Merge changes I275f0463,Ie736d7eb
* changes:
rust: handle modules with same crate_name
rust: validate existence of library source
diff --git a/android/sdk.go b/android/sdk.go
index 28f5cd5..9ea7ff4 100644
--- a/android/sdk.go
+++ b/android/sdk.go
@@ -327,6 +327,12 @@
// SdkAware and be added with an SdkMemberTypeDependencyTag tag.
HasTransitiveSdkMembers() bool
+ // Return true if prebuilt host artifacts may be specific to the host OS. Only
+ // applicable to modules where HostSupported() is true. If this is true,
+ // snapshots will list each host OS variant explicitly and disable all other
+ // host OS'es.
+ IsHostOsDependent() bool
+
// Add dependencies from the SDK module to all the module variants the member
// type contributes to the SDK. `names` is the list of module names given in
// the member type property (as returned by SdkPropertyName()) in the SDK
@@ -389,6 +395,7 @@
PropertyName string
SupportsSdk bool
TransitiveSdkMembers bool
+ HostOsDependent bool
}
func (b *SdkMemberTypeBase) SdkPropertyName() string {
@@ -403,6 +410,10 @@
return b.TransitiveSdkMembers
}
+func (b *SdkMemberTypeBase) IsHostOsDependent() bool {
+ return b.HostOsDependent
+}
+
// Encapsulates the information about registered SdkMemberTypes.
type SdkMemberTypesRegistry struct {
// The list of types sorted by property name.
diff --git a/cc/binary_sdk_member.go b/cc/binary_sdk_member.go
index 51d8b4e..337de55 100644
--- a/cc/binary_sdk_member.go
+++ b/cc/binary_sdk_member.go
@@ -29,7 +29,8 @@
var ccBinarySdkMemberType = &binarySdkMemberType{
SdkMemberTypeBase: android.SdkMemberTypeBase{
- PropertyName: "native_binaries",
+ PropertyName: "native_binaries",
+ HostOsDependent: true,
},
}
diff --git a/cc/library_headers.go b/cc/library_headers.go
index b7ab390..8b3dbeb 100644
--- a/cc/library_headers.go
+++ b/cc/library_headers.go
@@ -25,8 +25,9 @@
var headersLibrarySdkMemberType = &librarySdkMemberType{
SdkMemberTypeBase: android.SdkMemberTypeBase{
- PropertyName: "native_header_libs",
- SupportsSdk: true,
+ PropertyName: "native_header_libs",
+ SupportsSdk: true,
+ HostOsDependent: true,
},
prebuiltModuleType: "cc_prebuilt_library_headers",
noOutputFiles: true,
diff --git a/cc/library_sdk_member.go b/cc/library_sdk_member.go
index 4b9eb30..cff00b6 100644
--- a/cc/library_sdk_member.go
+++ b/cc/library_sdk_member.go
@@ -27,8 +27,9 @@
var sharedLibrarySdkMemberType = &librarySdkMemberType{
SdkMemberTypeBase: android.SdkMemberTypeBase{
- PropertyName: "native_shared_libs",
- SupportsSdk: true,
+ PropertyName: "native_shared_libs",
+ SupportsSdk: true,
+ HostOsDependent: true,
},
prebuiltModuleType: "cc_prebuilt_library_shared",
linkTypes: []string{"shared"},
@@ -36,8 +37,9 @@
var staticLibrarySdkMemberType = &librarySdkMemberType{
SdkMemberTypeBase: android.SdkMemberTypeBase{
- PropertyName: "native_static_libs",
- SupportsSdk: true,
+ PropertyName: "native_static_libs",
+ SupportsSdk: true,
+ HostOsDependent: true,
},
prebuiltModuleType: "cc_prebuilt_library_static",
linkTypes: []string{"static"},
@@ -45,8 +47,9 @@
var staticAndSharedLibrarySdkMemberType = &librarySdkMemberType{
SdkMemberTypeBase: android.SdkMemberTypeBase{
- PropertyName: "native_libs",
- SupportsSdk: true,
+ PropertyName: "native_libs",
+ SupportsSdk: true,
+ HostOsDependent: true,
},
prebuiltModuleType: "cc_prebuilt_library",
linkTypes: []string{"static", "shared"},
diff --git a/cc/vendor_snapshot.go b/cc/vendor_snapshot.go
index 0af2258..6df940c 100644
--- a/cc/vendor_snapshot.go
+++ b/cc/vendor_snapshot.go
@@ -484,18 +484,22 @@
var (
// Modules under following directories are ignored. They are OEM's and vendor's
- // proprietary modules(device/, vendor/, and hardware/).
+ // proprietary modules(device/, kernel/, vendor/, and hardware/).
// TODO(b/65377115): Clean up these with more maintainable way
vendorProprietaryDirs = []string{
"device",
+ "kernel",
"vendor",
"hardware",
}
// Modules under following directories are included as they are in AOSP,
- // although hardware/ is normally for vendor's own.
+ // although hardware/ and kernel/ are normally for vendor's own.
// TODO(b/65377115): Clean up these with more maintainable way
aospDirsUnderProprietary = []string{
+ "kernel/configs",
+ "kernel/prebuilts",
+ "kernel/tests",
"hardware/interfaces",
"hardware/libhardware",
"hardware/libhardware_legacy",
diff --git a/java/androidmk.go b/java/androidmk.go
index 081fcb2..650d126 100644
--- a/java/androidmk.go
+++ b/java/androidmk.go
@@ -127,8 +127,8 @@
entries.AddStrings("LOCAL_ADDITIONAL_CHECKED_MODULE", library.additionalCheckedModules.Strings()...)
}
- if library.proguardDictionary != nil {
- entries.SetPath("LOCAL_SOONG_PROGUARD_DICT", library.proguardDictionary)
+ if library.dexer.proguardDictionary.Valid() {
+ entries.SetPath("LOCAL_SOONG_PROGUARD_DICT", library.dexer.proguardDictionary.Path())
}
entries.SetString("LOCAL_MODULE_STEM", library.Stem())
@@ -332,8 +332,8 @@
if app.jacocoReportClassesFile != nil {
entries.SetPath("LOCAL_SOONG_JACOCO_REPORT_CLASSES_JAR", app.jacocoReportClassesFile)
}
- if app.proguardDictionary != nil {
- entries.SetPath("LOCAL_SOONG_PROGUARD_DICT", app.proguardDictionary)
+ if app.dexer.proguardDictionary.Valid() {
+ entries.SetPath("LOCAL_SOONG_PROGUARD_DICT", app.dexer.proguardDictionary.Path())
}
if app.Name() == "framework-res" {
diff --git a/java/app.go b/java/app.go
index 1ede34e..fcb2e99 100755
--- a/java/app.go
+++ b/java/app.go
@@ -588,11 +588,11 @@
func (a *AndroidApp) dexBuildActions(ctx android.ModuleContext) android.Path {
a.dexpreopter.installPath = a.installPath(ctx)
- if a.deviceProperties.Uncompress_dex == nil {
+ if a.dexProperties.Uncompress_dex == nil {
// If the value was not force-set by the user, use reasonable default based on the module.
- a.deviceProperties.Uncompress_dex = proptools.BoolPtr(a.shouldUncompressDex(ctx))
+ a.dexProperties.Uncompress_dex = proptools.BoolPtr(a.shouldUncompressDex(ctx))
}
- a.dexpreopter.uncompressedDex = *a.deviceProperties.Uncompress_dex
+ a.dexpreopter.uncompressedDex = *a.dexProperties.Uncompress_dex
a.dexpreopter.enforceUsesLibs = a.usesLibrary.enforceUsesLibraries()
a.dexpreopter.usesLibs = a.usesLibrary.usesLibraryProperties.Uses_libs
a.dexpreopter.optionalUsesLibs = a.usesLibrary.presentOptionalUsesLibs(ctx)
@@ -995,8 +995,8 @@
func AndroidAppFactory() android.Module {
module := &AndroidApp{}
- module.Module.deviceProperties.Optimize.EnabledByDefault = true
- module.Module.deviceProperties.Optimize.Shrink = proptools.BoolPtr(true)
+ module.Module.dexProperties.Optimize.EnabledByDefault = true
+ module.Module.dexProperties.Optimize.Shrink = proptools.BoolPtr(true)
module.Module.properties.Instrument = true
module.Module.properties.Installable = proptools.BoolPtr(true)
@@ -1110,7 +1110,7 @@
func AndroidTestFactory() android.Module {
module := &AndroidTest{}
- module.Module.deviceProperties.Optimize.EnabledByDefault = true
+ module.Module.dexProperties.Optimize.EnabledByDefault = true
module.Module.properties.Instrument = true
module.Module.properties.Installable = proptools.BoolPtr(true)
@@ -1161,7 +1161,7 @@
func AndroidTestHelperAppFactory() android.Module {
module := &AndroidTestHelperApp{}
- module.Module.deviceProperties.Optimize.EnabledByDefault = true
+ module.Module.dexProperties.Optimize.EnabledByDefault = true
module.Module.properties.Installable = proptools.BoolPtr(true)
module.appProperties.Use_embedded_native_libs = proptools.BoolPtr(true)
diff --git a/java/dex.go b/java/dex.go
index 9e61e95..cd45a93 100644
--- a/java/dex.go
+++ b/java/dex.go
@@ -24,6 +24,60 @@
"android/soong/remoteexec"
)
+type DexProperties struct {
+ // If set to true, compile dex regardless of installable. Defaults to false.
+ Compile_dex *bool
+
+ // list of module-specific flags that will be used for dex compiles
+ Dxflags []string `android:"arch_variant"`
+
+ Optimize struct {
+ // If false, disable all optimization. Defaults to true for android_app and android_test
+ // modules, false for java_library and java_test modules.
+ Enabled *bool
+ // True if the module containing this has it set by default.
+ EnabledByDefault bool `blueprint:"mutated"`
+
+ // If true, optimize for size by removing unused code. Defaults to true for apps,
+ // false for libraries and tests.
+ Shrink *bool
+
+ // If true, optimize bytecode. Defaults to false.
+ Optimize *bool
+
+ // If true, obfuscate bytecode. Defaults to false.
+ Obfuscate *bool
+
+ // If true, do not use the flag files generated by aapt that automatically keep
+ // classes referenced by the app manifest. Defaults to false.
+ No_aapt_flags *bool
+
+ // Flags to pass to proguard.
+ Proguard_flags []string
+
+ // Specifies the locations of files containing proguard flags.
+ Proguard_flags_files []string `android:"path"`
+ }
+
+ // Keep the data uncompressed. We always need uncompressed dex for execution,
+ // so this might actually save space by avoiding storing the same data twice.
+ // This defaults to reasonable value based on module and should not be set.
+ // It exists only to support ART tests.
+ Uncompress_dex *bool
+}
+
+type dexer struct {
+ dexProperties DexProperties
+
+ // list of extra proguard flag files
+ extraProguardFlagFiles android.Paths
+ proguardDictionary android.OptionalPath
+}
+
+func (d *dexer) effectiveOptimizeEnabled() bool {
+ return BoolDefault(d.dexProperties.Optimize.Enabled, d.dexProperties.Optimize.EnabledByDefault)
+}
+
var d8, d8RE = remoteexec.MultiCommandStaticRules(pctx, "d8",
blueprint.RuleParams{
Command: `rm -rf "$outDir" && mkdir -p "$outDir" && ` +
@@ -86,8 +140,8 @@
},
}, []string{"outDir", "outDict", "r8Flags", "zipFlags"}, []string{"implicits"})
-func (j *Module) dexCommonFlags(ctx android.ModuleContext) []string {
- flags := j.deviceProperties.Dxflags
+func (d *dexer) dexCommonFlags(ctx android.ModuleContext, minSdkVersion sdkSpec) []string {
+ flags := d.dexProperties.Dxflags
// Translate all the DX flags to D8 ones until all the build files have been migrated
// to D8 flags. See: b/69377755
flags = android.RemoveListFromList(flags,
@@ -103,30 +157,27 @@
"--verbose")
}
- minSdkVersion, err := j.minSdkVersion().effectiveVersion(ctx)
+ effectiveVersion, err := minSdkVersion.effectiveVersion(ctx)
if err != nil {
ctx.PropertyErrorf("min_sdk_version", "%s", err)
}
- flags = append(flags, "--min-api "+minSdkVersion.asNumberString())
+ flags = append(flags, "--min-api "+effectiveVersion.asNumberString())
return flags
}
-func (j *Module) d8Flags(ctx android.ModuleContext, flags javaBuilderFlags) ([]string, android.Paths) {
- d8Flags := j.dexCommonFlags(ctx)
-
+func d8Flags(flags javaBuilderFlags) (d8Flags []string, d8Deps android.Paths) {
d8Flags = append(d8Flags, flags.bootClasspath.FormRepeatedClassPath("--lib ")...)
d8Flags = append(d8Flags, flags.classpath.FormRepeatedClassPath("--lib ")...)
- var d8Deps android.Paths
d8Deps = append(d8Deps, flags.bootClasspath...)
d8Deps = append(d8Deps, flags.classpath...)
return d8Flags, d8Deps
}
-func (j *Module) r8Flags(ctx android.ModuleContext, flags javaBuilderFlags) (r8Flags []string, r8Deps android.Paths) {
- opt := j.deviceProperties.Optimize
+func (d *dexer) r8Flags(ctx android.ModuleContext, flags javaBuilderFlags) (r8Flags []string, r8Deps android.Paths) {
+ opt := d.dexProperties.Optimize
// When an app contains references to APIs that are not in the SDK specified by
// its LOCAL_SDK_VERSION for example added by support library or by runtime
@@ -140,8 +191,6 @@
proguardRaiseDeps = append(proguardRaiseDeps, dep.(Dependency).HeaderJars()...)
})
- r8Flags = append(r8Flags, j.dexCommonFlags(ctx)...)
-
r8Flags = append(r8Flags, proguardRaiseDeps.FormJavaClassPath("-libraryjars"))
r8Flags = append(r8Flags, flags.bootClasspath.FormJavaClassPath("-libraryjars"))
r8Flags = append(r8Flags, flags.classpath.FormJavaClassPath("-libraryjars"))
@@ -154,15 +203,10 @@
android.PathForSource(ctx, "build/make/core/proguard.flags"),
}
- if j.shouldInstrumentStatic(ctx) {
- flagFiles = append(flagFiles,
- android.PathForSource(ctx, "build/make/core/proguard.jacoco.flags"))
- }
-
- flagFiles = append(flagFiles, j.extraProguardFlagFiles...)
+ flagFiles = append(flagFiles, d.extraProguardFlagFiles...)
// TODO(ccross): static android library proguard files
- flagFiles = append(flagFiles, android.PathsForModuleSrc(ctx, j.deviceProperties.Optimize.Proguard_flags_files)...)
+ flagFiles = append(flagFiles, android.PathsForModuleSrc(ctx, opt.Proguard_flags_files)...)
r8Flags = append(r8Flags, android.JoinWithPrefix(flagFiles.Strings(), "-include "))
r8Deps = append(r8Deps, flagFiles...)
@@ -171,7 +215,7 @@
r8Deps = append(r8Deps, android.PathForSource(ctx,
"build/make/core/proguard_basic_keeps.flags"))
- r8Flags = append(r8Flags, j.deviceProperties.Optimize.Proguard_flags...)
+ r8Flags = append(r8Flags, opt.Proguard_flags...)
// TODO(ccross): Don't shrink app instrumentation tests by default.
if !Bool(opt.Shrink) {
@@ -197,29 +241,30 @@
return r8Flags, r8Deps
}
-func (j *Module) compileDex(ctx android.ModuleContext, flags javaBuilderFlags,
+func (d *dexer) compileDex(ctx android.ModuleContext, flags javaBuilderFlags, minSdkVersion sdkSpec,
classesJar android.Path, jarName string) android.ModuleOutPath {
- useR8 := j.deviceProperties.EffectiveOptimizeEnabled()
-
// Compile classes.jar into classes.dex and then javalib.jar
javalibJar := android.PathForModuleOut(ctx, "dex", jarName)
outDir := android.PathForModuleOut(ctx, "dex")
zipFlags := "--ignore_missing_files"
- if proptools.Bool(j.deviceProperties.Uncompress_dex) {
+ if proptools.Bool(d.dexProperties.Uncompress_dex) {
zipFlags += " -L 0"
}
+ commonFlags := d.dexCommonFlags(ctx, minSdkVersion)
+
+ useR8 := d.effectiveOptimizeEnabled()
if useR8 {
proguardDictionary := android.PathForModuleOut(ctx, "proguard_dictionary")
- j.proguardDictionary = proguardDictionary
- r8Flags, r8Deps := j.r8Flags(ctx, flags)
+ d.proguardDictionary = android.OptionalPathForPath(proguardDictionary)
+ r8Flags, r8Deps := d.r8Flags(ctx, flags)
rule := r8
args := map[string]string{
- "r8Flags": strings.Join(r8Flags, " "),
+ "r8Flags": strings.Join(append(commonFlags, r8Flags...), " "),
"zipFlags": zipFlags,
- "outDict": j.proguardDictionary.String(),
+ "outDict": proguardDictionary.String(),
"outDir": outDir.String(),
}
if ctx.Config().IsEnvTrue("RBE_R8") {
@@ -236,7 +281,7 @@
Args: args,
})
} else {
- d8Flags, d8Deps := j.d8Flags(ctx, flags)
+ d8Flags, d8Deps := d8Flags(flags)
rule := d8
if ctx.Config().IsEnvTrue("RBE_D8") {
rule = d8RE
@@ -248,13 +293,13 @@
Input: classesJar,
Implicits: d8Deps,
Args: map[string]string{
- "d8Flags": strings.Join(d8Flags, " "),
+ "d8Flags": strings.Join(append(commonFlags, d8Flags...), " "),
"zipFlags": zipFlags,
"outDir": outDir.String(),
},
})
}
- if proptools.Bool(j.deviceProperties.Uncompress_dex) {
+ if proptools.Bool(d.dexProperties.Uncompress_dex) {
alignedJavalibJar := android.PathForModuleOut(ctx, "aligned", jarName)
TransformZipAlign(ctx, alignedJavalibJar, javalibJar)
javalibJar = alignedJavalibJar
diff --git a/java/hiddenapi_singleton.go b/java/hiddenapi_singleton.go
index 7afba2a..1e6becb 100644
--- a/java/hiddenapi_singleton.go
+++ b/java/hiddenapi_singleton.go
@@ -248,18 +248,18 @@
FlagWithInput("--csv ", stubFlags).
Inputs(flagsCSV).
FlagWithInput("--unsupported ",
- android.PathForSource(ctx, "frameworks/base/config/hiddenapi-greylist.txt")).
+ android.PathForSource(ctx, "frameworks/base/config/hiddenapi-unsupported.txt")).
FlagWithInput("--unsupported-ignore-conflicts ", combinedRemovedApis).
FlagWithInput("--max-target-q ",
- android.PathForSource(ctx, "frameworks/base/config/hiddenapi-greylist-max-q.txt")).
+ android.PathForSource(ctx, "frameworks/base/config/hiddenapi-max-target-q.txt")).
FlagWithInput("--max-target-p ",
- android.PathForSource(ctx, "frameworks/base/config/hiddenapi-greylist-max-p.txt")).
+ android.PathForSource(ctx, "frameworks/base/config/hiddenapi-max-target-p.txt")).
FlagWithInput("--max-target-o-ignore-conflicts ",
- android.PathForSource(ctx, "frameworks/base/config/hiddenapi-greylist-max-o.txt")).
+ android.PathForSource(ctx, "frameworks/base/config/hiddenapi-max-target-o.txt")).
FlagWithInput("--blocked ",
- android.PathForSource(ctx, "frameworks/base/config/hiddenapi-force-blacklist.txt")).
+ android.PathForSource(ctx, "frameworks/base/config/hiddenapi-force-blocked.txt")).
FlagWithInput("--unsupported-packages ",
- android.PathForSource(ctx, "frameworks/base/config/hiddenapi-greylist-packages.txt")).
+ android.PathForSource(ctx, "frameworks/base/config/hiddenapi-unsupported-packages.txt")).
FlagWithOutput("--output ", tempPath)
commitChangeForRestat(rule, tempPath, outputPath)
diff --git a/java/java.go b/java/java.go
index bd476bc..d5375a5 100644
--- a/java/java.go
+++ b/java/java.go
@@ -264,9 +264,6 @@
}
type CompilerDeviceProperties struct {
- // list of module-specific flags that will be used for dex compiles
- Dxflags []string `android:"arch_variant"`
-
// if not blank, set to the version of the sdk to compile against.
// Defaults to compiling against the current platform.
Sdk_version *string
@@ -312,37 +309,6 @@
}
}
- // If set to true, compile dex regardless of installable. Defaults to false.
- Compile_dex *bool
-
- Optimize struct {
- // If false, disable all optimization. Defaults to true for android_app and android_test
- // modules, false for java_library and java_test modules.
- Enabled *bool
- // True if the module containing this has it set by default.
- EnabledByDefault bool `blueprint:"mutated"`
-
- // If true, optimize for size by removing unused code. Defaults to true for apps,
- // false for libraries and tests.
- Shrink *bool
-
- // If true, optimize bytecode. Defaults to false.
- Optimize *bool
-
- // If true, obfuscate bytecode. Defaults to false.
- Obfuscate *bool
-
- // If true, do not use the flag files generated by aapt that automatically keep
- // classes referenced by the app manifest. Defaults to false.
- No_aapt_flags *bool
-
- // Flags to pass to proguard.
- Proguard_flags []string
-
- // Specifies the locations of files containing proguard flags.
- Proguard_flags_files []string `android:"path"`
- }
-
// When targeting 1.9 and above, override the modules to use with --system,
// otherwise provides defaults libraries to add to the bootclasspath.
System_modules *string
@@ -356,19 +322,9 @@
// set the name of the output
Stem *string
- // Keep the data uncompressed. We always need uncompressed dex for execution,
- // so this might actually save space by avoiding storing the same data twice.
- // This defaults to reasonable value based on module and should not be set.
- // It exists only to support ART tests.
- Uncompress_dex *bool
-
IsSDKLibrary bool `blueprint:"mutated"`
}
-func (me *CompilerDeviceProperties) EffectiveOptimizeEnabled() bool {
- return BoolDefault(me.Optimize.Enabled, me.Optimize.EnabledByDefault)
-}
-
// Functionality common to Module and Import
//
// It is embedded in Module so its functionality can be used by methods in Module
@@ -437,9 +393,6 @@
// output file containing uninstrumented classes that will be instrumented by jacoco
jacocoReportClassesFile android.Path
- // output file containing mapping of obfuscated names
- proguardDictionary android.Path
-
// output file of the module, which may be a classes jar or a dex jar
outputFile android.Path
extraOutputFiles android.Paths
@@ -455,9 +408,6 @@
compiledJavaSrcs android.Paths
compiledSrcJars android.Paths
- // list of extra progurad flag files
- extraProguardFlagFiles android.Paths
-
// manifest file to use instead of properties.Manifest
overrideManifest android.OptionalPath
@@ -484,6 +434,7 @@
extraResources android.Paths
hiddenAPI
+ dexer
dexpreopter
linter
@@ -507,6 +458,7 @@
j.addHostProperties()
j.AddProperties(
&j.deviceProperties,
+ &j.dexer.dexProperties,
&j.dexpreoptProperties,
&j.linter.properties,
)
@@ -519,7 +471,10 @@
case ".jar":
return android.Paths{j.implementationAndResourcesJar}, nil
case ".proguard_map":
- return android.Paths{j.proguardDictionary}, nil
+ if j.dexer.proguardDictionary.Valid() {
+ return android.Paths{j.dexer.proguardDictionary.Path()}, nil
+ }
+ return nil, fmt.Errorf("%q was requested, but no output file was found.", tag)
default:
return nil, fmt.Errorf("unsupported module reference tag %q", tag)
}
@@ -728,10 +683,10 @@
ctx.AddVariationDependencies(nil, bootClasspathTag, sdkDep.bootclasspath...)
ctx.AddVariationDependencies(nil, java9LibTag, sdkDep.java9Classpath...)
ctx.AddVariationDependencies(nil, libTag, sdkDep.classpath...)
- if j.deviceProperties.EffectiveOptimizeEnabled() && sdkDep.hasStandardLibs() {
+ if j.effectiveOptimizeEnabled() && sdkDep.hasStandardLibs() {
ctx.AddVariationDependencies(nil, proguardRaiseTag, config.LegacyCorePlatformBootclasspathLibraries...)
}
- if j.deviceProperties.EffectiveOptimizeEnabled() && sdkDep.hasFrameworkLibs() {
+ if j.effectiveOptimizeEnabled() && sdkDep.hasFrameworkLibs() {
ctx.AddVariationDependencies(nil, proguardRaiseTag, config.FrameworkLibraries...)
}
}
@@ -1647,8 +1602,8 @@
// Enable dex compilation for the APEX variants, unless it is disabled explicitly
if android.DirectlyInAnyApex(ctx, ctx.ModuleName()) && !j.IsForPlatform() {
- if j.deviceProperties.Compile_dex == nil {
- j.deviceProperties.Compile_dex = proptools.BoolPtr(true)
+ if j.dexProperties.Compile_dex == nil {
+ j.dexProperties.Compile_dex = proptools.BoolPtr(true)
}
if j.deviceProperties.Hostdex == nil {
j.deviceProperties.Hostdex = proptools.BoolPtr(true)
@@ -1656,10 +1611,14 @@
}
if ctx.Device() && j.hasCode(ctx) &&
- (Bool(j.properties.Installable) || Bool(j.deviceProperties.Compile_dex)) {
+ (Bool(j.properties.Installable) || Bool(j.dexProperties.Compile_dex)) {
+ if j.shouldInstrumentStatic(ctx) {
+ j.dexer.extraProguardFlagFiles = append(j.dexer.extraProguardFlagFiles,
+ android.PathForSource(ctx, "build/make/core/proguard.jacoco.flags"))
+ }
// Dex compilation
var dexOutputFile android.ModuleOutPath
- dexOutputFile = j.compileDex(ctx, flags, outputFile, jarName)
+ dexOutputFile = j.dexer.compileDex(ctx, flags, j.minSdkVersion(), outputFile, jarName)
if ctx.Failed() {
return
}
@@ -1669,7 +1628,7 @@
// Hidden API CSV generation and dex encoding
dexOutputFile = j.hiddenAPI.hiddenAPI(ctx, configurationName, primary, dexOutputFile, j.implementationJarFile,
- proptools.Bool(j.deviceProperties.Uncompress_dex))
+ proptools.Bool(j.dexProperties.Uncompress_dex))
// merge dex jar with resources if necessary
if j.resourceJar != nil {
@@ -1677,7 +1636,7 @@
combinedJar := android.PathForModuleOut(ctx, "dex-withres", jarName)
TransformJarsToJar(ctx, combinedJar, "for dex resources", jars, android.OptionalPath{},
false, nil, nil)
- if *j.deviceProperties.Uncompress_dex {
+ if *j.dexProperties.Uncompress_dex {
combinedAlignedJar := android.PathForModuleOut(ctx, "dex-withres-aligned", jarName)
TransformZipAlign(ctx, combinedAlignedJar, combinedJar)
dexOutputFile = combinedAlignedJar
@@ -2008,11 +1967,11 @@
j.checkSdkVersions(ctx)
j.dexpreopter.installPath = android.PathForModuleInstall(ctx, "framework", j.Stem()+".jar")
j.dexpreopter.isSDKLibrary = j.deviceProperties.IsSDKLibrary
- if j.deviceProperties.Uncompress_dex == nil {
+ if j.dexProperties.Uncompress_dex == nil {
// If the value was not force-set by the user, use reasonable default based on the module.
- j.deviceProperties.Uncompress_dex = proptools.BoolPtr(shouldUncompressDex(ctx, &j.dexpreopter))
+ j.dexProperties.Uncompress_dex = proptools.BoolPtr(shouldUncompressDex(ctx, &j.dexpreopter))
}
- j.dexpreopter.uncompressedDex = *j.deviceProperties.Uncompress_dex
+ j.dexpreopter.uncompressedDex = *j.dexProperties.Uncompress_dex
j.compile(ctx, nil)
// Collect the module directory for IDE info in java/jdeps.go.
@@ -2970,6 +2929,7 @@
module.AddProperties(
&CompilerProperties{},
&CompilerDeviceProperties{},
+ &DexProperties{},
&DexpreoptProperties{},
&android.ProtoProperties{},
&aaptProperties{},
diff --git a/java/sdk_library.go b/java/sdk_library.go
index 8a8d0c9..0379a31 100644
--- a/java/sdk_library.go
+++ b/java/sdk_library.go
@@ -1112,6 +1112,7 @@
&module.properties,
&module.protoProperties,
&module.deviceProperties,
+ &module.dexProperties,
&module.dexpreoptProperties,
&module.linter.properties,
&props,
@@ -1171,8 +1172,8 @@
// We compile the stubs for 1.8 in line with the main android.jar stubs, and potential
// interop with older developer tools that don't support 1.9.
props.Java_version = proptools.StringPtr("1.8")
- if module.deviceProperties.Compile_dex != nil {
- props.Compile_dex = module.deviceProperties.Compile_dex
+ if module.dexProperties.Compile_dex != nil {
+ props.Compile_dex = module.dexProperties.Compile_dex
}
// Dist the class jar artifact for sdk builds.
diff --git a/rust/bindgen.go b/rust/bindgen.go
index 559adff..403f466 100644
--- a/rust/bindgen.go
+++ b/rust/bindgen.go
@@ -178,6 +178,7 @@
module.sourceProvider = bindgen
module.compiler = library
+ module.setClippy(false)
return module, bindgen
}
diff --git a/rust/rust.go b/rust/rust.go
index 1192836..0195247 100644
--- a/rust/rust.go
+++ b/rust/rust.go
@@ -1037,6 +1037,12 @@
return name
}
+func (mod *Module) setClippy(clippy bool) {
+ if mod.clippy != nil {
+ mod.clippy.Properties.Clippy = proptools.BoolPtr(clippy)
+ }
+}
+
var _ android.HostToolProvider = (*Module)(nil)
func (mod *Module) HostToolPath() android.OptionalPath {
diff --git a/sdk/cc_sdk_test.go b/sdk/cc_sdk_test.go
index 17afdb8..9501d88 100644
--- a/sdk/cc_sdk_test.go
+++ b/sdk/cc_sdk_test.go
@@ -39,6 +39,20 @@
// Contains tests for SDK members provided by the cc package.
+func TestSingleDeviceOsAssumption(t *testing.T) {
+ // Mock a module with DeviceSupported() == true.
+ s := &sdk{}
+ android.InitAndroidArchModule(s, android.DeviceSupported, android.MultilibCommon)
+
+ osTypes := s.getPossibleOsTypes()
+ if len(osTypes) != 1 {
+ // The snapshot generation assumes there is a single device OS. If more are
+ // added it might need to disable them by default, like it does for host
+ // OS'es.
+ t.Errorf("expected a single device OS, got %v", osTypes)
+ }
+}
+
func TestSdkIsCompileMultilibBoth(t *testing.T) {
result := testSdkWithCc(t, `
sdk {
@@ -99,9 +113,15 @@
stl: "none",
compile_multilib: "64",
target: {
+ host: {
+ enabled: false,
+ },
android_arm64: {
srcs: ["android/arm64/lib/sdkmember.so"],
},
+ linux_glibc: {
+ enabled: true,
+ },
linux_glibc_x86_64: {
srcs: ["linux_glibc/x86_64/lib/sdkmember.so"],
},
@@ -115,9 +135,15 @@
stl: "none",
compile_multilib: "64",
target: {
+ host: {
+ enabled: false,
+ },
android_arm64: {
srcs: ["android/arm64/lib/sdkmember.so"],
},
+ linux_glibc: {
+ enabled: true,
+ },
linux_glibc_x86_64: {
srcs: ["linux_glibc/x86_64/lib/sdkmember.so"],
},
@@ -129,6 +155,14 @@
host_supported: true,
native_shared_libs: ["mysdk_sdkmember@current"],
compile_multilib: "64",
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ },
}
`),
checkAllCopyRules(`
@@ -573,7 +607,11 @@
installable: false,
stl: "none",
target: {
+ host: {
+ enabled: false,
+ },
linux_glibc: {
+ enabled: true,
compile_multilib: "both",
},
linux_glibc_x86_64: {
@@ -583,6 +621,7 @@
srcs: ["linux_glibc/x86/bin/mynativebinary"],
},
windows: {
+ enabled: true,
compile_multilib: "64",
},
windows_x86_64: {
@@ -598,7 +637,11 @@
host_supported: true,
stl: "none",
target: {
+ host: {
+ enabled: false,
+ },
linux_glibc: {
+ enabled: true,
compile_multilib: "both",
},
linux_glibc_x86_64: {
@@ -608,6 +651,7 @@
srcs: ["linux_glibc/x86/bin/mynativebinary"],
},
windows: {
+ enabled: true,
compile_multilib: "64",
},
windows_x86_64: {
@@ -622,7 +666,14 @@
host_supported: true,
native_binaries: ["myexports_mynativebinary@current"],
target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
windows: {
+ enabled: true,
compile_multilib: "64",
},
},
@@ -636,6 +687,162 @@
)
}
+func TestSnapshotWithSingleHostOsType(t *testing.T) {
+ ctx, config := testSdkContext(`
+ cc_defaults {
+ name: "mydefaults",
+ device_supported: false,
+ host_supported: true,
+ compile_multilib: "64",
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_bionic: {
+ enabled: true,
+ },
+ },
+ }
+
+ module_exports {
+ name: "myexports",
+ defaults: ["mydefaults"],
+ native_shared_libs: ["mynativelib"],
+ native_binaries: ["mynativebinary"],
+ compile_multilib: "64", // The built-in default in sdk.go overrides mydefaults.
+ }
+
+ cc_library {
+ name: "mynativelib",
+ defaults: ["mydefaults"],
+ srcs: [
+ "Test.cpp",
+ ],
+ stl: "none",
+ }
+
+ cc_binary {
+ name: "mynativebinary",
+ defaults: ["mydefaults"],
+ srcs: [
+ "Test.cpp",
+ ],
+ stl: "none",
+ }
+ `, ccTestFs, []android.OsType{android.LinuxBionic})
+
+ result := runTests(t, ctx, config)
+
+ result.CheckSnapshot("myexports", "",
+ checkAndroidBpContents(`
+// This is auto-generated. DO NOT EDIT.
+
+cc_prebuilt_binary {
+ name: "myexports_mynativebinary@current",
+ sdk_member_name: "mynativebinary",
+ device_supported: false,
+ host_supported: true,
+ installable: false,
+ stl: "none",
+ compile_multilib: "64",
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_bionic: {
+ enabled: true,
+ },
+ linux_bionic_x86_64: {
+ srcs: ["x86_64/bin/mynativebinary"],
+ },
+ },
+}
+
+cc_prebuilt_binary {
+ name: "mynativebinary",
+ prefer: false,
+ device_supported: false,
+ host_supported: true,
+ stl: "none",
+ compile_multilib: "64",
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_bionic: {
+ enabled: true,
+ },
+ linux_bionic_x86_64: {
+ srcs: ["x86_64/bin/mynativebinary"],
+ },
+ },
+}
+
+cc_prebuilt_library_shared {
+ name: "myexports_mynativelib@current",
+ sdk_member_name: "mynativelib",
+ device_supported: false,
+ host_supported: true,
+ installable: false,
+ stl: "none",
+ compile_multilib: "64",
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_bionic: {
+ enabled: true,
+ },
+ linux_bionic_x86_64: {
+ srcs: ["x86_64/lib/mynativelib.so"],
+ },
+ },
+}
+
+cc_prebuilt_library_shared {
+ name: "mynativelib",
+ prefer: false,
+ device_supported: false,
+ host_supported: true,
+ stl: "none",
+ compile_multilib: "64",
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_bionic: {
+ enabled: true,
+ },
+ linux_bionic_x86_64: {
+ srcs: ["x86_64/lib/mynativelib.so"],
+ },
+ },
+}
+
+module_exports_snapshot {
+ name: "myexports@current",
+ device_supported: false,
+ host_supported: true,
+ native_binaries: ["myexports_mynativebinary@current"],
+ native_shared_libs: ["myexports_mynativelib@current"],
+ compile_multilib: "64",
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_bionic: {
+ enabled: true,
+ },
+ },
+}
+`),
+ checkAllCopyRules(`
+.intermediates/mynativebinary/linux_bionic_x86_64/mynativebinary -> x86_64/bin/mynativebinary
+.intermediates/mynativelib/linux_bionic_x86_64_shared/mynativelib.so -> x86_64/lib/mynativelib.so
+`),
+ )
+}
+
// Test that we support the necessary flags for the linker binary, which is
// special in several ways.
func TestSnapshotWithCcStaticNocrtBinary(t *testing.T) {
@@ -674,11 +881,17 @@
compile_multilib: "both",
static_executable: true,
nocrt: true,
- arch: {
- x86_64: {
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ linux_glibc_x86_64: {
srcs: ["x86_64/bin/linker"],
},
- x86: {
+ linux_glibc_x86: {
srcs: ["x86/bin/linker"],
},
},
@@ -693,11 +906,17 @@
compile_multilib: "both",
static_executable: true,
nocrt: true,
- arch: {
- x86_64: {
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ linux_glibc_x86_64: {
srcs: ["x86_64/bin/linker"],
},
- x86: {
+ linux_glibc_x86: {
srcs: ["x86/bin/linker"],
},
},
@@ -708,6 +927,14 @@
device_supported: false,
host_supported: true,
native_binaries: ["mymodule_exports_linker@current"],
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ },
}
`),
checkAllCopyRules(`
@@ -1034,12 +1261,18 @@
stl: "none",
compile_multilib: "both",
export_include_dirs: ["include/include"],
- arch: {
- x86_64: {
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ linux_glibc_x86_64: {
srcs: ["x86_64/lib/mynativelib.so"],
export_include_dirs: ["x86_64/include_gen/mynativelib"],
},
- x86: {
+ linux_glibc_x86: {
srcs: ["x86/lib/mynativelib.so"],
export_include_dirs: ["x86/include_gen/mynativelib"],
},
@@ -1055,12 +1288,18 @@
stl: "none",
compile_multilib: "both",
export_include_dirs: ["include/include"],
- arch: {
- x86_64: {
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ linux_glibc_x86_64: {
srcs: ["x86_64/lib/mynativelib.so"],
export_include_dirs: ["x86_64/include_gen/mynativelib"],
},
- x86: {
+ linux_glibc_x86: {
srcs: ["x86/lib/mynativelib.so"],
export_include_dirs: ["x86/include_gen/mynativelib"],
},
@@ -1072,6 +1311,14 @@
device_supported: false,
host_supported: true,
native_shared_libs: ["mysdk_mynativelib@current"],
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ },
}
`),
checkAllCopyRules(`
@@ -1130,7 +1377,11 @@
installable: false,
stl: "none",
target: {
+ host: {
+ enabled: false,
+ },
linux_glibc: {
+ enabled: true,
compile_multilib: "both",
},
linux_glibc_x86_64: {
@@ -1140,6 +1391,7 @@
srcs: ["linux_glibc/x86/lib/mynativelib.so"],
},
windows: {
+ enabled: true,
compile_multilib: "64",
},
windows_x86_64: {
@@ -1155,7 +1407,11 @@
host_supported: true,
stl: "none",
target: {
+ host: {
+ enabled: false,
+ },
linux_glibc: {
+ enabled: true,
compile_multilib: "both",
},
linux_glibc_x86_64: {
@@ -1165,6 +1421,7 @@
srcs: ["linux_glibc/x86/lib/mynativelib.so"],
},
windows: {
+ enabled: true,
compile_multilib: "64",
},
windows_x86_64: {
@@ -1179,7 +1436,14 @@
host_supported: true,
native_shared_libs: ["mysdk_mynativelib@current"],
target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
windows: {
+ enabled: true,
compile_multilib: "64",
},
},
@@ -1312,12 +1576,18 @@
stl: "none",
compile_multilib: "both",
export_include_dirs: ["include/include"],
- arch: {
- x86_64: {
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ linux_glibc_x86_64: {
srcs: ["x86_64/lib/mynativelib.a"],
export_include_dirs: ["x86_64/include_gen/mynativelib"],
},
- x86: {
+ linux_glibc_x86: {
srcs: ["x86/lib/mynativelib.a"],
export_include_dirs: ["x86/include_gen/mynativelib"],
},
@@ -1332,12 +1602,18 @@
stl: "none",
compile_multilib: "both",
export_include_dirs: ["include/include"],
- arch: {
- x86_64: {
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ linux_glibc_x86_64: {
srcs: ["x86_64/lib/mynativelib.a"],
export_include_dirs: ["x86_64/include_gen/mynativelib"],
},
- x86: {
+ linux_glibc_x86: {
srcs: ["x86/lib/mynativelib.a"],
export_include_dirs: ["x86/include_gen/mynativelib"],
},
@@ -1349,6 +1625,14 @@
device_supported: false,
host_supported: true,
native_static_libs: ["myexports_mynativelib@current"],
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ },
}
`),
checkAllCopyRules(`
@@ -1496,8 +1780,14 @@
stl: "none",
compile_multilib: "64",
export_include_dirs: ["include/include"],
- arch: {
- x86_64: {
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ linux_glibc_x86_64: {
srcs: ["x86_64/lib/mynativelib.a"],
export_include_dirs: ["x86_64/include_gen/mynativelib"],
},
@@ -1512,8 +1802,14 @@
stl: "none",
compile_multilib: "64",
export_include_dirs: ["include/include"],
- arch: {
- x86_64: {
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ linux_glibc_x86_64: {
srcs: ["x86_64/lib/mynativelib.a"],
export_include_dirs: ["x86_64/include_gen/mynativelib"],
},
@@ -1526,6 +1822,14 @@
host_supported: true,
native_static_libs: ["myexports_mynativelib@current"],
compile_multilib: "64",
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ },
}`),
checkAllCopyRules(`
include/Test.h -> include/include/Test.h
@@ -1612,6 +1916,14 @@
stl: "none",
compile_multilib: "both",
export_include_dirs: ["include/include"],
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ },
}
cc_prebuilt_library_headers {
@@ -1622,6 +1934,14 @@
stl: "none",
compile_multilib: "both",
export_include_dirs: ["include/include"],
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ },
}
sdk_snapshot {
@@ -1629,6 +1949,14 @@
device_supported: false,
host_supported: true,
native_header_libs: ["mysdk_mynativeheaders@current"],
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ },
}
`),
checkAllCopyRules(`
@@ -1673,10 +2001,14 @@
compile_multilib: "both",
export_system_include_dirs: ["common_os/include/include"],
target: {
+ host: {
+ enabled: false,
+ },
android: {
export_include_dirs: ["android/include/include-android"],
},
linux_glibc: {
+ enabled: true,
export_include_dirs: ["linux_glibc/include/include-host"],
},
},
@@ -1690,10 +2022,14 @@
compile_multilib: "both",
export_system_include_dirs: ["common_os/include/include"],
target: {
+ host: {
+ enabled: false,
+ },
android: {
export_include_dirs: ["android/include/include-android"],
},
linux_glibc: {
+ enabled: true,
export_include_dirs: ["linux_glibc/include/include-host"],
},
},
@@ -1703,6 +2039,14 @@
name: "mysdk@current",
host_supported: true,
native_header_libs: ["mysdk_mynativeheaders@current"],
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ },
}
`),
checkAllCopyRules(`
@@ -1870,6 +2214,9 @@
installable: false,
compile_multilib: "both",
target: {
+ host: {
+ enabled: false,
+ },
android: {
system_shared_libs: [],
},
@@ -1879,6 +2226,9 @@
android_arm: {
srcs: ["android/arm/lib/sslvariants.so"],
},
+ linux_glibc: {
+ enabled: true,
+ },
linux_glibc_x86_64: {
srcs: ["linux_glibc/x86_64/lib/sslvariants.so"],
},
@@ -1894,6 +2244,9 @@
host_supported: true,
compile_multilib: "both",
target: {
+ host: {
+ enabled: false,
+ },
android: {
system_shared_libs: [],
},
@@ -1903,6 +2256,9 @@
android_arm: {
srcs: ["android/arm/lib/sslvariants.so"],
},
+ linux_glibc: {
+ enabled: true,
+ },
linux_glibc_x86_64: {
srcs: ["linux_glibc/x86_64/lib/sslvariants.so"],
},
@@ -1916,6 +2272,14 @@
name: "mysdk@current",
host_supported: true,
native_shared_libs: ["mysdk_sslvariants@current"],
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ },
}
`))
}
@@ -2025,12 +2389,18 @@
versions: ["3"],
},
target: {
+ host: {
+ enabled: false,
+ },
android_arm64: {
srcs: ["android/arm64/lib/stubslib.so"],
},
android_arm: {
srcs: ["android/arm/lib/stubslib.so"],
},
+ linux_glibc: {
+ enabled: true,
+ },
linux_glibc_x86_64: {
srcs: ["linux_glibc/x86_64/lib/stubslib.so"],
},
@@ -2049,12 +2419,18 @@
versions: ["3"],
},
target: {
+ host: {
+ enabled: false,
+ },
android_arm64: {
srcs: ["android/arm64/lib/stubslib.so"],
},
android_arm: {
srcs: ["android/arm/lib/stubslib.so"],
},
+ linux_glibc: {
+ enabled: true,
+ },
linux_glibc_x86_64: {
srcs: ["linux_glibc/x86_64/lib/stubslib.so"],
},
@@ -2068,6 +2444,14 @@
name: "mysdk@current",
host_supported: true,
native_shared_libs: ["mysdk_stubslib@current"],
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ },
}
`))
}
@@ -2099,12 +2483,18 @@
unique_host_soname: true,
compile_multilib: "both",
target: {
+ host: {
+ enabled: false,
+ },
android_arm64: {
srcs: ["android/arm64/lib/mylib.so"],
},
android_arm: {
srcs: ["android/arm/lib/mylib.so"],
},
+ linux_glibc: {
+ enabled: true,
+ },
linux_glibc_x86_64: {
srcs: ["linux_glibc/x86_64/lib/mylib-host.so"],
},
@@ -2121,12 +2511,18 @@
unique_host_soname: true,
compile_multilib: "both",
target: {
+ host: {
+ enabled: false,
+ },
android_arm64: {
srcs: ["android/arm64/lib/mylib.so"],
},
android_arm: {
srcs: ["android/arm/lib/mylib.so"],
},
+ linux_glibc: {
+ enabled: true,
+ },
linux_glibc_x86_64: {
srcs: ["linux_glibc/x86_64/lib/mylib-host.so"],
},
@@ -2140,6 +2536,14 @@
name: "mysdk@current",
host_supported: true,
native_shared_libs: ["mysdk_mylib@current"],
+ target: {
+ host: {
+ enabled: false,
+ },
+ linux_glibc: {
+ enabled: true,
+ },
+ },
}
`),
checkAllCopyRules(`
diff --git a/sdk/update.go b/sdk/update.go
index 25d50d2..936696a 100644
--- a/sdk/update.go
+++ b/sdk/update.go
@@ -262,7 +262,7 @@
memberCtx := &memberContext{ctx, builder, memberType, member.name}
prebuiltModule := memberType.AddPrebuiltModule(memberCtx, member)
- s.createMemberSnapshot(memberCtx, member, prebuiltModule)
+ s.createMemberSnapshot(memberCtx, member, prebuiltModule.(*bpModule))
}
// Create a transformer that will transform an unversioned module into a versioned module.
@@ -345,12 +345,37 @@
snapshotModule.AddProperty("compile_multilib", commonVariantProperties.Compile_multilib)
}
- // Iterate over the os types in a fixed order.
targetPropertySet := snapshotModule.AddPropertySet("target")
+
+ // If host is supported and any member is host OS dependent then disable host
+ // by default, so that we can enable each host OS variant explicitly. This
+ // avoids problems with implicitly enabled OS variants when the snapshot is
+ // used, which might be different from this run (e.g. different build OS).
+ hasHostOsDependentMember := false
+ if s.HostSupported() {
+ for _, memberRef := range memberRefs {
+ if memberRef.memberType.IsHostOsDependent() {
+ hasHostOsDependentMember = true
+ break
+ }
+ }
+ if hasHostOsDependentMember {
+ hostPropertySet := targetPropertySet.AddPropertySet("host")
+ hostPropertySet.AddProperty("enabled", false)
+ }
+ }
+
+ // Iterate over the os types in a fixed order.
for _, osType := range s.getPossibleOsTypes() {
if sdkVariant, ok := osTypeToMemberProperties[osType]; ok {
osPropertySet := targetPropertySet.AddPropertySet(sdkVariant.Target().Os.Name)
+ // Enable the variant explicitly when we've disabled it by default on host.
+ if hasHostOsDependentMember &&
+ (osType.Class == android.Host || osType.Class == android.HostCross) {
+ osPropertySet.AddProperty("enabled", true)
+ }
+
variantProps := variantToProperties[sdkVariant]
if variantProps.Compile_multilib != "" && variantProps.Compile_multilib != "both" {
osPropertySet.AddProperty("compile_multilib", variantProps.Compile_multilib)
@@ -993,9 +1018,12 @@
var osPropertySet android.BpPropertySet
var archPropertySet android.BpPropertySet
var archOsPrefix string
- if osInfo.Properties.Base().Os_count == 1 {
- // There is only one os type present in the variants so don't bother
- // with adding target specific properties.
+ if osInfo.Properties.Base().Os_count == 1 &&
+ (osInfo.osType.Class == android.Device || !ctx.memberType.IsHostOsDependent()) {
+ // There is only one OS type present in the variants and it shouldn't have a
+ // variant-specific target. The latter is the case if it's either for device
+ // where there is only one OS (android), or for host and the member type
+ // isn't host OS dependent.
// Create a structure that looks like:
// module_type {
@@ -1032,6 +1060,12 @@
osPropertySet = targetPropertySet.AddPropertySet(osType.Name)
archPropertySet = targetPropertySet
+ // Enable the variant explicitly when we've disabled it by default on host.
+ if ctx.memberType.IsHostOsDependent() &&
+ (osType.Class == android.Host || osType.Class == android.HostCross) {
+ osPropertySet.AddProperty("enabled", true)
+ }
+
// Arch specific properties need to be added to an os and arch specific
// section prefixed with <os>_.
archOsPrefix = osType.Name + "_"
@@ -1202,7 +1236,7 @@
return m.name
}
-func (s *sdk) createMemberSnapshot(ctx *memberContext, member *sdkMember, bpModule android.BpModule) {
+func (s *sdk) createMemberSnapshot(ctx *memberContext, member *sdkMember, bpModule *bpModule) {
memberType := member.memberType
@@ -1256,6 +1290,18 @@
// added.
targetPropertySet := bpModule.AddPropertySet("target")
+ // If the member is host OS dependent and has host_supported then disable by
+ // default and enable each host OS variant explicitly. This avoids problems
+ // with implicitly enabled OS variants when the snapshot is used, which might
+ // be different from this run (e.g. different build OS).
+ if ctx.memberType.IsHostOsDependent() {
+ hostSupported := bpModule.getValue("host_supported") == true // Missing means false.
+ if hostSupported {
+ hostPropertySet := targetPropertySet.AddPropertySet("host")
+ hostPropertySet.AddProperty("enabled", false)
+ }
+ }
+
// Iterate over the os types in a fixed order.
for _, osType := range s.getPossibleOsTypes() {
osInfo := osTypeToInfo[osType]