Merge "Added write only sanitizer for ASAN and HWASAN"
diff --git a/OWNERS b/OWNERS
index dbb491d..8355d10 100644
--- a/OWNERS
+++ b/OWNERS
@@ -6,9 +6,8 @@
 per-file * = patricearruda@google.com
 per-file * = paulduffin@google.com
 
-per-file ndk_*.go, *gen_stub_libs.py = danalbert@google.com
+per-file ndk_*.go = danalbert@google.com
 per-file clang.go,global.go = srhines@google.com, chh@google.com, pirama@google.com, yikong@google.com
 per-file tidy.go = srhines@google.com, chh@google.com
 per-file lto.go,pgo.go = srhines@google.com, pirama@google.com, yikong@google.com
 per-file docs/map_files.md = danalbert@google.com, enh@google.com, jiyong@google.com
-per-file *ndk_api_coverage_parser.py = sophiez@google.com
\ No newline at end of file
diff --git a/android/Android.bp b/android/Android.bp
index 487372b..50faa44 100644
--- a/android/Android.bp
+++ b/android/Android.bp
@@ -19,10 +19,12 @@
         "csuite_config.go",
         "defaults.go",
         "defs.go",
+        "depset.go",
         "expand.go",
         "filegroup.go",
         "hooks.go",
         "image.go",
+        "makefile_goal.go",
         "makevars.go",
         "metrics.go",
         "module.go",
@@ -45,6 +47,7 @@
         "sdk.go",
         "singleton.go",
         "soong_config_modules.go",
+        "test_suites.go",
         "testing.go",
         "util.go",
         "variable.go",
@@ -61,6 +64,7 @@
         "arch_test.go",
         "config_test.go",
         "csuite_config_test.go",
+        "depset_test.go",
         "expand_test.go",
         "module_test.go",
         "mutator_test.go",
diff --git a/android/androidmk.go b/android/androidmk.go
index 045cb59..7e86140 100644
--- a/android/androidmk.go
+++ b/android/androidmk.go
@@ -107,6 +107,45 @@
 	a.EntryMap[name] = []string{path.String()}
 }
 
+func (a *AndroidMkEntries) SetOptionalPath(name string, path OptionalPath) {
+	if path.Valid() {
+		a.SetPath(name, path.Path())
+	}
+}
+
+func (a *AndroidMkEntries) AddPath(name string, path Path) {
+	if _, ok := a.EntryMap[name]; !ok {
+		a.entryOrder = append(a.entryOrder, name)
+	}
+	a.EntryMap[name] = append(a.EntryMap[name], path.String())
+}
+
+func (a *AndroidMkEntries) AddOptionalPath(name string, path OptionalPath) {
+	if path.Valid() {
+		a.AddPath(name, path.Path())
+	}
+}
+
+func (a *AndroidMkEntries) SetPaths(name string, paths Paths) {
+	if _, ok := a.EntryMap[name]; !ok {
+		a.entryOrder = append(a.entryOrder, name)
+	}
+	a.EntryMap[name] = paths.Strings()
+}
+
+func (a *AndroidMkEntries) SetOptionalPaths(name string, paths Paths) {
+	if len(paths) > 0 {
+		a.SetPaths(name, paths)
+	}
+}
+
+func (a *AndroidMkEntries) AddPaths(name string, paths Paths) {
+	if _, ok := a.EntryMap[name]; !ok {
+		a.entryOrder = append(a.entryOrder, name)
+	}
+	a.EntryMap[name] = append(a.EntryMap[name], paths.Strings()...)
+}
+
 func (a *AndroidMkEntries) SetBoolIfTrue(name string, flag bool) {
 	if flag {
 		if _, ok := a.EntryMap[name]; !ok {
@@ -146,7 +185,7 @@
 	var ret []string
 
 	availableTaggedDists := TaggedDistFiles{}
-	if a.DistFiles != nil && len(a.DistFiles[""]) > 0 {
+	if a.DistFiles != nil {
 		availableTaggedDists = a.DistFiles
 	} else if a.OutputFile.Valid() {
 		availableTaggedDists = MakeDefaultDistFiles(a.OutputFile.Path())
diff --git a/android/androidmk_test.go b/android/androidmk_test.go
index 250f086..a558f45 100644
--- a/android/androidmk_test.go
+++ b/android/androidmk_test.go
@@ -45,6 +45,8 @@
 		return PathsForTesting("one.out"), nil
 	case ".multiple":
 		return PathsForTesting("two.out", "three/four.out"), nil
+	case ".another-tag":
+		return PathsForTesting("another.out"), nil
 	default:
 		return nil, fmt.Errorf("unsupported module reference tag %q", tag)
 	}
@@ -123,6 +125,38 @@
 			bp: `
 			custom {
 				name: "foo",
+				dist: {
+					targets: ["my_goal"],
+					tag: ".another-tag",
+				}
+			}
+			`,
+			expectedAndroidMkLines: []string{
+				".PHONY: my_goal\n",
+				"$(call dist-for-goals,my_goal,another.out:another.out)\n",
+			},
+		},
+		{
+			bp: `
+			custom {
+				name: "foo",
+				dists: [
+					{
+						targets: ["my_goal"],
+						tag: ".another-tag",
+					},
+				],
+			}
+			`,
+			expectedAndroidMkLines: []string{
+				".PHONY: my_goal\n",
+				"$(call dist-for-goals,my_goal,another.out:another.out)\n",
+			},
+		},
+		{
+			bp: `
+			custom {
+				name: "foo",
 				dists: [
 					{
 						targets: ["my_goal"],
diff --git a/android/apex.go b/android/apex.go
index 47f07ca..cd84f8a 100644
--- a/android/apex.go
+++ b/android/apex.go
@@ -65,9 +65,9 @@
 
 	apexModuleBase() *ApexModuleBase
 
-	// Marks that this module should be built for the specified APEXes.
+	// Marks that this module should be built for the specified APEX.
 	// Call this before apex.apexMutator is run.
-	BuildForApexes(apexes []ApexInfo)
+	BuildForApex(apex ApexInfo)
 
 	// Returns the APEXes that this module will be built for
 	ApexVariations() []ApexInfo
@@ -96,7 +96,7 @@
 	IsInstallableToApex() bool
 
 	// Mutate this module into one or more variants each of which is built
-	// for an APEX marked via BuildForApexes().
+	// for an APEX marked via BuildForApex().
 	CreateApexVariations(mctx BottomUpMutatorContext) []Module
 
 	// Tests if this module is available for the specified APEX or ":platform"
@@ -137,6 +137,7 @@
 	//
 	// "//apex_available:anyapex" is a pseudo APEX name that matches to any APEX.
 	// "//apex_available:platform" refers to non-APEX partitions like "system.img".
+	// "com.android.gki.*" matches any APEX module name with the prefix "com.android.gki.".
 	// Default is ["//apex_available:platform"].
 	Apex_available []string
 
@@ -178,18 +179,15 @@
 	return nil
 }
 
-func (m *ApexModuleBase) BuildForApexes(apexes []ApexInfo) {
+func (m *ApexModuleBase) BuildForApex(apex ApexInfo) {
 	m.apexVariationsLock.Lock()
 	defer m.apexVariationsLock.Unlock()
-nextApex:
-	for _, apex := range apexes {
-		for _, v := range m.apexVariations {
-			if v.ApexName == apex.ApexName {
-				continue nextApex
-			}
+	for _, v := range m.apexVariations {
+		if v.ApexName == apex.ApexName {
+			return
 		}
-		m.apexVariations = append(m.apexVariations, apex)
 	}
+	m.apexVariations = append(m.apexVariations, apex)
 }
 
 func (m *ApexModuleBase) ApexVariations() []ApexInfo {
@@ -216,6 +214,7 @@
 const (
 	AvailableToPlatform = "//apex_available:platform"
 	AvailableToAnyApex  = "//apex_available:anyapex"
+	AvailableToGkiApex  = "com.android.gki.*"
 )
 
 func CheckAvailableForApex(what string, apex_available []string) bool {
@@ -225,7 +224,8 @@
 		return what == AvailableToPlatform
 	}
 	return InList(what, apex_available) ||
-		(what != AvailableToPlatform && InList(AvailableToAnyApex, apex_available))
+		(what != AvailableToPlatform && InList(AvailableToAnyApex, apex_available)) ||
+		(strings.HasPrefix(what, "com.android.gki.") && InList(AvailableToGkiApex, apex_available))
 }
 
 func (m *ApexModuleBase) AvailableFor(what string) bool {
@@ -259,7 +259,7 @@
 
 func (m *ApexModuleBase) checkApexAvailableProperty(mctx BaseModuleContext) {
 	for _, n := range m.ApexProperties.Apex_available {
-		if n == AvailableToPlatform || n == AvailableToAnyApex {
+		if n == AvailableToPlatform || n == AvailableToAnyApex || n == AvailableToGkiApex {
 			continue
 		}
 		if !mctx.OtherModuleExists(n) && !mctx.Config().AllowMissingDependencies() {
@@ -327,17 +327,15 @@
 // depended on by the specified APEXes. Directly depending means that a module
 // is explicitly listed in the build definition of the APEX via properties like
 // native_shared_libs, java_libs, etc.
-func UpdateApexDependency(apexes []ApexInfo, moduleName string, directDep bool) {
+func UpdateApexDependency(apex ApexInfo, moduleName string, directDep bool) {
 	apexNamesMapMutex.Lock()
 	defer apexNamesMapMutex.Unlock()
-	for _, apex := range apexes {
-		apexesForModule, ok := apexNamesMap()[moduleName]
-		if !ok {
-			apexesForModule = make(map[string]bool)
-			apexNamesMap()[moduleName] = apexesForModule
-		}
-		apexesForModule[apex.ApexName] = apexesForModule[apex.ApexName] || directDep
+	apexesForModule, ok := apexNamesMap()[moduleName]
+	if !ok {
+		apexesForModule = make(map[string]bool)
+		apexNamesMap()[moduleName] = apexesForModule
 	}
+	apexesForModule[apex.ApexName] = apexesForModule[apex.ApexName] || directDep
 }
 
 // TODO(b/146393795): remove this when b/146393795 is fixed
diff --git a/android/config.go b/android/config.go
index 7073a49..92a21a7 100644
--- a/android/config.go
+++ b/android/config.go
@@ -337,8 +337,8 @@
 		config: config,
 	}
 
-	// Sanity check the build and source directories. This won't catch strange
-	// configurations with symlinks, but at least checks the obvious cases.
+	// Soundness check of the build and source directories. This won't catch strange
+	// configurations with symlinks, but at least checks the obvious case.
 	absBuildDir, err := filepath.Abs(buildDir)
 	if err != nil {
 		return Config{}, err
@@ -875,12 +875,12 @@
 	enforceList := c.productVariables.EnforceRROTargets
 	// TODO(b/150820813) Some modules depend on static overlay, remove this after eliminating the dependency.
 	exemptedList := c.productVariables.EnforceRROExemptedTargets
-	if exemptedList != nil {
+	if len(exemptedList) > 0 {
 		if InList(name, exemptedList) {
 			return false
 		}
 	}
-	if enforceList != nil {
+	if len(enforceList) > 0 {
 		if InList("*", enforceList) {
 			return true
 		}
@@ -891,7 +891,7 @@
 
 func (c *config) EnforceRROExcludedOverlay(path string) bool {
 	excluded := c.productVariables.EnforceRROExcludedOverlays
-	if excluded != nil {
+	if len(excluded) > 0 {
 		return HasAnyPrefix(path, excluded)
 	}
 	return false
@@ -913,34 +913,6 @@
 	return c.productVariables.ModulesLoadedByPrivilegedModules
 }
 
-// Expected format for apexJarValue = <apex name>:<jar name>
-func SplitApexJarPair(ctx PathContext, str string) (string, string) {
-	pair := strings.SplitN(str, ":", 2)
-	if len(pair) == 2 {
-		return pair[0], pair[1]
-	} else {
-		reportPathErrorf(ctx, "malformed (apex, jar) pair: '%s', expected format: <apex>:<jar>", str)
-		return "error-apex", "error-jar"
-	}
-}
-
-func GetJarsFromApexJarPairs(ctx PathContext, apexJarPairs []string) []string {
-	modules := make([]string, len(apexJarPairs))
-	for i, p := range apexJarPairs {
-		_, jar := SplitApexJarPair(ctx, p)
-		modules[i] = jar
-	}
-	return modules
-}
-
-func (c *config) BootJars() []string {
-	ctx := NullPathContext{Config{
-		config: c,
-	}}
-	return append(GetJarsFromApexJarPairs(ctx, c.productVariables.BootJars),
-		GetJarsFromApexJarPairs(ctx, c.productVariables.UpdatableBootJars)...)
-}
-
 func (c *config) DexpreoptGlobalConfig(ctx PathContext) ([]byte, error) {
 	if c.productVariables.DexpreoptGlobalConfig == nil {
 		return nil, nil
@@ -1059,7 +1031,7 @@
 		HasAnyPrefix(path, c.config.productVariables.JavaCoveragePaths) {
 		coverage = true
 	}
-	if coverage && c.config.productVariables.JavaCoverageExcludePaths != nil {
+	if coverage && len(c.config.productVariables.JavaCoverageExcludePaths) > 0 {
 		if HasAnyPrefix(path, c.config.productVariables.JavaCoverageExcludePaths) {
 			coverage = false
 		}
@@ -1088,12 +1060,12 @@
 // NativeCoveragePaths represents any path.
 func (c *deviceConfig) NativeCoverageEnabledForPath(path string) bool {
 	coverage := false
-	if c.config.productVariables.NativeCoveragePaths != nil {
+	if len(c.config.productVariables.NativeCoveragePaths) > 0 {
 		if InList("*", c.config.productVariables.NativeCoveragePaths) || HasAnyPrefix(path, c.config.productVariables.NativeCoveragePaths) {
 			coverage = true
 		}
 	}
-	if coverage && c.config.productVariables.NativeCoverageExcludePaths != nil {
+	if coverage && len(c.config.productVariables.NativeCoverageExcludePaths) > 0 {
 		if HasAnyPrefix(path, c.config.productVariables.NativeCoverageExcludePaths) {
 			coverage = false
 		}
@@ -1164,21 +1136,21 @@
 }
 
 func (c *config) IntegerOverflowDisabledForPath(path string) bool {
-	if c.productVariables.IntegerOverflowExcludePaths == nil {
+	if len(c.productVariables.IntegerOverflowExcludePaths) == 0 {
 		return false
 	}
 	return HasAnyPrefix(path, c.productVariables.IntegerOverflowExcludePaths)
 }
 
 func (c *config) CFIDisabledForPath(path string) bool {
-	if c.productVariables.CFIExcludePaths == nil {
+	if len(c.productVariables.CFIExcludePaths) == 0 {
 		return false
 	}
 	return HasAnyPrefix(path, c.productVariables.CFIExcludePaths)
 }
 
 func (c *config) CFIEnabledForPath(path string) bool {
-	if c.productVariables.CFIIncludePaths == nil {
+	if len(c.productVariables.CFIIncludePaths) == 0 {
 		return false
 	}
 	return HasAnyPrefix(path, c.productVariables.CFIIncludePaths)
@@ -1252,10 +1224,6 @@
 	return c.productVariables.MissingUsesLibraries
 }
 
-func (c *deviceConfig) BoardVndkRuntimeDisable() bool {
-	return Bool(c.config.productVariables.BoardVndkRuntimeDisable)
-}
-
 func (c *deviceConfig) DeviceArch() string {
 	return String(c.config.productVariables.DeviceArch)
 }
@@ -1275,3 +1243,185 @@
 func (c *deviceConfig) BoardUsesRecoveryAsBoot() bool {
 	return Bool(c.config.productVariables.BoardUsesRecoveryAsBoot)
 }
+
+func (c *deviceConfig) BoardKernelBinaries() []string {
+	return c.config.productVariables.BoardKernelBinaries
+}
+
+// The ConfiguredJarList struct provides methods for handling a list of (apex, jar) pairs.
+// Such lists are used in the build system for things like bootclasspath jars or system server jars.
+// The apex part is either an apex name, or a special names "platform" or "system_ext". Jar is a
+// module name. The pairs come from Make product variables as a list of colon-separated strings.
+//
+// Examples:
+//   - "com.android.art:core-oj"
+//   - "platform:framework"
+//   - "system_ext:foo"
+//
+type ConfiguredJarList struct {
+	apexes []string // A list of apex components.
+	jars   []string // A list of jar components.
+}
+
+// The length of the list.
+func (l *ConfiguredJarList) Len() int {
+	return len(l.jars)
+}
+
+// Apex component of idx-th pair on the list.
+func (l *ConfiguredJarList) apex(idx int) string {
+	return l.apexes[idx]
+}
+
+// Jar component of idx-th pair on the list.
+func (l *ConfiguredJarList) Jar(idx int) string {
+	return l.jars[idx]
+}
+
+// If the list contains a pair with the given jar.
+func (l *ConfiguredJarList) ContainsJar(jar string) bool {
+	return InList(jar, l.jars)
+}
+
+// If the list contains the given (apex, jar) pair.
+func (l *ConfiguredJarList) containsApexJarPair(apex, jar string) bool {
+	for i := 0; i < l.Len(); i++ {
+		if apex == l.apex(i) && jar == l.Jar(i) {
+			return true
+		}
+	}
+	return false
+}
+
+// Index of the first pair with the given jar on the list, or -1 if none.
+func (l *ConfiguredJarList) IndexOfJar(jar string) int {
+	return IndexList(jar, l.jars)
+}
+
+// Append an (apex, jar) pair to the list.
+func (l *ConfiguredJarList) Append(apex string, jar string) {
+	l.apexes = append(l.apexes, apex)
+	l.jars = append(l.jars, jar)
+}
+
+// Filter out sublist.
+func (l *ConfiguredJarList) RemoveList(list ConfiguredJarList) {
+	apexes := make([]string, 0, l.Len())
+	jars := make([]string, 0, l.Len())
+
+	for i, jar := range l.jars {
+		apex := l.apex(i)
+		if !list.containsApexJarPair(apex, jar) {
+			apexes = append(apexes, apex)
+			jars = append(jars, jar)
+		}
+	}
+
+	l.apexes = apexes
+	l.jars = jars
+}
+
+// A copy of itself.
+func (l *ConfiguredJarList) CopyOf() ConfiguredJarList {
+	return ConfiguredJarList{CopyOf(l.apexes), CopyOf(l.jars)}
+}
+
+// A copy of the list of strings containing jar components.
+func (l *ConfiguredJarList) CopyOfJars() []string {
+	return CopyOf(l.jars)
+}
+
+// A copy of the list of strings with colon-separated (apex, jar) pairs.
+func (l *ConfiguredJarList) CopyOfApexJarPairs() []string {
+	pairs := make([]string, 0, l.Len())
+
+	for i, jar := range l.jars {
+		apex := l.apex(i)
+		pairs = append(pairs, apex+":"+jar)
+	}
+
+	return pairs
+}
+
+// A list of build paths based on the given directory prefix.
+func (l *ConfiguredJarList) BuildPaths(ctx PathContext, dir OutputPath) WritablePaths {
+	paths := make(WritablePaths, l.Len())
+	for i, jar := range l.jars {
+		paths[i] = dir.Join(ctx, ModuleStem(jar)+".jar")
+	}
+	return paths
+}
+
+func ModuleStem(module string) string {
+	// b/139391334: the stem of framework-minus-apex is framework. This is hard coded here until we
+	// find a good way to query the stem of a module before any other mutators are run.
+	if module == "framework-minus-apex" {
+		return "framework"
+	}
+	return module
+}
+
+// A list of on-device paths.
+func (l *ConfiguredJarList) DevicePaths(cfg Config, ostype OsType) []string {
+	paths := make([]string, l.Len())
+	for i, jar := range l.jars {
+		apex := l.apexes[i]
+		name := ModuleStem(jar) + ".jar"
+
+		var subdir string
+		if apex == "platform" {
+			subdir = "system/framework"
+		} else if apex == "system_ext" {
+			subdir = "system_ext/framework"
+		} else {
+			subdir = filepath.Join("apex", apex, "javalib")
+		}
+
+		if ostype.Class == Host {
+			paths[i] = filepath.Join(cfg.Getenv("OUT_DIR"), "host", cfg.PrebuiltOS(), subdir, name)
+		} else {
+			paths[i] = filepath.Join("/", subdir, name)
+		}
+	}
+	return paths
+}
+
+// Expected format for apexJarValue = <apex name>:<jar name>
+func splitConfiguredJarPair(ctx PathContext, str string) (string, string) {
+	pair := strings.SplitN(str, ":", 2)
+	if len(pair) == 2 {
+		return pair[0], pair[1]
+	} else {
+		reportPathErrorf(ctx, "malformed (apex, jar) pair: '%s', expected format: <apex>:<jar>", str)
+		return "error-apex", "error-jar"
+	}
+}
+
+func CreateConfiguredJarList(ctx PathContext, list []string) ConfiguredJarList {
+	apexes := make([]string, 0, len(list))
+	jars := make([]string, 0, len(list))
+
+	l := ConfiguredJarList{apexes, jars}
+
+	for _, apexjar := range list {
+		apex, jar := splitConfiguredJarPair(ctx, apexjar)
+		l.Append(apex, jar)
+	}
+
+	return l
+}
+
+func EmptyConfiguredJarList() ConfiguredJarList {
+	return ConfiguredJarList{}
+}
+
+var earlyBootJarsKey = NewOnceKey("earlyBootJars")
+
+func (c *config) BootJars() []string {
+	return c.Once(earlyBootJarsKey, func() interface{} {
+		ctx := NullPathContext{Config{c}}
+		list := CreateConfiguredJarList(ctx,
+			append(CopyOf(c.productVariables.BootJars), c.productVariables.UpdatableBootJars...))
+		return list.CopyOfJars()
+	}).([]string)
+}
diff --git a/android/depset.go b/android/depset.go
new file mode 100644
index 0000000..f707094
--- /dev/null
+++ b/android/depset.go
@@ -0,0 +1,190 @@
+// Copyright 2020 Google Inc. All rights reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//     http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+package android
+
+import "fmt"
+
+// DepSet is designed to be conceptually compatible with Bazel's depsets:
+// https://docs.bazel.build/versions/master/skylark/depsets.html
+
+// A DepSet efficiently stores Paths from transitive dependencies without copying. It is stored
+// as a DAG of DepSet nodes, each of which has some direct contents and a list of dependency
+// DepSet nodes.
+//
+// A DepSet has an order that will be used to walk the DAG when ToList() is called.  The order
+// can be POSTORDER, PREORDER, or TOPOLOGICAL.  POSTORDER and PREORDER orders return a postordered
+// or preordered left to right flattened list.  TOPOLOGICAL returns a list that guarantees that
+// elements of children are listed after all of their parents (unless there are duplicate direct
+// elements in the DepSet or any of its transitive dependencies, in which case the ordering of the
+// duplicated element is not guaranteed).
+//
+// A DepSet is created by NewDepSet or NewDepSetBuilder.Build from the Paths for direct contents
+// and the *DepSets of dependencies. A DepSet is immutable once created.
+type DepSet struct {
+	preorder   bool
+	reverse    bool
+	order      DepSetOrder
+	direct     Paths
+	transitive []*DepSet
+}
+
+// DepSetBuilder is used to create an immutable DepSet.
+type DepSetBuilder struct {
+	order      DepSetOrder
+	direct     Paths
+	transitive []*DepSet
+}
+
+type DepSetOrder int
+
+const (
+	PREORDER DepSetOrder = iota
+	POSTORDER
+	TOPOLOGICAL
+)
+
+func (o DepSetOrder) String() string {
+	switch o {
+	case PREORDER:
+		return "PREORDER"
+	case POSTORDER:
+		return "POSTORDER"
+	case TOPOLOGICAL:
+		return "TOPOLOGICAL"
+	default:
+		panic(fmt.Errorf("Invalid DepSetOrder %d", o))
+	}
+}
+
+// NewDepSet returns an immutable DepSet with the given order, direct and transitive contents.
+func NewDepSet(order DepSetOrder, direct Paths, transitive []*DepSet) *DepSet {
+	var directCopy Paths
+	var transitiveCopy []*DepSet
+	if order == TOPOLOGICAL {
+		directCopy = ReversePaths(direct)
+		transitiveCopy = reverseDepSets(transitive)
+	} else {
+		// Use copy instead of append(nil, ...) to make a slice that is exactly the size of the input
+		// slice.  The DepSet is immutable, there is no need for additional capacity.
+		directCopy = make(Paths, len(direct))
+		copy(directCopy, direct)
+		transitiveCopy = make([]*DepSet, len(transitive))
+		copy(transitiveCopy, transitive)
+	}
+
+	for _, dep := range transitive {
+		if dep.order != order {
+			panic(fmt.Errorf("incompatible order, new DepSet is %s but transitive DepSet is %s",
+				order, dep.order))
+		}
+	}
+
+	return &DepSet{
+		preorder:   order == PREORDER,
+		reverse:    order == TOPOLOGICAL,
+		order:      order,
+		direct:     directCopy,
+		transitive: transitiveCopy,
+	}
+}
+
+// NewDepSetBuilder returns a DepSetBuilder to create an immutable DepSet with the given order.
+func NewDepSetBuilder(order DepSetOrder) *DepSetBuilder {
+	return &DepSetBuilder{order: order}
+}
+
+// Direct adds direct contents to the DepSet being built by a DepSetBuilder. Newly added direct
+// contents are to the right of any existing direct contents.
+func (b *DepSetBuilder) Direct(direct ...Path) *DepSetBuilder {
+	b.direct = append(b.direct, direct...)
+	return b
+}
+
+// Transitive adds transitive contents to the DepSet being built by a DepSetBuilder. Newly added
+// transitive contents are to the right of any existing transitive contents.
+func (b *DepSetBuilder) Transitive(transitive ...*DepSet) *DepSetBuilder {
+	b.transitive = append(b.transitive, transitive...)
+	return b
+}
+
+// Returns the DepSet being built by this DepSetBuilder.  The DepSetBuilder retains its contents
+// for creating more DepSets.
+func (b *DepSetBuilder) Build() *DepSet {
+	return NewDepSet(b.order, b.direct, b.transitive)
+}
+
+// walk calls the visit method in depth-first order on a DepSet, preordered if d.preorder is set,
+// otherwise postordered.
+func (d *DepSet) walk(visit func(Paths)) {
+	visited := make(map[*DepSet]bool)
+
+	var dfs func(d *DepSet)
+	dfs = func(d *DepSet) {
+		visited[d] = true
+		if d.preorder {
+			visit(d.direct)
+		}
+		for _, dep := range d.transitive {
+			if !visited[dep] {
+				dfs(dep)
+			}
+		}
+
+		if !d.preorder {
+			visit(d.direct)
+		}
+	}
+
+	dfs(d)
+}
+
+// ToList returns the DepSet flattened to a list.  The order in the list is based on the order
+// of the DepSet.  POSTORDER and PREORDER orders return a postordered or preordered left to right
+// flattened list.  TOPOLOGICAL returns a list that guarantees that elements of children are listed
+// after all of their parents (unless there are duplicate direct elements in the DepSet or any of
+// its transitive dependencies, in which case the ordering of the duplicated element is not
+// guaranteed).
+func (d *DepSet) ToList() Paths {
+	var list Paths
+	d.walk(func(paths Paths) {
+		list = append(list, paths...)
+	})
+	list = FirstUniquePaths(list)
+	if d.reverse {
+		reversePathsInPlace(list)
+	}
+	return list
+}
+
+// ToSortedList returns the direct and transitive contents of a DepSet in lexically sorted order
+// with duplicates removed.
+func (d *DepSet) ToSortedList() Paths {
+	list := d.ToList()
+	return SortedUniquePaths(list)
+}
+
+func reversePathsInPlace(list Paths) {
+	for i, j := 0, len(list)-1; i < j; i, j = i+1, j-1 {
+		list[i], list[j] = list[j], list[i]
+	}
+}
+
+func reverseDepSets(list []*DepSet) []*DepSet {
+	ret := make([]*DepSet, len(list))
+	for i := range list {
+		ret[i] = list[len(list)-1-i]
+	}
+	return ret
+}
diff --git a/android/depset_test.go b/android/depset_test.go
new file mode 100644
index 0000000..c328127
--- /dev/null
+++ b/android/depset_test.go
@@ -0,0 +1,304 @@
+// Copyright 2020 Google Inc. All rights reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//     http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+package android
+
+import (
+	"fmt"
+	"reflect"
+	"strings"
+	"testing"
+)
+
+func ExampleDepSet_ToList_postordered() {
+	a := NewDepSetBuilder(POSTORDER).Direct(PathForTesting("a")).Build()
+	b := NewDepSetBuilder(POSTORDER).Direct(PathForTesting("b")).Transitive(a).Build()
+	c := NewDepSetBuilder(POSTORDER).Direct(PathForTesting("c")).Transitive(a).Build()
+	d := NewDepSetBuilder(POSTORDER).Direct(PathForTesting("d")).Transitive(b, c).Build()
+
+	fmt.Println(d.ToList().Strings())
+	// Output: [a b c d]
+}
+
+func ExampleDepSet_ToList_preordered() {
+	a := NewDepSetBuilder(PREORDER).Direct(PathForTesting("a")).Build()
+	b := NewDepSetBuilder(PREORDER).Direct(PathForTesting("b")).Transitive(a).Build()
+	c := NewDepSetBuilder(PREORDER).Direct(PathForTesting("c")).Transitive(a).Build()
+	d := NewDepSetBuilder(PREORDER).Direct(PathForTesting("d")).Transitive(b, c).Build()
+
+	fmt.Println(d.ToList().Strings())
+	// Output: [d b a c]
+}
+
+func ExampleDepSet_ToList_topological() {
+	a := NewDepSetBuilder(TOPOLOGICAL).Direct(PathForTesting("a")).Build()
+	b := NewDepSetBuilder(TOPOLOGICAL).Direct(PathForTesting("b")).Transitive(a).Build()
+	c := NewDepSetBuilder(TOPOLOGICAL).Direct(PathForTesting("c")).Transitive(a).Build()
+	d := NewDepSetBuilder(TOPOLOGICAL).Direct(PathForTesting("d")).Transitive(b, c).Build()
+
+	fmt.Println(d.ToList().Strings())
+	// Output: [d b c a]
+}
+
+func ExampleDepSet_ToSortedList() {
+	a := NewDepSetBuilder(POSTORDER).Direct(PathForTesting("a")).Build()
+	b := NewDepSetBuilder(POSTORDER).Direct(PathForTesting("b")).Transitive(a).Build()
+	c := NewDepSetBuilder(POSTORDER).Direct(PathForTesting("c")).Transitive(a).Build()
+	d := NewDepSetBuilder(POSTORDER).Direct(PathForTesting("d")).Transitive(b, c).Build()
+
+	fmt.Println(d.ToSortedList().Strings())
+	// Output: [a b c d]
+}
+
+// Tests based on Bazel's ExpanderTestBase.java to ensure compatibility
+// https://github.com/bazelbuild/bazel/blob/master/src/test/java/com/google/devtools/build/lib/collect/nestedset/ExpanderTestBase.java
+func TestDepSet(t *testing.T) {
+	a := PathForTesting("a")
+	b := PathForTesting("b")
+	c := PathForTesting("c")
+	c2 := PathForTesting("c2")
+	d := PathForTesting("d")
+	e := PathForTesting("e")
+
+	tests := []struct {
+		name                             string
+		depSet                           func(t *testing.T, order DepSetOrder) *DepSet
+		postorder, preorder, topological []string
+	}{
+		{
+			name: "simple",
+			depSet: func(t *testing.T, order DepSetOrder) *DepSet {
+				return NewDepSet(order, Paths{c, a, b}, nil)
+			},
+			postorder:   []string{"c", "a", "b"},
+			preorder:    []string{"c", "a", "b"},
+			topological: []string{"c", "a", "b"},
+		},
+		{
+			name: "simpleNoDuplicates",
+			depSet: func(t *testing.T, order DepSetOrder) *DepSet {
+				return NewDepSet(order, Paths{c, a, a, a, b}, nil)
+			},
+			postorder:   []string{"c", "a", "b"},
+			preorder:    []string{"c", "a", "b"},
+			topological: []string{"c", "a", "b"},
+		},
+		{
+			name: "nesting",
+			depSet: func(t *testing.T, order DepSetOrder) *DepSet {
+				subset := NewDepSet(order, Paths{c, a, e}, nil)
+				return NewDepSet(order, Paths{b, d}, []*DepSet{subset})
+			},
+			postorder:   []string{"c", "a", "e", "b", "d"},
+			preorder:    []string{"b", "d", "c", "a", "e"},
+			topological: []string{"b", "d", "c", "a", "e"},
+		},
+		{
+			name: "builderReuse",
+			depSet: func(t *testing.T, order DepSetOrder) *DepSet {
+				assertEquals := func(t *testing.T, w, g Paths) {
+					if !reflect.DeepEqual(w, g) {
+						t.Errorf("want %q, got %q", w, g)
+					}
+				}
+				builder := NewDepSetBuilder(order)
+				assertEquals(t, nil, builder.Build().ToList())
+
+				builder.Direct(b)
+				assertEquals(t, Paths{b}, builder.Build().ToList())
+
+				builder.Direct(d)
+				assertEquals(t, Paths{b, d}, builder.Build().ToList())
+
+				child := NewDepSetBuilder(order).Direct(c, a, e).Build()
+				builder.Transitive(child)
+				return builder.Build()
+			},
+			postorder:   []string{"c", "a", "e", "b", "d"},
+			preorder:    []string{"b", "d", "c", "a", "e"},
+			topological: []string{"b", "d", "c", "a", "e"},
+		},
+		{
+			name: "builderChaining",
+			depSet: func(t *testing.T, order DepSetOrder) *DepSet {
+				return NewDepSetBuilder(order).Direct(b).Direct(d).
+					Transitive(NewDepSetBuilder(order).Direct(c, a, e).Build()).Build()
+			},
+			postorder:   []string{"c", "a", "e", "b", "d"},
+			preorder:    []string{"b", "d", "c", "a", "e"},
+			topological: []string{"b", "d", "c", "a", "e"},
+		},
+		{
+			name: "transitiveDepsHandledSeparately",
+			depSet: func(t *testing.T, order DepSetOrder) *DepSet {
+				subset := NewDepSetBuilder(order).Direct(c, a, e).Build()
+				builder := NewDepSetBuilder(order)
+				// The fact that we add the transitive subset between the Direct(b) and Direct(d)
+				// calls should not change the result.
+				builder.Direct(b)
+				builder.Transitive(subset)
+				builder.Direct(d)
+				return builder.Build()
+			},
+			postorder:   []string{"c", "a", "e", "b", "d"},
+			preorder:    []string{"b", "d", "c", "a", "e"},
+			topological: []string{"b", "d", "c", "a", "e"},
+		},
+		{
+			name: "nestingNoDuplicates",
+			depSet: func(t *testing.T, order DepSetOrder) *DepSet {
+				subset := NewDepSetBuilder(order).Direct(c, a, e).Build()
+				return NewDepSetBuilder(order).Direct(b, d, e).Transitive(subset).Build()
+			},
+			postorder:   []string{"c", "a", "e", "b", "d"},
+			preorder:    []string{"b", "d", "e", "c", "a"},
+			topological: []string{"b", "d", "c", "a", "e"},
+		},
+		{
+			name: "chain",
+			depSet: func(t *testing.T, order DepSetOrder) *DepSet {
+				c := NewDepSetBuilder(order).Direct(c).Build()
+				b := NewDepSetBuilder(order).Direct(b).Transitive(c).Build()
+				a := NewDepSetBuilder(order).Direct(a).Transitive(b).Build()
+
+				return a
+			},
+			postorder:   []string{"c", "b", "a"},
+			preorder:    []string{"a", "b", "c"},
+			topological: []string{"a", "b", "c"},
+		},
+		{
+			name: "diamond",
+			depSet: func(t *testing.T, order DepSetOrder) *DepSet {
+				d := NewDepSetBuilder(order).Direct(d).Build()
+				c := NewDepSetBuilder(order).Direct(c).Transitive(d).Build()
+				b := NewDepSetBuilder(order).Direct(b).Transitive(d).Build()
+				a := NewDepSetBuilder(order).Direct(a).Transitive(b).Transitive(c).Build()
+
+				return a
+			},
+			postorder:   []string{"d", "b", "c", "a"},
+			preorder:    []string{"a", "b", "d", "c"},
+			topological: []string{"a", "b", "c", "d"},
+		},
+		{
+			name: "extendedDiamond",
+			depSet: func(t *testing.T, order DepSetOrder) *DepSet {
+				d := NewDepSetBuilder(order).Direct(d).Build()
+				e := NewDepSetBuilder(order).Direct(e).Build()
+				b := NewDepSetBuilder(order).Direct(b).Transitive(d).Transitive(e).Build()
+				c := NewDepSetBuilder(order).Direct(c).Transitive(e).Transitive(d).Build()
+				a := NewDepSetBuilder(order).Direct(a).Transitive(b).Transitive(c).Build()
+				return a
+			},
+			postorder:   []string{"d", "e", "b", "c", "a"},
+			preorder:    []string{"a", "b", "d", "e", "c"},
+			topological: []string{"a", "b", "c", "e", "d"},
+		},
+		{
+			name: "extendedDiamondRightArm",
+			depSet: func(t *testing.T, order DepSetOrder) *DepSet {
+				d := NewDepSetBuilder(order).Direct(d).Build()
+				e := NewDepSetBuilder(order).Direct(e).Build()
+				b := NewDepSetBuilder(order).Direct(b).Transitive(d).Transitive(e).Build()
+				c2 := NewDepSetBuilder(order).Direct(c2).Transitive(e).Transitive(d).Build()
+				c := NewDepSetBuilder(order).Direct(c).Transitive(c2).Build()
+				a := NewDepSetBuilder(order).Direct(a).Transitive(b).Transitive(c).Build()
+				return a
+			},
+			postorder:   []string{"d", "e", "b", "c2", "c", "a"},
+			preorder:    []string{"a", "b", "d", "e", "c", "c2"},
+			topological: []string{"a", "b", "c", "c2", "e", "d"},
+		},
+		{
+			name: "orderConflict",
+			depSet: func(t *testing.T, order DepSetOrder) *DepSet {
+				child1 := NewDepSetBuilder(order).Direct(a, b).Build()
+				child2 := NewDepSetBuilder(order).Direct(b, a).Build()
+				parent := NewDepSetBuilder(order).Transitive(child1).Transitive(child2).Build()
+				return parent
+			},
+			postorder:   []string{"a", "b"},
+			preorder:    []string{"a", "b"},
+			topological: []string{"b", "a"},
+		},
+		{
+			name: "orderConflictNested",
+			depSet: func(t *testing.T, order DepSetOrder) *DepSet {
+				a := NewDepSetBuilder(order).Direct(a).Build()
+				b := NewDepSetBuilder(order).Direct(b).Build()
+				child1 := NewDepSetBuilder(order).Transitive(a).Transitive(b).Build()
+				child2 := NewDepSetBuilder(order).Transitive(b).Transitive(a).Build()
+				parent := NewDepSetBuilder(order).Transitive(child1).Transitive(child2).Build()
+				return parent
+			},
+			postorder:   []string{"a", "b"},
+			preorder:    []string{"a", "b"},
+			topological: []string{"b", "a"},
+		},
+	}
+
+	for _, tt := range tests {
+		t.Run(tt.name, func(t *testing.T) {
+			t.Run("postorder", func(t *testing.T) {
+				depSet := tt.depSet(t, POSTORDER)
+				if g, w := depSet.ToList().Strings(), tt.postorder; !reflect.DeepEqual(g, w) {
+					t.Errorf("expected ToList() = %q, got %q", w, g)
+				}
+			})
+			t.Run("preorder", func(t *testing.T) {
+				depSet := tt.depSet(t, PREORDER)
+				if g, w := depSet.ToList().Strings(), tt.preorder; !reflect.DeepEqual(g, w) {
+					t.Errorf("expected ToList() = %q, got %q", w, g)
+				}
+			})
+			t.Run("topological", func(t *testing.T) {
+				depSet := tt.depSet(t, TOPOLOGICAL)
+				if g, w := depSet.ToList().Strings(), tt.topological; !reflect.DeepEqual(g, w) {
+					t.Errorf("expected ToList() = %q, got %q", w, g)
+				}
+			})
+		})
+	}
+}
+
+func TestDepSetInvalidOrder(t *testing.T) {
+	orders := []DepSetOrder{POSTORDER, PREORDER, TOPOLOGICAL}
+
+	run := func(t *testing.T, order1, order2 DepSetOrder) {
+		defer func() {
+			if r := recover(); r != nil {
+				if err, ok := r.(error); !ok {
+					t.Fatalf("expected panic error, got %v", err)
+				} else if !strings.Contains(err.Error(), "incompatible order") {
+					t.Fatalf("expected incompatible order error, got %v", err)
+				}
+			}
+		}()
+		NewDepSet(order1, nil, []*DepSet{NewDepSet(order2, nil, nil)})
+		t.Fatal("expected panic")
+	}
+
+	for _, order1 := range orders {
+		t.Run(order1.String(), func(t *testing.T) {
+			for _, order2 := range orders {
+				t.Run(order2.String(), func(t *testing.T) {
+					if order1 != order2 {
+						run(t, order1, order2)
+					}
+				})
+			}
+		})
+	}
+}
diff --git a/android/makefile_goal.go b/android/makefile_goal.go
new file mode 100644
index 0000000..eae3976
--- /dev/null
+++ b/android/makefile_goal.go
@@ -0,0 +1,99 @@
+// Copyright 2020 Google Inc. All rights reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//     http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+package android
+
+import (
+	"fmt"
+	"io"
+	"path/filepath"
+
+	"github.com/google/blueprint/proptools"
+)
+
+func init() {
+	RegisterModuleType("makefile_goal", MakefileGoalFactory)
+}
+
+type makefileGoalProperties struct {
+	// Sources.
+
+	// Makefile goal output file path, relative to PRODUCT_OUT.
+	Product_out_path *string
+}
+
+type makefileGoal struct {
+	ModuleBase
+
+	properties makefileGoalProperties
+
+	// Destination. Output file path of this module.
+	outputFilePath OutputPath
+}
+
+var _ AndroidMkEntriesProvider = (*makefileGoal)(nil)
+var _ OutputFileProducer = (*makefileGoal)(nil)
+
+// Input file of this makefile_goal module. Nil if none specified. May use variable names in makefiles.
+func (p *makefileGoal) inputPath() *string {
+	if p.properties.Product_out_path != nil {
+		return proptools.StringPtr(filepath.Join("$(PRODUCT_OUT)", proptools.String(p.properties.Product_out_path)))
+	}
+	return nil
+}
+
+// OutputFileProducer
+func (p *makefileGoal) OutputFiles(tag string) (Paths, error) {
+	if tag != "" {
+		return nil, fmt.Errorf("unsupported tag %q", tag)
+	}
+	return Paths{p.outputFilePath}, nil
+}
+
+// AndroidMkEntriesProvider
+func (p *makefileGoal) DepsMutator(ctx BottomUpMutatorContext) {
+	if p.inputPath() == nil {
+		ctx.PropertyErrorf("product_out_path", "Path relative to PRODUCT_OUT required")
+	}
+}
+
+func (p *makefileGoal) GenerateAndroidBuildActions(ctx ModuleContext) {
+	filename := filepath.Base(proptools.String(p.inputPath()))
+	p.outputFilePath = PathForModuleOut(ctx, filename).OutputPath
+
+	ctx.InstallFile(PathForModuleInstall(ctx, "etc"), ctx.ModuleName(), p.outputFilePath)
+}
+
+func (p *makefileGoal) AndroidMkEntries() []AndroidMkEntries {
+	return []AndroidMkEntries{AndroidMkEntries{
+		Class:      "ETC",
+		OutputFile: OptionalPathForPath(p.outputFilePath),
+		ExtraFooters: []AndroidMkExtraFootersFunc{
+			func(w io.Writer, name, prefix, moduleDir string, entries *AndroidMkEntries) {
+				// Can't use Cp because inputPath() is not a valid Path.
+				fmt.Fprintf(w, "$(eval $(call copy-one-file,%s,%s))\n", proptools.String(p.inputPath()), p.outputFilePath)
+			},
+		},
+	}}
+}
+
+// Import a Makefile goal to Soong by copying the file built by
+// the goal to a path visible to Soong. This rule only works on boot images.
+func MakefileGoalFactory() Module {
+	module := &makefileGoal{}
+	module.AddProperties(&module.properties)
+	// This module is device-only
+	InitAndroidArchModule(module, DeviceSupported, MultilibFirst)
+	return module
+}
diff --git a/android/module.go b/android/module.go
index f80f37e..8605954 100644
--- a/android/module.go
+++ b/android/module.go
@@ -50,6 +50,8 @@
 	Implicit        Path
 	Implicits       Paths
 	OrderOnly       Paths
+	Validation      Path
+	Validations     Paths
 	Default         bool
 	Args            map[string]string
 }
@@ -546,6 +548,9 @@
 
 	SkipInstall bool `blueprint:"mutated"`
 
+	// Disabled by mutators. If set to true, it overrides Enabled property.
+	ForcedDisabled bool `blueprint:"mutated"`
+
 	NamespaceExportedToMake bool `blueprint:"mutated"`
 
 	MissingDeps []string `blueprint:"mutated"`
@@ -1020,6 +1025,9 @@
 }
 
 func (m *ModuleBase) Enabled() bool {
+	if m.commonProperties.ForcedDisabled {
+		return false
+	}
 	if m.commonProperties.Enabled == nil {
 		return !m.Os().DefaultDisabled
 	}
@@ -1027,7 +1035,7 @@
 }
 
 func (m *ModuleBase) Disable() {
-	m.commonProperties.Enabled = proptools.BoolPtr(false)
+	m.commonProperties.ForcedDisabled = true
 }
 
 func (m *ModuleBase) SkipInstall() {
@@ -1561,6 +1569,7 @@
 		Inputs:          params.Inputs.Strings(),
 		Implicits:       params.Implicits.Strings(),
 		OrderOnly:       params.OrderOnly.Strings(),
+		Validations:     params.Validations.Strings(),
 		Args:            params.Args,
 		Optional:        !params.Default,
 	}
@@ -1580,13 +1589,17 @@
 	if params.Implicit != nil {
 		bparams.Implicits = append(bparams.Implicits, params.Implicit.String())
 	}
+	if params.Validation != nil {
+		bparams.Validations = append(bparams.Validations, params.Validation.String())
+	}
 
 	bparams.Outputs = proptools.NinjaEscapeList(bparams.Outputs)
 	bparams.ImplicitOutputs = proptools.NinjaEscapeList(bparams.ImplicitOutputs)
 	bparams.Inputs = proptools.NinjaEscapeList(bparams.Inputs)
 	bparams.Implicits = proptools.NinjaEscapeList(bparams.Implicits)
 	bparams.OrderOnly = proptools.NinjaEscapeList(bparams.OrderOnly)
-	bparams.Depfile = proptools.NinjaEscapeList([]string{bparams.Depfile})[0]
+	bparams.Validations = proptools.NinjaEscapeList(bparams.Validations)
+	bparams.Depfile = proptools.NinjaEscape(bparams.Depfile)
 
 	return bparams
 }
@@ -1826,7 +1839,7 @@
 
 // A regexp for removing boilerplate from BaseDependencyTag from the string representation of
 // a dependency tag.
-var tagCleaner = regexp.MustCompile(`\QBaseDependencyTag:blueprint.BaseDependencyTag{}\E(, )?`)
+var tagCleaner = regexp.MustCompile(`\QBaseDependencyTag:{}\E(, )?`)
 
 // PrettyPrintTag returns string representation of the tag, but prefers
 // custom String() method if available.
@@ -1837,7 +1850,7 @@
 	}
 
 	// Otherwise, get a default string representation of the tag's struct.
-	tagString := fmt.Sprintf("%#v", tag)
+	tagString := fmt.Sprintf("%T: %+v", tag, tag)
 
 	// Remove the boilerplate from BaseDependencyTag as it adds no value.
 	tagString = tagCleaner.ReplaceAllString(tagString, "")
diff --git a/android/neverallow.go b/android/neverallow.go
index 526d399..73829f1 100644
--- a/android/neverallow.go
+++ b/android/neverallow.go
@@ -56,6 +56,7 @@
 	AddNeverAllowRules(createJavaDeviceForHostRules()...)
 	AddNeverAllowRules(createCcSdkVariantRules()...)
 	AddNeverAllowRules(createUncompressDexRules()...)
+	AddNeverAllowRules(createMakefileGoalRules()...)
 }
 
 // Add a NeverAllow rule to the set of rules to apply.
@@ -231,6 +232,15 @@
 	}
 }
 
+func createMakefileGoalRules() []Rule {
+	return []Rule{
+		NeverAllow().
+			ModuleType("makefile_goal").
+			WithoutMatcher("product_out_path", Regexp("^boot[0-9a-zA-Z.-]*[.]img$")).
+			Because("Only boot images may be imported as a makefile goal."),
+	}
+}
+
 func neverallowMutator(ctx BottomUpMutatorContext) {
 	m, ok := ctx.Module().(Module)
 	if !ok {
diff --git a/android/neverallow_test.go b/android/neverallow_test.go
index 45d36a6..56a07dc 100644
--- a/android/neverallow_test.go
+++ b/android/neverallow_test.go
@@ -326,6 +326,20 @@
 			"module \"outside_art_libraries\": violates neverallow",
 		},
 	},
+	{
+		name: "disallowed makefile_goal",
+		fs: map[string][]byte{
+			"Android.bp": []byte(`
+				makefile_goal {
+					name: "foo",
+					product_out_path: "boot/trap.img"
+				}
+			`),
+		},
+		expectedErrors: []string{
+			"Only boot images may be imported as a makefile goal.",
+		},
+	},
 }
 
 func TestNeverallow(t *testing.T) {
@@ -350,6 +364,7 @@
 	ctx.RegisterModuleType("java_library", newMockJavaLibraryModule)
 	ctx.RegisterModuleType("java_library_host", newMockJavaLibraryModule)
 	ctx.RegisterModuleType("java_device_for_host", newMockJavaLibraryModule)
+	ctx.RegisterModuleType("makefile_goal", newMockMakefileGoalModule)
 	ctx.PostDepsMutators(RegisterNeverallowMutator)
 	ctx.Register(config)
 
@@ -438,3 +453,22 @@
 
 func (p *mockJavaLibraryModule) GenerateAndroidBuildActions(ModuleContext) {
 }
+
+type mockMakefileGoalProperties struct {
+	Product_out_path *string
+}
+
+type mockMakefileGoalModule struct {
+	ModuleBase
+	properties mockMakefileGoalProperties
+}
+
+func newMockMakefileGoalModule() Module {
+	m := &mockMakefileGoalModule{}
+	m.AddProperties(&m.properties)
+	InitAndroidModule(m)
+	return m
+}
+
+func (p *mockMakefileGoalModule) GenerateAndroidBuildActions(ModuleContext) {
+}
diff --git a/android/paths.go b/android/paths.go
index d13b6d8..65f129c 100644
--- a/android/paths.go
+++ b/android/paths.go
@@ -486,6 +486,10 @@
 	return ret
 }
 
+func CopyOfPaths(paths Paths) Paths {
+	return append(Paths(nil), paths...)
+}
+
 // FirstUniquePaths returns all unique elements of a Paths, keeping the first copy of each.  It
 // modifies the Paths slice contents in place, and returns a subslice of the original slice.
 func FirstUniquePaths(list Paths) Paths {
@@ -496,7 +500,8 @@
 	return firstUniquePathsList(list)
 }
 
-// SortedUniquePaths returns what its name says
+// SortedUniquePaths returns all unique elements of a Paths in sorted order.  It modifies the
+// Paths slice contents in place, and returns a subslice of the original slice.
 func SortedUniquePaths(list Paths) Paths {
 	unique := FirstUniquePaths(list)
 	sort.Slice(unique, func(i, j int) bool {
@@ -1550,3 +1555,15 @@
 	}
 	return filepath.Join(absSrcDir, path)
 }
+
+// A DataPath represents the path of a file to be used as data, for example
+// a test library to be installed alongside a test.
+// The data file should be installed (copied from `<SrcPath>`) to
+// `<install_root>/<RelativeInstallPath>/<filename>`, or
+// `<install_root>/<filename>` if RelativeInstallPath is empty.
+type DataPath struct {
+	// The path of the data file that should be copied into the data directory
+	SrcPath Path
+	// The install path of the data file, relative to the install root.
+	RelativeInstallPath string
+}
diff --git a/android/prebuilt.go b/android/prebuilt.go
index 9f4df28..269ad5d 100644
--- a/android/prebuilt.go
+++ b/android/prebuilt.go
@@ -225,7 +225,7 @@
 // PrebuiltSourceDepsMutator adds dependencies to the prebuilt module from the
 // corresponding source module, if one exists for the same variant.
 func PrebuiltSourceDepsMutator(ctx BottomUpMutatorContext) {
-	if m, ok := ctx.Module().(PrebuiltInterface); ok && m.Prebuilt() != nil {
+	if m, ok := ctx.Module().(PrebuiltInterface); ok && m.Enabled() && m.Prebuilt() != nil {
 		p := m.Prebuilt()
 		if !p.properties.PrebuiltRenamedToSource {
 			name := m.base().BaseModuleName()
diff --git a/android/prebuilt_test.go b/android/prebuilt_test.go
index 8029b85..6c3cd9e 100644
--- a/android/prebuilt_test.go
+++ b/android/prebuilt_test.go
@@ -22,9 +22,10 @@
 )
 
 var prebuiltsTests = []struct {
-	name     string
-	modules  string
-	prebuilt []OsClass
+	name      string
+	replaceBp bool // modules is added to default bp boilerplate if false.
+	modules   string
+	prebuilt  []OsType
 }{
 	{
 		name: "no prebuilt",
@@ -42,7 +43,7 @@
 				prefer: false,
 				srcs: ["prebuilt_file"],
 			}`,
-		prebuilt: []OsClass{Device, Host},
+		prebuilt: []OsType{Android, BuildOs},
 	},
 	{
 		name: "no source prebuilt preferred",
@@ -52,7 +53,7 @@
 				prefer: true,
 				srcs: ["prebuilt_file"],
 			}`,
-		prebuilt: []OsClass{Device, Host},
+		prebuilt: []OsType{Android, BuildOs},
 	},
 	{
 		name: "prebuilt not preferred",
@@ -80,7 +81,7 @@
 				prefer: true,
 				srcs: ["prebuilt_file"],
 			}`,
-		prebuilt: []OsClass{Device, Host},
+		prebuilt: []OsType{Android, BuildOs},
 	},
 	{
 		name: "prebuilt no file not preferred",
@@ -120,7 +121,7 @@
 				prefer: true,
 				srcs: [":fg"],
 			}`,
-		prebuilt: []OsClass{Device, Host},
+		prebuilt: []OsType{Android, BuildOs},
 	},
 	{
 		name: "prebuilt module for device only",
@@ -135,7 +136,7 @@
 				prefer: true,
 				srcs: ["prebuilt_file"],
 			}`,
-		prebuilt: []OsClass{Device},
+		prebuilt: []OsType{Android},
 	},
 	{
 		name: "prebuilt file for host only",
@@ -153,7 +154,7 @@
 					},
 				},
 			}`,
-		prebuilt: []OsClass{Host},
+		prebuilt: []OsType{BuildOs},
 	},
 	{
 		name: "prebuilt override not preferred",
@@ -191,7 +192,72 @@
 				prefer: true,
 				srcs: ["prebuilt_file"],
 			}`,
-		prebuilt: []OsClass{Device, Host},
+		prebuilt: []OsType{Android, BuildOs},
+	},
+	{
+		name:      "prebuilt including default-disabled OS",
+		replaceBp: true,
+		modules: `
+			source {
+				name: "foo",
+				deps: [":bar"],
+				target: {
+					windows: {
+						enabled: true,
+					},
+				},
+			}
+
+			source {
+				name: "bar",
+				target: {
+					windows: {
+						enabled: true,
+					},
+				},
+			}
+
+			prebuilt {
+				name: "bar",
+				prefer: true,
+				srcs: ["prebuilt_file"],
+				target: {
+					windows: {
+						enabled: true,
+					},
+				},
+			}`,
+		prebuilt: []OsType{Android, BuildOs, Windows},
+	},
+	{
+		name:      "fall back to source for default-disabled OS",
+		replaceBp: true,
+		modules: `
+			source {
+				name: "foo",
+				deps: [":bar"],
+				target: {
+					windows: {
+						enabled: true,
+					},
+				},
+			}
+
+			source {
+				name: "bar",
+				target: {
+					windows: {
+						enabled: true,
+					},
+				},
+			}
+
+			prebuilt {
+				name: "bar",
+				prefer: true,
+				srcs: ["prebuilt_file"],
+			}`,
+		prebuilt: []OsType{Android, BuildOs},
 	},
 }
 
@@ -203,14 +269,25 @@
 
 	for _, test := range prebuiltsTests {
 		t.Run(test.name, func(t *testing.T) {
-			bp := `
-				source {
-					name: "foo",
-					deps: [":bar"],
-				}
-				` + test.modules
+			bp := test.modules
+			if !test.replaceBp {
+				bp = bp + `
+					source {
+						name: "foo",
+						deps: [":bar"],
+					}`
+			}
 			config := TestArchConfig(buildDir, nil, bp, fs)
 
+			// Add windows to the target list to test the logic when a variant is
+			// disabled by default.
+			if !Windows.DefaultDisabled {
+				t.Errorf("windows is assumed to be disabled by default")
+			}
+			config.config.Targets[Windows] = []Target{
+				{Windows, Arch{ArchType: X86_64}, NativeBridgeDisabled, "", ""},
+			}
+
 			ctx := NewTestArchContext()
 			registerTestPrebuiltBuildComponents(ctx)
 			ctx.RegisterModuleType("filegroup", FileGroupFactory)
@@ -223,7 +300,7 @@
 
 			for _, variant := range ctx.ModuleVariantsForTests("foo") {
 				foo := ctx.ModuleForTests("foo", variant)
-				t.Run(foo.Module().Target().Os.Class.String(), func(t *testing.T) {
+				t.Run(foo.Module().Target().Os.String(), func(t *testing.T) {
 					var dependsOnSourceModule, dependsOnPrebuiltModule bool
 					ctx.VisitDirectDeps(foo.Module(), func(m blueprint.Module) {
 						if _, ok := m.(*sourceModule); ok {
@@ -237,26 +314,38 @@
 						}
 					})
 
+					moduleIsDisabled := !foo.Module().Enabled()
 					deps := foo.Module().(*sourceModule).deps
-					if deps == nil || len(deps) != 1 {
-						t.Errorf("deps does not have single path, but is %v", deps)
+					if moduleIsDisabled {
+						if len(deps) > 0 {
+							t.Errorf("disabled module got deps: %v", deps)
+						}
+					} else {
+						if len(deps) != 1 {
+							t.Errorf("deps does not have single path, but is %v", deps)
+						}
 					}
+
 					var usingSourceFile, usingPrebuiltFile bool
-					if deps[0].String() == "source_file" {
+					if len(deps) > 0 && deps[0].String() == "source_file" {
 						usingSourceFile = true
 					}
-					if deps[0].String() == "prebuilt_file" {
+					if len(deps) > 0 && deps[0].String() == "prebuilt_file" {
 						usingPrebuiltFile = true
 					}
 
 					prebuilt := false
 					for _, os := range test.prebuilt {
-						if os == foo.Module().Target().Os.Class {
+						if os == foo.Module().Target().Os {
 							prebuilt = true
 						}
 					}
 
 					if prebuilt {
+						if moduleIsDisabled {
+							t.Errorf("dependent module for prebuilt is disabled")
+						}
+
 						if !dependsOnPrebuiltModule {
 							t.Errorf("doesn't depend on prebuilt module")
 						}
@@ -270,7 +359,7 @@
 						if usingSourceFile {
 							t.Errorf("using source_file")
 						}
-					} else {
+					} else if !moduleIsDisabled {
 						if dependsOnPrebuiltModule {
 							t.Errorf("depends on prebuilt module")
 						}
diff --git a/android/sdk.go b/android/sdk.go
index 8115b69..9ea7ff4 100644
--- a/android/sdk.go
+++ b/android/sdk.go
@@ -34,10 +34,8 @@
 	RequiredSdks() SdkRefs
 }
 
-// SdkAware is the interface that must be supported by any module to become a member of SDK or to be
-// built with SDK
-type SdkAware interface {
-	Module
+// Provided to improve code navigation with the IDE.
+type sdkAwareWithoutModule interface {
 	RequiredSdks
 
 	sdkBase() *SdkBase
@@ -48,6 +46,13 @@
 	BuildWithSdks(sdks SdkRefs)
 }
 
+// SdkAware is the interface that must be supported by any module to become a member of SDK or to be
+// built with SDK
+type SdkAware interface {
+	Module
+	sdkAwareWithoutModule
+}
+
 // SdkRef refers to a version of an SDK
 type SdkRef struct {
 	Name    string
@@ -322,6 +327,12 @@
 	// SdkAware and be added with an SdkMemberTypeDependencyTag tag.
 	HasTransitiveSdkMembers() bool
 
+	// Return true if prebuilt host artifacts may be specific to the host OS. Only
+	// applicable to modules where HostSupported() is true. If this is true,
+	// snapshots will list each host OS variant explicitly and disable all other
+	// host OS'es.
+	IsHostOsDependent() bool
+
 	// Add dependencies from the SDK module to all the module variants the member
 	// type contributes to the SDK. `names` is the list of module names given in
 	// the member type property (as returned by SdkPropertyName()) in the SDK
@@ -384,6 +395,7 @@
 	PropertyName         string
 	SupportsSdk          bool
 	TransitiveSdkMembers bool
+	HostOsDependent      bool
 }
 
 func (b *SdkMemberTypeBase) SdkPropertyName() string {
@@ -398,6 +410,10 @@
 	return b.TransitiveSdkMembers
 }
 
+func (b *SdkMemberTypeBase) IsHostOsDependent() bool {
+	return b.HostOsDependent
+}
+
 // Encapsulates the information about registered SdkMemberTypes.
 type SdkMemberTypesRegistry struct {
 	// The list of types sorted by property name.
@@ -466,8 +482,7 @@
 
 // Base structure for all implementations of SdkMemberProperties.
 //
-// Contains common properties that apply across many different member types. These
-// are not affected by the optimization to extract common values.
+// Contains common properties that apply across many different member types.
 type SdkMemberPropertiesBase struct {
 	// The number of unique os types supported by the member variants.
 	//
@@ -489,9 +504,7 @@
 	Os OsType `sdk:"keep"`
 
 	// The setting to use for the compile_multilib property.
-	//
-	// This property is set after optimization so there is no point in trying to optimize it.
-	Compile_multilib string `sdk:"keep"`
+	Compile_multilib string `android:"arch_variant"`
 }
 
 // The os prefix to use for any file paths in the sdk.
diff --git a/android/test_suites.go b/android/test_suites.go
new file mode 100644
index 0000000..7b2d7dc
--- /dev/null
+++ b/android/test_suites.go
@@ -0,0 +1,75 @@
+// Copyright 2020 Google Inc. All rights reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//     http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+package android
+
+func init() {
+	RegisterSingletonType("testsuites", testSuiteFilesFactory)
+}
+
+func testSuiteFilesFactory() Singleton {
+	return &testSuiteFiles{}
+}
+
+type testSuiteFiles struct {
+	robolectric WritablePath
+}
+
+type TestSuiteModule interface {
+	Module
+	TestSuites() []string
+}
+
+func (t *testSuiteFiles) GenerateBuildActions(ctx SingletonContext) {
+	files := make(map[string]map[string]InstallPaths)
+
+	ctx.VisitAllModules(func(m Module) {
+		if tsm, ok := m.(TestSuiteModule); ok {
+			for _, testSuite := range tsm.TestSuites() {
+				if files[testSuite] == nil {
+					files[testSuite] = make(map[string]InstallPaths)
+				}
+				name := ctx.ModuleName(m)
+				files[testSuite][name] = append(files[testSuite][name], tsm.filesToInstall()...)
+			}
+		}
+	})
+
+	t.robolectric = robolectricTestSuite(ctx, files["robolectric-tests"])
+
+	ctx.Phony("robolectric-tests", t.robolectric)
+}
+
+func (t *testSuiteFiles) MakeVars(ctx MakeVarsContext) {
+	ctx.DistForGoal("robolectric-tests", t.robolectric)
+}
+
+func robolectricTestSuite(ctx SingletonContext, files map[string]InstallPaths) WritablePath {
+	var installedPaths InstallPaths
+	for _, module := range SortedStringKeys(files) {
+		installedPaths = append(installedPaths, files[module]...)
+	}
+	testCasesDir := pathForInstall(ctx, BuildOs, "testcases", false).ToMakePath()
+
+	outputFile := PathForOutput(ctx, "packaging", "robolectric-tests.zip")
+	rule := NewRuleBuilder()
+	rule.Command().BuiltTool(ctx, "soong_zip").
+		FlagWithOutput("-o ", outputFile).
+		FlagWithArg("-P ", "host/testcases").
+		FlagWithArg("-C ", testCasesDir.String()).
+		FlagWithRspFileInputList("-l ", installedPaths.Paths())
+	rule.Build(pctx, ctx, "robolectric_tests_zip", "robolectric-tests.zip")
+
+	return outputFile
+}
diff --git a/android/variable.go b/android/variable.go
index 2c8bd07..c1e1b42 100644
--- a/android/variable.go
+++ b/android/variable.go
@@ -308,8 +308,6 @@
 	BoardPlatPrivateSepolicyDirs []string `json:",omitempty"`
 	BoardSepolicyM4Defs          []string `json:",omitempty"`
 
-	BoardVndkRuntimeDisable *bool `json:",omitempty"`
-
 	VendorVars map[string]map[string]string `json:",omitempty"`
 
 	Ndk_abis               *bool `json:",omitempty"`
@@ -346,6 +344,8 @@
 	InstallExtraFlattenedApexes *bool `json:",omitempty"`
 
 	BoardUsesRecoveryAsBoot *bool `json:",omitempty"`
+
+	BoardKernelBinaries []string `json:",omitempty"`
 }
 
 func boolPtr(v bool) *bool {
diff --git a/apex/androidmk.go b/apex/androidmk.go
index 7595238..5c6d6cc 100644
--- a/apex/androidmk.go
+++ b/apex/androidmk.go
@@ -50,6 +50,11 @@
 		return moduleNames
 	}
 
+	// b/162366062. Prevent GKI APEXes to emit make rules to avoid conflicts.
+	if strings.HasPrefix(apexName, "com.android.gki.") && apexType != flattenedApex {
+		return moduleNames
+	}
+
 	// b/140136207. When there are overriding APEXes for a VNDK APEX, the symbols file for the overridden
 	// APEX and the overriding APEX will have the same installation paths at /apex/com.android.vndk.v<ver>
 	// as their apexName will be the same. To avoid the path conflicts, skip installing the symbol files
@@ -82,9 +87,9 @@
 
 		var moduleName string
 		if linkToSystemLib {
-			moduleName = fi.moduleName
+			moduleName = fi.androidMkModuleName
 		} else {
-			moduleName = fi.moduleName + "." + apexBundleName + a.suffix
+			moduleName = fi.androidMkModuleName + "." + apexBundleName + a.suffix
 		}
 
 		if !android.InList(moduleName, moduleNames) {
@@ -105,9 +110,10 @@
 		fmt.Fprintln(w, "LOCAL_MODULE :=", moduleName)
 		// /apex/<apex_name>/{lib|framework|...}
 		pathWhenActivated := filepath.Join("$(PRODUCT_OUT)", "apex", apexName, fi.installDir)
+		var modulePath string
 		if apexType == flattenedApex {
 			// /system/apex/<name>/{lib|framework|...}
-			modulePath := filepath.Join(a.installDir.ToMakePath().String(), apexBundleName, fi.installDir)
+			modulePath = filepath.Join(a.installDir.ToMakePath().String(), apexBundleName, fi.installDir)
 			fmt.Fprintln(w, "LOCAL_MODULE_PATH :=", modulePath)
 			if a.primaryApexType && !symbolFilesNotNeeded {
 				fmt.Fprintln(w, "LOCAL_SOONG_SYMBOL_PATH :=", pathWhenActivated)
@@ -115,9 +121,9 @@
 			if len(fi.symlinks) > 0 {
 				fmt.Fprintln(w, "LOCAL_MODULE_SYMLINKS :=", strings.Join(fi.symlinks, " "))
 			}
-			newDataPaths := []android.Path{}
+			newDataPaths := []android.DataPath{}
 			for _, path := range fi.dataPaths {
-				dataOutPath := modulePath + ":" + path.Rel()
+				dataOutPath := modulePath + ":" + path.SrcPath.Rel()
 				if ok := seenDataOutPaths[dataOutPath]; !ok {
 					newDataPaths = append(newDataPaths, path)
 					seenDataOutPaths[dataOutPath] = true
@@ -131,6 +137,7 @@
 				fmt.Fprintln(w, "LOCAL_NOTICE_FILE :=", strings.Join(fi.module.NoticeFiles().Strings(), " "))
 			}
 		} else {
+			modulePath = pathWhenActivated
 			fmt.Fprintln(w, "LOCAL_MODULE_PATH :=", pathWhenActivated)
 
 			// For non-flattend APEXes, the merged notice file is attached to the APEX itself.
@@ -193,8 +200,13 @@
 			// we need to remove the suffix from LOCAL_MODULE_STEM, otherwise
 			// we will have foo.apk.apk
 			fmt.Fprintln(w, "LOCAL_MODULE_STEM :=", strings.TrimSuffix(fi.Stem(), ".apk"))
-			if app, ok := fi.module.(*java.AndroidApp); ok && len(app.JniCoverageOutputs()) > 0 {
-				fmt.Fprintln(w, "LOCAL_PREBUILT_COVERAGE_ARCHIVE :=", strings.Join(app.JniCoverageOutputs().Strings(), " "))
+			if app, ok := fi.module.(*java.AndroidApp); ok {
+				if jniCoverageOutputs := app.JniCoverageOutputs(); len(jniCoverageOutputs) > 0 {
+					fmt.Fprintln(w, "LOCAL_PREBUILT_COVERAGE_ARCHIVE :=", strings.Join(jniCoverageOutputs.Strings(), " "))
+				}
+				if jniLibSymbols := app.JNISymbolsInstalls(modulePath); len(jniLibSymbols) > 0 {
+					fmt.Fprintln(w, "LOCAL_SOONG_JNI_LIBS_SYMBOLS :=", jniLibSymbols.String())
+				}
 			}
 			fmt.Fprintln(w, "include $(BUILD_SYSTEM)/soong_app_prebuilt.mk")
 		case appSet:
@@ -202,7 +214,8 @@
 			if !ok {
 				panic(fmt.Sprintf("Expected %s to be AndroidAppSet", fi.module))
 			}
-			fmt.Fprintln(w, "LOCAL_APK_SET_MASTER_FILE :=", as.MasterFile())
+			fmt.Fprintln(w, "LOCAL_APK_SET_INSTALL_FILE :=", as.InstallFile())
+			fmt.Fprintln(w, "LOCAL_APKCERTS_FILE :=", as.APKCertsFile().String())
 			fmt.Fprintln(w, "include $(BUILD_SYSTEM)/soong_android_app_set.mk")
 		case nativeSharedLib, nativeExecutable, nativeTest:
 			fmt.Fprintln(w, "LOCAL_MODULE_STEM :=", fi.Stem())
@@ -242,9 +255,9 @@
 		}
 
 		// m <module_name> will build <module_name>.<apex_name> as well.
-		if fi.moduleName != moduleName && a.primaryApexType {
-			fmt.Fprintln(w, ".PHONY: "+fi.moduleName)
-			fmt.Fprintln(w, fi.moduleName+": "+moduleName)
+		if fi.androidMkModuleName != moduleName && a.primaryApexType {
+			fmt.Fprintf(w, ".PHONY: %s\n", fi.androidMkModuleName)
+			fmt.Fprintf(w, "%s: %s\n", fi.androidMkModuleName, moduleName)
 		}
 	}
 	return moduleNames
@@ -345,6 +358,10 @@
 				if apexType == imageApex {
 					fmt.Fprintln(w, "ALL_MODULES.$(my_register_name).BUNDLE :=", a.bundleModuleFile.String())
 				}
+				if len(a.lintReports) > 0 {
+					fmt.Fprintln(w, "ALL_MODULES.$(my_register_name).LINT_REPORTS :=",
+						strings.Join(a.lintReports.Strings(), " "))
+				}
 
 				if a.installedFilesFile != nil {
 					goal := "checkbuild"
diff --git a/apex/apex.go b/apex/apex.go
index b29017d..9905b79 100644
--- a/apex/apex.go
+++ b/apex/apex.go
@@ -669,7 +669,7 @@
 }
 
 func RegisterPostDepsMutators(ctx android.RegisterMutatorsContext) {
-	ctx.TopDown("apex_deps", apexDepsMutator)
+	ctx.TopDown("apex_deps", apexDepsMutator).Parallel()
 	ctx.BottomUp("apex", apexMutator).Parallel()
 	ctx.BottomUp("apex_flattened", apexFlattenedMutator).Parallel()
 	ctx.BottomUp("apex_uses", apexUsesMutator).Parallel()
@@ -682,33 +682,43 @@
 	if !mctx.Module().Enabled() {
 		return
 	}
-	var apexBundles []android.ApexInfo
-	var directDep bool
-	if a, ok := mctx.Module().(*apexBundle); ok && !a.vndkApex {
-		apexBundles = []android.ApexInfo{{
-			ApexName:      mctx.ModuleName(),
-			MinSdkVersion: a.minSdkVersion(mctx),
-			Updatable:     a.Updatable(),
-		}}
-		directDep = true
-	} else if am, ok := mctx.Module().(android.ApexModule); ok {
-		apexBundles = am.ApexVariations()
-		directDep = false
+	a, ok := mctx.Module().(*apexBundle)
+	if !ok || a.vndkApex {
+		return
+	}
+	apexInfo := android.ApexInfo{
+		ApexName:      mctx.ModuleName(),
+		MinSdkVersion: a.minSdkVersion(mctx),
+		Updatable:     a.Updatable(),
 	}
 
-	if len(apexBundles) == 0 {
+	useVndk := a.SocSpecific() || a.DeviceSpecific() || (a.ProductSpecific() && mctx.Config().EnforceProductPartitionInterface())
+	excludeVndkLibs := useVndk && proptools.Bool(a.properties.Use_vndk_as_stable)
+	if !useVndk && proptools.Bool(a.properties.Use_vndk_as_stable) {
+		mctx.PropertyErrorf("use_vndk_as_stable", "not supported for system/system_ext APEXes")
 		return
 	}
 
-	cur := mctx.Module().(android.DepIsInSameApex)
-
-	mctx.VisitDirectDeps(func(child android.Module) {
-		depName := mctx.OtherModuleName(child)
-		if am, ok := child.(android.ApexModule); ok && am.CanHaveApexVariants() &&
-			(cur.DepIsInSameApex(mctx, child) || inAnySdk(child)) {
-			android.UpdateApexDependency(apexBundles, depName, directDep)
-			am.BuildForApexes(apexBundles)
+	mctx.WalkDeps(func(child, parent android.Module) bool {
+		am, ok := child.(android.ApexModule)
+		if !ok || !am.CanHaveApexVariants() {
+			return false
 		}
+		if !parent.(android.DepIsInSameApex).DepIsInSameApex(mctx, child) {
+			return false
+		}
+		if excludeVndkLibs {
+			if c, ok := child.(*cc.Module); ok && c.IsVndk() {
+				return false
+			}
+		}
+
+		depName := mctx.OtherModuleName(child)
+		// If the parent is apexBundle, this child is directly depended.
+		_, directDep := parent.(*apexBundle)
+		android.UpdateApexDependency(apexInfo, depName, directDep)
+		am.BuildForApex(apexInfo)
+		return true
 	})
 }
 
@@ -1012,6 +1022,11 @@
 
 	// The minimum SDK version that this apex must be compatibile with.
 	Min_sdk_version *string
+
+	// If set true, VNDK libs are considered as stable libs and are not included in this apex.
+	// Should be only used in non-system apexes (e.g. vendor: true).
+	// Default is false.
+	Use_vndk_as_stable *bool
 }
 
 type apexTargetBundleProperties struct {
@@ -1137,15 +1152,17 @@
 
 // apexFile represents a file in an APEX bundle
 type apexFile struct {
-	builtFile  android.Path
-	stem       string
-	moduleName string
-	installDir string
-	class      apexFileClass
-	module     android.Module
+	builtFile android.Path
+	stem      string
+	// Module name of `module` in AndroidMk. Note the generated AndroidMk module for
+	// apexFile is named something like <AndroidMk module name>.<apex name>[<apex suffix>]
+	androidMkModuleName string
+	installDir          string
+	class               apexFileClass
+	module              android.Module
 	// list of symlinks that will be created in installDir that point to this apexFile
 	symlinks      []string
-	dataPaths     android.Paths
+	dataPaths     []android.DataPath
 	transitiveDep bool
 	moduleDir     string
 
@@ -1154,19 +1171,20 @@
 	hostRequiredModuleNames   []string
 
 	jacocoReportClassesFile android.Path     // only for javalibs and apps
+	lintDepSets             java.LintDepSets // only for javalibs and apps
 	certificate             java.Certificate // only for apps
 	overriddenPackageName   string           // only for apps
 
 	isJniLib bool
 }
 
-func newApexFile(ctx android.BaseModuleContext, builtFile android.Path, moduleName string, installDir string, class apexFileClass, module android.Module) apexFile {
+func newApexFile(ctx android.BaseModuleContext, builtFile android.Path, androidMkModuleName string, installDir string, class apexFileClass, module android.Module) apexFile {
 	ret := apexFile{
-		builtFile:  builtFile,
-		moduleName: moduleName,
-		installDir: installDir,
-		class:      class,
-		module:     module,
+		builtFile:           builtFile,
+		androidMkModuleName: androidMkModuleName,
+		installDir:          installDir,
+		class:               class,
+		module:              module,
 	}
 	if module != nil {
 		ret.moduleDir = ctx.OtherModuleDir(module)
@@ -1278,6 +1296,9 @@
 
 	// Struct holding the merged notice file paths in different formats
 	mergedNotices android.NoticeOutputs
+
+	// Optional list of lint report zip files for apexes that contain java or app modules
+	lintReports android.Paths
 }
 
 func addDependenciesForNativeModules(ctx android.BottomUpMutatorContext,
@@ -1620,7 +1641,8 @@
 	}
 
 	fileToCopy := ccMod.OutputFile().Path()
-	return newApexFile(ctx, fileToCopy, ccMod.Name(), dirInApex, nativeSharedLib, ccMod)
+	androidMkModuleName := ccMod.BaseModuleName() + ccMod.Properties.SubName
+	return newApexFile(ctx, fileToCopy, androidMkModuleName, dirInApex, nativeSharedLib, ccMod)
 }
 
 func apexFileForExecutable(ctx android.BaseModuleContext, cc *cc.Module) apexFile {
@@ -1630,7 +1652,8 @@
 	}
 	dirInApex = filepath.Join(dirInApex, cc.RelativeInstallPath())
 	fileToCopy := cc.OutputFile().Path()
-	af := newApexFile(ctx, fileToCopy, cc.Name(), dirInApex, nativeExecutable, cc)
+	androidMkModuleName := cc.BaseModuleName() + cc.Properties.SubName
+	af := newApexFile(ctx, fileToCopy, androidMkModuleName, dirInApex, nativeExecutable, cc)
 	af.symlinks = cc.Symlinks()
 	af.dataPaths = cc.DataPaths()
 	return af
@@ -1639,7 +1662,7 @@
 func apexFileForPyBinary(ctx android.BaseModuleContext, py *python.Module) apexFile {
 	dirInApex := "bin"
 	fileToCopy := py.HostToolPath().Path()
-	return newApexFile(ctx, fileToCopy, py.Name(), dirInApex, pyBinary, py)
+	return newApexFile(ctx, fileToCopy, py.BaseModuleName(), dirInApex, pyBinary, py)
 }
 func apexFileForGoBinary(ctx android.BaseModuleContext, depName string, gb bootstrap.GoBinaryTool) apexFile {
 	dirInApex := "bin"
@@ -1658,25 +1681,33 @@
 func apexFileForShBinary(ctx android.BaseModuleContext, sh *sh.ShBinary) apexFile {
 	dirInApex := filepath.Join("bin", sh.SubDir())
 	fileToCopy := sh.OutputFile()
-	af := newApexFile(ctx, fileToCopy, sh.Name(), dirInApex, shBinary, sh)
+	af := newApexFile(ctx, fileToCopy, sh.BaseModuleName(), dirInApex, shBinary, sh)
 	af.symlinks = sh.Symlinks()
 	return af
 }
 
-type javaDependency interface {
+type javaModule interface {
+	android.Module
+	BaseModuleName() string
 	DexJarBuildPath() android.Path
 	JacocoReportClassesFile() android.Path
+	LintDepSets() java.LintDepSets
+
 	Stem() string
 }
 
-func apexFileForJavaLibrary(ctx android.BaseModuleContext, lib javaDependency, module android.Module) apexFile {
+var _ javaModule = (*java.Library)(nil)
+var _ javaModule = (*java.SdkLibrary)(nil)
+var _ javaModule = (*java.DexImport)(nil)
+var _ javaModule = (*java.SdkLibraryImport)(nil)
+
+func apexFileForJavaLibrary(ctx android.BaseModuleContext, module javaModule) apexFile {
 	dirInApex := "javalib"
-	fileToCopy := lib.DexJarBuildPath()
-	// Remove prebuilt_ if necessary so the source and prebuilt modules have the same name.
-	name := strings.TrimPrefix(module.Name(), "prebuilt_")
-	af := newApexFile(ctx, fileToCopy, name, dirInApex, javaSharedLib, module)
-	af.jacocoReportClassesFile = lib.JacocoReportClassesFile()
-	af.stem = lib.Stem() + ".jar"
+	fileToCopy := module.DexJarBuildPath()
+	af := newApexFile(ctx, fileToCopy, module.BaseModuleName(), dirInApex, javaSharedLib, module)
+	af.jacocoReportClassesFile = module.JacocoReportClassesFile()
+	af.lintDepSets = module.LintDepSets()
+	af.stem = module.Stem() + ".jar"
 	return af
 }
 
@@ -1699,6 +1730,7 @@
 	OutputFile() android.Path
 	JacocoReportClassesFile() android.Path
 	Certificate() java.Certificate
+	BaseModuleName() string
 }) apexFile {
 	appDir := "app"
 	if aapp.Privileged() {
@@ -1706,7 +1738,7 @@
 	}
 	dirInApex := filepath.Join(appDir, aapp.InstallApkName())
 	fileToCopy := aapp.OutputFile()
-	af := newApexFile(ctx, fileToCopy, aapp.Name(), dirInApex, app, aapp)
+	af := newApexFile(ctx, fileToCopy, aapp.BaseModuleName(), dirInApex, app, aapp)
 	af.jacocoReportClassesFile = aapp.JacocoReportClassesFile()
 	af.certificate = aapp.Certificate()
 
@@ -1812,7 +1844,8 @@
 
 	// Because APEXes targeting other than system/system_ext partitions
 	// can't set apex_available, we skip checks for these APEXes
-	if ctx.SocSpecific() || ctx.DeviceSpecific() || ctx.ProductSpecific() {
+	if a.SocSpecific() || a.DeviceSpecific() ||
+		(a.ProductSpecific() && ctx.Config().EnforceProductPartitionInterface()) {
 		return
 	}
 
@@ -2031,7 +2064,7 @@
 			case javaLibTag:
 				switch child.(type) {
 				case *java.Library, *java.SdkLibrary, *java.DexImport, *java.SdkLibraryImport:
-					af := apexFileForJavaLibrary(ctx, child.(javaDependency), child.(android.Module))
+					af := apexFileForJavaLibrary(ctx, child.(javaModule))
 					if !af.Ok() {
 						ctx.PropertyErrorf("java_libs", "%q is not configured to be compiled into dex", depName)
 						return false
@@ -2054,7 +2087,7 @@
 					if ap.Privileged() {
 						appDir = "priv-app"
 					}
-					af := newApexFile(ctx, ap.OutputFile(), ap.Name(),
+					af := newApexFile(ctx, ap.OutputFile(), ap.BaseModuleName(),
 						filepath.Join(appDir, ap.BaseModuleName()), appSet, ap)
 					af.certificate = java.PresignedCertificate
 					filesInfo = append(filesInfo, af)
@@ -2112,7 +2145,7 @@
 			case android.PrebuiltDepTag:
 				// If the prebuilt is force disabled, remember to delete the prebuilt file
 				// that might have been installed in the previous builds
-				if prebuilt, ok := child.(*Prebuilt); ok && prebuilt.isForceDisabled() {
+				if prebuilt, ok := child.(prebuilt); ok && prebuilt.isForceDisabled() {
 					a.prebuiltFileToDelete = prebuilt.InstallFilename()
 				}
 			}
@@ -2128,6 +2161,10 @@
 							// don't include it in this APEX
 							return false
 						}
+						if cc.UseVndk() && proptools.Bool(a.properties.Use_vndk_as_stable) && cc.IsVndk() {
+							requireNativeLibs = append(requireNativeLibs, ":vndk")
+							return false
+						}
 						af := apexFileForNativeLibrary(ctx, cc, handleSpecialLibs)
 						af.transitiveDep = true
 						if !a.Host() && !android.DirectlyInApex(ctx.ModuleName(), depName) && (cc.IsStubs() || cc.HasStubsVariants()) {
@@ -2164,7 +2201,7 @@
 						// use the name of the generated test binary (`fileToCopy`) instead of the name
 						// of the original test module (`depName`, shared by all `test_per_src`
 						// variations of that module).
-						af.moduleName = filepath.Base(af.builtFile.String())
+						af.androidMkModuleName = filepath.Base(af.builtFile.String())
 						// these are not considered transitive dep
 						af.transitiveDep = false
 						filesInfo = append(filesInfo, af)
@@ -2245,7 +2282,8 @@
 
 	// APEXes targeting other than system/system_ext partitions use vendor/product variants.
 	// So we can't link them to /system/lib libs which are core variants.
-	if a.SocSpecific() || a.DeviceSpecific() || a.ProductSpecific() {
+	if a.SocSpecific() || a.DeviceSpecific() ||
+		(a.ProductSpecific() && ctx.Config().EnforceProductPartitionInterface()) {
 		a.linkToSystemLib = false
 	}
 
@@ -2275,6 +2313,8 @@
 	a.compatSymlinks = makeCompatSymlinks(a.BaseModuleName(), ctx)
 
 	a.buildApexDependencyInfo(ctx)
+
+	a.buildLintReports(ctx)
 }
 
 // Enforce that Java deps of the apex are using stable SDKs to compile
diff --git a/apex/apex_test.go b/apex/apex_test.go
index f064338..d13ec5f 100644
--- a/apex/apex_test.go
+++ b/apex/apex_test.go
@@ -236,13 +236,15 @@
 	ctx.PreArchMutators(android.RegisterComponentsMutator)
 	ctx.PostDepsMutators(android.RegisterOverridePostDepsMutators)
 
-	cc.RegisterRequiredBuildComponentsForTest(ctx)
+	android.RegisterPrebuiltMutators(ctx)
 
-	// Register this after the prebuilt mutators have been registered (in
-	// cc.RegisterRequiredBuildComponentsForTest) to match what happens at runtime.
+	// Register these after the prebuilt mutators have been registered to match what
+	// happens at runtime.
 	ctx.PreArchMutators(android.RegisterVisibilityRuleGatherer)
 	ctx.PostDepsMutators(android.RegisterVisibilityRuleEnforcer)
 
+	cc.RegisterRequiredBuildComponentsForTest(ctx)
+
 	ctx.RegisterModuleType("cc_test", cc.TestFactory)
 	ctx.RegisterModuleType("vndk_prebuilt_shared", cc.VndkPrebuiltSharedFactory)
 	ctx.RegisterModuleType("vndk_libraries_txt", cc.VndkLibrariesTxtFactory)
@@ -412,7 +414,14 @@
 			system_shared_libs: [],
 			static_executable: true,
 			stl: "none",
-			apex_available: [ "myapex" ],
+			apex_available: [ "myapex", "com.android.gki.*" ],
+		}
+
+		apex {
+			name: "com.android.gki.fake",
+			binaries: ["foo"],
+			key: "myapex.key",
+			file_contexts: ":myapex-file_contexts",
 		}
 
 		cc_library_shared {
@@ -2201,6 +2210,63 @@
 	data.Custom(&builder, name, prefix, "", data)
 	androidMk := builder.String()
 	ensureContains(t, androidMk, `LOCAL_MODULE_PATH := /tmp/target/product/test_device/vendor/apex`)
+
+	apexManifestRule := ctx.ModuleForTests("myapex", "android_common_myapex_image").Rule("apexManifestRule")
+	requireNativeLibs := names(apexManifestRule.Args["requireNativeLibs"])
+	ensureListNotContains(t, requireNativeLibs, ":vndk")
+}
+
+func TestVendorApex_use_vndk_as_stable(t *testing.T) {
+	ctx, _ := testApex(t, `
+		apex {
+			name: "myapex",
+			key: "myapex.key",
+			binaries: ["mybin"],
+			vendor: true,
+			use_vndk_as_stable: true,
+		}
+		apex_key {
+			name: "myapex.key",
+			public_key: "testkey.avbpubkey",
+			private_key: "testkey.pem",
+		}
+		cc_binary {
+			name: "mybin",
+			vendor: true,
+			shared_libs: ["libvndk", "libvendor"],
+		}
+		cc_library {
+			name: "libvndk",
+			vndk: {
+				enabled: true,
+			},
+			vendor_available: true,
+		}
+		cc_library {
+			name: "libvendor",
+			vendor: true,
+		}
+	`)
+
+	vendorVariant := "android_vendor.VER_arm64_armv8-a"
+
+	ldRule := ctx.ModuleForTests("mybin", vendorVariant+"_myapex").Rule("ld")
+	libs := names(ldRule.Args["libFlags"])
+	// VNDK libs(libvndk/libc++) as they are
+	ensureListContains(t, libs, buildDir+"/.intermediates/libvndk/"+vendorVariant+"_shared/libvndk.so")
+	ensureListContains(t, libs, buildDir+"/.intermediates/libc++/"+vendorVariant+"_shared/libc++.so")
+	// non-stable Vendor libs as APEX variants
+	ensureListContains(t, libs, buildDir+"/.intermediates/libvendor/"+vendorVariant+"_shared_myapex/libvendor.so")
+
+	// VNDK libs are not included when use_vndk_as_stable: true
+	ensureExactContents(t, ctx, "myapex", "android_common_myapex_image", []string{
+		"bin/mybin",
+		"lib64/libvendor.so",
+	})
+
+	apexManifestRule := ctx.ModuleForTests("myapex", "android_common_myapex_image").Rule("apexManifestRule")
+	requireNativeLibs := names(apexManifestRule.Args["requireNativeLibs"])
+	ensureListContains(t, requireNativeLibs, ":vndk")
 }
 
 func TestAndroidMk_UseVendorRequired(t *testing.T) {
@@ -4384,11 +4450,11 @@
 func TestApexAvailable_IndirectDep(t *testing.T) {
 	// libbbaz is an indirect dep
 	testApexError(t, `requires "libbaz" that is not available for the APEX. Dependency path:
-.*via tag apex\.dependencyTag.*"sharedLib".*
+.*via tag apex\.dependencyTag.*name:sharedLib.*
 .*-> libfoo.*link:shared.*
-.*via tag cc\.DependencyTag.*"shared".*
+.*via tag cc\.libraryDependencyTag.*Kind:sharedLibraryDependency.*
 .*-> libbar.*link:shared.*
-.*via tag cc\.DependencyTag.*"shared".*
+.*via tag cc\.libraryDependencyTag.*Kind:sharedLibraryDependency.*
 .*-> libbaz.*link:shared.*`, `
 	apex {
 		name: "myapex",
@@ -5179,6 +5245,57 @@
 	ensureRealfileExists(t, files, "lib64/myotherlib.so") // this is a real file
 }
 
+func TestSymlinksFromApexToSystemRequiredModuleNames(t *testing.T) {
+	ctx, config := testApex(t, `
+		apex {
+			name: "myapex",
+			key: "myapex.key",
+			native_shared_libs: ["mylib"],
+		}
+
+		apex_key {
+			name: "myapex.key",
+			public_key: "testkey.avbpubkey",
+			private_key: "testkey.pem",
+		}
+
+		cc_library_shared {
+			name: "mylib",
+			srcs: ["mylib.cpp"],
+			shared_libs: ["myotherlib"],
+			system_shared_libs: [],
+			stl: "none",
+			apex_available: [
+				"myapex",
+				"//apex_available:platform",
+			],
+		}
+
+		cc_prebuilt_library_shared {
+			name: "myotherlib",
+			srcs: ["prebuilt.so"],
+			system_shared_libs: [],
+			stl: "none",
+			apex_available: [
+				"myapex",
+				"//apex_available:platform",
+			],
+		}
+	`)
+
+	apexBundle := ctx.ModuleForTests("myapex", "android_common_myapex_image").Module().(*apexBundle)
+	data := android.AndroidMkDataForTest(t, config, "", apexBundle)
+	var builder strings.Builder
+	data.Custom(&builder, apexBundle.BaseModuleName(), "TARGET_", "", data)
+	androidMk := builder.String()
+	// `myotherlib` is added to `myapex` as symlink
+	ensureContains(t, androidMk, "LOCAL_MODULE := mylib.myapex\n")
+	ensureNotContains(t, androidMk, "LOCAL_MODULE := prebuilt_myotherlib.myapex\n")
+	ensureNotContains(t, androidMk, "LOCAL_MODULE := myotherlib.myapex\n")
+	// `myapex` should have `myotherlib` in its required line, not `prebuilt_myotherlib`
+	ensureContains(t, androidMk, "LOCAL_REQUIRED_MODULES += mylib.myapex myotherlib apex_manifest.pb.myapex apex_pubkey.myapex\n")
+}
+
 func TestApexWithJniLibs(t *testing.T) {
 	ctx, _ := testApex(t, `
 		apex {
@@ -5434,6 +5551,7 @@
 	ctx.RegisterModuleType("apex_key", ApexKeyFactory)
 	ctx.RegisterModuleType("filegroup", android.FileGroupFactory)
 	ctx.PreArchMutators(android.RegisterDefaultsPreArchMutators)
+	android.RegisterPrebuiltMutators(ctx)
 	cc.RegisterRequiredBuildComponentsForTest(ctx)
 	java.RegisterJavaBuildComponents(ctx)
 	java.RegisterSystemModulesBuildComponents(ctx)
@@ -5484,13 +5602,15 @@
 }
 
 func TestNoUpdatableJarsInBootImage(t *testing.T) {
-
 	var err string
 	var transform func(*dexpreopt.GlobalConfig)
 
+	config := android.TestArchConfig(buildDir, nil, "", nil)
+	ctx := android.PathContextForTesting(config)
+
 	t.Run("updatable jar from ART apex in the ART boot image => ok", func(t *testing.T) {
 		transform = func(config *dexpreopt.GlobalConfig) {
-			config.ArtApexJars = []string{"com.android.art.something:some-art-lib"}
+			config.ArtApexJars = android.CreateConfiguredJarList(ctx, []string{"com.android.art.something:some-art-lib"})
 		}
 		testNoUpdatableJarsInBootImage(t, "", transform)
 	})
@@ -5498,7 +5618,7 @@
 	t.Run("updatable jar from ART apex in the framework boot image => error", func(t *testing.T) {
 		err = "module 'some-art-lib' from updatable apex 'com.android.art.something' is not allowed in the framework boot image"
 		transform = func(config *dexpreopt.GlobalConfig) {
-			config.BootJars = []string{"com.android.art.something:some-art-lib"}
+			config.BootJars = android.CreateConfiguredJarList(ctx, []string{"com.android.art.something:some-art-lib"})
 		}
 		testNoUpdatableJarsInBootImage(t, err, transform)
 	})
@@ -5506,7 +5626,7 @@
 	t.Run("updatable jar from some other apex in the ART boot image => error", func(t *testing.T) {
 		err = "module 'some-updatable-apex-lib' from updatable apex 'some-updatable-apex' is not allowed in the ART boot image"
 		transform = func(config *dexpreopt.GlobalConfig) {
-			config.ArtApexJars = []string{"some-updatable-apex:some-updatable-apex-lib"}
+			config.ArtApexJars = android.CreateConfiguredJarList(ctx, []string{"some-updatable-apex:some-updatable-apex-lib"})
 		}
 		testNoUpdatableJarsInBootImage(t, err, transform)
 	})
@@ -5514,7 +5634,7 @@
 	t.Run("non-updatable jar from some other apex in the ART boot image => error", func(t *testing.T) {
 		err = "module 'some-non-updatable-apex-lib' is not allowed in the ART boot image"
 		transform = func(config *dexpreopt.GlobalConfig) {
-			config.ArtApexJars = []string{"some-non-updatable-apex:some-non-updatable-apex-lib"}
+			config.ArtApexJars = android.CreateConfiguredJarList(ctx, []string{"some-non-updatable-apex:some-non-updatable-apex-lib"})
 		}
 		testNoUpdatableJarsInBootImage(t, err, transform)
 	})
@@ -5522,14 +5642,14 @@
 	t.Run("updatable jar from some other apex in the framework boot image => error", func(t *testing.T) {
 		err = "module 'some-updatable-apex-lib' from updatable apex 'some-updatable-apex' is not allowed in the framework boot image"
 		transform = func(config *dexpreopt.GlobalConfig) {
-			config.BootJars = []string{"some-updatable-apex:some-updatable-apex-lib"}
+			config.BootJars = android.CreateConfiguredJarList(ctx, []string{"some-updatable-apex:some-updatable-apex-lib"})
 		}
 		testNoUpdatableJarsInBootImage(t, err, transform)
 	})
 
 	t.Run("non-updatable jar from some other apex in the framework boot image => ok", func(t *testing.T) {
 		transform = func(config *dexpreopt.GlobalConfig) {
-			config.BootJars = []string{"some-non-updatable-apex:some-non-updatable-apex-lib"}
+			config.BootJars = android.CreateConfiguredJarList(ctx, []string{"some-non-updatable-apex:some-non-updatable-apex-lib"})
 		}
 		testNoUpdatableJarsInBootImage(t, "", transform)
 	})
@@ -5537,7 +5657,7 @@
 	t.Run("nonexistent jar in the ART boot image => error", func(t *testing.T) {
 		err = "failed to find a dex jar path for module 'nonexistent'"
 		transform = func(config *dexpreopt.GlobalConfig) {
-			config.ArtApexJars = []string{"platform:nonexistent"}
+			config.ArtApexJars = android.CreateConfiguredJarList(ctx, []string{"platform:nonexistent"})
 		}
 		testNoUpdatableJarsInBootImage(t, err, transform)
 	})
@@ -5545,7 +5665,7 @@
 	t.Run("nonexistent jar in the framework boot image => error", func(t *testing.T) {
 		err = "failed to find a dex jar path for module 'nonexistent'"
 		transform = func(config *dexpreopt.GlobalConfig) {
-			config.BootJars = []string{"platform:nonexistent"}
+			config.BootJars = android.CreateConfiguredJarList(ctx, []string{"platform:nonexistent"})
 		}
 		testNoUpdatableJarsInBootImage(t, err, transform)
 	})
@@ -5553,14 +5673,14 @@
 	t.Run("platform jar in the ART boot image => error", func(t *testing.T) {
 		err = "module 'some-platform-lib' is not allowed in the ART boot image"
 		transform = func(config *dexpreopt.GlobalConfig) {
-			config.ArtApexJars = []string{"platform:some-platform-lib"}
+			config.ArtApexJars = android.CreateConfiguredJarList(ctx, []string{"platform:some-platform-lib"})
 		}
 		testNoUpdatableJarsInBootImage(t, err, transform)
 	})
 
 	t.Run("platform jar in the framework boot image => ok", func(t *testing.T) {
 		transform = func(config *dexpreopt.GlobalConfig) {
-			config.BootJars = []string{"platform:some-platform-lib"}
+			config.BootJars = android.CreateConfiguredJarList(ctx, []string{"platform:some-platform-lib"})
 		}
 		testNoUpdatableJarsInBootImage(t, "", transform)
 	})
diff --git a/apex/builder.go b/apex/builder.go
index 5fb9a5f..0a1ec3e 100644
--- a/apex/builder.go
+++ b/apex/builder.go
@@ -390,7 +390,7 @@
 		} else {
 			if fi.class == appSet {
 				copyCommands = append(copyCommands,
-					fmt.Sprintf("unzip -q -d %s %s", destPathDir, fi.builtFile.String()))
+					fmt.Sprintf("unzip -qDD -d %s %s", destPathDir, fi.builtFile.String()))
 			} else {
 				copyCommands = append(copyCommands, "cp -f "+fi.builtFile.String()+" "+destPath)
 			}
@@ -403,16 +403,16 @@
 		}
 		for _, d := range fi.dataPaths {
 			// TODO(eakammer): This is now the third repetition of ~this logic for test paths, refactoring should be possible
-			relPath := d.Rel()
-			dataPath := d.String()
+			relPath := d.SrcPath.Rel()
+			dataPath := d.SrcPath.String()
 			if !strings.HasSuffix(dataPath, relPath) {
 				panic(fmt.Errorf("path %q does not end with %q", dataPath, relPath))
 			}
 
-			dataDest := android.PathForModuleOut(ctx, "image"+suffix, fi.apexRelativePath(relPath)).String()
+			dataDest := android.PathForModuleOut(ctx, "image"+suffix, fi.apexRelativePath(relPath), d.RelativeInstallPath).String()
 
-			copyCommands = append(copyCommands, "cp -f "+d.String()+" "+dataDest)
-			implicitInputs = append(implicitInputs, d)
+			copyCommands = append(copyCommands, "cp -f "+d.SrcPath.String()+" "+dataDest)
+			implicitInputs = append(implicitInputs, d.SrcPath)
 		}
 	}
 
@@ -473,7 +473,7 @@
 			if f.installDir == "bin" || strings.HasPrefix(f.installDir, "bin/") {
 				executablePaths = append(executablePaths, pathInApex)
 				for _, d := range f.dataPaths {
-					readOnlyPaths = append(readOnlyPaths, filepath.Join(f.installDir, d.Rel()))
+					readOnlyPaths = append(readOnlyPaths, filepath.Join(f.installDir, d.RelativeInstallPath, d.SrcPath.Rel()))
 				}
 				for _, s := range f.symlinks {
 					executablePaths = append(executablePaths, filepath.Join(f.installDir, s))
@@ -815,3 +815,12 @@
 		},
 	})
 }
+
+func (a *apexBundle) buildLintReports(ctx android.ModuleContext) {
+	depSetsBuilder := java.NewLintDepSetBuilder()
+	for _, fi := range a.filesInfo {
+		depSetsBuilder.Transitive(fi.lintDepSets)
+	}
+
+	a.lintReports = java.BuildModuleLintReportZips(ctx, depSetsBuilder.Build())
+}
diff --git a/apex/prebuilt.go b/apex/prebuilt.go
index bf574dc..d459f87 100644
--- a/apex/prebuilt.go
+++ b/apex/prebuilt.go
@@ -21,6 +21,7 @@
 
 	"android/soong/android"
 	"android/soong/java"
+
 	"github.com/google/blueprint"
 
 	"github.com/google/blueprint/proptools"
@@ -39,9 +40,55 @@
 		"abis", "allow-prereleased", "sdk-version")
 )
 
+type prebuilt interface {
+	isForceDisabled() bool
+	InstallFilename() string
+}
+
+type prebuiltCommon struct {
+	prebuilt   android.Prebuilt
+	properties prebuiltCommonProperties
+}
+
+type prebuiltCommonProperties struct {
+	ForceDisable bool `blueprint:"mutated"`
+}
+
+func (p *prebuiltCommon) Prebuilt() *android.Prebuilt {
+	return &p.prebuilt
+}
+
+func (p *prebuiltCommon) isForceDisabled() bool {
+	return p.properties.ForceDisable
+}
+
+func (p *prebuiltCommon) checkForceDisable(ctx android.ModuleContext) bool {
+	// If the device is configured to use flattened APEX, force disable the prebuilt because
+	// the prebuilt is a non-flattened one.
+	forceDisable := ctx.Config().FlattenApex()
+
+	// Force disable the prebuilts when we are doing unbundled build. We do unbundled build
+	// to build the prebuilts themselves.
+	forceDisable = forceDisable || ctx.Config().UnbundledBuild()
+
+	// Force disable the prebuilts when coverage is enabled.
+	forceDisable = forceDisable || ctx.DeviceConfig().NativeCoverageEnabled()
+	forceDisable = forceDisable || ctx.Config().IsEnvTrue("EMMA_INSTRUMENT")
+
+	// b/137216042 don't use prebuilts when address sanitizer is on
+	forceDisable = forceDisable || android.InList("address", ctx.Config().SanitizeDevice()) ||
+		android.InList("hwaddress", ctx.Config().SanitizeDevice())
+
+	if forceDisable && p.prebuilt.SourceExists() {
+		p.properties.ForceDisable = true
+		return true
+	}
+	return false
+}
+
 type Prebuilt struct {
 	android.ModuleBase
-	prebuilt android.Prebuilt
+	prebuiltCommon
 
 	properties PrebuiltProperties
 
@@ -57,8 +104,7 @@
 
 type PrebuiltProperties struct {
 	// the path to the prebuilt .apex file to import.
-	Source       string `blueprint:"mutated"`
-	ForceDisable bool   `blueprint:"mutated"`
+	Source string `blueprint:"mutated"`
 
 	Src  *string
 	Arch struct {
@@ -93,10 +139,6 @@
 	return p.properties.Installable == nil || proptools.Bool(p.properties.Installable)
 }
 
-func (p *Prebuilt) isForceDisabled() bool {
-	return p.properties.ForceDisable
-}
-
 func (p *Prebuilt) OutputFiles(tag string) (android.Paths, error) {
 	switch tag {
 	case "":
@@ -110,12 +152,8 @@
 	return proptools.StringDefault(p.properties.Filename, p.BaseModuleName()+imageApexSuffix)
 }
 
-func (p *Prebuilt) Prebuilt() *android.Prebuilt {
-	return &p.prebuilt
-}
-
 func (p *Prebuilt) Name() string {
-	return p.prebuilt.Name(p.ModuleBase.Name())
+	return p.prebuiltCommon.prebuilt.Name(p.ModuleBase.Name())
 }
 
 // prebuilt_apex imports an `.apex` file into the build graph as if it was built with apex.
@@ -128,27 +166,6 @@
 }
 
 func (p *Prebuilt) DepsMutator(ctx android.BottomUpMutatorContext) {
-	// If the device is configured to use flattened APEX, force disable the prebuilt because
-	// the prebuilt is a non-flattened one.
-	forceDisable := ctx.Config().FlattenApex()
-
-	// Force disable the prebuilts when we are doing unbundled build. We do unbundled build
-	// to build the prebuilts themselves.
-	forceDisable = forceDisable || ctx.Config().UnbundledBuild()
-
-	// Force disable the prebuilts when coverage is enabled.
-	forceDisable = forceDisable || ctx.DeviceConfig().NativeCoverageEnabled()
-	forceDisable = forceDisable || ctx.Config().IsEnvTrue("EMMA_INSTRUMENT")
-
-	// b/137216042 don't use prebuilts when address sanitizer is on
-	forceDisable = forceDisable || android.InList("address", ctx.Config().SanitizeDevice()) ||
-		android.InList("hwaddress", ctx.Config().SanitizeDevice())
-
-	if forceDisable && p.prebuilt.SourceExists() {
-		p.properties.ForceDisable = true
-		return
-	}
-
 	// This is called before prebuilt_select and prebuilt_postdeps mutators
 	// The mutators requires that src to be set correctly for each arch so that
 	// arch variants are disabled when src is not provided for the arch.
@@ -177,10 +194,6 @@
 }
 
 func (p *Prebuilt) GenerateAndroidBuildActions(ctx android.ModuleContext) {
-	if p.properties.ForceDisable {
-		return
-	}
-
 	// TODO(jungjw): Check the key validity.
 	p.inputApex = p.Prebuilt().SingleSourcePath(ctx)
 	p.installDir = android.PathForModuleInstall(ctx, "apex")
@@ -194,6 +207,12 @@
 		Input:  p.inputApex,
 		Output: p.outputApex,
 	})
+
+	if p.prebuiltCommon.checkForceDisable(ctx) {
+		p.SkipInstall()
+		return
+	}
+
 	if p.installable() {
 		ctx.InstallFile(p.installDir, p.installFilename, p.inputApex)
 	}
@@ -227,7 +246,7 @@
 
 type ApexSet struct {
 	android.ModuleBase
-	prebuilt android.Prebuilt
+	prebuiltCommon
 
 	properties ApexSetProperties
 
@@ -270,12 +289,8 @@
 	return proptools.StringDefault(a.properties.Filename, a.BaseModuleName()+imageApexSuffix)
 }
 
-func (a *ApexSet) Prebuilt() *android.Prebuilt {
-	return &a.prebuilt
-}
-
 func (a *ApexSet) Name() string {
-	return a.prebuilt.Name(a.ModuleBase.Name())
+	return a.prebuiltCommon.prebuilt.Name(a.ModuleBase.Name())
 }
 
 func (a *ApexSet) Overrides() []string {
@@ -297,7 +312,7 @@
 		ctx.ModuleErrorf("filename should end in %s for apex_set", imageApexSuffix)
 	}
 
-	apexSet := a.prebuilt.SingleSourcePath(ctx)
+	apexSet := a.prebuiltCommon.prebuilt.SingleSourcePath(ctx)
 	a.outputApex = android.PathForModuleOut(ctx, a.installFilename)
 	ctx.Build(pctx,
 		android.BuildParams{
@@ -311,6 +326,12 @@
 				"sdk-version":       ctx.Config().PlatformSdkVersion(),
 			},
 		})
+
+	if a.prebuiltCommon.checkForceDisable(ctx) {
+		a.SkipInstall()
+		return
+	}
+
 	a.installDir = android.PathForModuleInstall(ctx, "apex")
 	if a.installable() {
 		ctx.InstallFile(a.installDir, a.installFilename, a.outputApex)
diff --git a/cc/Android.bp b/cc/Android.bp
index 9ece05f..831911e 100644
--- a/cc/Android.bp
+++ b/cc/Android.bp
@@ -19,6 +19,7 @@
         "check.go",
         "coverage.go",
         "gen.go",
+        "image.go",
         "linkable.go",
         "lto.go",
         "makevars.go",
diff --git a/cc/androidmk.go b/cc/androidmk.go
index 3f812c2..e91b40a 100644
--- a/cc/androidmk.go
+++ b/cc/androidmk.go
@@ -149,21 +149,25 @@
 	return []android.AndroidMkEntries{entries}
 }
 
-func AndroidMkDataPaths(data android.Paths) []string {
+func AndroidMkDataPaths(data []android.DataPath) []string {
 	var testFiles []string
 	for _, d := range data {
-		rel := d.Rel()
-		path := d.String()
+		rel := d.SrcPath.Rel()
+		path := d.SrcPath.String()
 		if !strings.HasSuffix(path, rel) {
 			panic(fmt.Errorf("path %q does not end with %q", path, rel))
 		}
 		path = strings.TrimSuffix(path, rel)
-		testFiles = append(testFiles, path+":"+rel)
+		testFileString := path + ":" + rel
+		if len(d.RelativeInstallPath) > 0 {
+			testFileString += ":" + d.RelativeInstallPath
+		}
+		testFiles = append(testFiles, testFileString)
 	}
 	return testFiles
 }
 
-func androidMkWriteTestData(data android.Paths, ctx AndroidMkContext, entries *android.AndroidMkEntries) {
+func androidMkWriteTestData(data []android.DataPath, ctx AndroidMkContext, entries *android.AndroidMkEntries) {
 	testFiles := AndroidMkDataPaths(data)
 	if len(testFiles) > 0 {
 		entries.ExtraEntries = append(entries.ExtraEntries, func(entries *android.AndroidMkEntries) {
@@ -357,8 +361,11 @@
 			entries.SetBool("LOCAL_DISABLE_AUTO_GENERATE_TEST_CONFIG", true)
 		}
 	})
-
-	androidMkWriteTestData(benchmark.data, ctx, entries)
+	dataPaths := []android.DataPath{}
+	for _, srcPath := range benchmark.data {
+		dataPaths = append(dataPaths, android.DataPath{SrcPath: srcPath})
+	}
+	androidMkWriteTestData(dataPaths, ctx, entries)
 }
 
 func (test *testBinary) AndroidMkEntries(ctx AndroidMkContext, entries *android.AndroidMkEntries) {
diff --git a/cc/binary_sdk_member.go b/cc/binary_sdk_member.go
index 372a72e..337de55 100644
--- a/cc/binary_sdk_member.go
+++ b/cc/binary_sdk_member.go
@@ -29,7 +29,8 @@
 
 var ccBinarySdkMemberType = &binarySdkMemberType{
 	SdkMemberTypeBase: android.SdkMemberTypeBase{
-		PropertyName: "native_binaries",
+		PropertyName:    "native_binaries",
+		HostOsDependent: true,
 	},
 }
 
@@ -140,10 +141,6 @@
 }
 
 func (p *nativeBinaryInfoProperties) AddToPropertySet(ctx android.SdkMemberContext, propertySet android.BpPropertySet) {
-	if p.Compile_multilib != "" {
-		propertySet.AddProperty("compile_multilib", p.Compile_multilib)
-	}
-
 	builder := ctx.SnapshotBuilder()
 	if p.outputFile != nil {
 		propertySet.AddProperty("srcs", []string{nativeBinaryPathFor(*p)})
diff --git a/cc/cc.go b/cc/cc.go
index 0d5b6bd..4b36218 100644
--- a/cc/cc.go
+++ b/cc/cc.go
@@ -425,44 +425,130 @@
 	XrefCcFiles() android.Paths
 }
 
+type libraryDependencyKind int
+
+const (
+	headerLibraryDependency = iota
+	sharedLibraryDependency
+	staticLibraryDependency
+)
+
+func (k libraryDependencyKind) String() string {
+	switch k {
+	case headerLibraryDependency:
+		return "headerLibraryDependency"
+	case sharedLibraryDependency:
+		return "sharedLibraryDependency"
+	case staticLibraryDependency:
+		return "staticLibraryDependency"
+	default:
+		panic(fmt.Errorf("unknown libraryDependencyKind %d", k))
+	}
+}
+
+type libraryDependencyOrder int
+
+const (
+	earlyLibraryDependency  = -1
+	normalLibraryDependency = 0
+	lateLibraryDependency   = 1
+)
+
+func (o libraryDependencyOrder) String() string {
+	switch o {
+	case earlyLibraryDependency:
+		return "earlyLibraryDependency"
+	case normalLibraryDependency:
+		return "normalLibraryDependency"
+	case lateLibraryDependency:
+		return "lateLibraryDependency"
+	default:
+		panic(fmt.Errorf("unknown libraryDependencyOrder %d", o))
+	}
+}
+
+// libraryDependencyTag is used to tag dependencies on libraries.  Unlike many dependency
+// tags that have a set of predefined tag objects that are reused for each dependency, a
+// libraryDependencyTag is designed to contain extra metadata and is constructed as needed.
+// That means that comparing a libraryDependencyTag for equality will only be equal if all
+// of the metadata is equal.  Most usages will want to type assert to libraryDependencyTag and
+// then check individual metadata fields instead.
+type libraryDependencyTag struct {
+	blueprint.BaseDependencyTag
+
+	// These are exported so that fmt.Printf("%#v") can call their String methods.
+	Kind  libraryDependencyKind
+	Order libraryDependencyOrder
+
+	wholeStatic bool
+
+	reexportFlags       bool
+	explicitlyVersioned bool
+	dataLib             bool
+	ndk                 bool
+
+	staticUnwinder bool
+
+	makeSuffix string
+}
+
+// header returns true if the libraryDependencyTag is tagging a header lib dependency.
+func (d libraryDependencyTag) header() bool {
+	return d.Kind == headerLibraryDependency
+}
+
+// shared returns true if the libraryDependencyTag is tagging a shared lib dependency.
+func (d libraryDependencyTag) shared() bool {
+	return d.Kind == sharedLibraryDependency
+}
+
+// shared returns true if the libraryDependencyTag is tagging a static lib dependency.
+func (d libraryDependencyTag) static() bool {
+	return d.Kind == staticLibraryDependency
+}
+
+// dependencyTag is used for tagging miscellanous dependency types that don't fit into
+// libraryDependencyTag.  Each tag object is created globally and reused for multiple
+// dependencies (although since the object contains no references, assigning a tag to a
+// variable and modifying it will not modify the original).  Users can compare the tag
+// returned by ctx.OtherModuleDependencyTag against the global original
+type dependencyTag struct {
+	blueprint.BaseDependencyTag
+	name string
+}
+
 var (
-	dataLibDepTag         = DependencyTag{Name: "data_lib", Library: true, Shared: true}
-	sharedExportDepTag    = DependencyTag{Name: "shared", Library: true, Shared: true, ReexportFlags: true}
-	earlySharedDepTag     = DependencyTag{Name: "early_shared", Library: true, Shared: true}
-	lateSharedDepTag      = DependencyTag{Name: "late shared", Library: true, Shared: true}
-	staticExportDepTag    = DependencyTag{Name: "static", Library: true, ReexportFlags: true}
-	lateStaticDepTag      = DependencyTag{Name: "late static", Library: true}
-	staticUnwinderDepTag  = DependencyTag{Name: "static unwinder", Library: true}
-	wholeStaticDepTag     = DependencyTag{Name: "whole static", Library: true, ReexportFlags: true}
-	headerDepTag          = DependencyTag{Name: "header", Library: true}
-	headerExportDepTag    = DependencyTag{Name: "header", Library: true, ReexportFlags: true}
-	genSourceDepTag       = DependencyTag{Name: "gen source"}
-	genHeaderDepTag       = DependencyTag{Name: "gen header"}
-	genHeaderExportDepTag = DependencyTag{Name: "gen header", ReexportFlags: true}
-	objDepTag             = DependencyTag{Name: "obj"}
-	linkerFlagsDepTag     = DependencyTag{Name: "linker flags file"}
-	dynamicLinkerDepTag   = DependencyTag{Name: "dynamic linker"}
-	reuseObjTag           = DependencyTag{Name: "reuse objects"}
-	staticVariantTag      = DependencyTag{Name: "static variant"}
-	ndkStubDepTag         = DependencyTag{Name: "ndk stub", Library: true}
-	ndkLateStubDepTag     = DependencyTag{Name: "ndk late stub", Library: true}
-	vndkExtDepTag         = DependencyTag{Name: "vndk extends", Library: true}
-	runtimeDepTag         = DependencyTag{Name: "runtime lib"}
-	testPerSrcDepTag      = DependencyTag{Name: "test_per_src"}
+	genSourceDepTag       = dependencyTag{name: "gen source"}
+	genHeaderDepTag       = dependencyTag{name: "gen header"}
+	genHeaderExportDepTag = dependencyTag{name: "gen header export"}
+	objDepTag             = dependencyTag{name: "obj"}
+	linkerFlagsDepTag     = dependencyTag{name: "linker flags file"}
+	dynamicLinkerDepTag   = dependencyTag{name: "dynamic linker"}
+	reuseObjTag           = dependencyTag{name: "reuse objects"}
+	staticVariantTag      = dependencyTag{name: "static variant"}
+	vndkExtDepTag         = dependencyTag{name: "vndk extends"}
+	dataLibDepTag         = dependencyTag{name: "data lib"}
+	runtimeDepTag         = dependencyTag{name: "runtime lib"}
+	testPerSrcDepTag      = dependencyTag{name: "test_per_src"}
 )
 
 func IsSharedDepTag(depTag blueprint.DependencyTag) bool {
-	ccDepTag, ok := depTag.(DependencyTag)
-	return ok && ccDepTag.Shared
+	ccLibDepTag, ok := depTag.(libraryDependencyTag)
+	return ok && ccLibDepTag.shared()
+}
+
+func IsStaticDepTag(depTag blueprint.DependencyTag) bool {
+	ccLibDepTag, ok := depTag.(libraryDependencyTag)
+	return ok && ccLibDepTag.static()
 }
 
 func IsRuntimeDepTag(depTag blueprint.DependencyTag) bool {
-	ccDepTag, ok := depTag.(DependencyTag)
+	ccDepTag, ok := depTag.(dependencyTag)
 	return ok && ccDepTag == runtimeDepTag
 }
 
 func IsTestPerSrcDepTag(depTag blueprint.DependencyTag) bool {
-	ccDepTag, ok := depTag.(DependencyTag)
+	ccDepTag, ok := depTag.(dependencyTag)
 	return ok && ccDepTag == testPerSrcDepTag
 }
 
@@ -941,48 +1027,6 @@
 	return ""
 }
 
-// Returns true only when this module is configured to have core, product and vendor
-// variants.
-func (c *Module) HasVendorVariant() bool {
-	return c.IsVndk() || Bool(c.VendorProperties.Vendor_available)
-}
-
-const (
-	// VendorVariationPrefix is the variant prefix used for /vendor code that compiles
-	// against the VNDK.
-	VendorVariationPrefix = "vendor."
-
-	// ProductVariationPrefix is the variant prefix used for /product code that compiles
-	// against the VNDK.
-	ProductVariationPrefix = "product."
-)
-
-// Returns true if the module is "product" variant. Usually these modules are installed in /product
-func (c *Module) inProduct() bool {
-	return c.Properties.ImageVariationPrefix == ProductVariationPrefix
-}
-
-// Returns true if the module is "vendor" variant. Usually these modules are installed in /vendor
-func (c *Module) inVendor() bool {
-	return c.Properties.ImageVariationPrefix == VendorVariationPrefix
-}
-
-func (c *Module) InRamdisk() bool {
-	return c.ModuleBase.InRamdisk() || c.ModuleBase.InstallInRamdisk()
-}
-
-func (c *Module) InRecovery() bool {
-	return c.ModuleBase.InRecovery() || c.ModuleBase.InstallInRecovery()
-}
-
-func (c *Module) OnlyInRamdisk() bool {
-	return c.ModuleBase.InstallInRamdisk()
-}
-
-func (c *Module) OnlyInRecovery() bool {
-	return c.ModuleBase.InstallInRecovery()
-}
-
 func (c *Module) IsStubs() bool {
 	if library, ok := c.linker.(*libraryDecorator); ok {
 		return library.buildStubs()
@@ -1090,16 +1134,6 @@
 	moduleContextImpl
 }
 
-func (ctx *moduleContext) ProductSpecific() bool {
-	return ctx.ModuleContext.ProductSpecific() ||
-		(ctx.mod.HasVendorVariant() && ctx.mod.inProduct() && !ctx.mod.IsVndk())
-}
-
-func (ctx *moduleContext) SocSpecific() bool {
-	return ctx.ModuleContext.SocSpecific() ||
-		(ctx.mod.HasVendorVariant() && ctx.mod.inVendor() && !ctx.mod.IsVndk())
-}
-
 type moduleContextImpl struct {
 	mod *Module
 	ctx BaseModuleContext
@@ -1195,22 +1229,6 @@
 	return ctx.mod.MustUseVendorVariant()
 }
 
-func (ctx *moduleContextImpl) inProduct() bool {
-	return ctx.mod.inProduct()
-}
-
-func (ctx *moduleContextImpl) inVendor() bool {
-	return ctx.mod.inVendor()
-}
-
-func (ctx *moduleContextImpl) inRamdisk() bool {
-	return ctx.mod.InRamdisk()
-}
-
-func (ctx *moduleContextImpl) inRecovery() bool {
-	return ctx.mod.InRecovery()
-}
-
 // Check whether ABI dumps should be created for this module.
 func (ctx *moduleContextImpl) shouldCreateSourceAbiDump() bool {
 	if ctx.ctx.Config().IsEnvTrue("SKIP_ABI_CHECKS") {
@@ -1401,9 +1419,9 @@
 	return ok && test.isAllTestsVariation()
 }
 
-func (c *Module) DataPaths() android.Paths {
+func (c *Module) DataPaths() []android.DataPath {
 	if p, ok := c.installer.(interface {
-		dataPaths() android.Paths
+		dataPaths() []android.DataPath
 	}); ok {
 		return p.dataPaths()
 	}
@@ -1859,9 +1877,9 @@
 
 	vendorSnapshotHeaderLibs := vendorSnapshotHeaderLibs(actx.Config())
 	for _, lib := range deps.HeaderLibs {
-		depTag := headerDepTag
+		depTag := libraryDependencyTag{Kind: headerLibraryDependency}
 		if inList(lib, deps.ReexportHeaderLibHeaders) {
-			depTag = headerExportDepTag
+			depTag.reexportFlags = true
 		}
 
 		lib = rewriteSnapshotLibs(lib, vendorSnapshotHeaderLibs)
@@ -1884,7 +1902,7 @@
 	vendorSnapshotStaticLibs := vendorSnapshotStaticLibs(actx.Config())
 
 	for _, lib := range deps.WholeStaticLibs {
-		depTag := wholeStaticDepTag
+		depTag := libraryDependencyTag{Kind: staticLibraryDependency, wholeStatic: true, reexportFlags: true}
 		if impl, ok := syspropImplLibraries[lib]; ok {
 			lib = impl
 		}
@@ -1897,9 +1915,9 @@
 	}
 
 	for _, lib := range deps.StaticLibs {
-		depTag := StaticDepTag
+		depTag := libraryDependencyTag{Kind: staticLibraryDependency}
 		if inList(lib, deps.ReexportStaticLibHeaders) {
-			depTag = staticExportDepTag
+			depTag.reexportFlags = true
 		}
 
 		if impl, ok := syspropImplLibraries[lib]; ok {
@@ -1917,24 +1935,26 @@
 	// so that native libraries/binaries are linked with static unwinder
 	// because Q libc doesn't have unwinder APIs
 	if deps.StaticUnwinderIfLegacy {
+		depTag := libraryDependencyTag{Kind: staticLibraryDependency, staticUnwinder: true}
 		actx.AddVariationDependencies([]blueprint.Variation{
 			{Mutator: "link", Variation: "static"},
-		}, staticUnwinderDepTag, rewriteSnapshotLibs(staticUnwinder(actx), vendorSnapshotStaticLibs))
+		}, depTag, rewriteSnapshotLibs(staticUnwinder(actx), vendorSnapshotStaticLibs))
 	}
 
 	for _, lib := range deps.LateStaticLibs {
+		depTag := libraryDependencyTag{Kind: staticLibraryDependency, Order: lateLibraryDependency}
 		actx.AddVariationDependencies([]blueprint.Variation{
 			{Mutator: "link", Variation: "static"},
-		}, lateStaticDepTag, rewriteSnapshotLibs(lib, vendorSnapshotStaticLibs))
+		}, depTag, rewriteSnapshotLibs(lib, vendorSnapshotStaticLibs))
 	}
 
-	addSharedLibDependencies := func(depTag DependencyTag, name string, version string) {
+	addSharedLibDependencies := func(depTag libraryDependencyTag, name string, version string) {
 		var variations []blueprint.Variation
 		variations = append(variations, blueprint.Variation{Mutator: "link", Variation: "shared"})
 		if version != "" && VersionVariantAvailable(c) {
 			// Version is explicitly specified. i.e. libFoo#30
 			variations = append(variations, blueprint.Variation{Mutator: "version", Variation: version})
-			depTag.ExplicitlyVersioned = true
+			depTag.explicitlyVersioned = true
 		}
 		actx.AddVariationDependencies(variations, depTag, name)
 
@@ -1956,12 +1976,9 @@
 	var sharedLibNames []string
 
 	for _, lib := range deps.SharedLibs {
-		depTag := SharedDepTag
-		if c.static() {
-			depTag = SharedFromStaticDepTag
-		}
+		depTag := libraryDependencyTag{Kind: sharedLibraryDependency}
 		if inList(lib, deps.ReexportSharedLibHeaders) {
-			depTag = sharedExportDepTag
+			depTag.reexportFlags = true
 		}
 
 		if impl, ok := syspropImplLibraries[lib]; ok {
@@ -1981,7 +1998,8 @@
 			// linking against both the stubs lib and the non-stubs lib at the same time.
 			continue
 		}
-		addSharedLibDependencies(lateSharedDepTag, lib, "")
+		depTag := libraryDependencyTag{Kind: sharedLibraryDependency, Order: lateLibraryDependency}
+		addSharedLibDependencies(depTag, lib, "")
 	}
 
 	actx.AddVariationDependencies([]blueprint.Variation{
@@ -2020,10 +2038,14 @@
 	}
 
 	version := ctx.sdkVersion()
+
+	ndkStubDepTag := libraryDependencyTag{Kind: sharedLibraryDependency, ndk: true, makeSuffix: "." + version}
 	actx.AddVariationDependencies([]blueprint.Variation{
 		{Mutator: "ndk_api", Variation: version},
 		{Mutator: "link", Variation: "shared"},
 	}, ndkStubDepTag, variantNdkLibs...)
+
+	ndkLateStubDepTag := libraryDependencyTag{Kind: sharedLibraryDependency, Order: lateLibraryDependency, ndk: true, makeSuffix: "." + version}
 	actx.AddVariationDependencies([]blueprint.Variation{
 		{Mutator: "ndk_api", Variation: version},
 		{Mutator: "link", Variation: "shared"},
@@ -2047,7 +2069,19 @@
 
 // Whether a module can link to another module, taking into
 // account NDK linking.
-func checkLinkType(ctx android.ModuleContext, from LinkableInterface, to LinkableInterface, tag DependencyTag) {
+func checkLinkType(ctx android.ModuleContext, from LinkableInterface, to LinkableInterface,
+	tag blueprint.DependencyTag) {
+
+	switch t := tag.(type) {
+	case dependencyTag:
+		if t != vndkExtDepTag {
+			return
+		}
+	case libraryDependencyTag:
+	default:
+		return
+	}
+
 	if from.Module().Target().Os != android.Android {
 		// Host code is not restricted
 		return
@@ -2205,8 +2239,6 @@
 	directStaticDeps := []LinkableInterface{}
 	directSharedDeps := []LinkableInterface{}
 
-	vendorPublicLibraries := vendorPublicLibraries(ctx.Config())
-
 	reexportExporter := func(exporter exportedFlagsProducer) {
 		depPaths.ReexportedDirs = append(depPaths.ReexportedDirs, exporter.exportedDirs()...)
 		depPaths.ReexportedSystemDirs = append(depPaths.ReexportedSystemDirs, exporter.exportedSystemDirs()...)
@@ -2215,6 +2247,19 @@
 		depPaths.ReexportedGeneratedHeaders = append(depPaths.ReexportedGeneratedHeaders, exporter.exportedGeneratedHeaders()...)
 	}
 
+	// For the dependency from platform to apex, use the latest stubs
+	c.apexSdkVersion = android.FutureApiLevel
+	if !c.IsForPlatform() {
+		c.apexSdkVersion = c.ApexProperties.Info.MinSdkVersion
+	}
+
+	if android.InList("hwaddress", ctx.Config().SanitizeDevice()) {
+		// In hwasan build, we override apexSdkVersion to the FutureApiLevel(10000)
+		// so that even Q(29/Android10) apexes could use the dynamic unwinder by linking the newer stubs(e.g libc(R+)).
+		// (b/144430859)
+		c.apexSdkVersion = android.FutureApiLevel
+	}
+
 	ctx.VisitDirectDeps(func(dep android.Module) {
 		depName := ctx.OtherModuleName(dep)
 		depTag := ctx.OtherModuleDependencyTag(dep)
@@ -2303,52 +2348,24 @@
 			}
 		}
 
-		// For the dependency from platform to apex, use the latest stubs
-		c.apexSdkVersion = android.FutureApiLevel
-		if !c.IsForPlatform() {
-			c.apexSdkVersion = c.ApexProperties.Info.MinSdkVersion
-		}
+		checkLinkType(ctx, c, ccDep, depTag)
 
-		if android.InList("hwaddress", ctx.Config().SanitizeDevice()) {
-			// In hwasan build, we override apexSdkVersion to the FutureApiLevel(10000)
-			// so that even Q(29/Android10) apexes could use the dynamic unwinder by linking the newer stubs(e.g libc(R+)).
-			// (b/144430859)
-			c.apexSdkVersion = android.FutureApiLevel
-		}
+		linkFile := ccDep.OutputFile()
 
-		if depTag == staticUnwinderDepTag {
-			// Use static unwinder for legacy (min_sdk_version = 29) apexes (b/144430859)
-			if c.apexSdkVersion <= android.SdkVersion_Android10 {
-				depTag = StaticDepTag
-			} else {
+		if libDepTag, ok := depTag.(libraryDependencyTag); ok {
+			// Only use static unwinder for legacy (min_sdk_version = 29) apexes (b/144430859)
+			if libDepTag.staticUnwinder && c.apexSdkVersion > android.SdkVersion_Android10 {
 				return
 			}
-		}
 
-		// Extract ExplicitlyVersioned field from the depTag and reset it inside the struct.
-		// Otherwise, SharedDepTag and lateSharedDepTag with ExplicitlyVersioned set to true
-		// won't be matched to SharedDepTag and lateSharedDepTag.
-		explicitlyVersioned := false
-		if t, ok := depTag.(DependencyTag); ok {
-			explicitlyVersioned = t.ExplicitlyVersioned
-			t.ExplicitlyVersioned = false
-			depTag = t
-		}
-
-		if t, ok := depTag.(DependencyTag); ok && t.Library {
-			depIsStatic := false
-			switch depTag {
-			case StaticDepTag, staticExportDepTag, lateStaticDepTag, wholeStaticDepTag:
-				depIsStatic = true
-			}
-			if ccDep.CcLibrary() && !depIsStatic {
+			if ccDep.CcLibrary() && !libDepTag.static() {
 				depIsStubs := ccDep.BuildStubs()
 				depHasStubs := VersionVariantAvailable(c) && ccDep.HasStubsVariants()
 				depInSameApex := android.DirectlyInApex(c.ApexName(), depName)
 				depInPlatform := !android.DirectlyInAnyApex(ctx, depName)
 
 				var useThisDep bool
-				if depIsStubs && explicitlyVersioned {
+				if depIsStubs && libDepTag.explicitlyVersioned {
 					// Always respect dependency to the versioned stubs (i.e. libX#10)
 					useThisDep = true
 				} else if !depHasStubs {
@@ -2380,7 +2397,7 @@
 				}
 
 				// when to use (unspecified) stubs, check min_sdk_version and choose the right one
-				if useThisDep && depIsStubs && !explicitlyVersioned {
+				if useThisDep && depIsStubs && !libDepTag.explicitlyVersioned {
 					versionToUse, err := c.ChooseSdkVersion(ccDep.StubsVersions(), c.apexSdkVersion)
 					if err != nil {
 						ctx.OtherModuleErrorf(dep, err.Error())
@@ -2425,7 +2442,7 @@
 					depPaths.GeneratedDeps = append(depPaths.GeneratedDeps, i.exportedDeps()...)
 					depPaths.Flags = append(depPaths.Flags, i.exportedFlags()...)
 
-					if t.ReexportFlags {
+					if libDepTag.reexportFlags {
 						reexportExporter(i)
 						// Add these re-exported flags to help header-abi-dumper to infer the abi exported by a library.
 						// Re-exported shared library headers must be included as well since they can help us with type information
@@ -2437,210 +2454,178 @@
 					}
 				}
 			}
-			checkLinkType(ctx, c, ccDep, t)
-		}
 
-		var ptr *android.Paths
-		var depPtr *android.Paths
+			var ptr *android.Paths
+			var depPtr *android.Paths
 
-		linkFile := ccDep.OutputFile()
-		depFile := android.OptionalPath{}
+			depFile := android.OptionalPath{}
 
-		switch depTag {
-		case ndkStubDepTag, SharedDepTag, SharedFromStaticDepTag, sharedExportDepTag:
-			ptr = &depPaths.SharedLibs
-			depPtr = &depPaths.SharedLibsDeps
-			depFile = ccDep.Toc()
-			directSharedDeps = append(directSharedDeps, ccDep)
-
-		case earlySharedDepTag:
-			ptr = &depPaths.EarlySharedLibs
-			depPtr = &depPaths.EarlySharedLibsDeps
-			depFile = ccDep.Toc()
-			directSharedDeps = append(directSharedDeps, ccDep)
-		case lateSharedDepTag, ndkLateStubDepTag:
-			ptr = &depPaths.LateSharedLibs
-			depPtr = &depPaths.LateSharedLibsDeps
-			depFile = ccDep.Toc()
-		case StaticDepTag, staticExportDepTag:
-			ptr = nil
-			directStaticDeps = append(directStaticDeps, ccDep)
-		case lateStaticDepTag:
-			ptr = &depPaths.LateStaticLibs
-		case wholeStaticDepTag:
-			ptr = &depPaths.WholeStaticLibs
-			if !ccDep.CcLibraryInterface() || !ccDep.Static() {
-				ctx.ModuleErrorf("module %q not a static library", depName)
-				return
-			}
-
-			// Because the static library objects are included, this only makes sense
-			// in the context of proper cc.Modules.
-			if ccWholeStaticLib, ok := ccDep.(*Module); ok {
-				staticLib := ccWholeStaticLib.linker.(libraryInterface)
-				if missingDeps := staticLib.getWholeStaticMissingDeps(); missingDeps != nil {
-					postfix := " (required by " + ctx.OtherModuleName(dep) + ")"
-					for i := range missingDeps {
-						missingDeps[i] += postfix
-					}
-					ctx.AddMissingDependencies(missingDeps)
+			switch {
+			case libDepTag.header():
+				// nothing
+			case libDepTag.shared():
+				ptr = &depPaths.SharedLibs
+				switch libDepTag.Order {
+				case earlyLibraryDependency:
+					ptr = &depPaths.EarlySharedLibs
+					depPtr = &depPaths.EarlySharedLibsDeps
+				case normalLibraryDependency:
+					ptr = &depPaths.SharedLibs
+					depPtr = &depPaths.SharedLibsDeps
+					directSharedDeps = append(directSharedDeps, ccDep)
+				case lateLibraryDependency:
+					ptr = &depPaths.LateSharedLibs
+					depPtr = &depPaths.LateSharedLibsDeps
+				default:
+					panic(fmt.Errorf("unexpected library dependency order %d", libDepTag.Order))
 				}
-				if _, ok := ccWholeStaticLib.linker.(prebuiltLinkerInterface); ok {
-					depPaths.WholeStaticLibsFromPrebuilts = append(depPaths.WholeStaticLibsFromPrebuilts, linkFile.Path())
-				} else {
-					depPaths.WholeStaticLibObjs = depPaths.WholeStaticLibObjs.Append(staticLib.objs())
-				}
-			} else {
-				ctx.ModuleErrorf(
-					"non-cc.Modules cannot be included as whole static libraries.", depName)
-				return
-			}
-		case headerDepTag:
-			// Nothing
-		case objDepTag:
-			depPaths.Objs.objFiles = append(depPaths.Objs.objFiles, linkFile.Path())
-		case CrtBeginDepTag:
-			depPaths.CrtBegin = linkFile
-		case CrtEndDepTag:
-			depPaths.CrtEnd = linkFile
-		case dynamicLinkerDepTag:
-			depPaths.DynamicLinker = linkFile
-		}
-
-		switch depTag {
-		case StaticDepTag, staticExportDepTag, lateStaticDepTag:
-			if !ccDep.CcLibraryInterface() || !ccDep.Static() {
-				ctx.ModuleErrorf("module %q not a static library", depName)
-				return
-			}
-
-			// When combining coverage files for shared libraries and executables, coverage files
-			// in static libraries act as if they were whole static libraries. The same goes for
-			// source based Abi dump files.
-			if c, ok := ccDep.(*Module); ok {
-				staticLib := c.linker.(libraryInterface)
-				depPaths.StaticLibObjs.coverageFiles = append(depPaths.StaticLibObjs.coverageFiles,
-					staticLib.objs().coverageFiles...)
-				depPaths.StaticLibObjs.sAbiDumpFiles = append(depPaths.StaticLibObjs.sAbiDumpFiles,
-					staticLib.objs().sAbiDumpFiles...)
-			} else if c, ok := ccDep.(LinkableInterface); ok {
-				// Handle non-CC modules here
-				depPaths.StaticLibObjs.coverageFiles = append(depPaths.StaticLibObjs.coverageFiles,
-					c.CoverageFiles()...)
-			}
-		}
-
-		if ptr != nil {
-			if !linkFile.Valid() {
-				if !ctx.Config().AllowMissingDependencies() {
-					ctx.ModuleErrorf("module %q missing output file", depName)
-				} else {
-					ctx.AddMissingDependencies([]string{depName})
-				}
-				return
-			}
-			*ptr = append(*ptr, linkFile.Path())
-		}
-
-		if depPtr != nil {
-			dep := depFile
-			if !dep.Valid() {
-				dep = linkFile
-			}
-			*depPtr = append(*depPtr, dep.Path())
-		}
-
-		vendorSuffixModules := vendorSuffixModules(ctx.Config())
-
-		baseLibName := func(depName string) string {
-			libName := strings.TrimSuffix(depName, llndkLibrarySuffix)
-			libName = strings.TrimSuffix(libName, vendorPublicLibrarySuffix)
-			libName = strings.TrimPrefix(libName, "prebuilt_")
-			return libName
-		}
-
-		makeLibName := func(depName string) string {
-			libName := baseLibName(depName)
-			isLLndk := isLlndkLibrary(libName, ctx.Config())
-			isVendorPublicLib := inList(libName, *vendorPublicLibraries)
-			bothVendorAndCoreVariantsExist := ccDep.HasVendorVariant() || isLLndk
-
-			if c, ok := ccDep.(*Module); ok {
-				// Use base module name for snapshots when exporting to Makefile.
-				if c.isSnapshotPrebuilt() {
-					baseName := c.BaseModuleName()
-
-					if c.IsVndk() {
-						return baseName + ".vendor"
+				depFile = ccDep.Toc()
+			case libDepTag.static():
+				if libDepTag.wholeStatic {
+					ptr = &depPaths.WholeStaticLibs
+					if !ccDep.CcLibraryInterface() || !ccDep.Static() {
+						ctx.ModuleErrorf("module %q not a static library", depName)
+						return
 					}
 
-					if vendorSuffixModules[baseName] {
-						return baseName + ".vendor"
+					// Because the static library objects are included, this only makes sense
+					// in the context of proper cc.Modules.
+					if ccWholeStaticLib, ok := ccDep.(*Module); ok {
+						staticLib := ccWholeStaticLib.linker.(libraryInterface)
+						if missingDeps := staticLib.getWholeStaticMissingDeps(); missingDeps != nil {
+							postfix := " (required by " + ctx.OtherModuleName(dep) + ")"
+							for i := range missingDeps {
+								missingDeps[i] += postfix
+							}
+							ctx.AddMissingDependencies(missingDeps)
+						}
+						if _, ok := ccWholeStaticLib.linker.(prebuiltLinkerInterface); ok {
+							depPaths.WholeStaticLibsFromPrebuilts = append(depPaths.WholeStaticLibsFromPrebuilts, linkFile.Path())
+						} else {
+							depPaths.WholeStaticLibObjs = depPaths.WholeStaticLibObjs.Append(staticLib.objs())
+						}
 					} else {
-						return baseName
+						ctx.ModuleErrorf(
+							"non-cc.Modules cannot be included as whole static libraries.", depName)
+						return
+					}
+
+				} else {
+					switch libDepTag.Order {
+					case earlyLibraryDependency:
+						panic(fmt.Errorf("early static libs not suppported"))
+					case normalLibraryDependency:
+						// static dependencies will be handled separately so they can be ordered
+						// using transitive dependencies.
+						ptr = nil
+						directStaticDeps = append(directStaticDeps, ccDep)
+					case lateLibraryDependency:
+						ptr = &depPaths.LateStaticLibs
+					default:
+						panic(fmt.Errorf("unexpected library dependency order %d", libDepTag.Order))
 					}
 				}
 			}
 
-			if ctx.DeviceConfig().VndkUseCoreVariant() && ccDep.IsVndk() && !ccDep.MustUseVendorVariant() && !c.InRamdisk() && !c.InRecovery() {
-				// The vendor module is a no-vendor-variant VNDK library.  Depend on the
-				// core module instead.
-				return libName
-			} else if c.UseVndk() && bothVendorAndCoreVariantsExist {
-				// The vendor module in Make will have been renamed to not conflict with the core
-				// module, so update the dependency name here accordingly.
-				return libName + c.getNameSuffixWithVndkVersion(ctx)
-			} else if (ctx.Platform() || ctx.ProductSpecific()) && isVendorPublicLib {
-				return libName + vendorPublicLibrarySuffix
-			} else if ccDep.InRamdisk() && !ccDep.OnlyInRamdisk() {
-				return libName + ramdiskSuffix
-			} else if ccDep.InRecovery() && !ccDep.OnlyInRecovery() {
-				return libName + recoverySuffix
-			} else if ccDep.Module().Target().NativeBridge == android.NativeBridgeEnabled {
-				return libName + nativeBridgeSuffix
-			} else {
-				return libName
-			}
-		}
+			if libDepTag.static() && !libDepTag.wholeStatic {
+				if !ccDep.CcLibraryInterface() || !ccDep.Static() {
+					ctx.ModuleErrorf("module %q not a static library", depName)
+					return
+				}
 
-		// Export the shared libs to Make.
-		switch depTag {
-		case SharedDepTag, sharedExportDepTag, lateSharedDepTag, earlySharedDepTag:
-			if ccDep.CcLibrary() {
-				if ccDep.BuildStubs() && android.InAnyApex(depName) {
-					// Add the dependency to the APEX(es) providing the library so that
-					// m <module> can trigger building the APEXes as well.
-					for _, an := range android.GetApexesForModule(depName) {
-						c.Properties.ApexesProvidingSharedLibs = append(
-							c.Properties.ApexesProvidingSharedLibs, an)
-					}
+				// When combining coverage files for shared libraries and executables, coverage files
+				// in static libraries act as if they were whole static libraries. The same goes for
+				// source based Abi dump files.
+				if c, ok := ccDep.(*Module); ok {
+					staticLib := c.linker.(libraryInterface)
+					depPaths.StaticLibObjs.coverageFiles = append(depPaths.StaticLibObjs.coverageFiles,
+						staticLib.objs().coverageFiles...)
+					depPaths.StaticLibObjs.sAbiDumpFiles = append(depPaths.StaticLibObjs.sAbiDumpFiles,
+						staticLib.objs().sAbiDumpFiles...)
+				} else if c, ok := ccDep.(LinkableInterface); ok {
+					// Handle non-CC modules here
+					depPaths.StaticLibObjs.coverageFiles = append(depPaths.StaticLibObjs.coverageFiles,
+						c.CoverageFiles()...)
 				}
 			}
 
-			// Note: the order of libs in this list is not important because
-			// they merely serve as Make dependencies and do not affect this lib itself.
-			c.Properties.AndroidMkSharedLibs = append(
-				c.Properties.AndroidMkSharedLibs, makeLibName(depName))
-			// Record baseLibName for snapshots.
-			c.Properties.SnapshotSharedLibs = append(c.Properties.SnapshotSharedLibs, baseLibName(depName))
-		case ndkStubDepTag, ndkLateStubDepTag:
-			c.Properties.AndroidMkSharedLibs = append(
-				c.Properties.AndroidMkSharedLibs,
-				depName+"."+ccDep.ApiLevel())
-		case StaticDepTag, staticExportDepTag, lateStaticDepTag:
-			c.Properties.AndroidMkStaticLibs = append(
-				c.Properties.AndroidMkStaticLibs, makeLibName(depName))
-		case runtimeDepTag:
-			c.Properties.AndroidMkRuntimeLibs = append(
-				c.Properties.AndroidMkRuntimeLibs, makeLibName(depName))
-			// Record baseLibName for snapshots.
-			c.Properties.SnapshotRuntimeLibs = append(c.Properties.SnapshotRuntimeLibs, baseLibName(depName))
-		case wholeStaticDepTag:
-			c.Properties.AndroidMkWholeStaticLibs = append(
-				c.Properties.AndroidMkWholeStaticLibs, makeLibName(depName))
-		case headerDepTag:
-			c.Properties.AndroidMkHeaderLibs = append(
-				c.Properties.AndroidMkHeaderLibs, makeLibName(depName))
+			if ptr != nil {
+				if !linkFile.Valid() {
+					if !ctx.Config().AllowMissingDependencies() {
+						ctx.ModuleErrorf("module %q missing output file", depName)
+					} else {
+						ctx.AddMissingDependencies([]string{depName})
+					}
+					return
+				}
+				*ptr = append(*ptr, linkFile.Path())
+			}
+
+			if depPtr != nil {
+				dep := depFile
+				if !dep.Valid() {
+					dep = linkFile
+				}
+				*depPtr = append(*depPtr, dep.Path())
+			}
+
+			makeLibName := c.makeLibName(ctx, ccDep, depName) + libDepTag.makeSuffix
+			switch {
+			case libDepTag.header():
+				// TODO(ccross): The reexportFlags check is there to maintain previous
+				//   behavior when adding libraryDependencyTag and should be removed.
+				if !libDepTag.reexportFlags {
+					c.Properties.AndroidMkHeaderLibs = append(
+						c.Properties.AndroidMkHeaderLibs, makeLibName)
+				}
+			case libDepTag.shared():
+				if ccDep.CcLibrary() {
+					if ccDep.BuildStubs() && android.InAnyApex(depName) {
+						// Add the dependency to the APEX(es) providing the library so that
+						// m <module> can trigger building the APEXes as well.
+						for _, an := range android.GetApexesForModule(depName) {
+							c.Properties.ApexesProvidingSharedLibs = append(
+								c.Properties.ApexesProvidingSharedLibs, an)
+						}
+					}
+				}
+
+				// Note: the order of libs in this list is not important because
+				// they merely serve as Make dependencies and do not affect this lib itself.
+				// TODO(ccross): The reexportFlags, order and ndk checks are there to
+				//   maintain previous behavior when adding libraryDependencyTag and
+				//   should be removed.
+				if !c.static() || libDepTag.reexportFlags || libDepTag.Order == lateLibraryDependency || libDepTag.ndk {
+					c.Properties.AndroidMkSharedLibs = append(
+						c.Properties.AndroidMkSharedLibs, makeLibName)
+				}
+				// Record baseLibName for snapshots.
+				c.Properties.SnapshotSharedLibs = append(c.Properties.SnapshotSharedLibs, baseLibName(depName))
+			case libDepTag.static():
+				if libDepTag.wholeStatic {
+					c.Properties.AndroidMkWholeStaticLibs = append(
+						c.Properties.AndroidMkWholeStaticLibs, makeLibName)
+				} else {
+					c.Properties.AndroidMkStaticLibs = append(
+						c.Properties.AndroidMkStaticLibs, makeLibName)
+				}
+			}
+		} else {
+			switch depTag {
+			case runtimeDepTag:
+				c.Properties.AndroidMkRuntimeLibs = append(
+					c.Properties.AndroidMkRuntimeLibs, c.makeLibName(ctx, ccDep, depName)+libDepTag.makeSuffix)
+				// Record baseLibName for snapshots.
+				c.Properties.SnapshotRuntimeLibs = append(c.Properties.SnapshotRuntimeLibs, baseLibName(depName))
+			case objDepTag:
+				depPaths.Objs.objFiles = append(depPaths.Objs.objFiles, linkFile.Path())
+			case CrtBeginDepTag:
+				depPaths.CrtBegin = linkFile
+			case CrtEndDepTag:
+				depPaths.CrtEnd = linkFile
+			case dynamicLinkerDepTag:
+				depPaths.DynamicLinker = linkFile
+			}
 		}
 	})
 
@@ -2665,6 +2650,61 @@
 	return depPaths
 }
 
+// baseLibName trims known prefixes and suffixes
+func baseLibName(depName string) string {
+	libName := strings.TrimSuffix(depName, llndkLibrarySuffix)
+	libName = strings.TrimSuffix(libName, vendorPublicLibrarySuffix)
+	libName = strings.TrimPrefix(libName, "prebuilt_")
+	return libName
+}
+
+func (c *Module) makeLibName(ctx android.ModuleContext, ccDep LinkableInterface, depName string) string {
+	vendorSuffixModules := vendorSuffixModules(ctx.Config())
+	vendorPublicLibraries := vendorPublicLibraries(ctx.Config())
+
+	libName := baseLibName(depName)
+	isLLndk := isLlndkLibrary(libName, ctx.Config())
+	isVendorPublicLib := inList(libName, *vendorPublicLibraries)
+	bothVendorAndCoreVariantsExist := ccDep.HasVendorVariant() || isLLndk
+
+	if c, ok := ccDep.(*Module); ok {
+		// Use base module name for snapshots when exporting to Makefile.
+		if c.isSnapshotPrebuilt() {
+			baseName := c.BaseModuleName()
+
+			if c.IsVndk() {
+				return baseName + ".vendor"
+			}
+
+			if vendorSuffixModules[baseName] {
+				return baseName + ".vendor"
+			} else {
+				return baseName
+			}
+		}
+	}
+
+	if ctx.DeviceConfig().VndkUseCoreVariant() && ccDep.IsVndk() && !ccDep.MustUseVendorVariant() && !c.InRamdisk() && !c.InRecovery() {
+		// The vendor module is a no-vendor-variant VNDK library.  Depend on the
+		// core module instead.
+		return libName
+	} else if c.UseVndk() && bothVendorAndCoreVariantsExist {
+		// The vendor module in Make will have been renamed to not conflict with the core
+		// module, so update the dependency name here accordingly.
+		return libName + c.getNameSuffixWithVndkVersion(ctx)
+	} else if (ctx.Platform() || ctx.ProductSpecific()) && isVendorPublicLib {
+		return libName + vendorPublicLibrarySuffix
+	} else if ccDep.InRamdisk() && !ccDep.OnlyInRamdisk() {
+		return libName + ramdiskSuffix
+	} else if ccDep.InRecovery() && !ccDep.OnlyInRecovery() {
+		return libName + recoverySuffix
+	} else if ccDep.Module().Target().NativeBridge == android.NativeBridgeEnabled {
+		return libName + nativeBridgeSuffix
+	} else {
+		return libName
+	}
+}
+
 func (c *Module) InstallInData() bool {
 	if c.installer == nil {
 		return false
@@ -2876,26 +2916,30 @@
 }
 
 func (c *Module) DepIsInSameApex(ctx android.BaseModuleContext, dep android.Module) bool {
-	if depTag, ok := ctx.OtherModuleDependencyTag(dep).(DependencyTag); ok {
-		if cc, ok := dep.(*Module); ok {
-			if cc.HasStubsVariants() {
-				if depTag.Shared && depTag.Library {
-					// dynamic dep to a stubs lib crosses APEX boundary
-					return false
-				}
-				if IsRuntimeDepTag(depTag) {
-					// runtime dep to a stubs lib also crosses APEX boundary
-					return false
-				}
+	depTag := ctx.OtherModuleDependencyTag(dep)
+	libDepTag, isLibDepTag := depTag.(libraryDependencyTag)
+
+	if cc, ok := dep.(*Module); ok {
+		if cc.HasStubsVariants() {
+			if isLibDepTag && libDepTag.shared() {
+				// dynamic dep to a stubs lib crosses APEX boundary
+				return false
 			}
-			if depTag.FromStatic {
-				// shared_lib dependency from a static lib is considered as crossing
-				// the APEX boundary because the dependency doesn't actually is
-				// linked; the dependency is used only during the compilation phase.
+			if IsRuntimeDepTag(depTag) {
+				// runtime dep to a stubs lib also crosses APEX boundary
 				return false
 			}
 		}
-	} else if ctx.OtherModuleDependencyTag(dep) == llndkImplDep {
+		// TODO(ccross): The libDepTag.reexportFlags is there to maintain previous behavior
+		//   when adding libraryDependencyTag and should be removed.
+		if isLibDepTag && c.static() && libDepTag.shared() && !libDepTag.reexportFlags {
+			// shared_lib dependency from a static lib is considered as crossing
+			// the APEX boundary because the dependency doesn't actually is
+			// linked; the dependency is used only during the compilation phase.
+			return false
+		}
+	}
+	if depTag == llndkImplDep {
 		// We don't track beyond LLNDK
 		return false
 	}
@@ -3031,236 +3075,6 @@
 	}
 }
 
-var _ android.ImageInterface = (*Module)(nil)
-
-func (m *Module) ImageMutatorBegin(mctx android.BaseModuleContext) {
-	// Sanity check
-	vendorSpecific := mctx.SocSpecific() || mctx.DeviceSpecific()
-	productSpecific := mctx.ProductSpecific()
-
-	if m.VendorProperties.Vendor_available != nil && vendorSpecific {
-		mctx.PropertyErrorf("vendor_available",
-			"doesn't make sense at the same time as `vendor: true`, `proprietary: true`, or `device_specific:true`")
-	}
-
-	if vndkdep := m.vndkdep; vndkdep != nil {
-		if vndkdep.isVndk() {
-			if vendorSpecific || productSpecific {
-				if !vndkdep.isVndkExt() {
-					mctx.PropertyErrorf("vndk",
-						"must set `extends: \"...\"` to vndk extension")
-				} else if m.VendorProperties.Vendor_available != nil {
-					mctx.PropertyErrorf("vendor_available",
-						"must not set at the same time as `vndk: {extends: \"...\"}`")
-				}
-			} else {
-				if vndkdep.isVndkExt() {
-					mctx.PropertyErrorf("vndk",
-						"must set `vendor: true` or `product_specific: true` to set `extends: %q`",
-						m.getVndkExtendsModuleName())
-				}
-				if m.VendorProperties.Vendor_available == nil {
-					mctx.PropertyErrorf("vndk",
-						"vendor_available must be set to either true or false when `vndk: {enabled: true}`")
-				}
-			}
-		} else {
-			if vndkdep.isVndkSp() {
-				mctx.PropertyErrorf("vndk",
-					"must set `enabled: true` to set `support_system_process: true`")
-			}
-			if vndkdep.isVndkExt() {
-				mctx.PropertyErrorf("vndk",
-					"must set `enabled: true` to set `extends: %q`",
-					m.getVndkExtendsModuleName())
-			}
-		}
-	}
-
-	var coreVariantNeeded bool = false
-	var ramdiskVariantNeeded bool = false
-	var recoveryVariantNeeded bool = false
-
-	var vendorVariants []string
-	var productVariants []string
-
-	platformVndkVersion := mctx.DeviceConfig().PlatformVndkVersion()
-	boardVndkVersion := mctx.DeviceConfig().VndkVersion()
-	productVndkVersion := mctx.DeviceConfig().ProductVndkVersion()
-	if boardVndkVersion == "current" {
-		boardVndkVersion = platformVndkVersion
-	}
-	if productVndkVersion == "current" {
-		productVndkVersion = platformVndkVersion
-	}
-
-	if boardVndkVersion == "" {
-		// If the device isn't compiling against the VNDK, we always
-		// use the core mode.
-		coreVariantNeeded = true
-	} else if _, ok := m.linker.(*llndkStubDecorator); ok {
-		// LL-NDK stubs only exist in the vendor and product variants,
-		// since the real libraries will be used in the core variant.
-		vendorVariants = append(vendorVariants,
-			platformVndkVersion,
-			boardVndkVersion,
-		)
-		productVariants = append(productVariants,
-			platformVndkVersion,
-			productVndkVersion,
-		)
-	} else if _, ok := m.linker.(*llndkHeadersDecorator); ok {
-		// ... and LL-NDK headers as well
-		vendorVariants = append(vendorVariants,
-			platformVndkVersion,
-			boardVndkVersion,
-		)
-		productVariants = append(productVariants,
-			platformVndkVersion,
-			productVndkVersion,
-		)
-	} else if m.isSnapshotPrebuilt() {
-		// Make vendor variants only for the versions in BOARD_VNDK_VERSION and
-		// PRODUCT_EXTRA_VNDK_VERSIONS.
-		if snapshot, ok := m.linker.(interface {
-			version() string
-		}); ok {
-			vendorVariants = append(vendorVariants, snapshot.version())
-		} else {
-			mctx.ModuleErrorf("version is unknown for snapshot prebuilt")
-		}
-	} else if m.HasVendorVariant() && !m.isVndkExt() {
-		// This will be available in /system, /vendor and /product
-		// or a /system directory that is available to vendor and product.
-		coreVariantNeeded = true
-
-		// We assume that modules under proprietary paths are compatible for
-		// BOARD_VNDK_VERSION. The other modules are regarded as AOSP, or
-		// PLATFORM_VNDK_VERSION.
-		if isVendorProprietaryPath(mctx.ModuleDir()) {
-			vendorVariants = append(vendorVariants, boardVndkVersion)
-		} else {
-			vendorVariants = append(vendorVariants, platformVndkVersion)
-		}
-
-		// vendor_available modules are also available to /product.
-		productVariants = append(productVariants, platformVndkVersion)
-		// VNDK is always PLATFORM_VNDK_VERSION
-		if !m.IsVndk() {
-			productVariants = append(productVariants, productVndkVersion)
-		}
-	} else if vendorSpecific && String(m.Properties.Sdk_version) == "" {
-		// This will be available in /vendor (or /odm) only
-
-		// kernel_headers is a special module type whose exported headers
-		// are coming from DeviceKernelHeaders() which is always vendor
-		// dependent. They'll always have both vendor variants.
-		// For other modules, we assume that modules under proprietary
-		// paths are compatible for BOARD_VNDK_VERSION. The other modules
-		// are regarded as AOSP, which is PLATFORM_VNDK_VERSION.
-		if _, ok := m.linker.(*kernelHeadersDecorator); ok {
-			vendorVariants = append(vendorVariants,
-				platformVndkVersion,
-				boardVndkVersion,
-			)
-		} else if isVendorProprietaryPath(mctx.ModuleDir()) {
-			vendorVariants = append(vendorVariants, boardVndkVersion)
-		} else {
-			vendorVariants = append(vendorVariants, platformVndkVersion)
-		}
-	} else {
-		// This is either in /system (or similar: /data), or is a
-		// modules built with the NDK. Modules built with the NDK
-		// will be restricted using the existing link type checks.
-		coreVariantNeeded = true
-	}
-
-	if boardVndkVersion != "" && productVndkVersion != "" {
-		if coreVariantNeeded && productSpecific && String(m.Properties.Sdk_version) == "" {
-			// The module has "product_specific: true" that does not create core variant.
-			coreVariantNeeded = false
-			productVariants = append(productVariants, productVndkVersion)
-		}
-	} else {
-		// Unless PRODUCT_PRODUCT_VNDK_VERSION is set, product partition has no
-		// restriction to use system libs.
-		// No product variants defined in this case.
-		productVariants = []string{}
-	}
-
-	if Bool(m.Properties.Ramdisk_available) {
-		ramdiskVariantNeeded = true
-	}
-
-	if m.ModuleBase.InstallInRamdisk() {
-		ramdiskVariantNeeded = true
-		coreVariantNeeded = false
-	}
-
-	if Bool(m.Properties.Recovery_available) {
-		recoveryVariantNeeded = true
-	}
-
-	if m.ModuleBase.InstallInRecovery() {
-		recoveryVariantNeeded = true
-		coreVariantNeeded = false
-	}
-
-	for _, variant := range android.FirstUniqueStrings(vendorVariants) {
-		m.Properties.ExtraVariants = append(m.Properties.ExtraVariants, VendorVariationPrefix+variant)
-	}
-
-	for _, variant := range android.FirstUniqueStrings(productVariants) {
-		m.Properties.ExtraVariants = append(m.Properties.ExtraVariants, ProductVariationPrefix+variant)
-	}
-
-	m.Properties.RamdiskVariantNeeded = ramdiskVariantNeeded
-	m.Properties.RecoveryVariantNeeded = recoveryVariantNeeded
-	m.Properties.CoreVariantNeeded = coreVariantNeeded
-}
-
-func (c *Module) CoreVariantNeeded(ctx android.BaseModuleContext) bool {
-	return c.Properties.CoreVariantNeeded
-}
-
-func (c *Module) RamdiskVariantNeeded(ctx android.BaseModuleContext) bool {
-	return c.Properties.RamdiskVariantNeeded
-}
-
-func (c *Module) RecoveryVariantNeeded(ctx android.BaseModuleContext) bool {
-	return c.Properties.RecoveryVariantNeeded
-}
-
-func (c *Module) ExtraImageVariations(ctx android.BaseModuleContext) []string {
-	return c.Properties.ExtraVariants
-}
-
-func (c *Module) SetImageVariation(ctx android.BaseModuleContext, variant string, module android.Module) {
-	m := module.(*Module)
-	if variant == android.RamdiskVariation {
-		m.MakeAsPlatform()
-	} else if variant == android.RecoveryVariation {
-		m.MakeAsPlatform()
-		squashRecoverySrcs(m)
-	} else if strings.HasPrefix(variant, VendorVariationPrefix) {
-		m.Properties.ImageVariationPrefix = VendorVariationPrefix
-		m.Properties.VndkVersion = strings.TrimPrefix(variant, VendorVariationPrefix)
-		squashVendorSrcs(m)
-
-		// Makefile shouldn't know vendor modules other than BOARD_VNDK_VERSION.
-		// Hide other vendor variants to avoid collision.
-		vndkVersion := ctx.DeviceConfig().VndkVersion()
-		if vndkVersion != "current" && vndkVersion != "" && vndkVersion != m.Properties.VndkVersion {
-			m.Properties.HideFromMake = true
-			m.SkipInstall()
-		}
-	} else if strings.HasPrefix(variant, ProductVariationPrefix) {
-		m.Properties.ImageVariationPrefix = ProductVariationPrefix
-		m.Properties.VndkVersion = strings.TrimPrefix(variant, ProductVariationPrefix)
-		squashVendorSrcs(m)
-	}
-}
-
 func (c *Module) IsSdkVariant() bool {
 	return c.Properties.IsSdkVariant
 }
diff --git a/cc/cc_test.go b/cc/cc_test.go
index 8a1c8ed..38a5c2d 100644
--- a/cc/cc_test.go
+++ b/cc/cc_test.go
@@ -539,7 +539,7 @@
 			data_libs: ["test_lib"],
 			gtest: false,
 		}
-  `
+ `
 
 	config := TestConfig(buildDir, android.Android, nil, bp, nil)
 	config.TestProductVariables.DeviceVndkVersion = StringPtr("current")
@@ -564,7 +564,7 @@
 	}
 
 	outputPath := outputFiles[0].String()
-	testBinaryPath := testBinary.dataPaths()[0].String()
+	testBinaryPath := testBinary.dataPaths()[0].SrcPath.String()
 
 	if !strings.HasSuffix(outputPath, "/main_test") {
 		t.Errorf("expected test output file to be 'main_test', but was '%s'", outputPath)
@@ -576,6 +576,53 @@
 	}
 }
 
+func TestDataLibsRelativeInstallPath(t *testing.T) {
+	bp := `
+		cc_test_library {
+			name: "test_lib",
+			srcs: ["test_lib.cpp"],
+			relative_install_path: "foo/bar/baz",
+			gtest: false,
+		}
+
+		cc_test {
+			name: "main_test",
+			data_libs: ["test_lib"],
+			gtest: false,
+		}
+ `
+
+	config := TestConfig(buildDir, android.Android, nil, bp, nil)
+	config.TestProductVariables.DeviceVndkVersion = StringPtr("current")
+	config.TestProductVariables.Platform_vndk_version = StringPtr("VER")
+	config.TestProductVariables.VndkUseCoreVariant = BoolPtr(true)
+
+	ctx := testCcWithConfig(t, config)
+	module := ctx.ModuleForTests("main_test", "android_arm_armv7-a-neon").Module()
+	testBinary := module.(*Module).linker.(*testBinary)
+	outputFiles, err := module.(android.OutputFileProducer).OutputFiles("")
+	if err != nil {
+		t.Fatalf("Expected cc_test to produce output files, error: %s", err)
+	}
+	if len(outputFiles) != 1 {
+		t.Errorf("expected exactly one output file. output files: [%s]", outputFiles)
+	}
+	if len(testBinary.dataPaths()) != 1 {
+		t.Errorf("expected exactly one test data file. test data files: [%s]", testBinary.dataPaths())
+	}
+
+	outputPath := outputFiles[0].String()
+
+	if !strings.HasSuffix(outputPath, "/main_test") {
+		t.Errorf("expected test output file to be 'main_test', but was '%s'", outputPath)
+	}
+	entries := android.AndroidMkEntriesForTest(t, config, "", module)[0]
+	if !strings.HasSuffix(entries.EntryMap["LOCAL_TEST_DATA"][0], ":test_lib.so:foo/bar/baz") {
+		t.Errorf("expected LOCAL_TEST_DATA to end with `:test_lib.so:foo/bar/baz`,"+
+			" but was '%s'", entries.EntryMap["LOCAL_TEST_DATA"][0])
+	}
+}
+
 func TestVndkWhenVndkVersionIsNotSet(t *testing.T) {
 	ctx := testCcNoVndk(t, `
 		cc_library {
@@ -2919,6 +2966,52 @@
 	}
 }
 
+func TestDataLibsPrebuiltSharedTestLibrary(t *testing.T) {
+	bp := `
+		cc_prebuilt_test_library_shared {
+			name: "test_lib",
+			relative_install_path: "foo/bar/baz",
+			srcs: ["srcpath/dontusethispath/baz.so"],
+		}
+
+		cc_test {
+			name: "main_test",
+			data_libs: ["test_lib"],
+			gtest: false,
+		}
+ `
+
+	config := TestConfig(buildDir, android.Android, nil, bp, nil)
+	config.TestProductVariables.DeviceVndkVersion = StringPtr("current")
+	config.TestProductVariables.Platform_vndk_version = StringPtr("VER")
+	config.TestProductVariables.VndkUseCoreVariant = BoolPtr(true)
+
+	ctx := testCcWithConfig(t, config)
+	module := ctx.ModuleForTests("main_test", "android_arm_armv7-a-neon").Module()
+	testBinary := module.(*Module).linker.(*testBinary)
+	outputFiles, err := module.(android.OutputFileProducer).OutputFiles("")
+	if err != nil {
+		t.Fatalf("Expected cc_test to produce output files, error: %s", err)
+	}
+	if len(outputFiles) != 1 {
+		t.Errorf("expected exactly one output file. output files: [%s]", outputFiles)
+	}
+	if len(testBinary.dataPaths()) != 1 {
+		t.Errorf("expected exactly one test data file. test data files: [%s]", testBinary.dataPaths())
+	}
+
+	outputPath := outputFiles[0].String()
+
+	if !strings.HasSuffix(outputPath, "/main_test") {
+		t.Errorf("expected test output file to be 'main_test', but was '%s'", outputPath)
+	}
+	entries := android.AndroidMkEntriesForTest(t, config, "", module)[0]
+	if !strings.HasSuffix(entries.EntryMap["LOCAL_TEST_DATA"][0], ":test_lib.so:foo/bar/baz") {
+		t.Errorf("expected LOCAL_TEST_DATA to end with `:test_lib.so:foo/bar/baz`,"+
+			" but was '%s'", entries.EntryMap["LOCAL_TEST_DATA"][0])
+	}
+}
+
 func TestVersionedStubs(t *testing.T) {
 	ctx := testCc(t, `
 		cc_library_shared {
diff --git a/cc/config/integer_overflow_blacklist.txt b/cc/config/integer_overflow_blocklist.txt
similarity index 100%
rename from cc/config/integer_overflow_blacklist.txt
rename to cc/config/integer_overflow_blocklist.txt
diff --git a/cc/config/x86_darwin_host.go b/cc/config/x86_darwin_host.go
index 8eb79e3..81c907d 100644
--- a/cc/config/x86_darwin_host.go
+++ b/cc/config/x86_darwin_host.go
@@ -66,6 +66,7 @@
 		"10.13",
 		"10.14",
 		"10.15",
+		"11.0",
 	}
 
 	darwinAvailableLibraries = append(
diff --git a/cc/coverage.go b/cc/coverage.go
index c823324..aa1fdf6 100644
--- a/cc/coverage.go
+++ b/cc/coverage.go
@@ -22,6 +22,8 @@
 	"android/soong/android"
 )
 
+const profileInstrFlag = "-fprofile-instr-generate=/data/misc/trace/clang-%p-%m.profraw"
+
 type CoverageProperties struct {
 	Native_coverage *bool
 
@@ -92,7 +94,7 @@
 			// flags that the module may use.
 			flags.Local.CFlags = append(flags.Local.CFlags, "-Wno-frame-larger-than=", "-O0")
 		} else if clangCoverage {
-			flags.Local.CommonFlags = append(flags.Local.CommonFlags, "-fprofile-instr-generate", "-fcoverage-mapping", "-Wno-pass-failed")
+			flags.Local.CommonFlags = append(flags.Local.CommonFlags, profileInstrFlag, "-fcoverage-mapping", "-Wno-pass-failed")
 		}
 	}
 
@@ -103,10 +105,14 @@
 			// For static libraries, the only thing that changes our object files
 			// are included whole static libraries, so check to see if any of
 			// those have coverage enabled.
-			ctx.VisitDirectDepsWithTag(wholeStaticDepTag, func(m android.Module) {
-				if cc, ok := m.(*Module); ok && cc.coverage != nil {
-					if cc.coverage.linkCoverage {
-						cov.linkCoverage = true
+			ctx.VisitDirectDeps(func(m android.Module) {
+				if depTag, ok := ctx.OtherModuleDependencyTag(m).(libraryDependencyTag); ok {
+					if depTag.static() && depTag.wholeStatic {
+						if cc, ok := m.(*Module); ok && cc.coverage != nil {
+							if cc.coverage.linkCoverage {
+								cov.linkCoverage = true
+							}
+						}
 					}
 				}
 			})
@@ -139,7 +145,7 @@
 
 			flags.Local.LdFlags = append(flags.Local.LdFlags, "-Wl,--wrap,getenv")
 		} else if clangCoverage {
-			flags.Local.LdFlags = append(flags.Local.LdFlags, "-fprofile-instr-generate")
+			flags.Local.LdFlags = append(flags.Local.LdFlags, profileInstrFlag)
 
 			coverage := ctx.GetDirectDepWithTag(getClangProfileLibraryName(ctx), CoverageDepTag).(*Module)
 			deps.WholeStaticLibs = append(deps.WholeStaticLibs, coverage.OutputFile().Path())
diff --git a/cc/image.go b/cc/image.go
new file mode 100644
index 0000000..4daed7c
--- /dev/null
+++ b/cc/image.go
@@ -0,0 +1,348 @@
+// Copyright 2020 The Android Open Source Project
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+package cc
+
+// This file contains image variant related things, including image mutator functions, utility
+// functions to determine where a module is installed, etc.
+
+import (
+	"strings"
+
+	"android/soong/android"
+)
+
+var _ android.ImageInterface = (*Module)(nil)
+
+type imageVariantType string
+
+const (
+	coreImageVariant     imageVariantType = "core"
+	vendorImageVariant   imageVariantType = "vendor"
+	productImageVariant  imageVariantType = "product"
+	ramdiskImageVariant  imageVariantType = "ramdisk"
+	recoveryImageVariant imageVariantType = "recovery"
+	hostImageVariant     imageVariantType = "host"
+)
+
+func (c *Module) getImageVariantType() imageVariantType {
+	if c.Host() {
+		return hostImageVariant
+	} else if c.inVendor() {
+		return vendorImageVariant
+	} else if c.inProduct() {
+		return productImageVariant
+	} else if c.InRamdisk() {
+		return ramdiskImageVariant
+	} else if c.InRecovery() {
+		return recoveryImageVariant
+	} else {
+		return coreImageVariant
+	}
+}
+
+const (
+	// VendorVariationPrefix is the variant prefix used for /vendor code that compiles
+	// against the VNDK.
+	VendorVariationPrefix = "vendor."
+
+	// ProductVariationPrefix is the variant prefix used for /product code that compiles
+	// against the VNDK.
+	ProductVariationPrefix = "product."
+)
+
+func (ctx *moduleContext) ProductSpecific() bool {
+	return ctx.ModuleContext.ProductSpecific() ||
+		(ctx.mod.HasVendorVariant() && ctx.mod.inProduct() && !ctx.mod.IsVndk())
+}
+
+func (ctx *moduleContext) SocSpecific() bool {
+	return ctx.ModuleContext.SocSpecific() ||
+		(ctx.mod.HasVendorVariant() && ctx.mod.inVendor() && !ctx.mod.IsVndk())
+}
+
+func (ctx *moduleContextImpl) inProduct() bool {
+	return ctx.mod.inProduct()
+}
+
+func (ctx *moduleContextImpl) inVendor() bool {
+	return ctx.mod.inVendor()
+}
+
+func (ctx *moduleContextImpl) inRamdisk() bool {
+	return ctx.mod.InRamdisk()
+}
+
+func (ctx *moduleContextImpl) inRecovery() bool {
+	return ctx.mod.InRecovery()
+}
+
+// Returns true only when this module is configured to have core, product and vendor
+// variants.
+func (c *Module) HasVendorVariant() bool {
+	return c.IsVndk() || Bool(c.VendorProperties.Vendor_available)
+}
+
+// Returns true if the module is "product" variant. Usually these modules are installed in /product
+func (c *Module) inProduct() bool {
+	return c.Properties.ImageVariationPrefix == ProductVariationPrefix
+}
+
+// Returns true if the module is "vendor" variant. Usually these modules are installed in /vendor
+func (c *Module) inVendor() bool {
+	return c.Properties.ImageVariationPrefix == VendorVariationPrefix
+}
+
+func (c *Module) InRamdisk() bool {
+	return c.ModuleBase.InRamdisk() || c.ModuleBase.InstallInRamdisk()
+}
+
+func (c *Module) InRecovery() bool {
+	return c.ModuleBase.InRecovery() || c.ModuleBase.InstallInRecovery()
+}
+
+func (c *Module) OnlyInRamdisk() bool {
+	return c.ModuleBase.InstallInRamdisk()
+}
+
+func (c *Module) OnlyInRecovery() bool {
+	return c.ModuleBase.InstallInRecovery()
+}
+
+func (m *Module) ImageMutatorBegin(mctx android.BaseModuleContext) {
+	// Validation check
+	vendorSpecific := mctx.SocSpecific() || mctx.DeviceSpecific()
+	productSpecific := mctx.ProductSpecific()
+
+	if m.VendorProperties.Vendor_available != nil && vendorSpecific {
+		mctx.PropertyErrorf("vendor_available",
+			"doesn't make sense at the same time as `vendor: true`, `proprietary: true`, or `device_specific:true`")
+	}
+
+	if vndkdep := m.vndkdep; vndkdep != nil {
+		if vndkdep.isVndk() {
+			if vendorSpecific || productSpecific {
+				if !vndkdep.isVndkExt() {
+					mctx.PropertyErrorf("vndk",
+						"must set `extends: \"...\"` to vndk extension")
+				} else if m.VendorProperties.Vendor_available != nil {
+					mctx.PropertyErrorf("vendor_available",
+						"must not set at the same time as `vndk: {extends: \"...\"}`")
+				}
+			} else {
+				if vndkdep.isVndkExt() {
+					mctx.PropertyErrorf("vndk",
+						"must set `vendor: true` or `product_specific: true` to set `extends: %q`",
+						m.getVndkExtendsModuleName())
+				}
+				if m.VendorProperties.Vendor_available == nil {
+					mctx.PropertyErrorf("vndk",
+						"vendor_available must be set to either true or false when `vndk: {enabled: true}`")
+				}
+			}
+		} else {
+			if vndkdep.isVndkSp() {
+				mctx.PropertyErrorf("vndk",
+					"must set `enabled: true` to set `support_system_process: true`")
+			}
+			if vndkdep.isVndkExt() {
+				mctx.PropertyErrorf("vndk",
+					"must set `enabled: true` to set `extends: %q`",
+					m.getVndkExtendsModuleName())
+			}
+		}
+	}
+
+	var coreVariantNeeded bool = false
+	var ramdiskVariantNeeded bool = false
+	var recoveryVariantNeeded bool = false
+
+	var vendorVariants []string
+	var productVariants []string
+
+	platformVndkVersion := mctx.DeviceConfig().PlatformVndkVersion()
+	boardVndkVersion := mctx.DeviceConfig().VndkVersion()
+	productVndkVersion := mctx.DeviceConfig().ProductVndkVersion()
+	if boardVndkVersion == "current" {
+		boardVndkVersion = platformVndkVersion
+	}
+	if productVndkVersion == "current" {
+		productVndkVersion = platformVndkVersion
+	}
+
+	if boardVndkVersion == "" {
+		// If the device isn't compiling against the VNDK, we always
+		// use the core mode.
+		coreVariantNeeded = true
+	} else if _, ok := m.linker.(*llndkStubDecorator); ok {
+		// LL-NDK stubs only exist in the vendor and product variants,
+		// since the real libraries will be used in the core variant.
+		vendorVariants = append(vendorVariants,
+			platformVndkVersion,
+			boardVndkVersion,
+		)
+		productVariants = append(productVariants,
+			platformVndkVersion,
+			productVndkVersion,
+		)
+	} else if _, ok := m.linker.(*llndkHeadersDecorator); ok {
+		// ... and LL-NDK headers as well
+		vendorVariants = append(vendorVariants,
+			platformVndkVersion,
+			boardVndkVersion,
+		)
+		productVariants = append(productVariants,
+			platformVndkVersion,
+			productVndkVersion,
+		)
+	} else if m.isSnapshotPrebuilt() {
+		// Make vendor variants only for the versions in BOARD_VNDK_VERSION and
+		// PRODUCT_EXTRA_VNDK_VERSIONS.
+		if snapshot, ok := m.linker.(interface {
+			version() string
+		}); ok {
+			vendorVariants = append(vendorVariants, snapshot.version())
+		} else {
+			mctx.ModuleErrorf("version is unknown for snapshot prebuilt")
+		}
+	} else if m.HasVendorVariant() && !m.isVndkExt() {
+		// This will be available in /system, /vendor and /product
+		// or a /system directory that is available to vendor and product.
+		coreVariantNeeded = true
+
+		// We assume that modules under proprietary paths are compatible for
+		// BOARD_VNDK_VERSION. The other modules are regarded as AOSP, or
+		// PLATFORM_VNDK_VERSION.
+		if isVendorProprietaryPath(mctx.ModuleDir()) {
+			vendorVariants = append(vendorVariants, boardVndkVersion)
+		} else {
+			vendorVariants = append(vendorVariants, platformVndkVersion)
+		}
+
+		// vendor_available modules are also available to /product.
+		productVariants = append(productVariants, platformVndkVersion)
+		// VNDK is always PLATFORM_VNDK_VERSION
+		if !m.IsVndk() {
+			productVariants = append(productVariants, productVndkVersion)
+		}
+	} else if vendorSpecific && String(m.Properties.Sdk_version) == "" {
+		// This will be available in /vendor (or /odm) only
+
+		// kernel_headers is a special module type whose exported headers
+		// are coming from DeviceKernelHeaders() which is always vendor
+		// dependent. They'll always have both vendor variants.
+		// For other modules, we assume that modules under proprietary
+		// paths are compatible for BOARD_VNDK_VERSION. The other modules
+		// are regarded as AOSP, which is PLATFORM_VNDK_VERSION.
+		if _, ok := m.linker.(*kernelHeadersDecorator); ok {
+			vendorVariants = append(vendorVariants,
+				platformVndkVersion,
+				boardVndkVersion,
+			)
+		} else if isVendorProprietaryPath(mctx.ModuleDir()) {
+			vendorVariants = append(vendorVariants, boardVndkVersion)
+		} else {
+			vendorVariants = append(vendorVariants, platformVndkVersion)
+		}
+	} else {
+		// This is either in /system (or similar: /data), or is a
+		// modules built with the NDK. Modules built with the NDK
+		// will be restricted using the existing link type checks.
+		coreVariantNeeded = true
+	}
+
+	if boardVndkVersion != "" && productVndkVersion != "" {
+		if coreVariantNeeded && productSpecific && String(m.Properties.Sdk_version) == "" {
+			// The module has "product_specific: true" that does not create core variant.
+			coreVariantNeeded = false
+			productVariants = append(productVariants, productVndkVersion)
+		}
+	} else {
+		// Unless PRODUCT_PRODUCT_VNDK_VERSION is set, product partition has no
+		// restriction to use system libs.
+		// No product variants defined in this case.
+		productVariants = []string{}
+	}
+
+	if Bool(m.Properties.Ramdisk_available) {
+		ramdiskVariantNeeded = true
+	}
+
+	if m.ModuleBase.InstallInRamdisk() {
+		ramdiskVariantNeeded = true
+		coreVariantNeeded = false
+	}
+
+	if Bool(m.Properties.Recovery_available) {
+		recoveryVariantNeeded = true
+	}
+
+	if m.ModuleBase.InstallInRecovery() {
+		recoveryVariantNeeded = true
+		coreVariantNeeded = false
+	}
+
+	for _, variant := range android.FirstUniqueStrings(vendorVariants) {
+		m.Properties.ExtraVariants = append(m.Properties.ExtraVariants, VendorVariationPrefix+variant)
+	}
+
+	for _, variant := range android.FirstUniqueStrings(productVariants) {
+		m.Properties.ExtraVariants = append(m.Properties.ExtraVariants, ProductVariationPrefix+variant)
+	}
+
+	m.Properties.RamdiskVariantNeeded = ramdiskVariantNeeded
+	m.Properties.RecoveryVariantNeeded = recoveryVariantNeeded
+	m.Properties.CoreVariantNeeded = coreVariantNeeded
+}
+
+func (c *Module) CoreVariantNeeded(ctx android.BaseModuleContext) bool {
+	return c.Properties.CoreVariantNeeded
+}
+
+func (c *Module) RamdiskVariantNeeded(ctx android.BaseModuleContext) bool {
+	return c.Properties.RamdiskVariantNeeded
+}
+
+func (c *Module) RecoveryVariantNeeded(ctx android.BaseModuleContext) bool {
+	return c.Properties.RecoveryVariantNeeded
+}
+
+func (c *Module) ExtraImageVariations(ctx android.BaseModuleContext) []string {
+	return c.Properties.ExtraVariants
+}
+
+func (c *Module) SetImageVariation(ctx android.BaseModuleContext, variant string, module android.Module) {
+	m := module.(*Module)
+	if variant == android.RamdiskVariation {
+		m.MakeAsPlatform()
+	} else if variant == android.RecoveryVariation {
+		m.MakeAsPlatform()
+		squashRecoverySrcs(m)
+	} else if strings.HasPrefix(variant, VendorVariationPrefix) {
+		m.Properties.ImageVariationPrefix = VendorVariationPrefix
+		m.Properties.VndkVersion = strings.TrimPrefix(variant, VendorVariationPrefix)
+		squashVendorSrcs(m)
+
+		// Makefile shouldn't know vendor modules other than BOARD_VNDK_VERSION.
+		// Hide other vendor variants to avoid collision.
+		vndkVersion := ctx.DeviceConfig().VndkVersion()
+		if vndkVersion != "current" && vndkVersion != "" && vndkVersion != m.Properties.VndkVersion {
+			m.Properties.HideFromMake = true
+			m.SkipInstall()
+		}
+	} else if strings.HasPrefix(variant, ProductVariationPrefix) {
+		m.Properties.ImageVariationPrefix = ProductVariationPrefix
+		m.Properties.VndkVersion = strings.TrimPrefix(variant, ProductVariationPrefix)
+		squashVendorSrcs(m)
+	}
+}
diff --git a/cc/library.go b/cc/library.go
index 98f4d48..2a329ac 100644
--- a/cc/library.go
+++ b/cc/library.go
@@ -1633,8 +1633,7 @@
 	// TODO(b/137267623): Remove this in favor of a cc_genrule when they support operating on shared libraries.
 	injectBoringSSLHash := Bool(inject)
 	ctx.VisitDirectDeps(func(dep android.Module) {
-		tag := ctx.OtherModuleDependencyTag(dep)
-		if tag == StaticDepTag || tag == staticExportDepTag || tag == wholeStaticDepTag || tag == lateStaticDepTag {
+		if tag, ok := ctx.OtherModuleDependencyTag(dep).(libraryDependencyTag); ok && tag.static() {
 			if cc, ok := dep.(*Module); ok {
 				if library, ok := cc.linker.(*libraryDecorator); ok {
 					if Bool(library.Properties.Inject_bssl_hash) {
diff --git a/cc/library_headers.go b/cc/library_headers.go
index b7ab390..8b3dbeb 100644
--- a/cc/library_headers.go
+++ b/cc/library_headers.go
@@ -25,8 +25,9 @@
 
 var headersLibrarySdkMemberType = &librarySdkMemberType{
 	SdkMemberTypeBase: android.SdkMemberTypeBase{
-		PropertyName: "native_header_libs",
-		SupportsSdk:  true,
+		PropertyName:    "native_header_libs",
+		SupportsSdk:     true,
+		HostOsDependent: true,
 	},
 	prebuiltModuleType: "cc_prebuilt_library_headers",
 	noOutputFiles:      true,
diff --git a/cc/library_sdk_member.go b/cc/library_sdk_member.go
index 9c54399..cff00b6 100644
--- a/cc/library_sdk_member.go
+++ b/cc/library_sdk_member.go
@@ -27,8 +27,9 @@
 
 var sharedLibrarySdkMemberType = &librarySdkMemberType{
 	SdkMemberTypeBase: android.SdkMemberTypeBase{
-		PropertyName: "native_shared_libs",
-		SupportsSdk:  true,
+		PropertyName:    "native_shared_libs",
+		SupportsSdk:     true,
+		HostOsDependent: true,
 	},
 	prebuiltModuleType: "cc_prebuilt_library_shared",
 	linkTypes:          []string{"shared"},
@@ -36,8 +37,9 @@
 
 var staticLibrarySdkMemberType = &librarySdkMemberType{
 	SdkMemberTypeBase: android.SdkMemberTypeBase{
-		PropertyName: "native_static_libs",
-		SupportsSdk:  true,
+		PropertyName:    "native_static_libs",
+		SupportsSdk:     true,
+		HostOsDependent: true,
 	},
 	prebuiltModuleType: "cc_prebuilt_library_static",
 	linkTypes:          []string{"static"},
@@ -45,8 +47,9 @@
 
 var staticAndSharedLibrarySdkMemberType = &librarySdkMemberType{
 	SdkMemberTypeBase: android.SdkMemberTypeBase{
-		PropertyName: "native_libs",
-		SupportsSdk:  true,
+		PropertyName:    "native_libs",
+		SupportsSdk:     true,
+		HostOsDependent: true,
 	},
 	prebuiltModuleType: "cc_prebuilt_library",
 	linkTypes:          []string{"static", "shared"},
@@ -234,7 +237,7 @@
 	for _, propertyInfo := range includeDirProperties {
 		// Calculate the base directory in the snapshot into which the files will be copied.
 		// lib.ArchType is "" for common properties.
-		targetDir := filepath.Join(libInfo.archType, propertyInfo.snapshotDir)
+		targetDir := filepath.Join(libInfo.OsPrefix(), libInfo.archType, propertyInfo.snapshotDir)
 
 		propertyName := propertyInfo.propertyName
 
diff --git a/cc/linkable.go b/cc/linkable.go
index 66b1c3f..4c84163 100644
--- a/cc/linkable.go
+++ b/cc/linkable.go
@@ -1,9 +1,9 @@
 package cc
 
 import (
-	"github.com/google/blueprint"
-
 	"android/soong/android"
+
+	"github.com/google/blueprint"
 )
 
 type LinkableInterface interface {
@@ -63,27 +63,16 @@
 	StubDecorator() bool
 }
 
-type DependencyTag struct {
-	blueprint.BaseDependencyTag
-	Name    string
-	Library bool
-	Shared  bool
+var (
+	CrtBeginDepTag = dependencyTag{name: "crtbegin"}
+	CrtEndDepTag   = dependencyTag{name: "crtend"}
+	CoverageDepTag = dependencyTag{name: "coverage"}
+)
 
-	ReexportFlags bool
-
-	ExplicitlyVersioned bool
-
-	FromStatic bool
+func SharedDepTag() blueprint.DependencyTag {
+	return libraryDependencyTag{Kind: sharedLibraryDependency}
 }
 
-var (
-	SharedDepTag = DependencyTag{Name: "shared", Library: true, Shared: true}
-	StaticDepTag = DependencyTag{Name: "static", Library: true}
-
-	// Same as SharedDepTag, but from a static lib
-	SharedFromStaticDepTag = DependencyTag{Name: "shared from static", Library: true, Shared: true, FromStatic: true}
-
-	CrtBeginDepTag = DependencyTag{Name: "crtbegin"}
-	CrtEndDepTag   = DependencyTag{Name: "crtend"}
-	CoverageDepTag = DependencyTag{Name: "coverage"}
-)
+func StaticDepTag() blueprint.DependencyTag {
+	return libraryDependencyTag{Kind: staticLibraryDependency}
+}
diff --git a/cc/llndk_library.go b/cc/llndk_library.go
index 7ff20f4..71c9204 100644
--- a/cc/llndk_library.go
+++ b/cc/llndk_library.go
@@ -225,6 +225,8 @@
 func llndkHeadersFactory() android.Module {
 	module, library := NewLibrary(android.DeviceSupported)
 	library.HeaderOnly()
+	module.stl = nil
+	module.sanitize = nil
 
 	decorator := &llndkHeadersDecorator{
 		libraryDecorator: library,
diff --git a/cc/lto.go b/cc/lto.go
index 4489fc7..ed3abe7 100644
--- a/cc/lto.go
+++ b/cc/lto.go
@@ -148,24 +148,33 @@
 
 		mctx.WalkDeps(func(dep android.Module, parent android.Module) bool {
 			tag := mctx.OtherModuleDependencyTag(dep)
-			switch tag {
-			case StaticDepTag, staticExportDepTag, lateStaticDepTag, wholeStaticDepTag, objDepTag, reuseObjTag:
-				if dep, ok := dep.(*Module); ok && dep.lto != nil &&
-					!dep.lto.Disabled() {
-					if full && !Bool(dep.lto.Properties.Lto.Full) {
-						dep.lto.Properties.FullDep = true
-					}
-					if thin && !Bool(dep.lto.Properties.Lto.Thin) {
-						dep.lto.Properties.ThinDep = true
-					}
-				}
-
-				// Recursively walk static dependencies
-				return true
-			}
+			libTag, isLibTag := tag.(libraryDependencyTag)
 
 			// Do not recurse down non-static dependencies
-			return false
+			if isLibTag {
+				// TODO(ccross): the staticUnwinder check is there to maintain existing behavior
+				//   when adding libraryDependencyTag and should be removed.
+				if !libTag.static() || libTag.staticUnwinder {
+					return false
+				}
+			} else {
+				if tag != objDepTag && tag != reuseObjTag {
+					return false
+				}
+			}
+
+			if dep, ok := dep.(*Module); ok && dep.lto != nil &&
+				!dep.lto.Disabled() {
+				if full && !Bool(dep.lto.Properties.Lto.Full) {
+					dep.lto.Properties.FullDep = true
+				}
+				if thin && !Bool(dep.lto.Properties.Lto.Thin) {
+					dep.lto.Properties.ThinDep = true
+				}
+			}
+
+			// Recursively walk static dependencies
+			return true
 		})
 	}
 }
diff --git a/cc/ndk_api_coverage_parser/.gitignore b/cc/ndk_api_coverage_parser/.gitignore
new file mode 100644
index 0000000..fd94eac
--- /dev/null
+++ b/cc/ndk_api_coverage_parser/.gitignore
@@ -0,0 +1,140 @@
+# From https://github.com/github/gitignore/blob/master/Python.gitignore
+
+# Byte-compiled / optimized / DLL files
+__pycache__/
+*.py[cod]
+*$py.class
+
+# C extensions
+*.so
+
+# Distribution / packaging
+.Python
+build/
+develop-eggs/
+dist/
+downloads/
+eggs/
+.eggs/
+lib/
+lib64/
+parts/
+sdist/
+var/
+wheels/
+share/python-wheels/
+*.egg-info/
+.installed.cfg
+*.egg
+MANIFEST
+
+# PyInstaller
+#  Usually these files are written by a python script from a template
+#  before PyInstaller builds the exe, so as to inject date/other infos into it.
+*.manifest
+*.spec
+
+# Installer logs
+pip-log.txt
+pip-delete-this-directory.txt
+
+# Unit test / coverage reports
+htmlcov/
+.tox/
+.nox/
+.coverage
+.coverage.*
+.cache
+nosetests.xml
+coverage.xml
+*.cover
+*.py,cover
+.hypothesis/
+.pytest_cache/
+cover/
+
+# Translations
+*.mo
+*.pot
+
+# Django stuff:
+*.log
+local_settings.py
+db.sqlite3
+db.sqlite3-journal
+
+# Flask stuff:
+instance/
+.webassets-cache
+
+# Scrapy stuff:
+.scrapy
+
+# Sphinx documentation
+docs/_build/
+
+# PyBuilder
+.pybuilder/
+target/
+
+# Jupyter Notebook
+.ipynb_checkpoints
+
+# IPython
+profile_default/
+ipython_config.py
+
+# pyenv
+#   For a library or package, you might want to ignore these files since the code is
+#   intended to run in multiple environments; otherwise, check them in:
+# .python-version
+
+# pipenv
+#   According to pypa/pipenv#598, it is recommended to include Pipfile.lock in version control.
+#   However, in case of collaboration, if having platform-specific dependencies or dependencies
+#   having no cross-platform support, pipenv may install dependencies that don't work, or not
+#   install all needed dependencies.
+#Pipfile.lock
+
+# PEP 582; used by e.g. github.com/David-OConnor/pyflow
+__pypackages__/
+
+# Celery stuff
+celerybeat-schedule
+celerybeat.pid
+
+# SageMath parsed files
+*.sage.py
+
+# Environments
+.env
+.venv
+env/
+venv/
+ENV/
+env.bak/
+venv.bak/
+
+# Spyder project settings
+.spyderproject
+.spyproject
+
+# Rope project settings
+.ropeproject
+
+# mkdocs documentation
+/site
+
+# mypy
+.mypy_cache/
+.dmypy.json
+dmypy.json
+
+# Pyre type checker
+.pyre/
+
+# pytype static type analyzer
+.pytype/
+
+# Cython debug symbols
+cython_debug/
diff --git a/cc/scriptlib/Android.bp b/cc/ndk_api_coverage_parser/Android.bp
similarity index 73%
rename from cc/scriptlib/Android.bp
rename to cc/ndk_api_coverage_parser/Android.bp
index ff9a2f0..8d9827c 100644
--- a/cc/scriptlib/Android.bp
+++ b/cc/ndk_api_coverage_parser/Android.bp
@@ -14,19 +14,33 @@
 // limitations under the License.
 //
 
+python_library_host {
+    name: "ndk_api_coverage_parser_lib",
+    pkg_path: "ndk_api_coverage_parser",
+    srcs: [
+        "__init__.py",
+    ],
+}
+
 python_test_host {
     name: "test_ndk_api_coverage_parser",
     main: "test_ndk_api_coverage_parser.py",
     srcs: [
         "test_ndk_api_coverage_parser.py",
     ],
+    libs: [
+        "ndk_api_coverage_parser_lib",
+        "symbolfile",
+    ],
 }
 
 python_binary_host {
     name: "ndk_api_coverage_parser",
-    main: "ndk_api_coverage_parser.py",
+    main: "__init__.py",
     srcs: [
-        "gen_stub_libs.py",
-        "ndk_api_coverage_parser.py",
+        "__init__.py",
+    ],
+    libs: [
+        "symbolfile",
     ],
 }
diff --git a/cc/ndk_api_coverage_parser/OWNERS b/cc/ndk_api_coverage_parser/OWNERS
new file mode 100644
index 0000000..a90c48c
--- /dev/null
+++ b/cc/ndk_api_coverage_parser/OWNERS
@@ -0,0 +1 @@
+sophiez@google.com
diff --git a/cc/scriptlib/ndk_api_coverage_parser.py b/cc/ndk_api_coverage_parser/__init__.py
similarity index 96%
rename from cc/scriptlib/ndk_api_coverage_parser.py
rename to cc/ndk_api_coverage_parser/__init__.py
index d74035b..7817c78 100755
--- a/cc/scriptlib/ndk_api_coverage_parser.py
+++ b/cc/ndk_api_coverage_parser/__init__.py
@@ -21,7 +21,7 @@
 import sys
 
 from xml.etree.ElementTree import Element, SubElement, tostring
-from gen_stub_libs import ALL_ARCHITECTURES, FUTURE_API_LEVEL, MultiplyDefinedSymbolError, SymbolFileParser
+from symbolfile import ALL_ARCHITECTURES, FUTURE_API_LEVEL, MultiplyDefinedSymbolError, SymbolFileParser
 
 
 ROOT_ELEMENT_TAG = 'ndk-library'
diff --git a/cc/ndk_api_coverage_parser/test_ndk_api_coverage_parser.py b/cc/ndk_api_coverage_parser/test_ndk_api_coverage_parser.py
new file mode 100644
index 0000000..3ec14c1
--- /dev/null
+++ b/cc/ndk_api_coverage_parser/test_ndk_api_coverage_parser.py
@@ -0,0 +1,90 @@
+#!/usr/bin/env python
+#
+# Copyright (C) 2016 The Android Open Source Project
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#      http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+"""Tests for ndk_api_coverage_parser.py."""
+import io
+import textwrap
+import unittest
+
+from xml.etree.ElementTree import fromstring
+from symbolfile import FUTURE_API_LEVEL, SymbolFileParser
+import ndk_api_coverage_parser as nparser
+
+
+# pylint: disable=missing-docstring
+
+
+# https://stackoverflow.com/a/24349916/632035
+def etree_equal(elem1, elem2):
+    """Returns true if the two XML elements are equal.
+
+    xml.etree.ElementTree's comparison operator cares about the ordering of
+    elements and attributes, but they are stored in an unordered dict so the
+    ordering is not deterministic.
+
+    lxml is apparently API compatible with xml and does use an OrderedDict, but
+    we don't have it in the tree.
+    """
+    if elem1.tag != elem2.tag:
+        return False
+    if elem1.text != elem2.text:
+        return False
+    if elem1.tail != elem2.tail:
+        return False
+    if elem1.attrib != elem2.attrib:
+        return False
+    if len(elem1) != len(elem2):
+        return False
+    return all(etree_equal(c1, c2) for c1, c2 in zip(elem1, elem2))
+
+
+class ApiCoverageSymbolFileParserTest(unittest.TestCase):
+    def test_parse(self):
+        input_file = io.StringIO(textwrap.dedent(u"""\
+            LIBLOG { # introduced-arm64=24 introduced-x86=24 introduced-x86_64=24
+              global:
+                android_name_to_log_id; # apex llndk introduced=23
+                android_log_id_to_name; # llndk arm
+                __android_log_assert; # introduced-x86=23
+                __android_log_buf_print; # var
+                __android_log_buf_write;
+              local:
+                *;
+            };
+            
+            LIBLOG_PLATFORM {
+                android_fdtrack; # llndk
+                android_net; # introduced=23
+            };
+            
+            LIBLOG_FOO { # var
+                android_var;
+            };
+        """))
+        parser = SymbolFileParser(input_file, {}, "", FUTURE_API_LEVEL, True, True)
+        generator = nparser.XmlGenerator(io.StringIO())
+        result = generator.convertToXml(parser.parse())
+        expected = fromstring('<ndk-library><symbol apex="True" arch="" introduced="23" introduced-arm64="24" introduced-x86="24" introduced-x86_64="24" is_deprecated="False" is_platform="False" llndk="True" name="android_name_to_log_id" /><symbol arch="arm" introduced-arm64="24" introduced-x86="24" introduced-x86_64="24" is_deprecated="False" is_platform="False" llndk="True" name="android_log_id_to_name" /><symbol arch="" introduced-arm64="24" introduced-x86="23" introduced-x86_64="24" is_deprecated="False" is_platform="False" name="__android_log_assert" /><symbol arch="" introduced-arm64="24" introduced-x86="24" introduced-x86_64="24" is_deprecated="False" is_platform="False" name="__android_log_buf_write" /><symbol arch="" is_deprecated="False" is_platform="True" llndk="True" name="android_fdtrack" /><symbol arch="" introduced="23" is_deprecated="False" is_platform="True" name="android_net" /></ndk-library>')
+        self.assertTrue(etree_equal(expected, result))
+
+
+def main():
+    suite = unittest.TestLoader().loadTestsFromName(__name__)
+    unittest.TextTestRunner(verbosity=3).run(suite)
+
+
+if __name__ == '__main__':
+    main()
diff --git a/cc/ndk_library.go b/cc/ndk_library.go
index 6299b00..22e3ec3 100644
--- a/cc/ndk_library.go
+++ b/cc/ndk_library.go
@@ -26,17 +26,16 @@
 )
 
 func init() {
+	pctx.HostBinToolVariable("ndkStubGenerator", "ndkstubgen")
 	pctx.HostBinToolVariable("ndk_api_coverage_parser", "ndk_api_coverage_parser")
 }
 
 var (
-	toolPath = pctx.SourcePathVariable("toolPath", "build/soong/cc/scriptlib/gen_stub_libs.py")
-
 	genStubSrc = pctx.AndroidStaticRule("genStubSrc",
 		blueprint.RuleParams{
-			Command: "$toolPath --arch $arch --api $apiLevel --api-map " +
-				"$apiMap $flags $in $out",
-			CommandDeps: []string{"$toolPath"},
+			Command: "$ndkStubGenerator --arch $arch --api $apiLevel " +
+				"--api-map $apiMap $flags $in $out",
+			CommandDeps: []string{"$ndkStubGenerator"},
 		}, "arch", "apiLevel", "apiMap", "flags")
 
 	parseNdkApiRule = pctx.AndroidStaticRule("parseNdkApiRule",
@@ -78,9 +77,9 @@
 	// https://github.com/android-ndk/ndk/issues/265.
 	Unversioned_until *string
 
-	// Private property for use by the mutator that splits per-API level.
-	// can be one of <number:sdk_version> or <codename> or "current"
-	// passed to "gen_stub_libs.py" as it is
+	// Private property for use by the mutator that splits per-API level. Can be
+	// one of <number:sdk_version> or <codename> or "current" passed to
+	// "ndkstubgen.py" as it is
 	ApiLevel string `blueprint:"mutated"`
 
 	// True if this API is not yet ready to be shipped in the NDK. It will be
@@ -397,8 +396,8 @@
 	return module
 }
 
-// ndk_library creates a stub library that exposes dummy implementation
-// of functions and variables for use at build time only.
+// ndk_library creates a library that exposes a stub implementation of functions
+// and variables for use at build time only.
 func NdkLibraryFactory() android.Module {
 	module := newStubLibrary()
 	android.InitAndroidArchModule(module, android.DeviceSupported, android.MultilibBoth)
diff --git a/cc/ndkstubgen/.gitignore b/cc/ndkstubgen/.gitignore
new file mode 100644
index 0000000..fd94eac
--- /dev/null
+++ b/cc/ndkstubgen/.gitignore
@@ -0,0 +1,140 @@
+# From https://github.com/github/gitignore/blob/master/Python.gitignore
+
+# Byte-compiled / optimized / DLL files
+__pycache__/
+*.py[cod]
+*$py.class
+
+# C extensions
+*.so
+
+# Distribution / packaging
+.Python
+build/
+develop-eggs/
+dist/
+downloads/
+eggs/
+.eggs/
+lib/
+lib64/
+parts/
+sdist/
+var/
+wheels/
+share/python-wheels/
+*.egg-info/
+.installed.cfg
+*.egg
+MANIFEST
+
+# PyInstaller
+#  Usually these files are written by a python script from a template
+#  before PyInstaller builds the exe, so as to inject date/other infos into it.
+*.manifest
+*.spec
+
+# Installer logs
+pip-log.txt
+pip-delete-this-directory.txt
+
+# Unit test / coverage reports
+htmlcov/
+.tox/
+.nox/
+.coverage
+.coverage.*
+.cache
+nosetests.xml
+coverage.xml
+*.cover
+*.py,cover
+.hypothesis/
+.pytest_cache/
+cover/
+
+# Translations
+*.mo
+*.pot
+
+# Django stuff:
+*.log
+local_settings.py
+db.sqlite3
+db.sqlite3-journal
+
+# Flask stuff:
+instance/
+.webassets-cache
+
+# Scrapy stuff:
+.scrapy
+
+# Sphinx documentation
+docs/_build/
+
+# PyBuilder
+.pybuilder/
+target/
+
+# Jupyter Notebook
+.ipynb_checkpoints
+
+# IPython
+profile_default/
+ipython_config.py
+
+# pyenv
+#   For a library or package, you might want to ignore these files since the code is
+#   intended to run in multiple environments; otherwise, check them in:
+# .python-version
+
+# pipenv
+#   According to pypa/pipenv#598, it is recommended to include Pipfile.lock in version control.
+#   However, in case of collaboration, if having platform-specific dependencies or dependencies
+#   having no cross-platform support, pipenv may install dependencies that don't work, or not
+#   install all needed dependencies.
+#Pipfile.lock
+
+# PEP 582; used by e.g. github.com/David-OConnor/pyflow
+__pypackages__/
+
+# Celery stuff
+celerybeat-schedule
+celerybeat.pid
+
+# SageMath parsed files
+*.sage.py
+
+# Environments
+.env
+.venv
+env/
+venv/
+ENV/
+env.bak/
+venv.bak/
+
+# Spyder project settings
+.spyderproject
+.spyproject
+
+# Rope project settings
+.ropeproject
+
+# mkdocs documentation
+/site
+
+# mypy
+.mypy_cache/
+.dmypy.json
+dmypy.json
+
+# Pyre type checker
+.pyre/
+
+# pytype static type analyzer
+.pytype/
+
+# Cython debug symbols
+cython_debug/
diff --git a/cc/scriptlib/Android.bp b/cc/ndkstubgen/Android.bp
similarity index 63%
copy from cc/scriptlib/Android.bp
copy to cc/ndkstubgen/Android.bp
index ff9a2f0..85dfaee 100644
--- a/cc/scriptlib/Android.bp
+++ b/cc/ndkstubgen/Android.bp
@@ -14,19 +14,35 @@
 // limitations under the License.
 //
 
-python_test_host {
-    name: "test_ndk_api_coverage_parser",
-    main: "test_ndk_api_coverage_parser.py",
+python_binary_host {
+    name: "ndkstubgen",
+    pkg_path: "ndkstubgen",
+    main: "__init__.py",
     srcs: [
-        "test_ndk_api_coverage_parser.py",
+        "__init__.py",
+    ],
+    libs: [
+        "symbolfile",
     ],
 }
 
-python_binary_host {
-    name: "ndk_api_coverage_parser",
-    main: "ndk_api_coverage_parser.py",
+python_library_host {
+    name: "ndkstubgenlib",
+    pkg_path: "ndkstubgen",
     srcs: [
-        "gen_stub_libs.py",
-        "ndk_api_coverage_parser.py",
+        "__init__.py",
+    ],
+    libs: [
+        "symbolfile",
+    ],
+}
+
+python_test_host {
+    name: "test_ndkstubgen",
+    srcs: [
+        "test_ndkstubgen.py",
+    ],
+    libs: [
+        "ndkstubgenlib",
     ],
 }
diff --git a/cc/ndkstubgen/OWNERS b/cc/ndkstubgen/OWNERS
new file mode 100644
index 0000000..f0d8733
--- /dev/null
+++ b/cc/ndkstubgen/OWNERS
@@ -0,0 +1 @@
+danalbert@google.com
diff --git a/cc/ndkstubgen/__init__.py b/cc/ndkstubgen/__init__.py
new file mode 100755
index 0000000..2f4326a
--- /dev/null
+++ b/cc/ndkstubgen/__init__.py
@@ -0,0 +1,149 @@
+#!/usr/bin/env python
+#
+# Copyright (C) 2016 The Android Open Source Project
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#      http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+"""Generates source for stub shared libraries for the NDK."""
+import argparse
+import json
+import logging
+import os
+import sys
+
+import symbolfile
+
+
+class Generator:
+    """Output generator that writes stub source files and version scripts."""
+    def __init__(self, src_file, version_script, arch, api, llndk, apex):
+        self.src_file = src_file
+        self.version_script = version_script
+        self.arch = arch
+        self.api = api
+        self.llndk = llndk
+        self.apex = apex
+
+    def write(self, versions):
+        """Writes all symbol data to the output files."""
+        for version in versions:
+            self.write_version(version)
+
+    def write_version(self, version):
+        """Writes a single version block's data to the output files."""
+        if symbolfile.should_omit_version(version, self.arch, self.api,
+                                          self.llndk, self.apex):
+            return
+
+        section_versioned = symbolfile.symbol_versioned_in_api(
+            version.tags, self.api)
+        version_empty = True
+        pruned_symbols = []
+        for symbol in version.symbols:
+            if symbolfile.should_omit_symbol(symbol, self.arch, self.api,
+                                             self.llndk, self.apex):
+                continue
+
+            if symbolfile.symbol_versioned_in_api(symbol.tags, self.api):
+                version_empty = False
+            pruned_symbols.append(symbol)
+
+        if len(pruned_symbols) > 0:
+            if not version_empty and section_versioned:
+                self.version_script.write(version.name + ' {\n')
+                self.version_script.write('    global:\n')
+            for symbol in pruned_symbols:
+                emit_version = symbolfile.symbol_versioned_in_api(
+                    symbol.tags, self.api)
+                if section_versioned and emit_version:
+                    self.version_script.write('        ' + symbol.name + ';\n')
+
+                weak = ''
+                if 'weak' in symbol.tags:
+                    weak = '__attribute__((weak)) '
+
+                if 'var' in symbol.tags:
+                    self.src_file.write('{}int {} = 0;\n'.format(
+                        weak, symbol.name))
+                else:
+                    self.src_file.write('{}void {}() {{}}\n'.format(
+                        weak, symbol.name))
+
+            if not version_empty and section_versioned:
+                base = '' if version.base is None else ' ' + version.base
+                self.version_script.write('}' + base + ';\n')
+
+
+def parse_args():
+    """Parses and returns command line arguments."""
+    parser = argparse.ArgumentParser()
+
+    parser.add_argument('-v', '--verbose', action='count', default=0)
+
+    parser.add_argument(
+        '--api', required=True, help='API level being targeted.')
+    parser.add_argument(
+        '--arch', choices=symbolfile.ALL_ARCHITECTURES, required=True,
+        help='Architecture being targeted.')
+    parser.add_argument(
+        '--llndk', action='store_true', help='Use the LLNDK variant.')
+    parser.add_argument(
+        '--apex', action='store_true', help='Use the APEX variant.')
+
+    parser.add_argument(
+        '--api-map', type=os.path.realpath, required=True,
+        help='Path to the API level map JSON file.')
+
+    parser.add_argument(
+        'symbol_file', type=os.path.realpath, help='Path to symbol file.')
+    parser.add_argument(
+        'stub_src', type=os.path.realpath,
+        help='Path to output stub source file.')
+    parser.add_argument(
+        'version_script', type=os.path.realpath,
+        help='Path to output version script.')
+
+    return parser.parse_args()
+
+
+def main():
+    """Program entry point."""
+    args = parse_args()
+
+    with open(args.api_map) as map_file:
+        api_map = json.load(map_file)
+    api = symbolfile.decode_api_level(args.api, api_map)
+
+    verbose_map = (logging.WARNING, logging.INFO, logging.DEBUG)
+    verbosity = args.verbose
+    if verbosity > 2:
+        verbosity = 2
+    logging.basicConfig(level=verbose_map[verbosity])
+
+    with open(args.symbol_file) as symbol_file:
+        try:
+            versions = symbolfile.SymbolFileParser(symbol_file, api_map,
+                                                   args.arch, api, args.llndk,
+                                                   args.apex).parse()
+        except symbolfile.MultiplyDefinedSymbolError as ex:
+            sys.exit('{}: error: {}'.format(args.symbol_file, ex))
+
+    with open(args.stub_src, 'w') as src_file:
+        with open(args.version_script, 'w') as version_file:
+            generator = Generator(src_file, version_file, args.arch, api,
+                                  args.llndk, args.apex)
+            generator.write(versions)
+
+
+if __name__ == '__main__':
+    main()
diff --git a/cc/ndkstubgen/test_ndkstubgen.py b/cc/ndkstubgen/test_ndkstubgen.py
new file mode 100755
index 0000000..70bcf78
--- /dev/null
+++ b/cc/ndkstubgen/test_ndkstubgen.py
@@ -0,0 +1,378 @@
+#!/usr/bin/env python
+#
+# Copyright (C) 2016 The Android Open Source Project
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#      http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+"""Tests for ndkstubgen.py."""
+import io
+import textwrap
+import unittest
+
+import ndkstubgen
+import symbolfile
+
+
+# pylint: disable=missing-docstring
+
+
+class GeneratorTest(unittest.TestCase):
+    def test_omit_version(self):
+        # Thorough testing of the cases involved here is handled by
+        # OmitVersionTest, PrivateVersionTest, and SymbolPresenceTest.
+        src_file = io.StringIO()
+        version_file = io.StringIO()
+        generator = ndkstubgen.Generator(src_file, version_file, 'arm', 9,
+                                         False, False)
+
+        version = symbolfile.Version('VERSION_PRIVATE', None, [], [
+            symbolfile.Symbol('foo', []),
+        ])
+        generator.write_version(version)
+        self.assertEqual('', src_file.getvalue())
+        self.assertEqual('', version_file.getvalue())
+
+        version = symbolfile.Version('VERSION', None, ['x86'], [
+            symbolfile.Symbol('foo', []),
+        ])
+        generator.write_version(version)
+        self.assertEqual('', src_file.getvalue())
+        self.assertEqual('', version_file.getvalue())
+
+        version = symbolfile.Version('VERSION', None, ['introduced=14'], [
+            symbolfile.Symbol('foo', []),
+        ])
+        generator.write_version(version)
+        self.assertEqual('', src_file.getvalue())
+        self.assertEqual('', version_file.getvalue())
+
+    def test_omit_symbol(self):
+        # Thorough testing of the cases involved here is handled by
+        # SymbolPresenceTest.
+        src_file = io.StringIO()
+        version_file = io.StringIO()
+        generator = ndkstubgen.Generator(src_file, version_file, 'arm', 9,
+                                         False, False)
+
+        version = symbolfile.Version('VERSION_1', None, [], [
+            symbolfile.Symbol('foo', ['x86']),
+        ])
+        generator.write_version(version)
+        self.assertEqual('', src_file.getvalue())
+        self.assertEqual('', version_file.getvalue())
+
+        version = symbolfile.Version('VERSION_1', None, [], [
+            symbolfile.Symbol('foo', ['introduced=14']),
+        ])
+        generator.write_version(version)
+        self.assertEqual('', src_file.getvalue())
+        self.assertEqual('', version_file.getvalue())
+
+        version = symbolfile.Version('VERSION_1', None, [], [
+            symbolfile.Symbol('foo', ['llndk']),
+        ])
+        generator.write_version(version)
+        self.assertEqual('', src_file.getvalue())
+        self.assertEqual('', version_file.getvalue())
+
+        version = symbolfile.Version('VERSION_1', None, [], [
+            symbolfile.Symbol('foo', ['apex']),
+        ])
+        generator.write_version(version)
+        self.assertEqual('', src_file.getvalue())
+        self.assertEqual('', version_file.getvalue())
+
+    def test_write(self):
+        src_file = io.StringIO()
+        version_file = io.StringIO()
+        generator = ndkstubgen.Generator(src_file, version_file, 'arm', 9,
+                                         False, False)
+
+        versions = [
+            symbolfile.Version('VERSION_1', None, [], [
+                symbolfile.Symbol('foo', []),
+                symbolfile.Symbol('bar', ['var']),
+                symbolfile.Symbol('woodly', ['weak']),
+                symbolfile.Symbol('doodly', ['weak', 'var']),
+            ]),
+            symbolfile.Version('VERSION_2', 'VERSION_1', [], [
+                symbolfile.Symbol('baz', []),
+            ]),
+            symbolfile.Version('VERSION_3', 'VERSION_1', [], [
+                symbolfile.Symbol('qux', ['versioned=14']),
+            ]),
+        ]
+
+        generator.write(versions)
+        expected_src = textwrap.dedent("""\
+            void foo() {}
+            int bar = 0;
+            __attribute__((weak)) void woodly() {}
+            __attribute__((weak)) int doodly = 0;
+            void baz() {}
+            void qux() {}
+        """)
+        self.assertEqual(expected_src, src_file.getvalue())
+
+        expected_version = textwrap.dedent("""\
+            VERSION_1 {
+                global:
+                    foo;
+                    bar;
+                    woodly;
+                    doodly;
+            };
+            VERSION_2 {
+                global:
+                    baz;
+            } VERSION_1;
+        """)
+        self.assertEqual(expected_version, version_file.getvalue())
+
+
+class IntegrationTest(unittest.TestCase):
+    def test_integration(self):
+        api_map = {
+            'O': 9000,
+            'P': 9001,
+        }
+
+        input_file = io.StringIO(textwrap.dedent("""\
+            VERSION_1 {
+                global:
+                    foo; # var
+                    bar; # x86
+                    fizz; # introduced=O
+                    buzz; # introduced=P
+                local:
+                    *;
+            };
+
+            VERSION_2 { # arm
+                baz; # introduced=9
+                qux; # versioned=14
+            } VERSION_1;
+
+            VERSION_3 { # introduced=14
+                woodly;
+                doodly; # var
+            } VERSION_2;
+
+            VERSION_4 { # versioned=9
+                wibble;
+                wizzes; # llndk
+                waggle; # apex
+            } VERSION_2;
+
+            VERSION_5 { # versioned=14
+                wobble;
+            } VERSION_4;
+        """))
+        parser = symbolfile.SymbolFileParser(input_file, api_map, 'arm', 9,
+                                             False, False)
+        versions = parser.parse()
+
+        src_file = io.StringIO()
+        version_file = io.StringIO()
+        generator = ndkstubgen.Generator(src_file, version_file, 'arm', 9,
+                                         False, False)
+        generator.write(versions)
+
+        expected_src = textwrap.dedent("""\
+            int foo = 0;
+            void baz() {}
+            void qux() {}
+            void wibble() {}
+            void wobble() {}
+        """)
+        self.assertEqual(expected_src, src_file.getvalue())
+
+        expected_version = textwrap.dedent("""\
+            VERSION_1 {
+                global:
+                    foo;
+            };
+            VERSION_2 {
+                global:
+                    baz;
+            } VERSION_1;
+            VERSION_4 {
+                global:
+                    wibble;
+            } VERSION_2;
+        """)
+        self.assertEqual(expected_version, version_file.getvalue())
+
+    def test_integration_future_api(self):
+        api_map = {
+            'O': 9000,
+            'P': 9001,
+            'Q': 9002,
+        }
+
+        input_file = io.StringIO(textwrap.dedent("""\
+            VERSION_1 {
+                global:
+                    foo; # introduced=O
+                    bar; # introduced=P
+                    baz; # introduced=Q
+                local:
+                    *;
+            };
+        """))
+        parser = symbolfile.SymbolFileParser(input_file, api_map, 'arm', 9001,
+                                             False, False)
+        versions = parser.parse()
+
+        src_file = io.StringIO()
+        version_file = io.StringIO()
+        generator = ndkstubgen.Generator(src_file, version_file, 'arm', 9001,
+                                         False, False)
+        generator.write(versions)
+
+        expected_src = textwrap.dedent("""\
+            void foo() {}
+            void bar() {}
+        """)
+        self.assertEqual(expected_src, src_file.getvalue())
+
+        expected_version = textwrap.dedent("""\
+            VERSION_1 {
+                global:
+                    foo;
+                    bar;
+            };
+        """)
+        self.assertEqual(expected_version, version_file.getvalue())
+
+    def test_multiple_definition(self):
+        input_file = io.StringIO(textwrap.dedent("""\
+            VERSION_1 {
+                global:
+                    foo;
+                    foo;
+                    bar;
+                    baz;
+                    qux; # arm
+                local:
+                    *;
+            };
+
+            VERSION_2 {
+                global:
+                    bar;
+                    qux; # arm64
+            } VERSION_1;
+
+            VERSION_PRIVATE {
+                global:
+                    baz;
+            } VERSION_2;
+
+        """))
+        parser = symbolfile.SymbolFileParser(input_file, {}, 'arm', 16, False,
+                                             False)
+
+        with self.assertRaises(
+                symbolfile.MultiplyDefinedSymbolError) as ex_context:
+            parser.parse()
+        self.assertEqual(['bar', 'foo'],
+                         ex_context.exception.multiply_defined_symbols)
+
+    def test_integration_with_apex(self):
+        api_map = {
+            'O': 9000,
+            'P': 9001,
+        }
+
+        input_file = io.StringIO(textwrap.dedent("""\
+            VERSION_1 {
+                global:
+                    foo; # var
+                    bar; # x86
+                    fizz; # introduced=O
+                    buzz; # introduced=P
+                local:
+                    *;
+            };
+
+            VERSION_2 { # arm
+                baz; # introduced=9
+                qux; # versioned=14
+            } VERSION_1;
+
+            VERSION_3 { # introduced=14
+                woodly;
+                doodly; # var
+            } VERSION_2;
+
+            VERSION_4 { # versioned=9
+                wibble;
+                wizzes; # llndk
+                waggle; # apex
+                bubble; # apex llndk
+                duddle; # llndk apex
+            } VERSION_2;
+
+            VERSION_5 { # versioned=14
+                wobble;
+            } VERSION_4;
+        """))
+        parser = symbolfile.SymbolFileParser(input_file, api_map, 'arm', 9,
+                                             False, True)
+        versions = parser.parse()
+
+        src_file = io.StringIO()
+        version_file = io.StringIO()
+        generator = ndkstubgen.Generator(src_file, version_file, 'arm', 9,
+                                         False, True)
+        generator.write(versions)
+
+        expected_src = textwrap.dedent("""\
+            int foo = 0;
+            void baz() {}
+            void qux() {}
+            void wibble() {}
+            void waggle() {}
+            void bubble() {}
+            void duddle() {}
+            void wobble() {}
+        """)
+        self.assertEqual(expected_src, src_file.getvalue())
+
+        expected_version = textwrap.dedent("""\
+            VERSION_1 {
+                global:
+                    foo;
+            };
+            VERSION_2 {
+                global:
+                    baz;
+            } VERSION_1;
+            VERSION_4 {
+                global:
+                    wibble;
+                    waggle;
+                    bubble;
+                    duddle;
+            } VERSION_2;
+        """)
+        self.assertEqual(expected_version, version_file.getvalue())
+
+def main():
+    suite = unittest.TestLoader().loadTestsFromName(__name__)
+    unittest.TextTestRunner(verbosity=3).run(suite)
+
+
+if __name__ == '__main__':
+    main()
diff --git a/cc/pgo.go b/cc/pgo.go
index 9298e7a..674e1bb 100644
--- a/cc/pgo.go
+++ b/cc/pgo.go
@@ -199,8 +199,8 @@
 		return false
 	}
 
-	// If at least one property exists, validate that all properties exist
-	if !profileKindPresent || !filePresent || !benchmarksPresent {
+	// profileKindPresent and filePresent are mandatory properties.
+	if !profileKindPresent || !filePresent {
 		var missing []string
 		if !profileKindPresent {
 			missing = append(missing, "profile kind (either \"instrumentation\" or \"sampling\" property)")
@@ -208,13 +208,15 @@
 		if !filePresent {
 			missing = append(missing, "profile_file property")
 		}
-		if !benchmarksPresent {
-			missing = append(missing, "non-empty benchmarks property")
-		}
 		missingProps := strings.Join(missing, ", ")
 		ctx.ModuleErrorf("PGO specification is missing properties: " + missingProps)
 	}
 
+	// Benchmark property is mandatory for instrumentation PGO.
+	if isInstrumentation && !benchmarksPresent {
+		ctx.ModuleErrorf("Instrumentation PGO specification is missing benchmark property")
+	}
+
 	if isSampling && isInstrumentation {
 		ctx.PropertyErrorf("pgo", "Exactly one of \"instrumentation\" and \"sampling\" properties must be set")
 	}
@@ -288,15 +290,17 @@
 
 	// Add flags to profile this module based on its profile_kind
 	if props.ShouldProfileModule && props.isInstrumentation() {
-		return props.addInstrumentationProfileGatherFlags(ctx, flags)
+		props.addInstrumentationProfileGatherFlags(ctx, flags)
+		// Instrumentation PGO use and gather flags cannot coexist.
+		return flags
 	} else if props.ShouldProfileModule && props.isSampling() {
-		return props.addSamplingProfileGatherFlags(ctx, flags)
+		props.addSamplingProfileGatherFlags(ctx, flags)
 	} else if ctx.DeviceConfig().SamplingPGO() {
-		return props.addSamplingProfileGatherFlags(ctx, flags)
+		props.addSamplingProfileGatherFlags(ctx, flags)
 	}
 
 	if !ctx.Config().IsEnvTrue("ANDROID_PGO_NO_PROFILE_USE") {
-		return props.addProfileUseFlags(ctx, flags)
+		props.addProfileUseFlags(ctx, flags)
 	}
 
 	return flags
diff --git a/cc/prebuilt.go b/cc/prebuilt.go
index 0751f1c..653b43e 100644
--- a/cc/prebuilt.go
+++ b/cc/prebuilt.go
@@ -26,6 +26,7 @@
 	ctx.RegisterModuleType("cc_prebuilt_library", PrebuiltLibraryFactory)
 	ctx.RegisterModuleType("cc_prebuilt_library_shared", PrebuiltSharedLibraryFactory)
 	ctx.RegisterModuleType("cc_prebuilt_library_static", PrebuiltStaticLibraryFactory)
+	ctx.RegisterModuleType("cc_prebuilt_test_library_shared", PrebuiltSharedTestLibraryFactory)
 	ctx.RegisterModuleType("cc_prebuilt_object", prebuiltObjectFactory)
 	ctx.RegisterModuleType("cc_prebuilt_binary", prebuiltBinaryFactory)
 }
@@ -243,6 +244,16 @@
 	return module.Init()
 }
 
+// cc_prebuilt_test_library_shared installs a precompiled shared library
+// to be used as a data dependency of a test-related module (such as cc_test, or
+// cc_test_library).
+func PrebuiltSharedTestLibraryFactory() android.Module {
+	module, library := NewPrebuiltLibrary(android.HostAndDeviceSupported)
+	library.BuildOnlyShared()
+	library.baseInstaller = NewTestInstaller()
+	return module.Init()
+}
+
 func NewPrebuiltSharedLibrary(hod android.HostOrDeviceSupported) (*Module, *libraryDecorator) {
 	module, library := NewPrebuiltLibrary(hod)
 	library.BuildOnlyShared()
diff --git a/cc/pylintrc b/cc/pylintrc
index ed49dd7..2032d4e 100644
--- a/cc/pylintrc
+++ b/cc/pylintrc
@@ -1,280 +1,11 @@
-[MASTER]
-
-# Specify a configuration file.
-#rcfile=
-
-# Python code to execute, usually for sys.path manipulation such as
-# pygtk.require().
-#init-hook=
-
-# Profiled execution.
-profile=no
-
-# Add files or directories to the blacklist. They should be base names, not
-# paths.
-ignore=CVS
-
-# Pickle collected data for later comparisons.
-persistent=yes
-
-# List of plugins (as comma separated values of python modules names) to load,
-# usually to register additional checkers.
-load-plugins=
-
-
 [MESSAGES CONTROL]
-
-# Enable the message, report, category or checker with the given id(s). You can
-# either give multiple identifier separated by comma (,) or put this option
-# multiple time. See also the "--disable" option for examples.
-#enable=
-
-# Disable the message, report, category or checker with the given id(s). You
-# can either give multiple identifiers separated by comma (,) or put this
-# option multiple times (only on the command line, not in the configuration
-# file where it should appear only once).You can also use "--disable=all" to
-# disable everything first and then reenable specific checks. For example, if
-# you want to run only the similarities checker, you can use "--disable=all
-# --enable=similarities". If you want to run only the classes checker, but have
-# no Warning level messages displayed, use"--disable=all --enable=classes
-# --disable=W"
 disable=design,fixme
 
-
-[REPORTS]
-
-# Set the output format. Available formats are text, parseable, colorized, msvs
-# (visual studio) and html. You can also give a reporter class, eg
-# mypackage.mymodule.MyReporterClass.
-output-format=text
-
-# Put messages in a separate file for each module / package specified on the
-# command line instead of printing them on stdout. Reports (if any) will be
-# written in a file name "pylint_global.[txt|html]".
-files-output=no
-
-# Tells whether to display a full report or only the messages
-reports=yes
-
-# Python expression which should return a note less than 10 (10 is the highest
-# note). You have access to the variables errors warning, statement which
-# respectively contain the number of errors / warnings messages and the total
-# number of statements analyzed. This is used by the global evaluation report
-# (RP0004).
-evaluation=10.0 - ((float(5 * error + warning + refactor + convention) / statement) * 10)
-
-# Add a comment according to your evaluation note. This is used by the global
-# evaluation report (RP0004).
-comment=no
-
-# Template used to display messages. This is a python new-style format string
-# used to format the message information. See doc for all details
-#msg-template=
-
-
 [BASIC]
-
-# Required attributes for module, separated by a comma
-required-attributes=
-
-# List of builtins function names that should not be used, separated by a comma
-bad-functions=map,filter,apply,input
-
-# Regular expression which should only match correct module names
-module-rgx=(([a-z_][a-z0-9_]*)|([A-Z][a-zA-Z0-9]+))$
-
-# Regular expression which should only match correct module level names
-const-rgx=(([A-Z_][A-Z0-9_]*)|(__.*__))$
-
-# Regular expression which should only match correct class names
-class-rgx=[A-Z_][a-zA-Z0-9]+$
-
-# Regular expression which should only match correct function names
-function-rgx=[a-z_][a-z0-9_]{2,30}$
-
-# Regular expression which should only match correct method names
-method-rgx=[a-z_][a-z0-9_]{2,30}$
-
-# Regular expression which should only match correct instance attribute names
-attr-rgx=[a-z_][a-z0-9_]{2,30}$
-
-# Regular expression which should only match correct argument names
-argument-rgx=[a-z_][a-z0-9_]{2,30}$
-
-# Regular expression which should only match correct variable names
-variable-rgx=[a-z_][a-z0-9_]{2,30}$
-
-# Regular expression which should only match correct attribute names in class
-# bodies
-class-attribute-rgx=([A-Za-z_][A-Za-z0-9_]{2,30}|(__.*__))$
-
-# Regular expression which should only match correct list comprehension /
-# generator expression variable names
-inlinevar-rgx=[A-Za-z_][A-Za-z0-9_]*$
-
-# Good variable names which should always be accepted, separated by a comma
 good-names=i,j,k,ex,Run,_
 
-# Bad variable names which should always be refused, separated by a comma
-bad-names=foo,bar,baz,toto,tutu,tata
-
-# Regular expression which should only match function or class names that do
-# not require a docstring.
-no-docstring-rgx=__.*__
-
-# Minimum line length for functions/classes that require docstrings, shorter
-# ones are exempt.
-docstring-min-length=-1
-
-
-[TYPECHECK]
-
-# Tells whether missing members accessed in mixin class should be ignored. A
-# mixin class is detected if its name ends with "mixin" (case insensitive).
-ignore-mixin-members=yes
-
-# List of classes names for which member attributes should not be checked
-# (useful for classes with attributes dynamically set).
-ignored-classes=SQLObject
-
-# When zope mode is activated, add a predefined set of Zope acquired attributes
-# to generated-members.
-zope=no
-
-# List of members which are set dynamically and missed by pylint inference
-# system, and so shouldn't trigger E0201 when accessed. Python regular
-# expressions are accepted.
-generated-members=REQUEST,acl_users,aq_parent
-
-
-[MISCELLANEOUS]
-
-# List of note tags to take in consideration, separated by a comma.
-notes=FIXME,XXX,TODO
-
-
 [SIMILARITIES]
-
-# Minimum lines number of a similarity.
-min-similarity-lines=4
-
-# Ignore comments when computing similarities.
-ignore-comments=yes
-
-# Ignore docstrings when computing similarities.
-ignore-docstrings=yes
-
-# Ignore imports when computing similarities.
-ignore-imports=no
-
+ignore-imports=yes
 
 [VARIABLES]
-
-# Tells whether we should check for unused import in __init__ files.
-init-import=no
-
-# A regular expression matching the beginning of the name of dummy variables
-# (i.e. not used).
 dummy-variables-rgx=_|dummy
-
-# List of additional names supposed to be defined in builtins. Remember that
-# you should avoid to define new builtins when possible.
-additional-builtins=
-
-
-[FORMAT]
-
-# Maximum number of characters on a single line.
-max-line-length=80
-
-# Regexp for a line that is allowed to be longer than the limit.
-ignore-long-lines=^\s*(# )?<?https?://\S+>?$
-
-# Allow the body of an if to be on the same line as the test if there is no
-# else.
-single-line-if-stmt=no
-
-# List of optional constructs for which whitespace checking is disabled
-no-space-check=trailing-comma,dict-separator
-
-# Maximum number of lines in a module
-max-module-lines=1000
-
-# String used as indentation unit. This is usually " " (4 spaces) or "\t" (1
-# tab).
-indent-string='    '
-
-
-[IMPORTS]
-
-# Deprecated modules which should not be used, separated by a comma
-deprecated-modules=regsub,TERMIOS,Bastion,rexec
-
-# Create a graph of every (i.e. internal and external) dependencies in the
-# given file (report RP0402 must not be disabled)
-import-graph=
-
-# Create a graph of external dependencies in the given file (report RP0402 must
-# not be disabled)
-ext-import-graph=
-
-# Create a graph of internal dependencies in the given file (report RP0402 must
-# not be disabled)
-int-import-graph=
-
-
-[DESIGN]
-
-# Maximum number of arguments for function / method
-max-args=5
-
-# Argument names that match this expression will be ignored. Default to name
-# with leading underscore
-ignored-argument-names=_.*
-
-# Maximum number of locals for function / method body
-max-locals=15
-
-# Maximum number of return / yield for function / method body
-max-returns=6
-
-# Maximum number of branch for function / method body
-max-branches=12
-
-# Maximum number of statements in function / method body
-max-statements=50
-
-# Maximum number of parents for a class (see R0901).
-max-parents=7
-
-# Maximum number of attributes for a class (see R0902).
-max-attributes=7
-
-# Minimum number of public methods for a class (see R0903).
-min-public-methods=2
-
-# Maximum number of public methods for a class (see R0904).
-max-public-methods=20
-
-
-[CLASSES]
-
-# List of interface methods to ignore, separated by a comma. This is used for
-# instance to not check methods defines in Zope's Interface base class.
-ignore-iface-methods=isImplementedBy,deferred,extends,names,namesAndDescriptions,queryDescriptionFor,getBases,getDescriptionFor,getDoc,getName,getTaggedValue,getTaggedValueTags,isEqualOrExtendedBy,setTaggedValue,isImplementedByInstancesOf,adaptWith,is_implemented_by
-
-# List of method names used to declare (i.e. assign) instance attributes.
-defining-attr-methods=__init__,__new__,setUp
-
-# List of valid names for the first argument in a class method.
-valid-classmethod-first-arg=cls
-
-# List of valid names for the first argument in a metaclass class method.
-valid-metaclass-classmethod-first-arg=mcs
-
-
-[EXCEPTIONS]
-
-# Exceptions that will emit a warning when being caught. Defaults to
-# "Exception"
-overgeneral-exceptions=Exception
diff --git a/cc/sabi.go b/cc/sabi.go
index 8cef170..ef6bead 100644
--- a/cc/sabi.go
+++ b/cc/sabi.go
@@ -83,10 +83,7 @@
 		((c.IsVndk() && c.UseVndk()) || c.isLlndk(mctx.Config()) ||
 			(c.sabi != nil && c.sabi.Properties.CreateSAbiDumps)) {
 		mctx.VisitDirectDeps(func(m android.Module) {
-			tag := mctx.OtherModuleDependencyTag(m)
-			switch tag {
-			case StaticDepTag, staticExportDepTag, lateStaticDepTag, wholeStaticDepTag:
-
+			if tag, ok := mctx.OtherModuleDependencyTag(m).(libraryDependencyTag); ok && tag.static() {
 				cc, _ := m.(*Module)
 				if cc == nil {
 					return
diff --git a/cc/sanitize.go b/cc/sanitize.go
index 136a510..3433dd3 100644
--- a/cc/sanitize.go
+++ b/cc/sanitize.go
@@ -51,17 +51,15 @@
 	}
 
 	cfiCflags = []string{"-flto", "-fsanitize-cfi-cross-dso",
-		"-fsanitize-blacklist=external/compiler-rt/lib/cfi/cfi_blacklist.txt"}
+		"-fsanitize-blacklist=external/compiler-rt/lib/cfi/cfi_blocklist.txt"}
 	// -flto and -fvisibility are required by clang when -fsanitize=cfi is
 	// used, but have no effect on assembly files
 	cfiAsflags = []string{"-flto", "-fvisibility=default"}
 	cfiLdflags = []string{"-flto", "-fsanitize-cfi-cross-dso", "-fsanitize=cfi",
 		"-Wl,-plugin-opt,O1"}
-	cfiExportsMapPath     = "build/soong/cc/config/cfi_exports.map"
-	cfiStaticLibsMutex    sync.Mutex
-	hwasanStaticLibsMutex sync.Mutex
+	cfiExportsMapPath = "build/soong/cc/config/cfi_exports.map"
 
-	intOverflowCflags = []string{"-fsanitize-blacklist=build/soong/cc/config/integer_overflow_blacklist.txt"}
+	intOverflowCflags = []string{"-fsanitize-blacklist=build/soong/cc/config/integer_overflow_blocklist.txt"}
 
 	minimalRuntimeFlags = []string{"-fsanitize-minimal-runtime", "-fno-sanitize-trap=integer,undefined",
 		"-fno-sanitize-recover=integer,undefined"}
@@ -177,6 +175,8 @@
 
 		// value to pass to -fsanitize-blacklist
 		Blacklist *string
+		// value to pass to -fsanitize-blacklist
+		Blocklist *string
 	} `android:"arch_variant"`
 
 	SanitizerEnabled  bool     `blueprint:"mutated"`
@@ -615,6 +615,12 @@
 		flags.CFlagsDeps = append(flags.CFlagsDeps, blacklist.Path())
 	}
 
+	blocklist := android.OptionalPathForModuleSrc(ctx, sanitize.Properties.Sanitize.Blocklist)
+	if blocklist.Valid() {
+		flags.Local.CFlags = append(flags.Local.CFlags, "-fsanitize-blacklist="+blocklist.String())
+		flags.CFlagsDeps = append(flags.CFlagsDeps, blocklist.Path())
+	}
+
 	return flags
 }
 
@@ -725,8 +731,14 @@
 }
 
 func isSanitizableDependencyTag(tag blueprint.DependencyTag) bool {
-	t, ok := tag.(DependencyTag)
-	return ok && t.Library || t == reuseObjTag || t == objDepTag
+	switch t := tag.(type) {
+	case dependencyTag:
+		return t == reuseObjTag || t == objDepTag
+	case libraryDependencyTag:
+		return true
+	default:
+		return false
+	}
 }
 
 // Propagate sanitizer requirements down from binaries
@@ -968,10 +980,11 @@
 				}
 
 				// static executable gets static runtime libs
+				depTag := libraryDependencyTag{Kind: staticLibraryDependency}
 				mctx.AddFarVariationDependencies(append(mctx.Target().Variations(), []blueprint.Variation{
 					{Mutator: "link", Variation: "static"},
 					c.ImageVariation(),
-				}...), StaticDepTag, deps...)
+				}...), depTag, deps...)
 			} else if !c.static() && !c.header() {
 				// If we're using snapshots and in vendor, redirect to snapshot whenever possible
 				if c.VndkVersion() == mctx.DeviceConfig().VndkVersion() {
@@ -982,10 +995,11 @@
 				}
 
 				// dynamic executable and shared libs get shared runtime libs
+				depTag := libraryDependencyTag{Kind: sharedLibraryDependency, Order: earlyLibraryDependency}
 				mctx.AddFarVariationDependencies(append(mctx.Target().Variations(), []blueprint.Variation{
 					{Mutator: "link", Variation: "shared"},
 					c.ImageVariation(),
-				}...), earlySharedDepTag, runtimeLibrary)
+				}...), depTag, runtimeLibrary)
 			}
 			// static lib does not have dependency to the runtime library. The
 			// dependency will be added to the executables or shared libs using
@@ -1053,15 +1067,9 @@
 					// Export the static lib name to make
 					if c.static() && c.ExportedToMake() {
 						if t == cfi {
-							appendStringSync(c.Name(), cfiStaticLibs(mctx.Config()), &cfiStaticLibsMutex)
+							cfiStaticLibs(mctx.Config()).add(c, c.Name())
 						} else if t == hwasan {
-							if c.UseVndk() {
-								appendStringSync(c.Name(), hwasanVendorStaticLibs(mctx.Config()),
-									&hwasanStaticLibsMutex)
-							} else {
-								appendStringSync(c.Name(), hwasanStaticLibs(mctx.Config()),
-									&hwasanStaticLibsMutex)
-							}
+							hwasanStaticLibs(mctx.Config()).add(c, c.Name())
 						}
 					}
 				} else {
@@ -1091,34 +1099,74 @@
 	}
 }
 
+type sanitizerStaticLibsMap struct {
+	// libsMap contains one list of modules per each image and each arch.
+	// e.g. libs[vendor]["arm"] contains arm modules installed to vendor
+	libsMap       map[imageVariantType]map[string][]string
+	libsMapLock   sync.Mutex
+	sanitizerType sanitizerType
+}
+
+func newSanitizerStaticLibsMap(t sanitizerType) *sanitizerStaticLibsMap {
+	return &sanitizerStaticLibsMap{
+		sanitizerType: t,
+		libsMap:       make(map[imageVariantType]map[string][]string),
+	}
+}
+
+// Add the current module to sanitizer static libs maps
+// Each module should pass its exported name as names of Make and Soong can differ.
+func (s *sanitizerStaticLibsMap) add(c *Module, name string) {
+	image := c.getImageVariantType()
+	arch := c.Arch().ArchType.String()
+
+	s.libsMapLock.Lock()
+	defer s.libsMapLock.Unlock()
+
+	if _, ok := s.libsMap[image]; !ok {
+		s.libsMap[image] = make(map[string][]string)
+	}
+
+	s.libsMap[image][arch] = append(s.libsMap[image][arch], name)
+}
+
+// Exports makefile variables in the following format:
+// SOONG_{sanitizer}_{image}_{arch}_STATIC_LIBRARIES
+// e.g. SOONG_cfi_core_x86_STATIC_LIBRARIES
+// These are to be used by use_soong_sanitized_static_libraries.
+// See build/make/core/binary.mk for more details.
+func (s *sanitizerStaticLibsMap) exportToMake(ctx android.MakeVarsContext) {
+	for _, image := range android.SortedStringKeys(s.libsMap) {
+		archMap := s.libsMap[imageVariantType(image)]
+		for _, arch := range android.SortedStringKeys(archMap) {
+			libs := archMap[arch]
+			sort.Strings(libs)
+
+			key := fmt.Sprintf(
+				"SOONG_%s_%s_%s_STATIC_LIBRARIES",
+				s.sanitizerType.variationName(),
+				image, // already upper
+				arch)
+
+			ctx.Strict(key, strings.Join(libs, " "))
+		}
+	}
+}
+
 var cfiStaticLibsKey = android.NewOnceKey("cfiStaticLibs")
 
-func cfiStaticLibs(config android.Config) *[]string {
+func cfiStaticLibs(config android.Config) *sanitizerStaticLibsMap {
 	return config.Once(cfiStaticLibsKey, func() interface{} {
-		return &[]string{}
-	}).(*[]string)
+		return newSanitizerStaticLibsMap(cfi)
+	}).(*sanitizerStaticLibsMap)
 }
 
 var hwasanStaticLibsKey = android.NewOnceKey("hwasanStaticLibs")
 
-func hwasanStaticLibs(config android.Config) *[]string {
+func hwasanStaticLibs(config android.Config) *sanitizerStaticLibsMap {
 	return config.Once(hwasanStaticLibsKey, func() interface{} {
-		return &[]string{}
-	}).(*[]string)
-}
-
-var hwasanVendorStaticLibsKey = android.NewOnceKey("hwasanVendorStaticLibs")
-
-func hwasanVendorStaticLibs(config android.Config) *[]string {
-	return config.Once(hwasanVendorStaticLibsKey, func() interface{} {
-		return &[]string{}
-	}).(*[]string)
-}
-
-func appendStringSync(item string, list *[]string, mutex *sync.Mutex) {
-	mutex.Lock()
-	*list = append(*list, item)
-	mutex.Unlock()
+		return newSanitizerStaticLibsMap(hwasan)
+	}).(*sanitizerStaticLibsMap)
 }
 
 func enableMinimalRuntime(sanitize *sanitize) bool {
@@ -1148,17 +1196,9 @@
 }
 
 func cfiMakeVarsProvider(ctx android.MakeVarsContext) {
-	cfiStaticLibs := cfiStaticLibs(ctx.Config())
-	sort.Strings(*cfiStaticLibs)
-	ctx.Strict("SOONG_CFI_STATIC_LIBRARIES", strings.Join(*cfiStaticLibs, " "))
+	cfiStaticLibs(ctx.Config()).exportToMake(ctx)
 }
 
 func hwasanMakeVarsProvider(ctx android.MakeVarsContext) {
-	hwasanStaticLibs := hwasanStaticLibs(ctx.Config())
-	sort.Strings(*hwasanStaticLibs)
-	ctx.Strict("SOONG_HWASAN_STATIC_LIBRARIES", strings.Join(*hwasanStaticLibs, " "))
-
-	hwasanVendorStaticLibs := hwasanVendorStaticLibs(ctx.Config())
-	sort.Strings(*hwasanVendorStaticLibs)
-	ctx.Strict("SOONG_HWASAN_VENDOR_STATIC_LIBRARIES", strings.Join(*hwasanVendorStaticLibs, " "))
+	hwasanStaticLibs(ctx.Config()).exportToMake(ctx)
 }
diff --git a/cc/scriptlib/__init__.py b/cc/scriptlib/__init__.py
deleted file mode 100644
index e69de29..0000000
--- a/cc/scriptlib/__init__.py
+++ /dev/null
diff --git a/cc/scriptlib/test_gen_stub_libs.py b/cc/scriptlib/test_gen_stub_libs.py
deleted file mode 100755
index 0b45e71..0000000
--- a/cc/scriptlib/test_gen_stub_libs.py
+++ /dev/null
@@ -1,807 +0,0 @@
-#!/usr/bin/env python
-#
-# Copyright (C) 2016 The Android Open Source Project
-#
-# Licensed under the Apache License, Version 2.0 (the "License");
-# you may not use this file except in compliance with the License.
-# You may obtain a copy of the License at
-#
-#      http://www.apache.org/licenses/LICENSE-2.0
-#
-# Unless required by applicable law or agreed to in writing, software
-# distributed under the License is distributed on an "AS IS" BASIS,
-# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-# See the License for the specific language governing permissions and
-# limitations under the License.
-#
-"""Tests for gen_stub_libs.py."""
-import io
-import textwrap
-import unittest
-
-import gen_stub_libs as gsl
-
-
-# pylint: disable=missing-docstring
-
-
-class DecodeApiLevelTest(unittest.TestCase):
-    def test_decode_api_level(self):
-        self.assertEqual(9, gsl.decode_api_level('9', {}))
-        self.assertEqual(9000, gsl.decode_api_level('O', {'O': 9000}))
-
-        with self.assertRaises(KeyError):
-            gsl.decode_api_level('O', {})
-
-
-class TagsTest(unittest.TestCase):
-    def test_get_tags_no_tags(self):
-        self.assertEqual([], gsl.get_tags(''))
-        self.assertEqual([], gsl.get_tags('foo bar baz'))
-
-    def test_get_tags(self):
-        self.assertEqual(['foo', 'bar'], gsl.get_tags('# foo bar'))
-        self.assertEqual(['bar', 'baz'], gsl.get_tags('foo # bar baz'))
-
-    def test_split_tag(self):
-        self.assertTupleEqual(('foo', 'bar'), gsl.split_tag('foo=bar'))
-        self.assertTupleEqual(('foo', 'bar=baz'), gsl.split_tag('foo=bar=baz'))
-        with self.assertRaises(ValueError):
-            gsl.split_tag('foo')
-
-    def test_get_tag_value(self):
-        self.assertEqual('bar', gsl.get_tag_value('foo=bar'))
-        self.assertEqual('bar=baz', gsl.get_tag_value('foo=bar=baz'))
-        with self.assertRaises(ValueError):
-            gsl.get_tag_value('foo')
-
-    def test_is_api_level_tag(self):
-        self.assertTrue(gsl.is_api_level_tag('introduced=24'))
-        self.assertTrue(gsl.is_api_level_tag('introduced-arm=24'))
-        self.assertTrue(gsl.is_api_level_tag('versioned=24'))
-
-        # Shouldn't try to process things that aren't a key/value tag.
-        self.assertFalse(gsl.is_api_level_tag('arm'))
-        self.assertFalse(gsl.is_api_level_tag('introduced'))
-        self.assertFalse(gsl.is_api_level_tag('versioned'))
-
-        # We don't support arch specific `versioned` tags.
-        self.assertFalse(gsl.is_api_level_tag('versioned-arm=24'))
-
-    def test_decode_api_level_tags(self):
-        api_map = {
-            'O': 9000,
-            'P': 9001,
-        }
-
-        tags = [
-            'introduced=9',
-            'introduced-arm=14',
-            'versioned=16',
-            'arm',
-            'introduced=O',
-            'introduced=P',
-        ]
-        expected_tags = [
-            'introduced=9',
-            'introduced-arm=14',
-            'versioned=16',
-            'arm',
-            'introduced=9000',
-            'introduced=9001',
-        ]
-        self.assertListEqual(
-            expected_tags, gsl.decode_api_level_tags(tags, api_map))
-
-        with self.assertRaises(gsl.ParseError):
-            gsl.decode_api_level_tags(['introduced=O'], {})
-
-
-class PrivateVersionTest(unittest.TestCase):
-    def test_version_is_private(self):
-        self.assertFalse(gsl.version_is_private('foo'))
-        self.assertFalse(gsl.version_is_private('PRIVATE'))
-        self.assertFalse(gsl.version_is_private('PLATFORM'))
-        self.assertFalse(gsl.version_is_private('foo_private'))
-        self.assertFalse(gsl.version_is_private('foo_platform'))
-        self.assertFalse(gsl.version_is_private('foo_PRIVATE_'))
-        self.assertFalse(gsl.version_is_private('foo_PLATFORM_'))
-
-        self.assertTrue(gsl.version_is_private('foo_PRIVATE'))
-        self.assertTrue(gsl.version_is_private('foo_PLATFORM'))
-
-
-class SymbolPresenceTest(unittest.TestCase):
-    def test_symbol_in_arch(self):
-        self.assertTrue(gsl.symbol_in_arch([], 'arm'))
-        self.assertTrue(gsl.symbol_in_arch(['arm'], 'arm'))
-
-        self.assertFalse(gsl.symbol_in_arch(['x86'], 'arm'))
-
-    def test_symbol_in_api(self):
-        self.assertTrue(gsl.symbol_in_api([], 'arm', 9))
-        self.assertTrue(gsl.symbol_in_api(['introduced=9'], 'arm', 9))
-        self.assertTrue(gsl.symbol_in_api(['introduced=9'], 'arm', 14))
-        self.assertTrue(gsl.symbol_in_api(['introduced-arm=9'], 'arm', 14))
-        self.assertTrue(gsl.symbol_in_api(['introduced-arm=9'], 'arm', 14))
-        self.assertTrue(gsl.symbol_in_api(['introduced-x86=14'], 'arm', 9))
-        self.assertTrue(gsl.symbol_in_api(
-            ['introduced-arm=9', 'introduced-x86=21'], 'arm', 14))
-        self.assertTrue(gsl.symbol_in_api(
-            ['introduced=9', 'introduced-x86=21'], 'arm', 14))
-        self.assertTrue(gsl.symbol_in_api(
-            ['introduced=21', 'introduced-arm=9'], 'arm', 14))
-        self.assertTrue(gsl.symbol_in_api(
-            ['future'], 'arm', gsl.FUTURE_API_LEVEL))
-
-        self.assertFalse(gsl.symbol_in_api(['introduced=14'], 'arm', 9))
-        self.assertFalse(gsl.symbol_in_api(['introduced-arm=14'], 'arm', 9))
-        self.assertFalse(gsl.symbol_in_api(['future'], 'arm', 9))
-        self.assertFalse(gsl.symbol_in_api(
-            ['introduced=9', 'future'], 'arm', 14))
-        self.assertFalse(gsl.symbol_in_api(
-            ['introduced-arm=9', 'future'], 'arm', 14))
-        self.assertFalse(gsl.symbol_in_api(
-            ['introduced-arm=21', 'introduced-x86=9'], 'arm', 14))
-        self.assertFalse(gsl.symbol_in_api(
-            ['introduced=9', 'introduced-arm=21'], 'arm', 14))
-        self.assertFalse(gsl.symbol_in_api(
-            ['introduced=21', 'introduced-x86=9'], 'arm', 14))
-
-        # Interesting edge case: this symbol should be omitted from the
-        # library, but this call should still return true because none of the
-        # tags indiciate that it's not present in this API level.
-        self.assertTrue(gsl.symbol_in_api(['x86'], 'arm', 9))
-
-    def test_verioned_in_api(self):
-        self.assertTrue(gsl.symbol_versioned_in_api([], 9))
-        self.assertTrue(gsl.symbol_versioned_in_api(['versioned=9'], 9))
-        self.assertTrue(gsl.symbol_versioned_in_api(['versioned=9'], 14))
-
-        self.assertFalse(gsl.symbol_versioned_in_api(['versioned=14'], 9))
-
-
-class OmitVersionTest(unittest.TestCase):
-    def test_omit_private(self):
-        self.assertFalse(
-            gsl.should_omit_version(
-                gsl.Version('foo', None, [], []), 'arm', 9, False, False))
-
-        self.assertTrue(
-            gsl.should_omit_version(
-                gsl.Version('foo_PRIVATE', None, [], []), 'arm', 9, False, False))
-        self.assertTrue(
-            gsl.should_omit_version(
-                gsl.Version('foo_PLATFORM', None, [], []), 'arm', 9, False, False))
-
-        self.assertTrue(
-            gsl.should_omit_version(
-                gsl.Version('foo', None, ['platform-only'], []), 'arm', 9,
-                False, False))
-
-    def test_omit_llndk(self):
-        self.assertTrue(
-            gsl.should_omit_version(
-                gsl.Version('foo', None, ['llndk'], []), 'arm', 9, False, False))
-
-        self.assertFalse(
-            gsl.should_omit_version(
-                gsl.Version('foo', None, [], []), 'arm', 9, True, False))
-        self.assertFalse(
-            gsl.should_omit_version(
-                gsl.Version('foo', None, ['llndk'], []), 'arm', 9, True, False))
-
-    def test_omit_apex(self):
-        self.assertTrue(
-            gsl.should_omit_version(
-                gsl.Version('foo', None, ['apex'], []), 'arm', 9, False, False))
-
-        self.assertFalse(
-            gsl.should_omit_version(
-                gsl.Version('foo', None, [], []), 'arm', 9, False, True))
-        self.assertFalse(
-            gsl.should_omit_version(
-                gsl.Version('foo', None, ['apex'], []), 'arm', 9, False, True))
-
-    def test_omit_arch(self):
-        self.assertFalse(
-            gsl.should_omit_version(
-                gsl.Version('foo', None, [], []), 'arm', 9, False, False))
-        self.assertFalse(
-            gsl.should_omit_version(
-                gsl.Version('foo', None, ['arm'], []), 'arm', 9, False, False))
-
-        self.assertTrue(
-            gsl.should_omit_version(
-                gsl.Version('foo', None, ['x86'], []), 'arm', 9, False, False))
-
-    def test_omit_api(self):
-        self.assertFalse(
-            gsl.should_omit_version(
-                gsl.Version('foo', None, [], []), 'arm', 9, False, False))
-        self.assertFalse(
-            gsl.should_omit_version(
-                gsl.Version('foo', None, ['introduced=9'], []), 'arm', 9,
-                False, False))
-
-        self.assertTrue(
-            gsl.should_omit_version(
-                gsl.Version('foo', None, ['introduced=14'], []), 'arm', 9,
-                False, False))
-
-
-class OmitSymbolTest(unittest.TestCase):
-    def test_omit_llndk(self):
-        self.assertTrue(
-            gsl.should_omit_symbol(
-                gsl.Symbol('foo', ['llndk']), 'arm', 9, False, False))
-
-        self.assertFalse(
-            gsl.should_omit_symbol(gsl.Symbol('foo', []), 'arm', 9, True, False))
-        self.assertFalse(
-            gsl.should_omit_symbol(
-                gsl.Symbol('foo', ['llndk']), 'arm', 9, True, False))
-
-    def test_omit_apex(self):
-        self.assertTrue(
-            gsl.should_omit_symbol(
-                gsl.Symbol('foo', ['apex']), 'arm', 9, False, False))
-
-        self.assertFalse(
-            gsl.should_omit_symbol(gsl.Symbol('foo', []), 'arm', 9, False, True))
-        self.assertFalse(
-            gsl.should_omit_symbol(
-                gsl.Symbol('foo', ['apex']), 'arm', 9, False, True))
-
-    def test_omit_arch(self):
-        self.assertFalse(
-            gsl.should_omit_symbol(gsl.Symbol('foo', []), 'arm', 9, False, False))
-        self.assertFalse(
-            gsl.should_omit_symbol(
-                gsl.Symbol('foo', ['arm']), 'arm', 9, False, False))
-
-        self.assertTrue(
-            gsl.should_omit_symbol(
-                gsl.Symbol('foo', ['x86']), 'arm', 9, False, False))
-
-    def test_omit_api(self):
-        self.assertFalse(
-            gsl.should_omit_symbol(gsl.Symbol('foo', []), 'arm', 9, False, False))
-        self.assertFalse(
-            gsl.should_omit_symbol(
-                gsl.Symbol('foo', ['introduced=9']), 'arm', 9, False, False))
-
-        self.assertTrue(
-            gsl.should_omit_symbol(
-                gsl.Symbol('foo', ['introduced=14']), 'arm', 9, False, False))
-
-
-class SymbolFileParseTest(unittest.TestCase):
-    def test_next_line(self):
-        input_file = io.StringIO(textwrap.dedent("""\
-            foo
-
-            bar
-            # baz
-            qux
-        """))
-        parser = gsl.SymbolFileParser(input_file, {}, 'arm', 16, False, False)
-        self.assertIsNone(parser.current_line)
-
-        self.assertEqual('foo', parser.next_line().strip())
-        self.assertEqual('foo', parser.current_line.strip())
-
-        self.assertEqual('bar', parser.next_line().strip())
-        self.assertEqual('bar', parser.current_line.strip())
-
-        self.assertEqual('qux', parser.next_line().strip())
-        self.assertEqual('qux', parser.current_line.strip())
-
-        self.assertEqual('', parser.next_line())
-        self.assertEqual('', parser.current_line)
-
-    def test_parse_version(self):
-        input_file = io.StringIO(textwrap.dedent("""\
-            VERSION_1 { # foo bar
-                baz;
-                qux; # woodly doodly
-            };
-
-            VERSION_2 {
-            } VERSION_1; # asdf
-        """))
-        parser = gsl.SymbolFileParser(input_file, {}, 'arm', 16, False, False)
-
-        parser.next_line()
-        version = parser.parse_version()
-        self.assertEqual('VERSION_1', version.name)
-        self.assertIsNone(version.base)
-        self.assertEqual(['foo', 'bar'], version.tags)
-
-        expected_symbols = [
-            gsl.Symbol('baz', []),
-            gsl.Symbol('qux', ['woodly', 'doodly']),
-        ]
-        self.assertEqual(expected_symbols, version.symbols)
-
-        parser.next_line()
-        version = parser.parse_version()
-        self.assertEqual('VERSION_2', version.name)
-        self.assertEqual('VERSION_1', version.base)
-        self.assertEqual([], version.tags)
-
-    def test_parse_version_eof(self):
-        input_file = io.StringIO(textwrap.dedent("""\
-            VERSION_1 {
-        """))
-        parser = gsl.SymbolFileParser(input_file, {}, 'arm', 16, False, False)
-        parser.next_line()
-        with self.assertRaises(gsl.ParseError):
-            parser.parse_version()
-
-    def test_unknown_scope_label(self):
-        input_file = io.StringIO(textwrap.dedent("""\
-            VERSION_1 {
-                foo:
-            }
-        """))
-        parser = gsl.SymbolFileParser(input_file, {}, 'arm', 16, False, False)
-        parser.next_line()
-        with self.assertRaises(gsl.ParseError):
-            parser.parse_version()
-
-    def test_parse_symbol(self):
-        input_file = io.StringIO(textwrap.dedent("""\
-            foo;
-            bar; # baz qux
-        """))
-        parser = gsl.SymbolFileParser(input_file, {}, 'arm', 16, False, False)
-
-        parser.next_line()
-        symbol = parser.parse_symbol()
-        self.assertEqual('foo', symbol.name)
-        self.assertEqual([], symbol.tags)
-
-        parser.next_line()
-        symbol = parser.parse_symbol()
-        self.assertEqual('bar', symbol.name)
-        self.assertEqual(['baz', 'qux'], symbol.tags)
-
-    def test_wildcard_symbol_global(self):
-        input_file = io.StringIO(textwrap.dedent("""\
-            VERSION_1 {
-                *;
-            };
-        """))
-        parser = gsl.SymbolFileParser(input_file, {}, 'arm', 16, False, False)
-        parser.next_line()
-        with self.assertRaises(gsl.ParseError):
-            parser.parse_version()
-
-    def test_wildcard_symbol_local(self):
-        input_file = io.StringIO(textwrap.dedent("""\
-            VERSION_1 {
-                local:
-                    *;
-            };
-        """))
-        parser = gsl.SymbolFileParser(input_file, {}, 'arm', 16, False, False)
-        parser.next_line()
-        version = parser.parse_version()
-        self.assertEqual([], version.symbols)
-
-    def test_missing_semicolon(self):
-        input_file = io.StringIO(textwrap.dedent("""\
-            VERSION_1 {
-                foo
-            };
-        """))
-        parser = gsl.SymbolFileParser(input_file, {}, 'arm', 16, False, False)
-        parser.next_line()
-        with self.assertRaises(gsl.ParseError):
-            parser.parse_version()
-
-    def test_parse_fails_invalid_input(self):
-        with self.assertRaises(gsl.ParseError):
-            input_file = io.StringIO('foo')
-            parser = gsl.SymbolFileParser(input_file, {}, 'arm', 16, False, False)
-            parser.parse()
-
-    def test_parse(self):
-        input_file = io.StringIO(textwrap.dedent("""\
-            VERSION_1 {
-                local:
-                    hidden1;
-                global:
-                    foo;
-                    bar; # baz
-            };
-
-            VERSION_2 { # wasd
-                # Implicit global scope.
-                    woodly;
-                    doodly; # asdf
-                local:
-                    qwerty;
-            } VERSION_1;
-        """))
-        parser = gsl.SymbolFileParser(input_file, {}, 'arm', 16, False, False)
-        versions = parser.parse()
-
-        expected = [
-            gsl.Version('VERSION_1', None, [], [
-                gsl.Symbol('foo', []),
-                gsl.Symbol('bar', ['baz']),
-            ]),
-            gsl.Version('VERSION_2', 'VERSION_1', ['wasd'], [
-                gsl.Symbol('woodly', []),
-                gsl.Symbol('doodly', ['asdf']),
-            ]),
-        ]
-
-        self.assertEqual(expected, versions)
-
-    def test_parse_llndk_apex_symbol(self):
-        input_file = io.StringIO(textwrap.dedent("""\
-            VERSION_1 {
-                foo;
-                bar; # llndk
-                baz; # llndk apex
-                qux; # apex
-            };
-        """))
-        parser = gsl.SymbolFileParser(input_file, {}, 'arm', 16, False, True)
-
-        parser.next_line()
-        version = parser.parse_version()
-        self.assertEqual('VERSION_1', version.name)
-        self.assertIsNone(version.base)
-
-        expected_symbols = [
-            gsl.Symbol('foo', []),
-            gsl.Symbol('bar', ['llndk']),
-            gsl.Symbol('baz', ['llndk', 'apex']),
-            gsl.Symbol('qux', ['apex']),
-        ]
-        self.assertEqual(expected_symbols, version.symbols)
-
-
-class GeneratorTest(unittest.TestCase):
-    def test_omit_version(self):
-        # Thorough testing of the cases involved here is handled by
-        # OmitVersionTest, PrivateVersionTest, and SymbolPresenceTest.
-        src_file = io.StringIO()
-        version_file = io.StringIO()
-        generator = gsl.Generator(src_file, version_file, 'arm', 9, False, False)
-
-        version = gsl.Version('VERSION_PRIVATE', None, [], [
-            gsl.Symbol('foo', []),
-        ])
-        generator.write_version(version)
-        self.assertEqual('', src_file.getvalue())
-        self.assertEqual('', version_file.getvalue())
-
-        version = gsl.Version('VERSION', None, ['x86'], [
-            gsl.Symbol('foo', []),
-        ])
-        generator.write_version(version)
-        self.assertEqual('', src_file.getvalue())
-        self.assertEqual('', version_file.getvalue())
-
-        version = gsl.Version('VERSION', None, ['introduced=14'], [
-            gsl.Symbol('foo', []),
-        ])
-        generator.write_version(version)
-        self.assertEqual('', src_file.getvalue())
-        self.assertEqual('', version_file.getvalue())
-
-    def test_omit_symbol(self):
-        # Thorough testing of the cases involved here is handled by
-        # SymbolPresenceTest.
-        src_file = io.StringIO()
-        version_file = io.StringIO()
-        generator = gsl.Generator(src_file, version_file, 'arm', 9, False, False)
-
-        version = gsl.Version('VERSION_1', None, [], [
-            gsl.Symbol('foo', ['x86']),
-        ])
-        generator.write_version(version)
-        self.assertEqual('', src_file.getvalue())
-        self.assertEqual('', version_file.getvalue())
-
-        version = gsl.Version('VERSION_1', None, [], [
-            gsl.Symbol('foo', ['introduced=14']),
-        ])
-        generator.write_version(version)
-        self.assertEqual('', src_file.getvalue())
-        self.assertEqual('', version_file.getvalue())
-
-        version = gsl.Version('VERSION_1', None, [], [
-            gsl.Symbol('foo', ['llndk']),
-        ])
-        generator.write_version(version)
-        self.assertEqual('', src_file.getvalue())
-        self.assertEqual('', version_file.getvalue())
-
-        version = gsl.Version('VERSION_1', None, [], [
-            gsl.Symbol('foo', ['apex']),
-        ])
-        generator.write_version(version)
-        self.assertEqual('', src_file.getvalue())
-        self.assertEqual('', version_file.getvalue())
-
-    def test_write(self):
-        src_file = io.StringIO()
-        version_file = io.StringIO()
-        generator = gsl.Generator(src_file, version_file, 'arm', 9, False, False)
-
-        versions = [
-            gsl.Version('VERSION_1', None, [], [
-                gsl.Symbol('foo', []),
-                gsl.Symbol('bar', ['var']),
-                gsl.Symbol('woodly', ['weak']),
-                gsl.Symbol('doodly', ['weak', 'var']),
-            ]),
-            gsl.Version('VERSION_2', 'VERSION_1', [], [
-                gsl.Symbol('baz', []),
-            ]),
-            gsl.Version('VERSION_3', 'VERSION_1', [], [
-                gsl.Symbol('qux', ['versioned=14']),
-            ]),
-        ]
-
-        generator.write(versions)
-        expected_src = textwrap.dedent("""\
-            void foo() {}
-            int bar = 0;
-            __attribute__((weak)) void woodly() {}
-            __attribute__((weak)) int doodly = 0;
-            void baz() {}
-            void qux() {}
-        """)
-        self.assertEqual(expected_src, src_file.getvalue())
-
-        expected_version = textwrap.dedent("""\
-            VERSION_1 {
-                global:
-                    foo;
-                    bar;
-                    woodly;
-                    doodly;
-            };
-            VERSION_2 {
-                global:
-                    baz;
-            } VERSION_1;
-        """)
-        self.assertEqual(expected_version, version_file.getvalue())
-
-
-class IntegrationTest(unittest.TestCase):
-    def test_integration(self):
-        api_map = {
-            'O': 9000,
-            'P': 9001,
-        }
-
-        input_file = io.StringIO(textwrap.dedent("""\
-            VERSION_1 {
-                global:
-                    foo; # var
-                    bar; # x86
-                    fizz; # introduced=O
-                    buzz; # introduced=P
-                local:
-                    *;
-            };
-
-            VERSION_2 { # arm
-                baz; # introduced=9
-                qux; # versioned=14
-            } VERSION_1;
-
-            VERSION_3 { # introduced=14
-                woodly;
-                doodly; # var
-            } VERSION_2;
-
-            VERSION_4 { # versioned=9
-                wibble;
-                wizzes; # llndk
-                waggle; # apex
-            } VERSION_2;
-
-            VERSION_5 { # versioned=14
-                wobble;
-            } VERSION_4;
-        """))
-        parser = gsl.SymbolFileParser(input_file, api_map, 'arm', 9, False, False)
-        versions = parser.parse()
-
-        src_file = io.StringIO()
-        version_file = io.StringIO()
-        generator = gsl.Generator(src_file, version_file, 'arm', 9, False, False)
-        generator.write(versions)
-
-        expected_src = textwrap.dedent("""\
-            int foo = 0;
-            void baz() {}
-            void qux() {}
-            void wibble() {}
-            void wobble() {}
-        """)
-        self.assertEqual(expected_src, src_file.getvalue())
-
-        expected_version = textwrap.dedent("""\
-            VERSION_1 {
-                global:
-                    foo;
-            };
-            VERSION_2 {
-                global:
-                    baz;
-            } VERSION_1;
-            VERSION_4 {
-                global:
-                    wibble;
-            } VERSION_2;
-        """)
-        self.assertEqual(expected_version, version_file.getvalue())
-
-    def test_integration_future_api(self):
-        api_map = {
-            'O': 9000,
-            'P': 9001,
-            'Q': 9002,
-        }
-
-        input_file = io.StringIO(textwrap.dedent("""\
-            VERSION_1 {
-                global:
-                    foo; # introduced=O
-                    bar; # introduced=P
-                    baz; # introduced=Q
-                local:
-                    *;
-            };
-        """))
-        parser = gsl.SymbolFileParser(input_file, api_map, 'arm', 9001, False, False)
-        versions = parser.parse()
-
-        src_file = io.StringIO()
-        version_file = io.StringIO()
-        generator = gsl.Generator(src_file, version_file, 'arm', 9001, False, False)
-        generator.write(versions)
-
-        expected_src = textwrap.dedent("""\
-            void foo() {}
-            void bar() {}
-        """)
-        self.assertEqual(expected_src, src_file.getvalue())
-
-        expected_version = textwrap.dedent("""\
-            VERSION_1 {
-                global:
-                    foo;
-                    bar;
-            };
-        """)
-        self.assertEqual(expected_version, version_file.getvalue())
-
-    def test_multiple_definition(self):
-        input_file = io.StringIO(textwrap.dedent("""\
-            VERSION_1 {
-                global:
-                    foo;
-                    foo;
-                    bar;
-                    baz;
-                    qux; # arm
-                local:
-                    *;
-            };
-
-            VERSION_2 {
-                global:
-                    bar;
-                    qux; # arm64
-            } VERSION_1;
-
-            VERSION_PRIVATE {
-                global:
-                    baz;
-            } VERSION_2;
-
-        """))
-        parser = gsl.SymbolFileParser(input_file, {}, 'arm', 16, False, False)
-
-        with self.assertRaises(gsl.MultiplyDefinedSymbolError) as cm:
-            parser.parse()
-        self.assertEquals(['bar', 'foo'],
-                          cm.exception.multiply_defined_symbols)
-
-    def test_integration_with_apex(self):
-        api_map = {
-            'O': 9000,
-            'P': 9001,
-        }
-
-        input_file = io.StringIO(textwrap.dedent("""\
-            VERSION_1 {
-                global:
-                    foo; # var
-                    bar; # x86
-                    fizz; # introduced=O
-                    buzz; # introduced=P
-                local:
-                    *;
-            };
-
-            VERSION_2 { # arm
-                baz; # introduced=9
-                qux; # versioned=14
-            } VERSION_1;
-
-            VERSION_3 { # introduced=14
-                woodly;
-                doodly; # var
-            } VERSION_2;
-
-            VERSION_4 { # versioned=9
-                wibble;
-                wizzes; # llndk
-                waggle; # apex
-                bubble; # apex llndk
-                duddle; # llndk apex
-            } VERSION_2;
-
-            VERSION_5 { # versioned=14
-                wobble;
-            } VERSION_4;
-        """))
-        parser = gsl.SymbolFileParser(input_file, api_map, 'arm', 9, False, True)
-        versions = parser.parse()
-
-        src_file = io.StringIO()
-        version_file = io.StringIO()
-        generator = gsl.Generator(src_file, version_file, 'arm', 9, False, True)
-        generator.write(versions)
-
-        expected_src = textwrap.dedent("""\
-            int foo = 0;
-            void baz() {}
-            void qux() {}
-            void wibble() {}
-            void waggle() {}
-            void bubble() {}
-            void duddle() {}
-            void wobble() {}
-        """)
-        self.assertEqual(expected_src, src_file.getvalue())
-
-        expected_version = textwrap.dedent("""\
-            VERSION_1 {
-                global:
-                    foo;
-            };
-            VERSION_2 {
-                global:
-                    baz;
-            } VERSION_1;
-            VERSION_4 {
-                global:
-                    wibble;
-                    waggle;
-                    bubble;
-                    duddle;
-            } VERSION_2;
-        """)
-        self.assertEqual(expected_version, version_file.getvalue())
-
-def main():
-    suite = unittest.TestLoader().loadTestsFromName(__name__)
-    unittest.TextTestRunner(verbosity=3).run(suite)
-
-
-if __name__ == '__main__':
-    main()
diff --git a/cc/scriptlib/test_ndk_api_coverage_parser.py b/cc/scriptlib/test_ndk_api_coverage_parser.py
deleted file mode 100644
index a3c9b70..0000000
--- a/cc/scriptlib/test_ndk_api_coverage_parser.py
+++ /dev/null
@@ -1,66 +0,0 @@
-#!/usr/bin/env python
-#
-# Copyright (C) 2016 The Android Open Source Project
-#
-# Licensed under the Apache License, Version 2.0 (the "License");
-# you may not use this file except in compliance with the License.
-# You may obtain a copy of the License at
-#
-#      http://www.apache.org/licenses/LICENSE-2.0
-#
-# Unless required by applicable law or agreed to in writing, software
-# distributed under the License is distributed on an "AS IS" BASIS,
-# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-# See the License for the specific language governing permissions and
-# limitations under the License.
-#
-"""Tests for ndk_api_coverage_parser.py."""
-import io
-import textwrap
-import unittest
-
-from xml.etree.ElementTree import tostring
-from gen_stub_libs import FUTURE_API_LEVEL, SymbolFileParser
-import ndk_api_coverage_parser as nparser
-
-
-# pylint: disable=missing-docstring
-
-
-class ApiCoverageSymbolFileParserTest(unittest.TestCase):
-    def test_parse(self):
-        input_file = io.StringIO(textwrap.dedent(u"""\
-            LIBLOG { # introduced-arm64=24 introduced-x86=24 introduced-x86_64=24
-              global:
-                android_name_to_log_id; # apex llndk introduced=23
-                android_log_id_to_name; # llndk arm
-                __android_log_assert; # introduced-x86=23
-                __android_log_buf_print; # var
-                __android_log_buf_write;
-              local:
-                *;
-            };
-            
-            LIBLOG_PLATFORM {
-                android_fdtrack; # llndk
-                android_net; # introduced=23
-            };
-            
-            LIBLOG_FOO { # var
-                android_var;
-            };
-        """))
-        parser = SymbolFileParser(input_file, {}, "", FUTURE_API_LEVEL, True, True)
-        generator = nparser.XmlGenerator(io.StringIO())
-        result = tostring(generator.convertToXml(parser.parse())).decode()
-        expected = '<ndk-library><symbol apex="True" arch="" introduced="23" introduced-arm64="24" introduced-x86="24" introduced-x86_64="24" is_deprecated="False" is_platform="False" llndk="True" name="android_name_to_log_id" /><symbol arch="arm" introduced-arm64="24" introduced-x86="24" introduced-x86_64="24" is_deprecated="False" is_platform="False" llndk="True" name="android_log_id_to_name" /><symbol arch="" introduced-arm64="24" introduced-x86="23" introduced-x86_64="24" is_deprecated="False" is_platform="False" name="__android_log_assert" /><symbol arch="" introduced-arm64="24" introduced-x86="24" introduced-x86_64="24" is_deprecated="False" is_platform="False" name="__android_log_buf_write" /><symbol arch="" is_deprecated="False" is_platform="True" llndk="True" name="android_fdtrack" /><symbol arch="" introduced="23" is_deprecated="False" is_platform="True" name="android_net" /></ndk-library>'
-        self.assertEqual(expected, result)
-
-
-def main():
-    suite = unittest.TestLoader().loadTestsFromName(__name__)
-    unittest.TextTestRunner(verbosity=3).run(suite)
-
-
-if __name__ == '__main__':
-    main()
diff --git a/cc/symbolfile/.gitignore b/cc/symbolfile/.gitignore
new file mode 100644
index 0000000..fd94eac
--- /dev/null
+++ b/cc/symbolfile/.gitignore
@@ -0,0 +1,140 @@
+# From https://github.com/github/gitignore/blob/master/Python.gitignore
+
+# Byte-compiled / optimized / DLL files
+__pycache__/
+*.py[cod]
+*$py.class
+
+# C extensions
+*.so
+
+# Distribution / packaging
+.Python
+build/
+develop-eggs/
+dist/
+downloads/
+eggs/
+.eggs/
+lib/
+lib64/
+parts/
+sdist/
+var/
+wheels/
+share/python-wheels/
+*.egg-info/
+.installed.cfg
+*.egg
+MANIFEST
+
+# PyInstaller
+#  Usually these files are written by a python script from a template
+#  before PyInstaller builds the exe, so as to inject date/other infos into it.
+*.manifest
+*.spec
+
+# Installer logs
+pip-log.txt
+pip-delete-this-directory.txt
+
+# Unit test / coverage reports
+htmlcov/
+.tox/
+.nox/
+.coverage
+.coverage.*
+.cache
+nosetests.xml
+coverage.xml
+*.cover
+*.py,cover
+.hypothesis/
+.pytest_cache/
+cover/
+
+# Translations
+*.mo
+*.pot
+
+# Django stuff:
+*.log
+local_settings.py
+db.sqlite3
+db.sqlite3-journal
+
+# Flask stuff:
+instance/
+.webassets-cache
+
+# Scrapy stuff:
+.scrapy
+
+# Sphinx documentation
+docs/_build/
+
+# PyBuilder
+.pybuilder/
+target/
+
+# Jupyter Notebook
+.ipynb_checkpoints
+
+# IPython
+profile_default/
+ipython_config.py
+
+# pyenv
+#   For a library or package, you might want to ignore these files since the code is
+#   intended to run in multiple environments; otherwise, check them in:
+# .python-version
+
+# pipenv
+#   According to pypa/pipenv#598, it is recommended to include Pipfile.lock in version control.
+#   However, in case of collaboration, if having platform-specific dependencies or dependencies
+#   having no cross-platform support, pipenv may install dependencies that don't work, or not
+#   install all needed dependencies.
+#Pipfile.lock
+
+# PEP 582; used by e.g. github.com/David-OConnor/pyflow
+__pypackages__/
+
+# Celery stuff
+celerybeat-schedule
+celerybeat.pid
+
+# SageMath parsed files
+*.sage.py
+
+# Environments
+.env
+.venv
+env/
+venv/
+ENV/
+env.bak/
+venv.bak/
+
+# Spyder project settings
+.spyderproject
+.spyproject
+
+# Rope project settings
+.ropeproject
+
+# mkdocs documentation
+/site
+
+# mypy
+.mypy_cache/
+.dmypy.json
+dmypy.json
+
+# Pyre type checker
+.pyre/
+
+# pytype static type analyzer
+.pytype/
+
+# Cython debug symbols
+cython_debug/
diff --git a/cc/scriptlib/Android.bp b/cc/symbolfile/Android.bp
similarity index 69%
copy from cc/scriptlib/Android.bp
copy to cc/symbolfile/Android.bp
index ff9a2f0..5b43309 100644
--- a/cc/scriptlib/Android.bp
+++ b/cc/symbolfile/Android.bp
@@ -14,19 +14,20 @@
 // limitations under the License.
 //
 
-python_test_host {
-    name: "test_ndk_api_coverage_parser",
-    main: "test_ndk_api_coverage_parser.py",
+python_library_host {
+    name: "symbolfile",
+    pkg_path: "symbolfile",
     srcs: [
-        "test_ndk_api_coverage_parser.py",
+        "__init__.py",
     ],
 }
 
-python_binary_host {
-    name: "ndk_api_coverage_parser",
-    main: "ndk_api_coverage_parser.py",
+python_test_host {
+    name: "test_symbolfile",
     srcs: [
-        "gen_stub_libs.py",
-        "ndk_api_coverage_parser.py",
+        "test_symbolfile.py",
+    ],
+    libs: [
+        "symbolfile",
     ],
 }
diff --git a/cc/symbolfile/OWNERS b/cc/symbolfile/OWNERS
new file mode 100644
index 0000000..f0d8733
--- /dev/null
+++ b/cc/symbolfile/OWNERS
@@ -0,0 +1 @@
+danalbert@google.com
diff --git a/cc/scriptlib/gen_stub_libs.py b/cc/symbolfile/__init__.py
old mode 100755
new mode 100644
similarity index 72%
rename from cc/scriptlib/gen_stub_libs.py
rename to cc/symbolfile/__init__.py
index d61dfbb..faa3823
--- a/cc/scriptlib/gen_stub_libs.py
+++ b/cc/symbolfile/__init__.py
@@ -1,4 +1,3 @@
-#!/usr/bin/env python
 #
 # Copyright (C) 2016 The Android Open Source Project
 #
@@ -14,13 +13,9 @@
 # See the License for the specific language governing permissions and
 # limitations under the License.
 #
-"""Generates source for stub shared libraries for the NDK."""
-import argparse
-import json
+"""Parser for Android's version script information."""
 import logging
-import os
 import re
-import sys
 
 
 ALL_ARCHITECTURES = (
@@ -57,6 +52,24 @@
     return False
 
 
+def decode_api_level(api, api_map):
+    """Decodes the API level argument into the API level number.
+
+    For the average case, this just decodes the integer value from the string,
+    but for unreleased APIs we need to translate from the API codename (like
+    "O") to the future API level for that codename.
+    """
+    try:
+        return int(api)
+    except ValueError:
+        pass
+
+    if api == "current":
+        return FUTURE_API_LEVEL
+
+    return api_map[api]
+
+
 def decode_api_level_tags(tags, api_map):
     """Decodes API level code names in a list of tags.
 
@@ -118,7 +131,8 @@
     if 'platform-only' in version.tags:
         return True
 
-    no_llndk_no_apex = 'llndk' not in version.tags and 'apex' not in version.tags
+    no_llndk_no_apex = ('llndk' not in version.tags
+                        and 'apex' not in version.tags)
     keep = no_llndk_no_apex or \
            ('llndk' in version.tags and llndk) or \
            ('apex' in version.tags and apex)
@@ -205,7 +219,6 @@
 
 class ParseError(RuntimeError):
     """An error that occurred while parsing a symbol file."""
-    pass
 
 
 class MultiplyDefinedSymbolError(RuntimeError):
@@ -217,7 +230,7 @@
         self.multiply_defined_symbols = multiply_defined_symbols
 
 
-class Version(object):
+class Version:
     """A version block of a symbol file."""
     def __init__(self, name, base, tags, symbols):
         self.name = name
@@ -237,7 +250,7 @@
         return True
 
 
-class Symbol(object):
+class Symbol:
     """A symbol definition from a symbol file."""
     def __init__(self, name, tags):
         self.name = name
@@ -247,7 +260,7 @@
         return self.name == other.name and set(self.tags) == set(other.tags)
 
 
-class SymbolFileParser(object):
+class SymbolFileParser:
     """Parses NDK symbol files."""
     def __init__(self, input_file, api_map, arch, api, llndk, apex):
         self.input_file = input_file
@@ -283,11 +296,13 @@
         symbol_names = set()
         multiply_defined_symbols = set()
         for version in versions:
-            if should_omit_version(version, self.arch, self.api, self.llndk, self.apex):
+            if should_omit_version(version, self.arch, self.api, self.llndk,
+                                   self.apex):
                 continue
 
             for symbol in version.symbols:
-                if should_omit_symbol(symbol, self.arch, self.api, self.llndk, self.apex):
+                if should_omit_symbol(symbol, self.arch, self.api, self.llndk,
+                                      self.apex):
                     continue
 
                 if symbol.name in symbol_names:
@@ -367,141 +382,3 @@
                 break
         self.current_line = line
         return self.current_line
-
-
-class Generator(object):
-    """Output generator that writes stub source files and version scripts."""
-    def __init__(self, src_file, version_script, arch, api, llndk, apex):
-        self.src_file = src_file
-        self.version_script = version_script
-        self.arch = arch
-        self.api = api
-        self.llndk = llndk
-        self.apex = apex
-
-    def write(self, versions):
-        """Writes all symbol data to the output files."""
-        for version in versions:
-            self.write_version(version)
-
-    def write_version(self, version):
-        """Writes a single version block's data to the output files."""
-        if should_omit_version(version, self.arch, self.api, self.llndk, self.apex):
-            return
-
-        section_versioned = symbol_versioned_in_api(version.tags, self.api)
-        version_empty = True
-        pruned_symbols = []
-        for symbol in version.symbols:
-            if should_omit_symbol(symbol, self.arch, self.api, self.llndk, self.apex):
-                continue
-
-            if symbol_versioned_in_api(symbol.tags, self.api):
-                version_empty = False
-            pruned_symbols.append(symbol)
-
-        if len(pruned_symbols) > 0:
-            if not version_empty and section_versioned:
-                self.version_script.write(version.name + ' {\n')
-                self.version_script.write('    global:\n')
-            for symbol in pruned_symbols:
-                emit_version = symbol_versioned_in_api(symbol.tags, self.api)
-                if section_versioned and emit_version:
-                    self.version_script.write('        ' + symbol.name + ';\n')
-
-                weak = ''
-                if 'weak' in symbol.tags:
-                    weak = '__attribute__((weak)) '
-
-                if 'var' in symbol.tags:
-                    self.src_file.write('{}int {} = 0;\n'.format(
-                        weak, symbol.name))
-                else:
-                    self.src_file.write('{}void {}() {{}}\n'.format(
-                        weak, symbol.name))
-
-            if not version_empty and section_versioned:
-                base = '' if version.base is None else ' ' + version.base
-                self.version_script.write('}' + base + ';\n')
-
-
-def decode_api_level(api, api_map):
-    """Decodes the API level argument into the API level number.
-
-    For the average case, this just decodes the integer value from the string,
-    but for unreleased APIs we need to translate from the API codename (like
-    "O") to the future API level for that codename.
-    """
-    try:
-        return int(api)
-    except ValueError:
-        pass
-
-    if api == "current":
-        return FUTURE_API_LEVEL
-
-    return api_map[api]
-
-
-def parse_args():
-    """Parses and returns command line arguments."""
-    parser = argparse.ArgumentParser()
-
-    parser.add_argument('-v', '--verbose', action='count', default=0)
-
-    parser.add_argument(
-        '--api', required=True, help='API level being targeted.')
-    parser.add_argument(
-        '--arch', choices=ALL_ARCHITECTURES, required=True,
-        help='Architecture being targeted.')
-    parser.add_argument(
-        '--llndk', action='store_true', help='Use the LLNDK variant.')
-    parser.add_argument(
-        '--apex', action='store_true', help='Use the APEX variant.')
-
-    parser.add_argument(
-        '--api-map', type=os.path.realpath, required=True,
-        help='Path to the API level map JSON file.')
-
-    parser.add_argument(
-        'symbol_file', type=os.path.realpath, help='Path to symbol file.')
-    parser.add_argument(
-        'stub_src', type=os.path.realpath,
-        help='Path to output stub source file.')
-    parser.add_argument(
-        'version_script', type=os.path.realpath,
-        help='Path to output version script.')
-
-    return parser.parse_args()
-
-
-def main():
-    """Program entry point."""
-    args = parse_args()
-
-    with open(args.api_map) as map_file:
-        api_map = json.load(map_file)
-    api = decode_api_level(args.api, api_map)
-
-    verbose_map = (logging.WARNING, logging.INFO, logging.DEBUG)
-    verbosity = args.verbose
-    if verbosity > 2:
-        verbosity = 2
-    logging.basicConfig(level=verbose_map[verbosity])
-
-    with open(args.symbol_file) as symbol_file:
-        try:
-            versions = SymbolFileParser(symbol_file, api_map, args.arch, api,
-                                        args.llndk, args.apex).parse()
-        except MultiplyDefinedSymbolError as ex:
-            sys.exit('{}: error: {}'.format(args.symbol_file, ex))
-
-    with open(args.stub_src, 'w') as src_file:
-        with open(args.version_script, 'w') as version_file:
-            generator = Generator(src_file, version_file, args.arch, api,
-                                  args.llndk, args.apex)
-            generator.write(versions)
-
-
-if __name__ == '__main__':
-    main()
diff --git a/cc/symbolfile/test_symbolfile.py b/cc/symbolfile/test_symbolfile.py
new file mode 100644
index 0000000..c91131f
--- /dev/null
+++ b/cc/symbolfile/test_symbolfile.py
@@ -0,0 +1,493 @@
+#
+# Copyright (C) 2016 The Android Open Source Project
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#      http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+"""Tests for symbolfile."""
+import io
+import textwrap
+import unittest
+
+import symbolfile
+
+# pylint: disable=missing-docstring
+
+
+class DecodeApiLevelTest(unittest.TestCase):
+    def test_decode_api_level(self):
+        self.assertEqual(9, symbolfile.decode_api_level('9', {}))
+        self.assertEqual(9000, symbolfile.decode_api_level('O', {'O': 9000}))
+
+        with self.assertRaises(KeyError):
+            symbolfile.decode_api_level('O', {})
+
+
+class TagsTest(unittest.TestCase):
+    def test_get_tags_no_tags(self):
+        self.assertEqual([], symbolfile.get_tags(''))
+        self.assertEqual([], symbolfile.get_tags('foo bar baz'))
+
+    def test_get_tags(self):
+        self.assertEqual(['foo', 'bar'], symbolfile.get_tags('# foo bar'))
+        self.assertEqual(['bar', 'baz'], symbolfile.get_tags('foo # bar baz'))
+
+    def test_split_tag(self):
+        self.assertTupleEqual(('foo', 'bar'), symbolfile.split_tag('foo=bar'))
+        self.assertTupleEqual(('foo', 'bar=baz'), symbolfile.split_tag('foo=bar=baz'))
+        with self.assertRaises(ValueError):
+            symbolfile.split_tag('foo')
+
+    def test_get_tag_value(self):
+        self.assertEqual('bar', symbolfile.get_tag_value('foo=bar'))
+        self.assertEqual('bar=baz', symbolfile.get_tag_value('foo=bar=baz'))
+        with self.assertRaises(ValueError):
+            symbolfile.get_tag_value('foo')
+
+    def test_is_api_level_tag(self):
+        self.assertTrue(symbolfile.is_api_level_tag('introduced=24'))
+        self.assertTrue(symbolfile.is_api_level_tag('introduced-arm=24'))
+        self.assertTrue(symbolfile.is_api_level_tag('versioned=24'))
+
+        # Shouldn't try to process things that aren't a key/value tag.
+        self.assertFalse(symbolfile.is_api_level_tag('arm'))
+        self.assertFalse(symbolfile.is_api_level_tag('introduced'))
+        self.assertFalse(symbolfile.is_api_level_tag('versioned'))
+
+        # We don't support arch specific `versioned` tags.
+        self.assertFalse(symbolfile.is_api_level_tag('versioned-arm=24'))
+
+    def test_decode_api_level_tags(self):
+        api_map = {
+            'O': 9000,
+            'P': 9001,
+        }
+
+        tags = [
+            'introduced=9',
+            'introduced-arm=14',
+            'versioned=16',
+            'arm',
+            'introduced=O',
+            'introduced=P',
+        ]
+        expected_tags = [
+            'introduced=9',
+            'introduced-arm=14',
+            'versioned=16',
+            'arm',
+            'introduced=9000',
+            'introduced=9001',
+        ]
+        self.assertListEqual(
+            expected_tags, symbolfile.decode_api_level_tags(tags, api_map))
+
+        with self.assertRaises(symbolfile.ParseError):
+            symbolfile.decode_api_level_tags(['introduced=O'], {})
+
+
+class PrivateVersionTest(unittest.TestCase):
+    def test_version_is_private(self):
+        self.assertFalse(symbolfile.version_is_private('foo'))
+        self.assertFalse(symbolfile.version_is_private('PRIVATE'))
+        self.assertFalse(symbolfile.version_is_private('PLATFORM'))
+        self.assertFalse(symbolfile.version_is_private('foo_private'))
+        self.assertFalse(symbolfile.version_is_private('foo_platform'))
+        self.assertFalse(symbolfile.version_is_private('foo_PRIVATE_'))
+        self.assertFalse(symbolfile.version_is_private('foo_PLATFORM_'))
+
+        self.assertTrue(symbolfile.version_is_private('foo_PRIVATE'))
+        self.assertTrue(symbolfile.version_is_private('foo_PLATFORM'))
+
+
+class SymbolPresenceTest(unittest.TestCase):
+    def test_symbol_in_arch(self):
+        self.assertTrue(symbolfile.symbol_in_arch([], 'arm'))
+        self.assertTrue(symbolfile.symbol_in_arch(['arm'], 'arm'))
+
+        self.assertFalse(symbolfile.symbol_in_arch(['x86'], 'arm'))
+
+    def test_symbol_in_api(self):
+        self.assertTrue(symbolfile.symbol_in_api([], 'arm', 9))
+        self.assertTrue(symbolfile.symbol_in_api(['introduced=9'], 'arm', 9))
+        self.assertTrue(symbolfile.symbol_in_api(['introduced=9'], 'arm', 14))
+        self.assertTrue(symbolfile.symbol_in_api(['introduced-arm=9'], 'arm', 14))
+        self.assertTrue(symbolfile.symbol_in_api(['introduced-arm=9'], 'arm', 14))
+        self.assertTrue(symbolfile.symbol_in_api(['introduced-x86=14'], 'arm', 9))
+        self.assertTrue(symbolfile.symbol_in_api(
+            ['introduced-arm=9', 'introduced-x86=21'], 'arm', 14))
+        self.assertTrue(symbolfile.symbol_in_api(
+            ['introduced=9', 'introduced-x86=21'], 'arm', 14))
+        self.assertTrue(symbolfile.symbol_in_api(
+            ['introduced=21', 'introduced-arm=9'], 'arm', 14))
+        self.assertTrue(symbolfile.symbol_in_api(
+            ['future'], 'arm', symbolfile.FUTURE_API_LEVEL))
+
+        self.assertFalse(symbolfile.symbol_in_api(['introduced=14'], 'arm', 9))
+        self.assertFalse(symbolfile.symbol_in_api(['introduced-arm=14'], 'arm', 9))
+        self.assertFalse(symbolfile.symbol_in_api(['future'], 'arm', 9))
+        self.assertFalse(symbolfile.symbol_in_api(
+            ['introduced=9', 'future'], 'arm', 14))
+        self.assertFalse(symbolfile.symbol_in_api(
+            ['introduced-arm=9', 'future'], 'arm', 14))
+        self.assertFalse(symbolfile.symbol_in_api(
+            ['introduced-arm=21', 'introduced-x86=9'], 'arm', 14))
+        self.assertFalse(symbolfile.symbol_in_api(
+            ['introduced=9', 'introduced-arm=21'], 'arm', 14))
+        self.assertFalse(symbolfile.symbol_in_api(
+            ['introduced=21', 'introduced-x86=9'], 'arm', 14))
+
+        # Interesting edge case: this symbol should be omitted from the
+        # library, but this call should still return true because none of the
+        # tags indiciate that it's not present in this API level.
+        self.assertTrue(symbolfile.symbol_in_api(['x86'], 'arm', 9))
+
+    def test_verioned_in_api(self):
+        self.assertTrue(symbolfile.symbol_versioned_in_api([], 9))
+        self.assertTrue(symbolfile.symbol_versioned_in_api(['versioned=9'], 9))
+        self.assertTrue(symbolfile.symbol_versioned_in_api(['versioned=9'], 14))
+
+        self.assertFalse(symbolfile.symbol_versioned_in_api(['versioned=14'], 9))
+
+
+class OmitVersionTest(unittest.TestCase):
+    def test_omit_private(self):
+        self.assertFalse(
+            symbolfile.should_omit_version(
+                symbolfile.Version('foo', None, [], []), 'arm', 9, False,
+                False))
+
+        self.assertTrue(
+            symbolfile.should_omit_version(
+                symbolfile.Version('foo_PRIVATE', None, [], []), 'arm', 9,
+                False, False))
+        self.assertTrue(
+            symbolfile.should_omit_version(
+                symbolfile.Version('foo_PLATFORM', None, [], []), 'arm', 9,
+                False, False))
+
+        self.assertTrue(
+            symbolfile.should_omit_version(
+                symbolfile.Version('foo', None, ['platform-only'], []), 'arm',
+                9, False, False))
+
+    def test_omit_llndk(self):
+        self.assertTrue(
+            symbolfile.should_omit_version(
+                symbolfile.Version('foo', None, ['llndk'], []), 'arm', 9,
+                False, False))
+
+        self.assertFalse(
+            symbolfile.should_omit_version(
+                symbolfile.Version('foo', None, [], []), 'arm', 9, True,
+                False))
+        self.assertFalse(
+            symbolfile.should_omit_version(
+                symbolfile.Version('foo', None, ['llndk'], []), 'arm', 9, True,
+                False))
+
+    def test_omit_apex(self):
+        self.assertTrue(
+            symbolfile.should_omit_version(
+                symbolfile.Version('foo', None, ['apex'], []), 'arm', 9, False,
+                False))
+
+        self.assertFalse(
+            symbolfile.should_omit_version(
+                symbolfile.Version('foo', None, [], []), 'arm', 9, False,
+                True))
+        self.assertFalse(
+            symbolfile.should_omit_version(
+                symbolfile.Version('foo', None, ['apex'], []), 'arm', 9, False,
+                True))
+
+    def test_omit_arch(self):
+        self.assertFalse(
+            symbolfile.should_omit_version(
+                symbolfile.Version('foo', None, [], []), 'arm', 9, False,
+                False))
+        self.assertFalse(
+            symbolfile.should_omit_version(
+                symbolfile.Version('foo', None, ['arm'], []), 'arm', 9, False,
+                False))
+
+        self.assertTrue(
+            symbolfile.should_omit_version(
+                symbolfile.Version('foo', None, ['x86'], []), 'arm', 9, False,
+                False))
+
+    def test_omit_api(self):
+        self.assertFalse(
+            symbolfile.should_omit_version(
+                symbolfile.Version('foo', None, [], []), 'arm', 9, False,
+                False))
+        self.assertFalse(
+            symbolfile.should_omit_version(
+                symbolfile.Version('foo', None, ['introduced=9'], []), 'arm',
+                9, False, False))
+
+        self.assertTrue(
+            symbolfile.should_omit_version(
+                symbolfile.Version('foo', None, ['introduced=14'], []), 'arm',
+                9, False, False))
+
+
+class OmitSymbolTest(unittest.TestCase):
+    def test_omit_llndk(self):
+        self.assertTrue(
+            symbolfile.should_omit_symbol(symbolfile.Symbol('foo', ['llndk']),
+                                          'arm', 9, False, False))
+
+        self.assertFalse(
+            symbolfile.should_omit_symbol(symbolfile.Symbol('foo', []), 'arm',
+                                          9, True, False))
+        self.assertFalse(
+            symbolfile.should_omit_symbol(symbolfile.Symbol('foo', ['llndk']),
+                                          'arm', 9, True, False))
+
+    def test_omit_apex(self):
+        self.assertTrue(
+            symbolfile.should_omit_symbol(symbolfile.Symbol('foo', ['apex']),
+                                          'arm', 9, False, False))
+
+        self.assertFalse(
+            symbolfile.should_omit_symbol(symbolfile.Symbol('foo', []), 'arm',
+                                          9, False, True))
+        self.assertFalse(
+            symbolfile.should_omit_symbol(symbolfile.Symbol('foo', ['apex']),
+                                          'arm', 9, False, True))
+
+    def test_omit_arch(self):
+        self.assertFalse(
+            symbolfile.should_omit_symbol(symbolfile.Symbol('foo', []), 'arm',
+                                          9, False, False))
+        self.assertFalse(
+            symbolfile.should_omit_symbol(symbolfile.Symbol('foo', ['arm']),
+                                          'arm', 9, False, False))
+
+        self.assertTrue(
+            symbolfile.should_omit_symbol(symbolfile.Symbol('foo', ['x86']),
+                                          'arm', 9, False, False))
+
+    def test_omit_api(self):
+        self.assertFalse(
+            symbolfile.should_omit_symbol(symbolfile.Symbol('foo', []), 'arm',
+                                          9, False, False))
+        self.assertFalse(
+            symbolfile.should_omit_symbol(
+                symbolfile.Symbol('foo', ['introduced=9']), 'arm', 9, False,
+                False))
+
+        self.assertTrue(
+            symbolfile.should_omit_symbol(
+                symbolfile.Symbol('foo', ['introduced=14']), 'arm', 9, False,
+                False))
+
+
+class SymbolFileParseTest(unittest.TestCase):
+    def test_next_line(self):
+        input_file = io.StringIO(textwrap.dedent("""\
+            foo
+
+            bar
+            # baz
+            qux
+        """))
+        parser = symbolfile.SymbolFileParser(input_file, {}, 'arm', 16, False, False)
+        self.assertIsNone(parser.current_line)
+
+        self.assertEqual('foo', parser.next_line().strip())
+        self.assertEqual('foo', parser.current_line.strip())
+
+        self.assertEqual('bar', parser.next_line().strip())
+        self.assertEqual('bar', parser.current_line.strip())
+
+        self.assertEqual('qux', parser.next_line().strip())
+        self.assertEqual('qux', parser.current_line.strip())
+
+        self.assertEqual('', parser.next_line())
+        self.assertEqual('', parser.current_line)
+
+    def test_parse_version(self):
+        input_file = io.StringIO(textwrap.dedent("""\
+            VERSION_1 { # foo bar
+                baz;
+                qux; # woodly doodly
+            };
+
+            VERSION_2 {
+            } VERSION_1; # asdf
+        """))
+        parser = symbolfile.SymbolFileParser(input_file, {}, 'arm', 16, False, False)
+
+        parser.next_line()
+        version = parser.parse_version()
+        self.assertEqual('VERSION_1', version.name)
+        self.assertIsNone(version.base)
+        self.assertEqual(['foo', 'bar'], version.tags)
+
+        expected_symbols = [
+            symbolfile.Symbol('baz', []),
+            symbolfile.Symbol('qux', ['woodly', 'doodly']),
+        ]
+        self.assertEqual(expected_symbols, version.symbols)
+
+        parser.next_line()
+        version = parser.parse_version()
+        self.assertEqual('VERSION_2', version.name)
+        self.assertEqual('VERSION_1', version.base)
+        self.assertEqual([], version.tags)
+
+    def test_parse_version_eof(self):
+        input_file = io.StringIO(textwrap.dedent("""\
+            VERSION_1 {
+        """))
+        parser = symbolfile.SymbolFileParser(input_file, {}, 'arm', 16, False, False)
+        parser.next_line()
+        with self.assertRaises(symbolfile.ParseError):
+            parser.parse_version()
+
+    def test_unknown_scope_label(self):
+        input_file = io.StringIO(textwrap.dedent("""\
+            VERSION_1 {
+                foo:
+            }
+        """))
+        parser = symbolfile.SymbolFileParser(input_file, {}, 'arm', 16, False, False)
+        parser.next_line()
+        with self.assertRaises(symbolfile.ParseError):
+            parser.parse_version()
+
+    def test_parse_symbol(self):
+        input_file = io.StringIO(textwrap.dedent("""\
+            foo;
+            bar; # baz qux
+        """))
+        parser = symbolfile.SymbolFileParser(input_file, {}, 'arm', 16, False, False)
+
+        parser.next_line()
+        symbol = parser.parse_symbol()
+        self.assertEqual('foo', symbol.name)
+        self.assertEqual([], symbol.tags)
+
+        parser.next_line()
+        symbol = parser.parse_symbol()
+        self.assertEqual('bar', symbol.name)
+        self.assertEqual(['baz', 'qux'], symbol.tags)
+
+    def test_wildcard_symbol_global(self):
+        input_file = io.StringIO(textwrap.dedent("""\
+            VERSION_1 {
+                *;
+            };
+        """))
+        parser = symbolfile.SymbolFileParser(input_file, {}, 'arm', 16, False, False)
+        parser.next_line()
+        with self.assertRaises(symbolfile.ParseError):
+            parser.parse_version()
+
+    def test_wildcard_symbol_local(self):
+        input_file = io.StringIO(textwrap.dedent("""\
+            VERSION_1 {
+                local:
+                    *;
+            };
+        """))
+        parser = symbolfile.SymbolFileParser(input_file, {}, 'arm', 16, False, False)
+        parser.next_line()
+        version = parser.parse_version()
+        self.assertEqual([], version.symbols)
+
+    def test_missing_semicolon(self):
+        input_file = io.StringIO(textwrap.dedent("""\
+            VERSION_1 {
+                foo
+            };
+        """))
+        parser = symbolfile.SymbolFileParser(input_file, {}, 'arm', 16, False, False)
+        parser.next_line()
+        with self.assertRaises(symbolfile.ParseError):
+            parser.parse_version()
+
+    def test_parse_fails_invalid_input(self):
+        with self.assertRaises(symbolfile.ParseError):
+            input_file = io.StringIO('foo')
+            parser = symbolfile.SymbolFileParser(input_file, {}, 'arm', 16,
+                                                 False, False)
+            parser.parse()
+
+    def test_parse(self):
+        input_file = io.StringIO(textwrap.dedent("""\
+            VERSION_1 {
+                local:
+                    hidden1;
+                global:
+                    foo;
+                    bar; # baz
+            };
+
+            VERSION_2 { # wasd
+                # Implicit global scope.
+                    woodly;
+                    doodly; # asdf
+                local:
+                    qwerty;
+            } VERSION_1;
+        """))
+        parser = symbolfile.SymbolFileParser(input_file, {}, 'arm', 16, False, False)
+        versions = parser.parse()
+
+        expected = [
+            symbolfile.Version('VERSION_1', None, [], [
+                symbolfile.Symbol('foo', []),
+                symbolfile.Symbol('bar', ['baz']),
+            ]),
+            symbolfile.Version('VERSION_2', 'VERSION_1', ['wasd'], [
+                symbolfile.Symbol('woodly', []),
+                symbolfile.Symbol('doodly', ['asdf']),
+            ]),
+        ]
+
+        self.assertEqual(expected, versions)
+
+    def test_parse_llndk_apex_symbol(self):
+        input_file = io.StringIO(textwrap.dedent("""\
+            VERSION_1 {
+                foo;
+                bar; # llndk
+                baz; # llndk apex
+                qux; # apex
+            };
+        """))
+        parser = symbolfile.SymbolFileParser(input_file, {}, 'arm', 16, False, True)
+
+        parser.next_line()
+        version = parser.parse_version()
+        self.assertEqual('VERSION_1', version.name)
+        self.assertIsNone(version.base)
+
+        expected_symbols = [
+            symbolfile.Symbol('foo', []),
+            symbolfile.Symbol('bar', ['llndk']),
+            symbolfile.Symbol('baz', ['llndk', 'apex']),
+            symbolfile.Symbol('qux', ['apex']),
+        ]
+        self.assertEqual(expected_symbols, version.symbols)
+
+
+def main():
+    suite = unittest.TestLoader().loadTestsFromName(__name__)
+    unittest.TextTestRunner(verbosity=3).run(suite)
+
+
+if __name__ == '__main__':
+    main()
diff --git a/cc/test.go b/cc/test.go
index 37afb0c..9b6864a 100644
--- a/cc/test.go
+++ b/cc/test.go
@@ -165,7 +165,7 @@
 	return test.baseCompiler.Properties.Srcs
 }
 
-func (test *testBinary) dataPaths() android.Paths {
+func (test *testBinary) dataPaths() []android.DataPath {
 	return test.data
 }
 
@@ -310,7 +310,7 @@
 	*binaryDecorator
 	*baseCompiler
 	Properties TestBinaryProperties
-	data       android.Paths
+	data       []android.DataPath
 	testConfig android.Path
 }
 
@@ -339,7 +339,11 @@
 }
 
 func (test *testBinary) install(ctx ModuleContext, file android.Path) {
-	test.data = android.PathsForModuleSrc(ctx, test.Properties.Data)
+	dataSrcPaths := android.PathsForModuleSrc(ctx, test.Properties.Data)
+
+	for _, dataSrcPath := range dataSrcPaths {
+		test.data = append(test.data, android.DataPath{SrcPath: dataSrcPath})
+	}
 
 	ctx.VisitDirectDepsWithTag(dataLibDepTag, func(dep android.Module) {
 		depName := ctx.OtherModuleName(dep)
@@ -348,10 +352,14 @@
 		if !ok {
 			ctx.ModuleErrorf("data_lib %q is not a linkable cc module", depName)
 		}
+		ccModule, ok := dep.(*Module)
+		if !ok {
+			ctx.ModuleErrorf("data_lib %q is not a cc module", depName)
+		}
 		if ccDep.OutputFile().Valid() {
-			test.data = append(test.data, ccDep.OutputFile().Path())
-		} else {
-			ctx.ModuleErrorf("data_lib %q has no output file", depName)
+			test.data = append(test.data,
+				android.DataPath{SrcPath: ccDep.OutputFile().Path(),
+					RelativeInstallPath: ccModule.installer.relativeInstallPath()})
 		}
 	})
 
diff --git a/cc/testing.go b/cc/testing.go
index a106d46..c2353d8 100644
--- a/cc/testing.go
+++ b/cc/testing.go
@@ -20,8 +20,6 @@
 
 func RegisterRequiredBuildComponentsForTest(ctx android.RegistrationContext) {
 	RegisterPrebuiltBuildComponents(ctx)
-	android.RegisterPrebuiltMutators(ctx)
-
 	RegisterCCBuildComponents(ctx)
 	RegisterBinaryBuildComponents(ctx)
 	RegisterLibraryBuildComponents(ctx)
@@ -30,6 +28,7 @@
 	ctx.RegisterModuleType("toolchain_library", ToolchainLibraryFactory)
 	ctx.RegisterModuleType("llndk_library", LlndkLibraryFactory)
 	ctx.RegisterModuleType("cc_object", ObjectFactory)
+	ctx.RegisterModuleType("cc_genrule", genRuleFactory)
 	ctx.RegisterModuleType("ndk_prebuilt_shared_stl", NdkPrebuiltSharedStlFactory)
 	ctx.RegisterModuleType("ndk_prebuilt_object", NdkPrebuiltObjectFactory)
 	ctx.RegisterModuleType("ndk_library", NdkLibraryFactory)
@@ -39,6 +38,7 @@
 	ret := `
 		toolchain_library {
 			name: "libatomic",
+			defaults: ["linux_bionic_supported"],
 			vendor_available: true,
 			recovery_available: true,
 			native_bridge_supported: true,
@@ -92,6 +92,7 @@
 
 		toolchain_library {
 			name: "libclang_rt.builtins-x86_64-android",
+			defaults: ["linux_bionic_supported"],
 			vendor_available: true,
 			recovery_available: true,
 			native_bridge_supported: true,
@@ -121,6 +122,7 @@
 
 		toolchain_library {
 			name: "libclang_rt.fuzzer-x86_64-android",
+			defaults: ["linux_bionic_supported"],
 			vendor_available: true,
 			recovery_available: true,
 			src: "",
@@ -144,6 +146,7 @@
 
 		toolchain_library {
 			name: "libgcc",
+			defaults: ["linux_bionic_supported"],
 			vendor_available: true,
 			recovery_available: true,
 			src: "",
@@ -151,6 +154,7 @@
 
 		toolchain_library {
 			name: "libgcc_stripped",
+			defaults: ["linux_bionic_supported"],
 			vendor_available: true,
 			recovery_available: true,
 			sdk_version: "current",
@@ -159,6 +163,7 @@
 
 		cc_library {
 			name: "libc",
+			defaults: ["linux_bionic_supported"],
 			no_libcrt: true,
 			nocrt: true,
 			stl: "none",
@@ -175,6 +180,7 @@
 		}
 		cc_library {
 			name: "libm",
+			defaults: ["linux_bionic_supported"],
 			no_libcrt: true,
 			nocrt: true,
 			stl: "none",
@@ -234,6 +240,7 @@
 
 		cc_library {
 			name: "libdl",
+			defaults: ["linux_bionic_supported"],
 			no_libcrt: true,
 			nocrt: true,
 			stl: "none",
@@ -326,6 +333,7 @@
 
 		cc_defaults {
 			name: "crt_defaults",
+			defaults: ["linux_bionic_supported"],
 			recovery_available: true,
 			vendor_available: true,
 			native_bridge_supported: true,
@@ -437,6 +445,7 @@
 		}
 	`
 
+	supportLinuxBionic := false
 	for _, os := range oses {
 		if os == android.Fuchsia {
 			ret += `
@@ -465,7 +474,59 @@
 		}
 		`
 		}
+		if os == android.LinuxBionic {
+			supportLinuxBionic = true
+			ret += `
+				cc_binary {
+					name: "linker",
+					defaults: ["linux_bionic_supported"],
+					recovery_available: true,
+					stl: "none",
+					nocrt: true,
+					static_executable: true,
+					native_coverage: false,
+					system_shared_libs: [],
+				}
+
+				cc_genrule {
+					name: "host_bionic_linker_flags",
+					host_supported: true,
+					device_supported: false,
+					target: {
+						host: {
+							enabled: false,
+						},
+						linux_bionic: {
+							enabled: true,
+						},
+					},
+					out: ["linker.flags"],
+				}
+
+				cc_defaults {
+					name: "linux_bionic_supported",
+					host_supported: true,
+					target: {
+						host: {
+							enabled: false,
+						},
+						linux_bionic: {
+							enabled: true,
+						},
+					},
+				}
+			`
+		}
 	}
+
+	if !supportLinuxBionic {
+		ret += `
+			cc_defaults {
+				name: "linux_bionic_supported",
+			}
+		`
+	}
+
 	return ret
 }
 
@@ -507,6 +568,7 @@
 	ctx.RegisterModuleType("vndk_prebuilt_shared", VndkPrebuiltSharedFactory)
 	ctx.RegisterModuleType("vndk_libraries_txt", VndkLibrariesTxtFactory)
 	ctx.PreArchMutators(android.RegisterDefaultsPreArchMutators)
+	android.RegisterPrebuiltMutators(ctx)
 	RegisterRequiredBuildComponentsForTest(ctx)
 	ctx.RegisterSingletonType("vndk-snapshot", VndkSnapshotSingleton)
 	ctx.RegisterSingletonType("vendor-snapshot", VendorSnapshotSingleton)
diff --git a/cc/vendor_snapshot.go b/cc/vendor_snapshot.go
index fec0c8b..6df940c 100644
--- a/cc/vendor_snapshot.go
+++ b/cc/vendor_snapshot.go
@@ -484,18 +484,22 @@
 
 var (
 	// Modules under following directories are ignored. They are OEM's and vendor's
-	// proprietary modules(device/, vendor/, and hardware/).
+	// proprietary modules(device/, kernel/, vendor/, and hardware/).
 	// TODO(b/65377115): Clean up these with more maintainable way
 	vendorProprietaryDirs = []string{
 		"device",
+		"kernel",
 		"vendor",
 		"hardware",
 	}
 
 	// Modules under following directories are included as they are in AOSP,
-	// although hardware/ is normally for vendor's own.
+	// although hardware/ and kernel/ are normally for vendor's own.
 	// TODO(b/65377115): Clean up these with more maintainable way
 	aospDirsUnderProprietary = []string{
+		"kernel/configs",
+		"kernel/prebuilts",
+		"kernel/tests",
 		"hardware/interfaces",
 		"hardware/libhardware",
 		"hardware/libhardware_legacy",
@@ -552,6 +556,13 @@
 	if _, ok := m.linker.(*kernelHeadersDecorator); ok {
 		return false
 	}
+	// skip llndk_library and llndk_headers which are backward compatible
+	if _, ok := m.linker.(*llndkStubDecorator); ok {
+		return false
+	}
+	if _, ok := m.linker.(*llndkHeadersDecorator); ok {
+		return false
+	}
 
 	// Libraries
 	if l, ok := m.linker.(snapshotLibraryInterface); ok {
diff --git a/cc/vndk.go b/cc/vndk.go
index 4adf9d2..23bb095 100644
--- a/cc/vndk.go
+++ b/cc/vndk.go
@@ -26,6 +26,8 @@
 	"android/soong/android"
 	"android/soong/cc/config"
 	"android/soong/etc"
+
+	"github.com/google/blueprint"
 )
 
 const (
@@ -127,7 +129,7 @@
 	return "native:vendor:vndkspext"
 }
 
-func (vndk *vndkdep) vndkCheckLinkType(ctx android.ModuleContext, to *Module, tag DependencyTag) {
+func (vndk *vndkdep) vndkCheckLinkType(ctx android.ModuleContext, to *Module, tag blueprint.DependencyTag) {
 	if to.linker == nil {
 		return
 	}
@@ -340,7 +342,7 @@
 	}
 }
 
-// Sanity check for modules that mustn't be VNDK
+// Check for modules that mustn't be VNDK
 func shouldSkipVndkMutator(m *Module) bool {
 	if !m.Enabled() {
 		return true
@@ -559,10 +561,6 @@
 		return
 	}
 
-	if ctx.DeviceConfig().BoardVndkRuntimeDisable() {
-		return
-	}
-
 	var snapshotOutputs android.Paths
 
 	/*
diff --git a/cmd/diff_target_files/Android.bp b/cmd/diff_target_files/Android.bp
index 5397f4b..bc6b068 100644
--- a/cmd/diff_target_files/Android.bp
+++ b/cmd/diff_target_files/Android.bp
@@ -5,12 +5,12 @@
         "diff_target_files.go",
         "glob.go",
         "target_files.go",
-        "whitelist.go",
+        "allow_list.go",
         "zip_artifact.go",
     ],
     testSrcs: [
         "compare_test.go",
         "glob_test.go",
-        "whitelist_test.go",
+        "allow_list_test.go",
     ],
 }
diff --git a/cmd/diff_target_files/whitelist.go b/cmd/diff_target_files/allow_list.go
similarity index 77%
rename from cmd/diff_target_files/whitelist.go
rename to cmd/diff_target_files/allow_list.go
index f00fc1e..ca55b43 100644
--- a/cmd/diff_target_files/whitelist.go
+++ b/cmd/diff_target_files/allow_list.go
@@ -25,18 +25,13 @@
 	"unicode"
 )
 
-type jsonWhitelist struct {
-	Paths               []string
-	IgnoreMatchingLines []string
-}
-
-type whitelist struct {
+type allowList struct {
 	path                string
 	ignoreMatchingLines []string
 }
 
-func parseWhitelists(whitelists []string, whitelistFiles []string) ([]whitelist, error) {
-	var ret []whitelist
+func parseAllowLists(allowLists []string, allowListFiles []string) ([]allowList, error) {
+	var ret []allowList
 
 	add := func(path string, ignoreMatchingLines []string) {
 		for _, x := range ret {
@@ -46,24 +41,24 @@
 			}
 		}
 
-		ret = append(ret, whitelist{
+		ret = append(ret, allowList{
 			path:                path,
 			ignoreMatchingLines: ignoreMatchingLines,
 		})
 	}
 
-	for _, file := range whitelistFiles {
-		newWhitelists, err := parseWhitelistFile(file)
+	for _, file := range allowListFiles {
+		newAllowlists, err := parseAllowListFile(file)
 		if err != nil {
 			return nil, err
 		}
 
-		for _, w := range newWhitelists {
+		for _, w := range newAllowlists {
 			add(w.path, w.ignoreMatchingLines)
 		}
 	}
 
-	for _, s := range whitelists {
+	for _, s := range allowLists {
 		colon := strings.IndexRune(s, ':')
 		var ignoreMatchingLines []string
 		if colon >= 0 {
@@ -75,7 +70,7 @@
 	return ret, nil
 }
 
-func parseWhitelistFile(file string) ([]whitelist, error) {
+func parseAllowListFile(file string) ([]allowList, error) {
 	r, err := os.Open(file)
 	if err != nil {
 		return nil, err
@@ -84,27 +79,32 @@
 
 	d := json.NewDecoder(newJSONCommentStripper(r))
 
-	var jsonWhitelists []jsonWhitelist
+	var jsonAllowLists []struct {
+		Paths               []string
+		IgnoreMatchingLines []string
+	}
 
-	err = d.Decode(&jsonWhitelists)
+	if err := d.Decode(&jsonAllowLists); err != nil {
+		return nil, err
+	}
 
-	var whitelists []whitelist
-	for _, w := range jsonWhitelists {
+	var allowLists []allowList
+	for _, w := range jsonAllowLists {
 		for _, p := range w.Paths {
-			whitelists = append(whitelists, whitelist{
+			allowLists = append(allowLists, allowList{
 				path:                p,
 				ignoreMatchingLines: w.IgnoreMatchingLines,
 			})
 		}
 	}
 
-	return whitelists, err
+	return allowLists, err
 }
 
-func filterModifiedPaths(l [][2]*ZipArtifactFile, whitelists []whitelist) ([][2]*ZipArtifactFile, error) {
+func filterModifiedPaths(l [][2]*ZipArtifactFile, allowLists []allowList) ([][2]*ZipArtifactFile, error) {
 outer:
 	for i := 0; i < len(l); i++ {
-		for _, w := range whitelists {
+		for _, w := range allowLists {
 			if match, err := Match(w.path, l[i][0].Name); err != nil {
 				return l, err
 			} else if match {
@@ -126,10 +126,10 @@
 	return l, nil
 }
 
-func filterNewPaths(l []*ZipArtifactFile, whitelists []whitelist) ([]*ZipArtifactFile, error) {
+func filterNewPaths(l []*ZipArtifactFile, allowLists []allowList) ([]*ZipArtifactFile, error) {
 outer:
 	for i := 0; i < len(l); i++ {
-		for _, w := range whitelists {
+		for _, w := range allowLists {
 			if match, err := Match(w.path, l[i].Name); err != nil {
 				return l, err
 			} else if match && len(w.ignoreMatchingLines) == 0 {
@@ -192,18 +192,18 @@
 	return bytes.Compare(bufA, bufB) == 0, nil
 }
 
-func applyWhitelists(diff zipDiff, whitelists []whitelist) (zipDiff, error) {
+func applyAllowLists(diff zipDiff, allowLists []allowList) (zipDiff, error) {
 	var err error
 
-	diff.modified, err = filterModifiedPaths(diff.modified, whitelists)
+	diff.modified, err = filterModifiedPaths(diff.modified, allowLists)
 	if err != nil {
 		return diff, err
 	}
-	diff.onlyInA, err = filterNewPaths(diff.onlyInA, whitelists)
+	diff.onlyInA, err = filterNewPaths(diff.onlyInA, allowLists)
 	if err != nil {
 		return diff, err
 	}
-	diff.onlyInB, err = filterNewPaths(diff.onlyInB, whitelists)
+	diff.onlyInB, err = filterNewPaths(diff.onlyInB, allowLists)
 	if err != nil {
 		return diff, err
 	}
diff --git a/cmd/diff_target_files/whitelist_test.go b/cmd/diff_target_files/allow_list_test.go
similarity index 82%
rename from cmd/diff_target_files/whitelist_test.go
rename to cmd/diff_target_files/allow_list_test.go
index 4b19fdd..8410e5a 100644
--- a/cmd/diff_target_files/whitelist_test.go
+++ b/cmd/diff_target_files/allow_list_test.go
@@ -57,10 +57,10 @@
 
 var f2 = bytesToZipArtifactFile("dir/f2", nil)
 
-func Test_applyWhitelists(t *testing.T) {
+func Test_applyAllowLists(t *testing.T) {
 	type args struct {
 		diff       zipDiff
-		whitelists []whitelist
+		allowLists []allowList
 	}
 	tests := []struct {
 		name    string
@@ -74,7 +74,7 @@
 				diff: zipDiff{
 					onlyInA: []*ZipArtifactFile{f1a, f2},
 				},
-				whitelists: []whitelist{{path: "dir/f1"}},
+				allowLists: []allowList{{path: "dir/f1"}},
 			},
 			want: zipDiff{
 				onlyInA: []*ZipArtifactFile{f2},
@@ -86,7 +86,7 @@
 				diff: zipDiff{
 					onlyInA: []*ZipArtifactFile{f1a, f2},
 				},
-				whitelists: []whitelist{{path: "dir/*"}},
+				allowLists: []allowList{{path: "dir/*"}},
 			},
 			want: zipDiff{},
 		},
@@ -96,7 +96,7 @@
 				diff: zipDiff{
 					modified: [][2]*ZipArtifactFile{{f1a, f1b}},
 				},
-				whitelists: []whitelist{{path: "dir/*"}},
+				allowLists: []allowList{{path: "dir/*"}},
 			},
 			want: zipDiff{},
 		},
@@ -106,20 +106,20 @@
 				diff: zipDiff{
 					modified: [][2]*ZipArtifactFile{{f1a, f1b}},
 				},
-				whitelists: []whitelist{{path: "dir/*", ignoreMatchingLines: []string{"foo: .*"}}},
+				allowLists: []allowList{{path: "dir/*", ignoreMatchingLines: []string{"foo: .*"}}},
 			},
 			want: zipDiff{},
 		},
 	}
 	for _, tt := range tests {
 		t.Run(tt.name, func(t *testing.T) {
-			got, err := applyWhitelists(tt.args.diff, tt.args.whitelists)
+			got, err := applyAllowLists(tt.args.diff, tt.args.allowLists)
 			if (err != nil) != tt.wantErr {
-				t.Errorf("applyWhitelists() error = %v, wantErr %v", err, tt.wantErr)
+				t.Errorf("Test_applyAllowLists() error = %v, wantErr %v", err, tt.wantErr)
 				return
 			}
 			if !reflect.DeepEqual(got, tt.want) {
-				t.Errorf("applyWhitelists() = %v, want %v", got, tt.want)
+				t.Errorf("Test_applyAllowLists() = %v, want %v", got, tt.want)
 			}
 		})
 	}
diff --git a/cmd/diff_target_files/compare.go b/cmd/diff_target_files/compare.go
index 00cd9ca..45b6d6b 100644
--- a/cmd/diff_target_files/compare.go
+++ b/cmd/diff_target_files/compare.go
@@ -21,7 +21,7 @@
 
 // compareTargetFiles takes two ZipArtifacts and compares the files they contain by examining
 // the path, size, and CRC of each file.
-func compareTargetFiles(priZip, refZip ZipArtifact, artifact string, whitelists []whitelist, filters []string) (zipDiff, error) {
+func compareTargetFiles(priZip, refZip ZipArtifact, artifact string, allowLists []allowList, filters []string) (zipDiff, error) {
 	priZipFiles, err := priZip.Files()
 	if err != nil {
 		return zipDiff{}, fmt.Errorf("error fetching target file lists from primary zip %v", err)
@@ -45,7 +45,7 @@
 	// Compare the file lists from both builds
 	diff := diffTargetFilesLists(refZipFiles, priZipFiles)
 
-	return applyWhitelists(diff, whitelists)
+	return applyAllowLists(diff, allowLists)
 }
 
 // zipDiff contains the list of files that differ between two zip files.
diff --git a/cmd/diff_target_files/diff_target_files.go b/cmd/diff_target_files/diff_target_files.go
index 75bc8ee..634565b 100644
--- a/cmd/diff_target_files/diff_target_files.go
+++ b/cmd/diff_target_files/diff_target_files.go
@@ -22,8 +22,8 @@
 )
 
 var (
-	whitelists     = newMultiString("whitelist", "whitelist patterns in the form <pattern>[:<regex of line to ignore>]")
-	whitelistFiles = newMultiString("whitelist_file", "files containing whitelist definitions")
+	allowLists     = newMultiString("allowlist", "allowlist patterns in the form <pattern>[:<regex of line to ignore>]")
+	allowListFiles = newMultiString("allowlist_file", "files containing allowlist definitions")
 
 	filters = newMultiString("filter", "filter patterns to apply to files in target-files.zip before comparing")
 )
@@ -47,9 +47,9 @@
 		os.Exit(1)
 	}
 
-	whitelists, err := parseWhitelists(*whitelists, *whitelistFiles)
+	allowLists, err := parseAllowLists(*allowLists, *allowListFiles)
 	if err != nil {
-		fmt.Fprintf(os.Stderr, "Error parsing whitelists: %v\n", err)
+		fmt.Fprintf(os.Stderr, "Error parsing allowlists: %v\n", err)
 		os.Exit(1)
 	}
 
@@ -67,7 +67,7 @@
 	}
 	defer refZip.Close()
 
-	diff, err := compareTargetFiles(priZip, refZip, targetFilesPattern, whitelists, *filters)
+	diff, err := compareTargetFiles(priZip, refZip, targetFilesPattern, allowLists, *filters)
 	if err != nil {
 		fmt.Fprintf(os.Stderr, "Error comparing zip files: %v\n", err)
 		os.Exit(1)
diff --git a/cmd/merge_zips/merge_zips.go b/cmd/merge_zips/merge_zips.go
index a95aca9..274c8ee 100644
--- a/cmd/merge_zips/merge_zips.go
+++ b/cmd/merge_zips/merge_zips.go
@@ -429,7 +429,7 @@
 	if maxOpenZips < 3 {
 		panic(fmt.Errorf("open zips limit should be above 3"))
 	}
-	// In the dummy element .older points to the most recently opened InputZip, and .newer points to the oldest.
+	// In the fake element .older points to the most recently opened InputZip, and .newer points to the oldest.
 	head := new(ManagedInputZip)
 	head.older = head
 	head.newer = head
diff --git a/cmd/soong_ui/main.go b/cmd/soong_ui/main.go
index d3802f9..69e4f69 100644
--- a/cmd/soong_ui/main.go
+++ b/cmd/soong_ui/main.go
@@ -35,14 +35,14 @@
 // A command represents an operation to be executed in the soong build
 // system.
 type command struct {
-	// the flag name (must have double dashes)
+	// The flag name (must have double dashes).
 	flag string
 
-	// description for the flag (to display when running help)
+	// Description for the flag (to display when running help).
 	description string
 
-	// Forces the status output into dumb terminal mode.
-	forceDumbOutput bool
+	// Stream the build status output into the simple terminal mode.
+	simpleOutput bool
 
 	// Sets a prefix string to use for filenames of log files.
 	logsPrefix string
@@ -70,21 +70,21 @@
 		stdio: stdio,
 		run:   make,
 	}, {
-		flag:            "--dumpvar-mode",
-		description:     "print the value of the legacy make variable VAR to stdout",
-		forceDumbOutput: true,
-		logsPrefix:      "dumpvars-",
-		config:          dumpVarConfig,
-		stdio:           customStdio,
-		run:             dumpVar,
+		flag:         "--dumpvar-mode",
+		description:  "print the value of the legacy make variable VAR to stdout",
+		simpleOutput: true,
+		logsPrefix:   "dumpvars-",
+		config:       dumpVarConfig,
+		stdio:        customStdio,
+		run:          dumpVar,
 	}, {
-		flag:            "--dumpvars-mode",
-		description:     "dump the values of one or more legacy make variables, in shell syntax",
-		forceDumbOutput: true,
-		logsPrefix:      "dumpvars-",
-		config:          dumpVarConfig,
-		stdio:           customStdio,
-		run:             dumpVars,
+		flag:         "--dumpvars-mode",
+		description:  "dump the values of one or more legacy make variables, in shell syntax",
+		simpleOutput: true,
+		logsPrefix:   "dumpvars-",
+		config:       dumpVarConfig,
+		stdio:        customStdio,
+		run:          dumpVars,
 	}, {
 		flag:        "--build-mode",
 		description: "build modules based on the specified build action",
@@ -117,7 +117,7 @@
 // Command is the type of soong_ui execution. Only one type of
 // execution is specified. The args are specific to the command.
 func main() {
-	buildStartedMilli := time.Now().UnixNano() / int64(time.Millisecond)
+	buildStarted := time.Now()
 
 	c, args := getCommand(os.Args)
 	if c == nil {
@@ -125,7 +125,7 @@
 		os.Exit(1)
 	}
 
-	output := terminal.NewStatusOutput(c.stdio().Stdout(), os.Getenv("NINJA_STATUS"), c.forceDumbOutput,
+	output := terminal.NewStatusOutput(c.stdio().Stdout(), os.Getenv("NINJA_STATUS"), c.simpleOutput,
 		build.OsEnvironment().IsEnvTrue("ANDROID_QUIET_BUILD"))
 
 	log := logger.New(output)
@@ -138,6 +138,7 @@
 	defer trace.Close()
 
 	met := metrics.New()
+	met.SetBuildDateTime(buildStarted)
 
 	stat := &status.Status{}
 	defer stat.Finish()
@@ -171,7 +172,7 @@
 	buildErrorFile := filepath.Join(logsDir, c.logsPrefix+"build_error")
 	rbeMetricsFile := filepath.Join(logsDir, c.logsPrefix+"rbe_metrics.pb")
 	soongMetricsFile := filepath.Join(logsDir, c.logsPrefix+"soong_metrics")
-	defer build.UploadMetrics(buildCtx, config, c.forceDumbOutput, buildStartedMilli, buildErrorFile, rbeMetricsFile, soongMetricsFile)
+	defer build.UploadMetrics(buildCtx, config, c.simpleOutput, buildStarted, buildErrorFile, rbeMetricsFile, soongMetricsFile)
 
 	os.MkdirAll(logsDir, 0777)
 	log.SetOutput(filepath.Join(logsDir, c.logsPrefix+"soong.log"))
diff --git a/dexpreopt/config.go b/dexpreopt/config.go
index 2cf65fe..db5e97a 100644
--- a/dexpreopt/config.go
+++ b/dexpreopt/config.go
@@ -40,15 +40,15 @@
 	DisableGenerateProfile bool   // don't generate profiles
 	ProfileDir             string // directory to find profiles in
 
-	BootJars          []string // modules for jars that form the boot class path
-	UpdatableBootJars []string // jars within apex that form the boot class path
+	BootJars          android.ConfiguredJarList // modules for jars that form the boot class path
+	UpdatableBootJars android.ConfiguredJarList // jars within apex that form the boot class path
 
-	ArtApexJars []string // modules for jars that are in the ART APEX
+	ArtApexJars android.ConfiguredJarList // modules for jars that are in the ART APEX
 
-	SystemServerJars          []string // jars that form the system server
-	SystemServerApps          []string // apps that are loaded into system server
-	UpdatableSystemServerJars []string // jars within apex that are loaded into system server
-	SpeedApps                 []string // apps that should be speed optimized
+	SystemServerJars          []string                  // jars that form the system server
+	SystemServerApps          []string                  // apps that are loaded into system server
+	UpdatableSystemServerJars android.ConfiguredJarList // jars within apex that are loaded into system server
+	SpeedApps                 []string                  // apps that should be speed optimized
 
 	BrokenSuboptimalOrderOfSystemServerJars bool // if true, sub-optimal order does not cause a build error
 
@@ -189,8 +189,12 @@
 
 		// Copies of entries in GlobalConfig that are not constructable without extra parameters.  They will be
 		// used to construct the real value manually below.
-		DirtyImageObjects string
-		BootImageProfiles []string
+		BootJars                  []string
+		UpdatableBootJars         []string
+		ArtApexJars               []string
+		UpdatableSystemServerJars []string
+		DirtyImageObjects         string
+		BootImageProfiles         []string
 	}
 
 	config := GlobalJSONConfig{}
@@ -200,6 +204,10 @@
 	}
 
 	// Construct paths that require a PathContext.
+	config.GlobalConfig.BootJars = android.CreateConfiguredJarList(ctx, config.BootJars)
+	config.GlobalConfig.UpdatableBootJars = android.CreateConfiguredJarList(ctx, config.UpdatableBootJars)
+	config.GlobalConfig.ArtApexJars = android.CreateConfiguredJarList(ctx, config.ArtApexJars)
+	config.GlobalConfig.UpdatableSystemServerJars = android.CreateConfiguredJarList(ctx, config.UpdatableSystemServerJars)
 	config.GlobalConfig.DirtyImageObjects = android.OptionalPathForPath(constructPath(ctx, config.DirtyImageObjects))
 	config.GlobalConfig.BootImageProfiles = constructPaths(ctx, config.BootImageProfiles)
 
@@ -530,12 +538,12 @@
 		PatternsOnSystemOther:              nil,
 		DisableGenerateProfile:             false,
 		ProfileDir:                         "",
-		BootJars:                           nil,
-		UpdatableBootJars:                  nil,
-		ArtApexJars:                        nil,
+		BootJars:                           android.EmptyConfiguredJarList(),
+		UpdatableBootJars:                  android.EmptyConfiguredJarList(),
+		ArtApexJars:                        android.EmptyConfiguredJarList(),
 		SystemServerJars:                   nil,
 		SystemServerApps:                   nil,
-		UpdatableSystemServerJars:          nil,
+		UpdatableSystemServerJars:          android.EmptyConfiguredJarList(),
 		SpeedApps:                          nil,
 		PreoptFlags:                        nil,
 		DefaultCompilerFilter:              "",
diff --git a/dexpreopt/dexpreopt.go b/dexpreopt/dexpreopt.go
index e49fa98..8c9f0a2 100644
--- a/dexpreopt/dexpreopt.go
+++ b/dexpreopt/dexpreopt.go
@@ -83,7 +83,7 @@
 
 	if !dexpreoptDisabled(ctx, global, module) {
 		// Don't preopt individual boot jars, they will be preopted together.
-		if !contains(android.GetJarsFromApexJarPairs(ctx, global.BootJars), module.Name) {
+		if !global.BootJars.ContainsJar(module.Name) {
 			appImage := (generateProfile || module.ForceCreateAppImage || global.DefaultAppImages) &&
 				!module.NoCreateAppImage
 
@@ -104,17 +104,15 @@
 	}
 
 	// Don't preopt system server jars that are updatable.
-	for _, p := range global.UpdatableSystemServerJars {
-		if _, jar := android.SplitApexJarPair(ctx, p); jar == module.Name {
-			return true
-		}
+	if global.UpdatableSystemServerJars.ContainsJar(module.Name) {
+		return true
 	}
 
 	// If OnlyPreoptBootImageAndSystemServer=true and module is not in boot class path skip
 	// Also preopt system server jars since selinux prevents system server from loading anything from
 	// /data. If we don't do this they will need to be extracted which is not favorable for RAM usage
 	// or performance. If PreoptExtractedApk is true, we ignore the only preopt boot image options.
-	if global.OnlyPreoptBootImageAndSystemServer && !contains(android.GetJarsFromApexJarPairs(ctx, global.BootJars), module.Name) &&
+	if global.OnlyPreoptBootImageAndSystemServer && !global.BootJars.ContainsJar(module.Name) &&
 		!contains(global.SystemServerJars, module.Name) && !module.PreoptExtractedApk {
 		return true
 	}
@@ -571,20 +569,13 @@
 	}
 }
 
-// Expected format for apexJarValue = <apex name>:<jar name>
-func GetJarLocationFromApexJarPair(ctx android.PathContext, apexJarValue string) string {
-	apex, jar := android.SplitApexJarPair(ctx, apexJarValue)
-	return filepath.Join("/apex", apex, "javalib", jar+".jar")
-}
-
 var nonUpdatableSystemServerJarsKey = android.NewOnceKey("nonUpdatableSystemServerJars")
 
 // TODO: eliminate the superficial global config parameter by moving global config definition
 // from java subpackage to dexpreopt.
 func NonUpdatableSystemServerJars(ctx android.PathContext, global *GlobalConfig) []string {
 	return ctx.Config().Once(nonUpdatableSystemServerJarsKey, func() interface{} {
-		return android.RemoveListFromList(global.SystemServerJars,
-			android.GetJarsFromApexJarPairs(ctx, global.UpdatableSystemServerJars))
+		return android.RemoveListFromList(global.SystemServerJars, global.UpdatableSystemServerJars.CopyOfJars())
 	}).([]string)
 }
 
diff --git a/genrule/genrule.go b/genrule/genrule.go
index 00baa57..1cec289 100644
--- a/genrule/genrule.go
+++ b/genrule/genrule.go
@@ -259,9 +259,9 @@
 
 		// If AllowMissingDependencies is enabled, the build will not have stopped when
 		// AddFarVariationDependencies was called on a missing tool, which will result in nonsensical
-		// "cmd: unknown location label ..." errors later.  Add a dummy file to the local label.  The
-		// command that uses this dummy file will never be executed because the rule will be replaced with
-		// an android.Error rule reporting the missing dependencies.
+		// "cmd: unknown location label ..." errors later.  Add a placeholder file to the local label.
+		// The command that uses this placeholder file will never be executed because the rule will be
+		// replaced with an android.Error rule reporting the missing dependencies.
 		if ctx.Config().AllowMissingDependencies() {
 			for _, tool := range g.properties.Tools {
 				if !seenTools[tool] {
@@ -292,9 +292,9 @@
 
 			// If AllowMissingDependencies is enabled, the build will not have stopped when
 			// the dependency was added on a missing SourceFileProducer module, which will result in nonsensical
-			// "cmd: label ":..." has no files" errors later.  Add a dummy file to the local label.  The
-			// command that uses this dummy file will never be executed because the rule will be replaced with
-			// an android.Error rule reporting the missing dependencies.
+			// "cmd: label ":..." has no files" errors later.  Add a placeholder file to the local label.
+			// The command that uses this placeholder file will never be executed because the rule will be
+			// replaced with an android.Error rule reporting the missing dependencies.
 			ctx.AddMissingDependencies(missingDeps)
 			addLocationLabel(in, []string{"***missing srcs " + in + "***"})
 		} else {
diff --git a/java/Android.bp b/java/Android.bp
index 1fda7f7..e345014 100644
--- a/java/Android.bp
+++ b/java/Android.bp
@@ -10,6 +10,7 @@
         "soong-dexpreopt",
         "soong-genrule",
         "soong-java-config",
+        "soong-python",
         "soong-remoteexec",
         "soong-tradefed",
     ],
@@ -38,6 +39,7 @@
         "java_resources.go",
         "kotlin.go",
         "lint.go",
+        "legacy_core_platform_api_usage.go",
         "platform_compat_config.go",
         "plugin.go",
         "prebuilt_apis.go",
diff --git a/java/aar.go b/java/aar.go
index 500788f..ad9b5e7 100644
--- a/java/aar.go
+++ b/java/aar.go
@@ -641,7 +641,7 @@
 var unzipAAR = pctx.AndroidStaticRule("unzipAAR",
 	blueprint.RuleParams{
 		Command: `rm -rf $outDir && mkdir -p $outDir && ` +
-			`unzip -qo -d $outDir $in && rm -rf $outDir/res && touch $out`,
+			`unzip -qoDD -d $outDir $in && rm -rf $outDir/res && touch $out`,
 	},
 	"outDir")
 
diff --git a/java/android_manifest.go b/java/android_manifest.go
index 8280cb1..84dee16 100644
--- a/java/android_manifest.go
+++ b/java/android_manifest.go
@@ -130,7 +130,7 @@
 		},
 	})
 
-	return fixedManifest
+	return fixedManifest.WithoutRel()
 }
 
 func manifestMerger(ctx android.ModuleContext, manifest android.Path, staticLibManifests android.Paths,
@@ -155,5 +155,5 @@
 		},
 	})
 
-	return mergedManifest
+	return mergedManifest.WithoutRel()
 }
diff --git a/java/androidmk.go b/java/androidmk.go
index 618e15d..650d126 100644
--- a/java/androidmk.go
+++ b/java/androidmk.go
@@ -127,10 +127,12 @@
 						entries.AddStrings("LOCAL_ADDITIONAL_CHECKED_MODULE", library.additionalCheckedModules.Strings()...)
 					}
 
-					if library.proguardDictionary != nil {
-						entries.SetPath("LOCAL_SOONG_PROGUARD_DICT", library.proguardDictionary)
+					if library.dexer.proguardDictionary.Valid() {
+						entries.SetPath("LOCAL_SOONG_PROGUARD_DICT", library.dexer.proguardDictionary.Path())
 					}
 					entries.SetString("LOCAL_MODULE_STEM", library.Stem())
+
+					entries.SetOptionalPaths("LOCAL_SOONG_LINT_REPORTS", library.linter.reports)
 				},
 			},
 		}
@@ -330,8 +332,8 @@
 				if app.jacocoReportClassesFile != nil {
 					entries.SetPath("LOCAL_SOONG_JACOCO_REPORT_CLASSES_JAR", app.jacocoReportClassesFile)
 				}
-				if app.proguardDictionary != nil {
-					entries.SetPath("LOCAL_SOONG_PROGUARD_DICT", app.proguardDictionary)
+				if app.dexer.proguardDictionary.Valid() {
+					entries.SetPath("LOCAL_SOONG_PROGUARD_DICT", app.dexer.proguardDictionary.Path())
 				}
 
 				if app.Name() == "framework-res" {
@@ -370,9 +372,15 @@
 				entries.SetString("LOCAL_CERTIFICATE", app.certificate.AndroidMkString())
 				entries.AddStrings("LOCAL_OVERRIDES_PACKAGES", app.getOverriddenPackages()...)
 
-				for _, jniLib := range app.installJniLibs {
-					entries.AddStrings("LOCAL_SOONG_JNI_LIBS_"+jniLib.target.Arch.ArchType.String(), jniLib.name)
+				if app.embeddedJniLibs {
+					jniSymbols := app.JNISymbolsInstalls(app.installPathForJNISymbols.String())
+					entries.SetString("LOCAL_SOONG_JNI_LIBS_SYMBOLS", jniSymbols.String())
+				} else {
+					for _, jniLib := range app.jniLibs {
+						entries.AddStrings("LOCAL_SOONG_JNI_LIBS_"+jniLib.target.Arch.ArchType.String(), jniLib.name)
+					}
 				}
+
 				if len(app.jniCoverageOutputs) > 0 {
 					entries.AddStrings("LOCAL_PREBUILT_COVERAGE_ARCHIVE", app.jniCoverageOutputs.Strings()...)
 				}
@@ -383,6 +391,8 @@
 					install := app.onDeviceDir + "/" + extra.Base()
 					entries.AddStrings("LOCAL_SOONG_BUILT_INSTALLED", extra.String()+":"+install)
 				}
+
+				entries.SetOptionalPaths("LOCAL_SOONG_LINT_REPORTS", app.linter.reports)
 			},
 		},
 		ExtraFooters: []android.AndroidMkExtraFootersFunc{
@@ -718,7 +728,7 @@
 			ExtraEntries: []android.AndroidMkExtraEntriesFunc{
 				func(entries *android.AndroidMkEntries) {
 					entries.SetBoolIfTrue("LOCAL_PRIVILEGED_MODULE", apkSet.Privileged())
-					entries.SetString("LOCAL_APK_SET_MASTER_FILE", apkSet.masterFile)
+					entries.SetString("LOCAL_APK_SET_INSTALL_FILE", apkSet.InstallFile())
 					entries.SetPath("LOCAL_APKCERTS_FILE", apkSet.apkcertsFile)
 					entries.AddStrings("LOCAL_OVERRIDES_PACKAGES", apkSet.properties.Overrides...)
 				},
diff --git a/java/app.go b/java/app.go
index 98bce94..8a0b3db 100755
--- a/java/app.go
+++ b/java/app.go
@@ -78,7 +78,7 @@
 
 	properties   AndroidAppSetProperties
 	packedOutput android.WritablePath
-	masterFile   string
+	installFile  string
 	apkcertsFile android.ModuleOutPath
 }
 
@@ -102,8 +102,12 @@
 	return as.packedOutput
 }
 
-func (as *AndroidAppSet) MasterFile() string {
-	return as.masterFile
+func (as *AndroidAppSet) InstallFile() string {
+	return as.installFile
+}
+
+func (as *AndroidAppSet) APKCertsFile() android.Path {
+	return as.apkcertsFile
 }
 
 var TargetCpuAbi = map[string]string{
@@ -132,10 +136,10 @@
 func (as *AndroidAppSet) GenerateAndroidBuildActions(ctx android.ModuleContext) {
 	as.packedOutput = android.PathForModuleOut(ctx, ctx.ModuleName()+".zip")
 	as.apkcertsFile = android.PathForModuleOut(ctx, "apkcerts.txt")
-	// We are assuming here that the master file in the APK
+	// We are assuming here that the install file in the APK
 	// set has `.apk` suffix. If it doesn't the build will fail.
 	// APK sets containing APEX files are handled elsewhere.
-	as.masterFile = as.BaseModuleName() + ".apk"
+	as.installFile = as.BaseModuleName() + ".apk"
 	screenDensities := "all"
 	if dpis := ctx.Config().ProductAAPTPrebuiltDPI(); len(dpis) > 0 {
 		screenDensities = strings.ToUpper(strings.Join(dpis, ","))
@@ -163,7 +167,7 @@
 
 // android_app_set extracts a set of APKs based on the target device
 // configuration and installs this set as "split APKs".
-// The extracted set always contains 'master' APK whose name is
+// The extracted set always contains an APK whose name is
 // _module_name_.apk and every split APK matching target device.
 // The extraction of the density-specific splits depends on
 // PRODUCT_AAPT_PREBUILT_DPI variable. If present (its value should
@@ -288,8 +292,10 @@
 
 	overridableAppProperties overridableAppProperties
 
-	installJniLibs     []jniLib
-	jniCoverageOutputs android.Paths
+	jniLibs                  []jniLib
+	installPathForJNISymbols android.Path
+	embeddedJniLibs          bool
+	jniCoverageOutputs       android.Paths
 
 	bundleFile android.Path
 
@@ -566,8 +572,7 @@
 	a.Module.extraProguardFlagFiles = append(a.Module.extraProguardFlagFiles, a.proguardOptionsFile)
 }
 
-func (a *AndroidApp) dexBuildActions(ctx android.ModuleContext) android.Path {
-
+func (a *AndroidApp) installPath(ctx android.ModuleContext) android.InstallPath {
 	var installDir string
 	if ctx.ModuleName() == "framework-res" {
 		// framework-res.apk is installed as system/framework/framework-res.apk
@@ -577,12 +582,17 @@
 	} else {
 		installDir = filepath.Join("app", a.installApkName)
 	}
-	a.dexpreopter.installPath = android.PathForModuleInstall(ctx, installDir, a.installApkName+".apk")
-	if a.deviceProperties.Uncompress_dex == nil {
+
+	return android.PathForModuleInstall(ctx, installDir, a.installApkName+".apk")
+}
+
+func (a *AndroidApp) dexBuildActions(ctx android.ModuleContext) android.Path {
+	a.dexpreopter.installPath = a.installPath(ctx)
+	if a.dexProperties.Uncompress_dex == nil {
 		// If the value was not force-set by the user, use reasonable default based on the module.
-		a.deviceProperties.Uncompress_dex = proptools.BoolPtr(a.shouldUncompressDex(ctx))
+		a.dexProperties.Uncompress_dex = proptools.BoolPtr(a.shouldUncompressDex(ctx))
 	}
-	a.dexpreopter.uncompressedDex = *a.deviceProperties.Uncompress_dex
+	a.dexpreopter.uncompressedDex = *a.dexProperties.Uncompress_dex
 	a.dexpreopter.enforceUsesLibs = a.usesLibrary.enforceUsesLibraries()
 	a.dexpreopter.usesLibs = a.usesLibrary.usesLibraryProperties.Uses_libs
 	a.dexpreopter.optionalUsesLibs = a.usesLibrary.presentOptionalUsesLibs(ctx)
@@ -599,8 +609,10 @@
 func (a *AndroidApp) jniBuildActions(jniLibs []jniLib, ctx android.ModuleContext) android.WritablePath {
 	var jniJarFile android.WritablePath
 	if len(jniLibs) > 0 {
+		a.jniLibs = jniLibs
 		if a.shouldEmbedJnis(ctx) {
 			jniJarFile = android.PathForModuleOut(ctx, "jnilibs.zip")
+			a.installPathForJNISymbols = a.installPath(ctx).ToMakePath()
 			TransformJniLibsToJar(ctx, jniJarFile, jniLibs, a.useEmbeddedNativeLibs(ctx))
 			for _, jni := range jniLibs {
 				if jni.coverageFile.Valid() {
@@ -618,13 +630,25 @@
 					}
 				}
 			}
-		} else {
-			a.installJniLibs = jniLibs
+			a.embeddedJniLibs = true
 		}
 	}
 	return jniJarFile
 }
 
+func (a *AndroidApp) JNISymbolsInstalls(installPath string) android.RuleBuilderInstalls {
+	var jniSymbols android.RuleBuilderInstalls
+	for _, jniLib := range a.jniLibs {
+		if jniLib.unstrippedFile != nil {
+			jniSymbols = append(jniSymbols, android.RuleBuilderInstall{
+				From: jniLib.unstrippedFile,
+				To:   filepath.Join(installPath, targetToJniDir(jniLib.target), jniLib.unstrippedFile.Base()),
+			})
+		}
+	}
+	return jniSymbols
+}
+
 func (a *AndroidApp) noticeBuildActions(ctx android.ModuleContext) {
 	// Collect NOTICE files from all dependencies.
 	seenModules := make(map[android.Module]bool)
@@ -752,6 +776,7 @@
 	a.linter.mergedManifest = a.aapt.mergedManifestFile
 	a.linter.manifest = a.aapt.manifestPath
 	a.linter.resources = a.aapt.resourceFiles
+	a.linter.buildModuleReportZip = ctx.Config().UnbundledBuildApps()
 
 	dexJarFile := a.dexBuildActions(ctx)
 
@@ -820,7 +845,9 @@
 		otherName := ctx.OtherModuleName(module)
 		tag := ctx.OtherModuleDependencyTag(module)
 
-		if IsJniDepTag(tag) || tag == cc.SharedDepTag {
+		// TODO(ccross): The tag == cc.SharedDepTag() check should be cc.IsSharedDepTag(tag) but
+		//   was left to maintain behavior when adding libraryDependencyTag.
+		if IsJniDepTag(tag) || tag == cc.SharedDepTag() {
 			if dep, ok := module.(*cc.Module); ok {
 				if dep.IsNdk() || dep.IsStubs() {
 					return false
@@ -840,10 +867,11 @@
 
 				if lib.Valid() {
 					jniLibs = append(jniLibs, jniLib{
-						name:         ctx.OtherModuleName(module),
-						path:         path,
-						target:       module.Target(),
-						coverageFile: dep.CoverageOutputFile(),
+						name:           ctx.OtherModuleName(module),
+						path:           path,
+						target:         module.Target(),
+						coverageFile:   dep.CoverageOutputFile(),
+						unstrippedFile: dep.UnstrippedOutputFile(),
 					})
 				} else {
 					ctx.ModuleErrorf("dependency %q missing output file", otherName)
@@ -969,8 +997,8 @@
 func AndroidAppFactory() android.Module {
 	module := &AndroidApp{}
 
-	module.Module.deviceProperties.Optimize.EnabledByDefault = true
-	module.Module.deviceProperties.Optimize.Shrink = proptools.BoolPtr(true)
+	module.Module.dexProperties.Optimize.EnabledByDefault = true
+	module.Module.dexProperties.Optimize.Shrink = proptools.BoolPtr(true)
 
 	module.Module.properties.Instrument = true
 	module.Module.properties.Installable = proptools.BoolPtr(true)
@@ -1084,7 +1112,7 @@
 func AndroidTestFactory() android.Module {
 	module := &AndroidTest{}
 
-	module.Module.deviceProperties.Optimize.EnabledByDefault = true
+	module.Module.dexProperties.Optimize.EnabledByDefault = true
 
 	module.Module.properties.Instrument = true
 	module.Module.properties.Installable = proptools.BoolPtr(true)
@@ -1135,7 +1163,7 @@
 func AndroidTestHelperAppFactory() android.Module {
 	module := &AndroidTestHelperApp{}
 
-	module.Module.deviceProperties.Optimize.EnabledByDefault = true
+	module.Module.dexProperties.Optimize.EnabledByDefault = true
 
 	module.Module.properties.Installable = proptools.BoolPtr(true)
 	module.appProperties.Use_embedded_native_libs = proptools.BoolPtr(true)
diff --git a/java/app_test.go b/java/app_test.go
index d4323bb..efb4fd2 100644
--- a/java/app_test.go
+++ b/java/app_test.go
@@ -161,11 +161,11 @@
 		t.Errorf("wrong partition value: '%s', expected 'system'", s)
 	}
 	mkEntries := android.AndroidMkEntriesForTest(t, config, "", module.Module())[0]
-	actualMaster := mkEntries.EntryMap["LOCAL_APK_SET_MASTER_FILE"]
-	expectedMaster := []string{"foo.apk"}
-	if !reflect.DeepEqual(actualMaster, expectedMaster) {
-		t.Errorf("Unexpected LOCAL_APK_SET_MASTER_FILE value: '%s', expected: '%s',",
-			actualMaster, expectedMaster)
+	actualInstallFile := mkEntries.EntryMap["LOCAL_APK_SET_INSTALL_FILE"]
+	expectedInstallFile := []string{"foo.apk"}
+	if !reflect.DeepEqual(actualInstallFile, expectedInstallFile) {
+		t.Errorf("Unexpected LOCAL_APK_SET_INSTALL_FILE value: '%s', expected: '%s',",
+			actualInstallFile, expectedInstallFile)
 	}
 }
 
diff --git a/java/config/config.go b/java/config/config.go
index 0fe74c8..d2f4513 100644
--- a/java/config/config.go
+++ b/java/config/config.go
@@ -30,6 +30,8 @@
 
 	LegacyCorePlatformBootclasspathLibraries = []string{"legacy.core.platform.api.stubs", "core-lambda-stubs"}
 	LegacyCorePlatformSystemModules          = "legacy-core-platform-api-stubs-system-modules"
+	StableCorePlatformBootclasspathLibraries = []string{"stable.core.platform.api.stubs", "core-lambda-stubs"}
+	StableCorePlatformSystemModules          = "stable-core-platform-api-stubs-system-modules"
 	FrameworkLibraries                       = []string{"ext", "framework"}
 	DefaultLambdaStubsLibrary                = "core-lambda-stubs"
 	SdkLambdaStubsPath                       = "prebuilts/sdk/tools/core-lambda-stubs.jar"
diff --git a/java/dex.go b/java/dex.go
index 9e61e95..cd45a93 100644
--- a/java/dex.go
+++ b/java/dex.go
@@ -24,6 +24,60 @@
 	"android/soong/remoteexec"
 )
 
+type DexProperties struct {
+	// If set to true, compile dex regardless of installable.  Defaults to false.
+	Compile_dex *bool
+
+	// list of module-specific flags that will be used for dex compiles
+	Dxflags []string `android:"arch_variant"`
+
+	Optimize struct {
+		// If false, disable all optimization.  Defaults to true for android_app and android_test
+		// modules, false for java_library and java_test modules.
+		Enabled *bool
+		// True if the module containing this has it set by default.
+		EnabledByDefault bool `blueprint:"mutated"`
+
+		// If true, optimize for size by removing unused code.  Defaults to true for apps,
+		// false for libraries and tests.
+		Shrink *bool
+
+		// If true, optimize bytecode.  Defaults to false.
+		Optimize *bool
+
+		// If true, obfuscate bytecode.  Defaults to false.
+		Obfuscate *bool
+
+		// If true, do not use the flag files generated by aapt that automatically keep
+		// classes referenced by the app manifest.  Defaults to false.
+		No_aapt_flags *bool
+
+		// Flags to pass to proguard.
+		Proguard_flags []string
+
+		// Specifies the locations of files containing proguard flags.
+		Proguard_flags_files []string `android:"path"`
+	}
+
+	// Keep the data uncompressed. We always need uncompressed dex for execution,
+	// so this might actually save space by avoiding storing the same data twice.
+	// This defaults to reasonable value based on module and should not be set.
+	// It exists only to support ART tests.
+	Uncompress_dex *bool
+}
+
+type dexer struct {
+	dexProperties DexProperties
+
+	// list of extra proguard flag files
+	extraProguardFlagFiles android.Paths
+	proguardDictionary     android.OptionalPath
+}
+
+func (d *dexer) effectiveOptimizeEnabled() bool {
+	return BoolDefault(d.dexProperties.Optimize.Enabled, d.dexProperties.Optimize.EnabledByDefault)
+}
+
 var d8, d8RE = remoteexec.MultiCommandStaticRules(pctx, "d8",
 	blueprint.RuleParams{
 		Command: `rm -rf "$outDir" && mkdir -p "$outDir" && ` +
@@ -86,8 +140,8 @@
 		},
 	}, []string{"outDir", "outDict", "r8Flags", "zipFlags"}, []string{"implicits"})
 
-func (j *Module) dexCommonFlags(ctx android.ModuleContext) []string {
-	flags := j.deviceProperties.Dxflags
+func (d *dexer) dexCommonFlags(ctx android.ModuleContext, minSdkVersion sdkSpec) []string {
+	flags := d.dexProperties.Dxflags
 	// Translate all the DX flags to D8 ones until all the build files have been migrated
 	// to D8 flags. See: b/69377755
 	flags = android.RemoveListFromList(flags,
@@ -103,30 +157,27 @@
 			"--verbose")
 	}
 
-	minSdkVersion, err := j.minSdkVersion().effectiveVersion(ctx)
+	effectiveVersion, err := minSdkVersion.effectiveVersion(ctx)
 	if err != nil {
 		ctx.PropertyErrorf("min_sdk_version", "%s", err)
 	}
 
-	flags = append(flags, "--min-api "+minSdkVersion.asNumberString())
+	flags = append(flags, "--min-api "+effectiveVersion.asNumberString())
 	return flags
 }
 
-func (j *Module) d8Flags(ctx android.ModuleContext, flags javaBuilderFlags) ([]string, android.Paths) {
-	d8Flags := j.dexCommonFlags(ctx)
-
+func d8Flags(flags javaBuilderFlags) (d8Flags []string, d8Deps android.Paths) {
 	d8Flags = append(d8Flags, flags.bootClasspath.FormRepeatedClassPath("--lib ")...)
 	d8Flags = append(d8Flags, flags.classpath.FormRepeatedClassPath("--lib ")...)
 
-	var d8Deps android.Paths
 	d8Deps = append(d8Deps, flags.bootClasspath...)
 	d8Deps = append(d8Deps, flags.classpath...)
 
 	return d8Flags, d8Deps
 }
 
-func (j *Module) r8Flags(ctx android.ModuleContext, flags javaBuilderFlags) (r8Flags []string, r8Deps android.Paths) {
-	opt := j.deviceProperties.Optimize
+func (d *dexer) r8Flags(ctx android.ModuleContext, flags javaBuilderFlags) (r8Flags []string, r8Deps android.Paths) {
+	opt := d.dexProperties.Optimize
 
 	// When an app contains references to APIs that are not in the SDK specified by
 	// its LOCAL_SDK_VERSION for example added by support library or by runtime
@@ -140,8 +191,6 @@
 		proguardRaiseDeps = append(proguardRaiseDeps, dep.(Dependency).HeaderJars()...)
 	})
 
-	r8Flags = append(r8Flags, j.dexCommonFlags(ctx)...)
-
 	r8Flags = append(r8Flags, proguardRaiseDeps.FormJavaClassPath("-libraryjars"))
 	r8Flags = append(r8Flags, flags.bootClasspath.FormJavaClassPath("-libraryjars"))
 	r8Flags = append(r8Flags, flags.classpath.FormJavaClassPath("-libraryjars"))
@@ -154,15 +203,10 @@
 		android.PathForSource(ctx, "build/make/core/proguard.flags"),
 	}
 
-	if j.shouldInstrumentStatic(ctx) {
-		flagFiles = append(flagFiles,
-			android.PathForSource(ctx, "build/make/core/proguard.jacoco.flags"))
-	}
-
-	flagFiles = append(flagFiles, j.extraProguardFlagFiles...)
+	flagFiles = append(flagFiles, d.extraProguardFlagFiles...)
 	// TODO(ccross): static android library proguard files
 
-	flagFiles = append(flagFiles, android.PathsForModuleSrc(ctx, j.deviceProperties.Optimize.Proguard_flags_files)...)
+	flagFiles = append(flagFiles, android.PathsForModuleSrc(ctx, opt.Proguard_flags_files)...)
 
 	r8Flags = append(r8Flags, android.JoinWithPrefix(flagFiles.Strings(), "-include "))
 	r8Deps = append(r8Deps, flagFiles...)
@@ -171,7 +215,7 @@
 	r8Deps = append(r8Deps, android.PathForSource(ctx,
 		"build/make/core/proguard_basic_keeps.flags"))
 
-	r8Flags = append(r8Flags, j.deviceProperties.Optimize.Proguard_flags...)
+	r8Flags = append(r8Flags, opt.Proguard_flags...)
 
 	// TODO(ccross): Don't shrink app instrumentation tests by default.
 	if !Bool(opt.Shrink) {
@@ -197,29 +241,30 @@
 	return r8Flags, r8Deps
 }
 
-func (j *Module) compileDex(ctx android.ModuleContext, flags javaBuilderFlags,
+func (d *dexer) compileDex(ctx android.ModuleContext, flags javaBuilderFlags, minSdkVersion sdkSpec,
 	classesJar android.Path, jarName string) android.ModuleOutPath {
 
-	useR8 := j.deviceProperties.EffectiveOptimizeEnabled()
-
 	// Compile classes.jar into classes.dex and then javalib.jar
 	javalibJar := android.PathForModuleOut(ctx, "dex", jarName)
 	outDir := android.PathForModuleOut(ctx, "dex")
 
 	zipFlags := "--ignore_missing_files"
-	if proptools.Bool(j.deviceProperties.Uncompress_dex) {
+	if proptools.Bool(d.dexProperties.Uncompress_dex) {
 		zipFlags += " -L 0"
 	}
 
+	commonFlags := d.dexCommonFlags(ctx, minSdkVersion)
+
+	useR8 := d.effectiveOptimizeEnabled()
 	if useR8 {
 		proguardDictionary := android.PathForModuleOut(ctx, "proguard_dictionary")
-		j.proguardDictionary = proguardDictionary
-		r8Flags, r8Deps := j.r8Flags(ctx, flags)
+		d.proguardDictionary = android.OptionalPathForPath(proguardDictionary)
+		r8Flags, r8Deps := d.r8Flags(ctx, flags)
 		rule := r8
 		args := map[string]string{
-			"r8Flags":  strings.Join(r8Flags, " "),
+			"r8Flags":  strings.Join(append(commonFlags, r8Flags...), " "),
 			"zipFlags": zipFlags,
-			"outDict":  j.proguardDictionary.String(),
+			"outDict":  proguardDictionary.String(),
 			"outDir":   outDir.String(),
 		}
 		if ctx.Config().IsEnvTrue("RBE_R8") {
@@ -236,7 +281,7 @@
 			Args:           args,
 		})
 	} else {
-		d8Flags, d8Deps := j.d8Flags(ctx, flags)
+		d8Flags, d8Deps := d8Flags(flags)
 		rule := d8
 		if ctx.Config().IsEnvTrue("RBE_D8") {
 			rule = d8RE
@@ -248,13 +293,13 @@
 			Input:       classesJar,
 			Implicits:   d8Deps,
 			Args: map[string]string{
-				"d8Flags":  strings.Join(d8Flags, " "),
+				"d8Flags":  strings.Join(append(commonFlags, d8Flags...), " "),
 				"zipFlags": zipFlags,
 				"outDir":   outDir.String(),
 			},
 		})
 	}
-	if proptools.Bool(j.deviceProperties.Uncompress_dex) {
+	if proptools.Bool(d.dexProperties.Uncompress_dex) {
 		alignedJavalibJar := android.PathForModuleOut(ctx, "aligned", jarName)
 		TransformZipAlign(ctx, alignedJavalibJar, javalibJar)
 		javalibJar = alignedJavalibJar
diff --git a/java/dexpreopt_bootjars.go b/java/dexpreopt_bootjars.go
index 4120559..3abe782 100644
--- a/java/dexpreopt_bootjars.go
+++ b/java/dexpreopt_bootjars.go
@@ -49,8 +49,8 @@
 	// Subdirectory where the image files are installed.
 	installSubdir string
 
-	// The names of jars that constitute this image.
-	modules []string
+	// A list of (location, jar) pairs for the Java modules in this image.
+	modules android.ConfiguredJarList
 
 	// File paths to jars.
 	dexPaths     android.WritablePaths // for this image
@@ -113,16 +113,16 @@
 	// Dexpreopt on the boot class path produces multiple files. The first dex file
 	// is converted into 'name'.art (to match the legacy assumption that 'name'.art
 	// exists), and the rest are converted to 'name'-<jar>.art.
-	_, m := android.SplitApexJarPair(ctx, image.modules[idx])
+	m := image.modules.Jar(idx)
 	name := image.stem
 	if idx != 0 || image.extends != nil {
-		name += "-" + stemOf(m)
+		name += "-" + android.ModuleStem(m)
 	}
 	return name
 }
 
 func (image bootImageConfig) firstModuleNameOrStem(ctx android.PathContext) string {
-	if len(image.modules) > 0 {
+	if image.modules.Len() > 0 {
 		return image.moduleName(ctx, 0)
 	} else {
 		return image.stem
@@ -130,8 +130,8 @@
 }
 
 func (image bootImageConfig) moduleFiles(ctx android.PathContext, dir android.OutputPath, exts ...string) android.OutputPaths {
-	ret := make(android.OutputPaths, 0, len(image.modules)*len(exts))
-	for i := range image.modules {
+	ret := make(android.OutputPaths, 0, image.modules.Len()*len(exts))
+	for i := 0; i < image.modules.Len(); i++ {
 		name := image.moduleName(ctx, i)
 		for _, ext := range exts {
 			ret = append(ret, dir.Join(ctx, name+ext))
@@ -253,7 +253,7 @@
 	}
 
 	name := ctx.ModuleName(module)
-	index := android.IndexList(name, android.GetJarsFromApexJarPairs(ctx, image.modules))
+	index := image.modules.IndexOfJar(name)
 	if index == -1 {
 		return -1, nil
 	}
@@ -295,7 +295,7 @@
 func buildBootImage(ctx android.SingletonContext, image *bootImageConfig) *bootImageConfig {
 	// Collect dex jar paths for the boot image modules.
 	// This logic is tested in the apex package to avoid import cycle apex <-> java.
-	bootDexJars := make(android.Paths, len(image.modules))
+	bootDexJars := make(android.Paths, image.modules.Len())
 	ctx.VisitAllModules(func(module android.Module) {
 		if i, j := getBootImageJar(ctx, image, module); i != -1 {
 			bootDexJars[i] = j
@@ -306,7 +306,7 @@
 	// Ensure all modules were converted to paths
 	for i := range bootDexJars {
 		if bootDexJars[i] == nil {
-			_, m := android.SplitApexJarPair(ctx, image.modules[i])
+			m := image.modules.Jar(i)
 			if ctx.Config().AllowMissingDependencies() {
 				missingDeps = append(missingDeps, m)
 				bootDexJars[i] = android.PathForOutput(ctx, "missing")
@@ -608,7 +608,7 @@
 
 	return ctx.Config().Once(updatableBcpPackagesRuleKey, func() interface{} {
 		global := dexpreopt.GetGlobalConfig(ctx)
-		updatableModules := android.GetJarsFromApexJarPairs(ctx, global.UpdatableBootJars)
+		updatableModules := global.UpdatableBootJars.CopyOfJars()
 
 		// Collect `permitted_packages` for updatable boot jars.
 		var updatablePackages []string
diff --git a/java/dexpreopt_bootjars_test.go b/java/dexpreopt_bootjars_test.go
index 9670c7f..4a8d3cd 100644
--- a/java/dexpreopt_bootjars_test.go
+++ b/java/dexpreopt_bootjars_test.go
@@ -48,7 +48,7 @@
 
 	pathCtx := android.PathContextForTesting(config)
 	dexpreoptConfig := dexpreopt.GlobalConfigForTests(pathCtx)
-	dexpreoptConfig.BootJars = []string{"platform:foo", "platform:bar", "platform:baz"}
+	dexpreoptConfig.BootJars = android.CreateConfiguredJarList(pathCtx, []string{"platform:foo", "platform:bar", "platform:baz"})
 	dexpreopt.SetTestGlobalConfig(config, dexpreoptConfig)
 
 	ctx := testContext()
diff --git a/java/dexpreopt_config.go b/java/dexpreopt_config.go
index f13d9f2..f0d82ff 100644
--- a/java/dexpreopt_config.go
+++ b/java/dexpreopt_config.go
@@ -37,14 +37,12 @@
 				filepath.Join("/system/framework", m+".jar"))
 		}
 		// 2) The jars that are from an updatable apex.
-		for _, m := range global.UpdatableSystemServerJars {
-			systemServerClasspathLocations = append(systemServerClasspathLocations,
-				dexpreopt.GetJarLocationFromApexJarPair(ctx, m))
-		}
-		if len(systemServerClasspathLocations) != len(global.SystemServerJars)+len(global.UpdatableSystemServerJars) {
+		systemServerClasspathLocations = append(systemServerClasspathLocations,
+			global.UpdatableSystemServerJars.DevicePaths(ctx.Config(), android.Android)...)
+		if len(systemServerClasspathLocations) != len(global.SystemServerJars)+global.UpdatableSystemServerJars.Len() {
 			panic(fmt.Errorf("Wrong number of system server jars, got %d, expected %d",
 				len(systemServerClasspathLocations),
-				len(global.SystemServerJars)+len(global.UpdatableSystemServerJars)))
+				len(global.SystemServerJars)+global.UpdatableSystemServerJars.Len()))
 		}
 		return systemServerClasspathLocations
 	})
@@ -69,39 +67,6 @@
 	return targets
 }
 
-func stemOf(moduleName string) string {
-	// b/139391334: the stem of framework-minus-apex is framework
-	// This is hard coded here until we find a good way to query the stem
-	// of a module before any other mutators are run
-	if moduleName == "framework-minus-apex" {
-		return "framework"
-	}
-	return moduleName
-}
-
-func getDexLocation(ctx android.PathContext, target android.Target, module string) string {
-	apex, jar := android.SplitApexJarPair(ctx, module)
-
-	name := stemOf(jar) + ".jar"
-
-	var subdir string
-	if apex == "platform" {
-		// Special apex name "platform" denotes jars do not come from an apex, but are part
-		// of the platform. Such jars are installed on the /system partition on device.
-		subdir = "system/framework"
-	} else if apex == "system_ext" {
-		subdir = "system_ext/framework"
-	} else {
-		subdir = filepath.Join("apex", apex, "javalib")
-	}
-
-	if target.Os.Class == android.Host {
-		return filepath.Join(ctx.Config().Getenv("OUT_DIR"), "host", ctx.Config().PrebuiltOS(), subdir, name)
-	} else {
-		return filepath.Join("/", subdir, name)
-	}
-}
-
 var (
 	bootImageConfigKey     = android.NewOnceKey("bootImageConfig")
 	artBootImageName       = "art"
@@ -116,12 +81,13 @@
 		targets := dexpreoptTargets(ctx)
 		deviceDir := android.PathForOutput(ctx, ctx.Config().DeviceName())
 
-		artModules := global.ArtApexJars
+		artModules := global.ArtApexJars.CopyOf()
 		// With EMMA_INSTRUMENT_FRAMEWORK=true the Core libraries depend on jacoco.
 		if ctx.Config().IsEnvTrue("EMMA_INSTRUMENT_FRAMEWORK") {
-			artModules = append(artModules, "com.android.art:jacocoagent")
+			artModules.Append("com.android.art", "jacocoagent")
 		}
-		frameworkModules := android.RemoveListFromList(global.BootJars, artModules)
+		frameworkModules := global.BootJars.CopyOf()
+		frameworkModules.RemoveList(artModules)
 
 		artSubdir := "apex/com.android.art/javalib"
 		frameworkSubdir := "system/framework"
@@ -163,10 +129,7 @@
 			// Set up known paths for them, the singleton rules will copy them there.
 			// TODO(b/143682396): use module dependencies instead
 			inputDir := deviceDir.Join(ctx, "dex_"+c.name+"jars_input")
-			for _, m := range c.modules {
-				_, jar := android.SplitApexJarPair(ctx, m)
-				c.dexPaths = append(c.dexPaths, inputDir.Join(ctx, stemOf(jar)+".jar"))
-			}
+			c.dexPaths = c.modules.BuildPaths(ctx, inputDir)
 			c.dexPathsDeps = c.dexPaths
 
 			// Create target-specific variants.
@@ -178,9 +141,7 @@
 					target:          target,
 					images:          imageDir.Join(ctx, imageName),
 					imagesDeps:      c.moduleFiles(ctx, imageDir, ".art", ".oat", ".vdex"),
-				}
-				for _, m := range c.modules {
-					variant.dexLocations = append(variant.dexLocations, getDexLocation(ctx, target, m))
+					dexLocations:    c.modules.DevicePaths(ctx.Config(), target.Os),
 				}
 				variant.dexLocationsDeps = variant.dexLocations
 				c.variants = append(c.variants, variant)
@@ -213,10 +174,7 @@
 		global := dexpreopt.GetGlobalConfig(ctx)
 		image := defaultBootImageConfig(ctx)
 
-		updatableBootclasspath := make([]string, len(global.UpdatableBootJars))
-		for i, p := range global.UpdatableBootJars {
-			updatableBootclasspath[i] = dexpreopt.GetJarLocationFromApexJarPair(ctx, p)
-		}
+		updatableBootclasspath := global.UpdatableBootJars.DevicePaths(ctx.Config(), android.Android)
 
 		bootclasspath := append(copyOf(image.getAnyAndroidVariant().dexLocationsDeps), updatableBootclasspath...)
 		return bootclasspath
@@ -236,5 +194,5 @@
 	ctx.Strict("PRODUCT_DEX2OAT_BOOTCLASSPATH", strings.Join(defaultBootImageConfig(ctx).getAnyAndroidVariant().dexLocationsDeps, ":"))
 	ctx.Strict("PRODUCT_SYSTEM_SERVER_CLASSPATH", strings.Join(systemServerClasspath(ctx), ":"))
 
-	ctx.Strict("DEXPREOPT_BOOT_JARS_MODULES", strings.Join(defaultBootImageConfig(ctx).modules, ":"))
+	ctx.Strict("DEXPREOPT_BOOT_JARS_MODULES", strings.Join(defaultBootImageConfig(ctx).modules.CopyOfApexJarPairs(), ":"))
 }
diff --git a/java/droiddoc.go b/java/droiddoc.go
index 99bfb6d..0840d50 100644
--- a/java/droiddoc.go
+++ b/java/droiddoc.go
@@ -112,13 +112,20 @@
 	// local files that are used within user customized droiddoc options.
 	Arg_files []string `android:"path"`
 
-	// user customized droiddoc args.
+	// user customized droiddoc args. Deprecated, use flags instead.
 	// Available variables for substitution:
 	//
 	//  $(location <label>): the path to the arg_files with name <label>
 	//  $$: a literal $
 	Args *string
 
+	// user customized droiddoc args. Not compatible with property args.
+	// Available variables for substitution:
+	//
+	//  $(location <label>): the path to the arg_files with name <label>
+	//  $$: a literal $
+	Flags []string
+
 	// names of the output files used in args that will be generated
 	Out []string
 
@@ -191,7 +198,7 @@
 	// the generated removed Dex API filename by Doclava.
 	Removed_dex_api_filename *string
 
-	// if set to false, don't allow droiddoc to generate stubs source files. Defaults to true.
+	// if set to false, don't allow droiddoc to generate stubs source files. Defaults to false.
 	Create_stubs *bool
 
 	Check_api struct {
@@ -287,6 +294,9 @@
 	// the dirs which Metalava extracts API levels annotations from.
 	Api_levels_annotations_dirs []string
 
+	// the filename which Metalava extracts API levels annotations from. Defaults to android.jar.
+	Api_levels_jar_filename *string
+
 	// if set to true, collect the values used by the Dev tools and
 	// write them in files packaged with the SDK. Defaults to false.
 	Write_sdk_values *bool
@@ -382,7 +392,7 @@
 	argFiles    android.Paths
 	implicits   android.Paths
 
-	args string
+	args []string
 
 	docZip      android.WritablePath
 	stubsSrcJar android.WritablePath
@@ -619,8 +629,8 @@
 	}
 	srcFiles = filterHtml(srcFiles)
 
-	flags := j.collectAidlFlags(ctx, deps)
-	srcFiles = j.genSources(ctx, srcFiles, flags)
+	aidlFlags := j.collectAidlFlags(ctx, deps)
+	srcFiles = j.genSources(ctx, srcFiles, aidlFlags)
 
 	// srcs may depend on some genrule output.
 	j.srcJars = srcFiles.FilterByExt(".srcjar")
@@ -649,24 +659,38 @@
 		}
 	}
 
-	var err error
-	j.args, err = android.Expand(String(j.properties.Args), func(name string) (string, error) {
-		if strings.HasPrefix(name, "location ") {
-			label := strings.TrimSpace(strings.TrimPrefix(name, "location "))
-			if paths, ok := argFilesMap[label]; ok {
-				return paths, nil
-			} else {
-				return "", fmt.Errorf("unknown location label %q, expecting one of %q",
-					label, strings.Join(argFileLabels, ", "))
-			}
-		} else if name == "genDir" {
-			return android.PathForModuleGen(ctx).String(), nil
-		}
-		return "", fmt.Errorf("unknown variable '$(%s)'", name)
-	})
+	var argsPropertyName string
+	flags := make([]string, 0)
+	if j.properties.Args != nil && j.properties.Flags != nil {
+		ctx.PropertyErrorf("args", "flags is set. Cannot set args")
+	} else if args := proptools.String(j.properties.Args); args != "" {
+		flags = append(flags, args)
+		argsPropertyName = "args"
+	} else {
+		flags = append(flags, j.properties.Flags...)
+		argsPropertyName = "flags"
+	}
 
-	if err != nil {
-		ctx.PropertyErrorf("args", "%s", err.Error())
+	for _, flag := range flags {
+		args, err := android.Expand(flag, func(name string) (string, error) {
+			if strings.HasPrefix(name, "location ") {
+				label := strings.TrimSpace(strings.TrimPrefix(name, "location "))
+				if paths, ok := argFilesMap[label]; ok {
+					return paths, nil
+				} else {
+					return "", fmt.Errorf("unknown location label %q, expecting one of %q",
+						label, strings.Join(argFileLabels, ", "))
+				}
+			} else if name == "genDir" {
+				return android.PathForModuleGen(ctx).String(), nil
+			}
+			return "", fmt.Errorf("unknown variable '$(%s)'", name)
+		})
+
+		if err != nil {
+			ctx.PropertyErrorf(argsPropertyName, "%s", err.Error())
+		}
+		j.args = append(j.args, args)
 	}
 
 	return deps
@@ -849,6 +873,10 @@
 	}
 }
 
+func (d *Droiddoc) createStubs() bool {
+	return BoolDefault(d.properties.Create_stubs, false)
+}
+
 func (d *Droiddoc) stubsFlags(ctx android.ModuleContext, cmd *android.RuleBuilderCommand, stubsDir android.WritablePath) {
 	if apiCheckEnabled(ctx, d.properties.Check_api.Current, "current") ||
 		apiCheckEnabled(ctx, d.properties.Check_api.Last_released, "last_released") ||
@@ -871,7 +899,7 @@
 		cmd.FlagWithOutput("-removedDexApi ", d.removedDexApiFile)
 	}
 
-	if BoolDefault(d.properties.Create_stubs, true) {
+	if d.createStubs() {
 		cmd.FlagWithArg("-stubs ", stubsDir.String())
 	}
 
@@ -1010,7 +1038,7 @@
 
 	d.stubsFlags(ctx, cmd, stubsDir)
 
-	cmd.Flag(d.Javadoc.args).Implicits(d.Javadoc.argFiles)
+	cmd.Flag(strings.Join(d.Javadoc.args, " ")).Implicits(d.Javadoc.argFiles)
 
 	if d.properties.Compat_config != nil {
 		compatConfig := android.PathForModuleSrc(ctx, String(d.properties.Compat_config))
@@ -1327,7 +1355,7 @@
 		cmd.Flag("--include-annotations")
 
 		validatingNullability :=
-			strings.Contains(d.Javadoc.args, "--validate-nullability-from-merged-stubs") ||
+			android.InList("--validate-nullability-from-merged-stubs", d.Javadoc.args) ||
 				String(d.properties.Validate_nullability_from_list) != ""
 
 		migratingNullability := String(d.properties.Previous_api) != ""
@@ -1382,34 +1410,37 @@
 }
 
 func (d *Droidstubs) apiLevelsAnnotationsFlags(ctx android.ModuleContext, cmd *android.RuleBuilderCommand) {
-	if Bool(d.properties.Api_levels_annotations_enabled) {
-		d.apiVersionsXml = android.PathForModuleOut(ctx, "api-versions.xml")
-
-		if len(d.properties.Api_levels_annotations_dirs) == 0 {
-			ctx.PropertyErrorf("api_levels_annotations_dirs",
-				"has to be non-empty if api levels annotations was enabled!")
-		}
-
-		cmd.FlagWithOutput("--generate-api-levels ", d.apiVersionsXml)
-		cmd.FlagWithInput("--apply-api-levels ", d.apiVersionsXml)
-		cmd.FlagWithArg("--current-version ", ctx.Config().PlatformSdkVersion())
-		cmd.FlagWithArg("--current-codename ", ctx.Config().PlatformSdkCodename())
-
-		ctx.VisitDirectDepsWithTag(metalavaAPILevelsAnnotationsDirTag, func(m android.Module) {
-			if t, ok := m.(*ExportedDroiddocDir); ok {
-				for _, dep := range t.deps {
-					if strings.HasSuffix(dep.String(), "android.jar") {
-						cmd.Implicit(dep)
-					}
-				}
-				cmd.FlagWithArg("--android-jar-pattern ", t.dir.String()+"/%/public/android.jar")
-			} else {
-				ctx.PropertyErrorf("api_levels_annotations_dirs",
-					"module %q is not a metalava api-levels-annotations dir", ctx.OtherModuleName(m))
-			}
-		})
-
+	if !Bool(d.properties.Api_levels_annotations_enabled) {
+		return
 	}
+
+	d.apiVersionsXml = android.PathForModuleOut(ctx, "api-versions.xml")
+
+	if len(d.properties.Api_levels_annotations_dirs) == 0 {
+		ctx.PropertyErrorf("api_levels_annotations_dirs",
+			"has to be non-empty if api levels annotations was enabled!")
+	}
+
+	cmd.FlagWithOutput("--generate-api-levels ", d.apiVersionsXml)
+	cmd.FlagWithInput("--apply-api-levels ", d.apiVersionsXml)
+	cmd.FlagWithArg("--current-version ", ctx.Config().PlatformSdkVersion())
+	cmd.FlagWithArg("--current-codename ", ctx.Config().PlatformSdkCodename())
+
+	filename := proptools.StringDefault(d.properties.Api_levels_jar_filename, "android.jar")
+
+	ctx.VisitDirectDepsWithTag(metalavaAPILevelsAnnotationsDirTag, func(m android.Module) {
+		if t, ok := m.(*ExportedDroiddocDir); ok {
+			for _, dep := range t.deps {
+				if strings.HasSuffix(dep.String(), filename) {
+					cmd.Implicit(dep)
+				}
+			}
+			cmd.FlagWithArg("--android-jar-pattern ", t.dir.String()+"/%/public/"+filename)
+		} else {
+			ctx.PropertyErrorf("api_levels_annotations_dirs",
+				"module %q is not a metalava api-levels-annotations dir", ctx.OtherModuleName(m))
+		}
+	})
 }
 
 func (d *Droidstubs) apiToXmlFlags(ctx android.ModuleContext, cmd *android.RuleBuilderCommand) {
@@ -1498,7 +1529,9 @@
 	cmd.Flag("--no-banner").
 		Flag("--color").
 		Flag("--quiet").
-		Flag("--format=v2")
+		Flag("--format=v2").
+		FlagWithArg("--repeat-errors-max ", "10").
+		FlagWithArg("--hide ", "UnresolvedImport")
 
 	return cmd
 }
@@ -1539,14 +1572,14 @@
 	d.apiLevelsAnnotationsFlags(ctx, cmd)
 	d.apiToXmlFlags(ctx, cmd)
 
-	if strings.Contains(d.Javadoc.args, "--generate-documentation") {
+	if android.InList("--generate-documentation", d.Javadoc.args) {
 		// Currently Metalava have the ability to invoke Javadoc in a seperate process.
 		// Pass "-nodocs" to suppress the Javadoc invocation when Metalava receives
 		// "--generate-documentation" arg. This is not needed when Metalava removes this feature.
-		d.Javadoc.args = d.Javadoc.args + " -nodocs "
+		d.Javadoc.args = append(d.Javadoc.args, "-nodocs")
 	}
 
-	cmd.Flag(d.Javadoc.args).Implicits(d.Javadoc.argFiles)
+	cmd.Flag(strings.Join(d.Javadoc.args, " ")).Implicits(d.Javadoc.argFiles)
 	for _, o := range d.Javadoc.properties.Out {
 		cmd.ImplicitOutput(android.PathForModuleGen(ctx, o))
 	}
@@ -1651,7 +1684,7 @@
 
 	impRule := android.NewRuleBuilder()
 	impCmd := impRule.Command()
-	// A dummy action that copies the ninja generated rsp file to a new location. This allows us to
+	// An action that copies the ninja generated rsp file to a new location. This allows us to
 	// add a large number of inputs to a file without exceeding bash command length limits (which
 	// would happen if we use the WriteFile rule). The cp is needed because RuleBuilder sets the
 	// rsp file to be ${output}.rsp.
diff --git a/java/hiddenapi.go b/java/hiddenapi.go
index 130b634..b5a0217 100644
--- a/java/hiddenapi.go
+++ b/java/hiddenapi.go
@@ -146,7 +146,7 @@
 
 var hiddenAPIEncodeDexRule = pctx.AndroidStaticRule("hiddenAPIEncodeDex", blueprint.RuleParams{
 	Command: `rm -rf $tmpDir && mkdir -p $tmpDir && mkdir $tmpDir/dex-input && mkdir $tmpDir/dex-output &&
-		unzip -o -q $in 'classes*.dex' -d $tmpDir/dex-input &&
+		unzip -qoDD $in 'classes*.dex' -d $tmpDir/dex-input &&
 		for INPUT_DEX in $$(find $tmpDir/dex-input -maxdepth 1 -name 'classes*.dex' | sort); do
 		  echo "--input-dex=$${INPUT_DEX}";
 		  echo "--output-dex=$tmpDir/dex-output/$$(basename $${INPUT_DEX})";
diff --git a/java/hiddenapi_singleton.go b/java/hiddenapi_singleton.go
index bff591c..1e6becb 100644
--- a/java/hiddenapi_singleton.go
+++ b/java/hiddenapi_singleton.go
@@ -208,7 +208,7 @@
 }
 
 // flagsRule creates a rule to build hiddenapi-flags.csv out of flags.csv files generated for boot image modules and
-// the greylists.
+// the unsupported API.
 func flagsRule(ctx android.SingletonContext) android.Path {
 	var flagsCSV android.Paths
 	var greylistRemovedApis android.Paths
@@ -247,19 +247,19 @@
 		Tool(android.PathForSource(ctx, "frameworks/base/tools/hiddenapi/generate_hiddenapi_lists.py")).
 		FlagWithInput("--csv ", stubFlags).
 		Inputs(flagsCSV).
-		FlagWithInput("--greylist ",
-			android.PathForSource(ctx, "frameworks/base/config/hiddenapi-greylist.txt")).
-		FlagWithInput("--greylist-ignore-conflicts ", combinedRemovedApis).
-		FlagWithInput("--greylist-max-q ",
-			android.PathForSource(ctx, "frameworks/base/config/hiddenapi-greylist-max-q.txt")).
-		FlagWithInput("--greylist-max-p ",
-			android.PathForSource(ctx, "frameworks/base/config/hiddenapi-greylist-max-p.txt")).
-		FlagWithInput("--greylist-max-o-ignore-conflicts ",
-			android.PathForSource(ctx, "frameworks/base/config/hiddenapi-greylist-max-o.txt")).
-		FlagWithInput("--blacklist ",
-			android.PathForSource(ctx, "frameworks/base/config/hiddenapi-force-blacklist.txt")).
-		FlagWithInput("--greylist-packages ",
-			android.PathForSource(ctx, "frameworks/base/config/hiddenapi-greylist-packages.txt")).
+		FlagWithInput("--unsupported ",
+			android.PathForSource(ctx, "frameworks/base/config/hiddenapi-unsupported.txt")).
+		FlagWithInput("--unsupported-ignore-conflicts ", combinedRemovedApis).
+		FlagWithInput("--max-target-q ",
+			android.PathForSource(ctx, "frameworks/base/config/hiddenapi-max-target-q.txt")).
+		FlagWithInput("--max-target-p ",
+			android.PathForSource(ctx, "frameworks/base/config/hiddenapi-max-target-p.txt")).
+		FlagWithInput("--max-target-o-ignore-conflicts ",
+			android.PathForSource(ctx, "frameworks/base/config/hiddenapi-max-target-o.txt")).
+		FlagWithInput("--blocked ",
+			android.PathForSource(ctx, "frameworks/base/config/hiddenapi-force-blocked.txt")).
+		FlagWithInput("--unsupported-packages ",
+			android.PathForSource(ctx, "frameworks/base/config/hiddenapi-unsupported-packages.txt")).
 		FlagWithOutput("--output ", tempPath)
 
 	commitChangeForRestat(rule, tempPath, outputPath)
diff --git a/java/java.go b/java/java.go
index 46ef98b..d5375a5 100644
--- a/java/java.go
+++ b/java/java.go
@@ -264,9 +264,6 @@
 }
 
 type CompilerDeviceProperties struct {
-	// list of module-specific flags that will be used for dex compiles
-	Dxflags []string `android:"arch_variant"`
-
 	// if not blank, set to the version of the sdk to compile against.
 	// Defaults to compiling against the current platform.
 	Sdk_version *string
@@ -312,37 +309,6 @@
 		}
 	}
 
-	// If set to true, compile dex regardless of installable.  Defaults to false.
-	Compile_dex *bool
-
-	Optimize struct {
-		// If false, disable all optimization.  Defaults to true for android_app and android_test
-		// modules, false for java_library and java_test modules.
-		Enabled *bool
-		// True if the module containing this has it set by default.
-		EnabledByDefault bool `blueprint:"mutated"`
-
-		// If true, optimize for size by removing unused code.  Defaults to true for apps,
-		// false for libraries and tests.
-		Shrink *bool
-
-		// If true, optimize bytecode.  Defaults to false.
-		Optimize *bool
-
-		// If true, obfuscate bytecode.  Defaults to false.
-		Obfuscate *bool
-
-		// If true, do not use the flag files generated by aapt that automatically keep
-		// classes referenced by the app manifest.  Defaults to false.
-		No_aapt_flags *bool
-
-		// Flags to pass to proguard.
-		Proguard_flags []string
-
-		// Specifies the locations of files containing proguard flags.
-		Proguard_flags_files []string `android:"path"`
-	}
-
 	// When targeting 1.9 and above, override the modules to use with --system,
 	// otherwise provides defaults libraries to add to the bootclasspath.
 	System_modules *string
@@ -356,19 +322,9 @@
 	// set the name of the output
 	Stem *string
 
-	// Keep the data uncompressed. We always need uncompressed dex for execution,
-	// so this might actually save space by avoiding storing the same data twice.
-	// This defaults to reasonable value based on module and should not be set.
-	// It exists only to support ART tests.
-	Uncompress_dex *bool
-
 	IsSDKLibrary bool `blueprint:"mutated"`
 }
 
-func (me *CompilerDeviceProperties) EffectiveOptimizeEnabled() bool {
-	return BoolDefault(me.Optimize.Enabled, me.Optimize.EnabledByDefault)
-}
-
 // Functionality common to Module and Import
 //
 // It is embedded in Module so its functionality can be used by methods in Module
@@ -437,9 +393,6 @@
 	// output file containing uninstrumented classes that will be instrumented by jacoco
 	jacocoReportClassesFile android.Path
 
-	// output file containing mapping of obfuscated names
-	proguardDictionary android.Path
-
 	// output file of the module, which may be a classes jar or a dex jar
 	outputFile       android.Path
 	extraOutputFiles android.Paths
@@ -455,9 +408,6 @@
 	compiledJavaSrcs android.Paths
 	compiledSrcJars  android.Paths
 
-	// list of extra progurad flag files
-	extraProguardFlagFiles android.Paths
-
 	// manifest file to use instead of properties.Manifest
 	overrideManifest android.OptionalPath
 
@@ -484,6 +434,7 @@
 	extraResources android.Paths
 
 	hiddenAPI
+	dexer
 	dexpreopter
 	linter
 
@@ -507,6 +458,7 @@
 	j.addHostProperties()
 	j.AddProperties(
 		&j.deviceProperties,
+		&j.dexer.dexProperties,
 		&j.dexpreoptProperties,
 		&j.linter.properties,
 	)
@@ -519,7 +471,10 @@
 	case ".jar":
 		return android.Paths{j.implementationAndResourcesJar}, nil
 	case ".proguard_map":
-		return android.Paths{j.proguardDictionary}, nil
+		if j.dexer.proguardDictionary.Valid() {
+			return android.Paths{j.dexer.proguardDictionary.Path()}, nil
+		}
+		return nil, fmt.Errorf("%q was requested, but no output file was found.", tag)
 	default:
 		return nil, fmt.Errorf("unsupported module reference tag %q", tag)
 	}
@@ -556,7 +511,20 @@
 }
 
 func InitJavaModule(module android.DefaultableModule, hod android.HostOrDeviceSupported) {
-	android.InitAndroidArchModule(module, hod, android.MultilibCommon)
+	initJavaModule(module, hod, false)
+}
+
+func InitJavaModuleMultiTargets(module android.DefaultableModule, hod android.HostOrDeviceSupported) {
+	initJavaModule(module, hod, true)
+}
+
+func initJavaModule(module android.DefaultableModule, hod android.HostOrDeviceSupported, multiTargets bool) {
+	multilib := android.MultilibCommon
+	if multiTargets {
+		android.InitAndroidMultiTargetsArchModule(module, hod, multilib)
+	} else {
+		android.InitAndroidArchModule(module, hod, multilib)
+	}
 	android.InitDefaultableModule(module)
 }
 
@@ -575,6 +543,7 @@
 }
 
 var (
+	dataNativeBinsTag     = dependencyTag{name: "dataNativeBins"}
 	staticLibTag          = dependencyTag{name: "staticlib"}
 	libTag                = dependencyTag{name: "javalib"}
 	java9LibTag           = dependencyTag{name: "java9lib"}
@@ -635,10 +604,11 @@
 }
 
 type jniLib struct {
-	name         string
-	path         android.Path
-	target       android.Target
-	coverageFile android.OptionalPath
+	name           string
+	path           android.Path
+	target         android.Target
+	coverageFile   android.OptionalPath
+	unstrippedFile android.Path
 }
 
 func (j *Module) shouldInstrument(ctx android.BaseModuleContext) bool {
@@ -713,10 +683,10 @@
 			ctx.AddVariationDependencies(nil, bootClasspathTag, sdkDep.bootclasspath...)
 			ctx.AddVariationDependencies(nil, java9LibTag, sdkDep.java9Classpath...)
 			ctx.AddVariationDependencies(nil, libTag, sdkDep.classpath...)
-			if j.deviceProperties.EffectiveOptimizeEnabled() && sdkDep.hasStandardLibs() {
+			if j.effectiveOptimizeEnabled() && sdkDep.hasStandardLibs() {
 				ctx.AddVariationDependencies(nil, proguardRaiseTag, config.LegacyCorePlatformBootclasspathLibraries...)
 			}
-			if j.deviceProperties.EffectiveOptimizeEnabled() && sdkDep.hasFrameworkLibs() {
+			if j.effectiveOptimizeEnabled() && sdkDep.hasFrameworkLibs() {
 				ctx.AddVariationDependencies(nil, proguardRaiseTag, config.FrameworkLibraries...)
 			}
 		}
@@ -1632,8 +1602,8 @@
 
 	// Enable dex compilation for the APEX variants, unless it is disabled explicitly
 	if android.DirectlyInAnyApex(ctx, ctx.ModuleName()) && !j.IsForPlatform() {
-		if j.deviceProperties.Compile_dex == nil {
-			j.deviceProperties.Compile_dex = proptools.BoolPtr(true)
+		if j.dexProperties.Compile_dex == nil {
+			j.dexProperties.Compile_dex = proptools.BoolPtr(true)
 		}
 		if j.deviceProperties.Hostdex == nil {
 			j.deviceProperties.Hostdex = proptools.BoolPtr(true)
@@ -1641,10 +1611,14 @@
 	}
 
 	if ctx.Device() && j.hasCode(ctx) &&
-		(Bool(j.properties.Installable) || Bool(j.deviceProperties.Compile_dex)) {
+		(Bool(j.properties.Installable) || Bool(j.dexProperties.Compile_dex)) {
+		if j.shouldInstrumentStatic(ctx) {
+			j.dexer.extraProguardFlagFiles = append(j.dexer.extraProguardFlagFiles,
+				android.PathForSource(ctx, "build/make/core/proguard.jacoco.flags"))
+		}
 		// Dex compilation
 		var dexOutputFile android.ModuleOutPath
-		dexOutputFile = j.compileDex(ctx, flags, outputFile, jarName)
+		dexOutputFile = j.dexer.compileDex(ctx, flags, j.minSdkVersion(), outputFile, jarName)
 		if ctx.Failed() {
 			return
 		}
@@ -1654,7 +1628,7 @@
 
 		// Hidden API CSV generation and dex encoding
 		dexOutputFile = j.hiddenAPI.hiddenAPI(ctx, configurationName, primary, dexOutputFile, j.implementationJarFile,
-			proptools.Bool(j.deviceProperties.Uncompress_dex))
+			proptools.Bool(j.dexProperties.Uncompress_dex))
 
 		// merge dex jar with resources if necessary
 		if j.resourceJar != nil {
@@ -1662,7 +1636,7 @@
 			combinedJar := android.PathForModuleOut(ctx, "dex-withres", jarName)
 			TransformJarsToJar(ctx, combinedJar, "for dex resources", jars, android.OptionalPath{},
 				false, nil, nil)
-			if *j.deviceProperties.Uncompress_dex {
+			if *j.dexProperties.Uncompress_dex {
 				combinedAlignedJar := android.PathForModuleOut(ctx, "dex-withres-aligned", jarName)
 				TransformZipAlign(ctx, combinedAlignedJar, combinedJar)
 				dexOutputFile = combinedAlignedJar
@@ -1706,6 +1680,9 @@
 		j.linter.compileSdkVersion = lintSDKVersionString(j.sdkVersion())
 		j.linter.javaLanguageLevel = flags.javaVersion.String()
 		j.linter.kotlinLanguageLevel = "1.3"
+		if j.ApexName() != "" && ctx.Config().UnbundledBuildApps() {
+			j.linter.buildModuleReportZip = true
+		}
 		j.linter.lint(ctx)
 	}
 
@@ -1990,11 +1967,11 @@
 	j.checkSdkVersions(ctx)
 	j.dexpreopter.installPath = android.PathForModuleInstall(ctx, "framework", j.Stem()+".jar")
 	j.dexpreopter.isSDKLibrary = j.deviceProperties.IsSDKLibrary
-	if j.deviceProperties.Uncompress_dex == nil {
+	if j.dexProperties.Uncompress_dex == nil {
 		// If the value was not force-set by the user, use reasonable default based on the module.
-		j.deviceProperties.Uncompress_dex = proptools.BoolPtr(shouldUncompressDex(ctx, &j.dexpreopter))
+		j.dexProperties.Uncompress_dex = proptools.BoolPtr(shouldUncompressDex(ctx, &j.dexpreopter))
 	}
-	j.dexpreopter.uncompressedDex = *j.deviceProperties.Uncompress_dex
+	j.dexpreopter.uncompressedDex = *j.dexProperties.Uncompress_dex
 	j.compile(ctx, nil)
 
 	// Collect the module directory for IDE info in java/jdeps.go.
@@ -2189,6 +2166,11 @@
 	Test_mainline_modules []string
 }
 
+type hostTestProperties struct {
+	// list of native binary modules that should be installed alongside the test
+	Data_native_bins []string `android:"arch_variant"`
+}
+
 type testHelperLibraryProperties struct {
 	// list of compatibility suites (for example "cts", "vts") that the module should be
 	// installed into.
@@ -2214,6 +2196,12 @@
 	data       android.Paths
 }
 
+type TestHost struct {
+	Test
+
+	testHostProperties hostTestProperties
+}
+
 type TestHelperLibrary struct {
 	Library
 
@@ -2228,11 +2216,26 @@
 	testConfig android.Path
 }
 
+func (j *TestHost) DepsMutator(ctx android.BottomUpMutatorContext) {
+	if len(j.testHostProperties.Data_native_bins) > 0 {
+		for _, target := range ctx.MultiTargets() {
+			ctx.AddVariationDependencies(target.Variations(), dataNativeBinsTag, j.testHostProperties.Data_native_bins...)
+		}
+	}
+
+	j.deps(ctx)
+}
+
 func (j *Test) GenerateAndroidBuildActions(ctx android.ModuleContext) {
 	j.testConfig = tradefed.AutoGenJavaTestConfig(ctx, j.testProperties.Test_config, j.testProperties.Test_config_template,
 		j.testProperties.Test_suites, j.testProperties.Auto_gen_config)
+
 	j.data = android.PathsForModuleSrc(ctx, j.testProperties.Data)
 
+	ctx.VisitDirectDepsWithTag(dataNativeBinsTag, func(dep android.Module) {
+		j.data = append(j.data, android.OutputFileForModule(ctx, dep, ""))
+	})
+
 	j.Library.GenerateAndroidBuildActions(ctx)
 }
 
@@ -2373,14 +2376,15 @@
 // A java_test_host has a single variant that produces a `.jar` file containing `.class` files that were
 // compiled against the host bootclasspath.
 func TestHostFactory() android.Module {
-	module := &Test{}
+	module := &TestHost{}
 
 	module.addHostProperties()
 	module.AddProperties(&module.testProperties)
+	module.AddProperties(&module.testHostProperties)
 
 	module.Module.properties.Installable = proptools.BoolPtr(true)
 
-	InitJavaModule(module, android.HostSupported)
+	InitJavaModuleMultiTargets(module, android.HostSupported)
 	return module
 }
 
@@ -2788,6 +2792,10 @@
 	return nil
 }
 
+func (a *DexImport) LintDepSets() LintDepSets {
+	return LintDepSets{}
+}
+
 func (j *DexImport) IsInstallable() bool {
 	return true
 }
@@ -2921,6 +2929,7 @@
 	module.AddProperties(
 		&CompilerProperties{},
 		&CompilerDeviceProperties{},
+		&DexProperties{},
 		&DexpreoptProperties{},
 		&android.ProtoProperties{},
 		&aaptProperties{},
diff --git a/java/java_test.go b/java/java_test.go
index fb00361..50c40c3 100644
--- a/java/java_test.go
+++ b/java/java_test.go
@@ -31,6 +31,7 @@
 	"android/soong/cc"
 	"android/soong/dexpreopt"
 	"android/soong/genrule"
+	"android/soong/python"
 )
 
 var buildDir string
@@ -81,6 +82,7 @@
 	ctx.RegisterModuleType("java_plugin", PluginFactory)
 	ctx.RegisterModuleType("filegroup", android.FileGroupFactory)
 	ctx.RegisterModuleType("genrule", genrule.GenRuleFactory)
+	ctx.RegisterModuleType("python_binary_host", python.PythonBinaryHostFactory)
 	RegisterDocsBuildComponents(ctx)
 	RegisterStubsBuildComponents(ctx)
 	RegisterSdkLibraryBuildComponents(ctx)
@@ -89,10 +91,13 @@
 
 	RegisterPrebuiltApisBuildComponents(ctx)
 
+	ctx.PreDepsMutators(python.RegisterPythonPreDepsMutators)
 	ctx.PostDepsMutators(android.RegisterOverridePostDepsMutators)
 	ctx.RegisterPreSingletonType("overlay", android.SingletonFactoryAdaptor(OverlaySingletonFactory))
 	ctx.RegisterPreSingletonType("sdk_versions", android.SingletonFactoryAdaptor(sdkPreSingletonFactory))
 
+	android.RegisterPrebuiltMutators(ctx)
+
 	// Register module types and mutators from cc needed for JNI testing
 	cc.RegisterRequiredBuildComponentsForTest(ctx)
 
@@ -486,7 +491,7 @@
 
 	ctx, _ := testJavaWithConfig(t, config)
 
-	// first, sanity check that the -g flag is added to target modules
+	// first, check that the -g flag is added to target modules
 	targetLibrary := ctx.ModuleForTests("target_library", "android_common")
 	targetJavaFlags := targetLibrary.Module().VariablesForTests()["javacFlags"]
 	if !strings.Contains(targetJavaFlags, "-g:source,lines") {
@@ -1097,15 +1102,20 @@
 		    ],
 		    proofread_file: "libcore-proofread.txt",
 		    todo_file: "libcore-docs-todo.html",
-		    args: "-offlinemode -title \"libcore\"",
+		    flags: ["-offlinemode -title \"libcore\""],
 		}
 		`,
 		map[string][]byte{
 			"bar-doc/a.java": nil,
 			"bar-doc/b.java": nil,
 		})
+	barDocModule := ctx.ModuleForTests("bar-doc", "android_common")
+	barDoc := barDocModule.Rule("javadoc")
+	notExpected := " -stubs "
+	if strings.Contains(barDoc.RuleParams.Command, notExpected) {
+		t.Errorf("bar-doc command contains flag %q to create stubs, but should not", notExpected)
+	}
 
-	barDoc := ctx.ModuleForTests("bar-doc", "android_common").Rule("javadoc")
 	var javaSrcs []string
 	for _, i := range barDoc.Inputs {
 		javaSrcs = append(javaSrcs, i.Base())
@@ -1114,7 +1124,7 @@
 		t.Errorf("inputs of bar-doc must be []string{\"a.java\"}, but was %#v.", javaSrcs)
 	}
 
-	aidl := ctx.ModuleForTests("bar-doc", "android_common").Rule("aidl")
+	aidl := barDocModule.Rule("aidl")
 	if g, w := barDoc.Implicits.Strings(), aidl.Output.String(); !inList(w, g) {
 		t.Errorf("implicits of bar-doc must contain %q, but was %q.", w, g)
 	}
@@ -1124,6 +1134,98 @@
 	}
 }
 
+func TestDroiddocArgsAndFlagsCausesError(t *testing.T) {
+	testJavaError(t, "flags is set. Cannot set args", `
+		droiddoc_exported_dir {
+		    name: "droiddoc-templates-sdk",
+		    path: ".",
+		}
+		filegroup {
+		    name: "bar-doc-aidl-srcs",
+		    srcs: ["bar-doc/IBar.aidl"],
+		    path: "bar-doc",
+		}
+		droiddoc {
+		    name: "bar-doc",
+		    srcs: [
+		        "bar-doc/a.java",
+		        "bar-doc/IFoo.aidl",
+		        ":bar-doc-aidl-srcs",
+		    ],
+		    exclude_srcs: [
+		        "bar-doc/b.java"
+		    ],
+		    custom_template: "droiddoc-templates-sdk",
+		    hdf: [
+		        "android.whichdoc offline",
+		    ],
+		    knowntags: [
+		        "bar-doc/known_oj_tags.txt",
+		    ],
+		    proofread_file: "libcore-proofread.txt",
+		    todo_file: "libcore-docs-todo.html",
+		    flags: ["-offlinemode -title \"libcore\""],
+		    args: "-offlinemode -title \"libcore\"",
+		}
+		`)
+}
+
+func TestDroidstubs(t *testing.T) {
+	ctx, _ := testJavaWithFS(t, `
+		droiddoc_exported_dir {
+		    name: "droiddoc-templates-sdk",
+		    path: ".",
+		}
+
+		droidstubs {
+		    name: "bar-stubs",
+		    srcs: [
+		        "bar-doc/a.java",
+				],
+				api_levels_annotations_dirs: [
+					"droiddoc-templates-sdk",
+				],
+				api_levels_annotations_enabled: true,
+		}
+
+		droidstubs {
+		    name: "bar-stubs-other",
+		    srcs: [
+		        "bar-doc/a.java",
+				],
+				api_levels_annotations_dirs: [
+					"droiddoc-templates-sdk",
+				],
+				api_levels_annotations_enabled: true,
+				api_levels_jar_filename: "android.other.jar",
+		}
+		`,
+		map[string][]byte{
+			"bar-doc/a.java": nil,
+		})
+	testcases := []struct {
+		moduleName          string
+		expectedJarFilename string
+	}{
+		{
+			moduleName:          "bar-stubs",
+			expectedJarFilename: "android.jar",
+		},
+		{
+			moduleName:          "bar-stubs-other",
+			expectedJarFilename: "android.other.jar",
+		},
+	}
+	for _, c := range testcases {
+		m := ctx.ModuleForTests(c.moduleName, "android_common")
+		metalava := m.Rule("metalava")
+		expected := "--android-jar-pattern ./%/public/" + c.expectedJarFilename
+		if actual := metalava.RuleParams.Command; !strings.Contains(actual, expected) {
+			t.Errorf("For %q, expected metalava argument %q, but was not found %q", c.moduleName, expected, actual)
+		}
+	}
+}
+
 func TestDroidstubsWithSystemModules(t *testing.T) {
 	ctx, _ := testJava(t, `
 		droidstubs {
@@ -1972,3 +2074,28 @@
 		t.Errorf("aidl command %q does not contain %q", aidlCommand, expectedAidlFlag)
 	}
 }
+
+func TestDataNativeBinaries(t *testing.T) {
+	ctx, config := testJava(t, `
+		java_test_host {
+			name: "foo",
+			srcs: ["a.java"],
+			data_native_bins: ["bin"]
+		}
+
+		python_binary_host {
+			name: "bin",
+			srcs: ["bin.py"],
+		}
+	`)
+
+	buildOS := android.BuildOs.String()
+
+	test := ctx.ModuleForTests("foo", buildOS+"_common").Module().(*TestHost)
+	entries := android.AndroidMkEntriesForTest(t, config, "", test)[0]
+	expected := []string{buildDir + "/.intermediates/bin/" + buildOS + "_x86_64_PY3/bin:bin"}
+	actual := entries.EntryMap["LOCAL_COMPATIBILITY_SUPPORT_FILES"]
+	if !reflect.DeepEqual(expected, actual) {
+		t.Errorf("Unexpected test data - expected: %q, actual: %q", expected, actual)
+	}
+}
diff --git a/java/legacy_core_platform_api_usage.go b/java/legacy_core_platform_api_usage.go
new file mode 100644
index 0000000..8af66d0
--- /dev/null
+++ b/java/legacy_core_platform_api_usage.go
@@ -0,0 +1,162 @@
+// Copyright 2020 Google Inc. All rights reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//     http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+package java
+
+import (
+	"android/soong/android"
+	"android/soong/java/config"
+)
+
+var legacyCorePlatformApiModules = []string{
+	"ahat-test-dump",
+	"android.car",
+	"android.test.mock",
+	"android.test.mock.impl",
+	"AoapTestDeviceApp",
+	"AoapTestHostApp",
+	"api-stubs-docs",
+	"art_cts_jvmti_test_library",
+	"art-gtest-jars-MyClassNatives",
+	"BackupFrameworksServicesRoboTests",
+	"BandwidthEnforcementTest",
+	"BlockedNumberProvider",
+	"BluetoothInstrumentationTests",
+	"BluetoothMidiService",
+	"car-apps-common",
+	"CertInstaller",
+	"ConnectivityManagerTest",
+	"ContactsProvider",
+	"core-tests-support",
+	"CtsContentTestCases",
+	"CtsIkeTestCases",
+	"CtsLibcoreWycheproofBCTestCases",
+	"CtsMediaTestCases",
+	"CtsNetTestCases",
+	"CtsNetTestCasesLatestSdk",
+	"CtsSecurityTestCases",
+	"CtsUsageStatsTestCases",
+	"DisplayCutoutEmulationEmu01Overlay",
+	"DocumentsUIPerfTests",
+	"DocumentsUITests",
+	"DownloadProvider",
+	"DownloadProviderTests",
+	"DownloadProviderUi",
+	"DynamicSystemInstallationService",
+	"EmergencyInfo-lib",
+	"ethernet-service",
+	"EthernetServiceTests",
+	"ExternalStorageProvider",
+	"ExtServices",
+	"ExtServices-core",
+	"framework-all",
+	"framework-minus-apex",
+	"FrameworksCoreTests",
+	"FrameworksIkeTests",
+	"FrameworksNetCommonTests",
+	"FrameworksNetTests",
+	"FrameworksServicesRoboTests",
+	"FrameworksServicesTests",
+	"FrameworksUtilTests",
+	"hid",
+	"hidl_test_java_java",
+	"hwbinder",
+	"ims",
+	"KeyChain",
+	"ksoap2",
+	"LocalTransport",
+	"lockagent",
+	"mediaframeworktest",
+	"MediaProvider",
+	"MmsService",
+	"MtpDocumentsProvider",
+	"MultiDisplayProvider",
+	"NetworkStackIntegrationTestsLib",
+	"NetworkStackNextIntegrationTests",
+	"NetworkStackNextTests",
+	"NetworkStackTests",
+	"NetworkStackTestsLib",
+	"NfcNci",
+	"platform_library-docs",
+	"PrintSpooler",
+	"RollbackTest",
+	"services",
+	"services.accessibility",
+	"services.backup",
+	"services.core.unboosted",
+	"services.devicepolicy",
+	"services.print",
+	"services.usage",
+	"services.usb",
+	"Settings-core",
+	"SettingsLib",
+	"SettingsProvider",
+	"SettingsProviderTest",
+	"SettingsRoboTests",
+	"Shell",
+	"ShellTests",
+	"sl4a.Common",
+	"StatementService",
+	"SystemUI-core",
+	"SystemUISharedLib",
+	"SystemUI-tests",
+	"Telecom",
+	"TelecomUnitTests",
+	"telephony-common",
+	"TelephonyProvider",
+	"TelephonyProviderTests",
+	"TeleService",
+	"testables",
+	"TetheringTests",
+	"TetheringTestsLib",
+	"time_zone_distro_installer",
+	"time_zone_distro_installer-tests",
+	"time_zone_distro-tests",
+	"time_zone_updater",
+	"TvProvider",
+	"uiautomator-stubs-docs",
+	"UsbHostExternalManagementTestApp",
+	"UserDictionaryProvider",
+	"WallpaperBackup",
+	"wifi-service",
+}
+
+var legacyCorePlatformApiLookup = make(map[string]struct{})
+
+func init() {
+	for _, module := range legacyCorePlatformApiModules {
+		legacyCorePlatformApiLookup[module] = struct{}{}
+	}
+}
+
+func useLegacyCorePlatformApi(ctx android.EarlyModuleContext) bool {
+	_, found := legacyCorePlatformApiLookup[ctx.ModuleName()]
+	return found
+}
+
+func corePlatformSystemModules(ctx android.EarlyModuleContext) string {
+	if useLegacyCorePlatformApi(ctx) {
+		return config.LegacyCorePlatformSystemModules
+	} else {
+		return config.StableCorePlatformSystemModules
+	}
+}
+
+func corePlatformBootclasspathLibraries(ctx android.EarlyModuleContext) []string {
+	if useLegacyCorePlatformApi(ctx) {
+		return config.LegacyCorePlatformBootclasspathLibraries
+	} else {
+		return config.StableCorePlatformBootclasspathLibraries
+	}
+}
diff --git a/java/lint.go b/java/lint.go
index b73d6a5..1bf7f69 100644
--- a/java/lint.go
+++ b/java/lint.go
@@ -17,6 +17,7 @@
 import (
 	"fmt"
 	"sort"
+	"strings"
 
 	"android/soong/android"
 )
@@ -67,12 +68,82 @@
 	kotlinLanguageLevel string
 	outputs             lintOutputs
 	properties          LintProperties
+
+	reports android.Paths
+
+	buildModuleReportZip bool
 }
 
 type lintOutputs struct {
-	html android.ModuleOutPath
-	text android.ModuleOutPath
-	xml  android.ModuleOutPath
+	html android.Path
+	text android.Path
+	xml  android.Path
+
+	depSets LintDepSets
+}
+
+type lintOutputsIntf interface {
+	lintOutputs() *lintOutputs
+}
+
+type lintDepSetsIntf interface {
+	LintDepSets() LintDepSets
+}
+
+type LintDepSets struct {
+	HTML, Text, XML *android.DepSet
+}
+
+type LintDepSetsBuilder struct {
+	HTML, Text, XML *android.DepSetBuilder
+}
+
+func NewLintDepSetBuilder() LintDepSetsBuilder {
+	return LintDepSetsBuilder{
+		HTML: android.NewDepSetBuilder(android.POSTORDER),
+		Text: android.NewDepSetBuilder(android.POSTORDER),
+		XML:  android.NewDepSetBuilder(android.POSTORDER),
+	}
+}
+
+func (l LintDepSetsBuilder) Direct(html, text, xml android.Path) LintDepSetsBuilder {
+	l.HTML.Direct(html)
+	l.Text.Direct(text)
+	l.XML.Direct(xml)
+	return l
+}
+
+func (l LintDepSetsBuilder) Transitive(depSets LintDepSets) LintDepSetsBuilder {
+	if depSets.HTML != nil {
+		l.HTML.Transitive(depSets.HTML)
+	}
+	if depSets.Text != nil {
+		l.Text.Transitive(depSets.Text)
+	}
+	if depSets.XML != nil {
+		l.XML.Transitive(depSets.XML)
+	}
+	return l
+}
+
+func (l LintDepSetsBuilder) Build() LintDepSets {
+	return LintDepSets{
+		HTML: l.HTML.Build(),
+		Text: l.Text.Build(),
+		XML:  l.XML.Build(),
+	}
+}
+
+func (l *linter) LintDepSets() LintDepSets {
+	return l.outputs.depSets
+}
+
+var _ lintDepSetsIntf = (*linter)(nil)
+
+var _ lintOutputsIntf = (*linter)(nil)
+
+func (l *linter) lintOutputs() *lintOutputs {
+	return &l.outputs
 }
 
 func (l *linter) enabled() bool {
@@ -84,7 +155,16 @@
 		return
 	}
 
-	ctx.AddFarVariationDependencies(ctx.Config().BuildOSCommonTarget.Variations(), extraLintCheckTag, l.properties.Lint.Extra_check_modules...)
+	extraCheckModules := l.properties.Lint.Extra_check_modules
+
+	if checkOnly := ctx.Config().Getenv("ANDROID_LINT_CHECK"); checkOnly != "" {
+		if checkOnlyModules := ctx.Config().Getenv("ANDROID_LINT_CHECK_EXTRA_MODULES"); checkOnlyModules != "" {
+			extraCheckModules = strings.Split(checkOnlyModules, ",")
+		}
+	}
+
+	ctx.AddFarVariationDependencies(ctx.Config().BuildOSCommonTarget.Variations(),
+		extraLintCheckTag, extraCheckModules...)
 }
 
 func (l *linter) writeLintProjectXML(ctx android.ModuleContext,
@@ -172,7 +252,7 @@
 	return projectXMLPath, configXMLPath, cacheDir, homeDir, deps
 }
 
-// generateManifest adds a command to the rule to write a dummy manifest cat contains the
+// generateManifest adds a command to the rule to write a simple manifest that contains the
 // minSdkVersion and targetSdkVersion for modules (like java_library) that don't have a manifest.
 func (l *linter) generateManifest(ctx android.ModuleContext, rule *android.RuleBuilder) android.Path {
 	manifestPath := android.PathForModuleOut(ctx, "lint", "AndroidManifest.xml")
@@ -213,51 +293,95 @@
 
 	projectXML, lintXML, cacheDir, homeDir, deps := l.writeLintProjectXML(ctx, rule)
 
-	l.outputs.html = android.PathForModuleOut(ctx, "lint-report.html")
-	l.outputs.text = android.PathForModuleOut(ctx, "lint-report.txt")
-	l.outputs.xml = android.PathForModuleOut(ctx, "lint-report.xml")
+	html := android.PathForModuleOut(ctx, "lint-report.html")
+	text := android.PathForModuleOut(ctx, "lint-report.txt")
+	xml := android.PathForModuleOut(ctx, "lint-report.xml")
+
+	depSetsBuilder := NewLintDepSetBuilder().Direct(html, text, xml)
+
+	ctx.VisitDirectDepsWithTag(staticLibTag, func(dep android.Module) {
+		if depLint, ok := dep.(lintDepSetsIntf); ok {
+			depSetsBuilder.Transitive(depLint.LintDepSets())
+		}
+	})
 
 	rule.Command().Text("rm -rf").Flag(cacheDir.String()).Flag(homeDir.String())
 	rule.Command().Text("mkdir -p").Flag(cacheDir.String()).Flag(homeDir.String())
 
-	rule.Command().
+	var annotationsZipPath, apiVersionsXMLPath android.Path
+	if ctx.Config().UnbundledBuildUsePrebuiltSdks() {
+		annotationsZipPath = android.PathForSource(ctx, "prebuilts/sdk/current/public/data/annotations.zip")
+		apiVersionsXMLPath = android.PathForSource(ctx, "prebuilts/sdk/current/public/data/api-versions.xml")
+	} else {
+		annotationsZipPath = copiedAnnotationsZipPath(ctx)
+		apiVersionsXMLPath = copiedAPIVersionsXmlPath(ctx)
+	}
+
+	cmd := rule.Command().
 		Text("(").
 		Flag("JAVA_OPTS=-Xmx2048m").
 		FlagWithArg("ANDROID_SDK_HOME=", homeDir.String()).
-		FlagWithInput("SDK_ANNOTATIONS=", annotationsZipPath(ctx)).
-		FlagWithInput("LINT_OPTS=-DLINT_API_DATABASE=", apiVersionsXmlPath(ctx)).
+		FlagWithInput("SDK_ANNOTATIONS=", annotationsZipPath).
+		FlagWithInput("LINT_OPTS=-DLINT_API_DATABASE=", apiVersionsXMLPath).
 		Tool(android.PathForSource(ctx, "prebuilts/cmdline-tools/tools/bin/lint")).
 		Implicit(android.PathForSource(ctx, "prebuilts/cmdline-tools/tools/lib/lint-classpath.jar")).
 		Flag("--quiet").
 		FlagWithInput("--project ", projectXML).
 		FlagWithInput("--config ", lintXML).
-		FlagWithOutput("--html ", l.outputs.html).
-		FlagWithOutput("--text ", l.outputs.text).
-		FlagWithOutput("--xml ", l.outputs.xml).
+		FlagWithOutput("--html ", html).
+		FlagWithOutput("--text ", text).
+		FlagWithOutput("--xml ", xml).
 		FlagWithArg("--compile-sdk-version ", l.compileSdkVersion).
 		FlagWithArg("--java-language-level ", l.javaLanguageLevel).
 		FlagWithArg("--kotlin-language-level ", l.kotlinLanguageLevel).
 		FlagWithArg("--url ", fmt.Sprintf(".=.,%s=out", android.PathForOutput(ctx).String())).
 		Flag("--exitcode").
 		Flags(l.properties.Lint.Flags).
-		Implicits(deps).
-		Text("|| (").Text("cat").Input(l.outputs.text).Text("; exit 7)").
-		Text(")")
+		Implicits(deps)
+
+	if checkOnly := ctx.Config().Getenv("ANDROID_LINT_CHECK"); checkOnly != "" {
+		cmd.FlagWithArg("--check ", checkOnly)
+	}
+
+	cmd.Text("|| (").Text("cat").Input(text).Text("; exit 7)").Text(")")
 
 	rule.Command().Text("rm -rf").Flag(cacheDir.String()).Flag(homeDir.String())
 
 	rule.Build(pctx, ctx, "lint", "lint")
+
+	l.outputs = lintOutputs{
+		html: html,
+		text: text,
+		xml:  xml,
+
+		depSets: depSetsBuilder.Build(),
+	}
+
+	if l.buildModuleReportZip {
+		l.reports = BuildModuleLintReportZips(ctx, l.LintDepSets())
+	}
 }
 
-func (l *linter) lintOutputs() *lintOutputs {
-	return &l.outputs
-}
+func BuildModuleLintReportZips(ctx android.ModuleContext, depSets LintDepSets) android.Paths {
+	htmlList := depSets.HTML.ToSortedList()
+	textList := depSets.Text.ToSortedList()
+	xmlList := depSets.XML.ToSortedList()
 
-type lintOutputIntf interface {
-	lintOutputs() *lintOutputs
-}
+	if len(htmlList) == 0 && len(textList) == 0 && len(xmlList) == 0 {
+		return nil
+	}
 
-var _ lintOutputIntf = (*linter)(nil)
+	htmlZip := android.PathForModuleOut(ctx, "lint-report-html.zip")
+	lintZip(ctx, htmlList, htmlZip)
+
+	textZip := android.PathForModuleOut(ctx, "lint-report-text.zip")
+	lintZip(ctx, textList, textZip)
+
+	xmlZip := android.PathForModuleOut(ctx, "lint-report-xml.zip")
+	lintZip(ctx, xmlList, xmlZip)
+
+	return android.Paths{htmlZip, textZip, xmlZip}
+}
 
 type lintSingleton struct {
 	htmlZip android.WritablePath
@@ -271,7 +395,7 @@
 }
 
 func (l *lintSingleton) copyLintDependencies(ctx android.SingletonContext) {
-	if ctx.Config().UnbundledBuild() {
+	if ctx.Config().UnbundledBuildUsePrebuiltSdks() {
 		return
 	}
 
@@ -297,25 +421,29 @@
 	ctx.Build(pctx, android.BuildParams{
 		Rule:   android.Cp,
 		Input:  android.OutputFileForModule(ctx, frameworkDocStubs, ".annotations.zip"),
-		Output: annotationsZipPath(ctx),
+		Output: copiedAnnotationsZipPath(ctx),
 	})
 
 	ctx.Build(pctx, android.BuildParams{
 		Rule:   android.Cp,
 		Input:  android.OutputFileForModule(ctx, frameworkDocStubs, ".api_versions.xml"),
-		Output: apiVersionsXmlPath(ctx),
+		Output: copiedAPIVersionsXmlPath(ctx),
 	})
 }
 
-func annotationsZipPath(ctx android.PathContext) android.WritablePath {
+func copiedAnnotationsZipPath(ctx android.PathContext) android.WritablePath {
 	return android.PathForOutput(ctx, "lint", "annotations.zip")
 }
 
-func apiVersionsXmlPath(ctx android.PathContext) android.WritablePath {
+func copiedAPIVersionsXmlPath(ctx android.PathContext) android.WritablePath {
 	return android.PathForOutput(ctx, "lint", "api_versions.xml")
 }
 
 func (l *lintSingleton) generateLintReportZips(ctx android.SingletonContext) {
+	if ctx.Config().UnbundledBuild() {
+		return
+	}
+
 	var outputs []*lintOutputs
 	var dirs []string
 	ctx.VisitAllModules(func(m android.Module) {
@@ -329,7 +457,7 @@
 			return
 		}
 
-		if l, ok := m.(lintOutputIntf); ok {
+		if l, ok := m.(lintOutputsIntf); ok {
 			outputs = append(outputs, l.lintOutputs())
 		}
 	})
@@ -340,21 +468,12 @@
 		var paths android.Paths
 
 		for _, output := range outputs {
-			paths = append(paths, get(output))
+			if p := get(output); p != nil {
+				paths = append(paths, p)
+			}
 		}
 
-		sort.Slice(paths, func(i, j int) bool {
-			return paths[i].String() < paths[j].String()
-		})
-
-		rule := android.NewRuleBuilder()
-
-		rule.Command().BuiltTool(ctx, "soong_zip").
-			FlagWithOutput("-o ", outputPath).
-			FlagWithArg("-C ", android.PathForIntermediates(ctx).String()).
-			FlagWithRspFileInputList("-l ", paths)
-
-		rule.Build(pctx, ctx, outputPath.Base(), outputPath.Base())
+		lintZip(ctx, paths, outputPath)
 	}
 
 	l.htmlZip = android.PathForOutput(ctx, "lint-report-html.zip")
@@ -370,7 +489,9 @@
 }
 
 func (l *lintSingleton) MakeVars(ctx android.MakeVarsContext) {
-	ctx.DistForGoal("lint-check", l.htmlZip, l.textZip, l.xmlZip)
+	if !ctx.Config().UnbundledBuild() {
+		ctx.DistForGoal("lint-check", l.htmlZip, l.textZip, l.xmlZip)
+	}
 }
 
 var _ android.SingletonMakeVarsProvider = (*lintSingleton)(nil)
@@ -379,3 +500,20 @@
 	android.RegisterSingletonType("lint",
 		func() android.Singleton { return &lintSingleton{} })
 }
+
+func lintZip(ctx android.BuilderContext, paths android.Paths, outputPath android.WritablePath) {
+	paths = android.SortedUniquePaths(android.CopyOfPaths(paths))
+
+	sort.Slice(paths, func(i, j int) bool {
+		return paths[i].String() < paths[j].String()
+	})
+
+	rule := android.NewRuleBuilder()
+
+	rule.Command().BuiltTool(ctx, "soong_zip").
+		FlagWithOutput("-o ", outputPath).
+		FlagWithArg("-C ", android.PathForIntermediates(ctx).String()).
+		FlagWithRspFileInputList("-l ", paths)
+
+	rule.Build(pctx, ctx, outputPath.Base(), outputPath.Base())
+}
diff --git a/java/prebuilt_apis.go b/java/prebuilt_apis.go
index 999c72f..b10e6c7 100644
--- a/java/prebuilt_apis.go
+++ b/java/prebuilt_apis.go
@@ -83,8 +83,7 @@
 	}{}
 	props.Name = proptools.StringPtr(prebuiltApiModuleName(mctx, module, scope, apiver))
 	props.Jars = append(props.Jars, path)
-	// TODO(hansson): change to scope after migration is done.
-	props.Sdk_version = proptools.StringPtr("current")
+	props.Sdk_version = proptools.StringPtr(scope)
 	props.Installable = proptools.BoolPtr(false)
 
 	mctx.CreateModule(ImportFactory, &props)
diff --git a/java/robolectric.go b/java/robolectric.go
index c6b07a1..4d68fd9 100644
--- a/java/robolectric.go
+++ b/java/robolectric.go
@@ -21,10 +21,13 @@
 	"strings"
 
 	"android/soong/android"
+	"android/soong/java/config"
+	"android/soong/tradefed"
 )
 
 func init() {
 	android.RegisterModuleType("android_robolectric_test", RobolectricTestFactory)
+	android.RegisterModuleType("android_robolectric_runtimes", robolectricRuntimesFactory)
 }
 
 var robolectricDefaultLibs = []string{
@@ -32,10 +35,13 @@
 	"Robolectric_all-target",
 	"mockito-robolectric-prebuilt",
 	"truth-prebuilt",
+	// TODO(ccross): this is not needed at link time
+	"junitxml",
 }
 
 var (
-	roboCoverageLibsTag = dependencyTag{name: "roboSrcs"}
+	roboCoverageLibsTag = dependencyTag{name: "roboCoverageLibs"}
+	roboRuntimesTag     = dependencyTag{name: "roboRuntimes"}
 )
 
 type robolectricProperties struct {
@@ -58,13 +64,28 @@
 	Library
 
 	robolectricProperties robolectricProperties
+	testProperties        testProperties
 
 	libs  []string
 	tests []string
 
+	manifest    android.Path
+	resourceApk android.Path
+
+	combinedJar android.WritablePath
+
 	roboSrcJar android.Path
+
+	testConfig android.Path
+	data       android.Paths
 }
 
+func (r *robolectricTest) TestSuites() []string {
+	return r.testProperties.Test_suites
+}
+
+var _ android.TestSuiteModule = (*robolectricTest)(nil)
+
 func (r *robolectricTest) DepsMutator(ctx android.BottomUpMutatorContext) {
 	r.Library.DepsMutator(ctx)
 
@@ -77,9 +98,16 @@
 	ctx.AddVariationDependencies(nil, libTag, robolectricDefaultLibs...)
 
 	ctx.AddVariationDependencies(nil, roboCoverageLibsTag, r.robolectricProperties.Coverage_libs...)
+
+	ctx.AddVariationDependencies(nil, roboRuntimesTag, "robolectric-android-all-prebuilts")
 }
 
 func (r *robolectricTest) GenerateAndroidBuildActions(ctx android.ModuleContext) {
+	r.testConfig = tradefed.AutoGenRobolectricTestConfig(ctx, r.testProperties.Test_config,
+		r.testProperties.Test_config_template, r.testProperties.Test_suites,
+		r.testProperties.Auto_gen_config)
+	r.data = android.PathsForModuleSrc(ctx, r.testProperties.Data)
+
 	roboTestConfig := android.PathForModuleGen(ctx, "robolectric").
 		Join(ctx, "com/android/tools/test_config.properties")
 
@@ -95,6 +123,9 @@
 		ctx.PropertyErrorf("instrumentation_for", "dependency must be an android_app")
 	}
 
+	r.manifest = instrumentedApp.mergedManifestFile
+	r.resourceApk = instrumentedApp.outputFile
+
 	generateRoboTestConfig(ctx, roboTestConfig, instrumentedApp)
 	r.extraResources = android.Paths{roboTestConfig}
 
@@ -104,10 +135,30 @@
 	r.generateRoboSrcJar(ctx, roboSrcJar, instrumentedApp)
 	r.roboSrcJar = roboSrcJar
 
-	for _, dep := range ctx.GetDirectDepsWithTag(libTag) {
-		r.libs = append(r.libs, dep.(Dependency).BaseModuleName())
+	roboTestConfigJar := android.PathForModuleOut(ctx, "robolectric_samedir", "samedir_config.jar")
+	generateSameDirRoboTestConfigJar(ctx, roboTestConfigJar)
+
+	combinedJarJars := android.Paths{
+		// roboTestConfigJar comes first so that its com/android/tools/test_config.properties
+		// overrides the one from r.extraResources.  The r.extraResources one can be removed
+		// once the Make test runner is removed.
+		roboTestConfigJar,
+		r.outputFile,
+		instrumentedApp.implementationAndResourcesJar,
 	}
 
+	for _, dep := range ctx.GetDirectDepsWithTag(libTag) {
+		m := dep.(Dependency)
+		r.libs = append(r.libs, m.BaseModuleName())
+		if !android.InList(m.BaseModuleName(), config.FrameworkLibraries) {
+			combinedJarJars = append(combinedJarJars, m.ImplementationAndResourcesJars()...)
+		}
+	}
+
+	r.combinedJar = android.PathForModuleOut(ctx, "robolectric_combined", r.outputFile.Base())
+	TransformJarsToJar(ctx, r.combinedJar, "combine jars", combinedJarJars, android.OptionalPath{},
+		false, nil, nil)
+
 	// TODO: this could all be removed if tradefed was used as the test runner, it will find everything
 	// annotated as a test and run it.
 	for _, src := range r.compiledJavaSrcs {
@@ -121,14 +172,38 @@
 		}
 		r.tests = append(r.tests, s)
 	}
+
+	r.data = append(r.data, r.manifest, r.resourceApk)
+
+	runtimes := ctx.GetDirectDepWithTag("robolectric-android-all-prebuilts", roboRuntimesTag)
+
+	installPath := android.PathForModuleInstall(ctx, r.BaseModuleName())
+
+	installedResourceApk := ctx.InstallFile(installPath, ctx.ModuleName()+".apk", r.resourceApk)
+	installedManifest := ctx.InstallFile(installPath, ctx.ModuleName()+"-AndroidManifest.xml", r.manifest)
+	installedConfig := ctx.InstallFile(installPath, ctx.ModuleName()+".config", r.testConfig)
+
+	var installDeps android.Paths
+	for _, runtime := range runtimes.(*robolectricRuntimes).runtimes {
+		installDeps = append(installDeps, runtime)
+	}
+	installDeps = append(installDeps, installedResourceApk, installedManifest, installedConfig)
+
+	for _, data := range android.PathsForModuleSrc(ctx, r.testProperties.Data) {
+		installedData := ctx.InstallFile(installPath, data.Rel(), data)
+		installDeps = append(installDeps, installedData)
+	}
+
+	ctx.InstallFile(installPath, ctx.ModuleName()+".jar", r.combinedJar, installDeps...)
 }
 
-func generateRoboTestConfig(ctx android.ModuleContext, outputFile android.WritablePath, instrumentedApp *AndroidApp) {
+func generateRoboTestConfig(ctx android.ModuleContext, outputFile android.WritablePath,
+	instrumentedApp *AndroidApp) {
+	rule := android.NewRuleBuilder()
+
 	manifest := instrumentedApp.mergedManifestFile
 	resourceApk := instrumentedApp.outputFile
 
-	rule := android.NewRuleBuilder()
-
 	rule.Command().Text("rm -f").Output(outputFile)
 	rule.Command().
 		Textf(`echo "android_merged_manifest=%s" >>`, manifest.String()).Output(outputFile).Text("&&").
@@ -141,6 +216,28 @@
 	rule.Build(pctx, ctx, "generate_test_config", "generate test_config.properties")
 }
 
+func generateSameDirRoboTestConfigJar(ctx android.ModuleContext, outputFile android.ModuleOutPath) {
+	rule := android.NewRuleBuilder()
+
+	outputDir := outputFile.InSameDir(ctx)
+	configFile := outputDir.Join(ctx, "com/android/tools/test_config.properties")
+	rule.Temporary(configFile)
+	rule.Command().Text("rm -f").Output(outputFile).Output(configFile)
+	rule.Command().Textf("mkdir -p $(dirname %s)", configFile.String())
+	rule.Command().
+		Text("(").
+		Textf(`echo "android_merged_manifest=%s-AndroidManifest.xml" &&`, ctx.ModuleName()).
+		Textf(`echo "android_resource_apk=%s.apk"`, ctx.ModuleName()).
+		Text(") >>").Output(configFile)
+	rule.Command().
+		BuiltTool(ctx, "soong_zip").
+		FlagWithArg("-C ", outputDir.String()).
+		FlagWithInput("-f ", configFile).
+		FlagWithOutput("-o ", outputFile)
+
+	rule.Build(pctx, ctx, "generate_test_config_samedir", "generate test_config.properties")
+}
+
 func (r *robolectricTest) generateRoboSrcJar(ctx android.ModuleContext, outputFile android.WritablePath,
 	instrumentedApp *AndroidApp) {
 
@@ -202,7 +299,6 @@
 		fmt.Fprintln(w, "LOCAL_ROBOTEST_TIMEOUT :=", *t)
 	}
 	fmt.Fprintln(w, "-include external/robolectric-shadows/run_robotests.mk")
-
 }
 
 // An android_robolectric_test module compiles tests against the Robolectric framework that can run on the local host
@@ -218,11 +314,74 @@
 	module.addHostProperties()
 	module.AddProperties(
 		&module.Module.deviceProperties,
-		&module.robolectricProperties)
+		&module.robolectricProperties,
+		&module.testProperties)
 
 	module.Module.dexpreopter.isTest = true
 	module.Module.linter.test = true
 
+	module.testProperties.Test_suites = []string{"robolectric-tests"}
+
 	InitJavaModule(module, android.DeviceSupported)
 	return module
 }
+
+func (r *robolectricTest) InstallBypassMake() bool         { return true }
+func (r *robolectricTest) InstallInTestcases() bool        { return true }
+func (r *robolectricTest) InstallForceOS() *android.OsType { return &android.BuildOs }
+
+func robolectricRuntimesFactory() android.Module {
+	module := &robolectricRuntimes{}
+	module.AddProperties(&module.props)
+	android.InitAndroidArchModule(module, android.DeviceSupported, android.MultilibCommon)
+	return module
+}
+
+type robolectricRuntimesProperties struct {
+	Jars []string `android:"path"`
+	Lib  *string
+}
+
+type robolectricRuntimes struct {
+	android.ModuleBase
+
+	props robolectricRuntimesProperties
+
+	runtimes []android.InstallPath
+}
+
+func (r *robolectricRuntimes) TestSuites() []string {
+	return []string{"robolectric-tests"}
+}
+
+var _ android.TestSuiteModule = (*robolectricRuntimes)(nil)
+
+func (r *robolectricRuntimes) DepsMutator(ctx android.BottomUpMutatorContext) {
+	if !ctx.Config().UnbundledBuildUsePrebuiltSdks() && r.props.Lib != nil {
+		ctx.AddVariationDependencies(nil, libTag, String(r.props.Lib))
+	}
+}
+
+func (r *robolectricRuntimes) GenerateAndroidBuildActions(ctx android.ModuleContext) {
+	files := android.PathsForModuleSrc(ctx, r.props.Jars)
+
+	androidAllDir := android.PathForModuleInstall(ctx, "android-all")
+	for _, from := range files {
+		installedRuntime := ctx.InstallFile(androidAllDir, from.Base(), from)
+		r.runtimes = append(r.runtimes, installedRuntime)
+	}
+
+	if !ctx.Config().UnbundledBuildUsePrebuiltSdks() && r.props.Lib != nil {
+		runtimeFromSourceModule := ctx.GetDirectDepWithTag(String(r.props.Lib), libTag)
+		runtimeFromSourceJar := android.OutputFileForModule(ctx, runtimeFromSourceModule, "")
+
+		runtimeName := fmt.Sprintf("android-all-%s-robolectric-r0.jar",
+			ctx.Config().PlatformSdkCodename())
+		installedRuntime := ctx.InstallFile(androidAllDir, runtimeName, runtimeFromSourceJar)
+		r.runtimes = append(r.runtimes, installedRuntime)
+	}
+}
+
+func (r *robolectricRuntimes) InstallBypassMake() bool         { return true }
+func (r *robolectricRuntimes) InstallInTestcases() bool        { return true }
+func (r *robolectricRuntimes) InstallForceOS() *android.OsType { return &android.BuildOs }
diff --git a/java/sdk.go b/java/sdk.go
index 6564f6d..5d79d1d 100644
--- a/java/sdk.go
+++ b/java/sdk.go
@@ -214,7 +214,7 @@
 		// "current" can be built from source and be from prebuilt SDK
 		return ctx.Config().UnbundledBuildUsePrebuiltSdks()
 	} else if s.version.isNumbered() {
-		// sanity check
+		// validation check
 		if s.kind != sdkPublic && s.kind != sdkSystem && s.kind != sdkTest {
 			panic(fmt.Errorf("prebuilt SDK is not not available for sdkKind=%q", s.kind))
 			return false
@@ -413,8 +413,8 @@
 	case sdkPrivate:
 		return sdkDep{
 			useModule:          true,
-			systemModules:      config.LegacyCorePlatformSystemModules,
-			bootclasspath:      config.LegacyCorePlatformBootclasspathLibraries,
+			systemModules:      corePlatformSystemModules(ctx),
+			bootclasspath:      corePlatformBootclasspathLibraries(ctx),
 			classpath:          config.FrameworkLibraries,
 			frameworkResModule: "framework-res",
 		}
@@ -438,8 +438,8 @@
 	case sdkCorePlatform:
 		return sdkDep{
 			useModule:        true,
-			systemModules:    config.LegacyCorePlatformSystemModules,
-			bootclasspath:    config.LegacyCorePlatformBootclasspathLibraries,
+			systemModules:    corePlatformSystemModules(ctx),
+			bootclasspath:    corePlatformBootclasspathLibraries(ctx),
 			noFrameworksLibs: true,
 		}
 	case sdkPublic:
diff --git a/java/sdk_library.go b/java/sdk_library.go
index a5aa328..0379a31 100644
--- a/java/sdk_library.go
+++ b/java/sdk_library.go
@@ -126,24 +126,23 @@
 	// the prebuilt jar.
 	sdkVersion string
 
+	// The annotation that identifies this API level, empty for the public API scope.
+	annotation string
+
 	// Extra arguments to pass to droidstubs for this scope.
-	droidstubsArgs []string
-
-	// The args that must be passed to droidstubs to generate the stubs source
-	// for this scope.
 	//
-	// The stubs source must include the definitions of everything that is in this
-	// api scope and all the scopes that this one extends.
-	droidstubsArgsForGeneratingStubsSource []string
+	// This is not used directly but is used to construct the droidstubsArgs.
+	extraArgs []string
 
-	// The args that must be passed to droidstubs to generate the API for this scope.
+	// The args that must be passed to droidstubs to generate the API and stubs source
+	// for this scope, constructed dynamically by initApiScope().
 	//
 	// The API only includes the additional members that this scope adds over the scope
 	// that it extends.
-	droidstubsArgsForGeneratingApi []string
-
-	// True if the stubs source and api can be created by the same metalava invocation.
-	createStubsSourceAndApiTogether bool
+	//
+	// The stubs source must include the definitions of everything that is in this
+	// api scope and all the scopes that this one extends.
+	droidstubsArgs []string
 
 	// Whether the api scope can be treated as unstable, and should skip compat checks.
 	unstable bool
@@ -180,21 +179,23 @@
 	// To get the args needed to generate the stubs source append all the args from
 	// this scope and all the scopes it extends as each set of args adds additional
 	// members to the stubs.
-	var stubsSourceArgs []string
-	for s := scope; s != nil; s = s.extends {
-		stubsSourceArgs = append(stubsSourceArgs, s.droidstubsArgs...)
+	var scopeSpecificArgs []string
+	if scope.annotation != "" {
+		scopeSpecificArgs = []string{"--show-annotation", scope.annotation}
 	}
-	scope.droidstubsArgsForGeneratingStubsSource = stubsSourceArgs
+	for s := scope; s != nil; s = s.extends {
+		scopeSpecificArgs = append(scopeSpecificArgs, s.extraArgs...)
 
-	// Currently the args needed to generate the API are the same as the args
-	// needed to add additional members.
-	apiArgs := scope.droidstubsArgs
-	scope.droidstubsArgsForGeneratingApi = apiArgs
+		// Ensure that the generated stubs includes all the API elements from the API scope
+		// that this scope extends.
+		if s != scope && s.annotation != "" {
+			scopeSpecificArgs = append(scopeSpecificArgs, "--show-for-stub-purposes-annotation", s.annotation)
+		}
+	}
 
-	// If the args needed to generate the stubs and API are the same then they
-	// can be generated in a single invocation of metalava, otherwise they will
-	// need separate invocations.
-	scope.createStubsSourceAndApiTogether = reflect.DeepEqual(stubsSourceArgs, apiArgs)
+	// Escape any special characters in the arguments. This is needed because droidstubs
+	// passes these directly to the shell command.
+	scope.droidstubsArgs = proptools.ShellEscapeList(scopeSpecificArgs)
 
 	return scope
 }
@@ -249,10 +250,10 @@
 		scopeSpecificProperties: func(module *SdkLibrary) *ApiScopeProperties {
 			return &module.sdkLibraryProperties.System
 		},
-		apiFilePrefix:  "system-",
-		moduleSuffix:   ".system",
-		sdkVersion:     "system_current",
-		droidstubsArgs: []string{"-showAnnotation android.annotation.SystemApi\\(client=android.annotation.SystemApi.Client.PRIVILEGED_APPS\\)"},
+		apiFilePrefix: "system-",
+		moduleSuffix:  ".system",
+		sdkVersion:    "system_current",
+		annotation:    "android.annotation.SystemApi(client=android.annotation.SystemApi.Client.PRIVILEGED_APPS)",
 	})
 	apiScopeTest = initApiScope(&apiScope{
 		name:                "test",
@@ -261,11 +262,11 @@
 		scopeSpecificProperties: func(module *SdkLibrary) *ApiScopeProperties {
 			return &module.sdkLibraryProperties.Test
 		},
-		apiFilePrefix:  "test-",
-		moduleSuffix:   ".test",
-		sdkVersion:     "test_current",
-		droidstubsArgs: []string{"-showAnnotation android.annotation.TestApi"},
-		unstable:       true,
+		apiFilePrefix: "test-",
+		moduleSuffix:  ".test",
+		sdkVersion:    "test_current",
+		annotation:    "android.annotation.TestApi",
+		unstable:      true,
 	})
 	apiScopeModuleLib = initApiScope(&apiScope{
 		name:    "module-lib",
@@ -282,9 +283,7 @@
 		apiFilePrefix: "module-lib-",
 		moduleSuffix:  ".module_lib",
 		sdkVersion:    "module_current",
-		droidstubsArgs: []string{
-			"--show-annotation android.annotation.SystemApi\\(client=android.annotation.SystemApi.Client.MODULE_LIBRARIES\\)",
-		},
+		annotation:    "android.annotation.SystemApi(client=android.annotation.SystemApi.Client.MODULE_LIBRARIES)",
 	})
 	apiScopeSystemServer = initApiScope(&apiScope{
 		name:    "system-server",
@@ -301,11 +300,11 @@
 		apiFilePrefix: "system-server-",
 		moduleSuffix:  ".system_server",
 		sdkVersion:    "system_server_current",
-		droidstubsArgs: []string{
-			"--show-annotation android.annotation.SystemApi\\(client=android.annotation.SystemApi.Client.SYSTEM_SERVER\\) ",
-			"--hide-annotation android.annotation.Hide",
+		annotation:    "android.annotation.SystemApi(client=android.annotation.SystemApi.Client.SYSTEM_SERVER)",
+		extraArgs: []string{
+			"--hide-annotation", "android.annotation.Hide",
 			// com.android.* classes are okay in this interface"
-			"--hide InternalClasses",
+			"--hide", "InternalClasses",
 		},
 	})
 	allApiScopes = apiScopes{
@@ -985,16 +984,8 @@
 		// Add dependencies to the stubs library
 		ctx.AddVariationDependencies(nil, apiScope.stubsTag, module.stubsLibraryModuleName(apiScope))
 
-		// If the stubs source and API cannot be generated together then add an additional dependency on
-		// the API module.
-		if apiScope.createStubsSourceAndApiTogether {
-			// Add a dependency on the stubs source in order to access both stubs source and api information.
-			ctx.AddVariationDependencies(nil, apiScope.stubsSourceAndApiTag, module.stubsSourceModuleName(apiScope))
-		} else {
-			// Add separate dependencies on the creators of the stubs source files and the API.
-			ctx.AddVariationDependencies(nil, apiScope.stubsSourceTag, module.stubsSourceModuleName(apiScope))
-			ctx.AddVariationDependencies(nil, apiScope.apiFileTag, module.apiModuleName(apiScope))
-		}
+		// Add a dependency on the stubs source in order to access both stubs source and api information.
+		ctx.AddVariationDependencies(nil, apiScope.stubsSourceAndApiTag, module.stubsSourceModuleName(apiScope))
 	}
 
 	if module.requiresRuntimeImplementationLibrary() {
@@ -1121,6 +1112,7 @@
 		&module.properties,
 		&module.protoProperties,
 		&module.deviceProperties,
+		&module.dexProperties,
 		&module.dexpreoptProperties,
 		&module.linter.properties,
 		&props,
@@ -1180,8 +1172,8 @@
 	// We compile the stubs for 1.8 in line with the main android.jar stubs, and potential
 	// interop with older developer tools that don't support 1.9.
 	props.Java_version = proptools.StringPtr("1.8")
-	if module.deviceProperties.Compile_dex != nil {
-		props.Compile_dex = module.deviceProperties.Compile_dex
+	if module.dexProperties.Compile_dex != nil {
+		props.Compile_dex = module.dexProperties.Compile_dex
 	}
 
 	// Dist the class jar artifact for sdk builds.
@@ -1197,7 +1189,7 @@
 
 // Creates a droidstubs module that creates stubs source files from the given full source
 // files and also updates and checks the API specification files.
-func (module *SdkLibrary) createStubsSourcesAndApi(mctx android.DefaultableHookContext, apiScope *apiScope, name string, createStubSources, createApi bool, scopeSpecificDroidstubsArgs []string) {
+func (module *SdkLibrary) createStubsSourcesAndApi(mctx android.DefaultableHookContext, apiScope *apiScope, name string, scopeSpecificDroidstubsArgs []string) {
 	props := struct {
 		Name                             *string
 		Visibility                       []string
@@ -1284,64 +1276,57 @@
 	}
 	droidstubsArgs = append(droidstubsArgs, android.JoinWithPrefix(disabledWarnings, "--hide "))
 
-	if !createStubSources {
-		// Stubs are not required.
-		props.Generate_stubs = proptools.BoolPtr(false)
-	}
-
 	// Add in scope specific arguments.
 	droidstubsArgs = append(droidstubsArgs, scopeSpecificDroidstubsArgs...)
 	props.Arg_files = module.sdkLibraryProperties.Droiddoc_option_files
 	props.Args = proptools.StringPtr(strings.Join(droidstubsArgs, " "))
 
-	if createApi {
-		// List of APIs identified from the provided source files are created. They are later
-		// compared against to the not-yet-released (a.k.a current) list of APIs and to the
-		// last-released (a.k.a numbered) list of API.
-		currentApiFileName := apiScope.apiFilePrefix + "current.txt"
-		removedApiFileName := apiScope.apiFilePrefix + "removed.txt"
-		apiDir := module.getApiDir()
-		currentApiFileName = path.Join(apiDir, currentApiFileName)
-		removedApiFileName = path.Join(apiDir, removedApiFileName)
+	// List of APIs identified from the provided source files are created. They are later
+	// compared against to the not-yet-released (a.k.a current) list of APIs and to the
+	// last-released (a.k.a numbered) list of API.
+	currentApiFileName := apiScope.apiFilePrefix + "current.txt"
+	removedApiFileName := apiScope.apiFilePrefix + "removed.txt"
+	apiDir := module.getApiDir()
+	currentApiFileName = path.Join(apiDir, currentApiFileName)
+	removedApiFileName = path.Join(apiDir, removedApiFileName)
 
-		// check against the not-yet-release API
-		props.Check_api.Current.Api_file = proptools.StringPtr(currentApiFileName)
-		props.Check_api.Current.Removed_api_file = proptools.StringPtr(removedApiFileName)
+	// check against the not-yet-release API
+	props.Check_api.Current.Api_file = proptools.StringPtr(currentApiFileName)
+	props.Check_api.Current.Removed_api_file = proptools.StringPtr(removedApiFileName)
 
-		if !apiScope.unstable {
-			// check against the latest released API
-			latestApiFilegroupName := proptools.StringPtr(module.latestApiFilegroupName(apiScope))
-			props.Check_api.Last_released.Api_file = latestApiFilegroupName
-			props.Check_api.Last_released.Removed_api_file = proptools.StringPtr(
-				module.latestRemovedApiFilegroupName(apiScope))
-			props.Check_api.Ignore_missing_latest_api = proptools.BoolPtr(true)
+	if !apiScope.unstable {
+		// check against the latest released API
+		latestApiFilegroupName := proptools.StringPtr(module.latestApiFilegroupName(apiScope))
+		props.Check_api.Last_released.Api_file = latestApiFilegroupName
+		props.Check_api.Last_released.Removed_api_file = proptools.StringPtr(
+			module.latestRemovedApiFilegroupName(apiScope))
+		props.Check_api.Ignore_missing_latest_api = proptools.BoolPtr(true)
 
-			if proptools.Bool(module.sdkLibraryProperties.Api_lint.Enabled) {
-				// Enable api lint.
-				props.Check_api.Api_lint.Enabled = proptools.BoolPtr(true)
-				props.Check_api.Api_lint.New_since = latestApiFilegroupName
+		if proptools.Bool(module.sdkLibraryProperties.Api_lint.Enabled) {
+			// Enable api lint.
+			props.Check_api.Api_lint.Enabled = proptools.BoolPtr(true)
+			props.Check_api.Api_lint.New_since = latestApiFilegroupName
 
-				// If it exists then pass a lint-baseline.txt through to droidstubs.
-				baselinePath := path.Join(apiDir, apiScope.apiFilePrefix+"lint-baseline.txt")
-				baselinePathRelativeToRoot := path.Join(mctx.ModuleDir(), baselinePath)
-				paths, err := mctx.GlobWithDeps(baselinePathRelativeToRoot, nil)
-				if err != nil {
-					mctx.ModuleErrorf("error checking for presence of %s: %s", baselinePathRelativeToRoot, err)
-				}
-				if len(paths) == 1 {
-					props.Check_api.Api_lint.Baseline_file = proptools.StringPtr(baselinePath)
-				} else if len(paths) != 0 {
-					mctx.ModuleErrorf("error checking for presence of %s: expected one path, found: %v", baselinePathRelativeToRoot, paths)
-				}
+			// If it exists then pass a lint-baseline.txt through to droidstubs.
+			baselinePath := path.Join(apiDir, apiScope.apiFilePrefix+"lint-baseline.txt")
+			baselinePathRelativeToRoot := path.Join(mctx.ModuleDir(), baselinePath)
+			paths, err := mctx.GlobWithDeps(baselinePathRelativeToRoot, nil)
+			if err != nil {
+				mctx.ModuleErrorf("error checking for presence of %s: %s", baselinePathRelativeToRoot, err)
+			}
+			if len(paths) == 1 {
+				props.Check_api.Api_lint.Baseline_file = proptools.StringPtr(baselinePath)
+			} else if len(paths) != 0 {
+				mctx.ModuleErrorf("error checking for presence of %s: expected one path, found: %v", baselinePathRelativeToRoot, paths)
 			}
 		}
+	}
 
-		// Dist the api txt artifact for sdk builds.
-		if !Bool(module.sdkLibraryProperties.No_dist) {
-			props.Dist.Targets = []string{"sdk", "win_sdk"}
-			props.Dist.Dest = proptools.StringPtr(fmt.Sprintf("%v.txt", module.BaseModuleName()))
-			props.Dist.Dir = proptools.StringPtr(path.Join(module.apiDistPath(apiScope), "api"))
-		}
+	// Dist the api txt artifact for sdk builds.
+	if !Bool(module.sdkLibraryProperties.No_dist) {
+		props.Dist.Targets = []string{"sdk", "win_sdk"}
+		props.Dist.Dest = proptools.StringPtr(fmt.Sprintf("%v.txt", module.BaseModuleName()))
+		props.Dist.Dir = proptools.StringPtr(path.Join(module.apiDistPath(apiScope), "api"))
 	}
 
 	mctx.CreateModule(DroidstubsFactory, &props)
@@ -1524,22 +1509,8 @@
 	}
 
 	for _, scope := range generatedScopes {
-		stubsSourceArgs := scope.droidstubsArgsForGeneratingStubsSource
-		stubsSourceModuleName := module.stubsSourceModuleName(scope)
-
-		// If the args needed to generate the stubs and API are the same then they
-		// can be generated in a single invocation of metalava, otherwise they will
-		// need separate invocations.
-		if scope.createStubsSourceAndApiTogether {
-			// Use the stubs source name for legacy reasons.
-			module.createStubsSourcesAndApi(mctx, scope, stubsSourceModuleName, true, true, stubsSourceArgs)
-		} else {
-			module.createStubsSourcesAndApi(mctx, scope, stubsSourceModuleName, true, false, stubsSourceArgs)
-
-			apiArgs := scope.droidstubsArgsForGeneratingApi
-			apiName := module.apiModuleName(scope)
-			module.createStubsSourcesAndApi(mctx, scope, apiName, false, true, apiArgs)
-		}
+		// Use the stubs source name for legacy reasons.
+		module.createStubsSourcesAndApi(mctx, scope, module.stubsSourceModuleName(scope), scope.droidstubsArgs)
 
 		module.createStubsLibrary(mctx, scope)
 	}
@@ -2026,6 +1997,15 @@
 }
 
 // to satisfy apex.javaDependency interface
+func (module *SdkLibraryImport) LintDepSets() LintDepSets {
+	if module.implLibraryModule == nil {
+		return LintDepSets{}
+	} else {
+		return module.implLibraryModule.LintDepSets()
+	}
+}
+
+// to satisfy apex.javaDependency interface
 func (module *SdkLibraryImport) Stem() string {
 	return module.BaseModuleName()
 }
diff --git a/java/sdk_test.go b/java/sdk_test.go
index 1f23b14..395da79 100644
--- a/java/sdk_test.go
+++ b/java/sdk_test.go
@@ -49,8 +49,8 @@
 	}{
 		{
 			name:           "default",
-			bootclasspath:  config.LegacyCorePlatformBootclasspathLibraries,
-			system:         config.LegacyCorePlatformSystemModules,
+			bootclasspath:  config.StableCorePlatformBootclasspathLibraries,
+			system:         config.StableCorePlatformSystemModules,
 			java8classpath: config.FrameworkLibraries,
 			java9classpath: config.FrameworkLibraries,
 			aidl:           "-Iframework/aidl",
@@ -58,16 +58,16 @@
 		{
 			name:           `sdk_version:"core_platform"`,
 			properties:     `sdk_version:"core_platform"`,
-			bootclasspath:  config.LegacyCorePlatformBootclasspathLibraries,
-			system:         config.LegacyCorePlatformSystemModules,
+			bootclasspath:  config.StableCorePlatformBootclasspathLibraries,
+			system:         config.StableCorePlatformSystemModules,
 			java8classpath: []string{},
 			aidl:           "",
 		},
 		{
 			name:           "blank sdk version",
 			properties:     `sdk_version: "",`,
-			bootclasspath:  config.LegacyCorePlatformBootclasspathLibraries,
-			system:         config.LegacyCorePlatformSystemModules,
+			bootclasspath:  config.StableCorePlatformBootclasspathLibraries,
+			system:         config.StableCorePlatformSystemModules,
 			java8classpath: config.FrameworkLibraries,
 			java9classpath: config.FrameworkLibraries,
 			aidl:           "-Iframework/aidl",
@@ -155,9 +155,9 @@
 		{
 
 			name:           "nostdlib system_modules",
-			properties:     `sdk_version: "none", system_modules: "legacy-core-platform-api-stubs-system-modules"`,
-			system:         "legacy-core-platform-api-stubs-system-modules",
-			bootclasspath:  []string{"legacy-core-platform-api-stubs-system-modules-lib"},
+			properties:     `sdk_version: "none", system_modules: "stable-core-platform-api-stubs-system-modules"`,
+			system:         "stable-core-platform-api-stubs-system-modules",
+			bootclasspath:  []string{"stable-core-platform-api-stubs-system-modules-lib"},
 			java8classpath: []string{},
 		},
 		{
diff --git a/java/testing.go b/java/testing.go
index 94f054e..1e725fa 100644
--- a/java/testing.go
+++ b/java/testing.go
@@ -22,6 +22,8 @@
 
 	"android/soong/android"
 	"android/soong/cc"
+	"android/soong/python"
+
 	"github.com/google/blueprint"
 )
 
@@ -85,6 +87,10 @@
 		"prebuilts/sdk/tools/core-lambda-stubs.jar":                nil,
 		"prebuilts/sdk/Android.bp":                                 []byte(`prebuilt_apis { name: "sdk", api_dirs: ["14", "28", "30", "current"],}`),
 
+		"bin.py": nil,
+		python.StubTemplateHost: []byte(`PYTHON_BINARY = '%interpreter%'
+		MAIN_FILE = '%main%'`),
+
 		// For java_sdk_library
 		"api/module-lib-current.txt":                        nil,
 		"api/module-lib-removed.txt":                        nil,
@@ -136,7 +142,7 @@
 				name: "%s",
 				srcs: ["a.java"],
 				sdk_version: "none",
-				system_modules: "legacy-core-platform-api-stubs-system-modules",
+				system_modules: "stable-core-platform-api-stubs-system-modules",
 			}
 		`, extra)
 	}
@@ -146,7 +152,7 @@
 			name: "framework",
 			srcs: ["a.java"],
 			sdk_version: "none",
-			system_modules: "legacy-core-platform-api-stubs-system-modules",
+			system_modules: "stable-core-platform-api-stubs-system-modules",
 			aidl: {
 				export_include_dirs: ["framework/aidl"],
 			},
@@ -161,7 +167,7 @@
 			name: "android.hidl.base-V1.0-java",
 			srcs: ["a.java"],
 			sdk_version: "none",
-			system_modules: "legacy-core-platform-api-stubs-system-modules",
+			system_modules: "stable-core-platform-api-stubs-system-modules",
 			installable: true,
 		}
 
@@ -169,7 +175,7 @@
 			name: "android.hidl.manager-V1.0-java",
 			srcs: ["a.java"],
 			sdk_version: "none",
-			system_modules: "legacy-core-platform-api-stubs-system-modules",
+			system_modules: "stable-core-platform-api-stubs-system-modules",
 			installable: true,
 		}
 
@@ -177,7 +183,7 @@
 			name: "org.apache.http.legacy",
 			srcs: ["a.java"],
 			sdk_version: "none",
-			system_modules: "legacy-core-platform-api-stubs-system-modules",
+			system_modules: "stable-core-platform-api-stubs-system-modules",
 			installable: true,
 		}
 
@@ -185,7 +191,7 @@
 			name: "android.test.base",
 			srcs: ["a.java"],
 			sdk_version: "none",
-			system_modules: "legacy-core-platform-api-stubs-system-modules",
+			system_modules: "stable-core-platform-api-stubs-system-modules",
 			installable: true,
 		}
   
@@ -193,7 +199,7 @@
 			name: "android.test.mock",
 			srcs: ["a.java"],
 			sdk_version: "none",
-			system_modules: "legacy-core-platform-api-stubs-system-modules",
+			system_modules: "stable-core-platform-api-stubs-system-modules",
 			installable: true,
 		}
 	`
diff --git a/phony/phony.go b/phony/phony.go
index 305a434..cb60b9f 100644
--- a/phony/phony.go
+++ b/phony/phony.go
@@ -44,11 +44,6 @@
 	p.requiredModuleNames = ctx.RequiredModuleNames()
 	p.hostRequiredModuleNames = ctx.HostRequiredModuleNames()
 	p.targetRequiredModuleNames = ctx.TargetRequiredModuleNames()
-	if len(p.requiredModuleNames) == 0 &&
-		len(p.hostRequiredModuleNames) == 0 && len(p.targetRequiredModuleNames) == 0 {
-		ctx.PropertyErrorf("required", "phony must not have empty required dependencies "+
-			"in order to be useful(and therefore permitted).")
-	}
 }
 
 func (p *phony) AndroidMk() android.AndroidMkData {
diff --git a/python/binary.go b/python/binary.go
index 695fa12..5a74926 100644
--- a/python/binary.go
+++ b/python/binary.go
@@ -65,7 +65,7 @@
 }
 
 var (
-	stubTemplateHost = "build/soong/python/scripts/stub_template_host.txt"
+	StubTemplateHost = "build/soong/python/scripts/stub_template_host.txt"
 )
 
 func NewBinary(hod android.HostOrDeviceSupported) (*Module, *binaryDecorator) {
diff --git a/python/builder.go b/python/builder.go
index 36baecd..dc2d1f1 100644
--- a/python/builder.go
+++ b/python/builder.go
@@ -91,7 +91,7 @@
 
 	if !embeddedLauncher {
 		// the path of stub_template_host.txt from source tree.
-		template := android.PathForSource(ctx, stubTemplateHost)
+		template := android.PathForSource(ctx, StubTemplateHost)
 		implicits = append(implicits, template)
 
 		// intermediate output path for __main__.py
diff --git a/python/python.go b/python/python.go
index a6c9e2a..479c729 100644
--- a/python/python.go
+++ b/python/python.go
@@ -30,9 +30,11 @@
 )
 
 func init() {
-	android.PreDepsMutators(func(ctx android.RegisterMutatorsContext) {
-		ctx.BottomUp("version_split", versionSplitMutator()).Parallel()
-	})
+	android.PreDepsMutators(RegisterPythonPreDepsMutators)
+}
+
+func RegisterPythonPreDepsMutators(ctx android.RegisterMutatorsContext) {
+	ctx.BottomUp("version_split", versionSplitMutator()).Parallel()
 }
 
 // the version properties that apply to python libraries and binaries.
@@ -226,15 +228,20 @@
 	return func(mctx android.BottomUpMutatorContext) {
 		if base, ok := mctx.Module().(*Module); ok {
 			versionNames := []string{}
-			if base.properties.Version.Py2.Enabled != nil &&
-				*(base.properties.Version.Py2.Enabled) == true {
-				versionNames = append(versionNames, pyVersion2)
-			}
+			// PY3 is first so that we alias the PY3 variant rather than PY2 if both
+			// are available
 			if !(base.properties.Version.Py3.Enabled != nil &&
 				*(base.properties.Version.Py3.Enabled) == false) {
 				versionNames = append(versionNames, pyVersion3)
 			}
+			if base.properties.Version.Py2.Enabled != nil &&
+				*(base.properties.Version.Py2.Enabled) == true {
+				versionNames = append(versionNames, pyVersion2)
+			}
 			modules := mctx.CreateVariations(versionNames...)
+			if len(versionNames) > 0 {
+				mctx.AliasVariation(versionNames[0])
+			}
 			for i, v := range versionNames {
 				// set the actual version for Python module.
 				modules[i].(*Module).properties.Actual_version = v
diff --git a/python/python_test.go b/python/python_test.go
index 1245ca1..23db24e 100644
--- a/python/python_test.go
+++ b/python/python_test.go
@@ -301,7 +301,7 @@
 				filepath.Join("dir", "file2.py"):       nil,
 				filepath.Join("dir", "bin.py"):         nil,
 				filepath.Join("dir", "file4.py"):       nil,
-				stubTemplateHost: []byte(`PYTHON_BINARY = '%interpreter%'
+				StubTemplateHost: []byte(`PYTHON_BINARY = '%interpreter%'
 				MAIN_FILE = '%main%'`),
 			},
 			expectedBinaries: []pyModule{
@@ -330,9 +330,7 @@
 		t.Run(d.desc, func(t *testing.T) {
 			config := android.TestConfig(buildDir, nil, "", d.mockFiles)
 			ctx := android.NewTestContext()
-			ctx.PreDepsMutators(func(ctx android.RegisterMutatorsContext) {
-				ctx.BottomUp("version_split", versionSplitMutator()).Parallel()
-			})
+			ctx.PreDepsMutators(RegisterPythonPreDepsMutators)
 			ctx.RegisterModuleType("python_library_host", PythonLibraryHostFactory)
 			ctx.RegisterModuleType("python_binary_host", PythonBinaryHostFactory)
 			ctx.RegisterModuleType("python_defaults", defaultsFactory)
diff --git a/rust/Android.bp b/rust/Android.bp
index d56de87..bbeb28d 100644
--- a/rust/Android.bp
+++ b/rust/Android.bp
@@ -10,6 +10,7 @@
     srcs: [
         "androidmk.go",
         "binary.go",
+        "bindgen.go",
         "builder.go",
         "clippy.go",
         "compiler.go",
@@ -19,17 +20,21 @@
         "proc_macro.go",
         "project_json.go",
         "rust.go",
+        "source_provider.go",
         "test.go",
         "testing.go",
     ],
     testSrcs: [
         "binary_test.go",
+        "bindgen_test.go",
+        "builder_test.go",
         "clippy_test.go",
         "compiler_test.go",
         "coverage_test.go",
         "library_test.go",
         "project_json_test.go",
         "rust_test.go",
+        "source_provider_test.go",
         "test_test.go",
     ],
     pluginFor: ["soong_build"],
diff --git a/rust/androidmk.go b/rust/androidmk.go
index aea899b..5806017 100644
--- a/rust/androidmk.go
+++ b/rust/androidmk.go
@@ -76,8 +76,12 @@
 		},
 	}
 
-	mod.subAndroidMk(&ret, mod.compiler)
-
+	if mod.compiler != nil && !mod.compiler.Disabled() {
+		mod.subAndroidMk(&ret, mod.compiler)
+	} else if mod.sourceProvider != nil {
+		// If the compiler is disabled, this is a SourceProvider.
+		mod.subAndroidMk(&ret, mod.sourceProvider)
+	}
 	ret.SubName += mod.Properties.SubName
 
 	return ret
@@ -155,6 +159,26 @@
 
 }
 
+func (sourceProvider *baseSourceProvider) AndroidMk(ctx AndroidMkContext, ret *android.AndroidMkData) {
+	outFile := sourceProvider.outputFile
+	ret.Class = "ETC"
+	ret.OutputFile = android.OptionalPathForPath(outFile)
+	ret.SubName += sourceProvider.subName
+	ret.Extra = append(ret.Extra, func(w io.Writer, outputFile android.Path) {
+		_, file := filepath.Split(outFile.String())
+		stem, suffix, _ := android.SplitFileExt(file)
+		fmt.Fprintln(w, "LOCAL_MODULE_SUFFIX := "+suffix)
+		fmt.Fprintln(w, "LOCAL_MODULE_STEM := "+stem)
+	})
+}
+
+func (bindgen *bindgenDecorator) AndroidMk(ctx AndroidMkContext, ret *android.AndroidMkData) {
+	ctx.subAndroidMk(ret, bindgen.baseSourceProvider)
+	ret.Extra = append(ret.Extra, func(w io.Writer, outputFile android.Path) {
+		fmt.Fprintln(w, "LOCAL_UNINSTALLABLE_MODULE := true")
+	})
+}
+
 func (compiler *baseCompiler) AndroidMk(ctx AndroidMkContext, ret *android.AndroidMkData) {
 	// Soong installation is only supported for host modules. Have Make
 	// installation trigger Soong installation.
diff --git a/rust/binary.go b/rust/binary.go
index a1cd410..1a82c92 100644
--- a/rust/binary.go
+++ b/rust/binary.go
@@ -86,7 +86,7 @@
 	deps = binary.baseCompiler.compilerDeps(ctx, deps)
 
 	if ctx.toolchain().Bionic() {
-		deps = binary.baseCompiler.bionicDeps(ctx, deps)
+		deps = bionicDeps(deps)
 		deps.CrtBegin = "crtbegin_dynamic"
 		deps.CrtEnd = "crtend_android"
 	}
@@ -106,7 +106,7 @@
 func (binary *binaryDecorator) compile(ctx ModuleContext, flags Flags, deps PathDeps) android.Path {
 	fileName := binary.getStem(ctx) + ctx.toolchain().ExecutableSuffix()
 
-	srcPath := srcPathFromModuleSrcs(ctx, binary.baseCompiler.Properties.Srcs)
+	srcPath, _ := srcPathFromModuleSrcs(ctx, binary.baseCompiler.Properties.Srcs)
 
 	outputFile := android.PathForModuleOut(ctx, fileName)
 	binary.unstrippedOutputFile = outputFile
diff --git a/rust/bindgen.go b/rust/bindgen.go
new file mode 100644
index 0000000..2224a9c
--- /dev/null
+++ b/rust/bindgen.go
@@ -0,0 +1,212 @@
+// Copyright 2020 The Android Open Source Project
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//     http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+package rust
+
+import (
+	"strings"
+
+	"github.com/google/blueprint"
+
+	"android/soong/android"
+	ccConfig "android/soong/cc/config"
+)
+
+var (
+	defaultBindgenFlags = []string{""}
+
+	// bindgen should specify its own Clang revision so updating Clang isn't potentially blocked on bindgen failures.
+	bindgenClangVersion  = "clang-r383902c"
+	bindgenLibClangSoGit = "11git"
+
+	//TODO(b/160803703) Use a prebuilt bindgen instead of the built bindgen.
+	_ = pctx.SourcePathVariable("bindgenCmd", "out/host/${config.HostPrebuiltTag}/bin/bindgen")
+	_ = pctx.SourcePathVariable("bindgenClang",
+		"${ccConfig.ClangBase}/${config.HostPrebuiltTag}/"+bindgenClangVersion+"/bin/clang")
+	_ = pctx.SourcePathVariable("bindgenLibClang",
+		"${ccConfig.ClangBase}/${config.HostPrebuiltTag}/"+bindgenClangVersion+"/lib64/libclang.so."+bindgenLibClangSoGit)
+
+	//TODO(ivanlozano) Switch this to RuleBuilder
+	bindgen = pctx.AndroidStaticRule("bindgen",
+		blueprint.RuleParams{
+			Command: "CLANG_PATH=$bindgenClang LIBCLANG_PATH=$bindgenLibClang RUSTFMT=${config.RustBin}/rustfmt " +
+				"$cmd $flags $in -o $out -- -MD -MF $out.d $cflags",
+			CommandDeps: []string{"$cmd"},
+			Deps:        blueprint.DepsGCC,
+			Depfile:     "$out.d",
+		},
+		"cmd", "flags", "cflags")
+)
+
+func init() {
+	android.RegisterModuleType("rust_bindgen", RustBindgenFactory)
+	android.RegisterModuleType("rust_bindgen_host", RustBindgenHostFactory)
+}
+
+var _ SourceProvider = (*bindgenDecorator)(nil)
+
+type BindgenProperties struct {
+	// The wrapper header file
+	Wrapper_src *string `android:"path,arch_variant"`
+
+	// list of bindgen-specific flags and options
+	Bindgen_flags []string `android:"arch_variant"`
+
+	// list of clang flags required to correctly interpret the headers.
+	Cflags []string `android:"arch_variant"`
+
+	// list of directories relative to the Blueprints file that will
+	// be added to the include path using -I
+	Local_include_dirs []string `android:"arch_variant,variant_prepend"`
+
+	// list of static libraries that provide headers for this binding.
+	Static_libs []string `android:"arch_variant,variant_prepend"`
+
+	// list of shared libraries that provide headers for this binding.
+	Shared_libs []string `android:"arch_variant"`
+
+	// module name of a custom binary/script which should be used instead of the 'bindgen' binary. This custom
+	// binary must expect arguments in a similar fashion to bindgen, e.g.
+	//
+	// "my_bindgen [flags] wrapper_header.h -o [output_path] -- [clang flags]"
+	Custom_bindgen string `android:"path"`
+
+	//TODO(b/161141999) Add support for headers from cc_library_header modules.
+}
+
+type bindgenDecorator struct {
+	*baseSourceProvider
+
+	Properties BindgenProperties
+}
+
+func (b *bindgenDecorator) generateSource(ctx android.ModuleContext, deps PathDeps) android.Path {
+	ccToolchain := ccConfig.FindToolchain(ctx.Os(), ctx.Arch())
+
+	var cflags []string
+	var implicits android.Paths
+
+	implicits = append(implicits, deps.depIncludePaths...)
+	implicits = append(implicits, deps.depSystemIncludePaths...)
+
+	// Default clang flags
+	cflags = append(cflags, "${ccConfig.CommonClangGlobalCflags}")
+	if ctx.Device() {
+		cflags = append(cflags, "${ccConfig.DeviceClangGlobalCflags}")
+	}
+
+	// Toolchain clang flags
+	cflags = append(cflags, "-target "+ccToolchain.ClangTriple())
+	cflags = append(cflags, strings.ReplaceAll(ccToolchain.ToolchainClangCflags(), "${config.", "${ccConfig."))
+
+	// Dependency clang flags and include paths
+	cflags = append(cflags, deps.depClangFlags...)
+	for _, include := range deps.depIncludePaths {
+		cflags = append(cflags, "-I"+include.String())
+	}
+	for _, include := range deps.depSystemIncludePaths {
+		cflags = append(cflags, "-isystem "+include.String())
+	}
+
+	// Module defined clang flags and include paths
+	cflags = append(cflags, b.Properties.Cflags...)
+	for _, include := range b.Properties.Local_include_dirs {
+		cflags = append(cflags, "-I"+android.PathForModuleSrc(ctx, include).String())
+		implicits = append(implicits, android.PathForModuleSrc(ctx, include))
+	}
+
+	bindgenFlags := defaultBindgenFlags
+	bindgenFlags = append(bindgenFlags, strings.Join(b.Properties.Bindgen_flags, " "))
+
+	wrapperFile := android.OptionalPathForModuleSrc(ctx, b.Properties.Wrapper_src)
+	if !wrapperFile.Valid() {
+		ctx.PropertyErrorf("wrapper_src", "invalid path to wrapper source")
+	}
+
+	outputFile := android.PathForModuleOut(ctx, b.baseSourceProvider.getStem(ctx)+".rs")
+
+	var cmd, cmdDesc string
+	if b.Properties.Custom_bindgen != "" {
+		cmd = ctx.GetDirectDepWithTag(b.Properties.Custom_bindgen, customBindgenDepTag).(*Module).HostToolPath().String()
+		cmdDesc = b.Properties.Custom_bindgen
+	} else {
+		cmd = "$bindgenCmd"
+		cmdDesc = "bindgen"
+	}
+
+	ctx.Build(pctx, android.BuildParams{
+		Rule:        bindgen,
+		Description: strings.Join([]string{cmdDesc, wrapperFile.Path().Rel()}, " "),
+		Output:      outputFile,
+		Input:       wrapperFile.Path(),
+		Implicits:   implicits,
+		Args: map[string]string{
+			"cmd":    cmd,
+			"flags":  strings.Join(bindgenFlags, " "),
+			"cflags": strings.Join(cflags, " "),
+		},
+	})
+
+	b.baseSourceProvider.outputFile = outputFile
+	return outputFile
+}
+
+func (b *bindgenDecorator) sourceProviderProps() []interface{} {
+	return append(b.baseSourceProvider.sourceProviderProps(),
+		&b.Properties)
+}
+
+// rust_bindgen generates Rust FFI bindings to C libraries using bindgen given a wrapper header as the primary input.
+// Bindgen has a number of flags to control the generated source, and additional flags can be passed to clang to ensure
+// the header and generated source is appropriately handled.
+func RustBindgenFactory() android.Module {
+	module, _ := NewRustBindgen(android.HostAndDeviceSupported)
+	return module.Init()
+}
+
+func RustBindgenHostFactory() android.Module {
+	module, _ := NewRustBindgen(android.HostSupported)
+	return module.Init()
+}
+
+func NewRustBindgen(hod android.HostOrDeviceSupported) (*Module, *bindgenDecorator) {
+	module := newModule(hod, android.MultilibBoth)
+
+	bindgen := &bindgenDecorator{
+		baseSourceProvider: NewSourceProvider(),
+		Properties:         BindgenProperties{},
+	}
+
+	_, library := NewRustLibrary(hod)
+	library.BuildOnlyRust()
+	library.setNoLint()
+	library.sourceProvider = bindgen
+
+	module.sourceProvider = bindgen
+	module.compiler = library
+	module.setClippy(false)
+
+	return module, bindgen
+}
+
+func (b *bindgenDecorator) sourceProviderDeps(ctx DepsContext, deps Deps) Deps {
+	deps = b.baseSourceProvider.sourceProviderDeps(ctx, deps)
+	if ctx.toolchain().Bionic() {
+		deps = bionicDeps(deps)
+	}
+
+	deps.SharedLibs = append(deps.SharedLibs, b.Properties.Shared_libs...)
+	deps.StaticLibs = append(deps.StaticLibs, b.Properties.Static_libs...)
+	return deps
+}
diff --git a/rust/bindgen_test.go b/rust/bindgen_test.go
new file mode 100644
index 0000000..0b529ca
--- /dev/null
+++ b/rust/bindgen_test.go
@@ -0,0 +1,83 @@
+// Copyright 2020 The Android Open Source Project
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//     http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+package rust
+
+import (
+	"strings"
+	"testing"
+)
+
+func TestRustBindgen(t *testing.T) {
+	ctx := testRust(t, `
+		rust_bindgen {
+			name: "libbindgen",
+			wrapper_src: "src/any.h",
+			crate_name: "bindgen",
+			stem: "libbindgen",
+			source_stem: "bindings",
+			bindgen_flags: ["--bindgen-flag"],
+			cflags: ["--clang-flag"],
+			shared_libs: ["libfoo_shared"],
+			static_libs: ["libfoo_static"],
+		}
+		cc_library_shared {
+			name: "libfoo_shared",
+			export_include_dirs: ["shared_include"],
+		}
+		cc_library_static {
+			name: "libfoo_static",
+			export_include_dirs: ["static_include"],
+		}
+	`)
+	libbindgen := ctx.ModuleForTests("libbindgen", "android_arm64_armv8-a").Output("bindings.rs")
+	if !strings.Contains(libbindgen.Args["flags"], "--bindgen-flag") {
+		t.Errorf("missing bindgen flags in rust_bindgen rule: flags %#v", libbindgen.Args["flags"])
+	}
+	if !strings.Contains(libbindgen.Args["cflags"], "--clang-flag") {
+		t.Errorf("missing clang cflags in rust_bindgen rule: cflags %#v", libbindgen.Args["cflags"])
+	}
+	if !strings.Contains(libbindgen.Args["cflags"], "-Ishared_include") {
+		t.Errorf("missing shared_libs exported includes in rust_bindgen rule: cflags %#v", libbindgen.Args["cflags"])
+	}
+	if !strings.Contains(libbindgen.Args["cflags"], "-Istatic_include") {
+		t.Errorf("missing static_libs exported includes in rust_bindgen rule: cflags %#v", libbindgen.Args["cflags"])
+	}
+}
+
+func TestRustBindgenCustomBindgen(t *testing.T) {
+	ctx := testRust(t, `
+		rust_bindgen {
+			name: "libbindgen",
+			wrapper_src: "src/any.h",
+			crate_name: "bindgen",
+			stem: "libbindgen",
+			source_stem: "bindings",
+			custom_bindgen: "my_bindgen"
+		}
+		rust_binary_host {
+			name: "my_bindgen",
+			srcs: ["foo.rs"],
+		}
+	`)
+
+	libbindgen := ctx.ModuleForTests("libbindgen", "android_arm64_armv8-a").Output("bindings.rs")
+
+	// The rule description should contain the custom binary name rather than bindgen, so checking the description
+	// should be sufficient.
+	if !strings.Contains(libbindgen.Description, "my_bindgen") {
+		t.Errorf("Custom bindgen binary %s not used for libbindgen: rule description %#v", "my_bindgen",
+			libbindgen.Description)
+	}
+}
diff --git a/rust/builder.go b/rust/builder.go
index 16d7306..45cd268 100644
--- a/rust/builder.go
+++ b/rust/builder.go
@@ -28,7 +28,7 @@
 	_     = pctx.SourcePathVariable("rustcCmd", "${config.RustBin}/rustc")
 	rustc = pctx.AndroidStaticRule("rustc",
 		blueprint.RuleParams{
-			Command: "$rustcCmd " +
+			Command: "$envVars $rustcCmd " +
 				"-C linker=${config.RustLinker} " +
 				"-C link-args=\"${crtBegin} ${config.RustLinkerArgs} ${linkFlags} ${crtEnd}\" " +
 				"--emit link -o $out --emit dep-info=$out.d $in ${libFlags} $rustcFlags",
@@ -37,19 +37,19 @@
 			Deps:    blueprint.DepsGCC,
 			Depfile: "$out.d",
 		},
-		"rustcFlags", "linkFlags", "libFlags", "crtBegin", "crtEnd")
+		"rustcFlags", "linkFlags", "libFlags", "crtBegin", "crtEnd", "envVars")
 
 	_            = pctx.SourcePathVariable("clippyCmd", "${config.RustBin}/clippy-driver")
 	clippyDriver = pctx.AndroidStaticRule("clippy",
 		blueprint.RuleParams{
-			Command: "$clippyCmd " +
+			Command: "$envVars $clippyCmd " +
 				// Because clippy-driver uses rustc as backend, we need to have some output even during the linting.
 				// Use the metadata output as it has the smallest footprint.
 				"--emit metadata -o $out $in ${libFlags} " +
 				"$rustcFlags $clippyFlags",
 			CommandDeps: []string{"$clippyCmd"},
 		},
-		"rustcFlags", "libFlags", "clippyFlags")
+		"rustcFlags", "libFlags", "clippyFlags", "envVars")
 
 	zip = pctx.AndroidStaticRule("zip",
 		blueprint.RuleParams{
@@ -58,6 +58,14 @@
 			Rspfile:        "$out.rsp",
 			RspfileContent: "$in",
 		})
+
+	cp = pctx.AndroidStaticRule("cp",
+		blueprint.RuleParams{
+			Command:        "cp `cat $outDir.rsp` $outDir",
+			Rspfile:        "${outDir}.rsp",
+			RspfileContent: "$in",
+		},
+		"outDir")
 )
 
 type buildOutput struct {
@@ -116,6 +124,7 @@
 
 	var inputs android.Paths
 	var implicits android.Paths
+	var envVars []string
 	var output buildOutput
 	var libFlags, rustcFlags, linkFlags []string
 	var implicitOutputs android.WritablePaths
@@ -166,6 +175,7 @@
 	implicits = append(implicits, rustLibsToPaths(deps.ProcMacros)...)
 	implicits = append(implicits, deps.StaticLibs...)
 	implicits = append(implicits, deps.SharedLibs...)
+
 	if deps.CrtBegin.Valid() {
 		implicits = append(implicits, deps.CrtBegin.Path(), deps.CrtEnd.Path())
 	}
@@ -189,6 +199,32 @@
 		output.coverageFile = gcnoFile
 	}
 
+	if len(deps.SrcDeps) > 0 {
+		genSubDir := "out/"
+		moduleGenDir := android.PathForModuleOut(ctx, genSubDir)
+		var outputs android.WritablePaths
+
+		for _, genSrc := range deps.SrcDeps {
+			if android.SuffixInList(outputs.Strings(), genSubDir+genSrc.Base()) {
+				ctx.PropertyErrorf("srcs",
+					"multiple source providers generate the same filename output: "+genSrc.Base())
+			}
+			outputs = append(outputs, android.PathForModuleOut(ctx, genSubDir+genSrc.Base()))
+		}
+
+		ctx.Build(pctx, android.BuildParams{
+			Rule:        cp,
+			Description: "cp " + moduleGenDir.Rel(),
+			Outputs:     outputs,
+			Inputs:      deps.SrcDeps,
+			Args: map[string]string{
+				"outDir": moduleGenDir.String(),
+			},
+		})
+		implicits = append(implicits, outputs.Paths()...)
+		envVars = append(envVars, "OUT_DIR=$$PWD/"+moduleGenDir.String())
+	}
+
 	if flags.Clippy {
 		clippyFile := android.PathForModuleOut(ctx, outputFile.Base()+".clippy")
 		ctx.Build(pctx, android.BuildParams{
@@ -202,6 +238,7 @@
 				"rustcFlags":  strings.Join(rustcFlags, " "),
 				"libFlags":    strings.Join(libFlags, " "),
 				"clippyFlags": strings.Join(flags.ClippyFlags, " "),
+				"envVars":     strings.Join(envVars, " "),
 			},
 		})
 		// Declare the clippy build as an implicit dependency of the original crate.
@@ -221,6 +258,7 @@
 			"libFlags":   strings.Join(libFlags, " "),
 			"crtBegin":   deps.CrtBegin.String(),
 			"crtEnd":     deps.CrtEnd.String(),
+			"envVars":    strings.Join(envVars, " "),
 		},
 	})
 
diff --git a/rust/builder_test.go b/rust/builder_test.go
new file mode 100644
index 0000000..5c11cb7
--- /dev/null
+++ b/rust/builder_test.go
@@ -0,0 +1,42 @@
+// Copyright 2020 The Android Open Source Project
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//     http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+package rust
+
+import "testing"
+
+func TestSourceProviderCollision(t *testing.T) {
+	testRustError(t, "multiple source providers generate the same filename output: bindings.rs", `
+		rust_binary {
+			name: "source_collider",
+			srcs: [
+				"foo.rs",
+				":libbindings1",
+				":libbindings2",
+			],
+		}
+		rust_bindgen {
+			name: "libbindings1",
+			source_stem: "bindings",
+			crate_name: "bindings1",
+			wrapper_src: "src/any.h",
+		}
+		rust_bindgen {
+			name: "libbindings2",
+			source_stem: "bindings",
+			crate_name: "bindings2",
+			wrapper_src: "src/any.h",
+		}
+	`)
+}
diff --git a/rust/compiler.go b/rust/compiler.go
index 92a3b07..0274015 100644
--- a/rust/compiler.go
+++ b/rust/compiler.go
@@ -24,7 +24,7 @@
 	"android/soong/rust/config"
 )
 
-func getEdition(compiler *baseCompiler) string {
+func (compiler *baseCompiler) edition() string {
 	return proptools.StringDefault(compiler.Properties.Edition, config.DefaultEdition)
 }
 
@@ -32,6 +32,10 @@
 	compiler.Properties.No_stdlibs = proptools.BoolPtr(true)
 }
 
+func (compiler *baseCompiler) setNoLint() {
+	compiler.Properties.No_lint = proptools.BoolPtr(true)
+}
+
 func NewBaseCompiler(dir, dir64 string, location installLocation) *baseCompiler {
 	return &baseCompiler{
 		Properties: BaseCompilerProperties{},
@@ -46,6 +50,8 @@
 const (
 	InstallInSystem installLocation = 0
 	InstallInData                   = iota
+
+	incorrectSourcesError = "srcs can only contain one path for a rust file and source providers prefixed by \":\""
 )
 
 type BaseCompilerProperties struct {
@@ -79,7 +85,10 @@
 	// list of C static library dependencies
 	Static_libs []string `android:"arch_variant"`
 
-	// crate name, required for libraries. This must be the expected extern crate name used in source
+	// crate name, required for modules which produce Rust libraries: rust_library, rust_ffi and SourceProvider
+	// modules which create library variants (rust_bindgen). This must be the expected extern crate name used in
+	// source, and is required to conform to an enforced format matching library output files (if the output file is
+	// lib<someName><suffix>, the crate_name property must be <someName>).
 	Crate_name string `android:"arch_variant"`
 
 	// list of features to enable for this crate
@@ -118,6 +127,14 @@
 	distFile              android.OptionalPath
 }
 
+func (compiler *baseCompiler) Disabled() bool {
+	return false
+}
+
+func (compiler *baseCompiler) SetDisabled() {
+	panic("baseCompiler does not implement SetDisabled()")
+}
+
 func (compiler *baseCompiler) coverageOutputZipPath() android.OptionalPath {
 	panic("baseCompiler does not implement coverageOutputZipPath()")
 }
@@ -147,7 +164,7 @@
 	}
 	flags.RustFlags = append(flags.RustFlags, compiler.Properties.Flags...)
 	flags.RustFlags = append(flags.RustFlags, compiler.featuresToFlags(compiler.Properties.Features)...)
-	flags.RustFlags = append(flags.RustFlags, "--edition="+getEdition(compiler))
+	flags.RustFlags = append(flags.RustFlags, "--edition="+compiler.edition())
 	flags.LinkFlags = append(flags.LinkFlags, compiler.Properties.Ld_flags...)
 	flags.GlobalRustFlags = append(flags.GlobalRustFlags, config.GlobalRustFlags...)
 	flags.GlobalRustFlags = append(flags.GlobalRustFlags, ctx.toolchain().ToolchainRustFlags())
@@ -197,7 +214,7 @@
 	return deps
 }
 
-func (compiler *baseCompiler) bionicDeps(ctx DepsContext, deps Deps) Deps {
+func bionicDeps(deps Deps) Deps {
 	deps.SharedLibs = append(deps.SharedLibs, "liblog")
 	deps.SharedLibs = append(deps.SharedLibs, "libc")
 	deps.SharedLibs = append(deps.SharedLibs, "libm")
@@ -253,10 +270,25 @@
 	return String(compiler.Properties.Relative_install_path)
 }
 
-func srcPathFromModuleSrcs(ctx ModuleContext, srcs []string) android.Path {
-	srcPaths := android.PathsForModuleSrc(ctx, srcs)
-	if len(srcPaths) != 1 {
-		ctx.PropertyErrorf("srcs", "srcs can only contain one path for rust modules")
+// Returns the Path for the main source file along with Paths for generated source files from modules listed in srcs.
+func srcPathFromModuleSrcs(ctx ModuleContext, srcs []string) (android.Path, android.Paths) {
+	// The srcs can contain strings with prefix ":".
+	// They are dependent modules of this module, with android.SourceDepTag.
+	// They are not the main source file compiled by rustc.
+	numSrcs := 0
+	srcIndex := 0
+	for i, s := range srcs {
+		if android.SrcIsModule(s) == "" {
+			numSrcs++
+			srcIndex = i
+		}
 	}
-	return srcPaths[0]
+	if numSrcs != 1 {
+		ctx.PropertyErrorf("srcs", incorrectSourcesError)
+	}
+	if srcIndex != 0 {
+		ctx.PropertyErrorf("srcs", "main source file must be the first in srcs")
+	}
+	paths := android.PathsForModuleSrc(ctx, srcs)
+	return paths[srcIndex], paths[1:]
 }
diff --git a/rust/compiler_test.go b/rust/compiler_test.go
index bcde757..b853196 100644
--- a/rust/compiler_test.go
+++ b/rust/compiler_test.go
@@ -43,7 +43,7 @@
 // Test that we reject multiple source files.
 func TestEnforceSingleSourceFile(t *testing.T) {
 
-	singleSrcError := "srcs can only contain one path for rust modules"
+	singleSrcError := "srcs can only contain one path for a rust file and source providers prefixed by \":\""
 
 	// Test libraries
 	testRustError(t, singleSrcError, `
diff --git a/rust/config/allowed_list.go b/rust/config/allowed_list.go
index 0204cd2..9c9a136 100644
--- a/rust/config/allowed_list.go
+++ b/rust/config/allowed_list.go
@@ -7,6 +7,7 @@
 		"external/crosvm",
 		"external/adhd",
 		"prebuilts/rust",
+		"system/security",
 	}
 
 	RustModuleTypes = []string{
diff --git a/rust/config/global.go b/rust/config/global.go
index e1b1775..2020f46 100644
--- a/rust/config/global.go
+++ b/rust/config/global.go
@@ -54,6 +54,9 @@
 		"-Wl,--pack-dyn-relocs=android+relr",
 		"-Wl,--no-undefined",
 		"-Wl,--hash-style=gnu",
+
+		"-B${ccConfig.ClangBin}",
+		"-fuse-ld=lld",
 	}
 )
 
@@ -80,7 +83,7 @@
 
 	pctx.ImportAs("ccConfig", "android/soong/cc/config")
 	pctx.StaticVariable("RustLinker", "${ccConfig.ClangBin}/clang++")
-	pctx.StaticVariable("RustLinkerArgs", "-B ${ccConfig.ClangBin} -fuse-ld=lld")
+	pctx.StaticVariable("RustLinkerArgs", "")
 
 	pctx.StaticVariable("DeviceGlobalLinkFlags", strings.Join(deviceGlobalLinkFlags, " "))
 
diff --git a/rust/config/x86_darwin_host.go b/rust/config/x86_darwin_host.go
index 4c16693..4104400 100644
--- a/rust/config/x86_darwin_host.go
+++ b/rust/config/x86_darwin_host.go
@@ -21,8 +21,10 @@
 )
 
 var (
-	DarwinRustFlags      = []string{}
-	DarwinRustLinkFlags  = []string{}
+	DarwinRustFlags     = []string{}
+	DarwinRustLinkFlags = []string{
+		"-B${ccConfig.MacToolPath}",
+	}
 	darwinX8664Rustflags = []string{}
 	darwinX8664Linkflags = []string{}
 )
@@ -66,6 +68,10 @@
 	return ".dylib"
 }
 
+func (t *toolchainDarwin) DylibSuffix() string {
+	return ".rustlib.dylib"
+}
+
 func (t *toolchainDarwin) ProcMacroSuffix() string {
 	return ".dylib"
 }
diff --git a/rust/config/x86_linux_host.go b/rust/config/x86_linux_host.go
index 5376e5b..acc99e1 100644
--- a/rust/config/x86_linux_host.go
+++ b/rust/config/x86_linux_host.go
@@ -21,8 +21,11 @@
 )
 
 var (
-	LinuxRustFlags      = []string{}
-	LinuxRustLinkFlags  = []string{}
+	LinuxRustFlags     = []string{}
+	LinuxRustLinkFlags = []string{
+		"-B${ccConfig.ClangBin}",
+		"-fuse-ld=lld",
+	}
 	linuxX86Rustflags   = []string{}
 	linuxX86Linkflags   = []string{}
 	linuxX8664Rustflags = []string{}
diff --git a/rust/library.go b/rust/library.go
index 8b8e797..6766d61 100644
--- a/rust/library.go
+++ b/rust/library.go
@@ -69,6 +69,10 @@
 	VariantIsShared bool `blueprint:"mutated"`
 	// This variant is a static library
 	VariantIsStatic bool `blueprint:"mutated"`
+
+	// This variant is disabled and should not be compiled
+	// (used for SourceProvider variants that produce only source)
+	VariantIsDisabled bool `blueprint:"mutated"`
 }
 
 type libraryDecorator struct {
@@ -78,6 +82,7 @@
 	Properties        LibraryCompilerProperties
 	MutatedProperties LibraryMutatedProperties
 	includeDirs       android.Paths
+	sourceProvider    SourceProvider
 }
 
 type libraryInterface interface {
@@ -340,7 +345,7 @@
 	deps = library.baseCompiler.compilerDeps(ctx, deps)
 
 	if ctx.toolchain().Bionic() && (library.dylib() || library.shared()) {
-		deps = library.baseCompiler.bionicDeps(ctx, deps)
+		deps = bionicDeps(deps)
 		deps.CrtBegin = "crtbegin_so"
 		deps.CrtEnd = "crtend_so"
 	}
@@ -367,8 +372,13 @@
 
 func (library *libraryDecorator) compile(ctx ModuleContext, flags Flags, deps PathDeps) android.Path {
 	var outputFile android.WritablePath
+	var srcPath android.Path
 
-	srcPath := srcPathFromModuleSrcs(ctx, library.baseCompiler.Properties.Srcs)
+	if library.sourceProvider != nil {
+		srcPath = library.sourceProvider.Srcs()[0]
+	} else {
+		srcPath, _ = srcPathFromModuleSrcs(ctx, library.baseCompiler.Properties.Srcs)
+	}
 
 	flags.RustFlags = append(flags.RustFlags, deps.depFlags...)
 
@@ -430,6 +440,14 @@
 	return stem + String(library.baseCompiler.Properties.Suffix)
 }
 
+func (library *libraryDecorator) Disabled() bool {
+	return library.MutatedProperties.VariantIsDisabled
+}
+
+func (library *libraryDecorator) SetDisabled() {
+	library.MutatedProperties.VariantIsDisabled = true
+}
+
 var validCrateName = regexp.MustCompile("[^a-zA-Z0-9_]+")
 
 func validateLibraryStem(ctx BaseModuleContext, filename string, crate_name string) {
@@ -454,25 +472,35 @@
 	if m, ok := mctx.Module().(*Module); ok && m.compiler != nil {
 		switch library := m.compiler.(type) {
 		case libraryInterface:
-
-			// We only build the rust library variants here. This assumes that
-			// LinkageMutator runs first and there's an empty variant
-			// if rust variants are required.
-			if !library.static() && !library.shared() {
-				if library.buildRlib() && library.buildDylib() {
-					modules := mctx.CreateLocalVariations("rlib", "dylib")
-					rlib := modules[0].(*Module)
-					dylib := modules[1].(*Module)
-
-					rlib.compiler.(libraryInterface).setRlib()
-					dylib.compiler.(libraryInterface).setDylib()
-				} else if library.buildRlib() {
-					modules := mctx.CreateLocalVariations("rlib")
-					modules[0].(*Module).compiler.(libraryInterface).setRlib()
-				} else if library.buildDylib() {
-					modules := mctx.CreateLocalVariations("dylib")
-					modules[0].(*Module).compiler.(libraryInterface).setDylib()
+			if library.buildRlib() && library.buildDylib() {
+				variants := []string{"rlib", "dylib"}
+				if m.sourceProvider != nil {
+					variants = append(variants, "")
 				}
+				modules := mctx.CreateLocalVariations(variants...)
+
+				rlib := modules[0].(*Module)
+				dylib := modules[1].(*Module)
+				rlib.compiler.(libraryInterface).setRlib()
+				dylib.compiler.(libraryInterface).setDylib()
+
+				if m.sourceProvider != nil {
+					// This library is SourceProvider generated, so the non-library-producing
+					// variant needs to disable it's compiler and skip installation.
+					sourceProvider := modules[2].(*Module)
+					sourceProvider.compiler.SetDisabled()
+				}
+			} else if library.buildRlib() {
+				modules := mctx.CreateLocalVariations("rlib")
+				modules[0].(*Module).compiler.(libraryInterface).setRlib()
+			} else if library.buildDylib() {
+				modules := mctx.CreateLocalVariations("dylib")
+				modules[0].(*Module).compiler.(libraryInterface).setDylib()
+			}
+
+			if m.sourceProvider != nil {
+				// Alias the non-library variant to the empty-string variant.
+				mctx.AliasVariation("")
 			}
 		}
 	}
diff --git a/rust/prebuilt.go b/rust/prebuilt.go
index 67d649d..3d081c1 100644
--- a/rust/prebuilt.go
+++ b/rust/prebuilt.go
@@ -95,7 +95,10 @@
 func (prebuilt *prebuiltLibraryDecorator) compile(ctx ModuleContext, flags Flags, deps PathDeps) android.Path {
 	prebuilt.exportLinkDirs(android.PathsForModuleSrc(ctx, prebuilt.Properties.Link_dirs).Strings()...)
 
-	srcPath := srcPathFromModuleSrcs(ctx, prebuilt.prebuiltSrcs())
+	srcPath, paths := srcPathFromModuleSrcs(ctx, prebuilt.prebuiltSrcs())
+	if len(paths) > 0 {
+		ctx.PropertyErrorf("srcs", "prebuilt libraries can only have one entry in srcs (the prebuilt path)")
+	}
 
 	prebuilt.unstrippedOutputFile = srcPath
 
diff --git a/rust/proc_macro.go b/rust/proc_macro.go
index 2719161..3dd2521 100644
--- a/rust/proc_macro.go
+++ b/rust/proc_macro.go
@@ -65,7 +65,7 @@
 	fileName := procMacro.getStem(ctx) + ctx.toolchain().ProcMacroSuffix()
 	outputFile := android.PathForModuleOut(ctx, fileName)
 
-	srcPath := srcPathFromModuleSrcs(ctx, procMacro.baseCompiler.Properties.Srcs)
+	srcPath, _ := srcPathFromModuleSrcs(ctx, procMacro.baseCompiler.Properties.Srcs)
 
 	procMacro.unstrippedOutputFile = outputFile
 
diff --git a/rust/project_json.go b/rust/project_json.go
index a50e73a..41dd194 100644
--- a/rust/project_json.go
+++ b/rust/project_json.go
@@ -92,7 +92,7 @@
 // appendLibraryAndDeps creates a rustProjectCrate for the module argument and
 // appends it to the rustProjectJson struct.  It visits the dependencies of the
 // module depth-first. If the current module is already in knownCrates, its
-// its dependencies are merged. Returns a tuple (id, crate_name, ok).
+// dependencies are merged. Returns a tuple (id, crate_name, ok).
 func appendLibraryAndDeps(ctx android.SingletonContext, project *rustProjectJson,
 	knownCrates map[string]crateInfo, module android.Module) (int, string, bool) {
 	rModule, ok := module.(*Module)
@@ -111,12 +111,13 @@
 		// We have seen this crate already; merge any new dependencies.
 		crate := project.Crates[cInfo.ID]
 		mergeDependencies(ctx, project, knownCrates, module, &crate, cInfo.Deps)
+		project.Crates[cInfo.ID] = crate
 		return cInfo.ID, crateName, true
 	}
 	crate := rustProjectCrate{Deps: make([]rustProjectDep, 0), Cfgs: make([]string, 0)}
 	src := rustLib.baseCompiler.Properties.Srcs[0]
 	crate.RootModule = path.Join(ctx.ModuleDir(rModule), src)
-	crate.Edition = getEdition(rustLib.baseCompiler)
+	crate.Edition = rustLib.baseCompiler.edition()
 
 	deps := make(map[string]int)
 	mergeDependencies(ctx, project, knownCrates, module, &crate, deps)
diff --git a/rust/rust.go b/rust/rust.go
index 72301a7..edfa5d8 100644
--- a/rust/rust.go
+++ b/rust/rust.go
@@ -42,6 +42,7 @@
 		ctx.BottomUp("rust_begin", BeginMutator).Parallel()
 	})
 	pctx.Import("android/soong/rust/config")
+	pctx.ImportAs("ccConfig", "android/soong/cc/config")
 }
 
 type Flags struct {
@@ -61,9 +62,11 @@
 	AndroidMkProcMacroLibs []string
 	AndroidMkSharedLibs    []string
 	AndroidMkStaticLibs    []string
-	SubName                string `blueprint:"mutated"`
-	PreventInstall         bool
-	HideFromMake           bool
+
+	SubName string `blueprint:"mutated"`
+
+	PreventInstall bool
+	HideFromMake   bool
 }
 
 type Module struct {
@@ -79,8 +82,27 @@
 	coverage         *coverage
 	clippy           *clippy
 	cachedToolchain  config.Toolchain
+	sourceProvider   SourceProvider
 	subAndroidMkOnce map[subAndroidMkProvider]bool
-	outputFile       android.OptionalPath
+
+	outputFile    android.OptionalPath
+	generatedFile android.OptionalPath
+}
+
+func (mod *Module) OutputFiles(tag string) (android.Paths, error) {
+	switch tag {
+	case "":
+		if mod.sourceProvider != nil {
+			return mod.sourceProvider.Srcs(), nil
+		} else {
+			if mod.outputFile.Valid() {
+				return android.Paths{mod.outputFile.Path()}, nil
+			}
+			return android.Paths{}, nil
+		}
+	default:
+		return nil, fmt.Errorf("unsupported module reference tag %q", tag)
+	}
 }
 
 var _ android.ImageInterface = (*Module)(nil)
@@ -120,12 +142,8 @@
 
 func (mod *Module) NonCcVariants() bool {
 	if mod.compiler != nil {
-		if library, ok := mod.compiler.(libraryInterface); ok {
-			if library.buildRlib() || library.buildDylib() {
-				return true
-			} else {
-				return false
-			}
+		if _, ok := mod.compiler.(libraryInterface); ok {
+			return false
 		}
 	}
 	panic(fmt.Errorf("NonCcVariants called on non-library module: %q", mod.BaseModuleName()))
@@ -141,16 +159,16 @@
 			return library.static()
 		}
 	}
-	panic(fmt.Errorf("Static called on non-library module: %q", mod.BaseModuleName()))
+	return false
 }
 
 func (mod *Module) Shared() bool {
 	if mod.compiler != nil {
 		if library, ok := mod.compiler.(libraryInterface); ok {
-			return library.static()
+			return library.shared()
 		}
 	}
-	panic(fmt.Errorf("Shared called on non-library module: %q", mod.BaseModuleName()))
+	return false
 }
 
 func (mod *Module) Toc() android.OptionalPath {
@@ -235,10 +253,18 @@
 	depFlags   []string
 	//ReexportedDeps android.Paths
 
+	// Used by bindgen modules which call clang
+	depClangFlags         []string
+	depIncludePaths       android.Paths
+	depSystemIncludePaths android.Paths
+
 	coverageFiles android.Paths
 
 	CrtBegin android.OptionalPath
 	CrtEnd   android.OptionalPath
+
+	// Paths to generated source files
+	SrcDeps android.Paths
 }
 
 type RustLibraries []RustLibrary
@@ -260,6 +286,9 @@
 	relativeInstallPath() string
 
 	nativeCoverage() bool
+
+	Disabled() bool
+	SetDisabled()
 }
 
 type exportedFlagsProducer interface {
@@ -345,6 +374,7 @@
 		&LibraryCompilerProperties{},
 		&ProcMacroCompilerProperties{},
 		&PrebuiltProperties{},
+		&SourceProviderProperties{},
 		&TestProperties{},
 		&cc.CoverageProperties{},
 		&ClippyProperties{},
@@ -369,7 +399,9 @@
 
 func (mod *Module) CcLibraryInterface() bool {
 	if mod.compiler != nil {
-		if _, ok := mod.compiler.(libraryInterface); ok {
+		// use build{Static,Shared}() instead of {static,shared}() here because this might be called before
+		// VariantIs{Static,Shared} is set.
+		if lib, ok := mod.compiler.(libraryInterface); ok && (lib.buildShared() || lib.buildStatic()) {
 			return true
 		}
 	}
@@ -504,6 +536,9 @@
 	if mod.clippy != nil {
 		mod.AddProperties(mod.clippy.props()...)
 	}
+	if mod.sourceProvider != nil {
+		mod.AddProperties(mod.sourceProvider.sourceProviderProps()...)
+	}
 
 	android.InitAndroidArchModule(mod, mod.hod, mod.multilib)
 
@@ -636,10 +671,19 @@
 		flags, deps = mod.clippy.flags(ctx, flags, deps)
 	}
 
-	if mod.compiler != nil {
+	// SourceProvider needs to call generateSource() before compiler calls compile() so it can provide the source.
+	// TODO(b/162588681) This shouldn't have to run for every variant.
+	if mod.sourceProvider != nil {
+		generatedFile := mod.sourceProvider.generateSource(ctx, deps)
+		mod.generatedFile = android.OptionalPathForPath(generatedFile)
+		mod.sourceProvider.setSubName(ctx.ModuleSubDir())
+	}
+
+	if mod.compiler != nil && !mod.compiler.Disabled() {
 		outputFile := mod.compiler.compile(ctx, flags, deps)
+
 		mod.outputFile = android.OptionalPathForPath(outputFile)
-		if !mod.Properties.PreventInstall {
+		if mod.outputFile.Valid() && !mod.Properties.PreventInstall {
 			mod.compiler.install(ctx, mod.outputFile.Path())
 		}
 	}
@@ -651,6 +695,9 @@
 	if mod.compiler != nil {
 		deps = mod.compiler.compilerDeps(ctx, deps)
 	}
+	if mod.sourceProvider != nil {
+		deps = mod.sourceProvider.sourceProviderDeps(ctx, deps)
+	}
 
 	if mod.coverage != nil {
 		deps = mod.coverage.deps(ctx, deps)
@@ -675,10 +722,11 @@
 }
 
 var (
-	rlibDepTag       = dependencyTag{name: "rlibTag", library: true}
-	dylibDepTag      = dependencyTag{name: "dylib", library: true}
-	procMacroDepTag  = dependencyTag{name: "procMacro", proc_macro: true}
-	testPerSrcDepTag = dependencyTag{name: "rust_unit_tests"}
+	customBindgenDepTag = dependencyTag{name: "customBindgenTag"}
+	rlibDepTag          = dependencyTag{name: "rlibTag", library: true}
+	dylibDepTag         = dependencyTag{name: "dylib", library: true}
+	procMacroDepTag     = dependencyTag{name: "procMacro", proc_macro: true}
+	testPerSrcDepTag    = dependencyTag{name: "rust_unit_tests"}
 )
 
 type autoDep struct {
@@ -709,18 +757,15 @@
 	directProcMacroDeps := []*Module{}
 	directSharedLibDeps := [](cc.LinkableInterface){}
 	directStaticLibDeps := [](cc.LinkableInterface){}
+	directSrcProvidersDeps := []*Module{}
+	directSrcDeps := [](android.SourceFileProducer){}
 
 	ctx.VisitDirectDeps(func(dep android.Module) {
 		depName := ctx.OtherModuleName(dep)
 		depTag := ctx.OtherModuleDependencyTag(dep)
-		if rustDep, ok := dep.(*Module); ok {
+		if rustDep, ok := dep.(*Module); ok && !rustDep.CcLibraryInterface() {
 			//Handle Rust Modules
 
-			linkFile := rustDep.outputFile
-			if !linkFile.Valid() {
-				ctx.ModuleErrorf("Invalid output file when adding dep %q to %q", depName, ctx.ModuleName())
-			}
-
 			switch depTag {
 			case dylibDepTag:
 				dylib, ok := rustDep.compiler.(libraryInterface)
@@ -742,6 +787,24 @@
 			case procMacroDepTag:
 				directProcMacroDeps = append(directProcMacroDeps, rustDep)
 				mod.Properties.AndroidMkProcMacroLibs = append(mod.Properties.AndroidMkProcMacroLibs, depName)
+			case android.SourceDepTag:
+				// Since these deps are added in path_properties.go via AddDependencies, we need to ensure the correct
+				// OS/Arch variant is used.
+				var helper string
+				if ctx.Host() {
+					helper = "missing 'host_supported'?"
+				} else {
+					helper = "device module defined?"
+				}
+
+				if dep.Target().Os != ctx.Os() {
+					ctx.ModuleErrorf("OS mismatch on dependency %q (%s)", dep.Name(), helper)
+					return
+				} else if dep.Target().Arch.ArchType != ctx.Arch().ArchType {
+					ctx.ModuleErrorf("Arch mismatch on dependency %q (%s)", dep.Name(), helper)
+					return
+				}
+				directSrcProvidersDeps = append(directSrcProvidersDeps, rustDep)
 			}
 
 			//Append the dependencies exportedDirs
@@ -751,15 +814,19 @@
 			}
 
 			if depTag == dylibDepTag || depTag == rlibDepTag || depTag == procMacroDepTag {
+				linkFile := rustDep.outputFile
+				if !linkFile.Valid() {
+					ctx.ModuleErrorf("Invalid output file when adding dep %q to %q",
+						depName, ctx.ModuleName())
+					return
+				}
 				linkDir := linkPathFromFilePath(linkFile.Path())
 				if lib, ok := mod.compiler.(exportedFlagsProducer); ok {
 					lib.exportLinkDirs(linkDir)
 				}
 			}
 
-		}
-
-		if ccDep, ok := dep.(cc.LinkableInterface); ok {
+		} else if ccDep, ok := dep.(cc.LinkableInterface); ok {
 			//Handle C dependencies
 			if _, ok := ccDep.(*Module); !ok {
 				if ccDep.Module().Target().Os != ctx.Os() {
@@ -771,7 +838,6 @@
 					return
 				}
 			}
-
 			linkFile := ccDep.OutputFile()
 			linkPath := linkPathFromFilePath(linkFile.Path())
 			libName := libNameFromFilePath(linkFile.Path())
@@ -782,24 +848,34 @@
 			}
 
 			exportDep := false
-			switch depTag {
-			case cc.StaticDepTag:
+			switch {
+			case cc.IsStaticDepTag(depTag):
 				depFlag = "-lstatic=" + libName
 				depPaths.linkDirs = append(depPaths.linkDirs, linkPath)
 				depPaths.depFlags = append(depPaths.depFlags, depFlag)
+				depPaths.depIncludePaths = append(depPaths.depIncludePaths, ccDep.IncludeDirs()...)
+				if mod, ok := ccDep.(*cc.Module); ok {
+					depPaths.depSystemIncludePaths = append(depPaths.depSystemIncludePaths, mod.ExportedSystemIncludeDirs()...)
+					depPaths.depClangFlags = append(depPaths.depClangFlags, mod.ExportedFlags()...)
+				}
 				depPaths.coverageFiles = append(depPaths.coverageFiles, ccDep.CoverageFiles()...)
 				directStaticLibDeps = append(directStaticLibDeps, ccDep)
 				mod.Properties.AndroidMkStaticLibs = append(mod.Properties.AndroidMkStaticLibs, depName)
-			case cc.SharedDepTag:
+			case cc.IsSharedDepTag(depTag):
 				depFlag = "-ldylib=" + libName
 				depPaths.linkDirs = append(depPaths.linkDirs, linkPath)
 				depPaths.depFlags = append(depPaths.depFlags, depFlag)
+				depPaths.depIncludePaths = append(depPaths.depIncludePaths, ccDep.IncludeDirs()...)
+				if mod, ok := ccDep.(*cc.Module); ok {
+					depPaths.depSystemIncludePaths = append(depPaths.depSystemIncludePaths, mod.ExportedSystemIncludeDirs()...)
+					depPaths.depClangFlags = append(depPaths.depClangFlags, mod.ExportedFlags()...)
+				}
 				directSharedLibDeps = append(directSharedLibDeps, ccDep)
 				mod.Properties.AndroidMkSharedLibs = append(mod.Properties.AndroidMkSharedLibs, depName)
 				exportDep = true
-			case cc.CrtBeginDepTag:
+			case depTag == cc.CrtBeginDepTag:
 				depPaths.CrtBegin = linkFile
-			case cc.CrtEndDepTag:
+			case depTag == cc.CrtEndDepTag:
 				depPaths.CrtEnd = linkFile
 			}
 
@@ -809,6 +885,14 @@
 				lib.exportDepFlags(depFlag)
 			}
 		}
+
+		if srcDep, ok := dep.(android.SourceFileProducer); ok {
+			switch depTag {
+			case android.SourceDepTag:
+				// These are usually genrules which don't have per-target variants.
+				directSrcDeps = append(directSrcDeps, srcDep)
+			}
+		}
 	})
 
 	var rlibDepFiles RustLibraries
@@ -834,15 +918,29 @@
 		sharedLibDepFiles = append(sharedLibDepFiles, dep.OutputFile().Path())
 	}
 
+	var srcProviderDepFiles android.Paths
+	for _, dep := range directSrcProvidersDeps {
+		srcs, _ := dep.OutputFiles("")
+		srcProviderDepFiles = append(srcProviderDepFiles, srcs...)
+	}
+	for _, dep := range directSrcDeps {
+		srcs := dep.Srcs()
+		srcProviderDepFiles = append(srcProviderDepFiles, srcs...)
+	}
+
 	depPaths.RLibs = append(depPaths.RLibs, rlibDepFiles...)
 	depPaths.DyLibs = append(depPaths.DyLibs, dylibDepFiles...)
 	depPaths.SharedLibs = append(depPaths.SharedLibs, sharedLibDepFiles...)
 	depPaths.StaticLibs = append(depPaths.StaticLibs, staticLibDepFiles...)
 	depPaths.ProcMacros = append(depPaths.ProcMacros, procMacroDepFiles...)
+	depPaths.SrcDeps = append(depPaths.SrcDeps, srcProviderDepFiles...)
 
 	// Dedup exported flags from dependencies
 	depPaths.linkDirs = android.FirstUniqueStrings(depPaths.linkDirs)
 	depPaths.depFlags = android.FirstUniqueStrings(depPaths.depFlags)
+	depPaths.depClangFlags = android.FirstUniqueStrings(depPaths.depClangFlags)
+	depPaths.depIncludePaths = android.FirstUniquePaths(depPaths.depIncludePaths)
+	depPaths.depSystemIncludePaths = android.FirstUniquePaths(depPaths.depSystemIncludePaths)
 
 	return depPaths
 }
@@ -883,30 +981,27 @@
 	}
 	actx.AddVariationDependencies(
 		append(commonDepVariations, []blueprint.Variation{
-			{Mutator: "rust_libraries", Variation: "rlib"},
-			{Mutator: "link", Variation: ""}}...),
+			{Mutator: "rust_libraries", Variation: "rlib"}}...),
 		rlibDepTag, deps.Rlibs...)
 	actx.AddVariationDependencies(
 		append(commonDepVariations, []blueprint.Variation{
-			{Mutator: "rust_libraries", Variation: "dylib"},
-			{Mutator: "link", Variation: ""}}...),
+			{Mutator: "rust_libraries", Variation: "dylib"}}...),
 		dylibDepTag, deps.Dylibs...)
 
 	if deps.Rustlibs != nil {
 		autoDep := mod.compiler.(autoDeppable).autoDep()
 		actx.AddVariationDependencies(
 			append(commonDepVariations, []blueprint.Variation{
-				{Mutator: "rust_libraries", Variation: autoDep.variation},
-				{Mutator: "link", Variation: ""}}...),
+				{Mutator: "rust_libraries", Variation: autoDep.variation}}...),
 			autoDep.depTag, deps.Rustlibs...)
 	}
 
 	actx.AddVariationDependencies(append(commonDepVariations,
 		blueprint.Variation{Mutator: "link", Variation: "shared"}),
-		cc.SharedDepTag, deps.SharedLibs...)
+		cc.SharedDepTag(), deps.SharedLibs...)
 	actx.AddVariationDependencies(append(commonDepVariations,
 		blueprint.Variation{Mutator: "link", Variation: "static"}),
-		cc.StaticDepTag, deps.StaticLibs...)
+		cc.StaticDepTag(), deps.StaticLibs...)
 
 	if deps.CrtBegin != "" {
 		actx.AddVariationDependencies(commonDepVariations, cc.CrtBeginDepTag, deps.CrtBegin)
@@ -915,6 +1010,13 @@
 		actx.AddVariationDependencies(commonDepVariations, cc.CrtEndDepTag, deps.CrtEnd)
 	}
 
+	if mod.sourceProvider != nil {
+		if bindgen, ok := mod.sourceProvider.(*bindgenDecorator); ok &&
+			bindgen.Properties.Custom_bindgen != "" {
+			actx.AddFarVariationDependencies(ctx.Config().BuildOSTarget.Variations(), customBindgenDepTag,
+				bindgen.Properties.Custom_bindgen)
+		}
+	}
 	// proc_macros are compiler plugins, and so we need the host arch variant as a dependendcy.
 	actx.AddFarVariationDependencies(ctx.Config().BuildOSTarget.Variations(), procMacroDepTag, deps.ProcMacros...)
 }
@@ -943,6 +1045,12 @@
 	return name
 }
 
+func (mod *Module) setClippy(clippy bool) {
+	if mod.clippy != nil {
+		mod.clippy.Properties.Clippy = proptools.BoolPtr(clippy)
+	}
+}
+
 var _ android.HostToolProvider = (*Module)(nil)
 
 func (mod *Module) HostToolPath() android.OptionalPath {
@@ -959,3 +1067,5 @@
 var BoolDefault = proptools.BoolDefault
 var String = proptools.String
 var StringPtr = proptools.StringPtr
+
+var _ android.OutputFileProducer = (*Module)(nil)
diff --git a/rust/rust_test.go b/rust/rust_test.go
index 08bc8ca..04de48b 100644
--- a/rust/rust_test.go
+++ b/rust/rust_test.go
@@ -61,6 +61,7 @@
 		"foo.rs":     nil,
 		"foo.c":      nil,
 		"src/bar.rs": nil,
+		"src/any.h":  nil,
 		"liby.so":    nil,
 		"libz.so":    nil,
 	}
@@ -223,6 +224,114 @@
 	}
 }
 
+func TestSourceProviderDeps(t *testing.T) {
+	ctx := testRust(t, `
+		rust_binary {
+			name: "fizz-buzz-dep",
+			srcs: [
+				"foo.rs",
+				":my_generator",
+				":libbindings",
+			],
+			rlibs: ["libbindings"],
+		}
+		rust_proc_macro {
+			name: "libprocmacro",
+			srcs: [
+				"foo.rs",
+				":my_generator",
+				":libbindings",
+			],
+			rlibs: ["libbindings"],
+			crate_name: "procmacro",
+		}
+		rust_library {
+			name: "libfoo",
+			srcs: [
+				"foo.rs",
+				":my_generator",
+				":libbindings",
+			],
+			rlibs: ["libbindings"],
+			crate_name: "foo",
+		}
+		genrule {
+			name: "my_generator",
+			tools: ["any_rust_binary"],
+			cmd: "$(location) -o $(out) $(in)",
+			srcs: ["src/any.h"],
+			out: ["src/any.rs"],
+		}
+		rust_bindgen {
+			name: "libbindings",
+			crate_name: "bindings",
+			source_stem: "bindings",
+			host_supported: true,
+			wrapper_src: "src/any.h",
+        }
+	`)
+
+	libfoo := ctx.ModuleForTests("libfoo", "android_arm64_armv8-a_rlib").Rule("rustc")
+	if !android.SuffixInList(libfoo.Implicits.Strings(), "/out/bindings.rs") {
+		t.Errorf("rust_bindgen generated source not included as implicit input for libfoo; Implicits %#v", libfoo.Implicits.Strings())
+	}
+	if !android.SuffixInList(libfoo.Implicits.Strings(), "/out/any.rs") {
+		t.Errorf("genrule generated source not included as implicit input for libfoo; Implicits %#v", libfoo.Implicits.Strings())
+	}
+
+	fizzBuzz := ctx.ModuleForTests("fizz-buzz-dep", "android_arm64_armv8-a").Rule("rustc")
+	if !android.SuffixInList(fizzBuzz.Implicits.Strings(), "/out/bindings.rs") {
+		t.Errorf("rust_bindgen generated source not included as implicit input for fizz-buzz-dep; Implicits %#v", libfoo.Implicits.Strings())
+	}
+	if !android.SuffixInList(fizzBuzz.Implicits.Strings(), "/out/any.rs") {
+		t.Errorf("genrule generated source not included as implicit input for fizz-buzz-dep; Implicits %#v", libfoo.Implicits.Strings())
+	}
+
+	libprocmacro := ctx.ModuleForTests("libprocmacro", "linux_glibc_x86_64").Rule("rustc")
+	if !android.SuffixInList(libprocmacro.Implicits.Strings(), "/out/bindings.rs") {
+		t.Errorf("rust_bindgen generated source not included as implicit input for libprocmacro; Implicits %#v", libfoo.Implicits.Strings())
+	}
+	if !android.SuffixInList(libprocmacro.Implicits.Strings(), "/out/any.rs") {
+		t.Errorf("genrule generated source not included as implicit input for libprocmacro; Implicits %#v", libfoo.Implicits.Strings())
+	}
+
+	// Check that our bindings are picked up as crate dependencies as well
+	libfooMod := ctx.ModuleForTests("libfoo", "android_arm64_armv8-a_dylib").Module().(*Module)
+	if !android.InList("libbindings", libfooMod.Properties.AndroidMkRlibs) {
+		t.Errorf("bindgen dependency not detected as a rlib dependency (dependency missing from AndroidMkRlibs)")
+	}
+	fizzBuzzMod := ctx.ModuleForTests("fizz-buzz-dep", "android_arm64_armv8-a").Module().(*Module)
+	if !android.InList("libbindings", fizzBuzzMod.Properties.AndroidMkRlibs) {
+		t.Errorf("bindgen dependency not detected as a rlib dependency (dependency missing from AndroidMkRlibs)")
+	}
+	libprocmacroMod := ctx.ModuleForTests("libprocmacro", "linux_glibc_x86_64").Module().(*Module)
+	if !android.InList("libbindings", libprocmacroMod.Properties.AndroidMkRlibs) {
+		t.Errorf("bindgen dependency not detected as a rlib dependency (dependency missing from AndroidMkRlibs)")
+	}
+
+}
+
+func TestSourceProviderTargetMismatch(t *testing.T) {
+	// This might error while building the dependency tree or when calling depsToPaths() depending on the lunched
+	// target, which results in two different errors. So don't check the error, just confirm there is one.
+	testRustError(t, ".*", `
+		rust_proc_macro {
+			name: "libprocmacro",
+			srcs: [
+				"foo.rs",
+				":libbindings",
+			],
+			crate_name: "procmacro",
+		}
+		rust_bindgen {
+			name: "libbindings",
+			crate_name: "bindings",
+			source_stem: "bindings",
+			wrapper_src: "src/any.h",
+		}
+	`)
+}
+
 // Test to make sure proc_macros use host variants when building device modules.
 func TestProcMacroDeviceDeps(t *testing.T) {
 	ctx := testRust(t, `
diff --git a/rust/source_provider.go b/rust/source_provider.go
new file mode 100644
index 0000000..503880f
--- /dev/null
+++ b/rust/source_provider.go
@@ -0,0 +1,80 @@
+// Copyright 2020 The Android Open Source Project
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//     http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+package rust
+
+import (
+	"android/soong/android"
+)
+
+type SourceProviderProperties struct {
+	// filename for the generated source file (<source_stem>.rs). This field is required.
+	// The inherited "stem" property sets the output filename for the generated library variants only.
+	Source_stem *string `android:"arch_variant"`
+
+	// crate name, used for the library variant of this source provider. See additional details in rust_library.
+	Crate_name string `android:"arch_variant"`
+}
+
+type baseSourceProvider struct {
+	Properties SourceProviderProperties
+
+	outputFile       android.Path
+	subAndroidMkOnce map[subAndroidMkProvider]bool
+	subName          string
+}
+
+var _ SourceProvider = (*baseSourceProvider)(nil)
+
+type SourceProvider interface {
+	generateSource(ctx android.ModuleContext, deps PathDeps) android.Path
+	Srcs() android.Paths
+	sourceProviderProps() []interface{}
+	sourceProviderDeps(ctx DepsContext, deps Deps) Deps
+	setSubName(subName string)
+}
+
+func (sp *baseSourceProvider) Srcs() android.Paths {
+	return android.Paths{sp.outputFile}
+}
+
+func (sp *baseSourceProvider) generateSource(ctx android.ModuleContext, deps PathDeps) android.Path {
+	panic("baseSourceProviderModule does not implement generateSource()")
+}
+
+func (sp *baseSourceProvider) sourceProviderProps() []interface{} {
+	return []interface{}{&sp.Properties}
+}
+
+func NewSourceProvider() *baseSourceProvider {
+	return &baseSourceProvider{
+		Properties: SourceProviderProperties{},
+	}
+}
+
+func (sp *baseSourceProvider) getStem(ctx android.ModuleContext) string {
+	if String(sp.Properties.Source_stem) == "" {
+		ctx.PropertyErrorf("source_stem",
+			"source_stem property is undefined but required for rust_bindgen modules")
+	}
+	return String(sp.Properties.Source_stem)
+}
+
+func (sp *baseSourceProvider) sourceProviderDeps(ctx DepsContext, deps Deps) Deps {
+	return deps
+}
+
+func (sp *baseSourceProvider) setSubName(subName string) {
+	sp.subName = subName
+}
diff --git a/rust/source_provider_test.go b/rust/source_provider_test.go
new file mode 100644
index 0000000..6e68ae6
--- /dev/null
+++ b/rust/source_provider_test.go
@@ -0,0 +1,31 @@
+// Copyright 2020 The Android Open Source Project
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//     http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+package rust
+
+import (
+	"testing"
+)
+
+var stemRequiredError = "source_stem property is undefined but required for rust_bindgen modules"
+
+func TestSourceProviderRequiredFields(t *testing.T) {
+	testRustError(t, stemRequiredError, `
+		rust_bindgen {
+			name: "libbindgen",
+			wrapper_src: "src/any.h",
+			crate_name: "bindgen",
+		}
+	`)
+}
diff --git a/rust/test.go b/rust/test.go
index e27a70c..05c361e 100644
--- a/rust/test.go
+++ b/rust/test.go
@@ -41,6 +41,9 @@
 	// doesn't exist next to the Android.bp, this attribute doesn't need to be set to true
 	// explicitly.
 	Auto_gen_config *bool
+
+	// if set, build with the standard Rust test harness. Defaults to true.
+	Test_harness *bool
 }
 
 // A test module is a binary module with extra --test compiler flag
@@ -56,6 +59,10 @@
 	return true
 }
 
+func (test *testDecorator) testHarness() bool {
+	return BoolDefault(test.Properties.Test_harness, true)
+}
+
 func NewRustTest(hod android.HostOrDeviceSupported) (*Module, *testDecorator) {
 	// Build both 32 and 64 targets for device tests.
 	// Cannot build both for host tests yet if the test depends on
@@ -101,7 +108,9 @@
 
 func (test *testDecorator) compilerFlags(ctx ModuleContext, flags Flags) Flags {
 	flags = test.binaryDecorator.compilerFlags(ctx, flags)
-	flags.RustFlags = append(flags.RustFlags, "--test")
+	if test.testHarness() {
+		flags.RustFlags = append(flags.RustFlags, "--test")
+	}
 	return flags
 }
 
diff --git a/rust/testing.go b/rust/testing.go
index 3d583e1..83b2828 100644
--- a/rust/testing.go
+++ b/rust/testing.go
@@ -17,6 +17,7 @@
 import (
 	"android/soong/android"
 	"android/soong/cc"
+	"android/soong/genrule"
 )
 
 func GatherRequiredDepsForTest() string {
@@ -76,9 +77,12 @@
 
 func CreateTestContext() *android.TestContext {
 	ctx := android.NewTestArchContext()
+	android.RegisterPrebuiltMutators(ctx)
 	cc.RegisterRequiredBuildComponentsForTest(ctx)
+	ctx.RegisterModuleType("genrule", genrule.GenRuleFactory)
 	ctx.RegisterModuleType("rust_binary", RustBinaryFactory)
 	ctx.RegisterModuleType("rust_binary_host", RustBinaryHostFactory)
+	ctx.RegisterModuleType("rust_bindgen", RustBindgenFactory)
 	ctx.RegisterModuleType("rust_test", RustTestFactory)
 	ctx.RegisterModuleType("rust_test_host", RustTestHostFactory)
 	ctx.RegisterModuleType("rust_library", RustLibraryFactory)
diff --git a/scripts/build-mainline-modules.sh b/scripts/build-mainline-modules.sh
index 1bc78e6..c5ec8d1 100755
--- a/scripts/build-mainline-modules.sh
+++ b/scripts/build-mainline-modules.sh
@@ -24,7 +24,7 @@
   i18n-module-test-exports
   i18n-module-sdk
   platform-mainline-sdk
-  platform-mainline-host-exports
+  platform-mainline-test-exports
 )
 
 # List of libraries installed on the platform that are needed for ART chroot
@@ -52,6 +52,13 @@
   "$@"
 }
 
+lib_dir() {
+  case $1 in
+    (aosp_arm|aosp_x86) echo "lib";;
+    (aosp_arm64|aosp_x86_64) echo "lib64";;
+  esac
+}
+
 OUT_DIR=$(source build/envsetup.sh > /dev/null; TARGET_PRODUCT= get_build_var OUT_DIR)
 DIST_DIR=$(source build/envsetup.sh > /dev/null; TARGET_PRODUCT= get_build_var DIST_DIR)
 
@@ -69,7 +76,8 @@
     echo_and_run cp ${PWD}/${PRODUCT_OUT}/system/apex/${module}.apex ${DIST_DIR}/${TARGET_ARCH}/
   done
   for library in "${PLATFORM_LIBRARIES[@]}"; do
-    echo_and_run cp ${PWD}/${PRODUCT_OUT}/system/lib/${library}.so ${DIST_DIR}/${TARGET_ARCH}/
+    libdir=$(lib_dir $product)
+    echo_and_run cp ${PWD}/${PRODUCT_OUT}/system/${libdir}/${library}.so ${DIST_DIR}/${TARGET_ARCH}/
   done
 done
 
diff --git a/sdk/cc_sdk_test.go b/sdk/cc_sdk_test.go
index c59cd30..9501d88 100644
--- a/sdk/cc_sdk_test.go
+++ b/sdk/cc_sdk_test.go
@@ -21,24 +21,38 @@
 	"android/soong/cc"
 )
 
+var ccTestFs = map[string][]byte{
+	"Test.cpp":                      nil,
+	"include/Test.h":                nil,
+	"include-android/AndroidTest.h": nil,
+	"include-host/HostTest.h":       nil,
+	"arm64/include/Arm64Test.h":     nil,
+	"libfoo.so":                     nil,
+	"aidl/foo/bar/Test.aidl":        nil,
+	"some/where/stubslib.map.txt":   nil,
+}
+
 func testSdkWithCc(t *testing.T, bp string) *testSdkResult {
 	t.Helper()
-
-	fs := map[string][]byte{
-		"Test.cpp":                      nil,
-		"include/Test.h":                nil,
-		"include-android/AndroidTest.h": nil,
-		"include-host/HostTest.h":       nil,
-		"arm64/include/Arm64Test.h":     nil,
-		"libfoo.so":                     nil,
-		"aidl/foo/bar/Test.aidl":        nil,
-		"some/where/stubslib.map.txt":   nil,
-	}
-	return testSdkWithFs(t, bp, fs)
+	return testSdkWithFs(t, bp, ccTestFs)
 }
 
 // Contains tests for SDK members provided by the cc package.
 
+func TestSingleDeviceOsAssumption(t *testing.T) {
+	// Mock a module with DeviceSupported() == true.
+	s := &sdk{}
+	android.InitAndroidArchModule(s, android.DeviceSupported, android.MultilibCommon)
+
+	osTypes := s.getPossibleOsTypes()
+	if len(osTypes) != 1 {
+		// The snapshot generation assumes there is a single device OS. If more are
+		// added it might need to disable them by default, like it does for host
+		// OS'es.
+		t.Errorf("expected a single device OS, got %v", osTypes)
+	}
+}
+
 func TestSdkIsCompileMultilibBoth(t *testing.T) {
 	result := testSdkWithCc(t, `
 		sdk {
@@ -73,12 +87,14 @@
 	result := testSdkWithCc(t, `
 		sdk {
 			name: "mysdk",
+			host_supported: true,
 			native_shared_libs: ["sdkmember"],
 			compile_multilib: "64",
 		}
 
 		cc_library_shared {
 			name: "sdkmember",
+			host_supported: true,
 			srcs: ["Test.cpp"],
 			stl: "none",
 			compile_multilib: "64",
@@ -86,8 +102,72 @@
 	`)
 
 	result.CheckSnapshot("mysdk", "",
+		checkAndroidBpContents(`
+// This is auto-generated. DO NOT EDIT.
+
+cc_prebuilt_library_shared {
+    name: "mysdk_sdkmember@current",
+    sdk_member_name: "sdkmember",
+    host_supported: true,
+    installable: false,
+    stl: "none",
+    compile_multilib: "64",
+    target: {
+        host: {
+            enabled: false,
+        },
+        android_arm64: {
+            srcs: ["android/arm64/lib/sdkmember.so"],
+        },
+        linux_glibc: {
+            enabled: true,
+        },
+        linux_glibc_x86_64: {
+            srcs: ["linux_glibc/x86_64/lib/sdkmember.so"],
+        },
+    },
+}
+
+cc_prebuilt_library_shared {
+    name: "sdkmember",
+    prefer: false,
+    host_supported: true,
+    stl: "none",
+    compile_multilib: "64",
+    target: {
+        host: {
+            enabled: false,
+        },
+        android_arm64: {
+            srcs: ["android/arm64/lib/sdkmember.so"],
+        },
+        linux_glibc: {
+            enabled: true,
+        },
+        linux_glibc_x86_64: {
+            srcs: ["linux_glibc/x86_64/lib/sdkmember.so"],
+        },
+    },
+}
+
+sdk_snapshot {
+    name: "mysdk@current",
+    host_supported: true,
+    native_shared_libs: ["mysdk_sdkmember@current"],
+    compile_multilib: "64",
+    target: {
+        host: {
+            enabled: false,
+        },
+        linux_glibc: {
+            enabled: true,
+        },
+    },
+}
+`),
 		checkAllCopyRules(`
-.intermediates/sdkmember/android_arm64_armv8-a_shared/sdkmember.so -> arm64/lib/sdkmember.so
+.intermediates/sdkmember/android_arm64_armv8-a_shared/sdkmember.so -> android/arm64/lib/sdkmember.so
+.intermediates/sdkmember/linux_glibc_x86_64_shared/sdkmember.so -> linux_glibc/x86_64/lib/sdkmember.so
 `))
 }
 
@@ -271,6 +351,7 @@
     name: "mysdk_crtobj@current",
     sdk_member_name: "crtobj",
     stl: "none",
+    compile_multilib: "both",
     arch: {
         arm64: {
             srcs: ["arm64/lib/crtobj.o"],
@@ -285,6 +366,7 @@
     name: "crtobj",
     prefer: false,
     stl: "none",
+    compile_multilib: "both",
     arch: {
         arm64: {
             srcs: ["arm64/lib/crtobj.o"],
@@ -378,6 +460,7 @@
     sdk_member_name: "mynativelib",
     installable: false,
     stl: "none",
+    compile_multilib: "both",
     export_include_dirs: ["include/include"],
     arch: {
         arm64: {
@@ -394,6 +477,7 @@
     name: "mynativelib",
     prefer: false,
     stl: "none",
+    compile_multilib: "both",
     export_include_dirs: ["include/include"],
     arch: {
         arm64: {
@@ -481,9 +565,6 @@
 }
 
 func TestMultipleHostOsTypesSnapshotWithCcBinary(t *testing.T) {
-	// b/145598135 - Generating host snapshots for anything other than linux is not supported.
-	SkipIfNotLinux(t)
-
 	result := testSdkWithCc(t, `
 		module_exports {
 			name: "myexports",
@@ -526,7 +607,11 @@
     installable: false,
     stl: "none",
     target: {
+        host: {
+            enabled: false,
+        },
         linux_glibc: {
+            enabled: true,
             compile_multilib: "both",
         },
         linux_glibc_x86_64: {
@@ -536,6 +621,7 @@
             srcs: ["linux_glibc/x86/bin/mynativebinary"],
         },
         windows: {
+            enabled: true,
             compile_multilib: "64",
         },
         windows_x86_64: {
@@ -551,7 +637,11 @@
     host_supported: true,
     stl: "none",
     target: {
+        host: {
+            enabled: false,
+        },
         linux_glibc: {
+            enabled: true,
             compile_multilib: "both",
         },
         linux_glibc_x86_64: {
@@ -561,6 +651,7 @@
             srcs: ["linux_glibc/x86/bin/mynativebinary"],
         },
         windows: {
+            enabled: true,
             compile_multilib: "64",
         },
         windows_x86_64: {
@@ -575,7 +666,14 @@
     host_supported: true,
     native_binaries: ["myexports_mynativebinary@current"],
     target: {
+        host: {
+            enabled: false,
+        },
+        linux_glibc: {
+            enabled: true,
+        },
         windows: {
+            enabled: true,
             compile_multilib: "64",
         },
     },
@@ -589,12 +687,165 @@
 	)
 }
 
+func TestSnapshotWithSingleHostOsType(t *testing.T) {
+	ctx, config := testSdkContext(`
+		cc_defaults {
+			name: "mydefaults",
+			device_supported: false,
+			host_supported: true,
+			compile_multilib: "64",
+			target: {
+				host: {
+					enabled: false,
+				},
+				linux_bionic: {
+					enabled: true,
+				},
+			},
+		}
+
+		module_exports {
+			name: "myexports",
+			defaults: ["mydefaults"],
+			native_shared_libs: ["mynativelib"],
+			native_binaries: ["mynativebinary"],
+			compile_multilib: "64",  // The built-in default in sdk.go overrides mydefaults.
+		}
+
+		cc_library {
+			name: "mynativelib",
+			defaults: ["mydefaults"],
+			srcs: [
+				"Test.cpp",
+			],
+			stl: "none",
+		}
+
+		cc_binary {
+			name: "mynativebinary",
+			defaults: ["mydefaults"],
+			srcs: [
+				"Test.cpp",
+			],
+			stl: "none",
+		}
+	`, ccTestFs, []android.OsType{android.LinuxBionic})
+
+	result := runTests(t, ctx, config)
+
+	result.CheckSnapshot("myexports", "",
+		checkAndroidBpContents(`
+// This is auto-generated. DO NOT EDIT.
+
+cc_prebuilt_binary {
+    name: "myexports_mynativebinary@current",
+    sdk_member_name: "mynativebinary",
+    device_supported: false,
+    host_supported: true,
+    installable: false,
+    stl: "none",
+    compile_multilib: "64",
+    target: {
+        host: {
+            enabled: false,
+        },
+        linux_bionic: {
+            enabled: true,
+        },
+        linux_bionic_x86_64: {
+            srcs: ["x86_64/bin/mynativebinary"],
+        },
+    },
+}
+
+cc_prebuilt_binary {
+    name: "mynativebinary",
+    prefer: false,
+    device_supported: false,
+    host_supported: true,
+    stl: "none",
+    compile_multilib: "64",
+    target: {
+        host: {
+            enabled: false,
+        },
+        linux_bionic: {
+            enabled: true,
+        },
+        linux_bionic_x86_64: {
+            srcs: ["x86_64/bin/mynativebinary"],
+        },
+    },
+}
+
+cc_prebuilt_library_shared {
+    name: "myexports_mynativelib@current",
+    sdk_member_name: "mynativelib",
+    device_supported: false,
+    host_supported: true,
+    installable: false,
+    stl: "none",
+    compile_multilib: "64",
+    target: {
+        host: {
+            enabled: false,
+        },
+        linux_bionic: {
+            enabled: true,
+        },
+        linux_bionic_x86_64: {
+            srcs: ["x86_64/lib/mynativelib.so"],
+        },
+    },
+}
+
+cc_prebuilt_library_shared {
+    name: "mynativelib",
+    prefer: false,
+    device_supported: false,
+    host_supported: true,
+    stl: "none",
+    compile_multilib: "64",
+    target: {
+        host: {
+            enabled: false,
+        },
+        linux_bionic: {
+            enabled: true,
+        },
+        linux_bionic_x86_64: {
+            srcs: ["x86_64/lib/mynativelib.so"],
+        },
+    },
+}
+
+module_exports_snapshot {
+    name: "myexports@current",
+    device_supported: false,
+    host_supported: true,
+    native_binaries: ["myexports_mynativebinary@current"],
+    native_shared_libs: ["myexports_mynativelib@current"],
+    compile_multilib: "64",
+    target: {
+        host: {
+            enabled: false,
+        },
+        linux_bionic: {
+            enabled: true,
+        },
+    },
+}
+`),
+		checkAllCopyRules(`
+.intermediates/mynativebinary/linux_bionic_x86_64/mynativebinary -> x86_64/bin/mynativebinary
+.intermediates/mynativelib/linux_bionic_x86_64_shared/mynativelib.so -> x86_64/lib/mynativelib.so
+`),
+	)
+}
+
 // Test that we support the necessary flags for the linker binary, which is
 // special in several ways.
 func TestSnapshotWithCcStaticNocrtBinary(t *testing.T) {
-	// b/145598135 - Generating host snapshots for anything other than linux is not supported.
-	SkipIfNotLinux(t)
-
 	result := testSdkWithCc(t, `
 		module_exports {
 			name: "mymodule_exports",
@@ -627,14 +878,20 @@
     host_supported: true,
     installable: false,
     stl: "none",
+    compile_multilib: "both",
     static_executable: true,
     nocrt: true,
-    compile_multilib: "both",
-    arch: {
-        x86_64: {
+    target: {
+        host: {
+            enabled: false,
+        },
+        linux_glibc: {
+            enabled: true,
+        },
+        linux_glibc_x86_64: {
             srcs: ["x86_64/bin/linker"],
         },
-        x86: {
+        linux_glibc_x86: {
             srcs: ["x86/bin/linker"],
         },
     },
@@ -646,14 +903,20 @@
     device_supported: false,
     host_supported: true,
     stl: "none",
+    compile_multilib: "both",
     static_executable: true,
     nocrt: true,
-    compile_multilib: "both",
-    arch: {
-        x86_64: {
+    target: {
+        host: {
+            enabled: false,
+        },
+        linux_glibc: {
+            enabled: true,
+        },
+        linux_glibc_x86_64: {
             srcs: ["x86_64/bin/linker"],
         },
-        x86: {
+        linux_glibc_x86: {
             srcs: ["x86/bin/linker"],
         },
     },
@@ -664,6 +927,14 @@
     device_supported: false,
     host_supported: true,
     native_binaries: ["mymodule_exports_linker@current"],
+    target: {
+        host: {
+            enabled: false,
+        },
+        linux_glibc: {
+            enabled: true,
+        },
+    },
 }
 `),
 		checkAllCopyRules(`
@@ -708,6 +979,7 @@
     ],
     installable: false,
     stl: "none",
+    compile_multilib: "both",
     export_include_dirs: ["include/include"],
     arch: {
         arm64: {
@@ -729,6 +1001,7 @@
         "apex2",
     ],
     stl: "none",
+    compile_multilib: "both",
     export_include_dirs: ["include/include"],
     arch: {
         arm64: {
@@ -830,6 +1103,7 @@
     sdk_member_name: "mynativelib",
     installable: false,
     stl: "none",
+    compile_multilib: "both",
     shared_libs: [
         "mysdk_myothernativelib@current",
         "libc",
@@ -848,6 +1122,7 @@
     name: "mynativelib",
     prefer: false,
     stl: "none",
+    compile_multilib: "both",
     shared_libs: [
         "myothernativelib",
         "libc",
@@ -867,6 +1142,7 @@
     sdk_member_name: "myothernativelib",
     installable: false,
     stl: "none",
+    compile_multilib: "both",
     system_shared_libs: ["libm"],
     arch: {
         arm64: {
@@ -882,6 +1158,7 @@
     name: "myothernativelib",
     prefer: false,
     stl: "none",
+    compile_multilib: "both",
     system_shared_libs: ["libm"],
     arch: {
         arm64: {
@@ -898,6 +1175,7 @@
     sdk_member_name: "mysystemnativelib",
     installable: false,
     stl: "none",
+    compile_multilib: "both",
     arch: {
         arm64: {
             srcs: ["arm64/lib/mysystemnativelib.so"],
@@ -912,6 +1190,7 @@
     name: "mysystemnativelib",
     prefer: false,
     stl: "none",
+    compile_multilib: "both",
     arch: {
         arm64: {
             srcs: ["arm64/lib/mysystemnativelib.so"],
@@ -943,9 +1222,6 @@
 }
 
 func TestHostSnapshotWithCcSharedLibrary(t *testing.T) {
-	// b/145598135 - Generating host snapshots for anything other than linux is not supported.
-	SkipIfNotLinux(t)
-
 	result := testSdkWithCc(t, `
 		sdk {
 			name: "mysdk",
@@ -983,13 +1259,20 @@
     installable: false,
     sdk_version: "minimum",
     stl: "none",
+    compile_multilib: "both",
     export_include_dirs: ["include/include"],
-    arch: {
-        x86_64: {
+    target: {
+        host: {
+            enabled: false,
+        },
+        linux_glibc: {
+            enabled: true,
+        },
+        linux_glibc_x86_64: {
             srcs: ["x86_64/lib/mynativelib.so"],
             export_include_dirs: ["x86_64/include_gen/mynativelib"],
         },
-        x86: {
+        linux_glibc_x86: {
             srcs: ["x86/lib/mynativelib.so"],
             export_include_dirs: ["x86/include_gen/mynativelib"],
         },
@@ -1003,13 +1286,20 @@
     host_supported: true,
     sdk_version: "minimum",
     stl: "none",
+    compile_multilib: "both",
     export_include_dirs: ["include/include"],
-    arch: {
-        x86_64: {
+    target: {
+        host: {
+            enabled: false,
+        },
+        linux_glibc: {
+            enabled: true,
+        },
+        linux_glibc_x86_64: {
             srcs: ["x86_64/lib/mynativelib.so"],
             export_include_dirs: ["x86_64/include_gen/mynativelib"],
         },
-        x86: {
+        linux_glibc_x86: {
             srcs: ["x86/lib/mynativelib.so"],
             export_include_dirs: ["x86/include_gen/mynativelib"],
         },
@@ -1021,6 +1311,14 @@
     device_supported: false,
     host_supported: true,
     native_shared_libs: ["mysdk_mynativelib@current"],
+    target: {
+        host: {
+            enabled: false,
+        },
+        linux_glibc: {
+            enabled: true,
+        },
+    },
 }
 `),
 		checkAllCopyRules(`
@@ -1038,9 +1336,6 @@
 }
 
 func TestMultipleHostOsTypesSnapshotWithCcSharedLibrary(t *testing.T) {
-	// b/145598135 - Generating host snapshots for anything other than linux is not supported.
-	SkipIfNotLinux(t)
-
 	result := testSdkWithCc(t, `
 		sdk {
 			name: "mysdk",
@@ -1082,12 +1377,23 @@
     installable: false,
     stl: "none",
     target: {
+        host: {
+            enabled: false,
+        },
+        linux_glibc: {
+            enabled: true,
+            compile_multilib: "both",
+        },
         linux_glibc_x86_64: {
             srcs: ["linux_glibc/x86_64/lib/mynativelib.so"],
         },
         linux_glibc_x86: {
             srcs: ["linux_glibc/x86/lib/mynativelib.so"],
         },
+        windows: {
+            enabled: true,
+            compile_multilib: "64",
+        },
         windows_x86_64: {
             srcs: ["windows/x86_64/lib/mynativelib.dll"],
         },
@@ -1101,12 +1407,23 @@
     host_supported: true,
     stl: "none",
     target: {
+        host: {
+            enabled: false,
+        },
+        linux_glibc: {
+            enabled: true,
+            compile_multilib: "both",
+        },
         linux_glibc_x86_64: {
             srcs: ["linux_glibc/x86_64/lib/mynativelib.so"],
         },
         linux_glibc_x86: {
             srcs: ["linux_glibc/x86/lib/mynativelib.so"],
         },
+        windows: {
+            enabled: true,
+            compile_multilib: "64",
+        },
         windows_x86_64: {
             srcs: ["windows/x86_64/lib/mynativelib.dll"],
         },
@@ -1119,7 +1436,14 @@
     host_supported: true,
     native_shared_libs: ["mysdk_mynativelib@current"],
     target: {
+        host: {
+            enabled: false,
+        },
+        linux_glibc: {
+            enabled: true,
+        },
         windows: {
+            enabled: true,
             compile_multilib: "64",
         },
     },
@@ -1163,6 +1487,7 @@
     sdk_member_name: "mynativelib",
     installable: false,
     stl: "none",
+    compile_multilib: "both",
     export_include_dirs: ["include/include"],
     arch: {
         arm64: {
@@ -1180,6 +1505,7 @@
     name: "mynativelib",
     prefer: false,
     stl: "none",
+    compile_multilib: "both",
     export_include_dirs: ["include/include"],
     arch: {
         arm64: {
@@ -1213,9 +1539,6 @@
 }
 
 func TestHostSnapshotWithCcStaticLibrary(t *testing.T) {
-	// b/145598135 - Generating host snapshots for anything other than linux is not supported.
-	SkipIfNotLinux(t)
-
 	result := testSdkWithCc(t, `
 		module_exports {
 			name: "myexports",
@@ -1251,13 +1574,20 @@
     host_supported: true,
     installable: false,
     stl: "none",
+    compile_multilib: "both",
     export_include_dirs: ["include/include"],
-    arch: {
-        x86_64: {
+    target: {
+        host: {
+            enabled: false,
+        },
+        linux_glibc: {
+            enabled: true,
+        },
+        linux_glibc_x86_64: {
             srcs: ["x86_64/lib/mynativelib.a"],
             export_include_dirs: ["x86_64/include_gen/mynativelib"],
         },
-        x86: {
+        linux_glibc_x86: {
             srcs: ["x86/lib/mynativelib.a"],
             export_include_dirs: ["x86/include_gen/mynativelib"],
         },
@@ -1270,13 +1600,20 @@
     device_supported: false,
     host_supported: true,
     stl: "none",
+    compile_multilib: "both",
     export_include_dirs: ["include/include"],
-    arch: {
-        x86_64: {
+    target: {
+        host: {
+            enabled: false,
+        },
+        linux_glibc: {
+            enabled: true,
+        },
+        linux_glibc_x86_64: {
             srcs: ["x86_64/lib/mynativelib.a"],
             export_include_dirs: ["x86_64/include_gen/mynativelib"],
         },
-        x86: {
+        linux_glibc_x86: {
             srcs: ["x86/lib/mynativelib.a"],
             export_include_dirs: ["x86/include_gen/mynativelib"],
         },
@@ -1288,6 +1625,14 @@
     device_supported: false,
     host_supported: true,
     native_static_libs: ["myexports_mynativelib@current"],
+    target: {
+        host: {
+            enabled: false,
+        },
+        linux_glibc: {
+            enabled: true,
+        },
+    },
 }
 `),
 		checkAllCopyRules(`
@@ -1330,6 +1675,7 @@
     sdk_member_name: "mynativelib",
     installable: false,
     stl: "none",
+    compile_multilib: "both",
     export_include_dirs: ["include/include"],
     arch: {
         arm64: {
@@ -1355,6 +1701,7 @@
     name: "mynativelib",
     prefer: false,
     stl: "none",
+    compile_multilib: "both",
     export_include_dirs: ["include/include"],
     arch: {
         arm64: {
@@ -1391,9 +1738,6 @@
 }
 
 func TestHostSnapshotWithMultiLib64(t *testing.T) {
-	// b/145598135 - Generating host snapshots for anything other than linux is not supported.
-	SkipIfNotLinux(t)
-
 	result := testSdkWithCc(t, `
 		module_exports {
 			name: "myexports",
@@ -1434,9 +1778,16 @@
     host_supported: true,
     installable: false,
     stl: "none",
+    compile_multilib: "64",
     export_include_dirs: ["include/include"],
-    arch: {
-        x86_64: {
+    target: {
+        host: {
+            enabled: false,
+        },
+        linux_glibc: {
+            enabled: true,
+        },
+        linux_glibc_x86_64: {
             srcs: ["x86_64/lib/mynativelib.a"],
             export_include_dirs: ["x86_64/include_gen/mynativelib"],
         },
@@ -1449,9 +1800,16 @@
     device_supported: false,
     host_supported: true,
     stl: "none",
+    compile_multilib: "64",
     export_include_dirs: ["include/include"],
-    arch: {
-        x86_64: {
+    target: {
+        host: {
+            enabled: false,
+        },
+        linux_glibc: {
+            enabled: true,
+        },
+        linux_glibc_x86_64: {
             srcs: ["x86_64/lib/mynativelib.a"],
             export_include_dirs: ["x86_64/include_gen/mynativelib"],
         },
@@ -1463,9 +1821,13 @@
     device_supported: false,
     host_supported: true,
     native_static_libs: ["myexports_mynativelib@current"],
+    compile_multilib: "64",
     target: {
+        host: {
+            enabled: false,
+        },
         linux_glibc: {
-            compile_multilib: "64",
+            enabled: true,
         },
     },
 }`),
@@ -1501,6 +1863,7 @@
     name: "mysdk_mynativeheaders@current",
     sdk_member_name: "mynativeheaders",
     stl: "none",
+    compile_multilib: "both",
     export_include_dirs: ["include/include"],
 }
 
@@ -1508,6 +1871,7 @@
     name: "mynativeheaders",
     prefer: false,
     stl: "none",
+    compile_multilib: "both",
     export_include_dirs: ["include/include"],
 }
 
@@ -1523,9 +1887,6 @@
 }
 
 func TestHostSnapshotWithCcHeadersLibrary(t *testing.T) {
-	// b/145598135 - Generating host snapshots for anything other than linux is not supported.
-	SkipIfNotLinux(t)
-
 	result := testSdkWithCc(t, `
 		sdk {
 			name: "mysdk",
@@ -1553,7 +1914,16 @@
     device_supported: false,
     host_supported: true,
     stl: "none",
+    compile_multilib: "both",
     export_include_dirs: ["include/include"],
+    target: {
+        host: {
+            enabled: false,
+        },
+        linux_glibc: {
+            enabled: true,
+        },
+    },
 }
 
 cc_prebuilt_library_headers {
@@ -1562,7 +1932,16 @@
     device_supported: false,
     host_supported: true,
     stl: "none",
+    compile_multilib: "both",
     export_include_dirs: ["include/include"],
+    target: {
+        host: {
+            enabled: false,
+        },
+        linux_glibc: {
+            enabled: true,
+        },
+    },
 }
 
 sdk_snapshot {
@@ -1570,6 +1949,14 @@
     device_supported: false,
     host_supported: true,
     native_header_libs: ["mysdk_mynativeheaders@current"],
+    target: {
+        host: {
+            enabled: false,
+        },
+        linux_glibc: {
+            enabled: true,
+        },
+    },
 }
 `),
 		checkAllCopyRules(`
@@ -1579,9 +1966,6 @@
 }
 
 func TestDeviceAndHostSnapshotWithCcHeadersLibrary(t *testing.T) {
-	// b/145598135 - Generating host snapshots for anything other than linux is not supported.
-	SkipIfNotLinux(t)
-
 	result := testSdkWithCc(t, `
 		sdk {
 			name: "mysdk",
@@ -1614,13 +1998,18 @@
     sdk_member_name: "mynativeheaders",
     host_supported: true,
     stl: "none",
-    export_system_include_dirs: ["include/include"],
+    compile_multilib: "both",
+    export_system_include_dirs: ["common_os/include/include"],
     target: {
+        host: {
+            enabled: false,
+        },
         android: {
-            export_include_dirs: ["include/include-android"],
+            export_include_dirs: ["android/include/include-android"],
         },
         linux_glibc: {
-            export_include_dirs: ["include/include-host"],
+            enabled: true,
+            export_include_dirs: ["linux_glibc/include/include-host"],
         },
     },
 }
@@ -1630,13 +2019,18 @@
     prefer: false,
     host_supported: true,
     stl: "none",
-    export_system_include_dirs: ["include/include"],
+    compile_multilib: "both",
+    export_system_include_dirs: ["common_os/include/include"],
     target: {
+        host: {
+            enabled: false,
+        },
         android: {
-            export_include_dirs: ["include/include-android"],
+            export_include_dirs: ["android/include/include-android"],
         },
         linux_glibc: {
-            export_include_dirs: ["include/include-host"],
+            enabled: true,
+            export_include_dirs: ["linux_glibc/include/include-host"],
         },
     },
 }
@@ -1645,20 +2039,25 @@
     name: "mysdk@current",
     host_supported: true,
     native_header_libs: ["mysdk_mynativeheaders@current"],
+    target: {
+        host: {
+            enabled: false,
+        },
+        linux_glibc: {
+            enabled: true,
+        },
+    },
 }
 `),
 		checkAllCopyRules(`
-include/Test.h -> include/include/Test.h
-include-android/AndroidTest.h -> include/include-android/AndroidTest.h
-include-host/HostTest.h -> include/include-host/HostTest.h
+include/Test.h -> common_os/include/include/Test.h
+include-android/AndroidTest.h -> android/include/include-android/AndroidTest.h
+include-host/HostTest.h -> linux_glibc/include/include-host/HostTest.h
 `),
 	)
 }
 
 func TestSystemSharedLibPropagation(t *testing.T) {
-	// b/145598135 - Generating host snapshots for anything other than linux is not supported.
-	SkipIfNotLinux(t)
-
 	result := testSdkWithCc(t, `
 		sdk {
 			name: "mysdk",
@@ -1689,6 +2088,7 @@
     name: "mysdk_sslnil@current",
     sdk_member_name: "sslnil",
     installable: false,
+    compile_multilib: "both",
     arch: {
         arm64: {
             srcs: ["arm64/lib/sslnil.so"],
@@ -1702,6 +2102,7 @@
 cc_prebuilt_library_shared {
     name: "sslnil",
     prefer: false,
+    compile_multilib: "both",
     arch: {
         arm64: {
             srcs: ["arm64/lib/sslnil.so"],
@@ -1716,6 +2117,7 @@
     name: "mysdk_sslempty@current",
     sdk_member_name: "sslempty",
     installable: false,
+    compile_multilib: "both",
     system_shared_libs: [],
     arch: {
         arm64: {
@@ -1730,6 +2132,7 @@
 cc_prebuilt_library_shared {
     name: "sslempty",
     prefer: false,
+    compile_multilib: "both",
     system_shared_libs: [],
     arch: {
         arm64: {
@@ -1745,6 +2148,7 @@
     name: "mysdk_sslnonempty@current",
     sdk_member_name: "sslnonempty",
     installable: false,
+    compile_multilib: "both",
     system_shared_libs: ["mysdk_sslnil@current"],
     arch: {
         arm64: {
@@ -1759,6 +2163,7 @@
 cc_prebuilt_library_shared {
     name: "sslnonempty",
     prefer: false,
+    compile_multilib: "both",
     system_shared_libs: ["sslnil"],
     arch: {
         arm64: {
@@ -1807,7 +2212,11 @@
     sdk_member_name: "sslvariants",
     host_supported: true,
     installable: false,
+    compile_multilib: "both",
     target: {
+        host: {
+            enabled: false,
+        },
         android: {
             system_shared_libs: [],
         },
@@ -1817,6 +2226,9 @@
         android_arm: {
             srcs: ["android/arm/lib/sslvariants.so"],
         },
+        linux_glibc: {
+            enabled: true,
+        },
         linux_glibc_x86_64: {
             srcs: ["linux_glibc/x86_64/lib/sslvariants.so"],
         },
@@ -1830,7 +2242,11 @@
     name: "sslvariants",
     prefer: false,
     host_supported: true,
+    compile_multilib: "both",
     target: {
+        host: {
+            enabled: false,
+        },
         android: {
             system_shared_libs: [],
         },
@@ -1840,6 +2256,9 @@
         android_arm: {
             srcs: ["android/arm/lib/sslvariants.so"],
         },
+        linux_glibc: {
+            enabled: true,
+        },
         linux_glibc_x86_64: {
             srcs: ["linux_glibc/x86_64/lib/sslvariants.so"],
         },
@@ -1853,6 +2272,14 @@
     name: "mysdk@current",
     host_supported: true,
     native_shared_libs: ["mysdk_sslvariants@current"],
+    target: {
+        host: {
+            enabled: false,
+        },
+        linux_glibc: {
+            enabled: true,
+        },
+    },
 }
 `))
 }
@@ -1886,6 +2313,7 @@
     name: "mysdk_stubslib@current",
     sdk_member_name: "stubslib",
     installable: false,
+    compile_multilib: "both",
     stubs: {
         versions: ["3"],
     },
@@ -1902,6 +2330,7 @@
 cc_prebuilt_library_shared {
     name: "stubslib",
     prefer: false,
+    compile_multilib: "both",
     stubs: {
         versions: ["3"],
     },
@@ -1923,9 +2352,6 @@
 }
 
 func TestDeviceAndHostSnapshotWithStubsLibrary(t *testing.T) {
-	// b/145598135 - Generating host snapshots for anything other than linux is not supported.
-	SkipIfNotLinux(t)
-
 	result := testSdkWithCc(t, `
 		sdk {
 			name: "mysdk",
@@ -1958,16 +2384,23 @@
     sdk_member_name: "stubslib",
     host_supported: true,
     installable: false,
+    compile_multilib: "both",
     stubs: {
         versions: ["3"],
     },
     target: {
+        host: {
+            enabled: false,
+        },
         android_arm64: {
             srcs: ["android/arm64/lib/stubslib.so"],
         },
         android_arm: {
             srcs: ["android/arm/lib/stubslib.so"],
         },
+        linux_glibc: {
+            enabled: true,
+        },
         linux_glibc_x86_64: {
             srcs: ["linux_glibc/x86_64/lib/stubslib.so"],
         },
@@ -1981,16 +2414,23 @@
     name: "stubslib",
     prefer: false,
     host_supported: true,
+    compile_multilib: "both",
     stubs: {
         versions: ["3"],
     },
     target: {
+        host: {
+            enabled: false,
+        },
         android_arm64: {
             srcs: ["android/arm64/lib/stubslib.so"],
         },
         android_arm: {
             srcs: ["android/arm/lib/stubslib.so"],
         },
+        linux_glibc: {
+            enabled: true,
+        },
         linux_glibc_x86_64: {
             srcs: ["linux_glibc/x86_64/lib/stubslib.so"],
         },
@@ -2004,14 +2444,19 @@
     name: "mysdk@current",
     host_supported: true,
     native_shared_libs: ["mysdk_stubslib@current"],
+    target: {
+        host: {
+            enabled: false,
+        },
+        linux_glibc: {
+            enabled: true,
+        },
+    },
 }
 `))
 }
 
 func TestUniqueHostSoname(t *testing.T) {
-	// b/145598135 - Generating host snapshots for anything other than linux is not supported.
-	SkipIfNotLinux(t)
-
 	result := testSdkWithCc(t, `
 		sdk {
 			name: "mysdk",
@@ -2036,13 +2481,20 @@
     host_supported: true,
     installable: false,
     unique_host_soname: true,
+    compile_multilib: "both",
     target: {
+        host: {
+            enabled: false,
+        },
         android_arm64: {
             srcs: ["android/arm64/lib/mylib.so"],
         },
         android_arm: {
             srcs: ["android/arm/lib/mylib.so"],
         },
+        linux_glibc: {
+            enabled: true,
+        },
         linux_glibc_x86_64: {
             srcs: ["linux_glibc/x86_64/lib/mylib-host.so"],
         },
@@ -2057,13 +2509,20 @@
     prefer: false,
     host_supported: true,
     unique_host_soname: true,
+    compile_multilib: "both",
     target: {
+        host: {
+            enabled: false,
+        },
         android_arm64: {
             srcs: ["android/arm64/lib/mylib.so"],
         },
         android_arm: {
             srcs: ["android/arm/lib/mylib.so"],
         },
+        linux_glibc: {
+            enabled: true,
+        },
         linux_glibc_x86_64: {
             srcs: ["linux_glibc/x86_64/lib/mylib-host.so"],
         },
@@ -2077,6 +2536,14 @@
     name: "mysdk@current",
     host_supported: true,
     native_shared_libs: ["mysdk_mylib@current"],
+    target: {
+        host: {
+            enabled: false,
+        },
+        linux_glibc: {
+            enabled: true,
+        },
+    },
 }
 `),
 		checkAllCopyRules(`
diff --git a/sdk/java_sdk_test.go b/sdk/java_sdk_test.go
index 79da3f0..931ca3c 100644
--- a/sdk/java_sdk_test.go
+++ b/sdk/java_sdk_test.go
@@ -51,10 +51,10 @@
 	name: "core-current-stubs-system-modules",
 }
 java_system_modules_import {
-	name: "legacy-core-platform-api-stubs-system-modules",
+	name: "stable-core-platform-api-stubs-system-modules",
 }
 java_import {
-	name: "legacy.core.platform.api.stubs",
+	name: "stable.core.platform.api.stubs",
 }
 java_import {
 	name: "android_stubs_current",
@@ -204,8 +204,8 @@
 		}
 	`)
 
-	sdkMemberV1 := result.ctx.ModuleForTests("sdkmember_mysdk_1", "android_common_myapex").Rule("combineJar").Output
-	sdkMemberV2 := result.ctx.ModuleForTests("sdkmember_mysdk_2", "android_common_myapex2").Rule("combineJar").Output
+	sdkMemberV1 := result.ctx.ModuleForTests("sdkmember_mysdk_1", "android_common").Rule("combineJar").Output
+	sdkMemberV2 := result.ctx.ModuleForTests("sdkmember_mysdk_2", "android_common").Rule("combineJar").Output
 
 	javalibForMyApex := result.ctx.ModuleForTests("myjavalib", "android_common_myapex")
 	javalibForMyApex2 := result.ctx.ModuleForTests("myjavalib", "android_common_myapex2")
@@ -265,9 +265,6 @@
 }
 
 func TestHostSnapshotWithJavaHeaderLibrary(t *testing.T) {
-	// b/145598135 - Generating host snapshots for anything other than linux is not supported.
-	SkipIfNotLinux(t)
-
 	result := testSdkWithJava(t, `
 		sdk {
 			name: "mysdk",
@@ -325,9 +322,6 @@
 }
 
 func TestDeviceAndHostSnapshotWithJavaHeaderLibrary(t *testing.T) {
-	// b/145598135 - Generating host snapshots for anything other than linux is not supported.
-	SkipIfNotLinux(t)
-
 	result := testSdkWithJava(t, `
 		sdk {
 			name: "mysdk",
@@ -441,9 +435,6 @@
 }
 
 func TestHostSnapshotWithJavaImplLibrary(t *testing.T) {
-	// b/145598135 - Generating host snapshots for anything other than linux is not supported.
-	SkipIfNotLinux(t)
-
 	result := testSdkWithJava(t, `
 		module_exports {
 			name: "myexports",
@@ -548,9 +539,6 @@
 }
 
 func TestHostSnapshotWithJavaTest(t *testing.T) {
-	// b/145598135 - Generating host snapshots for anything other than linux is not supported.
-	SkipIfNotLinux(t)
-
 	result := testSdkWithJava(t, `
 		module_exports {
 			name: "myexports",
@@ -692,9 +680,6 @@
 }
 
 func TestHostSnapshotWithDroidstubs(t *testing.T) {
-	// b/145598135 - Generating host snapshots for anything other than linux is not supported.
-	SkipIfNotLinux(t)
-
 	result := testSdkWithDroidstubs(t, `
 		module_exports {
 			name: "myexports",
@@ -835,9 +820,6 @@
 }
 
 func TestHostSnapshotWithJavaSystemModules(t *testing.T) {
-	// b/145598135 - Generating host snapshots for anything other than linux is not supported.
-	SkipIfNotLinux(t)
-
 	result := testSdkWithJava(t, `
 		sdk {
 			name: "mysdk",
@@ -913,9 +895,6 @@
 }
 
 func TestDeviceAndHostSnapshotWithOsSpecificMembers(t *testing.T) {
-	// b/145598135 - Generating host snapshots for anything other than linux is not supported.
-	SkipIfNotLinux(t)
-
 	result := testSdkWithJava(t, `
 		module_exports {
 			name: "myexports",
@@ -1445,8 +1424,8 @@
 .intermediates/myjavalib.stubs.source.system/android_common/myjavalib.stubs.source.system_api.txt -> sdk_library/system/myjavalib.txt
 .intermediates/myjavalib.stubs.source.system/android_common/myjavalib.stubs.source.system_removed.txt -> sdk_library/system/myjavalib-removed.txt
 .intermediates/myjavalib.stubs.module_lib/android_common/javac/myjavalib.stubs.module_lib.jar -> sdk_library/module-lib/myjavalib-stubs.jar
-.intermediates/myjavalib.api.module_lib/android_common/myjavalib.api.module_lib_api.txt -> sdk_library/module-lib/myjavalib.txt
-.intermediates/myjavalib.api.module_lib/android_common/myjavalib.api.module_lib_removed.txt -> sdk_library/module-lib/myjavalib-removed.txt
+.intermediates/myjavalib.stubs.source.module_lib/android_common/myjavalib.stubs.source.module_lib_api.txt -> sdk_library/module-lib/myjavalib.txt
+.intermediates/myjavalib.stubs.source.module_lib/android_common/myjavalib.stubs.source.module_lib_removed.txt -> sdk_library/module-lib/myjavalib-removed.txt
 `),
 		checkMergeZips(
 			".intermediates/mysdk/common_os/tmp/sdk_library/public/myjavalib_stub_sources.zip",
diff --git a/sdk/sdk.go b/sdk/sdk.go
index 3e76008..7591020 100644
--- a/sdk/sdk.go
+++ b/sdk/sdk.go
@@ -406,13 +406,17 @@
 // Step 4: transitively ripple down the SDK requirements from the root modules like APEX to its
 // descendants
 func sdkDepsMutator(mctx android.TopDownMutatorContext) {
-	if m, ok := mctx.Module().(android.SdkAware); ok {
+	if parent, ok := mctx.Module().(interface {
+		android.DepIsInSameApex
+		android.RequiredSdks
+	}); ok {
 		// Module types for Mainline modules (e.g. APEX) are expected to implement RequiredSdks()
 		// by reading its own properties like `uses_sdks`.
-		requiredSdks := m.RequiredSdks()
+		requiredSdks := parent.RequiredSdks()
 		if len(requiredSdks) > 0 {
 			mctx.VisitDirectDeps(func(m android.Module) {
-				if dep, ok := m.(android.SdkAware); ok {
+				// Only propagate required sdks from the apex onto its contents.
+				if dep, ok := m.(android.SdkAware); ok && parent.DepIsInSameApex(mctx, dep) {
 					dep.BuildWithSdks(requiredSdks)
 				}
 			})
@@ -423,15 +427,28 @@
 // Step 5: if libfoo.mysdk.11 is in the context where version 11 of mysdk is requested, the
 // versioned module is used instead of the un-versioned (in-development) module libfoo
 func sdkDepsReplaceMutator(mctx android.BottomUpMutatorContext) {
-	if m, ok := mctx.Module().(android.SdkAware); ok && m.IsInAnySdk() {
-		if sdk := m.ContainingSdk(); !sdk.Unversioned() {
-			if m.RequiredSdks().Contains(sdk) {
-				// Note that this replacement is done only for the modules that have the same
-				// variations as the current module. Since current module is already mutated for
-				// apex references in other APEXes are not affected by this replacement.
-				memberName := m.MemberName()
-				mctx.ReplaceDependencies(memberName)
-			}
+	if versionedSdkMember, ok := mctx.Module().(android.SdkAware); ok && versionedSdkMember.IsInAnySdk() {
+		if sdk := versionedSdkMember.ContainingSdk(); !sdk.Unversioned() {
+			// Only replace dependencies to <sdkmember> with <sdkmember@required-version>
+			// if the depending module requires it. e.g.
+			//      foo -> sdkmember
+			// will be transformed to:
+			//      foo -> sdkmember@1
+			// if and only if foo is a member of an APEX that requires version 1 of the
+			// sdk containing sdkmember.
+			memberName := versionedSdkMember.MemberName()
+
+			// Replace dependencies on sdkmember with a dependency on the current module which
+			// is a versioned prebuilt of the sdkmember if required.
+			mctx.ReplaceDependenciesIf(memberName, func(from blueprint.Module, tag blueprint.DependencyTag, to blueprint.Module) bool {
+				// from - foo
+				// to - sdkmember
+				replace := false
+				if parent, ok := from.(android.RequiredSdks); ok {
+					replace = parent.RequiredSdks().Contains(sdk)
+				}
+				return replace
+			})
 		}
 	}
 }
diff --git a/sdk/sdk_test.go b/sdk/sdk_test.go
index 56be741..ef62b79 100644
--- a/sdk/sdk_test.go
+++ b/sdk/sdk_test.go
@@ -15,6 +15,9 @@
 package sdk
 
 import (
+	"android/soong/android"
+	"log"
+	"os"
 	"testing"
 
 	"github.com/google/blueprint/proptools"
@@ -22,6 +25,12 @@
 
 // Needed in an _test.go file in this package to ensure tests run correctly, particularly in IDE.
 func TestMain(m *testing.M) {
+	if android.BuildOs != android.Linux {
+		// b/145598135 - Generating host snapshots for anything other than linux is not supported.
+		log.Printf("Skipping as sdk snapshot generation is only supported on %s not %s", android.Linux, android.BuildOs)
+		os.Exit(0)
+	}
+
 	runTestWithBuildDir(m)
 }
 
diff --git a/sdk/testing.go b/sdk/testing.go
index 4d029e4..b53558d 100644
--- a/sdk/testing.go
+++ b/sdk/testing.go
@@ -29,7 +29,9 @@
 	"android/soong/java"
 )
 
-func testSdkContext(bp string, fs map[string][]byte) (*android.TestContext, android.Config) {
+func testSdkContext(bp string, fs map[string][]byte, extraOsTypes []android.OsType) (*android.TestContext, android.Config) {
+	extraOsTypes = append(extraOsTypes, android.Android, android.Windows)
+
 	bp = bp + `
 		apex_key {
 			name: "myapex.key",
@@ -41,7 +43,7 @@
 			name: "myapex.cert",
 			certificate: "myapex",
 		}
-	` + cc.GatherRequiredDepsForTest(android.Android, android.Windows)
+	` + cc.GatherRequiredDepsForTest(extraOsTypes...)
 
 	mockFS := map[string][]byte{
 		"build/make/target/product/security":           nil,
@@ -69,6 +71,15 @@
 		{android.Windows, android.Arch{ArchType: android.X86_64}, android.NativeBridgeDisabled, "", ""},
 	}
 
+	for _, extraOsType := range extraOsTypes {
+		switch extraOsType {
+		case android.LinuxBionic:
+			config.Targets[android.LinuxBionic] = []android.Target{
+				{android.LinuxBionic, android.Arch{ArchType: android.X86_64}, android.NativeBridgeDisabled, "", ""},
+			}
+		}
+	}
+
 	ctx := android.NewTestArchContext()
 
 	// Enable androidmk support.
@@ -86,6 +97,11 @@
 	ctx.PreArchMutators(android.RegisterVisibilityRuleChecker)
 	ctx.PreArchMutators(android.RegisterDefaultsPreArchMutators)
 	ctx.PreArchMutators(android.RegisterComponentsMutator)
+
+	android.RegisterPrebuiltMutators(ctx)
+
+	// Register these after the prebuilt mutators have been registered to match what
+	// happens at runtime.
 	ctx.PreArchMutators(android.RegisterVisibilityRuleGatherer)
 	ctx.PostDepsMutators(android.RegisterVisibilityRuleEnforcer)
 
@@ -117,9 +133,8 @@
 	return ctx, config
 }
 
-func testSdkWithFs(t *testing.T, bp string, fs map[string][]byte) *testSdkResult {
+func runTests(t *testing.T, ctx *android.TestContext, config android.Config) *testSdkResult {
 	t.Helper()
-	ctx, config := testSdkContext(bp, fs)
 	_, errs := ctx.ParseBlueprintsFiles(".")
 	android.FailIfErrored(t, errs)
 	_, errs = ctx.PrepareBuildActions(config)
@@ -131,9 +146,15 @@
 	}
 }
 
+func testSdkWithFs(t *testing.T, bp string, fs map[string][]byte) *testSdkResult {
+	t.Helper()
+	ctx, config := testSdkContext(bp, fs, nil)
+	return runTests(t, ctx, config)
+}
+
 func testSdkError(t *testing.T, pattern, bp string) {
 	t.Helper()
-	ctx, config := testSdkContext(bp, nil)
+	ctx, config := testSdkContext(bp, nil, nil)
 	_, errs := ctx.ParseFileList(".", []string{"Android.bp"})
 	if len(errs) > 0 {
 		android.FailIfNoMatchingErrors(t, pattern, errs)
@@ -422,10 +443,3 @@
 
 	os.Exit(run())
 }
-
-func SkipIfNotLinux(t *testing.T) {
-	t.Helper()
-	if android.BuildOs != android.Linux {
-		t.Skipf("Skipping as sdk snapshot generation is only supported on %s not %s", android.Linux, android.BuildOs)
-	}
-}
diff --git a/sdk/update.go b/sdk/update.go
index 8241151..936696a 100644
--- a/sdk/update.go
+++ b/sdk/update.go
@@ -262,7 +262,7 @@
 		memberCtx := &memberContext{ctx, builder, memberType, member.name}
 
 		prebuiltModule := memberType.AddPrebuiltModule(memberCtx, member)
-		s.createMemberSnapshot(memberCtx, member, prebuiltModule)
+		s.createMemberSnapshot(memberCtx, member, prebuiltModule.(*bpModule))
 	}
 
 	// Create a transformer that will transform an unversioned module into a versioned module.
@@ -323,19 +323,62 @@
 	// Add properties common to all os types.
 	s.addMemberPropertiesToPropertySet(builder, snapshotModule, commonDynamicMemberProperties)
 
-	// Iterate over the os types in a fixed order.
+	// Optimize other per-variant properties, besides the dynamic member lists.
+	type variantProperties struct {
+		Compile_multilib string `android:"arch_variant"`
+	}
+	var variantPropertiesContainers []propertiesContainer
+	variantToProperties := make(map[*sdk]*variantProperties)
+	for _, sdkVariant := range sdkVariants {
+		props := &variantProperties{
+			Compile_multilib: sdkVariant.multilibUsages.String(),
+		}
+		variantPropertiesContainers = append(variantPropertiesContainers, &dynamicMemberPropertiesContainer{sdkVariant, props})
+		variantToProperties[sdkVariant] = props
+	}
+	commonVariantProperties := variantProperties{}
+	extractor = newCommonValueExtractor(commonVariantProperties)
+	extractCommonProperties(ctx, extractor, &commonVariantProperties, variantPropertiesContainers)
+	if commonVariantProperties.Compile_multilib != "" && commonVariantProperties.Compile_multilib != "both" {
+		// Compile_multilib defaults to both so only needs to be set when it's
+		// specified and not both.
+		snapshotModule.AddProperty("compile_multilib", commonVariantProperties.Compile_multilib)
+	}
+
 	targetPropertySet := snapshotModule.AddPropertySet("target")
+
+	// If host is supported and any member is host OS dependent then disable host
+	// by default, so that we can enable each host OS variant explicitly. This
+	// avoids problems with implicitly enabled OS variants when the snapshot is
+	// used, which might be different from this run (e.g. different build OS).
+	hasHostOsDependentMember := false
+	if s.HostSupported() {
+		for _, memberRef := range memberRefs {
+			if memberRef.memberType.IsHostOsDependent() {
+				hasHostOsDependentMember = true
+				break
+			}
+		}
+		if hasHostOsDependentMember {
+			hostPropertySet := targetPropertySet.AddPropertySet("host")
+			hostPropertySet.AddProperty("enabled", false)
+		}
+	}
+
+	// Iterate over the os types in a fixed order.
 	for _, osType := range s.getPossibleOsTypes() {
 		if sdkVariant, ok := osTypeToMemberProperties[osType]; ok {
 			osPropertySet := targetPropertySet.AddPropertySet(sdkVariant.Target().Os.Name)
 
-			// Compile_multilib defaults to both and must always be set to both on the
-			// device and so only needs to be set when targeted at the host and is neither
-			// unspecified or both.
-			multilib := sdkVariant.multilibUsages
-			if (osType.Class == android.Host || osType.Class == android.HostCross) &&
-				multilib != multilibNone && multilib != multilibBoth {
-				osPropertySet.AddProperty("compile_multilib", multilib.String())
+			// Enable the variant explicitly when we've disabled it by default on host.
+			if hasHostOsDependentMember &&
+				(osType.Class == android.Host || osType.Class == android.HostCross) {
+				osPropertySet.AddProperty("enabled", true)
+			}
+
+			variantProps := variantToProperties[sdkVariant]
+			if variantProps.Compile_multilib != "" && variantProps.Compile_multilib != "both" {
+				osPropertySet.AddProperty("compile_multilib", variantProps.Compile_multilib)
 			}
 
 			s.addMemberPropertiesToPropertySet(builder, osPropertySet, sdkVariant.dynamicMemberTypeListProperties)
@@ -794,6 +837,17 @@
 	return !ok
 }
 
+// Add the properties from the given SdkMemberProperties to the blueprint
+// property set. This handles common properties in SdkMemberPropertiesBase and
+// calls the member-specific AddToPropertySet for the rest.
+func addSdkMemberPropertiesToSet(ctx *memberContext, memberProperties android.SdkMemberProperties, targetPropertySet android.BpPropertySet) {
+	if memberProperties.Base().Compile_multilib != "" {
+		targetPropertySet.AddProperty("compile_multilib", memberProperties.Base().Compile_multilib)
+	}
+
+	memberProperties.AddToPropertySet(ctx, targetPropertySet)
+}
+
 type sdkMemberRef struct {
 	memberType android.SdkMemberType
 	variant    android.SdkAware
@@ -911,7 +965,7 @@
 
 	if commonVariants, ok := variantsByArchName["common"]; ok {
 		if len(osTypeVariants) != 1 {
-			panic("Expected to only have 1 variant when arch type is common but found " + string(len(osTypeVariants)))
+			panic(fmt.Errorf("Expected to only have 1 variant when arch type is common but found %d", len(osTypeVariants)))
 		}
 
 		// A common arch type only has one variant and its properties should be treated
@@ -964,9 +1018,12 @@
 	var osPropertySet android.BpPropertySet
 	var archPropertySet android.BpPropertySet
 	var archOsPrefix string
-	if osInfo.Properties.Base().Os_count == 1 {
-		// There is only one os type present in the variants so don't bother
-		// with adding target specific properties.
+	if osInfo.Properties.Base().Os_count == 1 &&
+		(osInfo.osType.Class == android.Device || !ctx.memberType.IsHostOsDependent()) {
+		// There is only one OS type present in the variants and it shouldn't have a
+		// variant-specific target. The latter is the case if it's either for device
+		// where there is only one OS (android), or for host and the member type
+		// isn't host OS dependent.
 
 		// Create a structure that looks like:
 		// module_type {
@@ -1003,13 +1060,19 @@
 		osPropertySet = targetPropertySet.AddPropertySet(osType.Name)
 		archPropertySet = targetPropertySet
 
+		// Enable the variant explicitly when we've disabled it by default on host.
+		if ctx.memberType.IsHostOsDependent() &&
+			(osType.Class == android.Host || osType.Class == android.HostCross) {
+			osPropertySet.AddProperty("enabled", true)
+		}
+
 		// Arch specific properties need to be added to an os and arch specific
 		// section prefixed with <os>_.
 		archOsPrefix = osType.Name + "_"
 	}
 
 	// Add the os specific but arch independent properties to the module.
-	osInfo.Properties.AddToPropertySet(ctx, osPropertySet)
+	addSdkMemberPropertiesToSet(ctx, osInfo.Properties, osPropertySet)
 
 	// Add arch (and possibly os) specific sections for each set of arch (and possibly
 	// os) specific properties.
@@ -1111,11 +1174,11 @@
 func (archInfo *archTypeSpecificInfo) addToPropertySet(ctx *memberContext, archPropertySet android.BpPropertySet, archOsPrefix string) {
 	archTypeName := archInfo.archType.Name
 	archTypePropertySet := archPropertySet.AddPropertySet(archOsPrefix + archTypeName)
-	archInfo.Properties.AddToPropertySet(ctx, archTypePropertySet)
+	addSdkMemberPropertiesToSet(ctx, archInfo.Properties, archTypePropertySet)
 
 	for _, linkInfo := range archInfo.linkInfos {
 		linkPropertySet := archTypePropertySet.AddPropertySet(linkInfo.linkType)
-		linkInfo.Properties.AddToPropertySet(ctx, linkPropertySet)
+		addSdkMemberPropertiesToSet(ctx, linkInfo.Properties, linkPropertySet)
 	}
 }
 
@@ -1173,7 +1236,7 @@
 	return m.name
 }
 
-func (s *sdk) createMemberSnapshot(ctx *memberContext, member *sdkMember, bpModule android.BpModule) {
+func (s *sdk) createMemberSnapshot(ctx *memberContext, member *sdkMember, bpModule *bpModule) {
 
 	memberType := member.memberType
 
@@ -1221,12 +1284,24 @@
 	extractCommonProperties(ctx.sdkMemberContext, commonValueExtractor, commonProperties, osSpecificPropertiesContainers)
 
 	// Add the common properties to the module.
-	commonProperties.AddToPropertySet(ctx, bpModule)
+	addSdkMemberPropertiesToSet(ctx, commonProperties, bpModule)
 
 	// Create a target property set into which target specific properties can be
 	// added.
 	targetPropertySet := bpModule.AddPropertySet("target")
 
+	// If the member is host OS dependent and has host_supported then disable by
+	// default and enable each host OS variant explicitly. This avoids problems
+	// with implicitly enabled OS variants when the snapshot is used, which might
+	// be different from this run (e.g. different build OS).
+	if ctx.memberType.IsHostOsDependent() {
+		hostSupported := bpModule.getValue("host_supported") == true // Missing means false.
+		if hostSupported {
+			hostPropertySet := targetPropertySet.AddPropertySet("host")
+			hostPropertySet.AddProperty("enabled", false)
+		}
+	}
+
 	// Iterate over the os types in a fixed order.
 	for _, osType := range s.getPossibleOsTypes() {
 		osInfo := osTypeToInfo[osType]
diff --git a/sysprop/sysprop_test.go b/sysprop/sysprop_test.go
index 8503386..711129c 100644
--- a/sysprop/sysprop_test.go
+++ b/sysprop/sysprop_test.go
@@ -67,6 +67,8 @@
 		ctx.BottomUp("sysprop_deps", syspropDepsMutator).Parallel()
 	})
 
+	android.RegisterPrebuiltMutators(ctx)
+
 	cc.RegisterRequiredBuildComponentsForTest(ctx)
 	ctx.PreDepsMutators(func(ctx android.RegisterMutatorsContext) {
 		ctx.BottomUp("sysprop_java", java.SyspropMutator).Parallel()
diff --git a/third_party/zip/zip_test.go b/third_party/zip/zip_test.go
index 7373660..559c914 100644
--- a/third_party/zip/zip_test.go
+++ b/third_party/zip/zip_test.go
@@ -219,7 +219,7 @@
 	}
 }
 
-// fakeHash32 is a dummy Hash32 that always returns 0.
+// fakeHash32 is a fake Hash32 that always returns 0.
 type fakeHash32 struct {
 	hash.Hash32
 }
diff --git a/tradefed/autogen.go b/tradefed/autogen.go
index 1cb874d..798fc40 100644
--- a/tradefed/autogen.go
+++ b/tradefed/autogen.go
@@ -239,6 +239,21 @@
 	return path
 }
 
+func AutoGenRobolectricTestConfig(ctx android.ModuleContext, testConfigProp *string, testConfigTemplateProp *string,
+	testSuites []string, autoGenConfig *bool) android.Path {
+	path, autogenPath := testConfigPath(ctx, testConfigProp, testSuites, autoGenConfig, testConfigTemplateProp)
+	if autogenPath != nil {
+		templatePath := getTestConfigTemplate(ctx, testConfigTemplateProp)
+		if templatePath.Valid() {
+			autogenTemplate(ctx, autogenPath, templatePath.String(), nil)
+		} else {
+			autogenTemplate(ctx, autogenPath, "${RobolectricTestConfigTemplate}", nil)
+		}
+		return autogenPath
+	}
+	return path
+}
+
 var autogenInstrumentationTest = pctx.StaticRule("autogenInstrumentationTest", blueprint.RuleParams{
 	Command: "${AutoGenTestConfigScript} $out $in ${EmptyTestConfig} $template ${extraConfigs}",
 	CommandDeps: []string{
diff --git a/tradefed/config.go b/tradefed/config.go
index 34195c3..f7e8349 100644
--- a/tradefed/config.go
+++ b/tradefed/config.go
@@ -33,6 +33,7 @@
 	pctx.SourcePathVariable("PythonBinaryHostTestConfigTemplate", "build/make/core/python_binary_host_test_config_template.xml")
 	pctx.SourcePathVariable("RustDeviceTestConfigTemplate", "build/make/core/rust_device_test_config_template.xml")
 	pctx.SourcePathVariable("RustHostTestConfigTemplate", "build/make/core/rust_host_test_config_template.xml")
+	pctx.SourcePathVariable("RobolectricTestConfigTemplate", "build/make/core/robolectric_test_config_template.xml")
 	pctx.SourcePathVariable("ShellTestConfigTemplate", "build/make/core/shell_test_config_template.xml")
 
 	pctx.SourcePathVariable("EmptyTestConfig", "build/make/core/empty_test_config.xml")
diff --git a/ui/build/config.go b/ui/build/config.go
index e567e40..3fa0479 100644
--- a/ui/build/config.go
+++ b/ui/build/config.go
@@ -96,7 +96,7 @@
 		environ: OsEnvironment(),
 	}
 
-	// Sane default matching ninja
+	// Default matching ninja
 	ret.parallel = runtime.NumCPU() + 2
 	ret.keepGoing = 1
 
@@ -184,7 +184,8 @@
 	// Tell python not to spam the source tree with .pyc files.
 	ret.environ.Set("PYTHONDONTWRITEBYTECODE", "1")
 
-	ret.environ.Set("TMPDIR", absPath(ctx, ret.TempDir()))
+	tmpDir := absPath(ctx, ret.TempDir())
+	ret.environ.Set("TMPDIR", tmpDir)
 
 	// Always set ASAN_SYMBOLIZER_PATH so that ASAN-based tools can symbolize any crashes
 	symbolizerPath := filepath.Join("prebuilts/clang/host", ret.HostPrebuiltTag(),
@@ -256,11 +257,14 @@
 		ret.buildDateTime = strconv.FormatInt(time.Now().Unix(), 10)
 	}
 
-	if ctx.Metrics != nil {
-		ctx.Metrics.SetBuildDateTime(ret.buildDateTime)
-	}
 	ret.environ.Set("BUILD_DATETIME_FILE", buildDateTimeFile)
 
+	if ret.UseRBE() {
+		for k, v := range getRBEVars(ctx, tmpDir) {
+			ret.environ.Set(k, v)
+		}
+	}
+
 	return Config{ret}
 }
 
diff --git a/ui/build/paths/config.go b/ui/build/paths/config.go
index 5717401..81c500d 100644
--- a/ui/build/paths/config.go
+++ b/ui/build/paths/config.go
@@ -88,7 +88,6 @@
 	"javap":   Allowed,
 	"lsof":    Allowed,
 	"openssl": Allowed,
-	"patch":   Allowed,
 	"pstree":  Allowed,
 	"rsync":   Allowed,
 	"sh":      Allowed,
diff --git a/ui/build/rbe.go b/ui/build/rbe.go
index fcdab3b..fd3b7ab 100644
--- a/ui/build/rbe.go
+++ b/ui/build/rbe.go
@@ -15,8 +15,11 @@
 package build
 
 import (
+	"fmt"
+	"math/rand"
 	"os"
 	"path/filepath"
+	"time"
 
 	"android/soong/ui/metrics"
 )
@@ -49,6 +52,11 @@
 	return cmdPath
 }
 
+func getRBEVars(ctx Context, tmpDir string) map[string]string {
+	rand.Seed(time.Now().UnixNano())
+	return map[string]string{"RBE_server_address": fmt.Sprintf("unix://%v/reproxy_%v.sock", tmpDir, rand.Intn(1000))}
+}
+
 func startRBE(ctx Context, config Config) {
 	ctx.BeginTrace(metrics.RunSetupTool, "rbe_bootstrap")
 	defer ctx.EndTrace()
diff --git a/ui/build/rbe_test.go b/ui/build/rbe_test.go
index 2c4995b..23a53b4 100644
--- a/ui/build/rbe_test.go
+++ b/ui/build/rbe_test.go
@@ -94,12 +94,12 @@
 	}, {
 		description:         "stopRBE failed",
 		rbeOutputDirDefined: true,
-		bootstrapProgram:    "#!/bin/bash\nexit 1",
+		bootstrapProgram:    "#!/bin/bash\nexit 1\n",
 		expectedErr:         "shutdown failed",
 	}, {
 		description:         "failed to copy metrics file",
 		rbeOutputDirDefined: true,
-		bootstrapProgram:    "#!/bin/bash",
+		bootstrapProgram:    "#!/bin/bash\n",
 		expectedErr:         "failed to copy",
 	}}
 
@@ -139,4 +139,4 @@
 	}
 }
 
-var rbeBootstrapProgram = fmt.Sprintf("#!/bin/bash\necho 1 > $RBE_output_dir/%s", rbeMetricsPBFilename)
+var rbeBootstrapProgram = fmt.Sprintf("#!/bin/bash\necho 1 > $RBE_output_dir/%s\n", rbeMetricsPBFilename)
diff --git a/ui/build/soong.go b/ui/build/soong.go
index 749acb3..fb21430 100644
--- a/ui/build/soong.go
+++ b/ui/build/soong.go
@@ -38,7 +38,7 @@
 		ctx.BeginTrace(metrics.RunSoong, "blueprint bootstrap")
 		defer ctx.EndTrace()
 
-		cmd := Command(ctx, config, "blueprint bootstrap", "build/blueprint/bootstrap.bash", "-t")
+		cmd := Command(ctx, config, "blueprint bootstrap", "build/blueprint/bootstrap.bash", "-t", "-n")
 		cmd.Environment.Set("BLUEPRINTDIR", "./build/blueprint")
 		cmd.Environment.Set("BOOTSTRAP", "./build/blueprint/bootstrap.bash")
 		cmd.Environment.Set("BUILDDIR", config.SoongOutDir())
diff --git a/ui/build/upload.go b/ui/build/upload.go
index 3a23a80..a9346e0 100644
--- a/ui/build/upload.go
+++ b/ui/build/upload.go
@@ -44,7 +44,7 @@
 // environment variable. The metrics files are copied to a temporary directory
 // and the uploader is then executed in the background to allow the user to continue
 // working.
-func UploadMetrics(ctx Context, config Config, forceDumbOutput bool, buildStartedMilli int64, files ...string) {
+func UploadMetrics(ctx Context, config Config, simpleOutput bool, buildStarted time.Time, files ...string) {
 	ctx.BeginTrace(metrics.RunSetupTool, "upload_metrics")
 	defer ctx.EndTrace()
 
@@ -86,7 +86,7 @@
 	// For platform builds, the branch and target name is hardcoded to specific
 	// values for later extraction of the metrics in the data metrics pipeline.
 	data, err := proto.Marshal(&upload_proto.Upload{
-		CreationTimestampMs:   proto.Uint64(uint64(buildStartedMilli)),
+		CreationTimestampMs:   proto.Uint64(uint64(buildStarted.UnixNano() / int64(time.Millisecond))),
 		CompletionTimestampMs: proto.Uint64(uint64(time.Now().UnixNano() / int64(time.Millisecond))),
 		BranchName:            proto.String("developer-metrics"),
 		TargetName:            proto.String("platform-build-systems-metrics"),
@@ -105,7 +105,7 @@
 	// Start the uploader in the background as it takes several milliseconds to start the uploader
 	// and prepare the metrics for upload. This affects small commands like "lunch".
 	cmd := Command(ctx, config, "upload metrics", uploader, "--upload-metrics", pbFile)
-	if forceDumbOutput {
+	if simpleOutput {
 		cmd.RunOrFatal()
 	} else {
 		cmd.RunAndStreamOrFatal()
diff --git a/ui/build/upload_test.go b/ui/build/upload_test.go
index c812730..dccf156 100644
--- a/ui/build/upload_test.go
+++ b/ui/build/upload_test.go
@@ -97,7 +97,7 @@
 				buildDateTime: strconv.FormatInt(time.Now().UnixNano()/int64(time.Millisecond), 10),
 			}}
 
-			UploadMetrics(ctx, config, false, 1591031903, metricsFiles...)
+			UploadMetrics(ctx, config, false, time.Now(), metricsFiles...)
 		})
 	}
 }
@@ -151,7 +151,7 @@
 					"OUT_DIR=/bad",
 				}}}
 
-			UploadMetrics(ctx, config, true, 1591031903, metricsFile)
+			UploadMetrics(ctx, config, true, time.Now(), metricsFile)
 			t.Errorf("got nil, expecting %q as a failure", tt.expectedErr)
 		})
 	}
diff --git a/ui/metrics/Android.bp b/ui/metrics/Android.bp
index 3596e10..8188a69 100644
--- a/ui/metrics/Android.bp
+++ b/ui/metrics/Android.bp
@@ -25,6 +25,9 @@
         "metrics.go",
         "time.go",
     ],
+    testSrcs: [
+        "time_test.go",
+    ],
 }
 
 bootstrap_go_package {
diff --git a/ui/metrics/metrics.go b/ui/metrics/metrics.go
index e055b76..2b5c4c3 100644
--- a/ui/metrics/metrics.go
+++ b/ui/metrics/metrics.go
@@ -17,7 +17,7 @@
 import (
 	"io/ioutil"
 	"os"
-	"strconv"
+	"time"
 
 	"github.com/golang/protobuf/proto"
 
@@ -131,14 +131,8 @@
 	}
 }
 
-func (m *Metrics) SetBuildDateTime(date_time string) {
-	if date_time != "" {
-		date_time_timestamp, err := strconv.ParseInt(date_time, 10, 64)
-		if err != nil {
-			panic(err)
-		}
-		m.metrics.BuildDateTimestamp = &date_time_timestamp
-	}
+func (m *Metrics) SetBuildDateTime(buildTimestamp time.Time) {
+	m.metrics.BuildDateTimestamp = proto.Int64(buildTimestamp.UnixNano() / int64(time.Second))
 }
 
 // exports the output to the file at outputPath
diff --git a/ui/metrics/time.go b/ui/metrics/time.go
index b8baf16..4016563 100644
--- a/ui/metrics/time.go
+++ b/ui/metrics/time.go
@@ -19,13 +19,18 @@
 
 	"android/soong/ui/metrics/metrics_proto"
 	"android/soong/ui/tracer"
+	"github.com/golang/protobuf/proto"
 )
 
+// for testing purpose only
+var _now = now
+
 type timeEvent struct {
 	desc string
 	name string
 
-	atNanos uint64 // timestamp measured in nanoseconds since the reference date
+	// the time that the event started to occur.
+	start time.Time
 }
 
 type TimeTracer interface {
@@ -39,33 +44,26 @@
 
 var _ TimeTracer = &timeTracerImpl{}
 
-func (t *timeTracerImpl) now() uint64 {
-	return uint64(time.Now().UnixNano())
+func now() time.Time {
+	return time.Now()
 }
 
-func (t *timeTracerImpl) Begin(name, desc string, thread tracer.Thread) {
-	t.beginAt(name, desc, t.now())
+func (t *timeTracerImpl) Begin(name, desc string, _ tracer.Thread) {
+	t.activeEvents = append(t.activeEvents, timeEvent{name: name, desc: desc, start: _now()})
 }
 
-func (t *timeTracerImpl) beginAt(name, desc string, atNanos uint64) {
-	t.activeEvents = append(t.activeEvents, timeEvent{name: name, desc: desc, atNanos: atNanos})
-}
-
-func (t *timeTracerImpl) End(thread tracer.Thread) soong_metrics_proto.PerfInfo {
-	return t.endAt(t.now())
-}
-
-func (t *timeTracerImpl) endAt(atNanos uint64) soong_metrics_proto.PerfInfo {
+func (t *timeTracerImpl) End(tracer.Thread) soong_metrics_proto.PerfInfo {
 	if len(t.activeEvents) < 1 {
 		panic("Internal error: No pending events for endAt to end!")
 	}
 	lastEvent := t.activeEvents[len(t.activeEvents)-1]
 	t.activeEvents = t.activeEvents[:len(t.activeEvents)-1]
-	realTime := atNanos - lastEvent.atNanos
+	realTime := uint64(_now().Sub(lastEvent.start).Nanoseconds())
 
 	return soong_metrics_proto.PerfInfo{
-		Desc:      &lastEvent.desc,
-		Name:      &lastEvent.name,
-		StartTime: &lastEvent.atNanos,
-		RealTime:  &realTime}
+		Desc:      proto.String(lastEvent.desc),
+		Name:      proto.String(lastEvent.name),
+		StartTime: proto.Uint64(uint64(lastEvent.start.UnixNano())),
+		RealTime:  proto.Uint64(realTime),
+	}
 }
diff --git a/ui/metrics/time_test.go b/ui/metrics/time_test.go
new file mode 100644
index 0000000..d73080a
--- /dev/null
+++ b/ui/metrics/time_test.go
@@ -0,0 +1,42 @@
+// Copyright 2020 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+package metrics
+
+import (
+	"testing"
+	"time"
+
+	"android/soong/ui/tracer"
+)
+
+func TestEnd(t *testing.T) {
+	startTime := time.Date(2020, time.July, 13, 13, 0, 0, 0, time.UTC)
+	dur := time.Nanosecond * 10
+	initialNow := _now
+	_now = func() time.Time { return startTime.Add(dur) }
+	defer func() { _now = initialNow }()
+
+	timeTracer := &timeTracerImpl{}
+	timeTracer.activeEvents = append(timeTracer.activeEvents, timeEvent{
+		desc:  "test",
+		name:  "test",
+		start: startTime,
+	})
+
+	perf := timeTracer.End(tracer.Thread(0))
+	if perf.GetRealTime() != uint64(dur.Nanoseconds()) {
+		t.Errorf("got %d, want %d nanoseconds for event duration", perf.GetRealTime(), dur.Nanoseconds())
+	}
+}
diff --git a/ui/terminal/Android.bp b/ui/terminal/Android.bp
index b533b0d..aa6e35d 100644
--- a/ui/terminal/Android.bp
+++ b/ui/terminal/Android.bp
@@ -17,7 +17,7 @@
     pkgPath: "android/soong/ui/terminal",
     deps: ["soong-ui-status"],
     srcs: [
-        "dumb_status.go",
+        "simple_status.go",
         "format.go",
         "smart_status.go",
         "status.go",
diff --git a/ui/terminal/dumb_status.go b/ui/terminal/simple_status.go
similarity index 70%
rename from ui/terminal/dumb_status.go
rename to ui/terminal/simple_status.go
index 201770f..4e8c568 100644
--- a/ui/terminal/dumb_status.go
+++ b/ui/terminal/simple_status.go
@@ -21,31 +21,31 @@
 	"android/soong/ui/status"
 )
 
-type dumbStatusOutput struct {
+type simpleStatusOutput struct {
 	writer    io.Writer
 	formatter formatter
 }
 
-// NewDumbStatusOutput returns a StatusOutput that represents the
+// NewSimpleStatusOutput returns a StatusOutput that represents the
 // current build status similarly to Ninja's built-in terminal
 // output.
-func NewDumbStatusOutput(w io.Writer, formatter formatter) status.StatusOutput {
-	return &dumbStatusOutput{
+func NewSimpleStatusOutput(w io.Writer, formatter formatter) status.StatusOutput {
+	return &simpleStatusOutput{
 		writer:    w,
 		formatter: formatter,
 	}
 }
 
-func (s *dumbStatusOutput) Message(level status.MsgLevel, message string) {
+func (s *simpleStatusOutput) Message(level status.MsgLevel, message string) {
 	if level >= status.StatusLvl {
 		fmt.Fprintln(s.writer, s.formatter.message(level, message))
 	}
 }
 
-func (s *dumbStatusOutput) StartAction(action *status.Action, counts status.Counts) {
+func (s *simpleStatusOutput) StartAction(action *status.Action, counts status.Counts) {
 }
 
-func (s *dumbStatusOutput) FinishAction(result status.ActionResult, counts status.Counts) {
+func (s *simpleStatusOutput) FinishAction(result status.ActionResult, counts status.Counts) {
 	str := result.Description
 	if str == "" {
 		str = result.Command
@@ -63,9 +63,9 @@
 	}
 }
 
-func (s *dumbStatusOutput) Flush() {}
+func (s *simpleStatusOutput) Flush() {}
 
-func (s *dumbStatusOutput) Write(p []byte) (int, error) {
+func (s *simpleStatusOutput) Write(p []byte) (int, error) {
 	fmt.Fprint(s.writer, string(p))
 	return len(p), nil
 }
diff --git a/ui/terminal/status.go b/ui/terminal/status.go
index 60dfc70..d8e7392 100644
--- a/ui/terminal/status.go
+++ b/ui/terminal/status.go
@@ -26,12 +26,12 @@
 //
 // statusFormat takes nearly all the same options as NINJA_STATUS.
 // %c is currently unsupported.
-func NewStatusOutput(w io.Writer, statusFormat string, forceDumbOutput, quietBuild bool) status.StatusOutput {
+func NewStatusOutput(w io.Writer, statusFormat string, forceSimpleOutput, quietBuild bool) status.StatusOutput {
 	formatter := newFormatter(statusFormat, quietBuild)
 
-	if !forceDumbOutput && isSmartTerminal(w) {
+	if !forceSimpleOutput && isSmartTerminal(w) {
 		return NewSmartStatusOutput(w, formatter)
 	} else {
-		return NewDumbStatusOutput(w, formatter)
+		return NewSimpleStatusOutput(w, formatter)
 	}
 }
diff --git a/ui/terminal/status_test.go b/ui/terminal/status_test.go
index 9f60829..aa69dff 100644
--- a/ui/terminal/status_test.go
+++ b/ui/terminal/status_test.go
@@ -26,64 +26,64 @@
 
 func TestStatusOutput(t *testing.T) {
 	tests := []struct {
-		name  string
-		calls func(stat status.StatusOutput)
-		smart string
-		dumb  string
+		name   string
+		calls  func(stat status.StatusOutput)
+		smart  string
+		simple string
 	}{
 		{
-			name:  "two actions",
-			calls: twoActions,
-			smart: "\r\x1b[1m[  0% 0/2] action1\x1b[0m\x1b[K\r\x1b[1m[ 50% 1/2] action1\x1b[0m\x1b[K\r\x1b[1m[ 50% 1/2] action2\x1b[0m\x1b[K\r\x1b[1m[100% 2/2] action2\x1b[0m\x1b[K\n",
-			dumb:  "[ 50% 1/2] action1\n[100% 2/2] action2\n",
+			name:   "two actions",
+			calls:  twoActions,
+			smart:  "\r\x1b[1m[  0% 0/2] action1\x1b[0m\x1b[K\r\x1b[1m[ 50% 1/2] action1\x1b[0m\x1b[K\r\x1b[1m[ 50% 1/2] action2\x1b[0m\x1b[K\r\x1b[1m[100% 2/2] action2\x1b[0m\x1b[K\n",
+			simple: "[ 50% 1/2] action1\n[100% 2/2] action2\n",
 		},
 		{
-			name:  "two parallel actions",
-			calls: twoParallelActions,
-			smart: "\r\x1b[1m[  0% 0/2] action1\x1b[0m\x1b[K\r\x1b[1m[  0% 0/2] action2\x1b[0m\x1b[K\r\x1b[1m[ 50% 1/2] action1\x1b[0m\x1b[K\r\x1b[1m[100% 2/2] action2\x1b[0m\x1b[K\n",
-			dumb:  "[ 50% 1/2] action1\n[100% 2/2] action2\n",
+			name:   "two parallel actions",
+			calls:  twoParallelActions,
+			smart:  "\r\x1b[1m[  0% 0/2] action1\x1b[0m\x1b[K\r\x1b[1m[  0% 0/2] action2\x1b[0m\x1b[K\r\x1b[1m[ 50% 1/2] action1\x1b[0m\x1b[K\r\x1b[1m[100% 2/2] action2\x1b[0m\x1b[K\n",
+			simple: "[ 50% 1/2] action1\n[100% 2/2] action2\n",
 		},
 		{
-			name:  "action with output",
-			calls: actionsWithOutput,
-			smart: "\r\x1b[1m[  0% 0/3] action1\x1b[0m\x1b[K\r\x1b[1m[ 33% 1/3] action1\x1b[0m\x1b[K\r\x1b[1m[ 33% 1/3] action2\x1b[0m\x1b[K\r\x1b[1m[ 66% 2/3] action2\x1b[0m\x1b[K\noutput1\noutput2\n\r\x1b[1m[ 66% 2/3] action3\x1b[0m\x1b[K\r\x1b[1m[100% 3/3] action3\x1b[0m\x1b[K\n",
-			dumb:  "[ 33% 1/3] action1\n[ 66% 2/3] action2\noutput1\noutput2\n[100% 3/3] action3\n",
+			name:   "action with output",
+			calls:  actionsWithOutput,
+			smart:  "\r\x1b[1m[  0% 0/3] action1\x1b[0m\x1b[K\r\x1b[1m[ 33% 1/3] action1\x1b[0m\x1b[K\r\x1b[1m[ 33% 1/3] action2\x1b[0m\x1b[K\r\x1b[1m[ 66% 2/3] action2\x1b[0m\x1b[K\noutput1\noutput2\n\r\x1b[1m[ 66% 2/3] action3\x1b[0m\x1b[K\r\x1b[1m[100% 3/3] action3\x1b[0m\x1b[K\n",
+			simple: "[ 33% 1/3] action1\n[ 66% 2/3] action2\noutput1\noutput2\n[100% 3/3] action3\n",
 		},
 		{
-			name:  "action with output without newline",
-			calls: actionsWithOutputWithoutNewline,
-			smart: "\r\x1b[1m[  0% 0/3] action1\x1b[0m\x1b[K\r\x1b[1m[ 33% 1/3] action1\x1b[0m\x1b[K\r\x1b[1m[ 33% 1/3] action2\x1b[0m\x1b[K\r\x1b[1m[ 66% 2/3] action2\x1b[0m\x1b[K\noutput1\noutput2\n\r\x1b[1m[ 66% 2/3] action3\x1b[0m\x1b[K\r\x1b[1m[100% 3/3] action3\x1b[0m\x1b[K\n",
-			dumb:  "[ 33% 1/3] action1\n[ 66% 2/3] action2\noutput1\noutput2\n[100% 3/3] action3\n",
+			name:   "action with output without newline",
+			calls:  actionsWithOutputWithoutNewline,
+			smart:  "\r\x1b[1m[  0% 0/3] action1\x1b[0m\x1b[K\r\x1b[1m[ 33% 1/3] action1\x1b[0m\x1b[K\r\x1b[1m[ 33% 1/3] action2\x1b[0m\x1b[K\r\x1b[1m[ 66% 2/3] action2\x1b[0m\x1b[K\noutput1\noutput2\n\r\x1b[1m[ 66% 2/3] action3\x1b[0m\x1b[K\r\x1b[1m[100% 3/3] action3\x1b[0m\x1b[K\n",
+			simple: "[ 33% 1/3] action1\n[ 66% 2/3] action2\noutput1\noutput2\n[100% 3/3] action3\n",
 		},
 		{
-			name:  "action with error",
-			calls: actionsWithError,
-			smart: "\r\x1b[1m[  0% 0/3] action1\x1b[0m\x1b[K\r\x1b[1m[ 33% 1/3] action1\x1b[0m\x1b[K\r\x1b[1m[ 33% 1/3] action2\x1b[0m\x1b[K\r\x1b[1m[ 66% 2/3] action2\x1b[0m\x1b[K\nFAILED: f1 f2\ntouch f1 f2\nerror1\nerror2\n\r\x1b[1m[ 66% 2/3] action3\x1b[0m\x1b[K\r\x1b[1m[100% 3/3] action3\x1b[0m\x1b[K\n",
-			dumb:  "[ 33% 1/3] action1\n[ 66% 2/3] action2\nFAILED: f1 f2\ntouch f1 f2\nerror1\nerror2\n[100% 3/3] action3\n",
+			name:   "action with error",
+			calls:  actionsWithError,
+			smart:  "\r\x1b[1m[  0% 0/3] action1\x1b[0m\x1b[K\r\x1b[1m[ 33% 1/3] action1\x1b[0m\x1b[K\r\x1b[1m[ 33% 1/3] action2\x1b[0m\x1b[K\r\x1b[1m[ 66% 2/3] action2\x1b[0m\x1b[K\nFAILED: f1 f2\ntouch f1 f2\nerror1\nerror2\n\r\x1b[1m[ 66% 2/3] action3\x1b[0m\x1b[K\r\x1b[1m[100% 3/3] action3\x1b[0m\x1b[K\n",
+			simple: "[ 33% 1/3] action1\n[ 66% 2/3] action2\nFAILED: f1 f2\ntouch f1 f2\nerror1\nerror2\n[100% 3/3] action3\n",
 		},
 		{
-			name:  "action with empty description",
-			calls: actionWithEmptyDescription,
-			smart: "\r\x1b[1m[  0% 0/1] command1\x1b[0m\x1b[K\r\x1b[1m[100% 1/1] command1\x1b[0m\x1b[K\n",
-			dumb:  "[100% 1/1] command1\n",
+			name:   "action with empty description",
+			calls:  actionWithEmptyDescription,
+			smart:  "\r\x1b[1m[  0% 0/1] command1\x1b[0m\x1b[K\r\x1b[1m[100% 1/1] command1\x1b[0m\x1b[K\n",
+			simple: "[100% 1/1] command1\n",
 		},
 		{
-			name:  "messages",
-			calls: actionsWithMessages,
-			smart: "\r\x1b[1m[  0% 0/2] action1\x1b[0m\x1b[K\r\x1b[1m[ 50% 1/2] action1\x1b[0m\x1b[K\r\x1b[1mstatus\x1b[0m\x1b[K\r\x1b[Kprint\nFAILED: error\n\r\x1b[1m[ 50% 1/2] action2\x1b[0m\x1b[K\r\x1b[1m[100% 2/2] action2\x1b[0m\x1b[K\n",
-			dumb:  "[ 50% 1/2] action1\nstatus\nprint\nFAILED: error\n[100% 2/2] action2\n",
+			name:   "messages",
+			calls:  actionsWithMessages,
+			smart:  "\r\x1b[1m[  0% 0/2] action1\x1b[0m\x1b[K\r\x1b[1m[ 50% 1/2] action1\x1b[0m\x1b[K\r\x1b[1mstatus\x1b[0m\x1b[K\r\x1b[Kprint\nFAILED: error\n\r\x1b[1m[ 50% 1/2] action2\x1b[0m\x1b[K\r\x1b[1m[100% 2/2] action2\x1b[0m\x1b[K\n",
+			simple: "[ 50% 1/2] action1\nstatus\nprint\nFAILED: error\n[100% 2/2] action2\n",
 		},
 		{
-			name:  "action with long description",
-			calls: actionWithLongDescription,
-			smart: "\r\x1b[1m[  0% 0/2] action with very long descrip\x1b[0m\x1b[K\r\x1b[1m[ 50% 1/2] action with very long descrip\x1b[0m\x1b[K\n",
-			dumb:  "[ 50% 1/2] action with very long description to test eliding\n",
+			name:   "action with long description",
+			calls:  actionWithLongDescription,
+			smart:  "\r\x1b[1m[  0% 0/2] action with very long descrip\x1b[0m\x1b[K\r\x1b[1m[ 50% 1/2] action with very long descrip\x1b[0m\x1b[K\n",
+			simple: "[ 50% 1/2] action with very long description to test eliding\n",
 		},
 		{
-			name:  "action with output with ansi codes",
-			calls: actionWithOuptutWithAnsiCodes,
-			smart: "\r\x1b[1m[  0% 0/1] action1\x1b[0m\x1b[K\r\x1b[1m[100% 1/1] action1\x1b[0m\x1b[K\n\x1b[31mcolor\x1b[0m\n",
-			dumb:  "[100% 1/1] action1\ncolor\n",
+			name:   "action with output with ansi codes",
+			calls:  actionWithOuptutWithAnsiCodes,
+			smart:  "\r\x1b[1m[  0% 0/1] action1\x1b[0m\x1b[K\r\x1b[1m[100% 1/1] action1\x1b[0m\x1b[K\n\x1b[31mcolor\x1b[0m\n",
+			simple: "[100% 1/1] action1\ncolor\n",
 		},
 	}
 
@@ -103,24 +103,24 @@
 				}
 			})
 
-			t.Run("dumb", func(t *testing.T) {
-				dumb := &bytes.Buffer{}
-				stat := NewStatusOutput(dumb, "", false, false)
+			t.Run("simple", func(t *testing.T) {
+				simple := &bytes.Buffer{}
+				stat := NewStatusOutput(simple, "", false, false)
 				tt.calls(stat)
 				stat.Flush()
 
-				if g, w := dumb.String(), tt.dumb; g != w {
+				if g, w := simple.String(), tt.simple; g != w {
 					t.Errorf("want:\n%q\ngot:\n%q", w, g)
 				}
 			})
 
-			t.Run("force dumb", func(t *testing.T) {
+			t.Run("force simple", func(t *testing.T) {
 				smart := &fakeSmartTerminal{termWidth: 40}
 				stat := NewStatusOutput(smart, "", true, false)
 				tt.calls(stat)
 				stat.Flush()
 
-				if g, w := smart.String(), tt.dumb; g != w {
+				if g, w := smart.String(), tt.simple; g != w {
 					t.Errorf("want:\n%q\ngot:\n%q", w, g)
 				}
 			})