_log *bool `json:",omitempty"`
- Arc *bool `json:",omitempty"`
- MinimizeJavaDebugInfo *bool `json:",omitempty"`
+ Allow_missing_dependencies *bool `json:",omitempty"`
+ Unbundled_build *bool `json:",omitempty"`
+ Unbundled_build_apps *bool `json:",omitempty"`
+ Always_use_prebuilt_sdks *bool `json:",omitempty"`
+ Malloc_not_svelte *bool `json:",omitempty"`
+ Malloc_zero_contents *bool `json:",omitempty"`
+ Malloc_pattern_fill_contents *bool `json:",omitempty"`
+ Safestack *bool `json:",omitempty"`
+ HostStaticBinaries *bool `json:",omitempty"`
+ Binder32bit *bool `json:",omitempty"`
+ UseGoma *bool `json:",omitempty"`
+ UseRBE *bool `json:",omitempty"`
+ UseRBEJAVAC *bool `json:",omitempty"`
+ UseRBER8 *bool `json:",omitempty"`
+ UseRBED8 *bool `json:",omitempty"`
+ Debuggable *bool `json:",omitempty"`
+ Eng *bool `json:",omitempty"`
+ Treble_linker_namespaces *bool `json:",omitempty"`
+ Enforce_vintf_manifest *bool `json:",omitempty"`
+ Uml *bool `json:",omitempty"`
+ Use_lmkd_stats_log *bool `json:",omitempty"`
+ Arc *bool `json:",omitempty"`
+ MinimizeJavaDebugInfo *bool `json:",omitempty"`
Check_elf_files *bool `json:",omitempty"`
@@ -345,7 +344,8 @@
BoardUsesRecoveryAsBoot *bool `json:",omitempty"`
- BoardKernelBinaries []string `json:",omitempty"`
+ BoardKernelBinaries []string `json:",omitempty"`
+ BoardKernelModuleInterfaceVersions []string `json:",omitempty"`
}
func boolPtr(v bool) *bool {
diff --git a/apex/apex.go b/apex/apex.go
index 9905b79..8d9aa51 100644
--- a/apex/apex.go
+++ b/apex/apex.go
@@ -549,7 +549,6 @@
"android.hardware.tetheroffload.config-V1.0-java",
"android.hardware.tetheroffload.control-V1.0-java",
"android.hidl.base-V1.0-java",
- "ipmemorystore-aidl-interfaces-java",
"libcgrouprc",
"libcgrouprc_format",
"libtetherutilsjni",
diff --git a/apex/apex_test.go b/apex/apex_test.go
index bfd7dfe..d13ec5f 100644
--- a/apex/apex_test.go
+++ b/apex/apex_test.go
@@ -414,7 +414,14 @@
system_shared_libs: [],
static_executable: true,
stl: "none",
- apex_available: [ "myapex" ],
+ apex_available: [ "myapex", "com.android.gki.*" ],
+ }
+
+ apex {
+ name: "com.android.gki.fake",
+ binaries: ["foo"],
+ key: "myapex.key",
+ file_contexts: ":myapex-file_contexts",
}
cc_library_shared {
@@ -4443,11 +4450,11 @@
func TestApexAvailable_IndirectDep(t *testing.T) {
// libbbaz is an indirect dep
testApexError(t, `requires "libbaz" that is not available for the APEX. Dependency path:
-.*via tag apex\.dependencyTag.*"sharedLib".*
+.*via tag apex\.dependencyTag.*name:sharedLib.*
.*-> libfoo.*link:shared.*
-.*via tag cc\.DependencyTag.*"shared".*
+.*via tag cc\.libraryDependencyTag.*Kind:sharedLibraryDependency.*
.*-> libbar.*link:shared.*
-.*via tag cc\.DependencyTag.*"shared".*
+.*via tag cc\.libraryDependencyTag.*Kind:sharedLibraryDependency.*
.*-> libbaz.*link:shared.*`, `
apex {
name: "myapex",
@@ -5595,13 +5602,15 @@
}
func TestNoUpdatableJarsInBootImage(t *testing.T) {
-
var err string
var transform func(*dexpreopt.GlobalConfig)
+ config := android.TestArchConfig(buildDir, nil, "", nil)
+ ctx := android.PathContextForTesting(config)
+
t.Run("updatable jar from ART apex in the ART boot image => ok", func(t *testing.T) {
transform = func(config *dexpreopt.GlobalConfig) {
- config.ArtApexJars = []string{"com.android.art.something:some-art-lib"}
+ config.ArtApexJars = android.CreateConfiguredJarList(ctx, []string{"com.android.art.something:some-art-lib"})
}
testNoUpdatableJarsInBootImage(t, "", transform)
})
@@ -5609,7 +5618,7 @@
t.Run("updatable jar from ART apex in the framework boot image => error", func(t *testing.T) {
err = "module 'some-art-lib' from updatable apex 'com.android.art.something' is not allowed in the framework boot image"
transform = func(config *dexpreopt.GlobalConfig) {
- config.BootJars = []string{"com.android.art.something:some-art-lib"}
+ config.BootJars = android.CreateConfiguredJarList(ctx, []string{"com.android.art.something:some-art-lib"})
}
testNoUpdatableJarsInBootImage(t, err, transform)
})
@@ -5617,7 +5626,7 @@
t.Run("updatable jar from some other apex in the ART boot image => error", func(t *testing.T) {
err = "module 'some-updatable-apex-lib' from updatable apex 'some-updatable-apex' is not allowed in the ART boot image"
transform = func(config *dexpreopt.GlobalConfig) {
- config.ArtApexJars = []string{"some-updatable-apex:some-updatable-apex-lib"}
+ config.ArtApexJars = android.CreateConfiguredJarList(ctx, []string{"some-updatable-apex:some-updatable-apex-lib"})
}
testNoUpdatableJarsInBootImage(t, err, transform)
})
@@ -5625,7 +5634,7 @@
t.Run("non-updatable jar from some other apex in the ART boot image => error", func(t *testing.T) {
err = "module 'some-non-updatable-apex-lib' is not allowed in the ART boot image"
transform = func(config *dexpreopt.GlobalConfig) {
- config.ArtApexJars = []string{"some-non-updatable-apex:some-non-updatable-apex-lib"}
+ config.ArtApexJars = android.CreateConfiguredJarList(ctx, []string{"some-non-updatable-apex:some-non-updatable-apex-lib"})
}
testNoUpdatableJarsInBootImage(t, err, transform)
})
@@ -5633,14 +5642,14 @@
t.Run("updatable jar from some other apex in the framework boot image => error", func(t *testing.T) {
err = "module 'some-updatable-apex-lib' from updatable apex 'some-updatable-apex' is not allowed in the framework boot image"
transform = func(config *dexpreopt.GlobalConfig) {
- config.BootJars = []string{"some-updatable-apex:some-updatable-apex-lib"}
+ config.BootJars = android.CreateConfiguredJarList(ctx, []string{"some-updatable-apex:some-updatable-apex-lib"})
}
testNoUpdatableJarsInBootImage(t, err, transform)
})
t.Run("non-updatable jar from some other apex in the framework boot image => ok", func(t *testing.T) {
transform = func(config *dexpreopt.GlobalConfig) {
- config.BootJars = []string{"some-non-updatable-apex:some-non-updatable-apex-lib"}
+ config.BootJars = android.CreateConfiguredJarList(ctx, []string{"some-non-updatable-apex:some-non-updatable-apex-lib"})
}
testNoUpdatableJarsInBootImage(t, "", transform)
})
@@ -5648,7 +5657,7 @@
t.Run("nonexistent jar in the ART boot image => error", func(t *testing.T) {
err = "failed to find a dex jar path for module 'nonexistent'"
transform = func(config *dexpreopt.GlobalConfig) {
- config.ArtApexJars = []string{"platform:nonexistent"}
+ config.ArtApexJars = android.CreateConfiguredJarList(ctx, []string{"platform:nonexistent"})
}
testNoUpdatableJarsInBootImage(t, err, transform)
})
@@ -5656,7 +5665,7 @@
t.Run("nonexistent jar in the framework boot image => error", func(t *testing.T) {
err = "failed to find a dex jar path for module 'nonexistent'"
transform = func(config *dexpreopt.GlobalConfig) {
- config.BootJars = []string{"platform:nonexistent"}
+ config.BootJars = android.CreateConfiguredJarList(ctx, []string{"platform:nonexistent"})
}
testNoUpdatableJarsInBootImage(t, err, transform)
})
@@ -5664,14 +5673,14 @@
t.Run("platform jar in the ART boot image => error", func(t *testing.T) {
err = "module 'some-platform-lib' is not allowed in the ART boot image"
transform = func(config *dexpreopt.GlobalConfig) {
- config.ArtApexJars = []string{"platform:some-platform-lib"}
+ config.ArtApexJars = android.CreateConfiguredJarList(ctx, []string{"platform:some-platform-lib"})
}
testNoUpdatableJarsInBootImage(t, err, transform)
})
t.Run("platform jar in the framework boot image => ok", func(t *testing.T) {
transform = func(config *dexpreopt.GlobalConfig) {
- config.BootJars = []string{"platform:some-platform-lib"}
+ config.BootJars = android.CreateConfiguredJarList(ctx, []string{"platform:some-platform-lib"})
}
testNoUpdatableJarsInBootImage(t, "", transform)
})
diff --git a/bpfix/bpfix/bpfix.go b/bpfix/bpfix/bpfix.go
index 689cbd1..faec473 100644
--- a/bpfix/bpfix/bpfix.go
+++ b/bpfix/bpfix/bpfix.go
@@ -128,6 +128,10 @@
Name: "removeSoongConfigBoolVariable",
Fix: removeSoongConfigBoolVariable,
},
+ {
+ Name: "removePdkProperty",
+ Fix: runPatchListMod(removePdkProperty),
+ },
}
func NewFixRequest() FixRequest {
@@ -993,6 +997,25 @@
return patchlist.Add(prop.Pos().Offset, prop.End().Offset+2, replaceStr)
}
+func removePdkProperty(mod *parser.Module, buf []byte, patchlist *parser.PatchList) error {
+ prop, ok := mod.GetProperty("product_variables")
+ if !ok {
+ return nil
+ }
+ propMap, ok := prop.Value.(*parser.Map)
+ if !ok {
+ return nil
+ }
+ pdkProp, ok := propMap.GetProperty("pdk")
+ if !ok {
+ return nil
+ }
+ if len(propMap.Properties) > 1 {
+ return patchlist.Add(pdkProp.Pos().Offset, pdkProp.End().Offset+2, "")
+ }
+ return patchlist.Add(prop.Pos().Offset, prop.End().Offset+2, "")
+}
+
func mergeMatchingModuleProperties(mod *parser.Module, buf []byte, patchlist *parser.PatchList) error {
return mergeMatchingProperties(&mod.Properties, buf, patchlist)
}
diff --git a/bpfix/bpfix/bpfix_test.go b/bpfix/bpfix/bpfix_test.go
index 8988177..ef9814f 100644
--- a/bpfix/bpfix/bpfix_test.go
+++ b/bpfix/bpfix/bpfix_test.go
@@ -998,3 +998,61 @@
})
}
}
+
+func TestRemovePdkProperty(t *testing.T) {
+ tests := []struct {
+ name string
+ in string
+ out string
+ }{
+ {
+ name: "remove property",
+ in: `
+ cc_library_shared {
+ name: "foo",
+ product_variables: {
+ other: {
+ bar: true,
+ },
+ pdk: {
+ enabled: false,
+ },
+ },
+ }
+ `,
+ out: `
+ cc_library_shared {
+ name: "foo",
+ product_variables: {
+ other: {
+ bar: true,
+ },
+ },
+ }
+ `,
+ },
+ {
+ name: "remove property and empty product_variables",
+ in: `
+ cc_library_shared {
+ name: "foo",
+ product_variables: {
+ pdk: {
+ enabled: false,
+ },
+ },
+ }
+ `,
+ out: `
+ cc_library_shared {
+ name: "foo",
+ }
+ `,
+ },
+ }
+ for _, test := range tests {
+ t.Run(test.name, func(t *testing.T) {
+ runPass(t, test.in, test.out, runPatchListMod(removePdkProperty))
+ })
+ }
+}
diff --git a/cc/Android.bp b/cc/Android.bp
index 9ece05f..831911e 100644
--- a/cc/Android.bp
+++ b/cc/Android.bp
@@ -19,6 +19,7 @@
"check.go",
"coverage.go",
"gen.go",
+ "image.go",
"linkable.go",
"lto.go",
"makevars.go",
diff --git a/cc/androidmk.go b/cc/androidmk.go
index e91b40a..9ed8d81 100644
--- a/cc/androidmk.go
+++ b/cc/androidmk.go
@@ -206,29 +206,15 @@
}
func (library *libraryDecorator) androidMkEntriesWriteAdditionalDependenciesForSourceAbiDiff(entries *android.AndroidMkEntries) {
- if library.sAbiOutputFile.Valid() {
- entries.SetString("LOCAL_ADDITIONAL_DEPENDENCIES",
- "$(LOCAL_ADDITIONAL_DEPENDENCIES) "+library.sAbiOutputFile.String())
- if library.sAbiDiff.Valid() && !library.static() {
- entries.SetString("LOCAL_ADDITIONAL_DEPENDENCIES",
- "$(LOCAL_ADDITIONAL_DEPENDENCIES) "+library.sAbiDiff.String())
- entries.SetString("HEADER_ABI_DIFFS",
- "$(HEADER_ABI_DIFFS) "+library.sAbiDiff.String())
- }
+ if library.sAbiDiff.Valid() && !library.static() {
+ entries.AddStrings("LOCAL_ADDITIONAL_DEPENDENCIES", library.sAbiDiff.String())
}
}
// TODO(ccross): remove this once apex/androidmk.go is converted to AndroidMkEntries
func (library *libraryDecorator) androidMkWriteAdditionalDependenciesForSourceAbiDiff(w io.Writer) {
- if library.sAbiOutputFile.Valid() {
- fmt.Fprintln(w, "LOCAL_ADDITIONAL_DEPENDENCIES := $(LOCAL_ADDITIONAL_DEPENDENCIES) ",
- library.sAbiOutputFile.String())
- if library.sAbiDiff.Valid() && !library.static() {
- fmt.Fprintln(w, "LOCAL_ADDITIONAL_DEPENDENCIES := $(LOCAL_ADDITIONAL_DEPENDENCIES) ",
- library.sAbiDiff.String())
- fmt.Fprintln(w, "HEADER_ABI_DIFFS := $(HEADER_ABI_DIFFS) ",
- library.sAbiDiff.String())
- }
+ if library.sAbiDiff.Valid() && !library.static() {
+ fmt.Fprintln(w, "LOCAL_ADDITIONAL_DEPENDENCIES +=", library.sAbiDiff.String())
}
}
@@ -286,10 +272,8 @@
entries.SubName = "." + library.stubsVersion()
}
entries.ExtraEntries = append(entries.ExtraEntries, func(entries *android.AndroidMkEntries) {
- // Note library.skipInstall() has a special case to get here for static
- // libraries that otherwise would have skipped installation and hence not
- // have executed AndroidMkEntries at all. The reason is to ensure they get
- // a NOTICE file make target which other libraries might depend on.
+ // library.makeUninstallable() depends on this to bypass SkipInstall() for
+ // static libraries.
entries.SetBool("LOCAL_UNINSTALLABLE_MODULE", true)
if library.buildStubs() {
entries.SetBool("LOCAL_NO_NOTICE_FILE", true)
@@ -518,10 +502,14 @@
entries.Class = "HEADER_LIBRARIES"
}
+ entries.SubName = ""
+
+ if c.sanitizerProperties.CfiEnabled {
+ entries.SubName += ".cfi"
+ }
+
if c.androidMkVendorSuffix {
- entries.SubName = vendorSuffix
- } else {
- entries.SubName = ""
+ entries.SubName += vendorSuffix
}
entries.ExtraEntries = append(entries.ExtraEntries, func(entries *android.AndroidMkEntries) {
diff --git a/cc/binary.go b/cc/binary.go
index 565cb8a..63bbd83 100644
--- a/cc/binary.go
+++ b/cc/binary.go
@@ -130,34 +130,12 @@
deps = binary.baseLinker.linkerDeps(ctx, deps)
if ctx.toolchain().Bionic() {
if !Bool(binary.baseLinker.Properties.Nocrt) {
- if !ctx.useSdk() {
- if binary.static() {
- deps.CrtBegin = "crtbegin_static"
- } else {
- deps.CrtBegin = "crtbegin_dynamic"
- }
- deps.CrtEnd = "crtend_android"
+ if binary.static() {
+ deps.CrtBegin = "crtbegin_static"
} else {
- // TODO(danalbert): Add generation of crt objects.
- // For `sdk_version: "current"`, we don't actually have a
- // freshly generated set of CRT objects. Use the last stable
- // version.
- version := ctx.sdkVersion()
- if version == "current" {
- version = getCurrentNdkPrebuiltVersion(ctx)
- }
-
- if binary.static() {
- deps.CrtBegin = "ndk_crtbegin_static." + version
- } else {
- if binary.static() {
- deps.CrtBegin = "ndk_crtbegin_static." + version
- } else {
- deps.CrtBegin = "ndk_crtbegin_dynamic." + version
- }
- deps.CrtEnd = "ndk_crtend_android." + version
- }
+ deps.CrtBegin = "crtbegin_dynamic"
}
+ deps.CrtEnd = "crtend_android"
}
if binary.static() {
diff --git a/cc/binary_sdk_member.go b/cc/binary_sdk_member.go
index 51d8b4e..337de55 100644
--- a/cc/binary_sdk_member.go
+++ b/cc/binary_sdk_member.go
@@ -29,7 +29,8 @@
var ccBinarySdkMemberType = &binarySdkMemberType{
SdkMemberTypeBase: android.SdkMemberTypeBase{
- PropertyName: "native_binaries",
+ PropertyName: "native_binaries",
+ HostOsDependent: true,
},
}
diff --git a/cc/builder.go b/cc/builder.go
index b4f9947..28a573f 100644
--- a/cc/builder.go
+++ b/cc/builder.go
@@ -174,12 +174,21 @@
},
"crossCompile", "format")
- clangTidy = pctx.AndroidStaticRule("clangTidy",
+ clangTidy, clangTidyRE = remoteexec.StaticRules(pctx, "clangTidy",
blueprint.RuleParams{
- Command: "rm -f $out && ${config.ClangBin}/clang-tidy $tidyFlags $in -- $cFlags && touch $out",
+ Command: "rm -f $out && $reTemplate${config.ClangBin}/clang-tidy $tidyFlags $in -- $cFlags && touch $out",
CommandDeps: []string{"${config.ClangBin}/clang-tidy"},
},
- "cFlags", "tidyFlags")
+ &remoteexec.REParams{
+ Labels: map[string]string{"type": "lint", "tool": "clang-tidy", "lang": "cpp"},
+ ExecStrategy: "${config.REClangTidyExecStrategy}",
+ Inputs: []string{"$in"},
+ // OutputFile here is $in for remote-execution since its possible that
+ // clang-tidy modifies the given input file itself and $out refers to the
+ // ".tidy" file generated for ninja-dependency reasons.
+ OutputFiles: []string{"$in"},
+ Platform: map[string]string{remoteexec.PoolKey: "${config.REClangTidyPool}"},
+ }, []string{"cFlags", "tidyFlags"}, []string{})
_ = pctx.SourcePathVariable("yasmCmd", "prebuilts/misc/${config.HostPrebuiltTag}/yasm/yasm")
@@ -569,8 +578,13 @@
tidyFile := android.ObjPathWithExt(ctx, subdir, srcFile, "tidy")
tidyFiles = append(tidyFiles, tidyFile)
+ rule := clangTidy
+ if ctx.Config().IsEnvTrue("RBE_CLANG_TIDY") {
+ rule = clangTidyRE
+ }
+
ctx.Build(pctx, android.BuildParams{
- Rule: clangTidy,
+ Rule: rule,
Description: "clang-tidy " + srcFile.Rel(),
Output: tidyFile,
Input: srcFile,
diff --git a/cc/cc.go b/cc/cc.go
index 962da4c..abe003e 100644
--- a/cc/cc.go
+++ b/cc/cc.go
@@ -418,51 +418,137 @@
inSanitizerDir() bool
hostToolPath() android.OptionalPath
relativeInstallPath() string
- skipInstall(mod *Module)
+ makeUninstallable(mod *Module)
}
type xref interface {
XrefCcFiles() android.Paths
}
+type libraryDependencyKind int
+
+const (
+ headerLibraryDependency = iota
+ sharedLibraryDependency
+ staticLibraryDependency
+)
+
+func (k libraryDependencyKind) String() string {
+ switch k {
+ case headerLibraryDependency:
+ return "headerLibraryDependency"
+ case sharedLibraryDependency:
+ return "sharedLibraryDependency"
+ case staticLibraryDependency:
+ return "staticLibraryDependency"
+ default:
+ panic(fmt.Errorf("unknown libraryDependencyKind %d", k))
+ }
+}
+
+type libraryDependencyOrder int
+
+const (
+ earlyLibraryDependency = -1
+ normalLibraryDependency = 0
+ lateLibraryDependency = 1
+)
+
+func (o libraryDependencyOrder) String() string {
+ switch o {
+ case earlyLibraryDependency:
+ return "earlyLibraryDependency"
+ case normalLibraryDependency:
+ return "normalLibraryDependency"
+ case lateLibraryDependency:
+ return "lateLibraryDependency"
+ default:
+ panic(fmt.Errorf("unknown libraryDependencyOrder %d", o))
+ }
+}
+
+// libraryDependencyTag is used to tag dependencies on libraries. Unlike many dependency
+// tags that have a set of predefined tag objects that are reused for each dependency, a
+// libraryDependencyTag is designed to contain extra metadata and is constructed as needed.
+// That means that comparing a libraryDependencyTag for equality will only be equal if all
+// of the metadata is equal. Most usages will want to type assert to libraryDependencyTag and
+// then check individual metadata fields instead.
+type libraryDependencyTag struct {
+ blueprint.BaseDependencyTag
+
+ // These are exported so that fmt.Printf("%#v") can call their String methods.
+ Kind libraryDependencyKind
+ Order libraryDependencyOrder
+
+ wholeStatic bool
+
+ reexportFlags bool
+ explicitlyVersioned bool
+ dataLib bool
+ ndk bool
+
+ staticUnwinder bool
+
+ makeSuffix string
+}
+
+// header returns true if the libraryDependencyTag is tagging a header lib dependency.
+func (d libraryDependencyTag) header() bool {
+ return d.Kind == headerLibraryDependency
+}
+
+// shared returns true if the libraryDependencyTag is tagging a shared lib dependency.
+func (d libraryDependencyTag) shared() bool {
+ return d.Kind == sharedLibraryDependency
+}
+
+// shared returns true if the libraryDependencyTag is tagging a static lib dependency.
+func (d libraryDependencyTag) static() bool {
+ return d.Kind == staticLibraryDependency
+}
+
+// dependencyTag is used for tagging miscellanous dependency types that don't fit into
+// libraryDependencyTag. Each tag object is created globally and reused for multiple
+// dependencies (although since the object contains no references, assigning a tag to a
+// variable and modifying it will not modify the original). Users can compare the tag
+// returned by ctx.OtherModuleDependencyTag against the global original
+type dependencyTag struct {
+ blueprint.BaseDependencyTag
+ name string
+}
+
var (
- dataLibDepTag = DependencyTag{Name: "data_lib", Library: true, Shared: true}
- sharedExportDepTag = DependencyTag{Name: "shared", Library: true, Shared: true, ReexportFlags: true}
- earlySharedDepTag = DependencyTag{Name: "early_shared", Library: true, Shared: true}
- lateSharedDepTag = DependencyTag{Name: "late shared", Library: true, Shared: true}
- staticExportDepTag = DependencyTag{Name: "static", Library: true, ReexportFlags: true}
- lateStaticDepTag = DependencyTag{Name: "late static", Library: true}
- staticUnwinderDepTag = DependencyTag{Name: "static unwinder", Library: true}
- wholeStaticDepTag = DependencyTag{Name: "whole static", Library: true, ReexportFlags: true}
- headerDepTag = DependencyTag{Name: "header", Library: true}
- headerExportDepTag = DependencyTag{Name: "header", Library: true, ReexportFlags: true}
- genSourceDepTag = DependencyTag{Name: "gen source"}
- genHeaderDepTag = DependencyTag{Name: "gen header"}
- genHeaderExportDepTag = DependencyTag{Name: "gen header", ReexportFlags: true}
- objDepTag = DependencyTag{Name: "obj"}
- linkerFlagsDepTag = DependencyTag{Name: "linker flags file"}
- dynamicLinkerDepTag = DependencyTag{Name: "dynamic linker"}
- reuseObjTag = DependencyTag{Name: "reuse objects"}
- staticVariantTag = DependencyTag{Name: "static variant"}
- ndkStubDepTag = DependencyTag{Name: "ndk stub", Library: true}
- ndkLateStubDepTag = DependencyTag{Name: "ndk late stub", Library: true}
- vndkExtDepTag = DependencyTag{Name: "vndk extends", Library: true}
- runtimeDepTag = DependencyTag{Name: "runtime lib"}
- testPerSrcDepTag = DependencyTag{Name: "test_per_src"}
+ genSourceDepTag = dependencyTag{name: "gen source"}
+ genHeaderDepTag = dependencyTag{name: "gen header"}
+ genHeaderExportDepTag = dependencyTag{name: "gen header export"}
+ objDepTag = dependencyTag{name: "obj"}
+ linkerFlagsDepTag = dependencyTag{name: "linker flags file"}
+ dynamicLinkerDepTag = dependencyTag{name: "dynamic linker"}
+ reuseObjTag = dependencyTag{name: "reuse objects"}
+ staticVariantTag = dependencyTag{name: "static variant"}
+ vndkExtDepTag = dependencyTag{name: "vndk extends"}
+ dataLibDepTag = dependencyTag{name: "data lib"}
+ runtimeDepTag = dependencyTag{name: "runtime lib"}
+ testPerSrcDepTag = dependencyTag{name: "test_per_src"}
)
func IsSharedDepTag(depTag blueprint.DependencyTag) bool {
- ccDepTag, ok := depTag.(DependencyTag)
- return ok && ccDepTag.Shared
+ ccLibDepTag, ok := depTag.(libraryDependencyTag)
+ return ok && ccLibDepTag.shared()
+}
+
+func IsStaticDepTag(depTag blueprint.DependencyTag) bool {
+ ccLibDepTag, ok := depTag.(libraryDependencyTag)
+ return ok && ccLibDepTag.static()
}
func IsRuntimeDepTag(depTag blueprint.DependencyTag) bool {
- ccDepTag, ok := depTag.(DependencyTag)
+ ccDepTag, ok := depTag.(dependencyTag)
return ok && ccDepTag == runtimeDepTag
}
func IsTestPerSrcDepTag(depTag blueprint.DependencyTag) bool {
- ccDepTag, ok := depTag.(DependencyTag)
+ ccDepTag, ok := depTag.(dependencyTag)
return ok && ccDepTag == testPerSrcDepTag
}
@@ -595,6 +681,13 @@
return String(c.Properties.Min_sdk_version)
}
+func (c *Module) SplitPerApiLevel() bool {
+ if linker, ok := c.linker.(*objectLinker); ok {
+ return linker.isCrt()
+ }
+ return false
+}
+
func (c *Module) AlwaysSdk() bool {
return c.Properties.AlwaysSdk || Bool(c.Properties.Sdk_variant_only)
}
@@ -866,7 +959,7 @@
func (c *Module) UseSdk() bool {
if c.canUseSdk() {
- return String(c.Properties.Sdk_version) != ""
+ return String(c.Properties.Sdk_version) != "" || c.SplitPerApiLevel()
}
return false
}
@@ -876,7 +969,7 @@
}
func (c *Module) IsNdk() bool {
- return inList(c.Name(), ndkKnownLibs)
+ return inList(c.BaseModuleName(), ndkKnownLibs)
}
func (c *Module) isLlndk(config android.Config) bool {
@@ -941,48 +1034,6 @@
return ""
}
-// Returns true only when this module is configured to have core, product and vendor
-// variants.
-func (c *Module) HasVendorVariant() bool {
- return c.IsVndk() || Bool(c.VendorProperties.Vendor_available)
-}
-
-const (
- // VendorVariationPrefix is the variant prefix used for /vendor code that compiles
- // against the VNDK.
- VendorVariationPrefix = "vendor."
-
- // ProductVariationPrefix is the variant prefix used for /product code that compiles
- // against the VNDK.
- ProductVariationPrefix = "product."
-)
-
-// Returns true if the module is "product" variant. Usually these modules are installed in /product
-func (c *Module) inProduct() bool {
- return c.Properties.ImageVariationPrefix == ProductVariationPrefix
-}
-
-// Returns true if the module is "vendor" variant. Usually these modules are installed in /vendor
-func (c *Module) inVendor() bool {
- return c.Properties.ImageVariationPrefix == VendorVariationPrefix
-}
-
-func (c *Module) InRamdisk() bool {
- return c.ModuleBase.InRamdisk() || c.ModuleBase.InstallInRamdisk()
-}
-
-func (c *Module) InRecovery() bool {
- return c.ModuleBase.InRecovery() || c.ModuleBase.InstallInRecovery()
-}
-
-func (c *Module) OnlyInRamdisk() bool {
- return c.ModuleBase.InstallInRamdisk()
-}
-
-func (c *Module) OnlyInRecovery() bool {
- return c.ModuleBase.InstallInRecovery()
-}
-
func (c *Module) IsStubs() bool {
if library, ok := c.linker.(*libraryDecorator); ok {
return library.buildStubs()
@@ -1090,16 +1141,6 @@
moduleContextImpl
}
-func (ctx *moduleContext) ProductSpecific() bool {
- return ctx.ModuleContext.ProductSpecific() ||
- (ctx.mod.HasVendorVariant() && ctx.mod.inProduct() && !ctx.mod.IsVndk())
-}
-
-func (ctx *moduleContext) SocSpecific() bool {
- return ctx.ModuleContext.SocSpecific() ||
- (ctx.mod.HasVendorVariant() && ctx.mod.inVendor() && !ctx.mod.IsVndk())
-}
-
type moduleContextImpl struct {
mod *Module
ctx BaseModuleContext
@@ -1195,22 +1236,6 @@
return ctx.mod.MustUseVendorVariant()
}
-func (ctx *moduleContextImpl) inProduct() bool {
- return ctx.mod.inProduct()
-}
-
-func (ctx *moduleContextImpl) inVendor() bool {
- return ctx.mod.inVendor()
-}
-
-func (ctx *moduleContextImpl) inRamdisk() bool {
- return ctx.mod.InRamdisk()
-}
-
-func (ctx *moduleContextImpl) inRecovery() bool {
- return ctx.mod.InRecovery()
-}
-
// Check whether ABI dumps should be created for this module.
func (ctx *moduleContextImpl) shouldCreateSourceAbiDump() bool {
if ctx.ctx.Config().IsEnvTrue("SKIP_ABI_CHECKS") {
@@ -1467,8 +1492,11 @@
c.Properties.SubName += ramdiskSuffix
} else if c.InRecovery() && !c.OnlyInRecovery() {
c.Properties.SubName += recoverySuffix
- } else if c.Properties.IsSdkVariant && c.Properties.SdkAndPlatformVariantVisibleToMake {
+ } else if c.IsSdkVariant() && (c.Properties.SdkAndPlatformVariantVisibleToMake || c.SplitPerApiLevel()) {
c.Properties.SubName += sdkSuffix
+ if c.SplitPerApiLevel() {
+ c.Properties.SubName += "." + c.SdkVersion()
+ }
}
ctx := &moduleContext{
@@ -1641,7 +1669,7 @@
for _, feature := range c.features {
feature.begin(ctx)
}
- if ctx.useSdk() {
+ if ctx.useSdk() && c.IsSdkVariant() {
version, err := normalizeNdkApiLevel(ctx, ctx.sdkVersion(), ctx.Arch())
if err != nil {
ctx.PropertyErrorf("sdk_version", err.Error())
@@ -1744,6 +1772,22 @@
return name, ""
}
+func GetCrtVariations(ctx android.BottomUpMutatorContext,
+ m LinkableInterface) []blueprint.Variation {
+ if ctx.Os() != android.Android {
+ return nil
+ }
+ if m.UseSdk() {
+ return []blueprint.Variation{
+ {Mutator: "sdk", Variation: "sdk"},
+ {Mutator: "ndk_api", Variation: m.SdkVersion()},
+ }
+ }
+ return []blueprint.Variation{
+ {Mutator: "sdk", Variation: ""},
+ }
+}
+
func (c *Module) DepsMutator(actx android.BottomUpMutatorContext) {
if !c.Enabled() {
return
@@ -1859,9 +1903,9 @@
vendorSnapshotHeaderLibs := vendorSnapshotHeaderLibs(actx.Config())
for _, lib := range deps.HeaderLibs {
- depTag := headerDepTag
+ depTag := libraryDependencyTag{Kind: headerLibraryDependency}
if inList(lib, deps.ReexportHeaderLibHeaders) {
- depTag = headerExportDepTag
+ depTag.reexportFlags = true
}
lib = rewriteSnapshotLibs(lib, vendorSnapshotHeaderLibs)
@@ -1884,7 +1928,7 @@
vendorSnapshotStaticLibs := vendorSnapshotStaticLibs(actx.Config())
for _, lib := range deps.WholeStaticLibs {
- depTag := wholeStaticDepTag
+ depTag := libraryDependencyTag{Kind: staticLibraryDependency, wholeStatic: true, reexportFlags: true}
if impl, ok := syspropImplLibraries[lib]; ok {
lib = impl
}
@@ -1897,9 +1941,9 @@
}
for _, lib := range deps.StaticLibs {
- depTag := StaticDepTag
+ depTag := libraryDependencyTag{Kind: staticLibraryDependency}
if inList(lib, deps.ReexportStaticLibHeaders) {
- depTag = staticExportDepTag
+ depTag.reexportFlags = true
}
if impl, ok := syspropImplLibraries[lib]; ok {
@@ -1917,24 +1961,26 @@
// so that native libraries/binaries are linked with static unwinder
// because Q libc doesn't have unwinder APIs
if deps.StaticUnwinderIfLegacy {
+ depTag := libraryDependencyTag{Kind: staticLibraryDependency, staticUnwinder: true}
actx.AddVariationDependencies([]blueprint.Variation{
{Mutator: "link", Variation: "static"},
- }, staticUnwinderDepTag, rewriteSnapshotLibs(staticUnwinder(actx), vendorSnapshotStaticLibs))
+ }, depTag, rewriteSnapshotLibs(staticUnwinder(actx), vendorSnapshotStaticLibs))
}
for _, lib := range deps.LateStaticLibs {
+ depTag := libraryDependencyTag{Kind: staticLibraryDependency, Order: lateLibraryDependency}
actx.AddVariationDependencies([]blueprint.Variation{
{Mutator: "link", Variation: "static"},
- }, lateStaticDepTag, rewriteSnapshotLibs(lib, vendorSnapshotStaticLibs))
+ }, depTag, rewriteSnapshotLibs(lib, vendorSnapshotStaticLibs))
}
- addSharedLibDependencies := func(depTag DependencyTag, name string, version string) {
+ addSharedLibDependencies := func(depTag libraryDependencyTag, name string, version string) {
var variations []blueprint.Variation
variations = append(variations, blueprint.Variation{Mutator: "link", Variation: "shared"})
if version != "" && VersionVariantAvailable(c) {
// Version is explicitly specified. i.e. libFoo#30
variations = append(variations, blueprint.Variation{Mutator: "version", Variation: version})
- depTag.ExplicitlyVersioned = true
+ depTag.explicitlyVersioned = true
}
actx.AddVariationDependencies(variations, depTag, name)
@@ -1956,12 +2002,9 @@
var sharedLibNames []string
for _, lib := range deps.SharedLibs {
- depTag := SharedDepTag
- if c.static() {
- depTag = SharedFromStaticDepTag
- }
+ depTag := libraryDependencyTag{Kind: sharedLibraryDependency}
if inList(lib, deps.ReexportSharedLibHeaders) {
- depTag = sharedExportDepTag
+ depTag.reexportFlags = true
}
if impl, ok := syspropImplLibraries[lib]; ok {
@@ -1981,7 +2024,8 @@
// linking against both the stubs lib and the non-stubs lib at the same time.
continue
}
- addSharedLibDependencies(lateSharedDepTag, lib, "")
+ depTag := libraryDependencyTag{Kind: sharedLibraryDependency, Order: lateLibraryDependency}
+ addSharedLibDependencies(depTag, lib, "")
}
actx.AddVariationDependencies([]blueprint.Variation{
@@ -2006,11 +2050,14 @@
vendorSnapshotObjects := vendorSnapshotObjects(actx.Config())
+ crtVariations := GetCrtVariations(ctx, c)
if deps.CrtBegin != "" {
- actx.AddVariationDependencies(nil, CrtBeginDepTag, rewriteSnapshotLibs(deps.CrtBegin, vendorSnapshotObjects))
+ actx.AddVariationDependencies(crtVariations, CrtBeginDepTag,
+ rewriteSnapshotLibs(deps.CrtBegin, vendorSnapshotObjects))
}
if deps.CrtEnd != "" {
- actx.AddVariationDependencies(nil, CrtEndDepTag, rewriteSnapshotLibs(deps.CrtEnd, vendorSnapshotObjects))
+ actx.AddVariationDependencies(crtVariations, CrtEndDepTag,
+ rewriteSnapshotLibs(deps.CrtEnd, vendorSnapshotObjects))
}
if deps.LinkerFlagsFile != "" {
actx.AddDependency(c, linkerFlagsDepTag, deps.LinkerFlagsFile)
@@ -2020,10 +2067,14 @@
}
version := ctx.sdkVersion()
+
+ ndkStubDepTag := libraryDependencyTag{Kind: sharedLibraryDependency, ndk: true, makeSuffix: "." + version}
actx.AddVariationDependencies([]blueprint.Variation{
{Mutator: "ndk_api", Variation: version},
{Mutator: "link", Variation: "shared"},
}, ndkStubDepTag, variantNdkLibs...)
+
+ ndkLateStubDepTag := libraryDependencyTag{Kind: sharedLibraryDependency, Order: lateLibraryDependency, ndk: true, makeSuffix: "." + version}
actx.AddVariationDependencies([]blueprint.Variation{
{Mutator: "ndk_api", Variation: version},
{Mutator: "link", Variation: "shared"},
@@ -2047,7 +2098,19 @@
// Whether a module can link to another module, taking into
// account NDK linking.
-func checkLinkType(ctx android.ModuleContext, from LinkableInterface, to LinkableInterface, tag DependencyTag) {
+func checkLinkType(ctx android.ModuleContext, from LinkableInterface, to LinkableInterface,
+ tag blueprint.DependencyTag) {
+
+ switch t := tag.(type) {
+ case dependencyTag:
+ if t != vndkExtDepTag {
+ return
+ }
+ case libraryDependencyTag:
+ default:
+ return
+ }
+
if from.Module().Target().Os != android.Android {
// Host code is not restricted
return
@@ -2205,8 +2268,6 @@
directStaticDeps := []LinkableInterface{}
directSharedDeps := []LinkableInterface{}
- vendorPublicLibraries := vendorPublicLibraries(ctx.Config())
-
reexportExporter := func(exporter exportedFlagsProducer) {
depPaths.ReexportedDirs = append(depPaths.ReexportedDirs, exporter.exportedDirs()...)
depPaths.ReexportedSystemDirs = append(depPaths.ReexportedSystemDirs, exporter.exportedSystemDirs()...)
@@ -2316,39 +2377,24 @@
}
}
- if depTag == staticUnwinderDepTag {
- // Use static unwinder for legacy (min_sdk_version = 29) apexes (b/144430859)
- if c.apexSdkVersion <= android.SdkVersion_Android10 {
- depTag = StaticDepTag
- } else {
+ checkLinkType(ctx, c, ccDep, depTag)
+
+ linkFile := ccDep.OutputFile()
+
+ if libDepTag, ok := depTag.(libraryDependencyTag); ok {
+ // Only use static unwinder for legacy (min_sdk_version = 29) apexes (b/144430859)
+ if libDepTag.staticUnwinder && c.apexSdkVersion > android.SdkVersion_Android10 {
return
}
- }
- // Extract ExplicitlyVersioned field from the depTag and reset it inside the struct.
- // Otherwise, SharedDepTag and lateSharedDepTag with ExplicitlyVersioned set to true
- // won't be matched to SharedDepTag and lateSharedDepTag.
- explicitlyVersioned := false
- if t, ok := depTag.(DependencyTag); ok {
- explicitlyVersioned = t.ExplicitlyVersioned
- t.ExplicitlyVersioned = false
- depTag = t
- }
-
- if t, ok := depTag.(DependencyTag); ok && t.Library {
- depIsStatic := false
- switch depTag {
- case StaticDepTag, staticExportDepTag, lateStaticDepTag, wholeStaticDepTag:
- depIsStatic = true
- }
- if ccDep.CcLibrary() && !depIsStatic {
+ if ccDep.CcLibrary() && !libDepTag.static() {
depIsStubs := ccDep.BuildStubs()
depHasStubs := VersionVariantAvailable(c) && ccDep.HasStubsVariants()
depInSameApex := android.DirectlyInApex(c.ApexName(), depName)
depInPlatform := !android.DirectlyInAnyApex(ctx, depName)
var useThisDep bool
- if depIsStubs && explicitlyVersioned {
+ if depIsStubs && libDepTag.explicitlyVersioned {
// Always respect dependency to the versioned stubs (i.e. libX#10)
useThisDep = true
} else if !depHasStubs {
@@ -2380,7 +2426,7 @@
}
// when to use (unspecified) stubs, check min_sdk_version and choose the right one
- if useThisDep && depIsStubs && !explicitlyVersioned {
+ if useThisDep && depIsStubs && !libDepTag.explicitlyVersioned {
versionToUse, err := c.ChooseSdkVersion(ccDep.StubsVersions(), c.apexSdkVersion)
if err != nil {
ctx.OtherModuleErrorf(dep, err.Error())
@@ -2425,7 +2471,7 @@
depPaths.GeneratedDeps = append(depPaths.GeneratedDeps, i.exportedDeps()...)
depPaths.Flags = append(depPaths.Flags, i.exportedFlags()...)
- if t.ReexportFlags {
+ if libDepTag.reexportFlags {
reexportExporter(i)
// Add these re-exported flags to help header-abi-dumper to infer the abi exported by a library.
// Re-exported shared library headers must be included as well since they can help us with type information
@@ -2437,210 +2483,169 @@
}
}
}
- checkLinkType(ctx, c, ccDep, t)
- }
- var ptr *android.Paths
- var depPtr *android.Paths
+ var ptr *android.Paths
+ var depPtr *android.Paths
- linkFile := ccDep.OutputFile()
- depFile := android.OptionalPath{}
+ depFile := android.OptionalPath{}
- switch depTag {
- case ndkStubDepTag, SharedDepTag, SharedFromStaticDepTag, sharedExportDepTag:
- ptr = &depPaths.SharedLibs
- depPtr = &depPaths.SharedLibsDeps
- depFile = ccDep.Toc()
- directSharedDeps = append(directSharedDeps, ccDep)
-
- case earlySharedDepTag:
- ptr = &depPaths.EarlySharedLibs
- depPtr = &depPaths.EarlySharedLibsDeps
- depFile = ccDep.Toc()
- directSharedDeps = append(directSharedDeps, ccDep)
- case lateSharedDepTag, ndkLateStubDepTag:
- ptr = &depPaths.LateSharedLibs
- depPtr = &depPaths.LateSharedLibsDeps
- depFile = ccDep.Toc()
- case StaticDepTag, staticExportDepTag:
- ptr = nil
- directStaticDeps = append(directStaticDeps, ccDep)
- case lateStaticDepTag:
- ptr = &depPaths.LateStaticLibs
- case wholeStaticDepTag:
- ptr = &depPaths.WholeStaticLibs
- if !ccDep.CcLibraryInterface() || !ccDep.Static() {
- ctx.ModuleErrorf("module %q not a static library", depName)
- return
- }
-
- // Because the static library objects are included, this only makes sense
- // in the context of proper cc.Modules.
- if ccWholeStaticLib, ok := ccDep.(*Module); ok {
- staticLib := ccWholeStaticLib.linker.(libraryInterface)
- if missingDeps := staticLib.getWholeStaticMissingDeps(); missingDeps != nil {
- postfix := " (required by " + ctx.OtherModuleName(dep) + ")"
- for i := range missingDeps {
- missingDeps[i] += postfix
- }
- ctx.AddMissingDependencies(missingDeps)
+ switch {
+ case libDepTag.header():
+ // nothing
+ case libDepTag.shared():
+ ptr = &depPaths.SharedLibs
+ switch libDepTag.Order {
+ case earlyLibraryDependency:
+ ptr = &depPaths.EarlySharedLibs
+ depPtr = &depPaths.EarlySharedLibsDeps
+ case normalLibraryDependency:
+ ptr = &depPaths.SharedLibs
+ depPtr = &depPaths.SharedLibsDeps
+ directSharedDeps = append(directSharedDeps, ccDep)
+ case lateLibraryDependency:
+ ptr = &depPaths.LateSharedLibs
+ depPtr = &depPaths.LateSharedLibsDeps
+ default:
+ panic(fmt.Errorf("unexpected library dependency order %d", libDepTag.Order))
}
- if _, ok := ccWholeStaticLib.linker.(prebuiltLinkerInterface); ok {
- depPaths.WholeStaticLibsFromPrebuilts = append(depPaths.WholeStaticLibsFromPrebuilts, linkFile.Path())
- } else {
- depPaths.WholeStaticLibObjs = depPaths.WholeStaticLibObjs.Append(staticLib.objs())
- }
- } else {
- ctx.ModuleErrorf(
- "non-cc.Modules cannot be included as whole static libraries.", depName)
- return
- }
- case headerDepTag:
- // Nothing
- case objDepTag:
- depPaths.Objs.objFiles = append(depPaths.Objs.objFiles, linkFile.Path())
- case CrtBeginDepTag:
- depPaths.CrtBegin = linkFile
- case CrtEndDepTag:
- depPaths.CrtEnd = linkFile
- case dynamicLinkerDepTag:
- depPaths.DynamicLinker = linkFile
- }
-
- switch depTag {
- case StaticDepTag, staticExportDepTag, lateStaticDepTag:
- if !ccDep.CcLibraryInterface() || !ccDep.Static() {
- ctx.ModuleErrorf("module %q not a static library", depName)
- return
- }
-
- // When combining coverage files for shared libraries and executables, coverage files
- // in static libraries act as if they were whole static libraries. The same goes for
- // source based Abi dump files.
- if c, ok := ccDep.(*Module); ok {
- staticLib := c.linker.(libraryInterface)
- depPaths.StaticLibObjs.coverageFiles = append(depPaths.StaticLibObjs.coverageFiles,
- staticLib.objs().coverageFiles...)
- depPaths.StaticLibObjs.sAbiDumpFiles = append(depPaths.StaticLibObjs.sAbiDumpFiles,
- staticLib.objs().sAbiDumpFiles...)
- } else if c, ok := ccDep.(LinkableInterface); ok {
- // Handle non-CC modules here
- depPaths.StaticLibObjs.coverageFiles = append(depPaths.StaticLibObjs.coverageFiles,
- c.CoverageFiles()...)
- }
- }
-
- if ptr != nil {
- if !linkFile.Valid() {
- if !ctx.Config().AllowMissingDependencies() {
- ctx.ModuleErrorf("module %q missing output file", depName)
- } else {
- ctx.AddMissingDependencies([]string{depName})
- }
- return
- }
- *ptr = append(*ptr, linkFile.Path())
- }
-
- if depPtr != nil {
- dep := depFile
- if !dep.Valid() {
- dep = linkFile
- }
- *depPtr = append(*depPtr, dep.Path())
- }
-
- vendorSuffixModules := vendorSuffixModules(ctx.Config())
-
- baseLibName := func(depName string) string {
- libName := strings.TrimSuffix(depName, llndkLibrarySuffix)
- libName = strings.TrimSuffix(libName, vendorPublicLibrarySuffix)
- libName = strings.TrimPrefix(libName, "prebuilt_")
- return libName
- }
-
- makeLibName := func(depName string) string {
- libName := baseLibName(depName)
- isLLndk := isLlndkLibrary(libName, ctx.Config())
- isVendorPublicLib := inList(libName, *vendorPublicLibraries)
- bothVendorAndCoreVariantsExist := ccDep.HasVendorVariant() || isLLndk
-
- if c, ok := ccDep.(*Module); ok {
- // Use base module name for snapshots when exporting to Makefile.
- if c.isSnapshotPrebuilt() {
- baseName := c.BaseModuleName()
-
- if c.IsVndk() {
- return baseName + ".vendor"
+ depFile = ccDep.Toc()
+ case libDepTag.static():
+ if libDepTag.wholeStatic {
+ ptr = &depPaths.WholeStaticLibs
+ if !ccDep.CcLibraryInterface() || !ccDep.Static() {
+ ctx.ModuleErrorf("module %q not a static library", depName)
+ return
}
- if vendorSuffixModules[baseName] {
- return baseName + ".vendor"
+ // Because the static library objects are included, this only makes sense
+ // in the context of proper cc.Modules.
+ if ccWholeStaticLib, ok := ccDep.(*Module); ok {
+ staticLib := ccWholeStaticLib.linker.(libraryInterface)
+ if missingDeps := staticLib.getWholeStaticMissingDeps(); missingDeps != nil {
+ postfix := " (required by " + ctx.OtherModuleName(dep) + ")"
+ for i := range missingDeps {
+ missingDeps[i] += postfix
+ }
+ ctx.AddMissingDependencies(missingDeps)
+ }
+ if _, ok := ccWholeStaticLib.linker.(prebuiltLinkerInterface); ok {
+ depPaths.WholeStaticLibsFromPrebuilts = append(depPaths.WholeStaticLibsFromPrebuilts, linkFile.Path())
+ } else {
+ depPaths.WholeStaticLibObjs = depPaths.WholeStaticLibObjs.Append(staticLib.objs())
+ }
} else {
- return baseName
+ ctx.ModuleErrorf(
+ "non-cc.Modules cannot be included as whole static libraries.", depName)
+ return
+ }
+
+ } else {
+ switch libDepTag.Order {
+ case earlyLibraryDependency:
+ panic(fmt.Errorf("early static libs not suppported"))
+ case normalLibraryDependency:
+ // static dependencies will be handled separately so they can be ordered
+ // using transitive dependencies.
+ ptr = nil
+ directStaticDeps = append(directStaticDeps, ccDep)
+ case lateLibraryDependency:
+ ptr = &depPaths.LateStaticLibs
+ default:
+ panic(fmt.Errorf("unexpected library dependency order %d", libDepTag.Order))
}
}
}
- if ctx.DeviceConfig().VndkUseCoreVariant() && ccDep.IsVndk() && !ccDep.MustUseVendorVariant() && !c.InRamdisk() && !c.InRecovery() {
- // The vendor module is a no-vendor-variant VNDK library. Depend on the
- // core module instead.
- return libName
- } else if c.UseVndk() && bothVendorAndCoreVariantsExist {
- // The vendor module in Make will have been renamed to not conflict with the core
- // module, so update the dependency name here accordingly.
- return libName + c.getNameSuffixWithVndkVersion(ctx)
- } else if (ctx.Platform() || ctx.ProductSpecific()) && isVendorPublicLib {
- return libName + vendorPublicLibrarySuffix
- } else if ccDep.InRamdisk() && !ccDep.OnlyInRamdisk() {
- return libName + ramdiskSuffix
- } else if ccDep.InRecovery() && !ccDep.OnlyInRecovery() {
- return libName + recoverySuffix
- } else if ccDep.Module().Target().NativeBridge == android.NativeBridgeEnabled {
- return libName + nativeBridgeSuffix
- } else {
- return libName
- }
- }
+ if libDepTag.static() && !libDepTag.wholeStatic {
+ if !ccDep.CcLibraryInterface() || !ccDep.Static() {
+ ctx.ModuleErrorf("module %q not a static library", depName)
+ return
+ }
- // Export the shared libs to Make.
- switch depTag {
- case SharedDepTag, sharedExportDepTag, lateSharedDepTag, earlySharedDepTag:
- if ccDep.CcLibrary() {
- if ccDep.BuildStubs() && android.InAnyApex(depName) {
- // Add the dependency to the APEX(es) providing the library so that
- // m <module> can trigger building the APEXes as well.
- for _, an := range android.GetApexesForModule(depName) {
- c.Properties.ApexesProvidingSharedLibs = append(
- c.Properties.ApexesProvidingSharedLibs, an)
- }
+ // When combining coverage files for shared libraries and executables, coverage files
+ // in static libraries act as if they were whole static libraries. The same goes for
+ // source based Abi dump files.
+ if c, ok := ccDep.(*Module); ok {
+ staticLib := c.linker.(libraryInterface)
+ depPaths.StaticLibObjs.coverageFiles = append(depPaths.StaticLibObjs.coverageFiles,
+ staticLib.objs().coverageFiles...)
+ depPaths.StaticLibObjs.sAbiDumpFiles = append(depPaths.StaticLibObjs.sAbiDumpFiles,
+ staticLib.objs().sAbiDumpFiles...)
+ } else if c, ok := ccDep.(LinkableInterface); ok {
+ // Handle non-CC modules here
+ depPaths.StaticLibObjs.coverageFiles = append(depPaths.StaticLibObjs.coverageFiles,
+ c.CoverageFiles()...)
}
}
- // Note: the order of libs in this list is not important because
- // they merely serve as Make dependencies and do not affect this lib itself.
- c.Properties.AndroidMkSharedLibs = append(
- c.Properties.AndroidMkSharedLibs, makeLibName(depName))
- // Record baseLibName for snapshots.
- c.Properties.SnapshotSharedLibs = append(c.Properties.SnapshotSharedLibs, baseLibName(depName))
- case ndkStubDepTag, ndkLateStubDepTag:
- c.Properties.AndroidMkSharedLibs = append(
- c.Properties.AndroidMkSharedLibs,
- depName+"."+ccDep.ApiLevel())
- case StaticDepTag, staticExportDepTag, lateStaticDepTag:
- c.Properties.AndroidMkStaticLibs = append(
- c.Properties.AndroidMkStaticLibs, makeLibName(depName))
- case runtimeDepTag:
- c.Properties.AndroidMkRuntimeLibs = append(
- c.Properties.AndroidMkRuntimeLibs, makeLibName(depName))
- // Record baseLibName for snapshots.
- c.Properties.SnapshotRuntimeLibs = append(c.Properties.SnapshotRuntimeLibs, baseLibName(depName))
- case wholeStaticDepTag:
- c.Properties.AndroidMkWholeStaticLibs = append(
- c.Properties.AndroidMkWholeStaticLibs, makeLibName(depName))
- case headerDepTag:
- c.Properties.AndroidMkHeaderLibs = append(
- c.Properties.AndroidMkHeaderLibs, makeLibName(depName))
+ if ptr != nil {
+ if !linkFile.Valid() {
+ if !ctx.Config().AllowMissingDependencies() {
+ ctx.ModuleErrorf("module %q missing output file", depName)
+ } else {
+ ctx.AddMissingDependencies([]string{depName})
+ }
+ return
+ }
+ *ptr = append(*ptr, linkFile.Path())
+ }
+
+ if depPtr != nil {
+ dep := depFile
+ if !dep.Valid() {
+ dep = linkFile
+ }
+ *depPtr = append(*depPtr, dep.Path())
+ }
+
+ makeLibName := c.makeLibName(ctx, ccDep, depName) + libDepTag.makeSuffix
+ switch {
+ case libDepTag.header():
+ c.Properties.AndroidMkHeaderLibs = append(
+ c.Properties.AndroidMkHeaderLibs, makeLibName)
+ case libDepTag.shared():
+ if ccDep.CcLibrary() {
+ if ccDep.BuildStubs() && android.InAnyApex(depName) {
+ // Add the dependency to the APEX(es) providing the library so that
+ // m <module> can trigger building the APEXes as well.
+ for _, an := range android.GetApexesForModule(depName) {
+ c.Properties.ApexesProvidingSharedLibs = append(
+ c.Properties.ApexesProvidingSharedLibs, an)
+ }
+ }
+ }
+
+ // Note: the order of libs in this list is not important because
+ // they merely serve as Make dependencies and do not affect this lib itself.
+ c.Properties.AndroidMkSharedLibs = append(
+ c.Properties.AndroidMkSharedLibs, makeLibName)
+ // Record baseLibName for snapshots.
+ c.Properties.SnapshotSharedLibs = append(c.Properties.SnapshotSharedLibs, baseLibName(depName))
+ case libDepTag.static():
+ if libDepTag.wholeStatic {
+ c.Properties.AndroidMkWholeStaticLibs = append(
+ c.Properties.AndroidMkWholeStaticLibs, makeLibName)
+ } else {
+ c.Properties.AndroidMkStaticLibs = append(
+ c.Properties.AndroidMkStaticLibs, makeLibName)
+ }
+ }
+ } else {
+ switch depTag {
+ case runtimeDepTag:
+ c.Properties.AndroidMkRuntimeLibs = append(
+ c.Properties.AndroidMkRuntimeLibs, c.makeLibName(ctx, ccDep, depName)+libDepTag.makeSuffix)
+ // Record baseLibName for snapshots.
+ c.Properties.SnapshotRuntimeLibs = append(c.Properties.SnapshotRuntimeLibs, baseLibName(depName))
+ case objDepTag:
+ depPaths.Objs.objFiles = append(depPaths.Objs.objFiles, linkFile.Path())
+ case CrtBeginDepTag:
+ depPaths.CrtBegin = linkFile
+ case CrtEndDepTag:
+ depPaths.CrtEnd = linkFile
+ case dynamicLinkerDepTag:
+ depPaths.DynamicLinker = linkFile
+ }
}
})
@@ -2665,6 +2670,61 @@
return depPaths
}
+// baseLibName trims known prefixes and suffixes
+func baseLibName(depName string) string {
+ libName := strings.TrimSuffix(depName, llndkLibrarySuffix)
+ libName = strings.TrimSuffix(libName, vendorPublicLibrarySuffix)
+ libName = strings.TrimPrefix(libName, "prebuilt_")
+ return libName
+}
+
+func (c *Module) makeLibName(ctx android.ModuleContext, ccDep LinkableInterface, depName string) string {
+ vendorSuffixModules := vendorSuffixModules(ctx.Config())
+ vendorPublicLibraries := vendorPublicLibraries(ctx.Config())
+
+ libName := baseLibName(depName)
+ isLLndk := isLlndkLibrary(libName, ctx.Config())
+ isVendorPublicLib := inList(libName, *vendorPublicLibraries)
+ bothVendorAndCoreVariantsExist := ccDep.HasVendorVariant() || isLLndk
+
+ if c, ok := ccDep.(*Module); ok {
+ // Use base module name for snapshots when exporting to Makefile.
+ if c.isSnapshotPrebuilt() {
+ baseName := c.BaseModuleName()
+
+ if c.IsVndk() {
+ return baseName + ".vendor"
+ }
+
+ if vendorSuffixModules[baseName] {
+ return baseName + ".vendor"
+ } else {
+ return baseName
+ }
+ }
+ }
+
+ if ctx.DeviceConfig().VndkUseCoreVariant() && ccDep.IsVndk() && !ccDep.MustUseVendorVariant() && !c.InRamdisk() && !c.InRecovery() {
+ // The vendor module is a no-vendor-variant VNDK library. Depend on the
+ // core module instead.
+ return libName
+ } else if c.UseVndk() && bothVendorAndCoreVariantsExist {
+ // The vendor module in Make will have been renamed to not conflict with the core
+ // module, so update the dependency name here accordingly.
+ return libName + c.getNameSuffixWithVndkVersion(ctx)
+ } else if (ctx.Platform() || ctx.ProductSpecific()) && isVendorPublicLib {
+ return libName + vendorPublicLibrarySuffix
+ } else if ccDep.InRamdisk() && !ccDep.OnlyInRamdisk() {
+ return libName + ramdiskSuffix
+ } else if ccDep.InRecovery() && !ccDep.OnlyInRecovery() {
+ return libName + recoverySuffix
+ } else if ccDep.Module().Target().NativeBridge == android.NativeBridgeEnabled {
+ return libName + nativeBridgeSuffix
+ } else {
+ return libName
+ }
+}
+
func (c *Module) InstallInData() bool {
if c.installer == nil {
return false
@@ -2690,12 +2750,12 @@
return c.InRecovery()
}
-func (c *Module) SkipInstall() {
+func (c *Module) MakeUninstallable() {
if c.installer == nil {
- c.ModuleBase.SkipInstall()
+ c.ModuleBase.MakeUninstallable()
return
}
- c.installer.skipInstall(c)
+ c.installer.makeUninstallable(c)
}
func (c *Module) HostToolPath() android.OptionalPath {
@@ -2876,26 +2936,28 @@
}
func (c *Module) DepIsInSameApex(ctx android.BaseModuleContext, dep android.Module) bool {
- if depTag, ok := ctx.OtherModuleDependencyTag(dep).(DependencyTag); ok {
- if cc, ok := dep.(*Module); ok {
- if cc.HasStubsVariants() {
- if depTag.Shared && depTag.Library {
- // dynamic dep to a stubs lib crosses APEX boundary
- return false
- }
- if IsRuntimeDepTag(depTag) {
- // runtime dep to a stubs lib also crosses APEX boundary
- return false
- }
+ depTag := ctx.OtherModuleDependencyTag(dep)
+ libDepTag, isLibDepTag := depTag.(libraryDependencyTag)
+
+ if cc, ok := dep.(*Module); ok {
+ if cc.HasStubsVariants() {
+ if isLibDepTag && libDepTag.shared() {
+ // dynamic dep to a stubs lib crosses APEX boundary
+ return false
}
- if depTag.FromStatic {
- // shared_lib dependency from a static lib is considered as crossing
- // the APEX boundary because the dependency doesn't actually is
- // linked; the dependency is used only during the compilation phase.
+ if IsRuntimeDepTag(depTag) {
+ // runtime dep to a stubs lib also crosses APEX boundary
return false
}
}
- } else if ctx.OtherModuleDependencyTag(dep) == llndkImplDep {
+ if isLibDepTag && c.static() && libDepTag.shared() {
+ // shared_lib dependency from a static lib is considered as crossing
+ // the APEX boundary because the dependency doesn't actually is
+ // linked; the dependency is used only during the compilation phase.
+ return false
+ }
+ }
+ if depTag == llndkImplDep {
// We don't track beyond LLNDK
return false
}
@@ -3031,238 +3093,8 @@
}
}
-var _ android.ImageInterface = (*Module)(nil)
-
-func (m *Module) ImageMutatorBegin(mctx android.BaseModuleContext) {
- // Validation check
- vendorSpecific := mctx.SocSpecific() || mctx.DeviceSpecific()
- productSpecific := mctx.ProductSpecific()
-
- if m.VendorProperties.Vendor_available != nil && vendorSpecific {
- mctx.PropertyErrorf("vendor_available",
- "doesn't make sense at the same time as `vendor: true`, `proprietary: true`, or `device_specific:true`")
- }
-
- if vndkdep := m.vndkdep; vndkdep != nil {
- if vndkdep.isVndk() {
- if vendorSpecific || productSpecific {
- if !vndkdep.isVndkExt() {
- mctx.PropertyErrorf("vndk",
- "must set `extends: \"...\"` to vndk extension")
- } else if m.VendorProperties.Vendor_available != nil {
- mctx.PropertyErrorf("vendor_available",
- "must not set at the same time as `vndk: {extends: \"...\"}`")
- }
- } else {
- if vndkdep.isVndkExt() {
- mctx.PropertyErrorf("vndk",
- "must set `vendor: true` or `product_specific: true` to set `extends: %q`",
- m.getVndkExtendsModuleName())
- }
- if m.VendorProperties.Vendor_available == nil {
- mctx.PropertyErrorf("vndk",
- "vendor_available must be set to either true or false when `vndk: {enabled: true}`")
- }
- }
- } else {
- if vndkdep.isVndkSp() {
- mctx.PropertyErrorf("vndk",
- "must set `enabled: true` to set `support_system_process: true`")
- }
- if vndkdep.isVndkExt() {
- mctx.PropertyErrorf("vndk",
- "must set `enabled: true` to set `extends: %q`",
- m.getVndkExtendsModuleName())
- }
- }
- }
-
- var coreVariantNeeded bool = false
- var ramdiskVariantNeeded bool = false
- var recoveryVariantNeeded bool = false
-
- var vendorVariants []string
- var productVariants []string
-
- platformVndkVersion := mctx.DeviceConfig().PlatformVndkVersion()
- boardVndkVersion := mctx.DeviceConfig().VndkVersion()
- productVndkVersion := mctx.DeviceConfig().ProductVndkVersion()
- if boardVndkVersion == "current" {
- boardVndkVersion = platformVndkVersion
- }
- if productVndkVersion == "current" {
- productVndkVersion = platformVndkVersion
- }
-
- if boardVndkVersion == "" {
- // If the device isn't compiling against the VNDK, we always
- // use the core mode.
- coreVariantNeeded = true
- } else if _, ok := m.linker.(*llndkStubDecorator); ok {
- // LL-NDK stubs only exist in the vendor and product variants,
- // since the real libraries will be used in the core variant.
- vendorVariants = append(vendorVariants,
- platformVndkVersion,
- boardVndkVersion,
- )
- productVariants = append(productVariants,
- platformVndkVersion,
- productVndkVersion,
- )
- } else if _, ok := m.linker.(*llndkHeadersDecorator); ok {
- // ... and LL-NDK headers as well
- vendorVariants = append(vendorVariants,
- platformVndkVersion,
- boardVndkVersion,
- )
- productVariants = append(productVariants,
- platformVndkVersion,
- productVndkVersion,
- )
- } else if m.isSnapshotPrebuilt() {
- // Make vendor variants only for the versions in BOARD_VNDK_VERSION and
- // PRODUCT_EXTRA_VNDK_VERSIONS.
- if snapshot, ok := m.linker.(interface {
- version() string
- }); ok {
- vendorVariants = append(vendorVariants, snapshot.version())
- } else {
- mctx.ModuleErrorf("version is unknown for snapshot prebuilt")
- }
- } else if m.HasVendorVariant() && !m.isVndkExt() {
- // This will be available in /system, /vendor and /product
- // or a /system directory that is available to vendor and product.
- coreVariantNeeded = true
-
- // We assume that modules under proprietary paths are compatible for
- // BOARD_VNDK_VERSION. The other modules are regarded as AOSP, or
- // PLATFORM_VNDK_VERSION.
- if isVendorProprietaryPath(mctx.ModuleDir()) {
- vendorVariants = append(vendorVariants, boardVndkVersion)
- } else {
- vendorVariants = append(vendorVariants, platformVndkVersion)
- }
-
- // vendor_available modules are also available to /product.
- productVariants = append(productVariants, platformVndkVersion)
- // VNDK is always PLATFORM_VNDK_VERSION
- if !m.IsVndk() {
- productVariants = append(productVariants, productVndkVersion)
- }
- } else if vendorSpecific && String(m.Properties.Sdk_version) == "" {
- // This will be available in /vendor (or /odm) only
-
- // kernel_headers is a special module type whose exported headers
- // are coming from DeviceKernelHeaders() which is always vendor
- // dependent. They'll always have both vendor variants.
- // For other modules, we assume that modules under proprietary
- // paths are compatible for BOARD_VNDK_VERSION. The other modules
- // are regarded as AOSP, which is PLATFORM_VNDK_VERSION.
- if _, ok := m.linker.(*kernelHeadersDecorator); ok {
- vendorVariants = append(vendorVariants,
- platformVndkVersion,
- boardVndkVersion,
- )
- } else if isVendorProprietaryPath(mctx.ModuleDir()) {
- vendorVariants = append(vendorVariants, boardVndkVersion)
- } else {
- vendorVariants = append(vendorVariants, platformVndkVersion)
- }
- } else {
- // This is either in /system (or similar: /data), or is a
- // modules built with the NDK. Modules built with the NDK
- // will be restricted using the existing link type checks.
- coreVariantNeeded = true
- }
-
- if boardVndkVersion != "" && productVndkVersion != "" {
- if coreVariantNeeded && productSpecific && String(m.Properties.Sdk_version) == "" {
- // The module has "product_specific: true" that does not create core variant.
- coreVariantNeeded = false
- productVariants = append(productVariants, productVndkVersion)
- }
- } else {
- // Unless PRODUCT_PRODUCT_VNDK_VERSION is set, product partition has no
- // restriction to use system libs.
- // No product variants defined in this case.
- productVariants = []string{}
- }
-
- if Bool(m.Properties.Ramdisk_available) {
- ramdiskVariantNeeded = true
- }
-
- if m.ModuleBase.InstallInRamdisk() {
- ramdiskVariantNeeded = true
- coreVariantNeeded = false
- }
-
- if Bool(m.Properties.Recovery_available) {
- recoveryVariantNeeded = true
- }
-
- if m.ModuleBase.InstallInRecovery() {
- recoveryVariantNeeded = true
- coreVariantNeeded = false
- }
-
- for _, variant := range android.FirstUniqueStrings(vendorVariants) {
- m.Properties.ExtraVariants = append(m.Properties.ExtraVariants, VendorVariationPrefix+variant)
- }
-
- for _, variant := range android.FirstUniqueStrings(productVariants) {
- m.Properties.ExtraVariants = append(m.Properties.ExtraVariants, ProductVariationPrefix+variant)
- }
-
- m.Properties.RamdiskVariantNeeded = ramdiskVariantNeeded
- m.Properties.RecoveryVariantNeeded = recoveryVariantNeeded
- m.Properties.CoreVariantNeeded = coreVariantNeeded
-}
-
-func (c *Module) CoreVariantNeeded(ctx android.BaseModuleContext) bool {
- return c.Properties.CoreVariantNeeded
-}
-
-func (c *Module) RamdiskVariantNeeded(ctx android.BaseModuleContext) bool {
- return c.Properties.RamdiskVariantNeeded
-}
-
-func (c *Module) RecoveryVariantNeeded(ctx android.BaseModuleContext) bool {
- return c.Properties.RecoveryVariantNeeded
-}
-
-func (c *Module) ExtraImageVariations(ctx android.BaseModuleContext) []string {
- return c.Properties.ExtraVariants
-}
-
-func (c *Module) SetImageVariation(ctx android.BaseModuleContext, variant string, module android.Module) {
- m := module.(*Module)
- if variant == android.RamdiskVariation {
- m.MakeAsPlatform()
- } else if variant == android.RecoveryVariation {
- m.MakeAsPlatform()
- squashRecoverySrcs(m)
- } else if strings.HasPrefix(variant, VendorVariationPrefix) {
- m.Properties.ImageVariationPrefix = VendorVariationPrefix
- m.Properties.VndkVersion = strings.TrimPrefix(variant, VendorVariationPrefix)
- squashVendorSrcs(m)
-
- // Makefile shouldn't know vendor modules other than BOARD_VNDK_VERSION.
- // Hide other vendor variants to avoid collision.
- vndkVersion := ctx.DeviceConfig().VndkVersion()
- if vndkVersion != "current" && vndkVersion != "" && vndkVersion != m.Properties.VndkVersion {
- m.Properties.HideFromMake = true
- m.SkipInstall()
- }
- } else if strings.HasPrefix(variant, ProductVariationPrefix) {
- m.Properties.ImageVariationPrefix = ProductVariationPrefix
- m.Properties.VndkVersion = strings.TrimPrefix(variant, ProductVariationPrefix)
- squashVendorSrcs(m)
- }
-}
-
func (c *Module) IsSdkVariant() bool {
- return c.Properties.IsSdkVariant
+ return c.Properties.IsSdkVariant || c.AlwaysSdk()
}
func getCurrentNdkPrebuiltVersion(ctx DepsContext) string {
diff --git a/cc/cc_test.go b/cc/cc_test.go
index 38a5c2d..77b5c52 100644
--- a/cc/cc_test.go
+++ b/cc/cc_test.go
@@ -1013,17 +1013,25 @@
filepath.Join(sharedDir, "libvendor_available.so.json"))
// For static libraries, all vendor:true and vendor_available modules (including VNDK) are captured.
+ // Also cfi variants are captured, except for prebuilts like toolchain_library
staticVariant := fmt.Sprintf("android_vendor.VER_%s_%s_static", archType, archVariant)
+ staticCfiVariant := fmt.Sprintf("android_vendor.VER_%s_%s_static_cfi", archType, archVariant)
staticDir := filepath.Join(snapshotVariantPath, archDir, "static")
checkSnapshot(t, ctx, snapshotSingleton, "libb", "libb.a", staticDir, staticVariant)
checkSnapshot(t, ctx, snapshotSingleton, "libvndk", "libvndk.a", staticDir, staticVariant)
+ checkSnapshot(t, ctx, snapshotSingleton, "libvndk", "libvndk.cfi.a", staticDir, staticCfiVariant)
checkSnapshot(t, ctx, snapshotSingleton, "libvendor", "libvendor.a", staticDir, staticVariant)
+ checkSnapshot(t, ctx, snapshotSingleton, "libvendor", "libvendor.cfi.a", staticDir, staticCfiVariant)
checkSnapshot(t, ctx, snapshotSingleton, "libvendor_available", "libvendor_available.a", staticDir, staticVariant)
+ checkSnapshot(t, ctx, snapshotSingleton, "libvendor_available", "libvendor_available.cfi.a", staticDir, staticCfiVariant)
jsonFiles = append(jsonFiles,
filepath.Join(staticDir, "libb.a.json"),
filepath.Join(staticDir, "libvndk.a.json"),
+ filepath.Join(staticDir, "libvndk.cfi.a.json"),
filepath.Join(staticDir, "libvendor.a.json"),
- filepath.Join(staticDir, "libvendor_available.a.json"))
+ filepath.Join(staticDir, "libvendor.cfi.a.json"),
+ filepath.Join(staticDir, "libvendor_available.a.json"),
+ filepath.Join(staticDir, "libvendor_available.cfi.a.json"))
// For binary executables, all vendor:true and vendor_available modules are captured.
if archType == "arm64" {
@@ -1055,6 +1063,39 @@
}
}
+func TestVendorSnapshotSanitizer(t *testing.T) {
+ bp := `
+ vendor_snapshot_static {
+ name: "libsnapshot",
+ vendor: true,
+ target_arch: "arm64",
+ version: "BOARD",
+ arch: {
+ arm64: {
+ src: "libsnapshot.a",
+ cfi: {
+ src: "libsnapshot.cfi.a",
+ }
+ },
+ },
+ }
+`
+ config := TestConfig(buildDir, android.Android, nil, bp, nil)
+ config.TestProductVariables.DeviceVndkVersion = StringPtr("BOARD")
+ config.TestProductVariables.Platform_vndk_version = StringPtr("VER")
+ ctx := testCcWithConfig(t, config)
+
+ // Check non-cfi and cfi variant.
+ staticVariant := "android_vendor.BOARD_arm64_armv8-a_static"
+ staticCfiVariant := "android_vendor.BOARD_arm64_armv8-a_static_cfi"
+
+ staticModule := ctx.ModuleForTests("libsnapshot.vendor_static.BOARD.arm64", staticVariant).Module().(*Module)
+ assertString(t, staticModule.outputFile.Path().Base(), "libsnapshot.a")
+
+ staticCfiModule := ctx.ModuleForTests("libsnapshot.vendor_static.BOARD.arm64", staticCfiVariant).Module().(*Module)
+ assertString(t, staticCfiModule.outputFile.Path().Base(), "libsnapshot.cfi.a")
+}
+
func TestDoubleLoadableDepError(t *testing.T) {
// Check whether an error is emitted when a LLNDK depends on a non-double_loadable VNDK lib.
testCcError(t, "module \".*\" variant \".*\": link.* \".*\" which is not LL-NDK, VNDK-SP, .*double_loadable", `
diff --git a/cc/compiler.go b/cc/compiler.go
index d5ea2c3..d0b5b46 100644
--- a/cc/compiler.go
+++ b/cc/compiler.go
@@ -565,7 +565,7 @@
var gnuToCReplacer = strings.NewReplacer("gnu", "c")
func ndkPathDeps(ctx ModuleContext) android.Paths {
- if ctx.useSdk() {
+ if ctx.Module().(*Module).IsSdkVariant() {
// The NDK sysroot timestamp file depends on all the NDK sysroot files
// (headers and libraries).
return android.Paths{getNdkBaseTimestampFile(ctx)}
diff --git a/cc/config/global.go b/cc/config/global.go
index 373fc77..32f163d 100644
--- a/cc/config/global.go
+++ b/cc/config/global.go
@@ -261,7 +261,9 @@
pctx.VariableFunc("RECXXPool", remoteexec.EnvOverrideFunc("RBE_CXX_POOL", remoteexec.DefaultPool))
pctx.VariableFunc("RECXXLinksPool", remoteexec.EnvOverrideFunc("RBE_CXX_LINKS_POOL", remoteexec.DefaultPool))
+ pctx.VariableFunc("REClangTidyPool", remoteexec.EnvOverrideFunc("RBE_CLANG_TIDY_POOL", remoteexec.DefaultPool))
pctx.VariableFunc("RECXXLinksExecStrategy", remoteexec.EnvOverrideFunc("RBE_CXX_LINKS_EXEC_STRATEGY", remoteexec.LocalExecStrategy))
+ pctx.VariableFunc("REClangTidyExecStrategy", remoteexec.EnvOverrideFunc("RBE_CLANG_TIDY_EXEC_STRATEGY", remoteexec.LocalExecStrategy))
pctx.VariableFunc("REAbiDumperExecStrategy", remoteexec.EnvOverrideFunc("RBE_ABI_DUMPER_EXEC_STRATEGY", remoteexec.LocalExecStrategy))
pctx.VariableFunc("REAbiLinkerExecStrategy", remoteexec.EnvOverrideFunc("RBE_ABI_LINKER_EXEC_STRATEGY", remoteexec.LocalExecStrategy))
}
diff --git a/cc/coverage.go b/cc/coverage.go
index c823324..aa1fdf6 100644
--- a/cc/coverage.go
+++ b/cc/coverage.go
@@ -22,6 +22,8 @@
"android/soong/android"
)
+const profileInstrFlag = "-fprofile-instr-generate=/data/misc/trace/clang-%p-%m.profraw"
+
type CoverageProperties struct {
Native_coverage *bool
@@ -92,7 +94,7 @@
// flags that the module may use.
flags.Local.CFlags = append(flags.Local.CFlags, "-Wno-frame-larger-than=", "-O0")
} else if clangCoverage {
- flags.Local.CommonFlags = append(flags.Local.CommonFlags, "-fprofile-instr-generate", "-fcoverage-mapping", "-Wno-pass-failed")
+ flags.Local.CommonFlags = append(flags.Local.CommonFlags, profileInstrFlag, "-fcoverage-mapping", "-Wno-pass-failed")
}
}
@@ -103,10 +105,14 @@
// For static libraries, the only thing that changes our object files
// are included whole static libraries, so check to see if any of
// those have coverage enabled.
- ctx.VisitDirectDepsWithTag(wholeStaticDepTag, func(m android.Module) {
- if cc, ok := m.(*Module); ok && cc.coverage != nil {
- if cc.coverage.linkCoverage {
- cov.linkCoverage = true
+ ctx.VisitDirectDeps(func(m android.Module) {
+ if depTag, ok := ctx.OtherModuleDependencyTag(m).(libraryDependencyTag); ok {
+ if depTag.static() && depTag.wholeStatic {
+ if cc, ok := m.(*Module); ok && cc.coverage != nil {
+ if cc.coverage.linkCoverage {
+ cov.linkCoverage = true
+ }
+ }
}
}
})
@@ -139,7 +145,7 @@
flags.Local.LdFlags = append(flags.Local.LdFlags, "-Wl,--wrap,getenv")
} else if clangCoverage {
- flags.Local.LdFlags = append(flags.Local.LdFlags, "-fprofile-instr-generate")
+ flags.Local.LdFlags = append(flags.Local.LdFlags, profileInstrFlag)
coverage := ctx.GetDirectDepWithTag(getClangProfileLibraryName(ctx), CoverageDepTag).(*Module)
deps.WholeStaticLibs = append(deps.WholeStaticLibs, coverage.OutputFile().Path())
diff --git a/cc/genrule_test.go b/cc/genrule_test.go
index d38cf27..a366f76 100644
--- a/cc/genrule_test.go
+++ b/cc/genrule_test.go
@@ -76,3 +76,42 @@
t.Errorf(`want arm64 inputs %v, got %v`, expected, gen.Inputs.Strings())
}
}
+
+func TestLibraryGenruleCmd(t *testing.T) {
+ bp := `
+ cc_library {
+ name: "libboth",
+ }
+
+ cc_library_shared {
+ name: "libshared",
+ }
+
+ cc_library_static {
+ name: "libstatic",
+ }
+
+ cc_genrule {
+ name: "gen",
+ tool_files: ["tool"],
+ srcs: [
+ ":libboth",
+ ":libshared",
+ ":libstatic",
+ ],
+ cmd: "$(location tool) $(in) $(out)",
+ out: ["out"],
+ }
+ `
+ ctx := testCc(t, bp)
+
+ gen := ctx.ModuleForTests("gen", "android_arm_armv7-a-neon").Output("out")
+ expected := []string{"libboth.so", "libshared.so", "libstatic.a"}
+ var got []string
+ for _, input := range gen.Inputs {
+ got = append(got, input.Base())
+ }
+ if !reflect.DeepEqual(expected, got) {
+ t.Errorf(`want inputs %v, got %v`, expected, got)
+ }
+}
diff --git a/cc/image.go b/cc/image.go
new file mode 100644
index 0000000..4daed7c
--- /dev/null
+++ b/cc/image.go
@@ -0,0 +1,348 @@
+// Copyright 2020 The Android Open Source Project
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+package cc
+
+// This file contains image variant related things, including image mutator functions, utility
+// functions to determine where a module is installed, etc.
+
+import (
+ "strings"
+
+ "android/soong/android"
+)
+
+var _ android.ImageInterface = (*Module)(nil)
+
+type imageVariantType string
+
+const (
+ coreImageVariant imageVariantType = "core"
+ vendorImageVariant imageVariantType = "vendor"
+ productImageVariant imageVariantType = "product"
+ ramdiskImageVariant imageVariantType = "ramdisk"
+ recoveryImageVariant imageVariantType = "recovery"
+ hostImageVariant imageVariantType = "host"
+)
+
+func (c *Module) getImageVariantType() imageVariantType {
+ if c.Host() {
+ return hostImageVariant
+ } else if c.inVendor() {
+ return vendorImageVariant
+ } else if c.inProduct() {
+ return productImageVariant
+ } else if c.InRamdisk() {
+ return ramdiskImageVariant
+ } else if c.InRecovery() {
+ return recoveryImageVariant
+ } else {
+ return coreImageVariant
+ }
+}
+
+const (
+ // VendorVariationPrefix is the variant prefix used for /vendor code that compiles
+ // against the VNDK.
+ VendorVariationPrefix = "vendor."
+
+ // ProductVariationPrefix is the variant prefix used for /product code that compiles
+ // against the VNDK.
+ ProductVariationPrefix = "product."
+)
+
+func (ctx *moduleContext) ProductSpecific() bool {
+ return ctx.ModuleContext.ProductSpecific() ||
+ (ctx.mod.HasVendorVariant() && ctx.mod.inProduct() && !ctx.mod.IsVndk())
+}
+
+func (ctx *moduleContext) SocSpecific() bool {
+ return ctx.ModuleContext.SocSpecific() ||
+ (ctx.mod.HasVendorVariant() && ctx.mod.inVendor() && !ctx.mod.IsVndk())
+}
+
+func (ctx *moduleContextImpl) inProduct() bool {
+ return ctx.mod.inProduct()
+}
+
+func (ctx *moduleContextImpl) inVendor() bool {
+ return ctx.mod.inVendor()
+}
+
+func (ctx *moduleContextImpl) inRamdisk() bool {
+ return ctx.mod.InRamdisk()
+}
+
+func (ctx *moduleContextImpl) inRecovery() bool {
+ return ctx.mod.InRecovery()
+}
+
+// Returns true only when this module is configured to have core, product and vendor
+// variants.
+func (c *Module) HasVendorVariant() bool {
+ return c.IsVndk() || Bool(c.VendorProperties.Vendor_available)
+}
+
+// Returns true if the module is "product" variant. Usually these modules are installed in /product
+func (c *Module) inProduct() bool {
+ return c.Properties.ImageVariationPrefix == ProductVariationPrefix
+}
+
+// Returns true if the module is "vendor" variant. Usually these modules are installed in /vendor
+func (c *Module) inVendor() bool {
+ return c.Properties.ImageVariationPrefix == VendorVariationPrefix
+}
+
+func (c *Module) InRamdisk() bool {
+ return c.ModuleBase.InRamdisk() || c.ModuleBase.InstallInRamdisk()
+}
+
+func (c *Module) InRecovery() bool {
+ return c.ModuleBase.InRecovery() || c.ModuleBase.InstallInRecovery()
+}
+
+func (c *Module) OnlyInRamdisk() bool {
+ return c.ModuleBase.InstallInRamdisk()
+}
+
+func (c *Module) OnlyInRecovery() bool {
+ return c.ModuleBase.InstallInRecovery()
+}
+
+func (m *Module) ImageMutatorBegin(mctx android.BaseModuleContext) {
+ // Validation check
+ vendorSpecific := mctx.SocSpecific() || mctx.DeviceSpecific()
+ productSpecific := mctx.ProductSpecific()
+
+ if m.VendorProperties.Vendor_available != nil && vendorSpecific {
+ mctx.PropertyErrorf("vendor_available",
+ "doesn't make sense at the same time as `vendor: true`, `proprietary: true`, or `device_specific:true`")
+ }
+
+ if vndkdep := m.vndkdep; vndkdep != nil {
+ if vndkdep.isVndk() {
+ if vendorSpecific || productSpecific {
+ if !vndkdep.isVndkExt() {
+ mctx.PropertyErrorf("vndk",
+ "must set `extends: \"...\"` to vndk extension")
+ } else if m.VendorProperties.Vendor_available != nil {
+ mctx.PropertyErrorf("vendor_available",
+ "must not set at the same time as `vndk: {extends: \"...\"}`")
+ }
+ } else {
+ if vndkdep.isVndkExt() {
+ mctx.PropertyErrorf("vndk",
+ "must set `vendor: true` or `product_specific: true` to set `extends: %q`",
+ m.getVndkExtendsModuleName())
+ }
+ if m.VendorProperties.Vendor_available == nil {
+ mctx.PropertyErrorf("vndk",
+ "vendor_available must be set to either true or false when `vndk: {enabled: true}`")
+ }
+ }
+ } else {
+ if vndkdep.isVndkSp() {
+ mctx.PropertyErrorf("vndk",
+ "must set `enabled: true` to set `support_system_process: true`")
+ }
+ if vndkdep.isVndkExt() {
+ mctx.PropertyErrorf("vndk",
+ "must set `enabled: true` to set `extends: %q`",
+ m.getVndkExtendsModuleName())
+ }
+ }
+ }
+
+ var coreVariantNeeded bool = false
+ var ramdiskVariantNeeded bool = false
+ var recoveryVariantNeeded bool = false
+
+ var vendorVariants []string
+ var productVariants []string
+
+ platformVndkVersion := mctx.DeviceConfig().PlatformVndkVersion()
+ boardVndkVersion := mctx.DeviceConfig().VndkVersion()
+ productVndkVersion := mctx.DeviceConfig().ProductVndkVersion()
+ if boardVndkVersion == "current" {
+ boardVndkVersion = platformVndkVersion
+ }
+ if productVndkVersion == "current" {
+ productVndkVersion = platformVndkVersion
+ }
+
+ if boardVndkVersion == "" {
+ // If the device isn't compiling against the VNDK, we always
+ // use the core mode.
+ coreVariantNeeded = true
+ } else if _, ok := m.linker.(*llndkStubDecorator); ok {
+ // LL-NDK stubs only exist in the vendor and product variants,
+ // since the real libraries will be used in the core variant.
+ vendorVariants = append(vendorVariants,
+ platformVndkVersion,
+ boardVndkVersion,
+ )
+ productVariants = append(productVariants,
+ platformVndkVersion,
+ productVndkVersion,
+ )
+ } else if _, ok := m.linker.(*llndkHeadersDecorator); ok {
+ // ... and LL-NDK headers as well
+ vendorVariants = append(vendorVariants,
+ platformVndkVersion,
+ boardVndkVersion,
+ )
+ productVariants = append(productVariants,
+ platformVndkVersion,
+ productVndkVersion,
+ )
+ } else if m.isSnapshotPrebuilt() {
+ // Make vendor variants only for the versions in BOARD_VNDK_VERSION and
+ // PRODUCT_EXTRA_VNDK_VERSIONS.
+ if snapshot, ok := m.linker.(interface {
+ version() string
+ }); ok {
+ vendorVariants = append(vendorVariants, snapshot.version())
+ } else {
+ mctx.ModuleErrorf("version is unknown for snapshot prebuilt")
+ }
+ } else if m.HasVendorVariant() && !m.isVndkExt() {
+ // This will be available in /system, /vendor and /product
+ // or a /system directory that is available to vendor and product.
+ coreVariantNeeded = true
+
+ // We assume that modules under proprietary paths are compatible for
+ // BOARD_VNDK_VERSION. The other modules are regarded as AOSP, or
+ // PLATFORM_VNDK_VERSION.
+ if isVendorProprietaryPath(mctx.ModuleDir()) {
+ vendorVariants = append(vendorVariants, boardVndkVersion)
+ } else {
+ vendorVariants = append(vendorVariants, platformVndkVersion)
+ }
+
+ // vendor_available modules are also available to /product.
+ productVariants = append(productVariants, platformVndkVersion)
+ // VNDK is always PLATFORM_VNDK_VERSION
+ if !m.IsVndk() {
+ productVariants = append(productVariants, productVndkVersion)
+ }
+ } else if vendorSpecific && String(m.Properties.Sdk_version) == "" {
+ // This will be available in /vendor (or /odm) only
+
+ // kernel_headers is a special module type whose exported headers
+ // are coming from DeviceKernelHeaders() which is always vendor
+ // dependent. They'll always have both vendor variants.
+ // For other modules, we assume that modules under proprietary
+ // paths are compatible for BOARD_VNDK_VERSION. The other modules
+ // are regarded as AOSP, which is PLATFORM_VNDK_VERSION.
+ if _, ok := m.linker.(*kernelHeadersDecorator); ok {
+ vendorVariants = append(vendorVariants,
+ platformVndkVersion,
+ boardVndkVersion,
+ )
+ } else if isVendorProprietaryPath(mctx.ModuleDir()) {
+ vendorVariants = append(vendorVariants, boardVndkVersion)
+ } else {
+ vendorVariants = append(vendorVariants, platformVndkVersion)
+ }
+ } else {
+ // This is either in /system (or similar: /data), or is a
+ // modules built with the NDK. Modules built with the NDK
+ // will be restricted using the existing link type checks.
+ coreVariantNeeded = true
+ }
+
+ if boardVndkVersion != "" && productVndkVersion != "" {
+ if coreVariantNeeded && productSpecific && String(m.Properties.Sdk_version) == "" {
+ // The module has "product_specific: true" that does not create core variant.
+ coreVariantNeeded = false
+ productVariants = append(productVariants, productVndkVersion)
+ }
+ } else {
+ // Unless PRODUCT_PRODUCT_VNDK_VERSION is set, product partition has no
+ // restriction to use system libs.
+ // No product variants defined in this case.
+ productVariants = []string{}
+ }
+
+ if Bool(m.Properties.Ramdisk_available) {
+ ramdiskVariantNeeded = true
+ }
+
+ if m.ModuleBase.InstallInRamdisk() {
+ ramdiskVariantNeeded = true
+ coreVariantNeeded = false
+ }
+
+ if Bool(m.Properties.Recovery_available) {
+ recoveryVariantNeeded = true
+ }
+
+ if m.ModuleBase.InstallInRecovery() {
+ recoveryVariantNeeded = true
+ coreVariantNeeded = false
+ }
+
+ for _, variant := range android.FirstUniqueStrings(vendorVariants) {
+ m.Properties.ExtraVariants = append(m.Properties.ExtraVariants, VendorVariationPrefix+variant)
+ }
+
+ for _, variant := range android.FirstUniqueStrings(productVariants) {
+ m.Properties.ExtraVariants = append(m.Properties.ExtraVariants, ProductVariationPrefix+variant)
+ }
+
+ m.Properties.RamdiskVariantNeeded = ramdiskVariantNeeded
+ m.Properties.RecoveryVariantNeeded = recoveryVariantNeeded
+ m.Properties.CoreVariantNeeded = coreVariantNeeded
+}
+
+func (c *Module) CoreVariantNeeded(ctx android.BaseModuleContext) bool {
+ return c.Properties.CoreVariantNeeded
+}
+
+func (c *Module) RamdiskVariantNeeded(ctx android.BaseModuleContext) bool {
+ return c.Properties.RamdiskVariantNeeded
+}
+
+func (c *Module) RecoveryVariantNeeded(ctx android.BaseModuleContext) bool {
+ return c.Properties.RecoveryVariantNeeded
+}
+
+func (c *Module) ExtraImageVariations(ctx android.BaseModuleContext) []string {
+ return c.Properties.ExtraVariants
+}
+
+func (c *Module) SetImageVariation(ctx android.BaseModuleContext, variant string, module android.Module) {
+ m := module.(*Module)
+ if variant == android.RamdiskVariation {
+ m.MakeAsPlatform()
+ } else if variant == android.RecoveryVariation {
+ m.MakeAsPlatform()
+ squashRecoverySrcs(m)
+ } else if strings.HasPrefix(variant, VendorVariationPrefix) {
+ m.Properties.ImageVariationPrefix = VendorVariationPrefix
+ m.Properties.VndkVersion = strings.TrimPrefix(variant, VendorVariationPrefix)
+ squashVendorSrcs(m)
+
+ // Makefile shouldn't know vendor modules other than BOARD_VNDK_VERSION.
+ // Hide other vendor variants to avoid collision.
+ vndkVersion := ctx.DeviceConfig().VndkVersion()
+ if vndkVersion != "current" && vndkVersion != "" && vndkVersion != m.Properties.VndkVersion {
+ m.Properties.HideFromMake = true
+ m.SkipInstall()
+ }
+ } else if strings.HasPrefix(variant, ProductVariationPrefix) {
+ m.Properties.ImageVariationPrefix = ProductVariationPrefix
+ m.Properties.VndkVersion = strings.TrimPrefix(variant, ProductVariationPrefix)
+ squashVendorSrcs(m)
+ }
+}
diff --git a/cc/installer.go b/cc/installer.go
index 0b4a68c..e551c63 100644
--- a/cc/installer.go
+++ b/cc/installer.go
@@ -107,6 +107,6 @@
return String(installer.Properties.Relative_install_path)
}
-func (installer *baseInstaller) skipInstall(mod *Module) {
- mod.ModuleBase.SkipInstall()
+func (installer *baseInstaller) makeUninstallable(mod *Module) {
+ mod.ModuleBase.MakeUninstallable()
}
diff --git a/cc/library.go b/cc/library.go
index 98f4d48..1c2b1ee 100644
--- a/cc/library.go
+++ b/cc/library.go
@@ -28,7 +28,6 @@
"android/soong/android"
"android/soong/cc/config"
- "android/soong/genrule"
)
type LibraryProperties struct {
@@ -801,21 +800,8 @@
deps.ReexportStaticLibHeaders = append(deps.ReexportStaticLibHeaders, library.StaticProperties.Static.Export_static_lib_headers...)
} else if library.shared() {
if ctx.toolchain().Bionic() && !Bool(library.baseLinker.Properties.Nocrt) {
- if !ctx.useSdk() {
- deps.CrtBegin = "crtbegin_so"
- deps.CrtEnd = "crtend_so"
- } else {
- // TODO(danalbert): Add generation of crt objects.
- // For `sdk_version: "current"`, we don't actually have a
- // freshly generated set of CRT objects. Use the last stable
- // version.
- version := ctx.sdkVersion()
- if version == "current" {
- version = getCurrentNdkPrebuiltVersion(ctx)
- }
- deps.CrtBegin = "ndk_crtbegin_so." + version
- deps.CrtEnd = "ndk_crtend_so." + version
- }
+ deps.CrtBegin = "crtbegin_so"
+ deps.CrtEnd = "crtend_so"
}
deps.WholeStaticLibs = append(deps.WholeStaticLibs, library.SharedProperties.Shared.Whole_static_libs...)
deps.StaticLibs = append(deps.StaticLibs, library.SharedProperties.Shared.Static_libs...)
@@ -1365,16 +1351,15 @@
return android.CheckAvailableForApex(what, list)
}
-func (library *libraryDecorator) skipInstall(mod *Module) {
+func (library *libraryDecorator) makeUninstallable(mod *Module) {
if library.static() && library.buildStatic() && !library.buildStubs() {
- // If we're asked to skip installation of a static library (in particular
- // when it's not //apex_available:platform) we still want an AndroidMk entry
- // for it to ensure we get the relevant NOTICE file targets (cf.
- // notice_files.mk) that other libraries might depend on. AndroidMkEntries
- // always sets LOCAL_UNINSTALLABLE_MODULE for these entries.
+ // If we're asked to make a static library uninstallable we don't do
+ // anything since AndroidMkEntries always sets LOCAL_UNINSTALLABLE_MODULE
+ // for these entries. This is done to still get the make targets for NOTICE
+ // files from notice_files.mk, which other libraries might depend on.
return
}
- mod.ModuleBase.SkipInstall()
+ mod.ModuleBase.MakeUninstallable()
}
var versioningMacroNamesListKey = android.NewOnceKey("versioningMacroNamesList")
@@ -1470,6 +1455,12 @@
static.linker.(prebuiltLibraryInterface).setStatic()
shared.linker.(prebuiltLibraryInterface).setShared()
+ if library.buildShared() {
+ mctx.AliasVariation("shared")
+ } else if library.buildStatic() {
+ mctx.AliasVariation("static")
+ }
+
if !library.buildStatic() {
static.linker.(prebuiltLibraryInterface).disablePrebuilt()
}
@@ -1501,18 +1492,22 @@
if _, ok := library.(*Module); ok {
reuseStaticLibrary(mctx, static.(*Module), shared.(*Module))
}
+ mctx.AliasVariation("shared")
} else if library.BuildStaticVariant() {
variations := append([]string{"static"}, variations...)
modules := mctx.CreateLocalVariations(variations...)
modules[0].(LinkableInterface).SetStatic()
+ mctx.AliasVariation("static")
} else if library.BuildSharedVariant() {
variations := append([]string{"shared"}, variations...)
modules := mctx.CreateLocalVariations(variations...)
modules[0].(LinkableInterface).SetShared()
+ mctx.AliasVariation("shared")
} else if len(variations) > 0 {
mctx.CreateLocalVariations(variations...)
+ mctx.AliasVariation(variations[0])
}
}
}
@@ -1559,13 +1554,14 @@
// "" is for the non-stubs variant
versions = append([]string{""}, versions...)
- modules := mctx.CreateVariations(versions...)
+ modules := mctx.CreateLocalVariations(versions...)
for i, m := range modules {
if versions[i] != "" {
m.(LinkableInterface).SetBuildStubs()
m.(LinkableInterface).SetStubsVersions(versions[i])
}
}
+ mctx.AliasVariation("")
}
func VersionVariantAvailable(module interface {
@@ -1600,7 +1596,7 @@
if c, ok := library.(*Module); ok && c.IsStubs() {
stubsVersionsLock.Lock()
defer stubsVersionsLock.Unlock()
- // For LLNDK llndk_library, we borrow vstubs.ersions from its implementation library.
+ // For LLNDK llndk_library, we borrow stubs.versions from its implementation library.
// Since llndk_library has dependency to its implementation library,
// we can safely access stubsVersionsFor() with its baseModuleName.
versions := stubsVersionsFor(mctx.Config())[c.BaseModuleName()]
@@ -1611,17 +1607,10 @@
return
}
- mctx.CreateVariations("")
+ mctx.CreateLocalVariations("")
+ mctx.AliasVariation("")
return
}
- if genrule, ok := mctx.Module().(*genrule.Module); ok {
- if _, ok := genrule.Extra.(*GenruleExtraProperties); ok {
- if VersionVariantAvailable(genrule) {
- mctx.CreateVariations("")
- return
- }
- }
- }
}
// maybeInjectBoringSSLHash adds a rule to run bssl_inject_hash on the output file if the module has the
@@ -1633,8 +1622,7 @@
// TODO(b/137267623): Remove this in favor of a cc_genrule when they support operating on shared libraries.
injectBoringSSLHash := Bool(inject)
ctx.VisitDirectDeps(func(dep android.Module) {
- tag := ctx.OtherModuleDependencyTag(dep)
- if tag == StaticDepTag || tag == staticExportDepTag || tag == wholeStaticDepTag || tag == lateStaticDepTag {
+ if tag, ok := ctx.OtherModuleDependencyTag(dep).(libraryDependencyTag); ok && tag.static() {
if cc, ok := dep.(*Module); ok {
if library, ok := cc.linker.(*libraryDecorator); ok {
if Bool(library.Properties.Inject_bssl_hash) {
diff --git a/cc/library_headers.go b/cc/library_headers.go
index b7ab390..8b3dbeb 100644
--- a/cc/library_headers.go
+++ b/cc/library_headers.go
@@ -25,8 +25,9 @@
var headersLibrarySdkMemberType = &librarySdkMemberType{
SdkMemberTypeBase: android.SdkMemberTypeBase{
- PropertyName: "native_header_libs",
- SupportsSdk: true,
+ PropertyName: "native_header_libs",
+ SupportsSdk: true,
+ HostOsDependent: true,
},
prebuiltModuleType: "cc_prebuilt_library_headers",
noOutputFiles: true,
diff --git a/cc/library_sdk_member.go b/cc/library_sdk_member.go
index 4b9eb30..cff00b6 100644
--- a/cc/library_sdk_member.go
+++ b/cc/library_sdk_member.go
@@ -27,8 +27,9 @@
var sharedLibrarySdkMemberType = &librarySdkMemberType{
SdkMemberTypeBase: android.SdkMemberTypeBase{
- PropertyName: "native_shared_libs",
- SupportsSdk: true,
+ PropertyName: "native_shared_libs",
+ SupportsSdk: true,
+ HostOsDependent: true,
},
prebuiltModuleType: "cc_prebuilt_library_shared",
linkTypes: []string{"shared"},
@@ -36,8 +37,9 @@
var staticLibrarySdkMemberType = &librarySdkMemberType{
SdkMemberTypeBase: android.SdkMemberTypeBase{
- PropertyName: "native_static_libs",
- SupportsSdk: true,
+ PropertyName: "native_static_libs",
+ SupportsSdk: true,
+ HostOsDependent: true,
},
prebuiltModuleType: "cc_prebuilt_library_static",
linkTypes: []string{"static"},
@@ -45,8 +47,9 @@
var staticAndSharedLibrarySdkMemberType = &librarySdkMemberType{
SdkMemberTypeBase: android.SdkMemberTypeBase{
- PropertyName: "native_libs",
- SupportsSdk: true,
+ PropertyName: "native_libs",
+ SupportsSdk: true,
+ HostOsDependent: true,
},
prebuiltModuleType: "cc_prebuilt_library",
linkTypes: []string{"static", "shared"},
diff --git a/cc/linkable.go b/cc/linkable.go
index 66b1c3f..4c84163 100644
--- a/cc/linkable.go
+++ b/cc/linkable.go
@@ -1,9 +1,9 @@
package cc
import (
- "github.com/google/blueprint"
-
"android/soong/android"
+
+ "github.com/google/blueprint"
)
type LinkableInterface interface {
@@ -63,27 +63,16 @@
StubDecorator() bool
}
-type DependencyTag struct {
- blueprint.BaseDependencyTag
- Name string
- Library bool
- Shared bool
+var (
+ CrtBeginDepTag = dependencyTag{name: "crtbegin"}
+ CrtEndDepTag = dependencyTag{name: "crtend"}
+ CoverageDepTag = dependencyTag{name: "coverage"}
+)
- ReexportFlags bool
-
- ExplicitlyVersioned bool
-
- FromStatic bool
+func SharedDepTag() blueprint.DependencyTag {
+ return libraryDependencyTag{Kind: sharedLibraryDependency}
}
-var (
- SharedDepTag = DependencyTag{Name: "shared", Library: true, Shared: true}
- StaticDepTag = DependencyTag{Name: "static", Library: true}
-
- // Same as SharedDepTag, but from a static lib
- SharedFromStaticDepTag = DependencyTag{Name: "shared from static", Library: true, Shared: true, FromStatic: true}
-
- CrtBeginDepTag = DependencyTag{Name: "crtbegin"}
- CrtEndDepTag = DependencyTag{Name: "crtend"}
- CoverageDepTag = DependencyTag{Name: "coverage"}
-)
+func StaticDepTag() blueprint.DependencyTag {
+ return libraryDependencyTag{Kind: staticLibraryDependency}
+}
diff --git a/cc/lto.go b/cc/lto.go
index 4489fc7..9868cdf 100644
--- a/cc/lto.go
+++ b/cc/lto.go
@@ -148,24 +148,31 @@
mctx.WalkDeps(func(dep android.Module, parent android.Module) bool {
tag := mctx.OtherModuleDependencyTag(dep)
- switch tag {
- case StaticDepTag, staticExportDepTag, lateStaticDepTag, wholeStaticDepTag, objDepTag, reuseObjTag:
- if dep, ok := dep.(*Module); ok && dep.lto != nil &&
- !dep.lto.Disabled() {
- if full && !Bool(dep.lto.Properties.Lto.Full) {
- dep.lto.Properties.FullDep = true
- }
- if thin && !Bool(dep.lto.Properties.Lto.Thin) {
- dep.lto.Properties.ThinDep = true
- }
- }
-
- // Recursively walk static dependencies
- return true
- }
+ libTag, isLibTag := tag.(libraryDependencyTag)
// Do not recurse down non-static dependencies
- return false
+ if isLibTag {
+ if !libTag.static() {
+ return false
+ }
+ } else {
+ if tag != objDepTag && tag != reuseObjTag {
+ return false
+ }
+ }
+
+ if dep, ok := dep.(*Module); ok && dep.lto != nil &&
+ !dep.lto.Disabled() {
+ if full && !Bool(dep.lto.Properties.Lto.Full) {
+ dep.lto.Properties.FullDep = true
+ }
+ if thin && !Bool(dep.lto.Properties.Lto.Thin) {
+ dep.lto.Properties.ThinDep = true
+ }
+ }
+
+ // Recursively walk static dependencies
+ return true
})
}
}
diff --git a/cc/makevars.go b/cc/makevars.go
index 968eeb5..dcfd6d8 100644
--- a/cc/makevars.go
+++ b/cc/makevars.go
@@ -148,8 +148,6 @@
ctx.Strict("AIDL_CPP", "${aidlCmd}")
ctx.Strict("ALLOWED_MANUAL_INTERFACE_PATHS", strings.Join(allowedManualInterfacePaths, " "))
- ctx.Strict("M4", "${m4Cmd}")
-
ctx.Strict("RS_GLOBAL_INCLUDES", "${config.RsGlobalIncludes}")
ctx.Strict("SOONG_STRIP_PATH", "${stripPath}")
diff --git a/cc/ndk_library.go b/cc/ndk_library.go
index 22e3ec3..58e742e 100644
--- a/cc/ndk_library.go
+++ b/cc/ndk_library.go
@@ -110,6 +110,10 @@
func normalizeNdkApiLevel(ctx android.BaseModuleContext, apiLevel string,
arch android.Arch) (string, error) {
+ if apiLevel == "" {
+ panic("empty apiLevel not allowed")
+ }
+
if apiLevel == "current" {
return apiLevel, nil
}
@@ -136,7 +140,8 @@
// supported version here instead.
version, err := strconv.Atoi(apiLevel)
if err != nil {
- return "", fmt.Errorf("API level must be an integer (is %q)", apiLevel)
+ // Non-integer API levels are codenames.
+ return apiLevel, nil
}
version = intMax(version, minVersion)
@@ -182,40 +187,61 @@
return version >= unversionedUntil, nil
}
-func generateStubApiVariants(mctx android.BottomUpMutatorContext, c *stubDecorator) {
- platformVersion := mctx.Config().PlatformSdkVersionInt()
+func generatePerApiVariants(ctx android.BottomUpMutatorContext, m *Module,
+ propName string, propValue string, perSplit func(*Module, string)) {
+ platformVersion := ctx.Config().PlatformSdkVersionInt()
- firstSupportedVersion, err := normalizeNdkApiLevel(mctx, String(c.properties.First_version),
- mctx.Arch())
+ firstSupportedVersion, err := normalizeNdkApiLevel(ctx, propValue,
+ ctx.Arch())
if err != nil {
- mctx.PropertyErrorf("first_version", err.Error())
+ ctx.PropertyErrorf(propName, err.Error())
}
- firstGenVersion, err := getFirstGeneratedVersion(firstSupportedVersion, platformVersion)
+ firstGenVersion, err := getFirstGeneratedVersion(firstSupportedVersion,
+ platformVersion)
if err != nil {
// In theory this is impossible because we've already run this through
// normalizeNdkApiLevel above.
- mctx.PropertyErrorf("first_version", err.Error())
+ ctx.PropertyErrorf(propName, err.Error())
}
var versionStrs []string
for version := firstGenVersion; version <= platformVersion; version++ {
versionStrs = append(versionStrs, strconv.Itoa(version))
}
- versionStrs = append(versionStrs, mctx.Config().PlatformVersionActiveCodenames()...)
+ versionStrs = append(versionStrs, ctx.Config().PlatformVersionActiveCodenames()...)
versionStrs = append(versionStrs, "current")
- modules := mctx.CreateVariations(versionStrs...)
+ modules := ctx.CreateVariations(versionStrs...)
for i, module := range modules {
- module.(*Module).compiler.(*stubDecorator).properties.ApiLevel = versionStrs[i]
+ perSplit(module.(*Module), versionStrs[i])
}
}
-func NdkApiMutator(mctx android.BottomUpMutatorContext) {
- if m, ok := mctx.Module().(*Module); ok {
+func NdkApiMutator(ctx android.BottomUpMutatorContext) {
+ if m, ok := ctx.Module().(*Module); ok {
if m.Enabled() {
if compiler, ok := m.compiler.(*stubDecorator); ok {
- generateStubApiVariants(mctx, compiler)
+ if ctx.Os() != android.Android {
+ // These modules are always android.DeviceEnabled only, but
+ // those include Fuchsia devices, which we don't support.
+ ctx.Module().Disable()
+ return
+ }
+ generatePerApiVariants(ctx, m, "first_version",
+ String(compiler.properties.First_version),
+ func(m *Module, version string) {
+ m.compiler.(*stubDecorator).properties.ApiLevel =
+ version
+ })
+ } else if m.SplitPerApiLevel() && m.IsSdkVariant() {
+ if ctx.Os() != android.Android {
+ return
+ }
+ generatePerApiVariants(ctx, m, "min_sdk_version",
+ m.MinSdkVersion(), func(m *Module, version string) {
+ m.Properties.Sdk_version = &version
+ })
}
}
}
diff --git a/cc/object.go b/cc/object.go
index 15a529e..778d131 100644
--- a/cc/object.go
+++ b/cc/object.go
@@ -55,6 +55,10 @@
// if set, the path to a linker script to pass to ld -r when combining multiple object files.
Linker_script *string `android:"path,arch_variant"`
+
+ // Indicates that this module is a CRT object. CRT objects will be split
+ // into a variant per-API level between min_sdk_version and current.
+ Crt *bool
}
func newObject() *Module {
@@ -162,3 +166,7 @@
func (object *objectLinker) object() bool {
return true
}
+
+func (object *objectLinker) isCrt() bool {
+ return Bool(object.Properties.Crt)
+}
diff --git a/cc/prebuilt.go b/cc/prebuilt.go
index 653b43e..baf43ce 100644
--- a/cc/prebuilt.go
+++ b/cc/prebuilt.go
@@ -199,10 +199,6 @@
p.properties.Srcs = nil
}
-func (p *prebuiltLibraryLinker) skipInstall(mod *Module) {
- mod.ModuleBase.SkipInstall()
-}
-
func NewPrebuiltLibrary(hod android.HostOrDeviceSupported) (*Module, *libraryDecorator) {
module, library := NewLibrary(hod)
module.compiler = nil
@@ -211,7 +207,6 @@
libraryDecorator: library,
}
module.linker = prebuilt
- module.installer = prebuilt
module.AddProperties(&prebuilt.properties)
diff --git a/cc/rs.go b/cc/rs.go
index 9149e17..ba69f23 100644
--- a/cc/rs.go
+++ b/cc/rs.go
@@ -25,8 +25,8 @@
func init() {
pctx.VariableFunc("rsCmd", func(ctx android.PackageVarContext) string {
- if ctx.Config().UnbundledBuild() {
- // Use RenderScript prebuilts for unbundled builds but not PDK builds
+ if ctx.Config().AlwaysUsePrebuiltSdks() {
+ // Use RenderScript prebuilts for unbundled builds
return filepath.Join("prebuilts/sdk/tools", runtime.GOOS, "bin/llvm-rs-cc")
} else {
return ctx.Config().HostToolPath(ctx, "llvm-rs-cc").String()
diff --git a/cc/sabi.go b/cc/sabi.go
index 8cef170..ef6bead 100644
--- a/cc/sabi.go
+++ b/cc/sabi.go
@@ -83,10 +83,7 @@
((c.IsVndk() && c.UseVndk()) || c.isLlndk(mctx.Config()) ||
(c.sabi != nil && c.sabi.Properties.CreateSAbiDumps)) {
mctx.VisitDirectDeps(func(m android.Module) {
- tag := mctx.OtherModuleDependencyTag(m)
- switch tag {
- case StaticDepTag, staticExportDepTag, lateStaticDepTag, wholeStaticDepTag:
-
+ if tag, ok := mctx.OtherModuleDependencyTag(m).(libraryDependencyTag); ok && tag.static() {
cc, _ := m.(*Module)
if cc == nil {
return
diff --git a/cc/sanitize.go b/cc/sanitize.go
index 300bc8f..2243082 100644
--- a/cc/sanitize.go
+++ b/cc/sanitize.go
@@ -57,9 +57,7 @@
cfiAsflags = []string{"-flto", "-fvisibility=default"}
cfiLdflags = []string{"-flto", "-fsanitize-cfi-cross-dso", "-fsanitize=cfi",
"-Wl,-plugin-opt,O1"}
- cfiExportsMapPath = "build/soong/cc/config/cfi_exports.map"
- cfiStaticLibsMutex sync.Mutex
- hwasanStaticLibsMutex sync.Mutex
+ cfiExportsMapPath = "build/soong/cc/config/cfi_exports.map"
intOverflowCflags = []string{"-fsanitize-blacklist=build/soong/cc/config/integer_overflow_blocklist.txt"}
@@ -158,6 +156,9 @@
Scudo *bool `android:"arch_variant"`
Scs *bool `android:"arch_variant"`
+ // A modifier for ASAN and HWASAN for write only instrumentation
+ Writeonly *bool `android:"arch_variant"`
+
// Sanitizers to run in the diagnostic mode (as opposed to the release mode).
// Replaces abort() on error with a human-readable error message.
// Address and Thread sanitizers always run in diagnostic mode.
@@ -173,8 +174,6 @@
Recover []string
// value to pass to -fsanitize-blacklist
- Blacklist *string
- // value to pass to -fsanitize-blacklist
Blocklist *string
} `android:"arch_variant"`
@@ -281,6 +280,15 @@
s.Hwaddress = boolPtr(true)
}
+ if found, globalSanitizers = removeFromList("writeonly", globalSanitizers); found && s.Writeonly == nil {
+ // Hwaddress and Address are set before, so we can check them here
+ // If they aren't explicitly set in the blueprint/SANITIZE_(HOST|TARGET), they would be nil instead of false
+ if s.Address == nil && s.Hwaddress == nil {
+ ctx.ModuleErrorf("writeonly modifier cannot be used without 'address' or 'hwaddress'")
+ }
+ s.Writeonly = boolPtr(true)
+ }
+
if len(globalSanitizers) > 0 {
ctx.ModuleErrorf("unknown global sanitizer option %s", globalSanitizers[0])
}
@@ -311,14 +319,14 @@
// Is CFI actually enabled?
if !ctx.Config().EnableCFI() {
- s.Cfi = nil
- s.Diag.Cfi = nil
+ s.Cfi = boolPtr(false)
+ s.Diag.Cfi = boolPtr(false)
}
// Also disable CFI for arm32 until b/35157333 is fixed.
if ctx.Arch().ArchType == android.Arm {
- s.Cfi = nil
- s.Diag.Cfi = nil
+ s.Cfi = boolPtr(false)
+ s.Diag.Cfi = boolPtr(false)
}
// HWASan requires AArch64 hardware feature (top-byte-ignore).
@@ -333,14 +341,14 @@
// Also disable CFI if ASAN is enabled.
if Bool(s.Address) || Bool(s.Hwaddress) {
- s.Cfi = nil
- s.Diag.Cfi = nil
+ s.Cfi = boolPtr(false)
+ s.Diag.Cfi = boolPtr(false)
}
// Disable sanitizers that depend on the UBSan runtime for windows/darwin builds.
if !ctx.Os().Linux() {
- s.Cfi = nil
- s.Diag.Cfi = nil
+ s.Cfi = boolPtr(false)
+ s.Diag.Cfi = boolPtr(false)
s.Misc_undefined = nil
s.Undefined = nil
s.All_undefined = nil
@@ -349,14 +357,15 @@
// Also disable CFI for VNDK variants of components
if ctx.isVndk() && ctx.useVndk() {
- s.Cfi = nil
- s.Diag.Cfi = nil
- }
-
- // Also disable CFI if building against snapshot.
- vndkVersion := ctx.DeviceConfig().VndkVersion()
- if ctx.useVndk() && vndkVersion != "current" && vndkVersion != "" {
- s.Cfi = nil
+ if ctx.static() {
+ // Cfi variant for static vndk should be captured as vendor snapshot,
+ // so don't strictly disable Cfi.
+ s.Cfi = nil
+ s.Diag.Cfi = nil
+ } else {
+ s.Cfi = boolPtr(false)
+ s.Diag.Cfi = boolPtr(false)
+ }
}
// HWASan ramdisk (which is built from recovery) goes over some bootloader limit.
@@ -401,7 +410,7 @@
// TODO(b/131771163): CFI transiently depends on LTO, and thus Fuzzer is
// mutually incompatible.
if Bool(s.Fuzzer) {
- s.Cfi = nil
+ s.Cfi = boolPtr(false)
}
}
@@ -458,6 +467,10 @@
flags.Local.CFlags = append(flags.Local.CFlags, asanCflags...)
flags.Local.LdFlags = append(flags.Local.LdFlags, asanLdflags...)
+ if Bool(sanitize.Properties.Sanitize.Writeonly) {
+ flags.Local.CFlags = append(flags.Local.CFlags, "-mllvm", "-asan-instrument-reads=0")
+ }
+
if ctx.Host() {
// -nodefaultlibs (provided with libc++) prevents the driver from linking
// libraries needed with -fsanitize=address. http://b/18650275 (WAI)
@@ -477,6 +490,9 @@
if Bool(sanitize.Properties.Sanitize.Hwaddress) {
flags.Local.CFlags = append(flags.Local.CFlags, hwasanCflags...)
+ if Bool(sanitize.Properties.Sanitize.Writeonly) {
+ flags.Local.CFlags = append(flags.Local.CFlags, "-mllvm", "-hwasan-instrument-reads=0")
+ }
}
if Bool(sanitize.Properties.Sanitize.Fuzzer) {
@@ -592,12 +608,6 @@
strings.Join(sanitize.Properties.Sanitize.Diag.No_recover, ","))
}
- blacklist := android.OptionalPathForModuleSrc(ctx, sanitize.Properties.Sanitize.Blacklist)
- if blacklist.Valid() {
- flags.Local.CFlags = append(flags.Local.CFlags, "-fsanitize-blacklist="+blacklist.String())
- flags.CFlagsDeps = append(flags.CFlagsDeps, blacklist.Path())
- }
-
blocklist := android.OptionalPathForModuleSrc(ctx, sanitize.Properties.Sanitize.Blocklist)
if blocklist.Valid() {
flags.Local.CFlags = append(flags.Local.CFlags, "-fsanitize-blacklist="+blocklist.String())
@@ -714,31 +724,74 @@
}
func isSanitizableDependencyTag(tag blueprint.DependencyTag) bool {
- t, ok := tag.(DependencyTag)
- return ok && t.Library || t == reuseObjTag || t == objDepTag
+ switch t := tag.(type) {
+ case dependencyTag:
+ return t == reuseObjTag || t == objDepTag
+ case libraryDependencyTag:
+ return true
+ default:
+ return false
+ }
+}
+
+// Determines if the current module is a static library going to be captured
+// as vendor snapshot. Such modules must create both cfi and non-cfi variants,
+// except for ones which explicitly disable cfi.
+func needsCfiForVendorSnapshot(mctx android.TopDownMutatorContext) bool {
+ if isVendorProprietaryPath(mctx.ModuleDir()) {
+ return false
+ }
+
+ c := mctx.Module().(*Module)
+
+ if !c.inVendor() {
+ return false
+ }
+
+ if !c.static() {
+ return false
+ }
+
+ if c.Prebuilt() != nil {
+ return false
+ }
+
+ return c.sanitize != nil &&
+ !Bool(c.sanitize.Properties.Sanitize.Never) &&
+ !c.sanitize.isSanitizerExplicitlyDisabled(cfi)
}
// Propagate sanitizer requirements down from binaries
func sanitizerDepsMutator(t sanitizerType) func(android.TopDownMutatorContext) {
return func(mctx android.TopDownMutatorContext) {
- if c, ok := mctx.Module().(*Module); ok && c.sanitize.isSanitizerEnabled(t) {
- mctx.WalkDeps(func(child, parent android.Module) bool {
- if !isSanitizableDependencyTag(mctx.OtherModuleDependencyTag(child)) {
- return false
- }
- if d, ok := child.(*Module); ok && d.sanitize != nil &&
- !Bool(d.sanitize.Properties.Sanitize.Never) &&
- !d.sanitize.isSanitizerExplicitlyDisabled(t) {
- if t == cfi || t == hwasan || t == scs {
- if d.static() {
+ if c, ok := mctx.Module().(*Module); ok {
+ enabled := c.sanitize.isSanitizerEnabled(t)
+ if t == cfi && needsCfiForVendorSnapshot(mctx) {
+ // We shouldn't change the result of isSanitizerEnabled(cfi) to correctly
+ // determine defaultVariation in sanitizerMutator below.
+ // Instead, just mark SanitizeDep to forcefully create cfi variant.
+ enabled = true
+ c.sanitize.Properties.SanitizeDep = true
+ }
+ if enabled {
+ mctx.WalkDeps(func(child, parent android.Module) bool {
+ if !isSanitizableDependencyTag(mctx.OtherModuleDependencyTag(child)) {
+ return false
+ }
+ if d, ok := child.(*Module); ok && d.sanitize != nil &&
+ !Bool(d.sanitize.Properties.Sanitize.Never) &&
+ !d.sanitize.isSanitizerExplicitlyDisabled(t) {
+ if t == cfi || t == hwasan || t == scs {
+ if d.static() {
+ d.sanitize.Properties.SanitizeDep = true
+ }
+ } else {
d.sanitize.Properties.SanitizeDep = true
}
- } else {
- d.sanitize.Properties.SanitizeDep = true
}
- }
- return true
- })
+ return true
+ })
+ }
} else if sanitizeable, ok := mctx.Module().(Sanitizeable); ok {
// If an APEX module includes a lib which is enabled for a sanitizer T, then
// the APEX module is also enabled for the same sanitizer type.
@@ -957,10 +1010,11 @@
}
// static executable gets static runtime libs
+ depTag := libraryDependencyTag{Kind: staticLibraryDependency}
mctx.AddFarVariationDependencies(append(mctx.Target().Variations(), []blueprint.Variation{
{Mutator: "link", Variation: "static"},
c.ImageVariation(),
- }...), StaticDepTag, deps...)
+ }...), depTag, deps...)
} else if !c.static() && !c.header() {
// If we're using snapshots and in vendor, redirect to snapshot whenever possible
if c.VndkVersion() == mctx.DeviceConfig().VndkVersion() {
@@ -971,10 +1025,11 @@
}
// dynamic executable and shared libs get shared runtime libs
+ depTag := libraryDependencyTag{Kind: sharedLibraryDependency, Order: earlyLibraryDependency}
mctx.AddFarVariationDependencies(append(mctx.Target().Variations(), []blueprint.Variation{
{Mutator: "link", Variation: "shared"},
c.ImageVariation(),
- }...), earlySharedDepTag, runtimeLibrary)
+ }...), depTag, runtimeLibrary)
}
// static lib does not have dependency to the runtime library. The
// dependency will be added to the executables or shared libs using
@@ -1042,15 +1097,9 @@
// Export the static lib name to make
if c.static() && c.ExportedToMake() {
if t == cfi {
- appendStringSync(c.Name(), cfiStaticLibs(mctx.Config()), &cfiStaticLibsMutex)
+ cfiStaticLibs(mctx.Config()).add(c, c.Name())
} else if t == hwasan {
- if c.UseVndk() {
- appendStringSync(c.Name(), hwasanVendorStaticLibs(mctx.Config()),
- &hwasanStaticLibsMutex)
- } else {
- appendStringSync(c.Name(), hwasanStaticLibs(mctx.Config()),
- &hwasanStaticLibsMutex)
- }
+ hwasanStaticLibs(mctx.Config()).add(c, c.Name())
}
}
} else {
@@ -1076,38 +1125,96 @@
// APEX modules fall here
sanitizeable.AddSanitizerDependencies(mctx, t.name())
mctx.CreateVariations(t.variationName())
+ } else if c, ok := mctx.Module().(*Module); ok {
+ // Check if it's a snapshot module supporting sanitizer
+ if s, ok := c.linker.(snapshotSanitizer); ok && s.isSanitizerEnabled(t) {
+ // Set default variation as above.
+ defaultVariation := t.variationName()
+ mctx.SetDefaultDependencyVariation(&defaultVariation)
+ modules := mctx.CreateVariations("", t.variationName())
+ modules[0].(*Module).linker.(snapshotSanitizer).setSanitizerVariation(t, false)
+ modules[1].(*Module).linker.(snapshotSanitizer).setSanitizerVariation(t, true)
+
+ // Export the static lib name to make
+ if c.static() && c.ExportedToMake() {
+ if t == cfi {
+ // use BaseModuleName which is the name for Make.
+ cfiStaticLibs(mctx.Config()).add(c, c.BaseModuleName())
+ }
+ }
+ }
+ }
+ }
+}
+
+type sanitizerStaticLibsMap struct {
+ // libsMap contains one list of modules per each image and each arch.
+ // e.g. libs[vendor]["arm"] contains arm modules installed to vendor
+ libsMap map[imageVariantType]map[string][]string
+ libsMapLock sync.Mutex
+ sanitizerType sanitizerType
+}
+
+func newSanitizerStaticLibsMap(t sanitizerType) *sanitizerStaticLibsMap {
+ return &sanitizerStaticLibsMap{
+ sanitizerType: t,
+ libsMap: make(map[imageVariantType]map[string][]string),
+ }
+}
+
+// Add the current module to sanitizer static libs maps
+// Each module should pass its exported name as names of Make and Soong can differ.
+func (s *sanitizerStaticLibsMap) add(c *Module, name string) {
+ image := c.getImageVariantType()
+ arch := c.Arch().ArchType.String()
+
+ s.libsMapLock.Lock()
+ defer s.libsMapLock.Unlock()
+
+ if _, ok := s.libsMap[image]; !ok {
+ s.libsMap[image] = make(map[string][]string)
+ }
+
+ s.libsMap[image][arch] = append(s.libsMap[image][arch], name)
+}
+
+// Exports makefile variables in the following format:
+// SOONG_{sanitizer}_{image}_{arch}_STATIC_LIBRARIES
+// e.g. SOONG_cfi_core_x86_STATIC_LIBRARIES
+// These are to be used by use_soong_sanitized_static_libraries.
+// See build/make/core/binary.mk for more details.
+func (s *sanitizerStaticLibsMap) exportToMake(ctx android.MakeVarsContext) {
+ for _, image := range android.SortedStringKeys(s.libsMap) {
+ archMap := s.libsMap[imageVariantType(image)]
+ for _, arch := range android.SortedStringKeys(archMap) {
+ libs := archMap[arch]
+ sort.Strings(libs)
+
+ key := fmt.Sprintf(
+ "SOONG_%s_%s_%s_STATIC_LIBRARIES",
+ s.sanitizerType.variationName(),
+ image, // already upper
+ arch)
+
+ ctx.Strict(key, strings.Join(libs, " "))
}
}
}
var cfiStaticLibsKey = android.NewOnceKey("cfiStaticLibs")
-func cfiStaticLibs(config android.Config) *[]string {
+func cfiStaticLibs(config android.Config) *sanitizerStaticLibsMap {
return config.Once(cfiStaticLibsKey, func() interface{} {
- return &[]string{}
- }).(*[]string)
+ return newSanitizerStaticLibsMap(cfi)
+ }).(*sanitizerStaticLibsMap)
}
var hwasanStaticLibsKey = android.NewOnceKey("hwasanStaticLibs")
-func hwasanStaticLibs(config android.Config) *[]string {
+func hwasanStaticLibs(config android.Config) *sanitizerStaticLibsMap {
return config.Once(hwasanStaticLibsKey, func() interface{} {
- return &[]string{}
- }).(*[]string)
-}
-
-var hwasanVendorStaticLibsKey = android.NewOnceKey("hwasanVendorStaticLibs")
-
-func hwasanVendorStaticLibs(config android.Config) *[]string {
- return config.Once(hwasanVendorStaticLibsKey, func() interface{} {
- return &[]string{}
- }).(*[]string)
-}
-
-func appendStringSync(item string, list *[]string, mutex *sync.Mutex) {
- mutex.Lock()
- *list = append(*list, item)
- mutex.Unlock()
+ return newSanitizerStaticLibsMap(hwasan)
+ }).(*sanitizerStaticLibsMap)
}
func enableMinimalRuntime(sanitize *sanitize) bool {
@@ -1137,17 +1244,9 @@
}
func cfiMakeVarsProvider(ctx android.MakeVarsContext) {
- cfiStaticLibs := cfiStaticLibs(ctx.Config())
- sort.Strings(*cfiStaticLibs)
- ctx.Strict("SOONG_CFI_STATIC_LIBRARIES", strings.Join(*cfiStaticLibs, " "))
+ cfiStaticLibs(ctx.Config()).exportToMake(ctx)
}
func hwasanMakeVarsProvider(ctx android.MakeVarsContext) {
- hwasanStaticLibs := hwasanStaticLibs(ctx.Config())
- sort.Strings(*hwasanStaticLibs)
- ctx.Strict("SOONG_HWASAN_STATIC_LIBRARIES", strings.Join(*hwasanStaticLibs, " "))
-
- hwasanVendorStaticLibs := hwasanVendorStaticLibs(ctx.Config())
- sort.Strings(*hwasanVendorStaticLibs)
- ctx.Strict("SOONG_HWASAN_VENDOR_STATIC_LIBRARIES", strings.Join(*hwasanVendorStaticLibs, " "))
+ hwasanStaticLibs(ctx.Config()).exportToMake(ctx)
}
diff --git a/cc/testing.go b/cc/testing.go
index c2353d8..06e5f83 100644
--- a/cc/testing.go
+++ b/cc/testing.go
@@ -338,6 +338,8 @@
vendor_available: true,
native_bridge_supported: true,
stl: "none",
+ min_sdk_version: "16",
+ crt: true,
apex_available: [
"//apex_available:platform",
"//apex_available:anyapex",
@@ -347,48 +349,26 @@
cc_object {
name: "crtbegin_so",
defaults: ["crt_defaults"],
- recovery_available: true,
- vendor_available: true,
- native_bridge_supported: true,
- min_sdk_version: "29",
- stl: "none",
}
cc_object {
name: "crtbegin_dynamic",
defaults: ["crt_defaults"],
- recovery_available: true,
- vendor_available: true,
- native_bridge_supported: true,
- stl: "none",
}
cc_object {
name: "crtbegin_static",
defaults: ["crt_defaults"],
- recovery_available: true,
- vendor_available: true,
- native_bridge_supported: true,
- stl: "none",
}
cc_object {
name: "crtend_so",
defaults: ["crt_defaults"],
- recovery_available: true,
- vendor_available: true,
- native_bridge_supported: true,
- min_sdk_version: "29",
- stl: "none",
}
cc_object {
name: "crtend_android",
defaults: ["crt_defaults"],
- recovery_available: true,
- vendor_available: true,
- native_bridge_supported: true,
- stl: "none",
}
cc_library {
@@ -420,26 +400,6 @@
symbol_file: "libdl.map.txt",
}
- ndk_prebuilt_object {
- name: "ndk_crtbegin_so.27",
- sdk_version: "27",
- }
-
- ndk_prebuilt_object {
- name: "ndk_crtend_so.27",
- sdk_version: "27",
- }
-
- ndk_prebuilt_object {
- name: "ndk_crtbegin_dynamic.27",
- sdk_version: "27",
- }
-
- ndk_prebuilt_object {
- name: "ndk_crtend_android.27",
- sdk_version: "27",
- }
-
ndk_prebuilt_shared_stl {
name: "ndk_libc++_shared",
}
@@ -567,6 +527,7 @@
ctx.RegisterModuleType("filegroup", android.FileGroupFactory)
ctx.RegisterModuleType("vndk_prebuilt_shared", VndkPrebuiltSharedFactory)
ctx.RegisterModuleType("vndk_libraries_txt", VndkLibrariesTxtFactory)
+ ctx.RegisterModuleType("vendor_snapshot_static", VendorSnapshotStaticFactory)
ctx.PreArchMutators(android.RegisterDefaultsPreArchMutators)
android.RegisterPrebuiltMutators(ctx)
RegisterRequiredBuildComponentsForTest(ctx)
diff --git a/cc/vendor_snapshot.go b/cc/vendor_snapshot.go
index 0af2258..e17a6d0 100644
--- a/cc/vendor_snapshot.go
+++ b/cc/vendor_snapshot.go
@@ -80,23 +80,75 @@
}).(*snapshotMap)
}
-type vendorSnapshotLibraryProperties struct {
+type vendorSnapshotBaseProperties struct {
// snapshot version.
Version string
// Target arch name of the snapshot (e.g. 'arm64' for variant 'aosp_arm64')
Target_arch string
+}
+// vendorSnapshotModuleBase provides common basic functions for all snapshot modules.
+type vendorSnapshotModuleBase struct {
+ baseProperties vendorSnapshotBaseProperties
+ moduleSuffix string
+}
+
+func (p *vendorSnapshotModuleBase) Name(name string) string {
+ return name + p.NameSuffix()
+}
+
+func (p *vendorSnapshotModuleBase) NameSuffix() string {
+ versionSuffix := p.version()
+ if p.arch() != "" {
+ versionSuffix += "." + p.arch()
+ }
+
+ return p.moduleSuffix + versionSuffix
+}
+
+func (p *vendorSnapshotModuleBase) version() string {
+ return p.baseProperties.Version
+}
+
+func (p *vendorSnapshotModuleBase) arch() string {
+ return p.baseProperties.Target_arch
+}
+
+func (p *vendorSnapshotModuleBase) isSnapshotPrebuilt() bool {
+ return true
+}
+
+// Call this after creating a snapshot module with module suffix
+// such as vendorSnapshotSharedSuffix
+func (p *vendorSnapshotModuleBase) init(m *Module, suffix string) {
+ p.moduleSuffix = suffix
+ m.AddProperties(&p.baseProperties)
+ android.AddLoadHook(m, func(ctx android.LoadHookContext) {
+ vendorSnapshotLoadHook(ctx, p)
+ })
+}
+
+func vendorSnapshotLoadHook(ctx android.LoadHookContext, p *vendorSnapshotModuleBase) {
+ if p.version() != ctx.DeviceConfig().VndkVersion() {
+ ctx.Module().Disable()
+ return
+ }
+}
+
+type vendorSnapshotLibraryProperties struct {
// Prebuilt file for each arch.
Src *string `android:"arch_variant"`
+ // list of directories that will be added to the include path (using -I).
+ Export_include_dirs []string `android:"arch_variant"`
+
+ // list of directories that will be added to the system path (using -isystem).
+ Export_system_include_dirs []string `android:"arch_variant"`
+
// list of flags that will be used for any module that links against this module.
Export_flags []string `android:"arch_variant"`
- // Check the prebuilt ELF files (e.g. DT_SONAME, DT_NEEDED, resolution of undefined symbols,
- // etc).
- Check_elf_files *bool
-
// Whether this prebuilt needs to depend on sanitize ubsan runtime or not.
Sanitize_ubsan_dep *bool `android:"arch_variant"`
@@ -104,42 +156,24 @@
Sanitize_minimal_dep *bool `android:"arch_variant"`
}
+type snapshotSanitizer interface {
+ isSanitizerEnabled(t sanitizerType) bool
+ setSanitizerVariation(t sanitizerType, enabled bool)
+}
+
type vendorSnapshotLibraryDecorator struct {
+ vendorSnapshotModuleBase
*libraryDecorator
- properties vendorSnapshotLibraryProperties
+ properties vendorSnapshotLibraryProperties
+ sanitizerProperties struct {
+ CfiEnabled bool `blueprint:"mutated"`
+
+ // Library flags for cfi variant.
+ Cfi vendorSnapshotLibraryProperties `android:"arch_variant"`
+ }
androidMkVendorSuffix bool
}
-func (p *vendorSnapshotLibraryDecorator) Name(name string) string {
- return name + p.NameSuffix()
-}
-
-func (p *vendorSnapshotLibraryDecorator) NameSuffix() string {
- versionSuffix := p.version()
- if p.arch() != "" {
- versionSuffix += "." + p.arch()
- }
-
- var linkageSuffix string
- if p.buildShared() {
- linkageSuffix = vendorSnapshotSharedSuffix
- } else if p.buildStatic() {
- linkageSuffix = vendorSnapshotStaticSuffix
- } else {
- linkageSuffix = vendorSnapshotHeaderSuffix
- }
-
- return linkageSuffix + versionSuffix
-}
-
-func (p *vendorSnapshotLibraryDecorator) version() string {
- return p.properties.Version
-}
-
-func (p *vendorSnapshotLibraryDecorator) arch() string {
- return p.properties.Target_arch
-}
-
func (p *vendorSnapshotLibraryDecorator) linkerFlags(ctx ModuleContext, flags Flags) Flags {
p.libraryDecorator.libName = strings.TrimSuffix(ctx.ModuleName(), p.NameSuffix())
return p.libraryDecorator.linkerFlags(ctx, flags)
@@ -165,11 +199,16 @@
return p.libraryDecorator.link(ctx, flags, deps, objs)
}
+ if p.sanitizerProperties.CfiEnabled {
+ p.properties = p.sanitizerProperties.Cfi
+ }
+
if !p.matchesWithDevice(ctx.DeviceConfig()) {
return nil
}
- p.libraryDecorator.exportIncludes(ctx)
+ p.libraryDecorator.reexportDirs(android.PathsForModuleSrc(ctx, p.properties.Export_include_dirs)...)
+ p.libraryDecorator.reexportSystemDirs(android.PathsForModuleSrc(ctx, p.properties.Export_system_include_dirs)...)
p.libraryDecorator.reexportFlags(p.properties.Export_flags...)
in := android.PathForModuleSrc(ctx, *p.properties.Src)
@@ -189,32 +228,38 @@
return in
}
-func (p *vendorSnapshotLibraryDecorator) nativeCoverage() bool {
- return false
-}
-
-func (p *vendorSnapshotLibraryDecorator) isSnapshotPrebuilt() bool {
- return true
-}
-
func (p *vendorSnapshotLibraryDecorator) install(ctx ModuleContext, file android.Path) {
if p.matchesWithDevice(ctx.DeviceConfig()) && (p.shared() || p.static()) {
p.baseInstaller.install(ctx, file)
}
}
-type vendorSnapshotInterface interface {
- version() string
+func (p *vendorSnapshotLibraryDecorator) nativeCoverage() bool {
+ return false
}
-func vendorSnapshotLoadHook(ctx android.LoadHookContext, p vendorSnapshotInterface) {
- if p.version() != ctx.DeviceConfig().VndkVersion() {
- ctx.Module().Disable()
+func (p *vendorSnapshotLibraryDecorator) isSanitizerEnabled(t sanitizerType) bool {
+ switch t {
+ case cfi:
+ return p.sanitizerProperties.Cfi.Src != nil
+ default:
+ return false
+ }
+}
+
+func (p *vendorSnapshotLibraryDecorator) setSanitizerVariation(t sanitizerType, enabled bool) {
+ if !enabled {
+ return
+ }
+ switch t {
+ case cfi:
+ p.sanitizerProperties.CfiEnabled = true
+ default:
return
}
}
-func vendorSnapshotLibrary() (*Module, *vendorSnapshotLibraryDecorator) {
+func vendorSnapshotLibrary(suffix string) (*Module, *vendorSnapshotLibraryDecorator) {
module, library := NewLibrary(android.DeviceSupported)
module.stl = nil
@@ -237,77 +282,47 @@
module.linker = prebuilt
module.installer = prebuilt
+ prebuilt.init(module, suffix)
module.AddProperties(
&prebuilt.properties,
+ &prebuilt.sanitizerProperties,
)
return module, prebuilt
}
func VendorSnapshotSharedFactory() android.Module {
- module, prebuilt := vendorSnapshotLibrary()
+ module, prebuilt := vendorSnapshotLibrary(vendorSnapshotSharedSuffix)
prebuilt.libraryDecorator.BuildOnlyShared()
- android.AddLoadHook(module, func(ctx android.LoadHookContext) {
- vendorSnapshotLoadHook(ctx, prebuilt)
- })
return module.Init()
}
func VendorSnapshotStaticFactory() android.Module {
- module, prebuilt := vendorSnapshotLibrary()
+ module, prebuilt := vendorSnapshotLibrary(vendorSnapshotStaticSuffix)
prebuilt.libraryDecorator.BuildOnlyStatic()
- android.AddLoadHook(module, func(ctx android.LoadHookContext) {
- vendorSnapshotLoadHook(ctx, prebuilt)
- })
return module.Init()
}
func VendorSnapshotHeaderFactory() android.Module {
- module, prebuilt := vendorSnapshotLibrary()
+ module, prebuilt := vendorSnapshotLibrary(vendorSnapshotHeaderSuffix)
prebuilt.libraryDecorator.HeaderOnly()
- android.AddLoadHook(module, func(ctx android.LoadHookContext) {
- vendorSnapshotLoadHook(ctx, prebuilt)
- })
return module.Init()
}
+var _ snapshotSanitizer = (*vendorSnapshotLibraryDecorator)(nil)
+
type vendorSnapshotBinaryProperties struct {
- // snapshot version.
- Version string
-
- // Target arch name of the snapshot (e.g. 'arm64' for variant 'aosp_arm64_ab')
- Target_arch string
-
// Prebuilt file for each arch.
Src *string `android:"arch_variant"`
}
type vendorSnapshotBinaryDecorator struct {
+ vendorSnapshotModuleBase
*binaryDecorator
properties vendorSnapshotBinaryProperties
androidMkVendorSuffix bool
}
-func (p *vendorSnapshotBinaryDecorator) Name(name string) string {
- return name + p.NameSuffix()
-}
-
-func (p *vendorSnapshotBinaryDecorator) NameSuffix() string {
- versionSuffix := p.version()
- if p.arch() != "" {
- versionSuffix += "." + p.arch()
- }
- return vendorSnapshotBinarySuffix + versionSuffix
-}
-
-func (p *vendorSnapshotBinaryDecorator) version() string {
- return p.properties.Version
-}
-
-func (p *vendorSnapshotBinaryDecorator) arch() string {
- return p.properties.Target_arch
-}
-
func (p *vendorSnapshotBinaryDecorator) matchesWithDevice(config android.DeviceConfig) bool {
if config.DeviceArch() != p.arch() {
return false
@@ -349,8 +364,8 @@
return outputFile
}
-func (p *vendorSnapshotBinaryDecorator) isSnapshotPrebuilt() bool {
- return true
+func (p *vendorSnapshotBinaryDecorator) nativeCoverage() bool {
+ return false
}
func VendorSnapshotBinaryFactory() android.Module {
@@ -372,51 +387,23 @@
module.stl = nil
module.linker = prebuilt
- android.AddLoadHook(module, func(ctx android.LoadHookContext) {
- vendorSnapshotLoadHook(ctx, prebuilt)
- })
-
+ prebuilt.init(module, vendorSnapshotBinarySuffix)
module.AddProperties(&prebuilt.properties)
return module.Init()
}
type vendorSnapshotObjectProperties struct {
- // snapshot version.
- Version string
-
- // Target arch name of the snapshot (e.g. 'arm64' for variant 'aosp_arm64_ab')
- Target_arch string
-
// Prebuilt file for each arch.
Src *string `android:"arch_variant"`
}
type vendorSnapshotObjectLinker struct {
+ vendorSnapshotModuleBase
objectLinker
properties vendorSnapshotObjectProperties
androidMkVendorSuffix bool
}
-func (p *vendorSnapshotObjectLinker) Name(name string) string {
- return name + p.NameSuffix()
-}
-
-func (p *vendorSnapshotObjectLinker) NameSuffix() string {
- versionSuffix := p.version()
- if p.arch() != "" {
- versionSuffix += "." + p.arch()
- }
- return vendorSnapshotObjectSuffix + versionSuffix
-}
-
-func (p *vendorSnapshotObjectLinker) version() string {
- return p.properties.Version
-}
-
-func (p *vendorSnapshotObjectLinker) arch() string {
- return p.properties.Target_arch
-}
-
func (p *vendorSnapshotObjectLinker) matchesWithDevice(config android.DeviceConfig) bool {
if config.DeviceArch() != p.arch() {
return false
@@ -443,10 +430,6 @@
return false
}
-func (p *vendorSnapshotObjectLinker) isSnapshotPrebuilt() bool {
- return true
-}
-
func VendorSnapshotObjectFactory() android.Module {
module := newObject()
@@ -457,10 +440,7 @@
}
module.linker = prebuilt
- android.AddLoadHook(module, func(ctx android.LoadHookContext) {
- vendorSnapshotLoadHook(ctx, prebuilt)
- })
-
+ prebuilt.init(module, vendorSnapshotObjectSuffix)
module.AddProperties(&prebuilt.properties)
return module.Init()
}
@@ -484,18 +464,22 @@
var (
// Modules under following directories are ignored. They are OEM's and vendor's
- // proprietary modules(device/, vendor/, and hardware/).
+ // proprietary modules(device/, kernel/, vendor/, and hardware/).
// TODO(b/65377115): Clean up these with more maintainable way
vendorProprietaryDirs = []string{
"device",
+ "kernel",
"vendor",
"hardware",
}
// Modules under following directories are included as they are in AOSP,
- // although hardware/ is normally for vendor's own.
+ // although hardware/ and kernel/ are normally for vendor's own.
// TODO(b/65377115): Clean up these with more maintainable way
aospDirsUnderProprietary = []string{
+ "kernel/configs",
+ "kernel/prebuilts",
+ "kernel/tests",
"hardware/interfaces",
"hardware/libhardware",
"hardware/libhardware_legacy",
@@ -564,13 +548,17 @@
if l, ok := m.linker.(snapshotLibraryInterface); ok {
// TODO(b/65377115): add full support for sanitizer
if m.sanitize != nil {
- // cfi, scs and hwasan export both sanitized and unsanitized variants for static and header
+ // scs and hwasan export both sanitized and unsanitized variants for static and header
// Always use unsanitized variants of them.
- for _, t := range []sanitizerType{cfi, scs, hwasan} {
+ for _, t := range []sanitizerType{scs, hwasan} {
if !l.shared() && m.sanitize.isSanitizerEnabled(t) {
return false
}
}
+ // cfi also exports both variants. But for static, we capture both.
+ if !l.static() && !l.shared() && m.sanitize.isSanitizerEnabled(cfi) {
+ return false
+ }
}
if l.static() {
return m.outputFile.Valid() && proptools.BoolDefault(m.VendorProperties.Vendor_available, true)
@@ -664,6 +652,7 @@
ExportedDirs []string `json:",omitempty"`
ExportedSystemDirs []string `json:",omitempty"`
ExportedFlags []string `json:",omitempty"`
+ Sanitize string `json:",omitempty"`
SanitizeMinimalDep bool `json:",omitempty"`
SanitizeUbsanDep bool `json:",omitempty"`
@@ -713,6 +702,7 @@
var propOut string
if l, ok := m.linker.(snapshotLibraryInterface); ok {
+
// library flags
prop.ExportedFlags = l.exportedFlags()
for _, dir := range l.exportedDirs() {
@@ -745,6 +735,15 @@
if libType != "header" {
libPath := m.outputFile.Path()
stem = libPath.Base()
+ if l.static() && m.sanitize != nil && m.sanitize.isSanitizerEnabled(cfi) {
+ // both cfi and non-cfi variant for static libraries can exist.
+ // attach .cfi to distinguish between cfi and non-cfi.
+ // e.g. libbase.a -> libbase.cfi.a
+ ext := filepath.Ext(stem)
+ stem = strings.TrimSuffix(stem, ext) + ".cfi" + ext
+ prop.Sanitize = "cfi"
+ prop.ModuleName += ".cfi"
+ }
snapshotLibOut := filepath.Join(snapshotArchDir, targetArch, libType, stem)
ret = append(ret, copyFile(ctx, libPath, snapshotLibOut))
} else {
diff --git a/cc/vndk.go b/cc/vndk.go
index f9adec7..23bb095 100644
--- a/cc/vndk.go
+++ b/cc/vndk.go
@@ -26,6 +26,8 @@
"android/soong/android"
"android/soong/cc/config"
"android/soong/etc"
+
+ "github.com/google/blueprint"
)
const (
@@ -127,7 +129,7 @@
return "native:vendor:vndkspext"
}
-func (vndk *vndkdep) vndkCheckLinkType(ctx android.ModuleContext, to *Module, tag DependencyTag) {
+func (vndk *vndkdep) vndkCheckLinkType(ctx android.ModuleContext, to *Module, tag blueprint.DependencyTag) {
if to.linker == nil {
return
}
diff --git a/cmd/soong_build/Android.bp b/cmd/soong_build/Android.bp
index b559bac..7b8352b 100644
--- a/cmd/soong_build/Android.bp
+++ b/cmd/soong_build/Android.bp
@@ -26,6 +26,7 @@
srcs: [
"main.go",
"writedocs.go",
+ "bazel_overlay.go",
],
primaryBuilder: true,
}
diff --git a/cmd/soong_build/bazel_overlay.go b/cmd/soong_build/bazel_overlay.go
new file mode 100644
index 0000000..e37c163
--- /dev/null
+++ b/cmd/soong_build/bazel_overlay.go
@@ -0,0 +1,173 @@
+// Copyright 2020 Google Inc. All rights reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+package main
+
+import (
+ "android/soong/android"
+ "fmt"
+ "io/ioutil"
+ "os"
+ "path/filepath"
+ "strings"
+
+ "github.com/google/blueprint"
+)
+
+const (
+ soongModuleLoad = `package(default_visibility = ["//visibility:public"])
+load("//:soong_module.bzl", "soong_module")
+`
+
+ // A BUILD file target snippet representing a Soong module
+ soongModuleTarget = `soong_module(
+ name = "%s",
+ module_name = "%s",
+ module_type = "%s",
+ module_variant = "%s",
+ deps = [
+ %s
+ ],
+)
+`
+
+ // The soong_module rule implementation in a .bzl file
+ soongModuleBzl = `
+SoongModuleInfo = provider(
+ fields = {
+ "name": "Name of module",
+ "type": "Type of module",
+ "variant": "Variant of module",
+ },
+)
+
+def _soong_module_impl(ctx):
+ return [
+ SoongModuleInfo(
+ name = ctx.attr.module_name,
+ type = ctx.attr.module_type,
+ variant = ctx.attr.module_variant,
+ ),
+ ]
+
+soong_module = rule(
+ implementation = _soong_module_impl,
+ attrs = {
+ "module_name": attr.string(mandatory = True),
+ "module_type": attr.string(mandatory = True),
+ "module_variant": attr.string(),
+ "deps": attr.label_list(providers = [SoongModuleInfo]),
+ },
+)
+`
+)
+
+func targetNameWithVariant(c *blueprint.Context, logicModule blueprint.Module) string {
+ name := ""
+ if c.ModuleSubDir(logicModule) != "" {
+ name = c.ModuleName(logicModule) + "--" + c.ModuleSubDir(logicModule)
+ } else {
+ name = c.ModuleName(logicModule)
+ }
+
+ return strings.Replace(name, "//", "", 1)
+}
+
+func qualifiedTargetLabel(c *blueprint.Context, logicModule blueprint.Module) string {
+ return "//" +
+ packagePath(c, logicModule) +
+ ":" +
+ targetNameWithVariant(c, logicModule)
+}
+
+func packagePath(c *blueprint.Context, logicModule blueprint.Module) string {
+ return filepath.Dir(c.BlueprintFile(logicModule))
+}
+
+func createBazelOverlay(ctx *android.Context, bazelOverlayDir string) error {
+ blueprintCtx := ctx.Context
+ blueprintCtx.VisitAllModules(func(module blueprint.Module) {
+ buildFile, err := buildFileForModule(blueprintCtx, module)
+ if err != nil {
+ panic(err)
+ }
+
+ // TODO(b/163018919): DirectDeps can have duplicate (module, variant)
+ // items, if the modules are added using different DependencyTag. Figure
+ // out the implications of that.
+ depLabels := map[string]bool{}
+ blueprintCtx.VisitDirectDeps(module, func(depModule blueprint.Module) {
+ depLabels[qualifiedTargetLabel(blueprintCtx, depModule)] = true
+ })
+
+ var depLabelList string
+ for depLabel, _ := range depLabels {
+ depLabelList += "\"" + depLabel + "\",\n "
+ }
+ buildFile.Write([]byte(
+ fmt.Sprintf(
+ soongModuleTarget,
+ targetNameWithVariant(blueprintCtx, module),
+ blueprintCtx.ModuleName(module),
+ blueprintCtx.ModuleType(module),
+ // misleading name, this actually returns the variant.
+ blueprintCtx.ModuleSubDir(module),
+ depLabelList)))
+ buildFile.Close()
+ })
+
+ if err := writeReadOnlyFile(bazelOverlayDir, "WORKSPACE", ""); err != nil {
+ return err
+ }
+
+ if err := writeReadOnlyFile(bazelOverlayDir, "BUILD", ""); err != nil {
+ return err
+ }
+
+ return writeReadOnlyFile(bazelOverlayDir, "soong_module.bzl", soongModuleBzl)
+}
+
+func buildFileForModule(ctx *blueprint.Context, module blueprint.Module) (*os.File, error) {
+ // Create nested directories for the BUILD file
+ dirPath := filepath.Join(bazelOverlayDir, packagePath(ctx, module))
+ if _, err := os.Stat(dirPath); os.IsNotExist(err) {
+ os.MkdirAll(dirPath, os.ModePerm)
+ }
+ // Open the file for appending, and create it if it doesn't exist
+ f, err := os.OpenFile(
+ filepath.Join(dirPath, "BUILD.bazel"),
+ os.O_APPEND|os.O_CREATE|os.O_WRONLY,
+ 0644)
+ if err != nil {
+ return nil, err
+ }
+
+ // If the file is empty, add the load statement for the `soong_module` rule
+ fi, err := f.Stat()
+ if err != nil {
+ return nil, err
+ }
+ if fi.Size() == 0 {
+ f.Write([]byte(soongModuleLoad + "\n"))
+ }
+
+ return f, nil
+}
+
+// The overlay directory should be read-only, sufficient for bazel query.
+func writeReadOnlyFile(dir string, baseName string, content string) error {
+ workspaceFile := filepath.Join(bazelOverlayDir, baseName)
+ // 0444 is read-only
+ return ioutil.WriteFile(workspaceFile, []byte(content), 0444)
+}
diff --git a/cmd/soong_build/main.go b/cmd/soong_build/main.go
index 532d9e4..01a39a2 100644
--- a/cmd/soong_build/main.go
+++ b/cmd/soong_build/main.go
@@ -26,11 +26,13 @@
)
var (
- docFile string
+ docFile string
+ bazelOverlayDir string
)
func init() {
flag.StringVar(&docFile, "soong_docs", "", "build documentation file to output")
+ flag.StringVar(&bazelOverlayDir, "bazel_overlay_dir", "", "path to the bazel overlay directory")
}
func newNameResolver(config android.Config) *android.NameResolver {
@@ -65,7 +67,7 @@
os.Exit(1)
}
- if docFile != "" {
+ if !shouldPrepareBuildActions() {
configuration.SetStopBefore(bootstrap.StopBeforePrepareBuildActions)
}
@@ -85,6 +87,13 @@
bootstrap.Main(ctx.Context, configuration, extraNinjaDeps...)
+ if bazelOverlayDir != "" {
+ if err := createBazelOverlay(ctx, bazelOverlayDir); err != nil {
+ fmt.Fprintf(os.Stderr, "%s", err)
+ os.Exit(1)
+ }
+ }
+
if docFile != "" {
if err := writeDocs(ctx, docFile); err != nil {
fmt.Fprintf(os.Stderr, "%s", err)
@@ -94,7 +103,7 @@
// TODO(ccross): make this a command line argument. Requires plumbing through blueprint
// to affect the command line of the primary builder.
- if docFile == "" {
+ if shouldPrepareBuildActions() {
metricsFile := filepath.Join(bootstrap.BuildDir, "soong_build_metrics.pb")
err = android.WriteMetrics(configuration, metricsFile)
if err != nil {
@@ -103,3 +112,9 @@
}
}
}
+
+func shouldPrepareBuildActions() bool {
+ // If we're writing soong_docs or bazel_overlay, don't write build.ninja or
+ // collect metrics.
+ return docFile == "" && bazelOverlayDir == ""
+}
diff --git a/dexpreopt/config.go b/dexpreopt/config.go
index 2cf65fe..db5e97a 100644
--- a/dexpreopt/config.go
+++ b/dexpreopt/config.go
@@ -40,15 +40,15 @@
DisableGenerateProfile bool // don't generate profiles
ProfileDir string // directory to find profiles in
- BootJars []string // modules for jars that form the boot class path
- UpdatableBootJars []string // jars within apex that form the boot class path
+ BootJars android.ConfiguredJarList // modules for jars that form the boot class path
+ UpdatableBootJars android.ConfiguredJarList // jars within apex that form the boot class path
- ArtApexJars []string // modules for jars that are in the ART APEX
+ ArtApexJars android.ConfiguredJarList // modules for jars that are in the ART APEX
- SystemServerJars []string // jars that form the system server
- SystemServerApps []string // apps that are loaded into system server
- UpdatableSystemServerJars []string // jars within apex that are loaded into system server
- SpeedApps []string // apps that should be speed optimized
+ SystemServerJars []string // jars that form the system server
+ SystemServerApps []string // apps that are loaded into system server
+ UpdatableSystemServerJars android.ConfiguredJarList // jars within apex that are loaded into system server
+ SpeedApps []string // apps that should be speed optimized
BrokenSuboptimalOrderOfSystemServerJars bool // if true, sub-optimal order does not cause a build error
@@ -189,8 +189,12 @@
// Copies of entries in GlobalConfig that are not constructable without extra parameters. They will be
// used to construct the real value manually below.
- DirtyImageObjects string
- BootImageProfiles []string
+ BootJars []string
+ UpdatableBootJars []string
+ ArtApexJars []string
+ UpdatableSystemServerJars []string
+ DirtyImageObjects string
+ BootImageProfiles []string
}
config := GlobalJSONConfig{}
@@ -200,6 +204,10 @@
}
// Construct paths that require a PathContext.
+ config.GlobalConfig.BootJars = android.CreateConfiguredJarList(ctx, config.BootJars)
+ config.GlobalConfig.UpdatableBootJars = android.CreateConfiguredJarList(ctx, config.UpdatableBootJars)
+ config.GlobalConfig.ArtApexJars = android.CreateConfiguredJarList(ctx, config.ArtApexJars)
+ config.GlobalConfig.UpdatableSystemServerJars = android.CreateConfiguredJarList(ctx, config.UpdatableSystemServerJars)
config.GlobalConfig.DirtyImageObjects = android.OptionalPathForPath(constructPath(ctx, config.DirtyImageObjects))
config.GlobalConfig.BootImageProfiles = constructPaths(ctx, config.BootImageProfiles)
@@ -530,12 +538,12 @@
PatternsOnSystemOther: nil,
DisableGenerateProfile: false,
ProfileDir: "",
- BootJars: nil,
- UpdatableBootJars: nil,
- ArtApexJars: nil,
+ BootJars: android.EmptyConfiguredJarList(),
+ UpdatableBootJars: android.EmptyConfiguredJarList(),
+ ArtApexJars: android.EmptyConfiguredJarList(),
SystemServerJars: nil,
SystemServerApps: nil,
- UpdatableSystemServerJars: nil,
+ UpdatableSystemServerJars: android.EmptyConfiguredJarList(),
SpeedApps: nil,
PreoptFlags: nil,
DefaultCompilerFilter: "",
diff --git a/dexpreopt/dexpreopt.go b/dexpreopt/dexpreopt.go
index e49fa98..8c9f0a2 100644
--- a/dexpreopt/dexpreopt.go
+++ b/dexpreopt/dexpreopt.go
@@ -83,7 +83,7 @@
if !dexpreoptDisabled(ctx, global, module) {
// Don't preopt individual boot jars, they will be preopted together.
- if !contains(android.GetJarsFromApexJarPairs(ctx, global.BootJars), module.Name) {
+ if !global.BootJars.ContainsJar(module.Name) {
appImage := (generateProfile || module.ForceCreateAppImage || global.DefaultAppImages) &&
!module.NoCreateAppImage
@@ -104,17 +104,15 @@
}
// Don't preopt system server jars that are updatable.
- for _, p := range global.UpdatableSystemServerJars {
- if _, jar := android.SplitApexJarPair(ctx, p); jar == module.Name {
- return true
- }
+ if global.UpdatableSystemServerJars.ContainsJar(module.Name) {
+ return true
}
// If OnlyPreoptBootImageAndSystemServer=true and module is not in boot class path skip
// Also preopt system server jars since selinux prevents system server from loading anything from
// /data. If we don't do this they will need to be extracted which is not favorable for RAM usage
// or performance. If PreoptExtractedApk is true, we ignore the only preopt boot image options.
- if global.OnlyPreoptBootImageAndSystemServer && !contains(android.GetJarsFromApexJarPairs(ctx, global.BootJars), module.Name) &&
+ if global.OnlyPreoptBootImageAndSystemServer && !global.BootJars.ContainsJar(module.Name) &&
!contains(global.SystemServerJars, module.Name) && !module.PreoptExtractedApk {
return true
}
@@ -571,20 +569,13 @@
}
}
-// Expected format for apexJarValue = <apex name>:<jar name>
-func GetJarLocationFromApexJarPair(ctx android.PathContext, apexJarValue string) string {
- apex, jar := android.SplitApexJarPair(ctx, apexJarValue)
- return filepath.Join("/apex", apex, "javalib", jar+".jar")
-}
-
var nonUpdatableSystemServerJarsKey = android.NewOnceKey("nonUpdatableSystemServerJars")
// TODO: eliminate the superficial global config parameter by moving global config definition
// from java subpackage to dexpreopt.
func NonUpdatableSystemServerJars(ctx android.PathContext, global *GlobalConfig) []string {
return ctx.Config().Once(nonUpdatableSystemServerJarsKey, func() interface{} {
- return android.RemoveListFromList(global.SystemServerJars,
- android.GetJarsFromApexJarPairs(ctx, global.UpdatableSystemServerJars))
+ return android.RemoveListFromList(global.SystemServerJars, global.UpdatableSystemServerJars.CopyOfJars())
}).([]string)
}
diff --git a/java/aar.go b/java/aar.go
index ad9b5e7..778e1cd 100644
--- a/java/aar.go
+++ b/java/aar.go
@@ -625,7 +625,7 @@
}
func (a *AARImport) DepsMutator(ctx android.BottomUpMutatorContext) {
- if !ctx.Config().UnbundledBuildUsePrebuiltSdks() {
+ if !ctx.Config().AlwaysUsePrebuiltSdks() {
sdkDep := decodeSdkDep(ctx, sdkContext(a))
if sdkDep.useModule && sdkDep.frameworkResModule != "" {
ctx.AddVariationDependencies(nil, frameworkResTag, sdkDep.frameworkResModule)
@@ -641,9 +641,11 @@
var unzipAAR = pctx.AndroidStaticRule("unzipAAR",
blueprint.RuleParams{
Command: `rm -rf $outDir && mkdir -p $outDir && ` +
- `unzip -qoDD -d $outDir $in && rm -rf $outDir/res && touch $out`,
+ `unzip -qoDD -d $outDir $in && rm -rf $outDir/res && touch $out && ` +
+ `${config.MergeZipsCmd} $combinedClassesJar $$(ls $outDir/classes.jar 2> /dev/null) $$(ls $outDir/libs/*.jar 2> /dev/null)`,
+ CommandDeps: []string{"${config.MergeZipsCmd}"},
},
- "outDir")
+ "outDir", "combinedClassesJar")
func (a *AARImport) GenerateAndroidBuildActions(ctx android.ModuleContext) {
if len(a.properties.Aars) != 1 {
@@ -661,7 +663,7 @@
}
extractedAARDir := android.PathForModuleOut(ctx, "aar")
- a.classpathFile = extractedAARDir.Join(ctx, "classes.jar")
+ a.classpathFile = extractedAARDir.Join(ctx, "classes-combined.jar")
a.proguardFlags = extractedAARDir.Join(ctx, "proguard.txt")
a.manifest = extractedAARDir.Join(ctx, "AndroidManifest.xml")
@@ -671,7 +673,8 @@
Outputs: android.WritablePaths{a.classpathFile, a.proguardFlags, a.manifest},
Description: "unzip AAR",
Args: map[string]string{
- "outDir": extractedAARDir.String(),
+ "outDir": extractedAARDir.String(),
+ "combinedClassesJar": a.classpathFile.String(),
},
})
diff --git a/java/androidmk.go b/java/androidmk.go
index 081fcb2..bc327cf 100644
--- a/java/androidmk.go
+++ b/java/androidmk.go
@@ -127,8 +127,8 @@
entries.AddStrings("LOCAL_ADDITIONAL_CHECKED_MODULE", library.additionalCheckedModules.Strings()...)
}
- if library.proguardDictionary != nil {
- entries.SetPath("LOCAL_SOONG_PROGUARD_DICT", library.proguardDictionary)
+ if library.dexer.proguardDictionary.Valid() {
+ entries.SetPath("LOCAL_SOONG_PROGUARD_DICT", library.dexer.proguardDictionary.Path())
}
entries.SetString("LOCAL_MODULE_STEM", library.Stem())
@@ -332,8 +332,8 @@
if app.jacocoReportClassesFile != nil {
entries.SetPath("LOCAL_SOONG_JACOCO_REPORT_CLASSES_JAR", app.jacocoReportClassesFile)
}
- if app.proguardDictionary != nil {
- entries.SetPath("LOCAL_SOONG_PROGUARD_DICT", app.proguardDictionary)
+ if app.dexer.proguardDictionary.Valid() {
+ entries.SetPath("LOCAL_SOONG_PROGUARD_DICT", app.dexer.proguardDictionary.Path())
}
if app.Name() == "framework-res" {
@@ -559,15 +559,21 @@
// are created in make if only the api txt file is being generated. This is
// needed because an invalid output file would prevent the make entries from
// being written.
+ //
+ // Note that dstubs.apiFile can be also be nil if WITHOUT_CHECKS_API is true.
// TODO(b/146727827): Revert when we do not need to generate stubs and API separately.
- distFile := dstubs.apiFile
+
+ var distFiles android.TaggedDistFiles
+ if dstubs.apiFile != nil {
+ distFiles = android.MakeDefaultDistFiles(dstubs.apiFile)
+ }
outputFile := android.OptionalPathForPath(dstubs.stubsSrcJar)
if !outputFile.Valid() {
- outputFile = android.OptionalPathForPath(distFile)
+ outputFile = android.OptionalPathForPath(dstubs.apiFile)
}
return []android.AndroidMkEntries{android.AndroidMkEntries{
Class: "JAVA_LIBRARIES",
- DistFiles: android.MakeDefaultDistFiles(distFile),
+ DistFiles: distFiles,
OutputFile: outputFile,
Include: "$(BUILD_SYSTEM)/soong_droiddoc_prebuilt.mk",
ExtraEntries: []android.AndroidMkExtraEntriesFunc{
diff --git a/java/app.go b/java/app.go
index 1ede34e..e820048 100755
--- a/java/app.go
+++ b/java/app.go
@@ -588,11 +588,11 @@
func (a *AndroidApp) dexBuildActions(ctx android.ModuleContext) android.Path {
a.dexpreopter.installPath = a.installPath(ctx)
- if a.deviceProperties.Uncompress_dex == nil {
+ if a.dexProperties.Uncompress_dex == nil {
// If the value was not force-set by the user, use reasonable default based on the module.
- a.deviceProperties.Uncompress_dex = proptools.BoolPtr(a.shouldUncompressDex(ctx))
+ a.dexProperties.Uncompress_dex = proptools.BoolPtr(a.shouldUncompressDex(ctx))
}
- a.dexpreopter.uncompressedDex = *a.deviceProperties.Uncompress_dex
+ a.dexpreopter.uncompressedDex = *a.dexProperties.Uncompress_dex
a.dexpreopter.enforceUsesLibs = a.usesLibrary.enforceUsesLibraries()
a.dexpreopter.usesLibs = a.usesLibrary.usesLibraryProperties.Uses_libs
a.dexpreopter.optionalUsesLibs = a.usesLibrary.presentOptionalUsesLibs(ctx)
@@ -845,7 +845,7 @@
otherName := ctx.OtherModuleName(module)
tag := ctx.OtherModuleDependencyTag(module)
- if IsJniDepTag(tag) || tag == cc.SharedDepTag {
+ if IsJniDepTag(tag) || cc.IsSharedDepTag(tag) {
if dep, ok := module.(*cc.Module); ok {
if dep.IsNdk() || dep.IsStubs() {
return false
@@ -995,8 +995,8 @@
func AndroidAppFactory() android.Module {
module := &AndroidApp{}
- module.Module.deviceProperties.Optimize.EnabledByDefault = true
- module.Module.deviceProperties.Optimize.Shrink = proptools.BoolPtr(true)
+ module.Module.dexProperties.Optimize.EnabledByDefault = true
+ module.Module.dexProperties.Optimize.Shrink = proptools.BoolPtr(true)
module.Module.properties.Instrument = true
module.Module.properties.Installable = proptools.BoolPtr(true)
@@ -1110,7 +1110,7 @@
func AndroidTestFactory() android.Module {
module := &AndroidTest{}
- module.Module.deviceProperties.Optimize.EnabledByDefault = true
+ module.Module.dexProperties.Optimize.EnabledByDefault = true
module.Module.properties.Instrument = true
module.Module.properties.Installable = proptools.BoolPtr(true)
@@ -1161,7 +1161,7 @@
func AndroidTestHelperAppFactory() android.Module {
module := &AndroidTestHelperApp{}
- module.Module.deviceProperties.Optimize.EnabledByDefault = true
+ module.Module.dexProperties.Optimize.EnabledByDefault = true
module.Module.properties.Installable = proptools.BoolPtr(true)
module.appProperties.Use_embedded_native_libs = proptools.BoolPtr(true)
diff --git a/java/app_test.go b/java/app_test.go
index efb4fd2..a070318 100644
--- a/java/app_test.go
+++ b/java/app_test.go
@@ -531,16 +531,6 @@
system_shared_libs: [],
sdk_version: "29",
}
-
- ndk_prebuilt_object {
- name: "ndk_crtbegin_so.29",
- sdk_version: "29",
- }
-
- ndk_prebuilt_object {
- name: "ndk_crtend_so.29",
- sdk_version: "29",
- }
`
fs := map[string][]byte{
"prebuilts/ndk/current/platforms/android-29/arch-arm64/usr/lib/crtbegin_so.o": nil,
@@ -553,16 +543,28 @@
inputs := ctx.ModuleForTests("libjni", "android_arm64_armv8-a_sdk_shared").Description("link").Implicits
var crtbeginFound, crtendFound bool
+ expectedCrtBegin := ctx.ModuleForTests("crtbegin_so",
+ "android_arm64_armv8-a_sdk_29").Rule("partialLd").Output
+ expectedCrtEnd := ctx.ModuleForTests("crtend_so",
+ "android_arm64_armv8-a_sdk_29").Rule("partialLd").Output
+ implicits := []string{}
for _, input := range inputs {
- switch input.String() {
- case "prebuilts/ndk/current/platforms/android-29/arch-arm64/usr/lib/crtbegin_so.o":
+ implicits = append(implicits, input.String())
+ if strings.HasSuffix(input.String(), expectedCrtBegin.String()) {
crtbeginFound = true
- case "prebuilts/ndk/current/platforms/android-29/arch-arm64/usr/lib/crtend_so.o":
+ } else if strings.HasSuffix(input.String(), expectedCrtEnd.String()) {
crtendFound = true
}
}
- if !crtbeginFound || !crtendFound {
- t.Error("should link with ndk_crtbegin_so.29 and ndk_crtend_so.29")
+ if !crtbeginFound {
+ t.Error(fmt.Sprintf(
+ "expected implicit with suffix %q, have the following implicits:\n%s",
+ expectedCrtBegin, strings.Join(implicits, "\n")))
+ }
+ if !crtendFound {
+ t.Error(fmt.Sprintf(
+ "expected implicit with suffix %q, have the following implicits:\n%s",
+ expectedCrtEnd, strings.Join(implicits, "\n")))
}
}
@@ -2866,6 +2868,7 @@
config := testAppConfig(nil, bp, nil)
if unbundled {
config.TestProductVariables.Unbundled_build = proptools.BoolPtr(true)
+ config.TestProductVariables.Always_use_prebuilt_sdks = proptools.BoolPtr(true)
}
ctx := testContext()
diff --git a/java/config/config.go b/java/config/config.go
index d2f4513..2f39c99 100644
--- a/java/config/config.go
+++ b/java/config/config.go
@@ -128,7 +128,7 @@
pctx.HostBinToolVariable("ExtractApksCmd", "extract_apks")
pctx.VariableFunc("TurbineJar", func(ctx android.PackageVarContext) string {
turbine := "turbine.jar"
- if ctx.Config().UnbundledBuild() {
+ if ctx.Config().AlwaysUsePrebuiltSdks() {
return "prebuilts/build-tools/common/framework/" + turbine
} else {
return ctx.Config().HostJavaToolPath(ctx, turbine).String()
@@ -178,7 +178,7 @@
func hostBinToolVariableWithSdkToolsPrebuilt(name, tool string) {
pctx.VariableFunc(name, func(ctx android.PackageVarContext) string {
- if ctx.Config().UnbundledBuild() || ctx.Config().IsPdkBuild() {
+ if ctx.Config().AlwaysUsePrebuiltSdks() {
return filepath.Join("prebuilts/sdk/tools", runtime.GOOS, "bin", tool)
} else {
return ctx.Config().HostToolPath(ctx, tool).String()
@@ -188,7 +188,7 @@
func hostJavaToolVariableWithSdkToolsPrebuilt(name, tool string) {
pctx.VariableFunc(name, func(ctx android.PackageVarContext) string {
- if ctx.Config().UnbundledBuild() || ctx.Config().IsPdkBuild() {
+ if ctx.Config().AlwaysUsePrebuiltSdks() {
return filepath.Join("prebuilts/sdk/tools/lib", tool+".jar")
} else {
return ctx.Config().HostJavaToolPath(ctx, tool+".jar").String()
@@ -198,7 +198,7 @@
func hostJNIToolVariableWithSdkToolsPrebuilt(name, tool string) {
pctx.VariableFunc(name, func(ctx android.PackageVarContext) string {
- if ctx.Config().UnbundledBuild() || ctx.Config().IsPdkBuild() {
+ if ctx.Config().AlwaysUsePrebuiltSdks() {
ext := ".so"
if runtime.GOOS == "darwin" {
ext = ".dylib"
@@ -212,7 +212,7 @@
func hostBinToolVariableWithBuildToolsPrebuilt(name, tool string) {
pctx.VariableFunc(name, func(ctx android.PackageVarContext) string {
- if ctx.Config().UnbundledBuild() || ctx.Config().IsPdkBuild() {
+ if ctx.Config().AlwaysUsePrebuiltSdks() {
return filepath.Join("prebuilts/build-tools", ctx.Config().PrebuiltOS(), "bin", tool)
} else {
return ctx.Config().HostToolPath(ctx, tool).String()
diff --git a/java/dex.go b/java/dex.go
index 9e61e95..cd45a93 100644
--- a/java/dex.go
+++ b/java/dex.go
@@ -24,6 +24,60 @@
"android/soong/remoteexec"
)
+type DexProperties struct {
+ // If set to true, compile dex regardless of installable. Defaults to false.
+ Compile_dex *bool
+
+ // list of module-specific flags that will be used for dex compiles
+ Dxflags []string `android:"arch_variant"`
+
+ Optimize struct {
+ // If false, disable all optimization. Defaults to true for android_app and android_test
+ // modules, false for java_library and java_test modules.
+ Enabled *bool
+ // True if the module containing this has it set by default.
+ EnabledByDefault bool `blueprint:"mutated"`
+
+ // If true, optimize for size by removing unused code. Defaults to true for apps,
+ // false for libraries and tests.
+ Shrink *bool
+
+ // If true, optimize bytecode. Defaults to false.
+ Optimize *bool
+
+ // If true, obfuscate bytecode. Defaults to false.
+ Obfuscate *bool
+
+ // If true, do not use the flag files generated by aapt that automatically keep
+ // classes referenced by the app manifest. Defaults to false.
+ No_aapt_flags *bool
+
+ // Flags to pass to proguard.
+ Proguard_flags []string
+
+ // Specifies the locations of files containing proguard flags.
+ Proguard_flags_files []string `android:"path"`
+ }
+
+ // Keep the data uncompressed. We always need uncompressed dex for execution,
+ // so this might actually save space by avoiding storing the same data twice.
+ // This defaults to reasonable value based on module and should not be set.
+ // It exists only to support ART tests.
+ Uncompress_dex *bool
+}
+
+type dexer struct {
+ dexProperties DexProperties
+
+ // list of extra proguard flag files
+ extraProguardFlagFiles android.Paths
+ proguardDictionary android.OptionalPath
+}
+
+func (d *dexer) effectiveOptimizeEnabled() bool {
+ return BoolDefault(d.dexProperties.Optimize.Enabled, d.dexProperties.Optimize.EnabledByDefault)
+}
+
var d8, d8RE = remoteexec.MultiCommandStaticRules(pctx, "d8",
blueprint.RuleParams{
Command: `rm -rf "$outDir" && mkdir -p "$outDir" && ` +
@@ -86,8 +140,8 @@
},
}, []string{"outDir", "outDict", "r8Flags", "zipFlags"}, []string{"implicits"})
-func (j *Module) dexCommonFlags(ctx android.ModuleContext) []string {
- flags := j.deviceProperties.Dxflags
+func (d *dexer) dexCommonFlags(ctx android.ModuleContext, minSdkVersion sdkSpec) []string {
+ flags := d.dexProperties.Dxflags
// Translate all the DX flags to D8 ones until all the build files have been migrated
// to D8 flags. See: b/69377755
flags = android.RemoveListFromList(flags,
@@ -103,30 +157,27 @@
"--verbose")
}
- minSdkVersion, err := j.minSdkVersion().effectiveVersion(ctx)
+ effectiveVersion, err := minSdkVersion.effectiveVersion(ctx)
if err != nil {
ctx.PropertyErrorf("min_sdk_version", "%s", err)
}
- flags = append(flags, "--min-api "+minSdkVersion.asNumberString())
+ flags = append(flags, "--min-api "+effectiveVersion.asNumberString())
return flags
}
-func (j *Module) d8Flags(ctx android.ModuleContext, flags javaBuilderFlags) ([]string, android.Paths) {
- d8Flags := j.dexCommonFlags(ctx)
-
+func d8Flags(flags javaBuilderFlags) (d8Flags []string, d8Deps android.Paths) {
d8Flags = append(d8Flags, flags.bootClasspath.FormRepeatedClassPath("--lib ")...)
d8Flags = append(d8Flags, flags.classpath.FormRepeatedClassPath("--lib ")...)
- var d8Deps android.Paths
d8Deps = append(d8Deps, flags.bootClasspath...)
d8Deps = append(d8Deps, flags.classpath...)
return d8Flags, d8Deps
}
-func (j *Module) r8Flags(ctx android.ModuleContext, flags javaBuilderFlags) (r8Flags []string, r8Deps android.Paths) {
- opt := j.deviceProperties.Optimize
+func (d *dexer) r8Flags(ctx android.ModuleContext, flags javaBuilderFlags) (r8Flags []string, r8Deps android.Paths) {
+ opt := d.dexProperties.Optimize
// When an app contains references to APIs that are not in the SDK specified by
// its LOCAL_SDK_VERSION for example added by support library or by runtime
@@ -140,8 +191,6 @@
proguardRaiseDeps = append(proguardRaiseDeps, dep.(Dependency).HeaderJars()...)
})
- r8Flags = append(r8Flags, j.dexCommonFlags(ctx)...)
-
r8Flags = append(r8Flags, proguardRaiseDeps.FormJavaClassPath("-libraryjars"))
r8Flags = append(r8Flags, flags.bootClasspath.FormJavaClassPath("-libraryjars"))
r8Flags = append(r8Flags, flags.classpath.FormJavaClassPath("-libraryjars"))
@@ -154,15 +203,10 @@
android.PathForSource(ctx, "build/make/core/proguard.flags"),
}
- if j.shouldInstrumentStatic(ctx) {
- flagFiles = append(flagFiles,
- android.PathForSource(ctx, "build/make/core/proguard.jacoco.flags"))
- }
-
- flagFiles = append(flagFiles, j.extraProguardFlagFiles...)
+ flagFiles = append(flagFiles, d.extraProguardFlagFiles...)
// TODO(ccross): static android library proguard files
- flagFiles = append(flagFiles, android.PathsForModuleSrc(ctx, j.deviceProperties.Optimize.Proguard_flags_files)...)
+ flagFiles = append(flagFiles, android.PathsForModuleSrc(ctx, opt.Proguard_flags_files)...)
r8Flags = append(r8Flags, android.JoinWithPrefix(flagFiles.Strings(), "-include "))
r8Deps = append(r8Deps, flagFiles...)
@@ -171,7 +215,7 @@
r8Deps = append(r8Deps, android.PathForSource(ctx,
"build/make/core/proguard_basic_keeps.flags"))
- r8Flags = append(r8Flags, j.deviceProperties.Optimize.Proguard_flags...)
+ r8Flags = append(r8Flags, opt.Proguard_flags...)
// TODO(ccross): Don't shrink app instrumentation tests by default.
if !Bool(opt.Shrink) {
@@ -197,29 +241,30 @@
return r8Flags, r8Deps
}
-func (j *Module) compileDex(ctx android.ModuleContext, flags javaBuilderFlags,
+func (d *dexer) compileDex(ctx android.ModuleContext, flags javaBuilderFlags, minSdkVersion sdkSpec,
classesJar android.Path, jarName string) android.ModuleOutPath {
- useR8 := j.deviceProperties.EffectiveOptimizeEnabled()
-
// Compile classes.jar into classes.dex and then javalib.jar
javalibJar := android.PathForModuleOut(ctx, "dex", jarName)
outDir := android.PathForModuleOut(ctx, "dex")
zipFlags := "--ignore_missing_files"
- if proptools.Bool(j.deviceProperties.Uncompress_dex) {
+ if proptools.Bool(d.dexProperties.Uncompress_dex) {
zipFlags += " -L 0"
}
+ commonFlags := d.dexCommonFlags(ctx, minSdkVersion)
+
+ useR8 := d.effectiveOptimizeEnabled()
if useR8 {
proguardDictionary := android.PathForModuleOut(ctx, "proguard_dictionary")
- j.proguardDictionary = proguardDictionary
- r8Flags, r8Deps := j.r8Flags(ctx, flags)
+ d.proguardDictionary = android.OptionalPathForPath(proguardDictionary)
+ r8Flags, r8Deps := d.r8Flags(ctx, flags)
rule := r8
args := map[string]string{
- "r8Flags": strings.Join(r8Flags, " "),
+ "r8Flags": strings.Join(append(commonFlags, r8Flags...), " "),
"zipFlags": zipFlags,
- "outDict": j.proguardDictionary.String(),
+ "outDict": proguardDictionary.String(),
"outDir": outDir.String(),
}
if ctx.Config().IsEnvTrue("RBE_R8") {
@@ -236,7 +281,7 @@
Args: args,
})
} else {
- d8Flags, d8Deps := j.d8Flags(ctx, flags)
+ d8Flags, d8Deps := d8Flags(flags)
rule := d8
if ctx.Config().IsEnvTrue("RBE_D8") {
rule = d8RE
@@ -248,13 +293,13 @@
Input: classesJar,
Implicits: d8Deps,
Args: map[string]string{
- "d8Flags": strings.Join(d8Flags, " "),
+ "d8Flags": strings.Join(append(commonFlags, d8Flags...), " "),
"zipFlags": zipFlags,
"outDir": outDir.String(),
},
})
}
- if proptools.Bool(j.deviceProperties.Uncompress_dex) {
+ if proptools.Bool(d.dexProperties.Uncompress_dex) {
alignedJavalibJar := android.PathForModuleOut(ctx, "aligned", jarName)
TransformZipAlign(ctx, alignedJavalibJar, javalibJar)
javalibJar = alignedJavalibJar
diff --git a/java/dexpreopt_bootjars.go b/java/dexpreopt_bootjars.go
index 4120559..b445456 100644
--- a/java/dexpreopt_bootjars.go
+++ b/java/dexpreopt_bootjars.go
@@ -49,8 +49,8 @@
// Subdirectory where the image files are installed.
installSubdir string
- // The names of jars that constitute this image.
- modules []string
+ // A list of (location, jar) pairs for the Java modules in this image.
+ modules android.ConfiguredJarList
// File paths to jars.
dexPaths android.WritablePaths // for this image
@@ -113,16 +113,16 @@
// Dexpreopt on the boot class path produces multiple files. The first dex file
// is converted into 'name'.art (to match the legacy assumption that 'name'.art
// exists), and the rest are converted to 'name'-<jar>.art.
- _, m := android.SplitApexJarPair(ctx, image.modules[idx])
+ m := image.modules.Jar(idx)
name := image.stem
if idx != 0 || image.extends != nil {
- name += "-" + stemOf(m)
+ name += "-" + android.ModuleStem(m)
}
return name
}
func (image bootImageConfig) firstModuleNameOrStem(ctx android.PathContext) string {
- if len(image.modules) > 0 {
+ if image.modules.Len() > 0 {
return image.moduleName(ctx, 0)
} else {
return image.stem
@@ -130,8 +130,8 @@
}
func (image bootImageConfig) moduleFiles(ctx android.PathContext, dir android.OutputPath, exts ...string) android.OutputPaths {
- ret := make(android.OutputPaths, 0, len(image.modules)*len(exts))
- for i := range image.modules {
+ ret := make(android.OutputPaths, 0, image.modules.Len()*len(exts))
+ for i := 0; i < image.modules.Len(); i++ {
name := image.moduleName(ctx, i)
for _, ext := range exts {
ret = append(ret, dir.Join(ctx, name+ext))
@@ -253,7 +253,7 @@
}
name := ctx.ModuleName(module)
- index := android.IndexList(name, android.GetJarsFromApexJarPairs(ctx, image.modules))
+ index := image.modules.IndexOfJar(name)
if index == -1 {
return -1, nil
}
@@ -295,7 +295,7 @@
func buildBootImage(ctx android.SingletonContext, image *bootImageConfig) *bootImageConfig {
// Collect dex jar paths for the boot image modules.
// This logic is tested in the apex package to avoid import cycle apex <-> java.
- bootDexJars := make(android.Paths, len(image.modules))
+ bootDexJars := make(android.Paths, image.modules.Len())
ctx.VisitAllModules(func(module android.Module) {
if i, j := getBootImageJar(ctx, image, module); i != -1 {
bootDexJars[i] = j
@@ -306,7 +306,7 @@
// Ensure all modules were converted to paths
for i := range bootDexJars {
if bootDexJars[i] == nil {
- _, m := android.SplitApexJarPair(ctx, image.modules[i])
+ m := image.modules.Jar(i)
if ctx.Config().AllowMissingDependencies() {
missingDeps = append(missingDeps, m)
bootDexJars[i] = android.PathForOutput(ctx, "missing")
@@ -505,7 +505,7 @@
globalSoong := dexpreopt.GetCachedGlobalSoongConfig(ctx)
global := dexpreopt.GetGlobalConfig(ctx)
- if global.DisableGenerateProfile || ctx.Config().IsPdkBuild() || ctx.Config().UnbundledBuild() {
+ if global.DisableGenerateProfile || ctx.Config().UnbundledBuild() {
return nil
}
profile := ctx.Config().Once(bootImageProfileRuleKey, func() interface{} {
@@ -560,7 +560,7 @@
globalSoong := dexpreopt.GetCachedGlobalSoongConfig(ctx)
global := dexpreopt.GetGlobalConfig(ctx)
- if global.DisableGenerateProfile || ctx.Config().IsPdkBuild() || ctx.Config().UnbundledBuild() {
+ if global.DisableGenerateProfile || ctx.Config().UnbundledBuild() {
return nil
}
return ctx.Config().Once(bootFrameworkProfileRuleKey, func() interface{} {
@@ -602,13 +602,13 @@
var bootFrameworkProfileRuleKey = android.NewOnceKey("bootFrameworkProfileRule")
func updatableBcpPackagesRule(ctx android.SingletonContext, image *bootImageConfig, missingDeps []string) android.WritablePath {
- if ctx.Config().IsPdkBuild() || ctx.Config().UnbundledBuild() {
+ if ctx.Config().UnbundledBuild() {
return nil
}
return ctx.Config().Once(updatableBcpPackagesRuleKey, func() interface{} {
global := dexpreopt.GetGlobalConfig(ctx)
- updatableModules := android.GetJarsFromApexJarPairs(ctx, global.UpdatableBootJars)
+ updatableModules := global.UpdatableBootJars.CopyOfJars()
// Collect `permitted_packages` for updatable boot jars.
var updatablePackages []string
diff --git a/java/dexpreopt_bootjars_test.go b/java/dexpreopt_bootjars_test.go
index 9670c7f..4a8d3cd 100644
--- a/java/dexpreopt_bootjars_test.go
+++ b/java/dexpreopt_bootjars_test.go
@@ -48,7 +48,7 @@
pathCtx := android.PathContextForTesting(config)
dexpreoptConfig := dexpreopt.GlobalConfigForTests(pathCtx)
- dexpreoptConfig.BootJars = []string{"platform:foo", "platform:bar", "platform:baz"}
+ dexpreoptConfig.BootJars = android.CreateConfiguredJarList(pathCtx, []string{"platform:foo", "platform:bar", "platform:baz"})
dexpreopt.SetTestGlobalConfig(config, dexpreoptConfig)
ctx := testContext()
diff --git a/java/dexpreopt_config.go b/java/dexpreopt_config.go
index f13d9f2..f0d82ff 100644
--- a/java/dexpreopt_config.go
+++ b/java/dexpreopt_config.go
@@ -37,14 +37,12 @@
filepath.Join("/system/framework", m+".jar"))
}
// 2) The jars that are from an updatable apex.
- for _, m := range global.UpdatableSystemServerJars {
- systemServerClasspathLocations = append(systemServerClasspathLocations,
- dexpreopt.GetJarLocationFromApexJarPair(ctx, m))
- }
- if len(systemServerClasspathLocations) != len(global.SystemServerJars)+len(global.UpdatableSystemServerJars) {
+ systemServerClasspathLocations = append(systemServerClasspathLocations,
+ global.UpdatableSystemServerJars.DevicePaths(ctx.Config(), android.Android)...)
+ if len(systemServerClasspathLocations) != len(global.SystemServerJars)+global.UpdatableSystemServerJars.Len() {
panic(fmt.Errorf("Wrong number of system server jars, got %d, expected %d",
len(systemServerClasspathLocations),
- len(global.SystemServerJars)+len(global.UpdatableSystemServerJars)))
+ len(global.SystemServerJars)+global.UpdatableSystemServerJars.Len()))
}
return systemServerClasspathLocations
})
@@ -69,39 +67,6 @@
return targets
}
-func stemOf(moduleName string) string {
- // b/139391334: the stem of framework-minus-apex is framework
- // This is hard coded here until we find a good way to query the stem
- // of a module before any other mutators are run
- if moduleName == "framework-minus-apex" {
- return "framework"
- }
- return moduleName
-}
-
-func getDexLocation(ctx android.PathContext, target android.Target, module string) string {
- apex, jar := android.SplitApexJarPair(ctx, module)
-
- name := stemOf(jar) + ".jar"
-
- var subdir string
- if apex == "platform" {
- // Special apex name "platform" denotes jars do not come from an apex, but are part
- // of the platform. Such jars are installed on the /system partition on device.
- subdir = "system/framework"
- } else if apex == "system_ext" {
- subdir = "system_ext/framework"
- } else {
- subdir = filepath.Join("apex", apex, "javalib")
- }
-
- if target.Os.Class == android.Host {
- return filepath.Join(ctx.Config().Getenv("OUT_DIR"), "host", ctx.Config().PrebuiltOS(), subdir, name)
- } else {
- return filepath.Join("/", subdir, name)
- }
-}
-
var (
bootImageConfigKey = android.NewOnceKey("bootImageConfig")
artBootImageName = "art"
@@ -116,12 +81,13 @@
targets := dexpreoptTargets(ctx)
deviceDir := android.PathForOutput(ctx, ctx.Config().DeviceName())
- artModules := global.ArtApexJars
+ artModules := global.ArtApexJars.CopyOf()
// With EMMA_INSTRUMENT_FRAMEWORK=true the Core libraries depend on jacoco.
if ctx.Config().IsEnvTrue("EMMA_INSTRUMENT_FRAMEWORK") {
- artModules = append(artModules, "com.android.art:jacocoagent")
+ artModules.Append("com.android.art", "jacocoagent")
}
- frameworkModules := android.RemoveListFromList(global.BootJars, artModules)
+ frameworkModules := global.BootJars.CopyOf()
+ frameworkModules.RemoveList(artModules)
artSubdir := "apex/com.android.art/javalib"
frameworkSubdir := "system/framework"
@@ -163,10 +129,7 @@
// Set up known paths for them, the singleton rules will copy them there.
// TODO(b/143682396): use module dependencies instead
inputDir := deviceDir.Join(ctx, "dex_"+c.name+"jars_input")
- for _, m := range c.modules {
- _, jar := android.SplitApexJarPair(ctx, m)
- c.dexPaths = append(c.dexPaths, inputDir.Join(ctx, stemOf(jar)+".jar"))
- }
+ c.dexPaths = c.modules.BuildPaths(ctx, inputDir)
c.dexPathsDeps = c.dexPaths
// Create target-specific variants.
@@ -178,9 +141,7 @@
target: target,
images: imageDir.Join(ctx, imageName),
imagesDeps: c.moduleFiles(ctx, imageDir, ".art", ".oat", ".vdex"),
- }
- for _, m := range c.modules {
- variant.dexLocations = append(variant.dexLocations, getDexLocation(ctx, target, m))
+ dexLocations: c.modules.DevicePaths(ctx.Config(), target.Os),
}
variant.dexLocationsDeps = variant.dexLocations
c.variants = append(c.variants, variant)
@@ -213,10 +174,7 @@
global := dexpreopt.GetGlobalConfig(ctx)
image := defaultBootImageConfig(ctx)
- updatableBootclasspath := make([]string, len(global.UpdatableBootJars))
- for i, p := range global.UpdatableBootJars {
- updatableBootclasspath[i] = dexpreopt.GetJarLocationFromApexJarPair(ctx, p)
- }
+ updatableBootclasspath := global.UpdatableBootJars.DevicePaths(ctx.Config(), android.Android)
bootclasspath := append(copyOf(image.getAnyAndroidVariant().dexLocationsDeps), updatableBootclasspath...)
return bootclasspath
@@ -236,5 +194,5 @@
ctx.Strict("PRODUCT_DEX2OAT_BOOTCLASSPATH", strings.Join(defaultBootImageConfig(ctx).getAnyAndroidVariant().dexLocationsDeps, ":"))
ctx.Strict("PRODUCT_SYSTEM_SERVER_CLASSPATH", strings.Join(systemServerClasspath(ctx), ":"))
- ctx.Strict("DEXPREOPT_BOOT_JARS_MODULES", strings.Join(defaultBootImageConfig(ctx).modules, ":"))
+ ctx.Strict("DEXPREOPT_BOOT_JARS_MODULES", strings.Join(defaultBootImageConfig(ctx).modules.CopyOfApexJarPairs(), ":"))
}
diff --git a/java/droiddoc.go b/java/droiddoc.go
index d2f8d83..4c5f66c 100644
--- a/java/droiddoc.go
+++ b/java/droiddoc.go
@@ -294,6 +294,9 @@
// the dirs which Metalava extracts API levels annotations from.
Api_levels_annotations_dirs []string
+ // the filename which Metalava extracts API levels annotations from. Defaults to android.jar.
+ Api_levels_jar_filename *string
+
// if set to true, collect the values used by the Dev tools and
// write them in files packaged with the SDK. Defaults to false.
Write_sdk_values *bool
@@ -1078,9 +1081,7 @@
rule.Build(pctx, ctx, "javadoc", desc)
- if apiCheckEnabled(ctx, d.properties.Check_api.Current, "current") &&
- !ctx.Config().IsPdkBuild() {
-
+ if apiCheckEnabled(ctx, d.properties.Check_api.Current, "current") {
apiFile := android.PathForModuleSrc(ctx, String(d.properties.Check_api.Current.Api_file))
removedApiFile := android.PathForModuleSrc(ctx, String(d.properties.Check_api.Current.Removed_api_file))
@@ -1147,9 +1148,7 @@
rule.Build(pctx, ctx, "doclavaCurrentApiUpdate", "update current API")
}
- if apiCheckEnabled(ctx, d.properties.Check_api.Last_released, "last_released") &&
- !ctx.Config().IsPdkBuild() {
-
+ if apiCheckEnabled(ctx, d.properties.Check_api.Last_released, "last_released") {
apiFile := android.PathForModuleSrc(ctx, String(d.properties.Check_api.Last_released.Api_file))
removedApiFile := android.PathForModuleSrc(ctx, String(d.properties.Check_api.Last_released.Removed_api_file))
@@ -1407,38 +1406,41 @@
}
func (d *Droidstubs) apiLevelsAnnotationsFlags(ctx android.ModuleContext, cmd *android.RuleBuilderCommand) {
- if Bool(d.properties.Api_levels_annotations_enabled) {
- d.apiVersionsXml = android.PathForModuleOut(ctx, "api-versions.xml")
-
- if len(d.properties.Api_levels_annotations_dirs) == 0 {
- ctx.PropertyErrorf("api_levels_annotations_dirs",
- "has to be non-empty if api levels annotations was enabled!")
- }
-
- cmd.FlagWithOutput("--generate-api-levels ", d.apiVersionsXml)
- cmd.FlagWithInput("--apply-api-levels ", d.apiVersionsXml)
- cmd.FlagWithArg("--current-version ", ctx.Config().PlatformSdkVersion())
- cmd.FlagWithArg("--current-codename ", ctx.Config().PlatformSdkCodename())
-
- ctx.VisitDirectDepsWithTag(metalavaAPILevelsAnnotationsDirTag, func(m android.Module) {
- if t, ok := m.(*ExportedDroiddocDir); ok {
- for _, dep := range t.deps {
- if strings.HasSuffix(dep.String(), "android.jar") {
- cmd.Implicit(dep)
- }
- }
- cmd.FlagWithArg("--android-jar-pattern ", t.dir.String()+"/%/public/android.jar")
- } else {
- ctx.PropertyErrorf("api_levels_annotations_dirs",
- "module %q is not a metalava api-levels-annotations dir", ctx.OtherModuleName(m))
- }
- })
-
+ if !Bool(d.properties.Api_levels_annotations_enabled) {
+ return
}
+
+ d.apiVersionsXml = android.PathForModuleOut(ctx, "api-versions.xml")
+
+ if len(d.properties.Api_levels_annotations_dirs) == 0 {
+ ctx.PropertyErrorf("api_levels_annotations_dirs",
+ "has to be non-empty if api levels annotations was enabled!")
+ }
+
+ cmd.FlagWithOutput("--generate-api-levels ", d.apiVersionsXml)
+ cmd.FlagWithInput("--apply-api-levels ", d.apiVersionsXml)
+ cmd.FlagWithArg("--current-version ", ctx.Config().PlatformSdkVersion())
+ cmd.FlagWithArg("--current-codename ", ctx.Config().PlatformSdkCodename())
+
+ filename := proptools.StringDefault(d.properties.Api_levels_jar_filename, "android.jar")
+
+ ctx.VisitDirectDepsWithTag(metalavaAPILevelsAnnotationsDirTag, func(m android.Module) {
+ if t, ok := m.(*ExportedDroiddocDir); ok {
+ for _, dep := range t.deps {
+ if strings.HasSuffix(dep.String(), filename) {
+ cmd.Implicit(dep)
+ }
+ }
+ cmd.FlagWithArg("--android-jar-pattern ", t.dir.String()+"/%/public/"+filename)
+ } else {
+ ctx.PropertyErrorf("api_levels_annotations_dirs",
+ "module %q is not a metalava api-levels-annotations dir", ctx.OtherModuleName(m))
+ }
+ })
}
func (d *Droidstubs) apiToXmlFlags(ctx android.ModuleContext, cmd *android.RuleBuilderCommand) {
- if Bool(d.properties.Jdiff_enabled) && !ctx.Config().IsPdkBuild() && d.apiFile != nil {
+ if Bool(d.properties.Jdiff_enabled) && d.apiFile != nil {
if d.apiFile.String() == "" {
ctx.ModuleErrorf("API signature file has to be specified in Metalava when jdiff is enabled.")
}
@@ -1586,7 +1588,7 @@
// Add API lint options.
- if BoolDefault(d.properties.Check_api.Api_lint.Enabled, false) && !ctx.Config().IsPdkBuild() {
+ if BoolDefault(d.properties.Check_api.Api_lint.Enabled, false) {
doApiLint = true
newSince := android.OptionalPathForModuleSrc(ctx, d.properties.Check_api.Api_lint.New_since)
@@ -1644,8 +1646,7 @@
// Add "check released" options. (Detect incompatible API changes from the last public release)
- if apiCheckEnabled(ctx, d.properties.Check_api.Last_released, "last_released") &&
- !ctx.Config().IsPdkBuild() {
+ if apiCheckEnabled(ctx, d.properties.Check_api.Last_released, "last_released") {
doCheckReleased = true
if len(d.Javadoc.properties.Out) > 0 {
@@ -1722,8 +1723,7 @@
rule.Build(pctx, ctx, "metalava", "metalava merged")
- if apiCheckEnabled(ctx, d.properties.Check_api.Current, "current") &&
- !ctx.Config().IsPdkBuild() {
+ if apiCheckEnabled(ctx, d.properties.Check_api.Current, "current") {
if len(d.Javadoc.properties.Out) > 0 {
ctx.PropertyErrorf("out", "out property may not be combined with check_api")
@@ -1837,7 +1837,7 @@
rule.Build(pctx, ctx, "nullabilityWarningsCheck", "nullability warnings check")
}
- if Bool(d.properties.Jdiff_enabled) && !ctx.Config().IsPdkBuild() {
+ if Bool(d.properties.Jdiff_enabled) {
if len(d.Javadoc.properties.Out) > 0 {
ctx.PropertyErrorf("out", "out property may not be combined with jdiff")
}
diff --git a/java/hiddenapi_singleton.go b/java/hiddenapi_singleton.go
index 7afba2a..ea3fbda 100644
--- a/java/hiddenapi_singleton.go
+++ b/java/hiddenapi_singleton.go
@@ -43,7 +43,7 @@
return hiddenAPISingletonPathsStruct{
flags: android.PathForOutput(ctx, "hiddenapi", "hiddenapi-flags.csv"),
index: android.PathForOutput(ctx, "hiddenapi", "hiddenapi-index.csv"),
- metadata: android.PathForOutput(ctx, "hiddenapi", "hiddenapi-greylist.csv"),
+ metadata: android.PathForOutput(ctx, "hiddenapi", "hiddenapi-unsupported.csv"),
stubFlags: android.PathForOutput(ctx, "hiddenapi", "hiddenapi-stub-flags.txt"),
}
}).(hiddenAPISingletonPathsStruct)
@@ -100,7 +100,7 @@
// Add the android.test.base to the set of stubs only if the android.test.base module is on
// the boot jars list as the runtime will only enforce hiddenapi access against modules on
// that list.
- if inList("android.test.base", ctx.Config().BootJars()) && !ctx.Config().UnbundledBuildUsePrebuiltSdks() {
+ if inList("android.test.base", ctx.Config().BootJars()) && !ctx.Config().AlwaysUsePrebuiltSdks() {
publicStubModules = append(publicStubModules, "android.test.base.stubs")
}
@@ -248,18 +248,18 @@
FlagWithInput("--csv ", stubFlags).
Inputs(flagsCSV).
FlagWithInput("--unsupported ",
- android.PathForSource(ctx, "frameworks/base/config/hiddenapi-greylist.txt")).
+ android.PathForSource(ctx, "frameworks/base/config/hiddenapi-unsupported.txt")).
FlagWithInput("--unsupported-ignore-conflicts ", combinedRemovedApis).
FlagWithInput("--max-target-q ",
- android.PathForSource(ctx, "frameworks/base/config/hiddenapi-greylist-max-q.txt")).
+ android.PathForSource(ctx, "frameworks/base/config/hiddenapi-max-target-q.txt")).
FlagWithInput("--max-target-p ",
- android.PathForSource(ctx, "frameworks/base/config/hiddenapi-greylist-max-p.txt")).
+ android.PathForSource(ctx, "frameworks/base/config/hiddenapi-max-target-p.txt")).
FlagWithInput("--max-target-o-ignore-conflicts ",
- android.PathForSource(ctx, "frameworks/base/config/hiddenapi-greylist-max-o.txt")).
+ android.PathForSource(ctx, "frameworks/base/config/hiddenapi-max-target-o.txt")).
FlagWithInput("--blocked ",
- android.PathForSource(ctx, "frameworks/base/config/hiddenapi-force-blacklist.txt")).
+ android.PathForSource(ctx, "frameworks/base/config/hiddenapi-force-blocked.txt")).
FlagWithInput("--unsupported-packages ",
- android.PathForSource(ctx, "frameworks/base/config/hiddenapi-greylist-packages.txt")).
+ android.PathForSource(ctx, "frameworks/base/config/hiddenapi-unsupported-packages.txt")).
FlagWithOutput("--output ", tempPath)
commitChangeForRestat(rule, tempPath, outputPath)
@@ -284,7 +284,7 @@
return outputPath
}
-// metadataRule creates a rule to build hiddenapi-greylist.csv out of the metadata.csv files generated for boot image
+// metadataRule creates a rule to build hiddenapi-unsupported.csv out of the metadata.csv files generated for boot image
// modules.
func metadataRule(ctx android.SingletonContext) android.Path {
var metadataCSV android.Paths
diff --git a/java/java.go b/java/java.go
index bd476bc..d5375a5 100644
--- a/java/java.go
+++ b/java/java.go
@@ -264,9 +264,6 @@
}
type CompilerDeviceProperties struct {
- // list of module-specific flags that will be used for dex compiles
- Dxflags []string `android:"arch_variant"`
-
// if not blank, set to the version of the sdk to compile against.
// Defaults to compiling against the current platform.
Sdk_version *string
@@ -312,37 +309,6 @@
}
}
- // If set to true, compile dex regardless of installable. Defaults to false.
- Compile_dex *bool
-
- Optimize struct {
- // If false, disable all optimization. Defaults to true for android_app and android_test
- // modules, false for java_library and java_test modules.
- Enabled *bool
- // True if the module containing this has it set by default.
- EnabledByDefault bool `blueprint:"mutated"`
-
- // If true, optimize for size by removing unused code. Defaults to true for apps,
- // false for libraries and tests.
- Shrink *bool
-
- // If true, optimize bytecode. Defaults to false.
- Optimize *bool
-
- // If true, obfuscate bytecode. Defaults to false.
- Obfuscate *bool
-
- // If true, do not use the flag files generated by aapt that automatically keep
- // classes referenced by the app manifest. Defaults to false.
- No_aapt_flags *bool
-
- // Flags to pass to proguard.
- Proguard_flags []string
-
- // Specifies the locations of files containing proguard flags.
- Proguard_flags_files []string `android:"path"`
- }
-
// When targeting 1.9 and above, override the modules to use with --system,
// otherwise provides defaults libraries to add to the bootclasspath.
System_modules *string
@@ -356,19 +322,9 @@
// set the name of the output
Stem *string
- // Keep the data uncompressed. We always need uncompressed dex for execution,
- // so this might actually save space by avoiding storing the same data twice.
- // This defaults to reasonable value based on module and should not be set.
- // It exists only to support ART tests.
- Uncompress_dex *bool
-
IsSDKLibrary bool `blueprint:"mutated"`
}
-func (me *CompilerDeviceProperties) EffectiveOptimizeEnabled() bool {
- return BoolDefault(me.Optimize.Enabled, me.Optimize.EnabledByDefault)
-}
-
// Functionality common to Module and Import
//
// It is embedded in Module so its functionality can be used by methods in Module
@@ -437,9 +393,6 @@
// output file containing uninstrumented classes that will be instrumented by jacoco
jacocoReportClassesFile android.Path
- // output file containing mapping of obfuscated names
- proguardDictionary android.Path
-
// output file of the module, which may be a classes jar or a dex jar
outputFile android.Path
extraOutputFiles android.Paths
@@ -455,9 +408,6 @@
compiledJavaSrcs android.Paths
compiledSrcJars android.Paths
- // list of extra progurad flag files
- extraProguardFlagFiles android.Paths
-
// manifest file to use instead of properties.Manifest
overrideManifest android.OptionalPath
@@ -484,6 +434,7 @@
extraResources android.Paths
hiddenAPI
+ dexer
dexpreopter
linter
@@ -507,6 +458,7 @@
j.addHostProperties()
j.AddProperties(
&j.deviceProperties,
+ &j.dexer.dexProperties,
&j.dexpreoptProperties,
&j.linter.properties,
)
@@ -519,7 +471,10 @@
case ".jar":
return android.Paths{j.implementationAndResourcesJar}, nil
case ".proguard_map":
- return android.Paths{j.proguardDictionary}, nil
+ if j.dexer.proguardDictionary.Valid() {
+ return android.Paths{j.dexer.proguardDictionary.Path()}, nil
+ }
+ return nil, fmt.Errorf("%q was requested, but no output file was found.", tag)
default:
return nil, fmt.Errorf("unsupported module reference tag %q", tag)
}
@@ -728,10 +683,10 @@
ctx.AddVariationDependencies(nil, bootClasspathTag, sdkDep.bootclasspath...)
ctx.AddVariationDependencies(nil, java9LibTag, sdkDep.java9Classpath...)
ctx.AddVariationDependencies(nil, libTag, sdkDep.classpath...)
- if j.deviceProperties.EffectiveOptimizeEnabled() && sdkDep.hasStandardLibs() {
+ if j.effectiveOptimizeEnabled() && sdkDep.hasStandardLibs() {
ctx.AddVariationDependencies(nil, proguardRaiseTag, config.LegacyCorePlatformBootclasspathLibraries...)
}
- if j.deviceProperties.EffectiveOptimizeEnabled() && sdkDep.hasFrameworkLibs() {
+ if j.effectiveOptimizeEnabled() && sdkDep.hasFrameworkLibs() {
ctx.AddVariationDependencies(nil, proguardRaiseTag, config.FrameworkLibraries...)
}
}
@@ -1647,8 +1602,8 @@
// Enable dex compilation for the APEX variants, unless it is disabled explicitly
if android.DirectlyInAnyApex(ctx, ctx.ModuleName()) && !j.IsForPlatform() {
- if j.deviceProperties.Compile_dex == nil {
- j.deviceProperties.Compile_dex = proptools.BoolPtr(true)
+ if j.dexProperties.Compile_dex == nil {
+ j.dexProperties.Compile_dex = proptools.BoolPtr(true)
}
if j.deviceProperties.Hostdex == nil {
j.deviceProperties.Hostdex = proptools.BoolPtr(true)
@@ -1656,10 +1611,14 @@
}
if ctx.Device() && j.hasCode(ctx) &&
- (Bool(j.properties.Installable) || Bool(j.deviceProperties.Compile_dex)) {
+ (Bool(j.properties.Installable) || Bool(j.dexProperties.Compile_dex)) {
+ if j.shouldInstrumentStatic(ctx) {
+ j.dexer.extraProguardFlagFiles = append(j.dexer.extraProguardFlagFiles,
+ android.PathForSource(ctx, "build/make/core/proguard.jacoco.flags"))
+ }
// Dex compilation
var dexOutputFile android.ModuleOutPath
- dexOutputFile = j.compileDex(ctx, flags, outputFile, jarName)
+ dexOutputFile = j.dexer.compileDex(ctx, flags, j.minSdkVersion(), outputFile, jarName)
if ctx.Failed() {
return
}
@@ -1669,7 +1628,7 @@
// Hidden API CSV generation and dex encoding
dexOutputFile = j.hiddenAPI.hiddenAPI(ctx, configurationName, primary, dexOutputFile, j.implementationJarFile,
- proptools.Bool(j.deviceProperties.Uncompress_dex))
+ proptools.Bool(j.dexProperties.Uncompress_dex))
// merge dex jar with resources if necessary
if j.resourceJar != nil {
@@ -1677,7 +1636,7 @@
combinedJar := android.PathForModuleOut(ctx, "dex-withres", jarName)
TransformJarsToJar(ctx, combinedJar, "for dex resources", jars, android.OptionalPath{},
false, nil, nil)
- if *j.deviceProperties.Uncompress_dex {
+ if *j.dexProperties.Uncompress_dex {
combinedAlignedJar := android.PathForModuleOut(ctx, "dex-withres-aligned", jarName)
TransformZipAlign(ctx, combinedAlignedJar, combinedJar)
dexOutputFile = combinedAlignedJar
@@ -2008,11 +1967,11 @@
j.checkSdkVersions(ctx)
j.dexpreopter.installPath = android.PathForModuleInstall(ctx, "framework", j.Stem()+".jar")
j.dexpreopter.isSDKLibrary = j.deviceProperties.IsSDKLibrary
- if j.deviceProperties.Uncompress_dex == nil {
+ if j.dexProperties.Uncompress_dex == nil {
// If the value was not force-set by the user, use reasonable default based on the module.
- j.deviceProperties.Uncompress_dex = proptools.BoolPtr(shouldUncompressDex(ctx, &j.dexpreopter))
+ j.dexProperties.Uncompress_dex = proptools.BoolPtr(shouldUncompressDex(ctx, &j.dexpreopter))
}
- j.dexpreopter.uncompressedDex = *j.deviceProperties.Uncompress_dex
+ j.dexpreopter.uncompressedDex = *j.dexProperties.Uncompress_dex
j.compile(ctx, nil)
// Collect the module directory for IDE info in java/jdeps.go.
@@ -2970,6 +2929,7 @@
module.AddProperties(
&CompilerProperties{},
&CompilerDeviceProperties{},
+ &DexProperties{},
&DexpreoptProperties{},
&android.ProtoProperties{},
&aaptProperties{},
diff --git a/java/java_test.go b/java/java_test.go
index a3c7854..50c40c3 100644
--- a/java/java_test.go
+++ b/java/java_test.go
@@ -1170,6 +1170,62 @@
`)
}
+func TestDroidstubs(t *testing.T) {
+ ctx, _ := testJavaWithFS(t, `
+ droiddoc_exported_dir {
+ name: "droiddoc-templates-sdk",
+ path: ".",
+ }
+
+ droidstubs {
+ name: "bar-stubs",
+ srcs: [
+ "bar-doc/a.java",
+ ],
+ api_levels_annotations_dirs: [
+ "droiddoc-templates-sdk",
+ ],
+ api_levels_annotations_enabled: true,
+ }
+
+ droidstubs {
+ name: "bar-stubs-other",
+ srcs: [
+ "bar-doc/a.java",
+ ],
+ api_levels_annotations_dirs: [
+ "droiddoc-templates-sdk",
+ ],
+ api_levels_annotations_enabled: true,
+ api_levels_jar_filename: "android.other.jar",
+ }
+ `,
+ map[string][]byte{
+ "bar-doc/a.java": nil,
+ })
+ testcases := []struct {
+ moduleName string
+ expectedJarFilename string
+ }{
+ {
+ moduleName: "bar-stubs",
+ expectedJarFilename: "android.jar",
+ },
+ {
+ moduleName: "bar-stubs-other",
+ expectedJarFilename: "android.other.jar",
+ },
+ }
+ for _, c := range testcases {
+ m := ctx.ModuleForTests(c.moduleName, "android_common")
+ metalava := m.Rule("metalava")
+ expected := "--android-jar-pattern ./%/public/" + c.expectedJarFilename
+ if actual := metalava.RuleParams.Command; !strings.Contains(actual, expected) {
+ t.Errorf("For %q, expected metalava argument %q, but was not found %q", c.moduleName, expected, actual)
+ }
+ }
+}
+
func TestDroidstubsWithSystemModules(t *testing.T) {
ctx, _ := testJava(t, `
droidstubs {
diff --git a/java/lint.go b/java/lint.go
index 1bf7f69..b37f692 100644
--- a/java/lint.go
+++ b/java/lint.go
@@ -309,7 +309,7 @@
rule.Command().Text("mkdir -p").Flag(cacheDir.String()).Flag(homeDir.String())
var annotationsZipPath, apiVersionsXMLPath android.Path
- if ctx.Config().UnbundledBuildUsePrebuiltSdks() {
+ if ctx.Config().AlwaysUsePrebuiltSdks() {
annotationsZipPath = android.PathForSource(ctx, "prebuilts/sdk/current/public/data/annotations.zip")
apiVersionsXMLPath = android.PathForSource(ctx, "prebuilts/sdk/current/public/data/api-versions.xml")
} else {
@@ -319,7 +319,7 @@
cmd := rule.Command().
Text("(").
- Flag("JAVA_OPTS=-Xmx2048m").
+ Flag("JAVA_OPTS=-Xmx3072m").
FlagWithArg("ANDROID_SDK_HOME=", homeDir.String()).
FlagWithInput("SDK_ANNOTATIONS=", annotationsZipPath).
FlagWithInput("LINT_OPTS=-DLINT_API_DATABASE=", apiVersionsXMLPath).
@@ -395,7 +395,7 @@
}
func (l *lintSingleton) copyLintDependencies(ctx android.SingletonContext) {
- if ctx.Config().UnbundledBuildUsePrebuiltSdks() {
+ if ctx.Config().AlwaysUsePrebuiltSdks() {
return
}
diff --git a/java/robolectric.go b/java/robolectric.go
index 4d68fd9..3fe6626 100644
--- a/java/robolectric.go
+++ b/java/robolectric.go
@@ -357,7 +357,7 @@
var _ android.TestSuiteModule = (*robolectricRuntimes)(nil)
func (r *robolectricRuntimes) DepsMutator(ctx android.BottomUpMutatorContext) {
- if !ctx.Config().UnbundledBuildUsePrebuiltSdks() && r.props.Lib != nil {
+ if !ctx.Config().AlwaysUsePrebuiltSdks() && r.props.Lib != nil {
ctx.AddVariationDependencies(nil, libTag, String(r.props.Lib))
}
}
@@ -371,8 +371,16 @@
r.runtimes = append(r.runtimes, installedRuntime)
}
- if !ctx.Config().UnbundledBuildUsePrebuiltSdks() && r.props.Lib != nil {
+ if !ctx.Config().AlwaysUsePrebuiltSdks() && r.props.Lib != nil {
runtimeFromSourceModule := ctx.GetDirectDepWithTag(String(r.props.Lib), libTag)
+ if runtimeFromSourceModule == nil {
+ if ctx.Config().AllowMissingDependencies() {
+ ctx.AddMissingDependencies([]string{String(r.props.Lib)})
+ } else {
+ ctx.PropertyErrorf("lib", "missing dependency %q", String(r.props.Lib))
+ }
+ return
+ }
runtimeFromSourceJar := android.OutputFileForModule(ctx, runtimeFromSourceModule, "")
runtimeName := fmt.Sprintf("android-all-%s-robolectric-r0.jar",
diff --git a/java/sdk.go b/java/sdk.go
index 5d79d1d..b44cd8e1 100644
--- a/java/sdk.go
+++ b/java/sdk.go
@@ -53,7 +53,7 @@
func UseApiFingerprint(ctx android.BaseModuleContext) bool {
if ctx.Config().UnbundledBuild() &&
- !ctx.Config().UnbundledBuildUsePrebuiltSdks() &&
+ !ctx.Config().AlwaysUsePrebuiltSdks() &&
ctx.Config().IsEnvTrue("UNBUNDLED_BUILD_TARGET_SDK_WITH_API_FINGERPRINT") {
return true
}
@@ -191,28 +191,11 @@
return s.kind != sdkPrivate && s.kind != sdkNone && s.kind != sdkCorePlatform
}
-// forPdkBuild converts this sdkSpec into another sdkSpec that is for the PDK builds.
-func (s sdkSpec) forPdkBuild(ctx android.EarlyModuleContext) sdkSpec {
- // For PDK builds, use the latest SDK version instead of "current" or ""
- if s.kind == sdkPrivate || s.kind == sdkPublic {
- kind := s.kind
- if kind == sdkPrivate {
- // We don't have prebuilt SDK for private APIs, so use the public SDK
- // instead. This looks odd, but that's how it has been done.
- // TODO(b/148271073): investigate the need for this.
- kind = sdkPublic
- }
- version := sdkVersion(LatestSdkVersionInt(ctx))
- return sdkSpec{kind, version, s.raw}
- }
- return s
-}
-
// usePrebuilt determines whether prebuilt SDK should be used for this sdkSpec with the given context.
func (s sdkSpec) usePrebuilt(ctx android.EarlyModuleContext) bool {
if s.version.isCurrent() {
// "current" can be built from source and be from prebuilt SDK
- return ctx.Config().UnbundledBuildUsePrebuiltSdks()
+ return ctx.Config().AlwaysUsePrebuiltSdks()
} else if s.version.isNumbered() {
// validation check
if s.kind != sdkPublic && s.kind != sdkSystem && s.kind != sdkTest {
@@ -233,9 +216,6 @@
if !s.valid() {
return s.version, fmt.Errorf("invalid sdk version %q", s.raw)
}
- if ctx.Config().IsPdkBuild() {
- s = s.forPdkBuild(ctx)
- }
if s.version.isNumbered() {
return s.version, nil
}
@@ -350,9 +330,6 @@
return sdkDep{}
}
- if ctx.Config().IsPdkBuild() {
- sdkVersion = sdkVersion.forPdkBuild(ctx)
- }
if !sdkVersion.validateSystemSdk(ctx) {
return sdkDep{}
}
@@ -511,7 +488,7 @@
type sdkSingleton struct{}
func (sdkSingleton) GenerateBuildActions(ctx android.SingletonContext) {
- if ctx.Config().UnbundledBuildUsePrebuiltSdks() || ctx.Config().IsPdkBuild() {
+ if ctx.Config().AlwaysUsePrebuiltSdks() {
return
}
@@ -631,10 +608,7 @@
if ctx.Config().PlatformSdkCodename() == "REL" {
cmd.Text("echo REL >").Output(out)
- } else if ctx.Config().IsPdkBuild() {
- // TODO: get this from the PDK artifacts?
- cmd.Text("echo PDK >").Output(out)
- } else if !ctx.Config().UnbundledBuildUsePrebuiltSdks() {
+ } else if !ctx.Config().AlwaysUsePrebuiltSdks() {
in, err := ctx.GlobWithDeps("frameworks/base/api/*current.txt", nil)
if err != nil {
ctx.Errorf("error globbing API files: %s", err)
@@ -663,7 +637,7 @@
}
func sdkMakeVars(ctx android.MakeVarsContext) {
- if ctx.Config().UnbundledBuildUsePrebuiltSdks() || ctx.Config().IsPdkBuild() {
+ if ctx.Config().AlwaysUsePrebuiltSdks() {
return
}
diff --git a/java/sdk_library.go b/java/sdk_library.go
index 8a8d0c9..25f0134 100644
--- a/java/sdk_library.go
+++ b/java/sdk_library.go
@@ -1112,6 +1112,7 @@
&module.properties,
&module.protoProperties,
&module.deviceProperties,
+ &module.dexProperties,
&module.dexpreoptProperties,
&module.linter.properties,
&props,
@@ -1123,22 +1124,17 @@
// Creates a static java library that has API stubs
func (module *SdkLibrary) createStubsLibrary(mctx android.DefaultableHookContext, apiScope *apiScope) {
props := struct {
- Name *string
- Visibility []string
- Srcs []string
- Installable *bool
- Sdk_version *string
- System_modules *string
- Patch_module *string
- Libs []string
- Compile_dex *bool
- Java_version *string
- Product_variables struct {
- Pdk struct {
- Enabled *bool
- }
- }
- Openjdk9 struct {
+ Name *string
+ Visibility []string
+ Srcs []string
+ Installable *bool
+ Sdk_version *string
+ System_modules *string
+ Patch_module *string
+ Libs []string
+ Compile_dex *bool
+ Java_version *string
+ Openjdk9 struct {
Srcs []string
Javacflags []string
}
@@ -1165,14 +1161,13 @@
props.Patch_module = module.properties.Patch_module
props.Installable = proptools.BoolPtr(false)
props.Libs = module.sdkLibraryProperties.Stub_only_libs
- props.Product_variables.Pdk.Enabled = proptools.BoolPtr(false)
props.Openjdk9.Srcs = module.properties.Openjdk9.Srcs
props.Openjdk9.Javacflags = module.properties.Openjdk9.Javacflags
// We compile the stubs for 1.8 in line with the main android.jar stubs, and potential
// interop with older developer tools that don't support 1.9.
props.Java_version = proptools.StringPtr("1.8")
- if module.deviceProperties.Compile_dex != nil {
- props.Compile_dex = module.deviceProperties.Compile_dex
+ if module.dexProperties.Compile_dex != nil {
+ props.Compile_dex = module.dexProperties.Compile_dex
}
// Dist the class jar artifact for sdk builds.
@@ -1798,7 +1793,7 @@
func (module *SdkLibraryImport) createInternalModules(mctx android.DefaultableHookContext) {
// If the build is configured to use prebuilts then force this to be preferred.
- if mctx.Config().UnbundledBuildUsePrebuiltSdks() {
+ if mctx.Config().AlwaysUsePrebuiltSdks() {
module.prebuilt.ForcePrefer()
}
diff --git a/java/sdk_test.go b/java/sdk_test.go
index 395da79..776069d 100644
--- a/java/sdk_test.go
+++ b/java/sdk_test.go
@@ -30,7 +30,6 @@
var classpathTestcases = []struct {
name string
unbundled bool
- pdk bool
moduleType string
host android.OsClass
properties string
@@ -217,35 +216,6 @@
},
{
- name: "pdk default",
- pdk: true,
- bootclasspath: []string{`""`},
- system: "sdk_public_30_system_modules",
- java8classpath: []string{"prebuilts/sdk/30/public/android.jar", "prebuilts/sdk/tools/core-lambda-stubs.jar"},
- java9classpath: []string{"prebuilts/sdk/30/public/android.jar", "prebuilts/sdk/tools/core-lambda-stubs.jar"},
- aidl: "-pprebuilts/sdk/30/public/framework.aidl",
- },
- {
- name: "pdk current",
- pdk: true,
- properties: `sdk_version: "current",`,
- bootclasspath: []string{`""`},
- system: "sdk_public_30_system_modules",
- java8classpath: []string{"prebuilts/sdk/30/public/android.jar", "prebuilts/sdk/tools/core-lambda-stubs.jar"},
- java9classpath: []string{"prebuilts/sdk/30/public/android.jar", "prebuilts/sdk/tools/core-lambda-stubs.jar"},
- aidl: "-pprebuilts/sdk/30/public/framework.aidl",
- },
- {
- name: "pdk 29",
- pdk: true,
- properties: `sdk_version: "29",`,
- bootclasspath: []string{`""`},
- system: "sdk_public_30_system_modules",
- java8classpath: []string{"prebuilts/sdk/30/public/android.jar", "prebuilts/sdk/tools/core-lambda-stubs.jar"},
- java9classpath: []string{"prebuilts/sdk/30/public/android.jar", "prebuilts/sdk/tools/core-lambda-stubs.jar"},
- aidl: "-pprebuilts/sdk/30/public/framework.aidl",
- },
- {
name: "module_current",
properties: `sdk_version: "module_current",`,
bootclasspath: []string{"android_module_lib_stubs_current", "core-lambda-stubs"},
@@ -384,9 +354,7 @@
config := testConfig(nil, bpJava8, nil)
if testcase.unbundled {
config.TestProductVariables.Unbundled_build = proptools.BoolPtr(true)
- }
- if testcase.pdk {
- config.TestProductVariables.Pdk = proptools.BoolPtr(true)
+ config.TestProductVariables.Always_use_prebuilt_sdks = proptools.BoolPtr(true)
}
ctx := testContext()
run(t, ctx, config)
@@ -407,9 +375,7 @@
config := testConfig(nil, bp, nil)
if testcase.unbundled {
config.TestProductVariables.Unbundled_build = proptools.BoolPtr(true)
- }
- if testcase.pdk {
- config.TestProductVariables.Pdk = proptools.BoolPtr(true)
+ config.TestProductVariables.Always_use_prebuilt_sdks = proptools.BoolPtr(true)
}
ctx := testContext()
run(t, ctx, config)
@@ -433,9 +399,7 @@
if testcase.unbundled {
config.TestProductVariables.Unbundled_build = proptools.BoolPtr(true)
- }
- if testcase.pdk {
- config.TestProductVariables.Pdk = proptools.BoolPtr(true)
+ config.TestProductVariables.Always_use_prebuilt_sdks = proptools.BoolPtr(true)
}
ctx := testContext()
run(t, ctx, config)
@@ -451,9 +415,7 @@
if testcase.unbundled {
config.TestProductVariables.Unbundled_build = proptools.BoolPtr(true)
- }
- if testcase.pdk {
- config.TestProductVariables.Pdk = proptools.BoolPtr(true)
+ config.TestProductVariables.Always_use_prebuilt_sdks = proptools.BoolPtr(true)
}
ctx := testContext()
run(t, ctx, config)
diff --git a/phony/phony.go b/phony/phony.go
index 305a434..cb60b9f 100644
--- a/phony/phony.go
+++ b/phony/phony.go
@@ -44,11 +44,6 @@
p.requiredModuleNames = ctx.RequiredModuleNames()
p.hostRequiredModuleNames = ctx.HostRequiredModuleNames()
p.targetRequiredModuleNames = ctx.TargetRequiredModuleNames()
- if len(p.requiredModuleNames) == 0 &&
- len(p.hostRequiredModuleNames) == 0 && len(p.targetRequiredModuleNames) == 0 {
- ctx.PropertyErrorf("required", "phony must not have empty required dependencies "+
- "in order to be useful(and therefore permitted).")
- }
}
func (p *phony) AndroidMk() android.AndroidMkData {
diff --git a/rust/Android.bp b/rust/Android.bp
index e03bf4f..bbeb28d 100644
--- a/rust/Android.bp
+++ b/rust/Android.bp
@@ -34,6 +34,7 @@
"library_test.go",
"project_json_test.go",
"rust_test.go",
+ "source_provider_test.go",
"test_test.go",
],
pluginFor: ["soong_build"],
diff --git a/rust/androidmk.go b/rust/androidmk.go
index babbf91..fda0a25 100644
--- a/rust/androidmk.go
+++ b/rust/androidmk.go
@@ -26,18 +26,18 @@
type AndroidMkContext interface {
Name() string
Target() android.Target
- subAndroidMk(*android.AndroidMkData, interface{})
+ SubAndroidMk(*android.AndroidMkData, interface{})
}
-type subAndroidMkProvider interface {
+type SubAndroidMkProvider interface {
AndroidMk(AndroidMkContext, *android.AndroidMkData)
}
-func (mod *Module) subAndroidMk(data *android.AndroidMkData, obj interface{}) {
+func (mod *Module) SubAndroidMk(data *android.AndroidMkData, obj interface{}) {
if mod.subAndroidMkOnce == nil {
- mod.subAndroidMkOnce = make(map[subAndroidMkProvider]bool)
+ mod.subAndroidMkOnce = make(map[SubAndroidMkProvider]bool)
}
- if androidmk, ok := obj.(subAndroidMkProvider); ok {
+ if androidmk, ok := obj.(SubAndroidMkProvider); ok {
if !mod.subAndroidMkOnce[androidmk] {
mod.subAndroidMkOnce[androidmk] = true
androidmk.AndroidMk(mod, data)
@@ -55,7 +55,6 @@
ret := android.AndroidMkData{
OutputFile: mod.outputFile,
Include: "$(BUILD_SYSTEM)/soong_rust_prebuilt.mk",
- SubName: mod.subName,
Extra: []android.AndroidMkExtraFunc{
func(w io.Writer, outputFile android.Path) {
if len(mod.Properties.AndroidMkRlibs) > 0 {
@@ -76,10 +75,12 @@
},
},
}
- if mod.compiler != nil {
- mod.subAndroidMk(&ret, mod.compiler)
+
+ if mod.compiler != nil && !mod.compiler.Disabled() {
+ mod.SubAndroidMk(&ret, mod.compiler)
} else if mod.sourceProvider != nil {
- mod.subAndroidMk(&ret, mod.sourceProvider)
+ // If the compiler is disabled, this is a SourceProvider.
+ mod.SubAndroidMk(&ret, mod.sourceProvider)
}
ret.SubName += mod.Properties.SubName
@@ -87,7 +88,7 @@
}
func (binary *binaryDecorator) AndroidMk(ctx AndroidMkContext, ret *android.AndroidMkData) {
- ctx.subAndroidMk(ret, binary.baseCompiler)
+ ctx.SubAndroidMk(ret, binary.baseCompiler)
if binary.distFile.Valid() {
ret.DistFiles = android.MakeDefaultDistFiles(binary.distFile.Path())
@@ -121,7 +122,7 @@
}
func (library *libraryDecorator) AndroidMk(ctx AndroidMkContext, ret *android.AndroidMkData) {
- ctx.subAndroidMk(ret, library.baseCompiler)
+ ctx.SubAndroidMk(ret, library.baseCompiler)
if library.rlib() {
ret.Class = "RLIB_LIBRARIES"
@@ -149,7 +150,7 @@
}
func (procMacro *procMacroDecorator) AndroidMk(ctx AndroidMkContext, ret *android.AndroidMkData) {
- ctx.subAndroidMk(ret, procMacro.baseCompiler)
+ ctx.SubAndroidMk(ret, procMacro.baseCompiler)
ret.Class = "PROC_MACRO_LIBRARIES"
if procMacro.distFile.Valid() {
@@ -158,10 +159,11 @@
}
-func (sourceProvider *baseSourceProvider) AndroidMk(ctx AndroidMkContext, ret *android.AndroidMkData) {
- outFile := sourceProvider.outputFile
+func (sourceProvider *BaseSourceProvider) AndroidMk(ctx AndroidMkContext, ret *android.AndroidMkData) {
+ outFile := sourceProvider.OutputFile
ret.Class = "ETC"
ret.OutputFile = android.OptionalPathForPath(outFile)
+ ret.SubName += sourceProvider.subName
ret.Extra = append(ret.Extra, func(w io.Writer, outputFile android.Path) {
_, file := filepath.Split(outFile.String())
stem, suffix, _ := android.SplitFileExt(file)
@@ -171,7 +173,7 @@
}
func (bindgen *bindgenDecorator) AndroidMk(ctx AndroidMkContext, ret *android.AndroidMkData) {
- ctx.subAndroidMk(ret, bindgen.baseSourceProvider)
+ ctx.SubAndroidMk(ret, bindgen.BaseSourceProvider)
ret.Extra = append(ret.Extra, func(w io.Writer, outputFile android.Path) {
fmt.Fprintln(w, "LOCAL_UNINSTALLABLE_MODULE := true")
})
diff --git a/rust/binary_test.go b/rust/binary_test.go
index ab2dae1..b9c8698 100644
--- a/rust/binary_test.go
+++ b/rust/binary_test.go
@@ -36,6 +36,11 @@
fizzBuzz := ctx.ModuleForTests("fizz-buzz", "linux_glibc_x86_64").Output("fizz-buzz")
fizzBuzzDynamic := ctx.ModuleForTests("fizz-buzz-dynamic", "linux_glibc_x86_64").Output("fizz-buzz-dynamic")
+ path := ctx.ModuleForTests("fizz-buzz", "linux_glibc_x86_64").Module().(*Module).HostToolPath()
+ if g, w := path.String(), "/host/linux-x86/bin/fizz-buzz"; !strings.Contains(g, w) {
+ t.Errorf("wrong host tool path, expected %q got %q", w, g)
+ }
+
// Do not compile binary modules with the --test flag.
flags := fizzBuzzDynamic.Args["rustcFlags"]
if strings.Contains(flags, "--test") {
diff --git a/rust/bindgen.go b/rust/bindgen.go
index e8bbb35..9b09e61 100644
--- a/rust/bindgen.go
+++ b/rust/bindgen.go
@@ -18,6 +18,7 @@
"strings"
"github.com/google/blueprint"
+ "github.com/google/blueprint/proptools"
"android/soong/android"
ccConfig "android/soong/cc/config"
@@ -41,12 +42,12 @@
bindgen = pctx.AndroidStaticRule("bindgen",
blueprint.RuleParams{
Command: "CLANG_PATH=$bindgenClang LIBCLANG_PATH=$bindgenLibClang RUSTFMT=${config.RustBin}/rustfmt " +
- "$bindgenCmd $flags $in -o $out -- -MD -MF $out.d $cflags",
- CommandDeps: []string{"$bindgenCmd"},
+ "$cmd $flags $in -o $out -- -MD -MF $out.d $cflags",
+ CommandDeps: []string{"$cmd"},
Deps: blueprint.DepsGCC,
Depfile: "$out.d",
},
- "flags", "cflags")
+ "cmd", "flags", "cflags")
)
func init() {
@@ -61,7 +62,7 @@
Wrapper_src *string `android:"path,arch_variant"`
// list of bindgen-specific flags and options
- Flags []string `android:"arch_variant"`
+ Bindgen_flags []string `android:"arch_variant"`
// list of clang flags required to correctly interpret the headers.
Cflags []string `android:"arch_variant"`
@@ -76,16 +77,22 @@
// list of shared libraries that provide headers for this binding.
Shared_libs []string `android:"arch_variant"`
+ // module name of a custom binary/script which should be used instead of the 'bindgen' binary. This custom
+ // binary must expect arguments in a similar fashion to bindgen, e.g.
+ //
+ // "my_bindgen [flags] wrapper_header.h -o [output_path] -- [clang flags]"
+ Custom_bindgen string `android:"path"`
+
//TODO(b/161141999) Add support for headers from cc_library_header modules.
}
type bindgenDecorator struct {
- *baseSourceProvider
+ *BaseSourceProvider
Properties BindgenProperties
}
-func (b *bindgenDecorator) generateSource(ctx android.ModuleContext, deps PathDeps) android.Path {
+func (b *bindgenDecorator) GenerateSource(ctx android.ModuleContext, deps PathDeps) android.Path {
ccToolchain := ccConfig.FindToolchain(ctx.Os(), ctx.Arch())
var cflags []string
@@ -113,40 +120,53 @@
cflags = append(cflags, "-isystem "+include.String())
}
+ esc := proptools.NinjaAndShellEscapeList
+
// Module defined clang flags and include paths
- cflags = append(cflags, b.Properties.Cflags...)
+ cflags = append(cflags, esc(b.Properties.Cflags)...)
for _, include := range b.Properties.Local_include_dirs {
cflags = append(cflags, "-I"+android.PathForModuleSrc(ctx, include).String())
implicits = append(implicits, android.PathForModuleSrc(ctx, include))
}
bindgenFlags := defaultBindgenFlags
- bindgenFlags = append(bindgenFlags, strings.Join(b.Properties.Flags, " "))
+ bindgenFlags = append(bindgenFlags, esc(b.Properties.Bindgen_flags)...)
wrapperFile := android.OptionalPathForModuleSrc(ctx, b.Properties.Wrapper_src)
if !wrapperFile.Valid() {
ctx.PropertyErrorf("wrapper_src", "invalid path to wrapper source")
}
- outputFile := android.PathForModuleOut(ctx, b.baseSourceProvider.getStem(ctx)+".rs")
+ outputFile := android.PathForModuleOut(ctx, b.BaseSourceProvider.getStem(ctx)+".rs")
+
+ var cmd, cmdDesc string
+ if b.Properties.Custom_bindgen != "" {
+ cmd = ctx.GetDirectDepWithTag(b.Properties.Custom_bindgen, customBindgenDepTag).(*Module).HostToolPath().String()
+ cmdDesc = b.Properties.Custom_bindgen
+ } else {
+ cmd = "$bindgenCmd"
+ cmdDesc = "bindgen"
+ }
ctx.Build(pctx, android.BuildParams{
Rule: bindgen,
- Description: "bindgen " + wrapperFile.Path().Rel(),
+ Description: strings.Join([]string{cmdDesc, wrapperFile.Path().Rel()}, " "),
Output: outputFile,
Input: wrapperFile.Path(),
Implicits: implicits,
Args: map[string]string{
+ "cmd": cmd,
"flags": strings.Join(bindgenFlags, " "),
"cflags": strings.Join(cflags, " "),
},
})
- b.baseSourceProvider.outputFile = outputFile
+
+ b.BaseSourceProvider.OutputFile = outputFile
return outputFile
}
-func (b *bindgenDecorator) sourceProviderProps() []interface{} {
- return append(b.baseSourceProvider.sourceProviderProps(),
+func (b *bindgenDecorator) SourceProviderProps() []interface{} {
+ return append(b.BaseSourceProvider.SourceProviderProps(),
&b.Properties)
}
@@ -164,19 +184,18 @@
}
func NewRustBindgen(hod android.HostOrDeviceSupported) (*Module, *bindgenDecorator) {
- module := newModule(hod, android.MultilibBoth)
-
bindgen := &bindgenDecorator{
- baseSourceProvider: NewSourceProvider(),
+ BaseSourceProvider: NewSourceProvider(),
Properties: BindgenProperties{},
}
- module.sourceProvider = bindgen
+
+ module := NewSourceProviderModule(hod, bindgen, false)
return module, bindgen
}
-func (b *bindgenDecorator) sourceProviderDeps(ctx DepsContext, deps Deps) Deps {
- deps = b.baseSourceProvider.sourceProviderDeps(ctx, deps)
+func (b *bindgenDecorator) SourceProviderDeps(ctx DepsContext, deps Deps) Deps {
+ deps = b.BaseSourceProvider.SourceProviderDeps(ctx, deps)
if ctx.toolchain().Bionic() {
deps = bionicDeps(deps)
}
diff --git a/rust/bindgen_test.go b/rust/bindgen_test.go
index 2122ec1..191da9b 100644
--- a/rust/bindgen_test.go
+++ b/rust/bindgen_test.go
@@ -24,9 +24,11 @@
rust_bindgen {
name: "libbindgen",
wrapper_src: "src/any.h",
- stem: "bindings",
- flags: ["--bindgen-flag"],
- cflags: ["--clang-flag"],
+ crate_name: "bindgen",
+ stem: "libbindgen",
+ source_stem: "bindings",
+ bindgen_flags: ["--bindgen-flag.*"],
+ cflags: ["--clang-flag()"],
shared_libs: ["libfoo_shared"],
static_libs: ["libfoo_static"],
}
@@ -38,13 +40,13 @@
name: "libfoo_static",
export_include_dirs: ["static_include"],
}
-
`)
libbindgen := ctx.ModuleForTests("libbindgen", "android_arm64_armv8-a").Output("bindings.rs")
- if !strings.Contains(libbindgen.Args["flags"], "--bindgen-flag") {
+ // Ensure that the flags are present and escaped
+ if !strings.Contains(libbindgen.Args["flags"], "'--bindgen-flag.*'") {
t.Errorf("missing bindgen flags in rust_bindgen rule: flags %#v", libbindgen.Args["flags"])
}
- if !strings.Contains(libbindgen.Args["cflags"], "--clang-flag") {
+ if !strings.Contains(libbindgen.Args["cflags"], "'--clang-flag()'") {
t.Errorf("missing clang cflags in rust_bindgen rule: cflags %#v", libbindgen.Args["cflags"])
}
if !strings.Contains(libbindgen.Args["cflags"], "-Ishared_include") {
@@ -54,3 +56,29 @@
t.Errorf("missing static_libs exported includes in rust_bindgen rule: cflags %#v", libbindgen.Args["cflags"])
}
}
+
+func TestRustBindgenCustomBindgen(t *testing.T) {
+ ctx := testRust(t, `
+ rust_bindgen {
+ name: "libbindgen",
+ wrapper_src: "src/any.h",
+ crate_name: "bindgen",
+ stem: "libbindgen",
+ source_stem: "bindings",
+ custom_bindgen: "my_bindgen"
+ }
+ rust_binary_host {
+ name: "my_bindgen",
+ srcs: ["foo.rs"],
+ }
+ `)
+
+ libbindgen := ctx.ModuleForTests("libbindgen", "android_arm64_armv8-a").Output("bindings.rs")
+
+ // The rule description should contain the custom binary name rather than bindgen, so checking the description
+ // should be sufficient.
+ if !strings.Contains(libbindgen.Description, "my_bindgen") {
+ t.Errorf("Custom bindgen binary %s not used for libbindgen: rule description %#v", "my_bindgen",
+ libbindgen.Description)
+ }
+}
diff --git a/rust/builder_test.go b/rust/builder_test.go
index 04b67d9..5c11cb7 100644
--- a/rust/builder_test.go
+++ b/rust/builder_test.go
@@ -28,12 +28,14 @@
}
rust_bindgen {
name: "libbindings1",
- stem: "bindings",
+ source_stem: "bindings",
+ crate_name: "bindings1",
wrapper_src: "src/any.h",
}
rust_bindgen {
name: "libbindings2",
- stem: "bindings",
+ source_stem: "bindings",
+ crate_name: "bindings2",
wrapper_src: "src/any.h",
}
`)
diff --git a/rust/compiler.go b/rust/compiler.go
index 83a1f27..c39a4a1 100644
--- a/rust/compiler.go
+++ b/rust/compiler.go
@@ -32,6 +32,10 @@
compiler.Properties.No_stdlibs = proptools.BoolPtr(true)
}
+func (compiler *baseCompiler) setNoLint() {
+ compiler.Properties.No_lint = proptools.BoolPtr(true)
+}
+
func NewBaseCompiler(dir, dir64 string, location installLocation) *baseCompiler {
return &baseCompiler{
Properties: BaseCompilerProperties{},
@@ -81,7 +85,10 @@
// list of C static library dependencies
Static_libs []string `android:"arch_variant"`
- // crate name, required for libraries. This must be the expected extern crate name used in source
+ // crate name, required for modules which produce Rust libraries: rust_library, rust_ffi and SourceProvider
+ // modules which create library variants (rust_bindgen). This must be the expected extern crate name used in
+ // source, and is required to conform to an enforced format matching library output files (if the output file is
+ // lib<someName><suffix>, the crate_name property must be <someName>).
Crate_name string `android:"arch_variant"`
// list of features to enable for this crate
@@ -120,6 +127,14 @@
distFile android.OptionalPath
}
+func (compiler *baseCompiler) Disabled() bool {
+ return false
+}
+
+func (compiler *baseCompiler) SetDisabled() {
+ panic("baseCompiler does not implement SetDisabled()")
+}
+
func (compiler *baseCompiler) coverageOutputZipPath() android.OptionalPath {
panic("baseCompiler does not implement coverageOutputZipPath()")
}
@@ -144,7 +159,9 @@
func (compiler *baseCompiler) compilerFlags(ctx ModuleContext, flags Flags) Flags {
- if !Bool(compiler.Properties.No_lint) {
+ if Bool(compiler.Properties.No_lint) {
+ flags.RustFlags = append(flags.RustFlags, config.AllowAllLints)
+ } else {
flags.RustFlags = append(flags.RustFlags, config.RustcLintsForDir(ctx.ModuleDir()))
}
flags.RustFlags = append(flags.RustFlags, compiler.Properties.Flags...)
diff --git a/rust/config/allowed_list.go b/rust/config/allowed_list.go
index 0204cd2..ed9f90b 100644
--- a/rust/config/allowed_list.go
+++ b/rust/config/allowed_list.go
@@ -6,7 +6,10 @@
"external/rust",
"external/crosvm",
"external/adhd",
+ "frameworks/native/libs/binder/rust",
"prebuilts/rust",
+ "system/extras/profcollectd",
+ "system/security",
}
RustModuleTypes = []string{
diff --git a/rust/config/lints.go b/rust/config/lints.go
index 529d094..e24ffac 100644
--- a/rust/config/lints.go
+++ b/rust/config/lints.go
@@ -128,6 +128,7 @@
{"vendor/google", rustcDefault, true, clippyDefault},
{"vendor/", rustcVendor, true, clippyVendor},
}
+var AllowAllLints = rustcAllowAll
// ClippyLintsForDir returns a boolean if Clippy should be executed and if so, the lints to be used.
func ClippyLintsForDir(dir string) (bool, string) {
diff --git a/rust/library.go b/rust/library.go
index 6d5eca0..6766d61 100644
--- a/rust/library.go
+++ b/rust/library.go
@@ -69,6 +69,10 @@
VariantIsShared bool `blueprint:"mutated"`
// This variant is a static library
VariantIsStatic bool `blueprint:"mutated"`
+
+ // This variant is disabled and should not be compiled
+ // (used for SourceProvider variants that produce only source)
+ VariantIsDisabled bool `blueprint:"mutated"`
}
type libraryDecorator struct {
@@ -78,6 +82,7 @@
Properties LibraryCompilerProperties
MutatedProperties LibraryMutatedProperties
includeDirs android.Paths
+ sourceProvider SourceProvider
}
type libraryInterface interface {
@@ -367,8 +372,13 @@
func (library *libraryDecorator) compile(ctx ModuleContext, flags Flags, deps PathDeps) android.Path {
var outputFile android.WritablePath
+ var srcPath android.Path
- srcPath, _ := srcPathFromModuleSrcs(ctx, library.baseCompiler.Properties.Srcs)
+ if library.sourceProvider != nil {
+ srcPath = library.sourceProvider.Srcs()[0]
+ } else {
+ srcPath, _ = srcPathFromModuleSrcs(ctx, library.baseCompiler.Properties.Srcs)
+ }
flags.RustFlags = append(flags.RustFlags, deps.depFlags...)
@@ -430,6 +440,14 @@
return stem + String(library.baseCompiler.Properties.Suffix)
}
+func (library *libraryDecorator) Disabled() bool {
+ return library.MutatedProperties.VariantIsDisabled
+}
+
+func (library *libraryDecorator) SetDisabled() {
+ library.MutatedProperties.VariantIsDisabled = true
+}
+
var validCrateName = regexp.MustCompile("[^a-zA-Z0-9_]+")
func validateLibraryStem(ctx BaseModuleContext, filename string, crate_name string) {
@@ -455,12 +473,23 @@
switch library := m.compiler.(type) {
case libraryInterface:
if library.buildRlib() && library.buildDylib() {
- modules := mctx.CreateLocalVariations("rlib", "dylib")
+ variants := []string{"rlib", "dylib"}
+ if m.sourceProvider != nil {
+ variants = append(variants, "")
+ }
+ modules := mctx.CreateLocalVariations(variants...)
+
rlib := modules[0].(*Module)
dylib := modules[1].(*Module)
-
rlib.compiler.(libraryInterface).setRlib()
dylib.compiler.(libraryInterface).setDylib()
+
+ if m.sourceProvider != nil {
+ // This library is SourceProvider generated, so the non-library-producing
+ // variant needs to disable it's compiler and skip installation.
+ sourceProvider := modules[2].(*Module)
+ sourceProvider.compiler.SetDisabled()
+ }
} else if library.buildRlib() {
modules := mctx.CreateLocalVariations("rlib")
modules[0].(*Module).compiler.(libraryInterface).setRlib()
@@ -468,6 +497,11 @@
modules := mctx.CreateLocalVariations("dylib")
modules[0].(*Module).compiler.(libraryInterface).setDylib()
}
+
+ if m.sourceProvider != nil {
+ // Alias the non-library variant to the empty-string variant.
+ mctx.AliasVariation("")
+ }
}
}
}
diff --git a/rust/project_json.go b/rust/project_json.go
index 24e7691..8310479 100644
--- a/rust/project_json.go
+++ b/rust/project_json.go
@@ -75,24 +75,23 @@
knownCrates map[string]crateInfo, module android.Module,
crate *rustProjectCrate, deps map[string]int) {
- //TODO(tweek): The stdlib dependencies do not appear here. We need to manually add them.
ctx.VisitDirectDeps(module, func(child android.Module) {
- childId, childName, ok := appendLibraryAndDeps(ctx, project, knownCrates, child)
+ childId, childCrateName, ok := appendLibraryAndDeps(ctx, project, knownCrates, child)
if !ok {
return
}
- if _, ok = deps[childName]; ok {
+ if _, ok = deps[ctx.ModuleName(child)]; ok {
return
}
- crate.Deps = append(crate.Deps, rustProjectDep{Crate: childId, Name: childName})
- deps[childName] = childId
+ crate.Deps = append(crate.Deps, rustProjectDep{Crate: childId, Name: childCrateName})
+ deps[ctx.ModuleName(child)] = childId
})
}
// appendLibraryAndDeps creates a rustProjectCrate for the module argument and
// appends it to the rustProjectJson struct. It visits the dependencies of the
// module depth-first. If the current module is already in knownCrates, its
-// its dependencies are merged. Returns a tuple (id, crate_name, ok).
+// dependencies are merged. Returns a tuple (id, crate_name, ok).
func appendLibraryAndDeps(ctx android.SingletonContext, project *rustProjectJson,
knownCrates map[string]crateInfo, module android.Module) (int, string, bool) {
rModule, ok := module.(*Module)
@@ -106,23 +105,28 @@
if !ok {
return 0, "", false
}
+ moduleName := ctx.ModuleName(module)
crateName := rModule.CrateName()
- if cInfo, ok := knownCrates[crateName]; ok {
+ if cInfo, ok := knownCrates[moduleName]; ok {
// We have seen this crate already; merge any new dependencies.
crate := project.Crates[cInfo.ID]
mergeDependencies(ctx, project, knownCrates, module, &crate, cInfo.Deps)
+ project.Crates[cInfo.ID] = crate
return cInfo.ID, crateName, true
}
crate := rustProjectCrate{Deps: make([]rustProjectDep, 0), Cfgs: make([]string, 0)}
- src := rustLib.baseCompiler.Properties.Srcs[0]
- crate.RootModule = path.Join(ctx.ModuleDir(rModule), src)
+ srcs := rustLib.baseCompiler.Properties.Srcs
+ if len(srcs) == 0 {
+ return 0, "", false
+ }
+ crate.RootModule = path.Join(ctx.ModuleDir(rModule), srcs[0])
crate.Edition = rustLib.baseCompiler.edition()
deps := make(map[string]int)
mergeDependencies(ctx, project, knownCrates, module, &crate, deps)
id := len(project.Crates)
- knownCrates[crateName] = crateInfo{ID: id, Deps: deps}
+ knownCrates[moduleName] = crateInfo{ID: id, Deps: deps}
project.Crates = append(project.Crates, crate)
// rust-analyzer requires that all crates belong to at least one root:
// https://github.com/rust-analyzer/rust-analyzer/issues/4735.
diff --git a/rust/project_json_test.go b/rust/project_json_test.go
index 6786e72..8521940 100644
--- a/rust/project_json_test.go
+++ b/rust/project_json_test.go
@@ -15,6 +15,7 @@
package rust
import (
+ "encoding/json"
"io/ioutil"
"path/filepath"
"testing"
@@ -23,20 +24,12 @@
"android/soong/cc"
)
-func TestProjectJson(t *testing.T) {
- bp := `rust_library {
- name: "liba",
- srcs: ["src/lib.rs"],
- crate_name: "a"
- }` + GatherRequiredDepsForTest()
- env := map[string]string{"SOONG_GEN_RUST_PROJECT": "1"}
- fs := map[string][]byte{
- "foo.rs": nil,
- "src/lib.rs": nil,
- }
-
+// testProjectJson run the generation of rust-project.json. It returns the raw
+// content of the generated file.
+func testProjectJson(t *testing.T, bp string, fs map[string][]byte) []byte {
cc.GatherRequiredFilesForTest(fs)
+ env := map[string]string{"SOONG_GEN_RUST_PROJECT": "1"}
config := android.TestArchConfig(buildDir, env, bp, fs)
ctx := CreateTestContext()
ctx.Register(config)
@@ -48,8 +41,131 @@
// The JSON file is generated via WriteFileToOutputDir. Therefore, it
// won't appear in the Output of the TestingSingleton. Manually verify
// it exists.
- _, err := ioutil.ReadFile(filepath.Join(buildDir, "rust-project.json"))
+ content, err := ioutil.ReadFile(filepath.Join(buildDir, rustProjectJsonFileName))
if err != nil {
t.Errorf("rust-project.json has not been generated")
}
+ return content
+}
+
+// validateJsonCrates validates that content follows the basic structure of
+// rust-project.json. It returns the crates attribute if the validation
+// succeeded.
+// It uses an empty interface instead of relying on a defined structure to
+// avoid a strong dependency on our implementation.
+func validateJsonCrates(t *testing.T, rawContent []byte) []interface{} {
+ var content interface{}
+ err := json.Unmarshal(rawContent, &content)
+ if err != nil {
+ t.Errorf("Unable to parse the rust-project.json as JSON: %v", err)
+ }
+ root, ok := content.(map[string]interface{})
+ if !ok {
+ t.Errorf("Unexpected JSON format: %v", content)
+ }
+ if _, ok = root["crates"]; !ok {
+ t.Errorf("No crates attribute in rust-project.json: %v", root)
+ }
+ crates, ok := root["crates"].([]interface{})
+ if !ok {
+ t.Errorf("Unexpected crates format: %v", root["crates"])
+ }
+ return crates
+}
+
+func TestProjectJsonDep(t *testing.T) {
+ bp := `
+ rust_library {
+ name: "liba",
+ srcs: ["a/src/lib.rs"],
+ crate_name: "a"
+ }
+ rust_library {
+ name: "libb",
+ srcs: ["b/src/lib.rs"],
+ crate_name: "b",
+ rlibs: ["liba"],
+ }
+ ` + GatherRequiredDepsForTest()
+ fs := map[string][]byte{
+ "a/src/lib.rs": nil,
+ "b/src/lib.rs": nil,
+ }
+ jsonContent := testProjectJson(t, bp, fs)
+ validateJsonCrates(t, jsonContent)
+}
+
+func TestProjectJsonBindGen(t *testing.T) {
+ bp := `
+ rust_library {
+ name: "liba",
+ srcs: ["src/lib.rs"],
+ rlibs: ["libbindings"],
+ crate_name: "a"
+ }
+ rust_bindgen {
+ name: "libbindings",
+ crate_name: "bindings",
+ source_stem: "bindings",
+ host_supported: true,
+ wrapper_src: "src/any.h",
+ }
+ ` + GatherRequiredDepsForTest()
+ fs := map[string][]byte{
+ "src/lib.rs": nil,
+ }
+ jsonContent := testProjectJson(t, bp, fs)
+ validateJsonCrates(t, jsonContent)
+}
+
+func TestProjectJsonMultiVersion(t *testing.T) {
+ bp := `
+ rust_library {
+ name: "liba1",
+ srcs: ["a1/src/lib.rs"],
+ crate_name: "a"
+ }
+ rust_library {
+ name: "liba2",
+ srcs: ["a2/src/lib.rs"],
+ crate_name: "a",
+ }
+ rust_library {
+ name: "libb",
+ srcs: ["b/src/lib.rs"],
+ crate_name: "b",
+ rustlibs: ["liba1", "liba2"],
+ }
+ ` + GatherRequiredDepsForTest()
+ fs := map[string][]byte{
+ "a1/src/lib.rs": nil,
+ "a2/src/lib.rs": nil,
+ "b/src/lib.rs": nil,
+ }
+ jsonContent := testProjectJson(t, bp, fs)
+ crates := validateJsonCrates(t, jsonContent)
+ for _, crate := range crates {
+ c := crate.(map[string]interface{})
+ if c["root_module"] == "b/src/lib.rs" {
+ deps, ok := c["deps"].([]interface{})
+ if !ok {
+ t.Errorf("Unexpected format for deps: %v", c["deps"])
+ }
+ aCount := 0
+ for _, dep := range deps {
+ d, ok := dep.(map[string]interface{})
+ if !ok {
+ t.Errorf("Unexpected format for dep: %v", dep)
+ }
+ if d["name"] == "a" {
+ aCount++
+ }
+ }
+ if aCount != 2 {
+ t.Errorf("Unexpected number of liba dependencies want %v, got %v: %v", 2, aCount, deps)
+ }
+ return
+ }
+ }
+ t.Errorf("libb crate has not been found: %v", crates)
}
diff --git a/rust/rust.go b/rust/rust.go
index 5d383e1..54b2285 100644
--- a/rust/rust.go
+++ b/rust/rust.go
@@ -63,7 +63,8 @@
AndroidMkSharedLibs []string
AndroidMkStaticLibs []string
- SubName string `blueprint:"mutated"`
+ SubName string `blueprint:"mutated"`
+
PreventInstall bool
HideFromMake bool
}
@@ -82,16 +83,16 @@
clippy *clippy
cachedToolchain config.Toolchain
sourceProvider SourceProvider
- subAndroidMkOnce map[subAndroidMkProvider]bool
- outputFile android.OptionalPath
+ subAndroidMkOnce map[SubAndroidMkProvider]bool
- subName string
+ outputFile android.OptionalPath
+ generatedFile android.OptionalPath
}
func (mod *Module) OutputFiles(tag string) (android.Paths, error) {
switch tag {
case "":
- if mod.sourceProvider != nil {
+ if mod.sourceProvider != nil && (mod.compiler == nil || mod.compiler.Disabled()) {
return mod.sourceProvider.Srcs(), nil
} else {
if mod.outputFile.Valid() {
@@ -285,6 +286,9 @@
relativeInstallPath() string
nativeCoverage() bool
+
+ Disabled() bool
+ SetDisabled()
}
type exportedFlagsProducer interface {
@@ -533,7 +537,7 @@
mod.AddProperties(mod.clippy.props()...)
}
if mod.sourceProvider != nil {
- mod.AddProperties(mod.sourceProvider.sourceProviderProps()...)
+ mod.AddProperties(mod.sourceProvider.SourceProviderProps()...)
}
android.InitAndroidArchModule(mod, mod.hod, mod.multilib)
@@ -667,16 +671,21 @@
flags, deps = mod.clippy.flags(ctx, flags, deps)
}
- if mod.compiler != nil {
+ // SourceProvider needs to call GenerateSource() before compiler calls compile() so it can provide the source.
+ // TODO(b/162588681) This shouldn't have to run for every variant.
+ if mod.sourceProvider != nil {
+ generatedFile := mod.sourceProvider.GenerateSource(ctx, deps)
+ mod.generatedFile = android.OptionalPathForPath(generatedFile)
+ mod.sourceProvider.setSubName(ctx.ModuleSubDir())
+ }
+
+ if mod.compiler != nil && !mod.compiler.Disabled() {
outputFile := mod.compiler.compile(ctx, flags, deps)
+
mod.outputFile = android.OptionalPathForPath(outputFile)
- if !mod.Properties.PreventInstall {
+ if mod.outputFile.Valid() && !mod.Properties.PreventInstall {
mod.compiler.install(ctx, mod.outputFile.Path())
}
- } else if mod.sourceProvider != nil {
- outputFile := mod.sourceProvider.generateSource(ctx, deps)
- mod.outputFile = android.OptionalPathForPath(outputFile)
- mod.subName = ctx.ModuleSubDir()
}
}
@@ -685,8 +694,9 @@
if mod.compiler != nil {
deps = mod.compiler.compilerDeps(ctx, deps)
- } else if mod.sourceProvider != nil {
- deps = mod.sourceProvider.sourceProviderDeps(ctx, deps)
+ }
+ if mod.sourceProvider != nil {
+ deps = mod.sourceProvider.SourceProviderDeps(ctx, deps)
}
if mod.coverage != nil {
@@ -712,10 +722,11 @@
}
var (
- rlibDepTag = dependencyTag{name: "rlibTag", library: true}
- dylibDepTag = dependencyTag{name: "dylib", library: true}
- procMacroDepTag = dependencyTag{name: "procMacro", proc_macro: true}
- testPerSrcDepTag = dependencyTag{name: "rust_unit_tests"}
+ customBindgenDepTag = dependencyTag{name: "customBindgenTag"}
+ rlibDepTag = dependencyTag{name: "rlibTag", library: true}
+ dylibDepTag = dependencyTag{name: "dylib", library: true}
+ procMacroDepTag = dependencyTag{name: "procMacro", proc_macro: true}
+ testPerSrcDepTag = dependencyTag{name: "rust_unit_tests"}
)
type autoDep struct {
@@ -755,11 +766,6 @@
if rustDep, ok := dep.(*Module); ok && !rustDep.CcLibraryInterface() {
//Handle Rust Modules
- linkFile := rustDep.outputFile
- if !linkFile.Valid() {
- ctx.ModuleErrorf("Invalid output file when adding dep %q to %q", depName, ctx.ModuleName())
- }
-
switch depTag {
case dylibDepTag:
dylib, ok := rustDep.compiler.(libraryInterface)
@@ -801,13 +807,19 @@
directSrcProvidersDeps = append(directSrcProvidersDeps, rustDep)
}
- //Append the dependencies exportedDirs
- if lib, ok := rustDep.compiler.(exportedFlagsProducer); ok {
+ //Append the dependencies exportedDirs, except for proc-macros which target a different arch/OS
+ if lib, ok := rustDep.compiler.(exportedFlagsProducer); ok && depTag != procMacroDepTag {
depPaths.linkDirs = append(depPaths.linkDirs, lib.exportedLinkDirs()...)
depPaths.depFlags = append(depPaths.depFlags, lib.exportedDepFlags()...)
}
if depTag == dylibDepTag || depTag == rlibDepTag || depTag == procMacroDepTag {
+ linkFile := rustDep.outputFile
+ if !linkFile.Valid() {
+ ctx.ModuleErrorf("Invalid output file when adding dep %q to %q",
+ depName, ctx.ModuleName())
+ return
+ }
linkDir := linkPathFromFilePath(linkFile.Path())
if lib, ok := mod.compiler.(exportedFlagsProducer); ok {
lib.exportLinkDirs(linkDir)
@@ -826,7 +838,6 @@
return
}
}
-
linkFile := ccDep.OutputFile()
linkPath := linkPathFromFilePath(linkFile.Path())
libName := libNameFromFilePath(linkFile.Path())
@@ -837,8 +848,8 @@
}
exportDep := false
- switch depTag {
- case cc.StaticDepTag:
+ switch {
+ case cc.IsStaticDepTag(depTag):
depFlag = "-lstatic=" + libName
depPaths.linkDirs = append(depPaths.linkDirs, linkPath)
depPaths.depFlags = append(depPaths.depFlags, depFlag)
@@ -850,7 +861,7 @@
depPaths.coverageFiles = append(depPaths.coverageFiles, ccDep.CoverageFiles()...)
directStaticLibDeps = append(directStaticLibDeps, ccDep)
mod.Properties.AndroidMkStaticLibs = append(mod.Properties.AndroidMkStaticLibs, depName)
- case cc.SharedDepTag:
+ case cc.IsSharedDepTag(depTag):
depFlag = "-ldylib=" + libName
depPaths.linkDirs = append(depPaths.linkDirs, linkPath)
depPaths.depFlags = append(depPaths.depFlags, depFlag)
@@ -862,9 +873,9 @@
directSharedLibDeps = append(directSharedLibDeps, ccDep)
mod.Properties.AndroidMkSharedLibs = append(mod.Properties.AndroidMkSharedLibs, depName)
exportDep = true
- case cc.CrtBeginDepTag:
+ case depTag == cc.CrtBeginDepTag:
depPaths.CrtBegin = linkFile
- case cc.CrtEndDepTag:
+ case depTag == cc.CrtEndDepTag:
depPaths.CrtEnd = linkFile
}
@@ -987,18 +998,26 @@
actx.AddVariationDependencies(append(commonDepVariations,
blueprint.Variation{Mutator: "link", Variation: "shared"}),
- cc.SharedDepTag, deps.SharedLibs...)
+ cc.SharedDepTag(), deps.SharedLibs...)
actx.AddVariationDependencies(append(commonDepVariations,
blueprint.Variation{Mutator: "link", Variation: "static"}),
- cc.StaticDepTag, deps.StaticLibs...)
+ cc.StaticDepTag(), deps.StaticLibs...)
+ crtVariations := append(cc.GetCrtVariations(ctx, mod), commonDepVariations...)
if deps.CrtBegin != "" {
- actx.AddVariationDependencies(commonDepVariations, cc.CrtBeginDepTag, deps.CrtBegin)
+ actx.AddVariationDependencies(crtVariations, cc.CrtBeginDepTag, deps.CrtBegin)
}
if deps.CrtEnd != "" {
- actx.AddVariationDependencies(commonDepVariations, cc.CrtEndDepTag, deps.CrtEnd)
+ actx.AddVariationDependencies(crtVariations, cc.CrtEndDepTag, deps.CrtEnd)
}
+ if mod.sourceProvider != nil {
+ if bindgen, ok := mod.sourceProvider.(*bindgenDecorator); ok &&
+ bindgen.Properties.Custom_bindgen != "" {
+ actx.AddFarVariationDependencies(ctx.Config().BuildOSTarget.Variations(), customBindgenDepTag,
+ bindgen.Properties.Custom_bindgen)
+ }
+ }
// proc_macros are compiler plugins, and so we need the host arch variant as a dependendcy.
actx.AddFarVariationDependencies(ctx.Config().BuildOSTarget.Variations(), procMacroDepTag, deps.ProcMacros...)
}
@@ -1027,14 +1046,20 @@
return name
}
+func (mod *Module) setClippy(clippy bool) {
+ if mod.clippy != nil {
+ mod.clippy.Properties.Clippy = proptools.BoolPtr(clippy)
+ }
+}
+
var _ android.HostToolProvider = (*Module)(nil)
func (mod *Module) HostToolPath() android.OptionalPath {
if !mod.Host() {
return android.OptionalPath{}
}
- if _, ok := mod.compiler.(*binaryDecorator); ok {
- return mod.outputFile
+ if binary, ok := mod.compiler.(*binaryDecorator); ok {
+ return android.OptionalPathForPath(binary.baseCompiler.path)
}
return android.OptionalPath{}
}
diff --git a/rust/rust_test.go b/rust/rust_test.go
index b3bbddb..04de48b 100644
--- a/rust/rust_test.go
+++ b/rust/rust_test.go
@@ -233,6 +233,7 @@
":my_generator",
":libbindings",
],
+ rlibs: ["libbindings"],
}
rust_proc_macro {
name: "libprocmacro",
@@ -241,6 +242,7 @@
":my_generator",
":libbindings",
],
+ rlibs: ["libbindings"],
crate_name: "procmacro",
}
rust_library {
@@ -248,7 +250,9 @@
srcs: [
"foo.rs",
":my_generator",
- ":libbindings"],
+ ":libbindings",
+ ],
+ rlibs: ["libbindings"],
crate_name: "foo",
}
genrule {
@@ -260,7 +264,8 @@
}
rust_bindgen {
name: "libbindings",
- stem: "bindings",
+ crate_name: "bindings",
+ source_stem: "bindings",
host_supported: true,
wrapper_src: "src/any.h",
}
@@ -289,6 +294,21 @@
if !android.SuffixInList(libprocmacro.Implicits.Strings(), "/out/any.rs") {
t.Errorf("genrule generated source not included as implicit input for libprocmacro; Implicits %#v", libfoo.Implicits.Strings())
}
+
+ // Check that our bindings are picked up as crate dependencies as well
+ libfooMod := ctx.ModuleForTests("libfoo", "android_arm64_armv8-a_dylib").Module().(*Module)
+ if !android.InList("libbindings", libfooMod.Properties.AndroidMkRlibs) {
+ t.Errorf("bindgen dependency not detected as a rlib dependency (dependency missing from AndroidMkRlibs)")
+ }
+ fizzBuzzMod := ctx.ModuleForTests("fizz-buzz-dep", "android_arm64_armv8-a").Module().(*Module)
+ if !android.InList("libbindings", fizzBuzzMod.Properties.AndroidMkRlibs) {
+ t.Errorf("bindgen dependency not detected as a rlib dependency (dependency missing from AndroidMkRlibs)")
+ }
+ libprocmacroMod := ctx.ModuleForTests("libprocmacro", "linux_glibc_x86_64").Module().(*Module)
+ if !android.InList("libbindings", libprocmacroMod.Properties.AndroidMkRlibs) {
+ t.Errorf("bindgen dependency not detected as a rlib dependency (dependency missing from AndroidMkRlibs)")
+ }
+
}
func TestSourceProviderTargetMismatch(t *testing.T) {
@@ -305,7 +325,8 @@
}
rust_bindgen {
name: "libbindings",
- stem: "bindings",
+ crate_name: "bindings",
+ source_stem: "bindings",
wrapper_src: "src/any.h",
}
`)
diff --git a/rust/source_provider.go b/rust/source_provider.go
index da6147a..76679c2 100644
--- a/rust/source_provider.go
+++ b/rust/source_provider.go
@@ -19,52 +19,79 @@
)
type SourceProviderProperties struct {
- // sets name of the output
- Stem *string `android:"arch_variant"`
+ // filename for the generated source file (<source_stem>.rs). This field is required.
+ // The inherited "stem" property sets the output filename for the generated library variants only.
+ Source_stem *string `android:"arch_variant"`
+
+ // crate name, used for the library variant of this source provider. See additional details in rust_library.
+ Crate_name string `android:"arch_variant"`
}
-type baseSourceProvider struct {
+type BaseSourceProvider struct {
Properties SourceProviderProperties
- outputFile android.Path
- subAndroidMkOnce map[subAndroidMkProvider]bool
+ OutputFile android.Path
+ subAndroidMkOnce map[SubAndroidMkProvider]bool
+ subName string
}
-var _ SourceProvider = (*baseSourceProvider)(nil)
+var _ SourceProvider = (*BaseSourceProvider)(nil)
type SourceProvider interface {
- generateSource(ctx android.ModuleContext, deps PathDeps) android.Path
+ GenerateSource(ctx android.ModuleContext, deps PathDeps) android.Path
Srcs() android.Paths
- sourceProviderProps() []interface{}
- sourceProviderDeps(ctx DepsContext, deps Deps) Deps
+ SourceProviderProps() []interface{}
+ SourceProviderDeps(ctx DepsContext, deps Deps) Deps
+ setSubName(subName string)
}
-func (sp *baseSourceProvider) Srcs() android.Paths {
- return android.Paths{sp.outputFile}
+func (sp *BaseSourceProvider) Srcs() android.Paths {
+ return android.Paths{sp.OutputFile}
}
-func (sp *baseSourceProvider) generateSource(ctx android.ModuleContext, deps PathDeps) android.Path {
- panic("baseSourceProviderModule does not implement generateSource()")
+func (sp *BaseSourceProvider) GenerateSource(ctx android.ModuleContext, deps PathDeps) android.Path {
+ panic("BaseSourceProviderModule does not implement GenerateSource()")
}
-func (sp *baseSourceProvider) sourceProviderProps() []interface{} {
+func (sp *BaseSourceProvider) SourceProviderProps() []interface{} {
return []interface{}{&sp.Properties}
}
-func NewSourceProvider() *baseSourceProvider {
- return &baseSourceProvider{
+func NewSourceProvider() *BaseSourceProvider {
+ return &BaseSourceProvider{
Properties: SourceProviderProperties{},
}
}
-func (sp *baseSourceProvider) getStem(ctx android.ModuleContext) string {
- stem := ctx.ModuleName()
- if String(sp.Properties.Stem) != "" {
- stem = String(sp.Properties.Stem)
+func NewSourceProviderModule(hod android.HostOrDeviceSupported, sourceProvider SourceProvider, enableLints bool) *Module {
+ _, library := NewRustLibrary(hod)
+ library.BuildOnlyRust()
+ library.sourceProvider = sourceProvider
+
+ module := newModule(hod, android.MultilibBoth)
+ module.sourceProvider = sourceProvider
+ module.compiler = library
+
+ if !enableLints {
+ library.setNoLint()
+ module.setClippy(false)
}
- return stem
+
+ return module
}
-func (sp *baseSourceProvider) sourceProviderDeps(ctx DepsContext, deps Deps) Deps {
+func (sp *BaseSourceProvider) getStem(ctx android.ModuleContext) string {
+ if String(sp.Properties.Source_stem) == "" {
+ ctx.PropertyErrorf("source_stem",
+ "source_stem property is undefined but required for rust_bindgen modules")
+ }
+ return String(sp.Properties.Source_stem)
+}
+
+func (sp *BaseSourceProvider) SourceProviderDeps(ctx DepsContext, deps Deps) Deps {
return deps
}
+
+func (sp *BaseSourceProvider) setSubName(subName string) {
+ sp.subName = subName
+}
diff --git a/rust/source_provider_test.go b/rust/source_provider_test.go
new file mode 100644
index 0000000..6e68ae6
--- /dev/null
+++ b/rust/source_provider_test.go
@@ -0,0 +1,31 @@
+// Copyright 2020 The Android Open Source Project
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+package rust
+
+import (
+ "testing"
+)
+
+var stemRequiredError = "source_stem property is undefined but required for rust_bindgen modules"
+
+func TestSourceProviderRequiredFields(t *testing.T) {
+ testRustError(t, stemRequiredError, `
+ rust_bindgen {
+ name: "libbindgen",
+ wrapper_src: "src/any.h",
+ crate_name: "bindgen",
+ }
+ `)
+}
diff --git a/rust/test.go b/rust/test.go
index e27a70c..05c361e 100644
--- a/rust/test.go
+++ b/rust/test.go
@@ -41,6 +41,9 @@
// doesn't exist next to the Android.bp, this attribute doesn't need to be set to true
// explicitly.
Auto_gen_config *bool
+
+ // if set, build with the standard Rust test harness. Defaults to true.
+ Test_harness *bool
}
// A test module is a binary module with extra --test compiler flag
@@ -56,6 +59,10 @@
return true
}
+func (test *testDecorator) testHarness() bool {
+ return BoolDefault(test.Properties.Test_harness, true)
+}
+
func NewRustTest(hod android.HostOrDeviceSupported) (*Module, *testDecorator) {
// Build both 32 and 64 targets for device tests.
// Cannot build both for host tests yet if the test depends on
@@ -101,7 +108,9 @@
func (test *testDecorator) compilerFlags(ctx ModuleContext, flags Flags) Flags {
flags = test.binaryDecorator.compilerFlags(ctx, flags)
- flags.RustFlags = append(flags.RustFlags, "--test")
+ if test.testHarness() {
+ flags.RustFlags = append(flags.RustFlags, "--test")
+ }
return flags
}
diff --git a/rust/testing.go b/rust/testing.go
index 83b2828..80e4148 100644
--- a/rust/testing.go
+++ b/rust/testing.go
@@ -44,7 +44,28 @@
},
host_supported: true,
}
-
+ rust_prebuilt_library {
+ name: "libstd_x86_64-apple-darwin",
+ crate_name: "std",
+ rlib: {
+ srcs: ["libstd.rlib"],
+ },
+ dylib: {
+ srcs: ["libstd.so"],
+ },
+ host_supported: true,
+ }
+ rust_prebuilt_library {
+ name: "libtest_x86_64-apple-darwin",
+ crate_name: "test",
+ rlib: {
+ srcs: ["libtest.rlib"],
+ },
+ dylib: {
+ srcs: ["libtest.so"],
+ },
+ host_supported: true,
+ }
//////////////////////////////
// Device module requirements
@@ -78,6 +99,7 @@
func CreateTestContext() *android.TestContext {
ctx := android.NewTestArchContext()
android.RegisterPrebuiltMutators(ctx)
+ ctx.PreArchMutators(android.RegisterDefaultsPreArchMutators)
cc.RegisterRequiredBuildComponentsForTest(ctx)
ctx.RegisterModuleType("genrule", genrule.GenRuleFactory)
ctx.RegisterModuleType("rust_binary", RustBinaryFactory)
diff --git a/scripts/build-mainline-modules.sh b/scripts/build-mainline-modules.sh
index c7baca7..c5ec8d1 100755
--- a/scripts/build-mainline-modules.sh
+++ b/scripts/build-mainline-modules.sh
@@ -24,6 +24,7 @@
i18n-module-test-exports
i18n-module-sdk
platform-mainline-sdk
+ platform-mainline-test-exports
)
# List of libraries installed on the platform that are needed for ART chroot
diff --git a/sdk/cc_sdk_test.go b/sdk/cc_sdk_test.go
index 17afdb8..9501d88 100644
--- a/sdk/cc_sdk_test.go
+++ b/sdk/cc_sdk_test.go
@@ -39,6 +39,20 @@
// Contains tests for SDK members provided by the cc package.
+func TestSingleDeviceOsAssumption(t *testing.T) {
+ // Mock a module with DeviceSupported() == true.
+ s := &sdk{}
+ android.InitAndroidArchModule(s, android.DeviceSupported, android.MultilibCommon)
+
+ osTypes := s.getPossibleOsTypes()
+ if len(osTypes) != 1 {
+ // The snapshot generation assumes there is a single device OS. If more are
+ // added it might need to disable them by default, like it does for host
+ // OS'es.
+ t.Errorf("expected a single device OS, got %v", osTypes)
+ }
+}
+
func TestSdkIsCompileMultilibBoth(t *testing.T) {
result := testSdkWithCc(t, `
sdk {
@@ -99,9 +113,15 @@
stl: "none",
compile_multilib: "64",
target: {
+ host: {
+ enabled: false,
+ },
android_arm64: {
srcs: ["android/arm64/lib/sdkmember.so"],
},
+ linux_glibc: {
+ enabled: true,
+ },
linux_glibc_x86_64: {
srcs: ["linux_glibc/x86_64/lib/sdkmember.so"],
},
@@ -115,9 +135,15 @@
stl: "none",
compile_multilib: "64",
target: {
+ host: {
+ enabled: false,
+ },
android_arm64: {
srcs: ["android/arm64/lib/sdkmember.so"],
},
+ linux_glibc: {
+ enabled: true,
+ },
linux_glibc_x86_64: {
srcs: ["linux_glibc/x86_64/lib/sdkmember.so"],
},
@@ -129,6 +155,14 @@
host_supported: true,
native_shared_libs: ["mysdk_sdkmember@current"],
compile_multilib: "64",
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ },
}
`),
checkAllCopyRules(`
@@ -573,7 +607,11 @@
installable: false,
stl: "none",
target: {
+ host: {
+ enabled: false,
+ },
linux_glibc: {
+ enabled: true,
compile_multilib: "both",
},
linux_glibc_x86_64: {
@@ -583,6 +621,7 @@
srcs: ["linux_glibc/x86/bin/mynativebinary"],
},
windows: {
+ enabled: true,
compile_multilib: "64",
},
windows_x86_64: {
@@ -598,7 +637,11 @@
host_supported: true,
stl: "none",
target: {
+ host: {
+ enabled: false,
+ },
linux_glibc: {
+ enabled: true,
compile_multilib: "both",
},
linux_glibc_x86_64: {
@@ -608,6 +651,7 @@
srcs: ["linux_glibc/x86/bin/mynativebinary"],
},
windows: {
+ enabled: true,
compile_multilib: "64",
},
windows_x86_64: {
@@ -622,7 +666,14 @@
host_supported: true,
native_binaries: ["myexports_mynativebinary@current"],
target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
windows: {
+ enabled: true,
compile_multilib: "64",
},
},
@@ -636,6 +687,162 @@
)
}
+func TestSnapshotWithSingleHostOsType(t *testing.T) {
+ ctx, config := testSdkContext(`
+ cc_defaults {
+ name: "mydefaults",
+ device_supported: false,
+ host_supported: true,
+ compile_multilib: "64",
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_bionic: {
+ enabled: true,
+ },
+ },
+ }
+
+ module_exports {
+ name: "myexports",
+ defaults: ["mydefaults"],
+ native_shared_libs: ["mynativelib"],
+ native_binaries: ["mynativebinary"],
+ compile_multilib: "64", // The built-in default in sdk.go overrides mydefaults.
+ }
+
+ cc_library {
+ name: "mynativelib",
+ defaults: ["mydefaults"],
+ srcs: [
+ "Test.cpp",
+ ],
+ stl: "none",
+ }
+
+ cc_binary {
+ name: "mynativebinary",
+ defaults: ["mydefaults"],
+ srcs: [
+ "Test.cpp",
+ ],
+ stl: "none",
+ }
+ `, ccTestFs, []android.OsType{android.LinuxBionic})
+
+ result := runTests(t, ctx, config)
+
+ result.CheckSnapshot("myexports", "",
+ checkAndroidBpContents(`
+// This is auto-generated. DO NOT EDIT.
+
+cc_prebuilt_binary {
+ name: "myexports_mynativebinary@current",
+ sdk_member_name: "mynativebinary",
+ device_supported: false,
+ host_supported: true,
+ installable: false,
+ stl: "none",
+ compile_multilib: "64",
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_bionic: {
+ enabled: true,
+ },
+ linux_bionic_x86_64: {
+ srcs: ["x86_64/bin/mynativebinary"],
+ },
+ },
+}
+
+cc_prebuilt_binary {
+ name: "mynativebinary",
+ prefer: false,
+ device_supported: false,
+ host_supported: true,
+ stl: "none",
+ compile_multilib: "64",
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_bionic: {
+ enabled: true,
+ },
+ linux_bionic_x86_64: {
+ srcs: ["x86_64/bin/mynativebinary"],
+ },
+ },
+}
+
+cc_prebuilt_library_shared {
+ name: "myexports_mynativelib@current",
+ sdk_member_name: "mynativelib",
+ device_supported: false,
+ host_supported: true,
+ installable: false,
+ stl: "none",
+ compile_multilib: "64",
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_bionic: {
+ enabled: true,
+ },
+ linux_bionic_x86_64: {
+ srcs: ["x86_64/lib/mynativelib.so"],
+ },
+ },
+}
+
+cc_prebuilt_library_shared {
+ name: "mynativelib",
+ prefer: false,
+ device_supported: false,
+ host_supported: true,
+ stl: "none",
+ compile_multilib: "64",
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_bionic: {
+ enabled: true,
+ },
+ linux_bionic_x86_64: {
+ srcs: ["x86_64/lib/mynativelib.so"],
+ },
+ },
+}
+
+module_exports_snapshot {
+ name: "myexports@current",
+ device_supported: false,
+ host_supported: true,
+ native_binaries: ["myexports_mynativebinary@current"],
+ native_shared_libs: ["myexports_mynativelib@current"],
+ compile_multilib: "64",
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_bionic: {
+ enabled: true,
+ },
+ },
+}
+`),
+ checkAllCopyRules(`
+.intermediates/mynativebinary/linux_bionic_x86_64/mynativebinary -> x86_64/bin/mynativebinary
+.intermediates/mynativelib/linux_bionic_x86_64_shared/mynativelib.so -> x86_64/lib/mynativelib.so
+`),
+ )
+}
+
// Test that we support the necessary flags for the linker binary, which is
// special in several ways.
func TestSnapshotWithCcStaticNocrtBinary(t *testing.T) {
@@ -674,11 +881,17 @@
compile_multilib: "both",
static_executable: true,
nocrt: true,
- arch: {
- x86_64: {
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ linux_glibc_x86_64: {
srcs: ["x86_64/bin/linker"],
},
- x86: {
+ linux_glibc_x86: {
srcs: ["x86/bin/linker"],
},
},
@@ -693,11 +906,17 @@
compile_multilib: "both",
static_executable: true,
nocrt: true,
- arch: {
- x86_64: {
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ linux_glibc_x86_64: {
srcs: ["x86_64/bin/linker"],
},
- x86: {
+ linux_glibc_x86: {
srcs: ["x86/bin/linker"],
},
},
@@ -708,6 +927,14 @@
device_supported: false,
host_supported: true,
native_binaries: ["mymodule_exports_linker@current"],
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ },
}
`),
checkAllCopyRules(`
@@ -1034,12 +1261,18 @@
stl: "none",
compile_multilib: "both",
export_include_dirs: ["include/include"],
- arch: {
- x86_64: {
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ linux_glibc_x86_64: {
srcs: ["x86_64/lib/mynativelib.so"],
export_include_dirs: ["x86_64/include_gen/mynativelib"],
},
- x86: {
+ linux_glibc_x86: {
srcs: ["x86/lib/mynativelib.so"],
export_include_dirs: ["x86/include_gen/mynativelib"],
},
@@ -1055,12 +1288,18 @@
stl: "none",
compile_multilib: "both",
export_include_dirs: ["include/include"],
- arch: {
- x86_64: {
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ linux_glibc_x86_64: {
srcs: ["x86_64/lib/mynativelib.so"],
export_include_dirs: ["x86_64/include_gen/mynativelib"],
},
- x86: {
+ linux_glibc_x86: {
srcs: ["x86/lib/mynativelib.so"],
export_include_dirs: ["x86/include_gen/mynativelib"],
},
@@ -1072,6 +1311,14 @@
device_supported: false,
host_supported: true,
native_shared_libs: ["mysdk_mynativelib@current"],
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ },
}
`),
checkAllCopyRules(`
@@ -1130,7 +1377,11 @@
installable: false,
stl: "none",
target: {
+ host: {
+ enabled: false,
+ },
linux_glibc: {
+ enabled: true,
compile_multilib: "both",
},
linux_glibc_x86_64: {
@@ -1140,6 +1391,7 @@
srcs: ["linux_glibc/x86/lib/mynativelib.so"],
},
windows: {
+ enabled: true,
compile_multilib: "64",
},
windows_x86_64: {
@@ -1155,7 +1407,11 @@
host_supported: true,
stl: "none",
target: {
+ host: {
+ enabled: false,
+ },
linux_glibc: {
+ enabled: true,
compile_multilib: "both",
},
linux_glibc_x86_64: {
@@ -1165,6 +1421,7 @@
srcs: ["linux_glibc/x86/lib/mynativelib.so"],
},
windows: {
+ enabled: true,
compile_multilib: "64",
},
windows_x86_64: {
@@ -1179,7 +1436,14 @@
host_supported: true,
native_shared_libs: ["mysdk_mynativelib@current"],
target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
windows: {
+ enabled: true,
compile_multilib: "64",
},
},
@@ -1312,12 +1576,18 @@
stl: "none",
compile_multilib: "both",
export_include_dirs: ["include/include"],
- arch: {
- x86_64: {
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ linux_glibc_x86_64: {
srcs: ["x86_64/lib/mynativelib.a"],
export_include_dirs: ["x86_64/include_gen/mynativelib"],
},
- x86: {
+ linux_glibc_x86: {
srcs: ["x86/lib/mynativelib.a"],
export_include_dirs: ["x86/include_gen/mynativelib"],
},
@@ -1332,12 +1602,18 @@
stl: "none",
compile_multilib: "both",
export_include_dirs: ["include/include"],
- arch: {
- x86_64: {
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ linux_glibc_x86_64: {
srcs: ["x86_64/lib/mynativelib.a"],
export_include_dirs: ["x86_64/include_gen/mynativelib"],
},
- x86: {
+ linux_glibc_x86: {
srcs: ["x86/lib/mynativelib.a"],
export_include_dirs: ["x86/include_gen/mynativelib"],
},
@@ -1349,6 +1625,14 @@
device_supported: false,
host_supported: true,
native_static_libs: ["myexports_mynativelib@current"],
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ },
}
`),
checkAllCopyRules(`
@@ -1496,8 +1780,14 @@
stl: "none",
compile_multilib: "64",
export_include_dirs: ["include/include"],
- arch: {
- x86_64: {
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ linux_glibc_x86_64: {
srcs: ["x86_64/lib/mynativelib.a"],
export_include_dirs: ["x86_64/include_gen/mynativelib"],
},
@@ -1512,8 +1802,14 @@
stl: "none",
compile_multilib: "64",
export_include_dirs: ["include/include"],
- arch: {
- x86_64: {
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ linux_glibc_x86_64: {
srcs: ["x86_64/lib/mynativelib.a"],
export_include_dirs: ["x86_64/include_gen/mynativelib"],
},
@@ -1526,6 +1822,14 @@
host_supported: true,
native_static_libs: ["myexports_mynativelib@current"],
compile_multilib: "64",
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ },
}`),
checkAllCopyRules(`
include/Test.h -> include/include/Test.h
@@ -1612,6 +1916,14 @@
stl: "none",
compile_multilib: "both",
export_include_dirs: ["include/include"],
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ },
}
cc_prebuilt_library_headers {
@@ -1622,6 +1934,14 @@
stl: "none",
compile_multilib: "both",
export_include_dirs: ["include/include"],
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ },
}
sdk_snapshot {
@@ -1629,6 +1949,14 @@
device_supported: false,
host_supported: true,
native_header_libs: ["mysdk_mynativeheaders@current"],
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ },
}
`),
checkAllCopyRules(`
@@ -1673,10 +2001,14 @@
compile_multilib: "both",
export_system_include_dirs: ["common_os/include/include"],
target: {
+ host: {
+ enabled: false,
+ },
android: {
export_include_dirs: ["android/include/include-android"],
},
linux_glibc: {
+ enabled: true,
export_include_dirs: ["linux_glibc/include/include-host"],
},
},
@@ -1690,10 +2022,14 @@
compile_multilib: "both",
export_system_include_dirs: ["common_os/include/include"],
target: {
+ host: {
+ enabled: false,
+ },
android: {
export_include_dirs: ["android/include/include-android"],
},
linux_glibc: {
+ enabled: true,
export_include_dirs: ["linux_glibc/include/include-host"],
},
},
@@ -1703,6 +2039,14 @@
name: "mysdk@current",
host_supported: true,
native_header_libs: ["mysdk_mynativeheaders@current"],
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ },
}
`),
checkAllCopyRules(`
@@ -1870,6 +2214,9 @@
installable: false,
compile_multilib: "both",
target: {
+ host: {
+ enabled: false,
+ },
android: {
system_shared_libs: [],
},
@@ -1879,6 +2226,9 @@
android_arm: {
srcs: ["android/arm/lib/sslvariants.so"],
},
+ linux_glibc: {
+ enabled: true,
+ },
linux_glibc_x86_64: {
srcs: ["linux_glibc/x86_64/lib/sslvariants.so"],
},
@@ -1894,6 +2244,9 @@
host_supported: true,
compile_multilib: "both",
target: {
+ host: {
+ enabled: false,
+ },
android: {
system_shared_libs: [],
},
@@ -1903,6 +2256,9 @@
android_arm: {
srcs: ["android/arm/lib/sslvariants.so"],
},
+ linux_glibc: {
+ enabled: true,
+ },
linux_glibc_x86_64: {
srcs: ["linux_glibc/x86_64/lib/sslvariants.so"],
},
@@ -1916,6 +2272,14 @@
name: "mysdk@current",
host_supported: true,
native_shared_libs: ["mysdk_sslvariants@current"],
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ },
}
`))
}
@@ -2025,12 +2389,18 @@
versions: ["3"],
},
target: {
+ host: {
+ enabled: false,
+ },
android_arm64: {
srcs: ["android/arm64/lib/stubslib.so"],
},
android_arm: {
srcs: ["android/arm/lib/stubslib.so"],
},
+ linux_glibc: {
+ enabled: true,
+ },
linux_glibc_x86_64: {
srcs: ["linux_glibc/x86_64/lib/stubslib.so"],
},
@@ -2049,12 +2419,18 @@
versions: ["3"],
},
target: {
+ host: {
+ enabled: false,
+ },
android_arm64: {
srcs: ["android/arm64/lib/stubslib.so"],
},
android_arm: {
srcs: ["android/arm/lib/stubslib.so"],
},
+ linux_glibc: {
+ enabled: true,
+ },
linux_glibc_x86_64: {
srcs: ["linux_glibc/x86_64/lib/stubslib.so"],
},
@@ -2068,6 +2444,14 @@
name: "mysdk@current",
host_supported: true,
native_shared_libs: ["mysdk_stubslib@current"],
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ },
}
`))
}
@@ -2099,12 +2483,18 @@
unique_host_soname: true,
compile_multilib: "both",
target: {
+ host: {
+ enabled: false,
+ },
android_arm64: {
srcs: ["android/arm64/lib/mylib.so"],
},
android_arm: {
srcs: ["android/arm/lib/mylib.so"],
},
+ linux_glibc: {
+ enabled: true,
+ },
linux_glibc_x86_64: {
srcs: ["linux_glibc/x86_64/lib/mylib-host.so"],
},
@@ -2121,12 +2511,18 @@
unique_host_soname: true,
compile_multilib: "both",
target: {
+ host: {
+ enabled: false,
+ },
android_arm64: {
srcs: ["android/arm64/lib/mylib.so"],
},
android_arm: {
srcs: ["android/arm/lib/mylib.so"],
},
+ linux_glibc: {
+ enabled: true,
+ },
linux_glibc_x86_64: {
srcs: ["linux_glibc/x86_64/lib/mylib-host.so"],
},
@@ -2140,6 +2536,14 @@
name: "mysdk@current",
host_supported: true,
native_shared_libs: ["mysdk_mylib@current"],
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ },
}
`),
checkAllCopyRules(`
diff --git a/sdk/update.go b/sdk/update.go
index 25d50d2..936696a 100644
--- a/sdk/update.go
+++ b/sdk/update.go
@@ -262,7 +262,7 @@
memberCtx := &memberContext{ctx, builder, memberType, member.name}
prebuiltModule := memberType.AddPrebuiltModule(memberCtx, member)
- s.createMemberSnapshot(memberCtx, member, prebuiltModule)
+ s.createMemberSnapshot(memberCtx, member, prebuiltModule.(*bpModule))
}
// Create a transformer that will transform an unversioned module into a versioned module.
@@ -345,12 +345,37 @@
snapshotModule.AddProperty("compile_multilib", commonVariantProperties.Compile_multilib)
}
- // Iterate over the os types in a fixed order.
targetPropertySet := snapshotModule.AddPropertySet("target")
+
+ // If host is supported and any member is host OS dependent then disable host
+ // by default, so that we can enable each host OS variant explicitly. This
+ // avoids problems with implicitly enabled OS variants when the snapshot is
+ // used, which might be different from this run (e.g. different build OS).
+ hasHostOsDependentMember := false
+ if s.HostSupported() {
+ for _, memberRef := range memberRefs {
+ if memberRef.memberType.IsHostOsDependent() {
+ hasHostOsDependentMember = true
+ break
+ }
+ }
+ if hasHostOsDependentMember {
+ hostPropertySet := targetPropertySet.AddPropertySet("host")
+ hostPropertySet.AddProperty("enabled", false)
+ }
+ }
+
+ // Iterate over the os types in a fixed order.
for _, osType := range s.getPossibleOsTypes() {
if sdkVariant, ok := osTypeToMemberProperties[osType]; ok {
osPropertySet := targetPropertySet.AddPropertySet(sdkVariant.Target().Os.Name)
+ // Enable the variant explicitly when we've disabled it by default on host.
+ if hasHostOsDependentMember &&
+ (osType.Class == android.Host || osType.Class == android.HostCross) {
+ osPropertySet.AddProperty("enabled", true)
+ }
+
variantProps := variantToProperties[sdkVariant]
if variantProps.Compile_multilib != "" && variantProps.Compile_multilib != "both" {
osPropertySet.AddProperty("compile_multilib", variantProps.Compile_multilib)
@@ -993,9 +1018,12 @@
var osPropertySet android.BpPropertySet
var archPropertySet android.BpPropertySet
var archOsPrefix string
- if osInfo.Properties.Base().Os_count == 1 {
- // There is only one os type present in the variants so don't bother
- // with adding target specific properties.
+ if osInfo.Properties.Base().Os_count == 1 &&
+ (osInfo.osType.Class == android.Device || !ctx.memberType.IsHostOsDependent()) {
+ // There is only one OS type present in the variants and it shouldn't have a
+ // variant-specific target. The latter is the case if it's either for device
+ // where there is only one OS (android), or for host and the member type
+ // isn't host OS dependent.
// Create a structure that looks like:
// module_type {
@@ -1032,6 +1060,12 @@
osPropertySet = targetPropertySet.AddPropertySet(osType.Name)
archPropertySet = targetPropertySet
+ // Enable the variant explicitly when we've disabled it by default on host.
+ if ctx.memberType.IsHostOsDependent() &&
+ (osType.Class == android.Host || osType.Class == android.HostCross) {
+ osPropertySet.AddProperty("enabled", true)
+ }
+
// Arch specific properties need to be added to an os and arch specific
// section prefixed with <os>_.
archOsPrefix = osType.Name + "_"
@@ -1202,7 +1236,7 @@
return m.name
}
-func (s *sdk) createMemberSnapshot(ctx *memberContext, member *sdkMember, bpModule android.BpModule) {
+func (s *sdk) createMemberSnapshot(ctx *memberContext, member *sdkMember, bpModule *bpModule) {
memberType := member.memberType
@@ -1256,6 +1290,18 @@
// added.
targetPropertySet := bpModule.AddPropertySet("target")
+ // If the member is host OS dependent and has host_supported then disable by
+ // default and enable each host OS variant explicitly. This avoids problems
+ // with implicitly enabled OS variants when the snapshot is used, which might
+ // be different from this run (e.g. different build OS).
+ if ctx.memberType.IsHostOsDependent() {
+ hostSupported := bpModule.getValue("host_supported") == true // Missing means false.
+ if hostSupported {
+ hostPropertySet := targetPropertySet.AddPropertySet("host")
+ hostPropertySet.AddProperty("enabled", false)
+ }
+ }
+
// Iterate over the os types in a fixed order.
for _, osType := range s.getPossibleOsTypes() {
osInfo := osTypeToInfo[osType]
diff --git a/third_party/zip/android.go b/third_party/zip/android.go
index 8d387cc..f8e45c5 100644
--- a/third_party/zip/android.go
+++ b/third_party/zip/android.go
@@ -43,6 +43,15 @@
offset: uint64(w.cw.count),
}
w.dir = append(w.dir, h)
+ if !fh.isZip64() {
+ // Some writers will generate 64 bit sizes and set 32 bit fields to
+ // uint32max even if the actual size fits in 32 bit. So we should
+ // make sure CompressedSize contains the correct value in such
+ // cases. With out the two lines below we would be writing invalid(-1)
+ // sizes in such case.
+ fh.CompressedSize = uint32(fh.CompressedSize64)
+ fh.UncompressedSize = uint32(fh.UncompressedSize64)
+ }
if err := writeHeader(w.cw, fh); err != nil {
return err
diff --git a/ui/build/config.go b/ui/build/config.go
index 3fa0479..e9a8fc9 100644
--- a/ui/build/config.go
+++ b/ui/build/config.go
@@ -15,6 +15,7 @@
package build
import (
+ "fmt"
"os"
"path/filepath"
"runtime"
@@ -23,6 +24,9 @@
"time"
"android/soong/shared"
+ "github.com/golang/protobuf/proto"
+
+ smpb "android/soong/ui/metrics/metrics_proto"
)
type Config struct{ *configImpl }
@@ -53,8 +57,6 @@
// Autodetected
totalRAM uint64
- pdkBuild bool
-
brokenDupRules bool
brokenUsesNetwork bool
brokenNinjaEnvVars []string
@@ -260,12 +262,14 @@
ret.environ.Set("BUILD_DATETIME_FILE", buildDateTimeFile)
if ret.UseRBE() {
- for k, v := range getRBEVars(ctx, tmpDir) {
+ for k, v := range getRBEVars(ctx, Config{ret}) {
ret.environ.Set(k, v)
}
}
- return Config{ret}
+ c := Config{ret}
+ storeConfigMetrics(ctx, c)
+ return c
}
// NewBuildActionConfig returns a build configuration based on the build action. The arguments are
@@ -274,6 +278,20 @@
return NewConfig(ctx, getConfigArgs(action, dir, ctx, args)...)
}
+// storeConfigMetrics selects a set of configuration information and store in
+// the metrics system for further analysis.
+func storeConfigMetrics(ctx Context, config Config) {
+ if ctx.Metrics == nil {
+ return
+ }
+
+ b := &smpb.BuildConfig{
+ UseGoma: proto.Bool(config.UseGoma()),
+ UseRbe: proto.Bool(config.UseRBE()),
+ }
+ ctx.Metrics.BuildConfig(b)
+}
+
// getConfigArgs processes the command arguments based on the build action and creates a set of new
// arguments to be accepted by Config.
func getConfigArgs(action BuildAction, dir string, ctx Context, args []string) []string {
@@ -808,13 +826,73 @@
return true
}
-func (c *configImpl) RBEStatsOutputDir() string {
+func (c *configImpl) logDir() string {
+ if c.Dist() {
+ return filepath.Join(c.DistDir(), "logs")
+ }
+ return c.OutDir()
+}
+
+func (c *configImpl) rbeStatsOutputDir() string {
for _, f := range []string{"RBE_output_dir", "FLAG_output_dir"} {
if v, ok := c.environ.Get(f); ok {
return v
}
}
- return ""
+ return c.logDir()
+}
+
+func (c *configImpl) rbeLogPath() string {
+ for _, f := range []string{"RBE_log_path", "FLAG_log_path"} {
+ if v, ok := c.environ.Get(f); ok {
+ return v
+ }
+ }
+ return fmt.Sprintf("text://%v/reproxy_log.txt", c.logDir())
+}
+
+func (c *configImpl) rbeExecRoot() string {
+ for _, f := range []string{"RBE_exec_root", "FLAG_exec_root"} {
+ if v, ok := c.environ.Get(f); ok {
+ return v
+ }
+ }
+ wd, err := os.Getwd()
+ if err != nil {
+ return ""
+ }
+ return wd
+}
+
+func (c *configImpl) rbeDir() string {
+ if v, ok := c.environ.Get("RBE_DIR"); ok {
+ return v
+ }
+ return "prebuilts/remoteexecution-client/live/"
+}
+
+func (c *configImpl) rbeReproxy() string {
+ for _, f := range []string{"RBE_re_proxy", "FLAG_re_proxy"} {
+ if v, ok := c.environ.Get(f); ok {
+ return v
+ }
+ }
+ return filepath.Join(c.rbeDir(), "reproxy")
+}
+
+func (c *configImpl) rbeAuth() (string, string) {
+ credFlags := []string{"use_application_default_credentials", "use_gce_credentials", "credential_file"}
+ for _, cf := range credFlags {
+ for _, f := range []string{"RBE_" + cf, "FLAG_" + cf} {
+ if v, ok := c.environ.Get(f); ok {
+ v = strings.TrimSpace(v)
+ if v != "" && v != "false" && v != "0" {
+ return "RBE_" + cf, v
+ }
+ }
+ }
+ }
+ return "RBE_use_application_default_credentials", "true"
}
func (c *configImpl) UseRemoteBuild() bool {
@@ -968,14 +1046,6 @@
return c.targetDeviceDir
}
-func (c *configImpl) SetPdkBuild(pdk bool) {
- c.pdkBuild = pdk
-}
-
-func (c *configImpl) IsPdkBuild() bool {
- return c.pdkBuild
-}
-
func (c *configImpl) BuildDateTime() string {
return c.buildDateTime
}
diff --git a/ui/build/dumpvars.go b/ui/build/dumpvars.go
index e229856..999af07 100644
--- a/ui/build/dumpvars.go
+++ b/ui/build/dumpvars.go
@@ -161,8 +161,6 @@
"BUILD_ID",
"OUT_DIR",
"AUX_OS_VARIANT_LIST",
- "TARGET_BUILD_PDK",
- "PDK_FUSION_PLATFORM_ZIP",
"PRODUCT_SOONG_NAMESPACES",
}
@@ -281,7 +279,6 @@
config.SetTargetDevice(make_vars["TARGET_DEVICE"])
config.SetTargetDeviceDir(make_vars["TARGET_DEVICE_DIR"])
- config.SetPdkBuild(make_vars["TARGET_BUILD_PDK"] == "true")
config.SetBuildBrokenDupRules(make_vars["BUILD_BROKEN_DUP_RULES"] == "true")
config.SetBuildBrokenUsesNetwork(make_vars["BUILD_BROKEN_USES_NETWORK"] == "true")
config.SetBuildBrokenNinjaUsesEnvVars(strings.Fields(make_vars["BUILD_BROKEN_NINJA_USES_ENV_VARS"]))
diff --git a/ui/build/kati.go b/ui/build/kati.go
index 1cd5fea..f6d3a57 100644
--- a/ui/build/kati.go
+++ b/ui/build/kati.go
@@ -134,14 +134,10 @@
args := []string{
"--writable", config.OutDir() + "/",
+ "--werror_implicit_rules",
"-f", "build/make/core/main.mk",
}
- // PDK builds still uses a few implicit rules
- if !config.IsPdkBuild() {
- args = append(args, "--werror_implicit_rules")
- }
-
if !config.BuildBrokenDupRules() {
args = append(args, "--werror_overriding_commands")
}
diff --git a/ui/build/paths/config.go b/ui/build/paths/config.go
index 5717401..81c500d 100644
--- a/ui/build/paths/config.go
+++ b/ui/build/paths/config.go
@@ -88,7 +88,6 @@
"javap": Allowed,
"lsof": Allowed,
"openssl": Allowed,
- "patch": Allowed,
"pstree": Allowed,
"rsync": Allowed,
"sh": Allowed,
diff --git a/ui/build/rbe.go b/ui/build/rbe.go
index fd3b7ab..99107e3 100644
--- a/ui/build/rbe.go
+++ b/ui/build/rbe.go
@@ -37,10 +37,8 @@
func rbeCommand(ctx Context, config Config, rbeCmd string) string {
var cmdPath string
- if rbeDir, ok := config.Environment().Get("RBE_DIR"); ok {
+ if rbeDir := config.rbeDir(); rbeDir != "" {
cmdPath = filepath.Join(rbeDir, rbeCmd)
- } else if home, ok := config.Environment().Get("HOME"); ok {
- cmdPath = filepath.Join(home, "rbe", rbeCmd)
} else {
ctx.Fatalf("rbe command path not found")
}
@@ -52,9 +50,18 @@
return cmdPath
}
-func getRBEVars(ctx Context, tmpDir string) map[string]string {
+func getRBEVars(ctx Context, config Config) map[string]string {
rand.Seed(time.Now().UnixNano())
- return map[string]string{"RBE_server_address": fmt.Sprintf("unix://%v/reproxy_%v.sock", tmpDir, rand.Intn(1000))}
+ vars := map[string]string{
+ "RBE_server_address": fmt.Sprintf("unix://%v/reproxy_%v.sock", absPath(ctx, config.TempDir()), rand.Intn(1000)),
+ "RBE_log_path": config.rbeLogPath(),
+ "RBE_re_proxy": config.rbeReproxy(),
+ "RBE_exec_root": config.rbeExecRoot(),
+ "RBE_output_dir": config.rbeStatsOutputDir(),
+ }
+ k, v := config.rbeAuth()
+ vars[k] = v
+ return vars
}
func startRBE(ctx Context, config Config) {
@@ -102,7 +109,7 @@
return
}
- outputDir := config.RBEStatsOutputDir()
+ outputDir := config.rbeStatsOutputDir()
if outputDir == "" {
ctx.Fatal("RBE output dir variable not defined. Aborting metrics dumping.")
}
@@ -111,6 +118,9 @@
// Stop the proxy first in order to generate the RBE metrics protobuf file.
stopRBE(ctx, config)
+ if metricsFile == filename {
+ return
+ }
if _, err := copyFile(metricsFile, filename); err != nil {
ctx.Fatalf("failed to copy %q to %q: %v\n", metricsFile, filename, err)
}
diff --git a/ui/build/rbe_test.go b/ui/build/rbe_test.go
index 23a53b4..8ff96bc 100644
--- a/ui/build/rbe_test.go
+++ b/ui/build/rbe_test.go
@@ -83,24 +83,13 @@
func TestDumpRBEMetricsErrors(t *testing.T) {
ctx := testContext()
tests := []struct {
- description string
- rbeOutputDirDefined bool
- bootstrapProgram string
- expectedErr string
+ description string
+ bootstrapProgram string
+ expectedErr string
}{{
- description: "output_dir not defined",
- bootstrapProgram: rbeBootstrapProgram,
- expectedErr: "RBE output dir variable not defined",
- }, {
- description: "stopRBE failed",
- rbeOutputDirDefined: true,
- bootstrapProgram: "#!/bin/bash\nexit 1\n",
- expectedErr: "shutdown failed",
- }, {
- description: "failed to copy metrics file",
- rbeOutputDirDefined: true,
- bootstrapProgram: "#!/bin/bash\n",
- expectedErr: "failed to copy",
+ description: "stopRBE failed",
+ bootstrapProgram: "#!/bin/bash\nexit 1\n",
+ expectedErr: "shutdown failed",
}}
for _, tt := range tests {
@@ -124,10 +113,6 @@
env.Set("OUT_DIR", tmpDir)
env.Set("RBE_DIR", tmpDir)
- if tt.rbeOutputDirDefined {
- env.Set("RBE_output_dir", t.TempDir())
- }
-
config := Config{&configImpl{
environ: env,
}}
diff --git a/ui/metrics/metrics.go b/ui/metrics/metrics.go
index 2b5c4c3..f5552a3 100644
--- a/ui/metrics/metrics.go
+++ b/ui/metrics/metrics.go
@@ -17,6 +17,7 @@
import (
"io/ioutil"
"os"
+ "runtime"
"time"
"github.com/golang/protobuf/proto"
@@ -65,6 +66,10 @@
}
}
+func (m *Metrics) BuildConfig(b *soong_metrics_proto.BuildConfig) {
+ m.metrics.BuildConfig = b
+}
+
func (m *Metrics) SetMetadataMetrics(metadata map[string]string) {
for k, v := range metadata {
switch k {
@@ -98,8 +103,6 @@
m.metrics.HostArch = m.getArch(v)
case "HOST_2ND_ARCH":
m.metrics.Host_2NdArch = m.getArch(v)
- case "HOST_OS":
- m.metrics.HostOs = proto.String(v)
case "HOST_OS_EXTRA":
m.metrics.HostOsExtra = proto.String(v)
case "HOST_CROSS_OS":
@@ -137,6 +140,7 @@
// exports the output to the file at outputPath
func (m *Metrics) Dump(outputPath string) (err error) {
+ m.metrics.HostOs = proto.String(runtime.GOOS)
return writeMessageToFile(&m.metrics, outputPath)
}
diff --git a/ui/metrics/metrics_proto/metrics.pb.go b/ui/metrics/metrics_proto/metrics.pb.go
index a39d1a8..d7c53ec 100644
--- a/ui/metrics/metrics_proto/metrics.pb.go
+++ b/ui/metrics/metrics_proto/metrics.pb.go
@@ -152,7 +152,7 @@
}
func (ModuleTypeInfo_BuildSystem) EnumDescriptor() ([]byte, []int) {
- return fileDescriptor_6039342a2ba47b72, []int{2, 0}
+ return fileDescriptor_6039342a2ba47b72, []int{3, 0}
}
type MetricsBase struct {
@@ -199,6 +199,7 @@
// The metrics for the whole build
Total *PerfInfo `protobuf:"bytes,21,opt,name=total" json:"total,omitempty"`
SoongBuildMetrics *SoongBuildMetrics `protobuf:"bytes,22,opt,name=soong_build_metrics,json=soongBuildMetrics" json:"soong_build_metrics,omitempty"`
+ BuildConfig *BuildConfig `protobuf:"bytes,23,opt,name=build_config,json=buildConfig" json:"build_config,omitempty"`
XXX_NoUnkeyedLiteral struct{} `json:"-"`
XXX_unrecognized []byte `json:"-"`
XXX_sizecache int32 `json:"-"`
@@ -388,6 +389,60 @@
return nil
}
+func (m *MetricsBase) GetBuildConfig() *BuildConfig {
+ if m != nil {
+ return m.BuildConfig
+ }
+ return nil
+}
+
+type BuildConfig struct {
+ UseGoma *bool `protobuf:"varint,1,opt,name=use_goma,json=useGoma" json:"use_goma,omitempty"`
+ UseRbe *bool `protobuf:"varint,2,opt,name=use_rbe,json=useRbe" json:"use_rbe,omitempty"`
+ XXX_NoUnkeyedLiteral struct{} `json:"-"`
+ XXX_unrecognized []byte `json:"-"`
+ XXX_sizecache int32 `json:"-"`
+}
+
+func (m *BuildConfig) Reset() { *m = BuildConfig{} }
+func (m *BuildConfig) String() string { return proto.CompactTextString(m) }
+func (*BuildConfig) ProtoMessage() {}
+func (*BuildConfig) Descriptor() ([]byte, []int) {
+ return fileDescriptor_6039342a2ba47b72, []int{1}
+}
+
+func (m *BuildConfig) XXX_Unmarshal(b []byte) error {
+ return xxx_messageInfo_BuildConfig.Unmarshal(m, b)
+}
+func (m *BuildConfig) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) {
+ return xxx_messageInfo_BuildConfig.Marshal(b, m, deterministic)
+}
+func (m *BuildConfig) XXX_Merge(src proto.Message) {
+ xxx_messageInfo_BuildConfig.Merge(m, src)
+}
+func (m *BuildConfig) XXX_Size() int {
+ return xxx_messageInfo_BuildConfig.Size(m)
+}
+func (m *BuildConfig) XXX_DiscardUnknown() {
+ xxx_messageInfo_BuildConfig.DiscardUnknown(m)
+}
+
+var xxx_messageInfo_BuildConfig proto.InternalMessageInfo
+
+func (m *BuildConfig) GetUseGoma() bool {
+ if m != nil && m.UseGoma != nil {
+ return *m.UseGoma
+ }
+ return false
+}
+
+func (m *BuildConfig) GetUseRbe() bool {
+ if m != nil && m.UseRbe != nil {
+ return *m.UseRbe
+ }
+ return false
+}
+
type PerfInfo struct {
// The description for the phase/action/part while the tool running.
Desc *string `protobuf:"bytes,1,opt,name=desc" json:"desc,omitempty"`
@@ -410,7 +465,7 @@
func (m *PerfInfo) String() string { return proto.CompactTextString(m) }
func (*PerfInfo) ProtoMessage() {}
func (*PerfInfo) Descriptor() ([]byte, []int) {
- return fileDescriptor_6039342a2ba47b72, []int{1}
+ return fileDescriptor_6039342a2ba47b72, []int{2}
}
func (m *PerfInfo) XXX_Unmarshal(b []byte) error {
@@ -482,7 +537,7 @@
func (m *ModuleTypeInfo) String() string { return proto.CompactTextString(m) }
func (*ModuleTypeInfo) ProtoMessage() {}
func (*ModuleTypeInfo) Descriptor() ([]byte, []int) {
- return fileDescriptor_6039342a2ba47b72, []int{2}
+ return fileDescriptor_6039342a2ba47b72, []int{3}
}
func (m *ModuleTypeInfo) XXX_Unmarshal(b []byte) error {
@@ -540,7 +595,7 @@
func (m *CriticalUserJourneyMetrics) String() string { return proto.CompactTextString(m) }
func (*CriticalUserJourneyMetrics) ProtoMessage() {}
func (*CriticalUserJourneyMetrics) Descriptor() ([]byte, []int) {
- return fileDescriptor_6039342a2ba47b72, []int{3}
+ return fileDescriptor_6039342a2ba47b72, []int{4}
}
func (m *CriticalUserJourneyMetrics) XXX_Unmarshal(b []byte) error {
@@ -587,7 +642,7 @@
func (m *CriticalUserJourneysMetrics) String() string { return proto.CompactTextString(m) }
func (*CriticalUserJourneysMetrics) ProtoMessage() {}
func (*CriticalUserJourneysMetrics) Descriptor() ([]byte, []int) {
- return fileDescriptor_6039342a2ba47b72, []int{4}
+ return fileDescriptor_6039342a2ba47b72, []int{5}
}
func (m *CriticalUserJourneysMetrics) XXX_Unmarshal(b []byte) error {
@@ -635,7 +690,7 @@
func (m *SoongBuildMetrics) String() string { return proto.CompactTextString(m) }
func (*SoongBuildMetrics) ProtoMessage() {}
func (*SoongBuildMetrics) Descriptor() ([]byte, []int) {
- return fileDescriptor_6039342a2ba47b72, []int{5}
+ return fileDescriptor_6039342a2ba47b72, []int{6}
}
func (m *SoongBuildMetrics) XXX_Unmarshal(b []byte) error {
@@ -696,6 +751,7 @@
proto.RegisterEnum("soong_build_metrics.MetricsBase_Arch", MetricsBase_Arch_name, MetricsBase_Arch_value)
proto.RegisterEnum("soong_build_metrics.ModuleTypeInfo_BuildSystem", ModuleTypeInfo_BuildSystem_name, ModuleTypeInfo_BuildSystem_value)
proto.RegisterType((*MetricsBase)(nil), "soong_build_metrics.MetricsBase")
+ proto.RegisterType((*BuildConfig)(nil), "soong_build_metrics.BuildConfig")
proto.RegisterType((*PerfInfo)(nil), "soong_build_metrics.PerfInfo")
proto.RegisterType((*ModuleTypeInfo)(nil), "soong_build_metrics.ModuleTypeInfo")
proto.RegisterType((*CriticalUserJourneyMetrics)(nil), "soong_build_metrics.CriticalUserJourneyMetrics")
@@ -703,69 +759,74 @@
proto.RegisterType((*SoongBuildMetrics)(nil), "soong_build_metrics.SoongBuildMetrics")
}
-func init() { proto.RegisterFile("metrics.proto", fileDescriptor_6039342a2ba47b72) }
+func init() {
+ proto.RegisterFile("metrics.proto", fileDescriptor_6039342a2ba47b72)
+}
var fileDescriptor_6039342a2ba47b72 = []byte{
- // 962 bytes of a gzipped FileDescriptorProto
- 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0x9c, 0x56, 0xef, 0x4e, 0xdc, 0x46,
- 0x10, 0x8f, 0xe1, 0xe0, 0xce, 0x63, 0xee, 0x30, 0x0b, 0x69, 0x9c, 0x44, 0xa8, 0x27, 0xab, 0x89,
- 0x50, 0xd5, 0x90, 0x88, 0x46, 0x28, 0x42, 0x51, 0x25, 0x38, 0x50, 0x9a, 0x22, 0xb8, 0xc8, 0xfc,
- 0x69, 0xd4, 0x7e, 0x58, 0x2d, 0xf6, 0x12, 0x9c, 0xda, 0x5e, 0x6b, 0x77, 0x1d, 0x41, 0xde, 0xa1,
- 0x0f, 0xd4, 0xcf, 0x7d, 0x96, 0xbe, 0x47, 0xb5, 0xb3, 0xf6, 0x61, 0xda, 0x8b, 0x40, 0xf9, 0x66,
- 0xcf, 0xef, 0xcf, 0xce, 0xac, 0x67, 0xe6, 0x0e, 0xfa, 0x39, 0xd7, 0x32, 0x8d, 0xd5, 0x7a, 0x29,
- 0x85, 0x16, 0x64, 0x59, 0x09, 0x51, 0x7c, 0xa0, 0x67, 0x55, 0x9a, 0x25, 0xb4, 0x86, 0xc2, 0xbf,
- 0x00, 0xbc, 0x03, 0xfb, 0xbc, 0xc3, 0x14, 0x27, 0x2f, 0x60, 0xc5, 0x12, 0x12, 0xa6, 0x39, 0xd5,
- 0x69, 0xce, 0x95, 0x66, 0x79, 0x19, 0x38, 0x43, 0x67, 0x6d, 0x36, 0x22, 0x88, 0xed, 0x32, 0xcd,
- 0x8f, 0x1b, 0x84, 0x3c, 0x84, 0x9e, 0x55, 0xa4, 0x49, 0x30, 0x33, 0x74, 0xd6, 0xdc, 0xa8, 0x8b,
- 0xef, 0x6f, 0x13, 0xb2, 0x05, 0x0f, 0xcb, 0x8c, 0xe9, 0x73, 0x21, 0x73, 0xfa, 0x89, 0x4b, 0x95,
- 0x8a, 0x82, 0xc6, 0x22, 0xe1, 0x05, 0xcb, 0x79, 0x30, 0x8b, 0xdc, 0x07, 0x0d, 0xe1, 0xd4, 0xe2,
- 0xa3, 0x1a, 0x26, 0x4f, 0x60, 0xa0, 0x99, 0xfc, 0xc0, 0x35, 0x2d, 0xa5, 0x48, 0xaa, 0x58, 0x07,
- 0x1d, 0x14, 0xf4, 0x6d, 0xf4, 0x9d, 0x0d, 0x92, 0x04, 0x56, 0x6a, 0x9a, 0x4d, 0xe2, 0x13, 0x93,
- 0x29, 0x2b, 0x74, 0x30, 0x37, 0x74, 0xd6, 0x06, 0x1b, 0xcf, 0xd6, 0xa7, 0xd4, 0xbc, 0xde, 0xaa,
- 0x77, 0x7d, 0xc7, 0x20, 0xa7, 0x56, 0xb4, 0x35, 0xbb, 0x77, 0xf8, 0x26, 0x22, 0xd6, 0xaf, 0x0d,
- 0x90, 0x31, 0x78, 0xf5, 0x29, 0x4c, 0xc6, 0x17, 0xc1, 0x3c, 0x9a, 0x3f, 0xb9, 0xd5, 0x7c, 0x5b,
- 0xc6, 0x17, 0x5b, 0xdd, 0x93, 0xc3, 0xfd, 0xc3, 0xf1, 0xaf, 0x87, 0x11, 0x58, 0x0b, 0x13, 0x24,
- 0xeb, 0xb0, 0xdc, 0x32, 0x9c, 0x64, 0xdd, 0xc5, 0x12, 0x97, 0xae, 0x89, 0x4d, 0x02, 0x3f, 0x40,
- 0x9d, 0x16, 0x8d, 0xcb, 0x6a, 0x42, 0xef, 0x21, 0xdd, 0xb7, 0xc8, 0xa8, 0xac, 0x1a, 0xf6, 0x3e,
- 0xb8, 0x17, 0x42, 0xd5, 0xc9, 0xba, 0x5f, 0x95, 0x6c, 0xcf, 0x18, 0x60, 0xaa, 0x11, 0xf4, 0xd1,
- 0x6c, 0xa3, 0x48, 0xac, 0x21, 0x7c, 0x95, 0xa1, 0x67, 0x4c, 0x36, 0x8a, 0x04, 0x3d, 0x1f, 0x40,
- 0x17, 0x3d, 0x85, 0x0a, 0x3c, 0xac, 0x61, 0xde, 0xbc, 0x8e, 0x15, 0x09, 0xeb, 0xc3, 0x84, 0xa2,
- 0xfc, 0x52, 0x4b, 0x16, 0x2c, 0x20, 0xec, 0x59, 0x78, 0xcf, 0x84, 0x26, 0x9c, 0x58, 0x0a, 0xa5,
- 0x8c, 0x45, 0xff, 0x9a, 0x33, 0x32, 0xb1, 0xb1, 0x22, 0x4f, 0x61, 0xb1, 0xc5, 0xc1, 0xb4, 0x07,
- 0xb6, 0x7d, 0x26, 0x2c, 0x4c, 0xe4, 0x19, 0x2c, 0xb7, 0x78, 0x93, 0x12, 0x17, 0xed, 0xc5, 0x4e,
- 0xb8, 0xad, 0xbc, 0x45, 0xa5, 0x69, 0x92, 0xca, 0xc0, 0xb7, 0x79, 0x8b, 0x4a, 0xef, 0xa6, 0x92,
- 0xfc, 0x04, 0x9e, 0xe2, 0xba, 0x2a, 0xa9, 0x16, 0x22, 0x53, 0xc1, 0xd2, 0x70, 0x76, 0xcd, 0xdb,
- 0x58, 0x9d, 0x7a, 0x45, 0xef, 0xb8, 0x3c, 0x7f, 0x5b, 0x9c, 0x8b, 0x08, 0x50, 0x71, 0x6c, 0x04,
- 0x64, 0x0b, 0xdc, 0x3f, 0x98, 0x4e, 0xa9, 0xac, 0x0a, 0x15, 0x90, 0xbb, 0xa8, 0x7b, 0x86, 0x1f,
- 0x55, 0x85, 0x22, 0xaf, 0x01, 0x2c, 0x13, 0xc5, 0xcb, 0x77, 0x11, 0xbb, 0x88, 0x36, 0xea, 0x22,
- 0x2d, 0x3e, 0x32, 0xab, 0x5e, 0xb9, 0x93, 0x1a, 0x05, 0xa8, 0xfe, 0x11, 0xe6, 0xb4, 0xd0, 0x2c,
- 0x0b, 0xee, 0x0f, 0x9d, 0xdb, 0x85, 0x96, 0x4b, 0x4e, 0x61, 0xda, 0x2a, 0x0a, 0xbe, 0x41, 0x8b,
- 0xa7, 0x53, 0x2d, 0x8e, 0x4c, 0x0c, 0x47, 0xb2, 0xee, 0xb0, 0x68, 0x49, 0xfd, 0x37, 0x14, 0xbe,
- 0x80, 0x85, 0x1b, 0x53, 0xdb, 0x83, 0xce, 0xc9, 0xd1, 0x5e, 0xe4, 0xdf, 0x23, 0x7d, 0x70, 0xcd,
- 0xd3, 0xee, 0xde, 0xce, 0xc9, 0x1b, 0xdf, 0x21, 0x5d, 0x30, 0x93, 0xee, 0xcf, 0x84, 0xaf, 0xa1,
- 0x83, 0xdf, 0xd5, 0x83, 0xa6, 0x4f, 0xfd, 0x7b, 0x06, 0xdd, 0x8e, 0x0e, 0x7c, 0x87, 0xb8, 0x30,
- 0xb7, 0x1d, 0x1d, 0x6c, 0xbe, 0xf4, 0x67, 0x4c, 0xec, 0xfd, 0xab, 0x4d, 0x7f, 0x96, 0x00, 0xcc,
- 0xbf, 0x7f, 0xb5, 0x49, 0x37, 0x5f, 0xfa, 0x9d, 0xf0, 0x4f, 0x07, 0x7a, 0x4d, 0x6d, 0x84, 0x40,
- 0x27, 0xe1, 0x2a, 0xc6, 0x45, 0xe9, 0x46, 0xf8, 0x6c, 0x62, 0xb8, 0xea, 0xec, 0x5a, 0xc4, 0x67,
- 0xb2, 0x0a, 0xa0, 0x34, 0x93, 0x1a, 0x77, 0x2b, 0x2e, 0xc1, 0x4e, 0xe4, 0x62, 0xc4, 0xac, 0x54,
- 0xf2, 0x18, 0x5c, 0xc9, 0x59, 0x66, 0xd1, 0x0e, 0xa2, 0x3d, 0x13, 0x40, 0x70, 0x15, 0x20, 0xe7,
- 0xb9, 0x90, 0x57, 0xb4, 0x52, 0x1c, 0x57, 0x5c, 0x27, 0x72, 0x6d, 0xe4, 0x44, 0xf1, 0xf0, 0x1f,
- 0x07, 0x06, 0x07, 0x22, 0xa9, 0x32, 0x7e, 0x7c, 0x55, 0x72, 0xcc, 0xea, 0x77, 0x58, 0xb0, 0x17,
- 0xa9, 0xae, 0x94, 0xe6, 0x39, 0x66, 0x37, 0xd8, 0x78, 0x3e, 0x7d, 0x76, 0x6f, 0x48, 0xed, 0x66,
- 0x3c, 0x42, 0x59, 0x6b, 0x8a, 0xcf, 0xae, 0xa3, 0xe4, 0x5b, 0xf0, 0x72, 0xd4, 0x50, 0x7d, 0x55,
- 0x36, 0x55, 0x42, 0x3e, 0xb1, 0x21, 0xdf, 0xc1, 0xa0, 0xa8, 0x72, 0x2a, 0xce, 0xa9, 0x0d, 0x2a,
- 0xac, 0xb7, 0x1f, 0x2d, 0x14, 0x55, 0x3e, 0x3e, 0xb7, 0xe7, 0xa9, 0xf0, 0x39, 0x78, 0xad, 0xb3,
- 0x6e, 0x7e, 0x0b, 0x17, 0xe6, 0x8e, 0xc6, 0xe3, 0x43, 0xf3, 0xd1, 0x7a, 0xd0, 0x39, 0xd8, 0xde,
- 0xdf, 0xf3, 0x67, 0xc2, 0x0c, 0x1e, 0x8d, 0x64, 0xaa, 0xd3, 0x98, 0x65, 0x27, 0x8a, 0xcb, 0x5f,
- 0x44, 0x25, 0x0b, 0x7e, 0x55, 0x77, 0xc1, 0xe4, 0xd2, 0x9d, 0xd6, 0xa5, 0x6f, 0x41, 0xb7, 0xe9,
- 0xb2, 0x19, 0xec, 0xb2, 0xe1, 0x6d, 0xdb, 0x2b, 0x6a, 0x04, 0xe1, 0x19, 0x3c, 0x9e, 0x72, 0x9a,
- 0x6a, 0x8e, 0x1b, 0x41, 0x27, 0xae, 0x3e, 0xaa, 0xc0, 0xc1, 0xc9, 0x99, 0x7e, 0xb3, 0x5f, 0xce,
- 0x36, 0x42, 0x71, 0xf8, 0xb7, 0x03, 0x4b, 0xff, 0x6b, 0x71, 0x12, 0x40, 0xb7, 0xb9, 0x37, 0x07,
- 0xef, 0xad, 0x79, 0x25, 0x8f, 0xa0, 0x57, 0xff, 0x06, 0xd8, 0x82, 0xfa, 0xd1, 0xe4, 0x9d, 0x7c,
- 0x0f, 0x4b, 0x38, 0x66, 0x94, 0x65, 0x99, 0x88, 0x69, 0x2c, 0xaa, 0x42, 0xd7, 0x7d, 0xb6, 0x88,
- 0xc0, 0xb6, 0x89, 0x8f, 0x4c, 0x98, 0xac, 0x81, 0xdf, 0xe6, 0xaa, 0xf4, 0x73, 0xd3, 0x74, 0x83,
- 0x6b, 0xea, 0x51, 0xfa, 0x99, 0x9b, 0xa5, 0x9b, 0xb3, 0x4b, 0x7a, 0xc1, 0x59, 0x69, 0x69, 0xb6,
- 0xfb, 0xbc, 0x9c, 0x5d, 0xfe, 0xcc, 0x59, 0x69, 0x38, 0x3b, 0xf7, 0x7f, 0xab, 0xe7, 0xba, 0xae,
- 0x9b, 0xe2, 0xff, 0x8e, 0x7f, 0x03, 0x00, 0x00, 0xff, 0xff, 0x4d, 0x2a, 0x36, 0xe3, 0x87, 0x08,
- 0x00, 0x00,
+ // 1021 bytes of a gzipped FileDescriptorProto
+ 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0x9c, 0x56, 0xef, 0x6e, 0xdb, 0x36,
+ 0x10, 0xaf, 0x12, 0x27, 0xb6, 0x4e, 0xb1, 0xab, 0x30, 0xed, 0xa2, 0xb6, 0x08, 0x66, 0x18, 0x6b,
+ 0x11, 0x0c, 0x6b, 0x5a, 0x64, 0x45, 0x50, 0x04, 0xc5, 0x00, 0xc7, 0x09, 0xb2, 0x2e, 0x48, 0x5c,
+ 0x30, 0x7f, 0x56, 0x6c, 0x1f, 0x04, 0x5a, 0xa2, 0x13, 0x75, 0x96, 0x28, 0x90, 0x54, 0x91, 0xf4,
+ 0x1d, 0xf6, 0x54, 0x7b, 0x96, 0xbd, 0xc6, 0x30, 0xf0, 0x28, 0xd9, 0xca, 0xe6, 0xad, 0x41, 0xbf,
+ 0x89, 0xf7, 0xfb, 0xc3, 0x3b, 0xf2, 0x78, 0x36, 0xb4, 0x53, 0xae, 0x65, 0x12, 0xa9, 0xad, 0x5c,
+ 0x0a, 0x2d, 0xc8, 0x9a, 0x12, 0x22, 0xbb, 0x0c, 0x47, 0x45, 0x32, 0x89, 0xc3, 0x12, 0xea, 0xfd,
+ 0x05, 0xe0, 0x1d, 0xdb, 0xef, 0x3d, 0xa6, 0x38, 0x79, 0x09, 0x0f, 0x2c, 0x21, 0x66, 0x9a, 0x87,
+ 0x3a, 0x49, 0xb9, 0xd2, 0x2c, 0xcd, 0x03, 0xa7, 0xeb, 0x6c, 0x2e, 0x52, 0x82, 0xd8, 0x3e, 0xd3,
+ 0xfc, 0xac, 0x42, 0xc8, 0x23, 0x68, 0x59, 0x45, 0x12, 0x07, 0x0b, 0x5d, 0x67, 0xd3, 0xa5, 0x4d,
+ 0x5c, 0xbf, 0x8d, 0xc9, 0x2e, 0x3c, 0xca, 0x27, 0x4c, 0x8f, 0x85, 0x4c, 0xc3, 0x8f, 0x5c, 0xaa,
+ 0x44, 0x64, 0x61, 0x24, 0x62, 0x9e, 0xb1, 0x94, 0x07, 0x8b, 0xc8, 0x5d, 0xaf, 0x08, 0x17, 0x16,
+ 0x1f, 0x94, 0x30, 0x79, 0x0a, 0x1d, 0xcd, 0xe4, 0x25, 0xd7, 0x61, 0x2e, 0x45, 0x5c, 0x44, 0x3a,
+ 0x68, 0xa0, 0xa0, 0x6d, 0xa3, 0xef, 0x6c, 0x90, 0xc4, 0xf0, 0xa0, 0xa4, 0xd9, 0x24, 0x3e, 0x32,
+ 0x99, 0xb0, 0x4c, 0x07, 0x4b, 0x5d, 0x67, 0xb3, 0xb3, 0xfd, 0x7c, 0x6b, 0x4e, 0xcd, 0x5b, 0xb5,
+ 0x7a, 0xb7, 0xf6, 0x0c, 0x72, 0x61, 0x45, 0xbb, 0x8b, 0x07, 0x27, 0x87, 0x94, 0x58, 0xbf, 0x3a,
+ 0x40, 0x86, 0xe0, 0x95, 0xbb, 0x30, 0x19, 0x5d, 0x05, 0xcb, 0x68, 0xfe, 0xf4, 0xb3, 0xe6, 0x7d,
+ 0x19, 0x5d, 0xed, 0x36, 0xcf, 0x4f, 0x8e, 0x4e, 0x86, 0x3f, 0x9f, 0x50, 0xb0, 0x16, 0x26, 0x48,
+ 0xb6, 0x60, 0xad, 0x66, 0x38, 0xcd, 0xba, 0x89, 0x25, 0xae, 0xce, 0x88, 0x55, 0x02, 0xdf, 0x41,
+ 0x99, 0x56, 0x18, 0xe5, 0xc5, 0x94, 0xde, 0x42, 0xba, 0x6f, 0x91, 0x41, 0x5e, 0x54, 0xec, 0x23,
+ 0x70, 0xaf, 0x84, 0x2a, 0x93, 0x75, 0xbf, 0x28, 0xd9, 0x96, 0x31, 0xc0, 0x54, 0x29, 0xb4, 0xd1,
+ 0x6c, 0x3b, 0x8b, 0xad, 0x21, 0x7c, 0x91, 0xa1, 0x67, 0x4c, 0xb6, 0xb3, 0x18, 0x3d, 0xd7, 0xa1,
+ 0x89, 0x9e, 0x42, 0x05, 0x1e, 0xd6, 0xb0, 0x6c, 0x96, 0x43, 0x45, 0x7a, 0xe5, 0x66, 0x42, 0x85,
+ 0xfc, 0x5a, 0x4b, 0x16, 0xac, 0x20, 0xec, 0x59, 0xf8, 0xc0, 0x84, 0xa6, 0x9c, 0x48, 0x0a, 0xa5,
+ 0x8c, 0x45, 0x7b, 0xc6, 0x19, 0x98, 0xd8, 0x50, 0x91, 0x67, 0x70, 0xbf, 0xc6, 0xc1, 0xb4, 0x3b,
+ 0xb6, 0x7d, 0xa6, 0x2c, 0x4c, 0xe4, 0x39, 0xac, 0xd5, 0x78, 0xd3, 0x12, 0xef, 0xdb, 0x83, 0x9d,
+ 0x72, 0x6b, 0x79, 0x8b, 0x42, 0x87, 0x71, 0x22, 0x03, 0xdf, 0xe6, 0x2d, 0x0a, 0xbd, 0x9f, 0x48,
+ 0xf2, 0x03, 0x78, 0x8a, 0xeb, 0x22, 0x0f, 0xb5, 0x10, 0x13, 0x15, 0xac, 0x76, 0x17, 0x37, 0xbd,
+ 0xed, 0x8d, 0xb9, 0x47, 0xf4, 0x8e, 0xcb, 0xf1, 0xdb, 0x6c, 0x2c, 0x28, 0xa0, 0xe2, 0xcc, 0x08,
+ 0xc8, 0x2e, 0xb8, 0xbf, 0x31, 0x9d, 0x84, 0xb2, 0xc8, 0x54, 0x40, 0xee, 0xa2, 0x6e, 0x19, 0x3e,
+ 0x2d, 0x32, 0x45, 0xde, 0x00, 0x58, 0x26, 0x8a, 0xd7, 0xee, 0x22, 0x76, 0x11, 0xad, 0xd4, 0x59,
+ 0x92, 0x7d, 0x60, 0x56, 0xfd, 0xe0, 0x4e, 0x6a, 0x14, 0xa0, 0xfa, 0x7b, 0x58, 0xd2, 0x42, 0xb3,
+ 0x49, 0xf0, 0xb0, 0xeb, 0x7c, 0x5e, 0x68, 0xb9, 0xe4, 0x02, 0xe6, 0x8d, 0xa2, 0xe0, 0x2b, 0xb4,
+ 0x78, 0x36, 0xd7, 0xe2, 0xd4, 0xc4, 0xf0, 0x49, 0x96, 0x1d, 0x46, 0x57, 0xd5, 0x3f, 0x43, 0x64,
+ 0x00, 0x2b, 0x56, 0x15, 0x89, 0x6c, 0x9c, 0x5c, 0x06, 0xeb, 0x68, 0xd8, 0x9d, 0x6b, 0x88, 0xc2,
+ 0x01, 0xf2, 0xa8, 0x37, 0x9a, 0x2d, 0x7a, 0x2f, 0x61, 0xe5, 0xd6, 0xd3, 0x6f, 0x41, 0xe3, 0xfc,
+ 0xf4, 0x80, 0xfa, 0xf7, 0x48, 0x1b, 0x5c, 0xf3, 0xb5, 0x7f, 0xb0, 0x77, 0x7e, 0xe8, 0x3b, 0xa4,
+ 0x09, 0x66, 0x5c, 0xf8, 0x0b, 0xbd, 0x37, 0xd0, 0xc0, 0xe6, 0xf0, 0xa0, 0x6a, 0x76, 0xff, 0x9e,
+ 0x41, 0xfb, 0xf4, 0xd8, 0x77, 0x88, 0x0b, 0x4b, 0x7d, 0x7a, 0xbc, 0xf3, 0xca, 0x5f, 0x30, 0xb1,
+ 0xf7, 0xaf, 0x77, 0xfc, 0x45, 0x02, 0xb0, 0xfc, 0xfe, 0xf5, 0x4e, 0xb8, 0xf3, 0xca, 0x6f, 0xf4,
+ 0xfa, 0xe0, 0xd5, 0x72, 0x31, 0xd3, 0xb4, 0x50, 0x3c, 0xbc, 0x14, 0x29, 0xc3, 0x99, 0xdb, 0xa2,
+ 0xcd, 0x42, 0xf1, 0x43, 0x91, 0x32, 0xd3, 0x7c, 0x06, 0x92, 0x23, 0x8e, 0x73, 0xb6, 0x45, 0x97,
+ 0x0b, 0xc5, 0xe9, 0x88, 0xf7, 0x7e, 0x77, 0xa0, 0x55, 0x9d, 0x31, 0x21, 0xd0, 0x88, 0xb9, 0x8a,
+ 0x50, 0xec, 0x52, 0xfc, 0x36, 0x31, 0x1c, 0xb9, 0x76, 0x3c, 0xe3, 0x37, 0xd9, 0x00, 0x50, 0x9a,
+ 0x49, 0x8d, 0x33, 0x1e, 0x87, 0x71, 0x83, 0xba, 0x18, 0x31, 0xa3, 0x9d, 0x3c, 0x01, 0x57, 0x72,
+ 0x36, 0xb1, 0x68, 0x03, 0xd1, 0x96, 0x09, 0x20, 0xb8, 0x01, 0x90, 0xf2, 0x54, 0xc8, 0x9b, 0xb0,
+ 0x50, 0x1c, 0x47, 0x6d, 0x83, 0xba, 0x36, 0x72, 0xae, 0x78, 0xef, 0x4f, 0x07, 0x3a, 0xc7, 0x22,
+ 0x2e, 0x26, 0xfc, 0xec, 0x26, 0xe7, 0x98, 0xd5, 0xaf, 0xd5, 0xd5, 0xa8, 0x1b, 0xa5, 0x79, 0x8a,
+ 0xd9, 0x75, 0xb6, 0x5f, 0xcc, 0x9f, 0x21, 0xb7, 0xa4, 0xf6, 0xa6, 0x4e, 0x51, 0x56, 0x9b, 0x26,
+ 0xa3, 0x59, 0x94, 0x7c, 0x0d, 0x5e, 0x8a, 0x9a, 0x50, 0xdf, 0xe4, 0x55, 0x95, 0x90, 0x4e, 0x6d,
+ 0xc8, 0x37, 0xd0, 0xc9, 0x8a, 0x34, 0x14, 0xe3, 0xd0, 0x06, 0x15, 0xd6, 0xdb, 0xa6, 0x2b, 0x59,
+ 0x91, 0x0e, 0xc7, 0x76, 0x3f, 0xd5, 0x7b, 0x51, 0xde, 0x44, 0xe9, 0x7a, 0xeb, 0x3a, 0x5d, 0x58,
+ 0x3a, 0x1d, 0x0e, 0x4f, 0xcc, 0xbd, 0xb7, 0xa0, 0x71, 0xdc, 0x3f, 0x3a, 0xf0, 0x17, 0x7a, 0x13,
+ 0x78, 0x3c, 0x90, 0x89, 0x4e, 0x22, 0x36, 0x39, 0x57, 0x5c, 0xfe, 0x24, 0x0a, 0x99, 0xf1, 0x9b,
+ 0xaa, 0x1b, 0xab, 0x43, 0x77, 0x6a, 0x87, 0xbe, 0x0b, 0xcd, 0xaa, 0xdb, 0x17, 0xfe, 0xa7, 0x39,
+ 0x6b, 0x53, 0x94, 0x56, 0x82, 0xde, 0x08, 0x9e, 0xcc, 0xd9, 0x4d, 0xcd, 0x9a, 0xbf, 0x11, 0x15,
+ 0x1f, 0x54, 0xe0, 0xe0, 0x0b, 0x9e, 0x7f, 0xb2, 0xff, 0x9d, 0x2d, 0x45, 0x71, 0xef, 0x0f, 0x07,
+ 0x56, 0xff, 0xf5, 0xd4, 0x48, 0x00, 0xcd, 0xea, 0xdc, 0x1c, 0x3c, 0xb7, 0x6a, 0x49, 0x1e, 0x43,
+ 0xab, 0xfc, 0x2d, 0xb2, 0x05, 0xb5, 0xe9, 0x74, 0x4d, 0xbe, 0x85, 0x55, 0x7c, 0xee, 0x21, 0x9b,
+ 0x4c, 0x44, 0x14, 0x46, 0xa2, 0xc8, 0x74, 0xd9, 0x67, 0xf7, 0x11, 0xe8, 0x9b, 0xf8, 0xc0, 0x84,
+ 0xc9, 0x26, 0xf8, 0x75, 0xae, 0x4a, 0x3e, 0x55, 0x4d, 0xd7, 0x99, 0x51, 0x4f, 0x93, 0x4f, 0xdc,
+ 0x0c, 0xff, 0x94, 0x5d, 0x87, 0x57, 0x9c, 0xe5, 0x96, 0x66, 0xbb, 0xcf, 0x4b, 0xd9, 0xf5, 0x8f,
+ 0x9c, 0xe5, 0x86, 0xb3, 0xf7, 0xf0, 0x97, 0x72, 0xbe, 0x94, 0x75, 0x87, 0xf8, 0xff, 0xe7, 0xef,
+ 0x00, 0x00, 0x00, 0xff, 0xff, 0x0a, 0x03, 0x26, 0x59, 0x0f, 0x09, 0x00, 0x00,
}
diff --git a/ui/metrics/metrics_proto/metrics.proto b/ui/metrics/metrics_proto/metrics.proto
index 50810eb..6559ba3 100644
--- a/ui/metrics/metrics_proto/metrics.proto
+++ b/ui/metrics/metrics_proto/metrics.proto
@@ -94,6 +94,14 @@
optional PerfInfo total = 21;
optional SoongBuildMetrics soong_build_metrics = 22;
+
+ optional BuildConfig build_config = 23;
+}
+
+message BuildConfig {
+ optional bool use_goma = 1;
+
+ optional bool use_rbe = 2;
}
message PerfInfo {
@@ -159,4 +167,4 @@
// The approximate maximum size of the heap in soong_build in bytes.
optional uint64 max_heap_size = 5;
-}
\ No newline at end of file
+}